| 1 |
/*! shepherd.js 5.0.1 */ |
| 2 |
|
| 3 |
(function (global, factory) { |
| 4 |
typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() : |
| 5 |
typeof define === 'function' && define.amd ? define(factory) : |
| 6 |
(global = global || self, global.Shepherd = factory()); |
| 7 |
}(this, function () { 'use strict'; |
| 8 |
|
| 9 |
function _extends() { |
| 10 |
_extends = Object.assign || function (target) { |
| 11 |
for (var i = 1; i < arguments.length; i++) { |
| 12 |
var source = arguments[i]; |
| 13 |
|
| 14 |
for (var key in source) { |
| 15 |
if (Object.prototype.hasOwnProperty.call(source, key)) { |
| 16 |
target[key] = source[key]; |
| 17 |
} |
| 18 |
} |
| 19 |
} |
| 20 |
|
| 21 |
return target; |
| 22 |
}; |
| 23 |
|
| 24 |
return _extends.apply(this, arguments); |
| 25 |
} |
| 26 |
|
| 27 |
function _inheritsLoose(subClass, superClass) { |
| 28 |
subClass.prototype = Object.create(superClass.prototype); |
| 29 |
subClass.prototype.constructor = subClass; |
| 30 |
subClass.__proto__ = superClass; |
| 31 |
} |
| 32 |
|
| 33 |
function _assertThisInitialized(self) { |
| 34 |
if (self === void 0) { |
| 35 |
throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); |
| 36 |
} |
| 37 |
|
| 38 |
return self; |
| 39 |
} |
| 40 |
|
| 41 |
var validTypes = { object: true, symbol: true }; |
| 42 |
|
| 43 |
var isImplemented = function () { |
| 44 |
var symbol; |
| 45 |
if (typeof Symbol !== 'function') return false; |
| 46 |
symbol = Symbol('test symbol'); |
| 47 |
try { String(symbol); } catch (e) { return false; } |
| 48 |
|
| 49 |
// Return 'true' also for polyfills |
| 50 |
if (!validTypes[typeof Symbol.iterator]) return false; |
| 51 |
if (!validTypes[typeof Symbol.toPrimitive]) return false; |
| 52 |
if (!validTypes[typeof Symbol.toStringTag]) return false; |
| 53 |
|
| 54 |
return true; |
| 55 |
}; |
| 56 |
|
| 57 |
var global$1 = (function () { |
| 58 |
if (this) return this; |
| 59 |
|
| 60 |
// Unexpected strict mode (may happen if e.g. bundled into ESM module) be nice |
| 61 |
|
| 62 |
// Thanks @mathiasbynens -> https://mathiasbynens.be/notes/globalthis |
| 63 |
// In all ES5 engines global object inherits from Object.prototype |
| 64 |
// (if you approached one that doesn't please report) |
| 65 |
Object.defineProperty(Object.prototype, "__global__", { |
| 66 |
get: function () { return this; }, |
| 67 |
configurable: true |
| 68 |
}); |
| 69 |
try { return __global__; } |
| 70 |
finally { delete Object.prototype.__global__; } |
| 71 |
})(); |
| 72 |
|
| 73 |
var commonjsGlobal = typeof globalThis !== 'undefined' ? globalThis : typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {}; |
| 74 |
|
| 75 |
function unwrapExports (x) { |
| 76 |
return x && x.__esModule && Object.prototype.hasOwnProperty.call(x, 'default') ? x['default'] : x; |
| 77 |
} |
| 78 |
|
| 79 |
function createCommonjsModule(fn, module) { |
| 80 |
return module = { exports: {} }, fn(module, module.exports), module.exports; |
| 81 |
} |
| 82 |
|
| 83 |
// ES3 safe |
| 84 |
var _undefined = void 0; |
| 85 |
|
| 86 |
var is = function (value) { return value !== _undefined && value !== null; }; |
| 87 |
|
| 88 |
// prettier-ignore |
| 89 |
var possibleTypes = { "object": true, "function": true, "undefined": true /* document.all */ }; |
| 90 |
|
| 91 |
var is$1 = function (value) { |
| 92 |
if (!is(value)) return false; |
| 93 |
return hasOwnProperty.call(possibleTypes, typeof value); |
| 94 |
}; |
| 95 |
|
| 96 |
var is$2 = function (value) { |
| 97 |
if (!is$1(value)) return false; |
| 98 |
try { |
| 99 |
if (!value.constructor) return false; |
| 100 |
return value.constructor.prototype === value; |
| 101 |
} catch (error) { |
| 102 |
return false; |
| 103 |
} |
| 104 |
}; |
| 105 |
|
| 106 |
var is$3 = function (value) { |
| 107 |
if (typeof value !== "function") return false; |
| 108 |
|
| 109 |
if (!hasOwnProperty.call(value, "length")) return false; |
| 110 |
|
| 111 |
try { |
| 112 |
if (typeof value.length !== "number") return false; |
| 113 |
if (typeof value.call !== "function") return false; |
| 114 |
if (typeof value.apply !== "function") return false; |
| 115 |
} catch (error) { |
| 116 |
return false; |
| 117 |
} |
| 118 |
|
| 119 |
return !is$2(value); |
| 120 |
}; |
| 121 |
|
| 122 |
var classRe = /^\s*class[\s{/}]/, functionToString = Function.prototype.toString; |
| 123 |
|
| 124 |
var is$4 = function (value) { |
| 125 |
if (!is$3(value)) return false; |
| 126 |
if (classRe.test(functionToString.call(value))) return false; |
| 127 |
return true; |
| 128 |
}; |
| 129 |
|
| 130 |
var isImplemented$1 = function () { |
| 131 |
var assign = Object.assign, obj; |
| 132 |
if (typeof assign !== "function") return false; |
| 133 |
obj = { foo: "raz" }; |
| 134 |
assign(obj, { bar: "dwa" }, { trzy: "trzy" }); |
| 135 |
return (obj.foo + obj.bar + obj.trzy) === "razdwatrzy"; |
| 136 |
}; |
| 137 |
|
| 138 |
var isImplemented$2 = function () { |
| 139 |
try { |
| 140 |
Object.keys("primitive"); |
| 141 |
return true; |
| 142 |
} catch (e) { |
| 143 |
return false; |
| 144 |
} |
| 145 |
}; |
| 146 |
|
| 147 |
// eslint-disable-next-line no-empty-function |
| 148 |
var noop = function () {}; |
| 149 |
|
| 150 |
var _undefined$1 = noop(); // Support ES3 engines |
| 151 |
|
| 152 |
var isValue = function (val) { |
| 153 |
return (val !== _undefined$1) && (val !== null); |
| 154 |
}; |
| 155 |
|
| 156 |
var keys = Object.keys; |
| 157 |
|
| 158 |
var shim = function (object) { return keys(isValue(object) ? Object(object) : object); }; |
| 159 |
|
| 160 |
var keys$1 = isImplemented$2() ? Object.keys : shim; |
| 161 |
|
| 162 |
var validValue = function (value) { |
| 163 |
if (!isValue(value)) throw new TypeError("Cannot use null or undefined"); |
| 164 |
return value; |
| 165 |
}; |
| 166 |
|
| 167 |
var max = Math.max; |
| 168 |
|
| 169 |
var shim$1 = function (dest, src /*, …srcn*/) { |
| 170 |
var error, i, length = max(arguments.length, 2), assign; |
| 171 |
dest = Object(validValue(dest)); |
| 172 |
assign = function (key) { |
| 173 |
try { |
| 174 |
dest[key] = src[key]; |
| 175 |
} catch (e) { |
| 176 |
if (!error) error = e; |
| 177 |
} |
| 178 |
}; |
| 179 |
for (i = 1; i < length; ++i) { |
| 180 |
src = arguments[i]; |
| 181 |
keys$1(src).forEach(assign); |
| 182 |
} |
| 183 |
if (error !== undefined) throw error; |
| 184 |
return dest; |
| 185 |
}; |
| 186 |
|
| 187 |
var assign = isImplemented$1() |
| 188 |
? Object.assign |
| 189 |
: shim$1; |
| 190 |
|
| 191 |
var forEach = Array.prototype.forEach, create = Object.create; |
| 192 |
|
| 193 |
var process = function (src, obj) { |
| 194 |
var key; |
| 195 |
for (key in src) obj[key] = src[key]; |
| 196 |
}; |
| 197 |
|
| 198 |
// eslint-disable-next-line no-unused-vars |
| 199 |
var normalizeOptions = function (opts1 /*, …options*/) { |
| 200 |
var result = create(null); |
| 201 |
forEach.call(arguments, function (options) { |
| 202 |
if (!isValue(options)) return; |
| 203 |
process(Object(options), result); |
| 204 |
}); |
| 205 |
return result; |
| 206 |
}; |
| 207 |
|
| 208 |
var str = "razdwatrzy"; |
| 209 |
|
| 210 |
var isImplemented$3 = function () { |
| 211 |
if (typeof str.contains !== "function") return false; |
| 212 |
return (str.contains("dwa") === true) && (str.contains("foo") === false); |
| 213 |
}; |
| 214 |
|
| 215 |
var indexOf = String.prototype.indexOf; |
| 216 |
|
| 217 |
var shim$2 = function (searchString/*, position*/) { |
| 218 |
return indexOf.call(this, searchString, arguments[1]) > -1; |
| 219 |
}; |
| 220 |
|
| 221 |
var contains = isImplemented$3() |
| 222 |
? String.prototype.contains |
| 223 |
: shim$2; |
| 224 |
|
| 225 |
var d_1 = createCommonjsModule(function (module) { |
| 226 |
|
| 227 |
|
| 228 |
|
| 229 |
var d = (module.exports = function (dscr, value/*, options*/) { |
| 230 |
var c, e, w, options, desc; |
| 231 |
if (arguments.length < 2 || typeof dscr !== "string") { |
| 232 |
options = value; |
| 233 |
value = dscr; |
| 234 |
dscr = null; |
| 235 |
} else { |
| 236 |
options = arguments[2]; |
| 237 |
} |
| 238 |
if (is(dscr)) { |
| 239 |
c = contains.call(dscr, "c"); |
| 240 |
e = contains.call(dscr, "e"); |
| 241 |
w = contains.call(dscr, "w"); |
| 242 |
} else { |
| 243 |
c = w = true; |
| 244 |
e = false; |
| 245 |
} |
| 246 |
|
| 247 |
desc = { value: value, configurable: c, enumerable: e, writable: w }; |
| 248 |
return !options ? desc : assign(normalizeOptions(options), desc); |
| 249 |
}); |
| 250 |
|
| 251 |
d.gs = function (dscr, get, set/*, options*/) { |
| 252 |
var c, e, options, desc; |
| 253 |
if (typeof dscr !== "string") { |
| 254 |
options = set; |
| 255 |
set = get; |
| 256 |
get = dscr; |
| 257 |
dscr = null; |
| 258 |
} else { |
| 259 |
options = arguments[3]; |
| 260 |
} |
| 261 |
if (!is(get)) { |
| 262 |
get = undefined; |
| 263 |
} else if (!is$4(get)) { |
| 264 |
options = get; |
| 265 |
get = set = undefined; |
| 266 |
} else if (!is(set)) { |
| 267 |
set = undefined; |
| 268 |
} else if (!is$4(set)) { |
| 269 |
options = set; |
| 270 |
set = undefined; |
| 271 |
} |
| 272 |
if (is(dscr)) { |
| 273 |
c = contains.call(dscr, "c"); |
| 274 |
e = contains.call(dscr, "e"); |
| 275 |
} else { |
| 276 |
c = true; |
| 277 |
e = false; |
| 278 |
} |
| 279 |
|
| 280 |
desc = { get: get, set: set, configurable: c, enumerable: e }; |
| 281 |
return !options ? desc : assign(normalizeOptions(options), desc); |
| 282 |
}; |
| 283 |
}); |
| 284 |
|
| 285 |
var isSymbol = function (x) { |
| 286 |
if (!x) return false; |
| 287 |
if (typeof x === 'symbol') return true; |
| 288 |
if (!x.constructor) return false; |
| 289 |
if (x.constructor.name !== 'Symbol') return false; |
| 290 |
return (x[x.constructor.toStringTag] === 'Symbol'); |
| 291 |
}; |
| 292 |
|
| 293 |
var validateSymbol = function (value) { |
| 294 |
if (!isSymbol(value)) throw new TypeError(value + " is not a symbol"); |
| 295 |
return value; |
| 296 |
}; |
| 297 |
|
| 298 |
var create$1 = Object.create, defineProperties = Object.defineProperties |
| 299 |
, defineProperty = Object.defineProperty, objPrototype = Object.prototype |
| 300 |
, NativeSymbol, SymbolPolyfill, HiddenSymbol, globalSymbols = create$1(null) |
| 301 |
, isNativeSafe; |
| 302 |
|
| 303 |
if (typeof Symbol === 'function') { |
| 304 |
NativeSymbol = Symbol; |
| 305 |
try { |
| 306 |
String(NativeSymbol()); |
| 307 |
isNativeSafe = true; |
| 308 |
} catch (ignore) {} |
| 309 |
} |
| 310 |
|
| 311 |
var generateName = (function () { |
| 312 |
var created = create$1(null); |
| 313 |
return function (desc) { |
| 314 |
var postfix = 0, name, ie11BugWorkaround; |
| 315 |
while (created[desc + (postfix || '')]) ++postfix; |
| 316 |
desc += (postfix || ''); |
| 317 |
created[desc] = true; |
| 318 |
name = '@@' + desc; |
| 319 |
defineProperty(objPrototype, name, d_1.gs(null, function (value) { |
| 320 |
// For IE11 issue see: |
| 321 |
// https://connect.microsoft.com/IE/feedbackdetail/view/1928508/ |
| 322 |
// ie11-broken-getters-on-dom-objects |
| 323 |
// https://github.com/medikoo/es6-symbol/issues/12 |
| 324 |
if (ie11BugWorkaround) return; |
| 325 |
ie11BugWorkaround = true; |
| 326 |
defineProperty(this, name, d_1(value)); |
| 327 |
ie11BugWorkaround = false; |
| 328 |
})); |
| 329 |
return name; |
| 330 |
}; |
| 331 |
}()); |
| 332 |
|
| 333 |
// Internal constructor (not one exposed) for creating Symbol instances. |
| 334 |
// This one is used to ensure that `someSymbol instanceof Symbol` always return false |
| 335 |
HiddenSymbol = function Symbol(description) { |
| 336 |
if (this instanceof HiddenSymbol) throw new TypeError('Symbol is not a constructor'); |
| 337 |
return SymbolPolyfill(description); |
| 338 |
}; |
| 339 |
|
| 340 |
// Exposed `Symbol` constructor |
| 341 |
// (returns instances of HiddenSymbol) |
| 342 |
var polyfill = SymbolPolyfill = function Symbol(description) { |
| 343 |
var symbol; |
| 344 |
if (this instanceof Symbol) throw new TypeError('Symbol is not a constructor'); |
| 345 |
if (isNativeSafe) return NativeSymbol(description); |
| 346 |
symbol = create$1(HiddenSymbol.prototype); |
| 347 |
description = (description === undefined ? '' : String(description)); |
| 348 |
return defineProperties(symbol, { |
| 349 |
__description__: d_1('', description), |
| 350 |
__name__: d_1('', generateName(description)) |
| 351 |
}); |
| 352 |
}; |
| 353 |
defineProperties(SymbolPolyfill, { |
| 354 |
for: d_1(function (key) { |
| 355 |
if (globalSymbols[key]) return globalSymbols[key]; |
| 356 |
return (globalSymbols[key] = SymbolPolyfill(String(key))); |
| 357 |
}), |
| 358 |
keyFor: d_1(function (s) { |
| 359 |
var key; |
| 360 |
validateSymbol(s); |
| 361 |
for (key in globalSymbols) if (globalSymbols[key] === s) return key; |
| 362 |
}), |
| 363 |
|
| 364 |
// To ensure proper interoperability with other native functions (e.g. Array.from) |
| 365 |
// fallback to eventual native implementation of given symbol |
| 366 |
hasInstance: d_1('', (NativeSymbol && NativeSymbol.hasInstance) || SymbolPolyfill('hasInstance')), |
| 367 |
isConcatSpreadable: d_1('', (NativeSymbol && NativeSymbol.isConcatSpreadable) || |
| 368 |
SymbolPolyfill('isConcatSpreadable')), |
| 369 |
iterator: d_1('', (NativeSymbol && NativeSymbol.iterator) || SymbolPolyfill('iterator')), |
| 370 |
match: d_1('', (NativeSymbol && NativeSymbol.match) || SymbolPolyfill('match')), |
| 371 |
replace: d_1('', (NativeSymbol && NativeSymbol.replace) || SymbolPolyfill('replace')), |
| 372 |
search: d_1('', (NativeSymbol && NativeSymbol.search) || SymbolPolyfill('search')), |
| 373 |
species: d_1('', (NativeSymbol && NativeSymbol.species) || SymbolPolyfill('species')), |
| 374 |
split: d_1('', (NativeSymbol && NativeSymbol.split) || SymbolPolyfill('split')), |
| 375 |
toPrimitive: d_1('', (NativeSymbol && NativeSymbol.toPrimitive) || SymbolPolyfill('toPrimitive')), |
| 376 |
toStringTag: d_1('', (NativeSymbol && NativeSymbol.toStringTag) || SymbolPolyfill('toStringTag')), |
| 377 |
unscopables: d_1('', (NativeSymbol && NativeSymbol.unscopables) || SymbolPolyfill('unscopables')) |
| 378 |
}); |
| 379 |
|
| 380 |
// Internal tweaks for real symbol producer |
| 381 |
defineProperties(HiddenSymbol.prototype, { |
| 382 |
constructor: d_1(SymbolPolyfill), |
| 383 |
toString: d_1('', function () { return this.__name__; }) |
| 384 |
}); |
| 385 |
|
| 386 |
// Proper implementation of methods exposed on Symbol.prototype |
| 387 |
// They won't be accessible on produced symbol instances as they derive from HiddenSymbol.prototype |
| 388 |
defineProperties(SymbolPolyfill.prototype, { |
| 389 |
toString: d_1(function () { return 'Symbol (' + validateSymbol(this).__description__ + ')'; }), |
| 390 |
valueOf: d_1(function () { return validateSymbol(this); }) |
| 391 |
}); |
| 392 |
defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toPrimitive, d_1('', function () { |
| 393 |
var symbol = validateSymbol(this); |
| 394 |
if (typeof symbol === 'symbol') return symbol; |
| 395 |
return symbol.toString(); |
| 396 |
})); |
| 397 |
defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toStringTag, d_1('c', 'Symbol')); |
| 398 |
|
| 399 |
// Proper implementaton of toPrimitive and toStringTag for returned symbol instances |
| 400 |
defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toStringTag, |
| 401 |
d_1('c', SymbolPolyfill.prototype[SymbolPolyfill.toStringTag])); |
| 402 |
|
| 403 |
// Note: It's important to define `toPrimitive` as last one, as some implementations |
| 404 |
// implement `toPrimitive` natively without implementing `toStringTag` (or other specified symbols) |
| 405 |
// And that may invoke error in definition flow: |
| 406 |
// See: https://github.com/medikoo/es6-symbol/issues/13#issuecomment-164146149 |
| 407 |
defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toPrimitive, |
| 408 |
d_1('c', SymbolPolyfill.prototype[SymbolPolyfill.toPrimitive])); |
| 409 |
|
| 410 |
if (!isImplemented()) { |
| 411 |
Object.defineProperty(global$1, 'Symbol', |
| 412 |
{ value: polyfill, configurable: true, enumerable: false, |
| 413 |
writable: true }); |
| 414 |
} |
| 415 |
|
| 416 |
/*! |
| 417 |
* isobject <https://github.com/jonschlinkert/isobject> |
| 418 |
* |
| 419 |
* Copyright (c) 2014-2017, Jon Schlinkert. |
| 420 |
* Released under the MIT License. |
| 421 |
*/ |
| 422 |
|
| 423 |
var isobject = function isObject(val) { |
| 424 |
return val != null && typeof val === 'object' && Array.isArray(val) === false; |
| 425 |
}; |
| 426 |
|
| 427 |
/*! |
| 428 |
* get-value <https://github.com/jonschlinkert/get-value> |
| 429 |
* |
| 430 |
* Copyright (c) 2014-2018, Jon Schlinkert. |
| 431 |
* Released under the MIT License. |
| 432 |
*/ |
| 433 |
|
| 434 |
|
| 435 |
|
| 436 |
var getValue = function(target, path, options) { |
| 437 |
if (!isobject(options)) { |
| 438 |
options = { default: options }; |
| 439 |
} |
| 440 |
|
| 441 |
if (!isValidObject(target)) { |
| 442 |
return typeof options.default !== 'undefined' ? options.default : target; |
| 443 |
} |
| 444 |
|
| 445 |
if (typeof path === 'number') { |
| 446 |
path = String(path); |
| 447 |
} |
| 448 |
|
| 449 |
const isArray = Array.isArray(path); |
| 450 |
const isString = typeof path === 'string'; |
| 451 |
const splitChar = options.separator || '.'; |
| 452 |
const joinChar = options.joinChar || (typeof splitChar === 'string' ? splitChar : '.'); |
| 453 |
|
| 454 |
if (!isString && !isArray) { |
| 455 |
return target; |
| 456 |
} |
| 457 |
|
| 458 |
if (isString && path in target) { |
| 459 |
return isValid(path, target, options) ? target[path] : options.default; |
| 460 |
} |
| 461 |
|
| 462 |
let segs = isArray ? path : split(path, splitChar, options); |
| 463 |
let len = segs.length; |
| 464 |
let idx = 0; |
| 465 |
|
| 466 |
do { |
| 467 |
let prop = segs[idx]; |
| 468 |
if (typeof prop === 'number') { |
| 469 |
prop = String(prop); |
| 470 |
} |
| 471 |
|
| 472 |
while (prop && prop.slice(-1) === '\\') { |
| 473 |
prop = join([prop.slice(0, -1), segs[++idx] || ''], joinChar, options); |
| 474 |
} |
| 475 |
|
| 476 |
if (prop in target) { |
| 477 |
if (!isValid(prop, target, options)) { |
| 478 |
return options.default; |
| 479 |
} |
| 480 |
|
| 481 |
target = target[prop]; |
| 482 |
} else { |
| 483 |
let hasProp = false; |
| 484 |
let n = idx + 1; |
| 485 |
|
| 486 |
while (n < len) { |
| 487 |
prop = join([prop, segs[n++]], joinChar, options); |
| 488 |
|
| 489 |
if ((hasProp = prop in target)) { |
| 490 |
if (!isValid(prop, target, options)) { |
| 491 |
return options.default; |
| 492 |
} |
| 493 |
|
| 494 |
target = target[prop]; |
| 495 |
idx = n - 1; |
| 496 |
break; |
| 497 |
} |
| 498 |
} |
| 499 |
|
| 500 |
if (!hasProp) { |
| 501 |
return options.default; |
| 502 |
} |
| 503 |
} |
| 504 |
} while (++idx < len && isValidObject(target)); |
| 505 |
|
| 506 |
if (idx === len) { |
| 507 |
return target; |
| 508 |
} |
| 509 |
|
| 510 |
return options.default; |
| 511 |
}; |
| 512 |
|
| 513 |
function join(segs, joinChar, options) { |
| 514 |
if (typeof options.join === 'function') { |
| 515 |
return options.join(segs); |
| 516 |
} |
| 517 |
return segs[0] + joinChar + segs[1]; |
| 518 |
} |
| 519 |
|
| 520 |
function split(path, splitChar, options) { |
| 521 |
if (typeof options.split === 'function') { |
| 522 |
return options.split(path); |
| 523 |
} |
| 524 |
return path.split(splitChar); |
| 525 |
} |
| 526 |
|
| 527 |
function isValid(key, target, options) { |
| 528 |
if (typeof options.isValid === 'function') { |
| 529 |
return options.isValid(key, target); |
| 530 |
} |
| 531 |
return true; |
| 532 |
} |
| 533 |
|
| 534 |
function isValidObject(val) { |
| 535 |
return isobject(val) || Array.isArray(val) || typeof val === 'function'; |
| 536 |
} |
| 537 |
|
| 538 |
var VNode = function VNode() {}; |
| 539 |
|
| 540 |
var options = {}; |
| 541 |
|
| 542 |
var stack = []; |
| 543 |
|
| 544 |
var EMPTY_CHILDREN = []; |
| 545 |
|
| 546 |
function h(nodeName, attributes) { |
| 547 |
var children = EMPTY_CHILDREN, |
| 548 |
lastSimple, |
| 549 |
child, |
| 550 |
simple, |
| 551 |
i; |
| 552 |
for (i = arguments.length; i-- > 2;) { |
| 553 |
stack.push(arguments[i]); |
| 554 |
} |
| 555 |
if (attributes && attributes.children != null) { |
| 556 |
if (!stack.length) stack.push(attributes.children); |
| 557 |
delete attributes.children; |
| 558 |
} |
| 559 |
while (stack.length) { |
| 560 |
if ((child = stack.pop()) && child.pop !== undefined) { |
| 561 |
for (i = child.length; i--;) { |
| 562 |
stack.push(child[i]); |
| 563 |
} |
| 564 |
} else { |
| 565 |
if (typeof child === 'boolean') child = null; |
| 566 |
|
| 567 |
if (simple = typeof nodeName !== 'function') { |
| 568 |
if (child == null) child = '';else if (typeof child === 'number') child = String(child);else if (typeof child !== 'string') simple = false; |
| 569 |
} |
| 570 |
|
| 571 |
if (simple && lastSimple) { |
| 572 |
children[children.length - 1] += child; |
| 573 |
} else if (children === EMPTY_CHILDREN) { |
| 574 |
children = [child]; |
| 575 |
} else { |
| 576 |
children.push(child); |
| 577 |
} |
| 578 |
|
| 579 |
lastSimple = simple; |
| 580 |
} |
| 581 |
} |
| 582 |
|
| 583 |
var p = new VNode(); |
| 584 |
p.nodeName = nodeName; |
| 585 |
p.children = children; |
| 586 |
p.attributes = attributes == null ? undefined : attributes; |
| 587 |
p.key = attributes == null ? undefined : attributes.key; |
| 588 |
|
| 589 |
return p; |
| 590 |
} |
| 591 |
|
| 592 |
function extend(obj, props) { |
| 593 |
for (var i in props) { |
| 594 |
obj[i] = props[i]; |
| 595 |
}return obj; |
| 596 |
} |
| 597 |
|
| 598 |
function applyRef(ref, value) { |
| 599 |
if (ref) { |
| 600 |
if (typeof ref == 'function') ref(value);else ref.current = value; |
| 601 |
} |
| 602 |
} |
| 603 |
|
| 604 |
var defer = typeof Promise == 'function' ? Promise.resolve().then.bind(Promise.resolve()) : setTimeout; |
| 605 |
|
| 606 |
function cloneElement(vnode, props) { |
| 607 |
return h(vnode.nodeName, extend(extend({}, vnode.attributes), props), arguments.length > 2 ? [].slice.call(arguments, 2) : vnode.children); |
| 608 |
} |
| 609 |
|
| 610 |
var IS_NON_DIMENSIONAL = /acit|ex(?:s|g|n|p|$)|rph|ows|mnc|ntw|ine[ch]|zoo|^ord/i; |
| 611 |
|
| 612 |
var items = []; |
| 613 |
|
| 614 |
function enqueueRender(component) { |
| 615 |
if (!component._dirty && (component._dirty = true) && items.push(component) == 1) { |
| 616 |
( defer)(rerender); |
| 617 |
} |
| 618 |
} |
| 619 |
|
| 620 |
function rerender() { |
| 621 |
var p; |
| 622 |
while (p = items.pop()) { |
| 623 |
if (p._dirty) renderComponent(p); |
| 624 |
} |
| 625 |
} |
| 626 |
|
| 627 |
function isSameNodeType(node, vnode, hydrating) { |
| 628 |
if (typeof vnode === 'string' || typeof vnode === 'number') { |
| 629 |
return node.splitText !== undefined; |
| 630 |
} |
| 631 |
if (typeof vnode.nodeName === 'string') { |
| 632 |
return !node._componentConstructor && isNamedNode(node, vnode.nodeName); |
| 633 |
} |
| 634 |
return hydrating || node._componentConstructor === vnode.nodeName; |
| 635 |
} |
| 636 |
|
| 637 |
function isNamedNode(node, nodeName) { |
| 638 |
return node.normalizedNodeName === nodeName || node.nodeName.toLowerCase() === nodeName.toLowerCase(); |
| 639 |
} |
| 640 |
|
| 641 |
function getNodeProps(vnode) { |
| 642 |
var props = extend({}, vnode.attributes); |
| 643 |
props.children = vnode.children; |
| 644 |
|
| 645 |
var defaultProps = vnode.nodeName.defaultProps; |
| 646 |
if (defaultProps !== undefined) { |
| 647 |
for (var i in defaultProps) { |
| 648 |
if (props[i] === undefined) { |
| 649 |
props[i] = defaultProps[i]; |
| 650 |
} |
| 651 |
} |
| 652 |
} |
| 653 |
|
| 654 |
return props; |
| 655 |
} |
| 656 |
|
| 657 |
function createNode(nodeName, isSvg) { |
| 658 |
var node = isSvg ? document.createElementNS('http://www.w3.org/2000/svg', nodeName) : document.createElement(nodeName); |
| 659 |
node.normalizedNodeName = nodeName; |
| 660 |
return node; |
| 661 |
} |
| 662 |
|
| 663 |
function removeNode(node) { |
| 664 |
var parentNode = node.parentNode; |
| 665 |
if (parentNode) parentNode.removeChild(node); |
| 666 |
} |
| 667 |
|
| 668 |
function setAccessor(node, name, old, value, isSvg) { |
| 669 |
if (name === 'className') name = 'class'; |
| 670 |
|
| 671 |
if (name === 'key') ; else if (name === 'ref') { |
| 672 |
applyRef(old, null); |
| 673 |
applyRef(value, node); |
| 674 |
} else if (name === 'class' && !isSvg) { |
| 675 |
node.className = value || ''; |
| 676 |
} else if (name === 'style') { |
| 677 |
if (!value || typeof value === 'string' || typeof old === 'string') { |
| 678 |
node.style.cssText = value || ''; |
| 679 |
} |
| 680 |
if (value && typeof value === 'object') { |
| 681 |
if (typeof old !== 'string') { |
| 682 |
for (var i in old) { |
| 683 |
if (!(i in value)) node.style[i] = ''; |
| 684 |
} |
| 685 |
} |
| 686 |
for (var i in value) { |
| 687 |
node.style[i] = typeof value[i] === 'number' && IS_NON_DIMENSIONAL.test(i) === false ? value[i] + 'px' : value[i]; |
| 688 |
} |
| 689 |
} |
| 690 |
} else if (name === 'dangerouslySetInnerHTML') { |
| 691 |
if (value) node.innerHTML = value.__html || ''; |
| 692 |
} else if (name[0] == 'o' && name[1] == 'n') { |
| 693 |
var useCapture = name !== (name = name.replace(/Capture$/, '')); |
| 694 |
name = name.toLowerCase().substring(2); |
| 695 |
if (value) { |
| 696 |
if (!old) node.addEventListener(name, eventProxy, useCapture); |
| 697 |
} else { |
| 698 |
node.removeEventListener(name, eventProxy, useCapture); |
| 699 |
} |
| 700 |
(node._listeners || (node._listeners = {}))[name] = value; |
| 701 |
} else if (name !== 'list' && name !== 'type' && !isSvg && name in node) { |
| 702 |
try { |
| 703 |
node[name] = value == null ? '' : value; |
| 704 |
} catch (e) {} |
| 705 |
if ((value == null || value === false) && name != 'spellcheck') node.removeAttribute(name); |
| 706 |
} else { |
| 707 |
var ns = isSvg && name !== (name = name.replace(/^xlink:?/, '')); |
| 708 |
|
| 709 |
if (value == null || value === false) { |
| 710 |
if (ns) node.removeAttributeNS('http://www.w3.org/1999/xlink', name.toLowerCase());else node.removeAttribute(name); |
| 711 |
} else if (typeof value !== 'function') { |
| 712 |
if (ns) node.setAttributeNS('http://www.w3.org/1999/xlink', name.toLowerCase(), value);else node.setAttribute(name, value); |
| 713 |
} |
| 714 |
} |
| 715 |
} |
| 716 |
|
| 717 |
function eventProxy(e) { |
| 718 |
return this._listeners[e.type]( e); |
| 719 |
} |
| 720 |
|
| 721 |
var mounts = []; |
| 722 |
|
| 723 |
var diffLevel = 0; |
| 724 |
|
| 725 |
var isSvgMode = false; |
| 726 |
|
| 727 |
var hydrating = false; |
| 728 |
|
| 729 |
function flushMounts() { |
| 730 |
var c; |
| 731 |
while (c = mounts.shift()) { |
| 732 |
if (c.componentDidMount) c.componentDidMount(); |
| 733 |
} |
| 734 |
} |
| 735 |
|
| 736 |
function diff(dom, vnode, context, mountAll, parent, componentRoot) { |
| 737 |
if (!diffLevel++) { |
| 738 |
isSvgMode = parent != null && parent.ownerSVGElement !== undefined; |
| 739 |
|
| 740 |
hydrating = dom != null && !('__preactattr_' in dom); |
| 741 |
} |
| 742 |
|
| 743 |
var ret = idiff(dom, vnode, context, mountAll, componentRoot); |
| 744 |
|
| 745 |
if (parent && ret.parentNode !== parent) parent.appendChild(ret); |
| 746 |
|
| 747 |
if (! --diffLevel) { |
| 748 |
hydrating = false; |
| 749 |
|
| 750 |
if (!componentRoot) flushMounts(); |
| 751 |
} |
| 752 |
|
| 753 |
return ret; |
| 754 |
} |
| 755 |
|
| 756 |
function idiff(dom, vnode, context, mountAll, componentRoot) { |
| 757 |
var out = dom, |
| 758 |
prevSvgMode = isSvgMode; |
| 759 |
|
| 760 |
if (vnode == null || typeof vnode === 'boolean') vnode = ''; |
| 761 |
|
| 762 |
if (typeof vnode === 'string' || typeof vnode === 'number') { |
| 763 |
if (dom && dom.splitText !== undefined && dom.parentNode && (!dom._component || componentRoot)) { |
| 764 |
if (dom.nodeValue != vnode) { |
| 765 |
dom.nodeValue = vnode; |
| 766 |
} |
| 767 |
} else { |
| 768 |
out = document.createTextNode(vnode); |
| 769 |
if (dom) { |
| 770 |
if (dom.parentNode) dom.parentNode.replaceChild(out, dom); |
| 771 |
recollectNodeTree(dom, true); |
| 772 |
} |
| 773 |
} |
| 774 |
|
| 775 |
out['__preactattr_'] = true; |
| 776 |
|
| 777 |
return out; |
| 778 |
} |
| 779 |
|
| 780 |
var vnodeName = vnode.nodeName; |
| 781 |
if (typeof vnodeName === 'function') { |
| 782 |
return buildComponentFromVNode(dom, vnode, context, mountAll); |
| 783 |
} |
| 784 |
|
| 785 |
isSvgMode = vnodeName === 'svg' ? true : vnodeName === 'foreignObject' ? false : isSvgMode; |
| 786 |
|
| 787 |
vnodeName = String(vnodeName); |
| 788 |
if (!dom || !isNamedNode(dom, vnodeName)) { |
| 789 |
out = createNode(vnodeName, isSvgMode); |
| 790 |
|
| 791 |
if (dom) { |
| 792 |
while (dom.firstChild) { |
| 793 |
out.appendChild(dom.firstChild); |
| 794 |
} |
| 795 |
if (dom.parentNode) dom.parentNode.replaceChild(out, dom); |
| 796 |
|
| 797 |
recollectNodeTree(dom, true); |
| 798 |
} |
| 799 |
} |
| 800 |
|
| 801 |
var fc = out.firstChild, |
| 802 |
props = out['__preactattr_'], |
| 803 |
vchildren = vnode.children; |
| 804 |
|
| 805 |
if (props == null) { |
| 806 |
props = out['__preactattr_'] = {}; |
| 807 |
for (var a = out.attributes, i = a.length; i--;) { |
| 808 |
props[a[i].name] = a[i].value; |
| 809 |
} |
| 810 |
} |
| 811 |
|
| 812 |
if (!hydrating && vchildren && vchildren.length === 1 && typeof vchildren[0] === 'string' && fc != null && fc.splitText !== undefined && fc.nextSibling == null) { |
| 813 |
if (fc.nodeValue != vchildren[0]) { |
| 814 |
fc.nodeValue = vchildren[0]; |
| 815 |
} |
| 816 |
} else if (vchildren && vchildren.length || fc != null) { |
| 817 |
innerDiffNode(out, vchildren, context, mountAll, hydrating || props.dangerouslySetInnerHTML != null); |
| 818 |
} |
| 819 |
|
| 820 |
diffAttributes(out, vnode.attributes, props); |
| 821 |
|
| 822 |
isSvgMode = prevSvgMode; |
| 823 |
|
| 824 |
return out; |
| 825 |
} |
| 826 |
|
| 827 |
function innerDiffNode(dom, vchildren, context, mountAll, isHydrating) { |
| 828 |
var originalChildren = dom.childNodes, |
| 829 |
children = [], |
| 830 |
keyed = {}, |
| 831 |
keyedLen = 0, |
| 832 |
min = 0, |
| 833 |
len = originalChildren.length, |
| 834 |
childrenLen = 0, |
| 835 |
vlen = vchildren ? vchildren.length : 0, |
| 836 |
j, |
| 837 |
c, |
| 838 |
f, |
| 839 |
vchild, |
| 840 |
child; |
| 841 |
|
| 842 |
if (len !== 0) { |
| 843 |
for (var i = 0; i < len; i++) { |
| 844 |
var _child = originalChildren[i], |
| 845 |
props = _child['__preactattr_'], |
| 846 |
key = vlen && props ? _child._component ? _child._component.__key : props.key : null; |
| 847 |
if (key != null) { |
| 848 |
keyedLen++; |
| 849 |
keyed[key] = _child; |
| 850 |
} else if (props || (_child.splitText !== undefined ? isHydrating ? _child.nodeValue.trim() : true : isHydrating)) { |
| 851 |
children[childrenLen++] = _child; |
| 852 |
} |
| 853 |
} |
| 854 |
} |
| 855 |
|
| 856 |
if (vlen !== 0) { |
| 857 |
for (var i = 0; i < vlen; i++) { |
| 858 |
vchild = vchildren[i]; |
| 859 |
child = null; |
| 860 |
|
| 861 |
var key = vchild.key; |
| 862 |
if (key != null) { |
| 863 |
if (keyedLen && keyed[key] !== undefined) { |
| 864 |
child = keyed[key]; |
| 865 |
keyed[key] = undefined; |
| 866 |
keyedLen--; |
| 867 |
} |
| 868 |
} else if (min < childrenLen) { |
| 869 |
for (j = min; j < childrenLen; j++) { |
| 870 |
if (children[j] !== undefined && isSameNodeType(c = children[j], vchild, isHydrating)) { |
| 871 |
child = c; |
| 872 |
children[j] = undefined; |
| 873 |
if (j === childrenLen - 1) childrenLen--; |
| 874 |
if (j === min) min++; |
| 875 |
break; |
| 876 |
} |
| 877 |
} |
| 878 |
} |
| 879 |
|
| 880 |
child = idiff(child, vchild, context, mountAll); |
| 881 |
|
| 882 |
f = originalChildren[i]; |
| 883 |
if (child && child !== dom && child !== f) { |
| 884 |
if (f == null) { |
| 885 |
dom.appendChild(child); |
| 886 |
} else if (child === f.nextSibling) { |
| 887 |
removeNode(f); |
| 888 |
} else { |
| 889 |
dom.insertBefore(child, f); |
| 890 |
} |
| 891 |
} |
| 892 |
} |
| 893 |
} |
| 894 |
|
| 895 |
if (keyedLen) { |
| 896 |
for (var i in keyed) { |
| 897 |
if (keyed[i] !== undefined) recollectNodeTree(keyed[i], false); |
| 898 |
} |
| 899 |
} |
| 900 |
|
| 901 |
while (min <= childrenLen) { |
| 902 |
if ((child = children[childrenLen--]) !== undefined) recollectNodeTree(child, false); |
| 903 |
} |
| 904 |
} |
| 905 |
|
| 906 |
function recollectNodeTree(node, unmountOnly) { |
| 907 |
var component = node._component; |
| 908 |
if (component) { |
| 909 |
unmountComponent(component); |
| 910 |
} else { |
| 911 |
if (node['__preactattr_'] != null) applyRef(node['__preactattr_'].ref, null); |
| 912 |
|
| 913 |
if (unmountOnly === false || node['__preactattr_'] == null) { |
| 914 |
removeNode(node); |
| 915 |
} |
| 916 |
|
| 917 |
removeChildren(node); |
| 918 |
} |
| 919 |
} |
| 920 |
|
| 921 |
function removeChildren(node) { |
| 922 |
node = node.lastChild; |
| 923 |
while (node) { |
| 924 |
var next = node.previousSibling; |
| 925 |
recollectNodeTree(node, true); |
| 926 |
node = next; |
| 927 |
} |
| 928 |
} |
| 929 |
|
| 930 |
function diffAttributes(dom, attrs, old) { |
| 931 |
var name; |
| 932 |
|
| 933 |
for (name in old) { |
| 934 |
if (!(attrs && attrs[name] != null) && old[name] != null) { |
| 935 |
setAccessor(dom, name, old[name], old[name] = undefined, isSvgMode); |
| 936 |
} |
| 937 |
} |
| 938 |
|
| 939 |
for (name in attrs) { |
| 940 |
if (name !== 'children' && name !== 'innerHTML' && (!(name in old) || attrs[name] !== (name === 'value' || name === 'checked' ? dom[name] : old[name]))) { |
| 941 |
setAccessor(dom, name, old[name], old[name] = attrs[name], isSvgMode); |
| 942 |
} |
| 943 |
} |
| 944 |
} |
| 945 |
|
| 946 |
var recyclerComponents = []; |
| 947 |
|
| 948 |
function createComponent(Ctor, props, context) { |
| 949 |
var inst, |
| 950 |
i = recyclerComponents.length; |
| 951 |
|
| 952 |
if (Ctor.prototype && Ctor.prototype.render) { |
| 953 |
inst = new Ctor(props, context); |
| 954 |
Component.call(inst, props, context); |
| 955 |
} else { |
| 956 |
inst = new Component(props, context); |
| 957 |
inst.constructor = Ctor; |
| 958 |
inst.render = doRender; |
| 959 |
} |
| 960 |
|
| 961 |
while (i--) { |
| 962 |
if (recyclerComponents[i].constructor === Ctor) { |
| 963 |
inst.nextBase = recyclerComponents[i].nextBase; |
| 964 |
recyclerComponents.splice(i, 1); |
| 965 |
return inst; |
| 966 |
} |
| 967 |
} |
| 968 |
|
| 969 |
return inst; |
| 970 |
} |
| 971 |
|
| 972 |
function doRender(props, state, context) { |
| 973 |
return this.constructor(props, context); |
| 974 |
} |
| 975 |
|
| 976 |
function setComponentProps(component, props, renderMode, context, mountAll) { |
| 977 |
if (component._disable) return; |
| 978 |
component._disable = true; |
| 979 |
|
| 980 |
component.__ref = props.ref; |
| 981 |
component.__key = props.key; |
| 982 |
delete props.ref; |
| 983 |
delete props.key; |
| 984 |
|
| 985 |
if (typeof component.constructor.getDerivedStateFromProps === 'undefined') { |
| 986 |
if (!component.base || mountAll) { |
| 987 |
if (component.componentWillMount) component.componentWillMount(); |
| 988 |
} else if (component.componentWillReceiveProps) { |
| 989 |
component.componentWillReceiveProps(props, context); |
| 990 |
} |
| 991 |
} |
| 992 |
|
| 993 |
if (context && context !== component.context) { |
| 994 |
if (!component.prevContext) component.prevContext = component.context; |
| 995 |
component.context = context; |
| 996 |
} |
| 997 |
|
| 998 |
if (!component.prevProps) component.prevProps = component.props; |
| 999 |
component.props = props; |
| 1000 |
|
| 1001 |
component._disable = false; |
| 1002 |
|
| 1003 |
if (renderMode !== 0) { |
| 1004 |
if (renderMode === 1 || options.syncComponentUpdates !== false || !component.base) { |
| 1005 |
renderComponent(component, 1, mountAll); |
| 1006 |
} else { |
| 1007 |
enqueueRender(component); |
| 1008 |
} |
| 1009 |
} |
| 1010 |
|
| 1011 |
applyRef(component.__ref, component); |
| 1012 |
} |
| 1013 |
|
| 1014 |
function renderComponent(component, renderMode, mountAll, isChild) { |
| 1015 |
if (component._disable) return; |
| 1016 |
|
| 1017 |
var props = component.props, |
| 1018 |
state = component.state, |
| 1019 |
context = component.context, |
| 1020 |
previousProps = component.prevProps || props, |
| 1021 |
previousState = component.prevState || state, |
| 1022 |
previousContext = component.prevContext || context, |
| 1023 |
isUpdate = component.base, |
| 1024 |
nextBase = component.nextBase, |
| 1025 |
initialBase = isUpdate || nextBase, |
| 1026 |
initialChildComponent = component._component, |
| 1027 |
skip = false, |
| 1028 |
snapshot = previousContext, |
| 1029 |
rendered, |
| 1030 |
inst, |
| 1031 |
cbase; |
| 1032 |
|
| 1033 |
if (component.constructor.getDerivedStateFromProps) { |
| 1034 |
state = extend(extend({}, state), component.constructor.getDerivedStateFromProps(props, state)); |
| 1035 |
component.state = state; |
| 1036 |
} |
| 1037 |
|
| 1038 |
if (isUpdate) { |
| 1039 |
component.props = previousProps; |
| 1040 |
component.state = previousState; |
| 1041 |
component.context = previousContext; |
| 1042 |
if (renderMode !== 2 && component.shouldComponentUpdate && component.shouldComponentUpdate(props, state, context) === false) { |
| 1043 |
skip = true; |
| 1044 |
} else if (component.componentWillUpdate) { |
| 1045 |
component.componentWillUpdate(props, state, context); |
| 1046 |
} |
| 1047 |
component.props = props; |
| 1048 |
component.state = state; |
| 1049 |
component.context = context; |
| 1050 |
} |
| 1051 |
|
| 1052 |
component.prevProps = component.prevState = component.prevContext = component.nextBase = null; |
| 1053 |
component._dirty = false; |
| 1054 |
|
| 1055 |
if (!skip) { |
| 1056 |
rendered = component.render(props, state, context); |
| 1057 |
|
| 1058 |
if (component.getChildContext) { |
| 1059 |
context = extend(extend({}, context), component.getChildContext()); |
| 1060 |
} |
| 1061 |
|
| 1062 |
if (isUpdate && component.getSnapshotBeforeUpdate) { |
| 1063 |
snapshot = component.getSnapshotBeforeUpdate(previousProps, previousState); |
| 1064 |
} |
| 1065 |
|
| 1066 |
var childComponent = rendered && rendered.nodeName, |
| 1067 |
toUnmount, |
| 1068 |
base; |
| 1069 |
|
| 1070 |
if (typeof childComponent === 'function') { |
| 1071 |
|
| 1072 |
var childProps = getNodeProps(rendered); |
| 1073 |
inst = initialChildComponent; |
| 1074 |
|
| 1075 |
if (inst && inst.constructor === childComponent && childProps.key == inst.__key) { |
| 1076 |
setComponentProps(inst, childProps, 1, context, false); |
| 1077 |
} else { |
| 1078 |
toUnmount = inst; |
| 1079 |
|
| 1080 |
component._component = inst = createComponent(childComponent, childProps, context); |
| 1081 |
inst.nextBase = inst.nextBase || nextBase; |
| 1082 |
inst._parentComponent = component; |
| 1083 |
setComponentProps(inst, childProps, 0, context, false); |
| 1084 |
renderComponent(inst, 1, mountAll, true); |
| 1085 |
} |
| 1086 |
|
| 1087 |
base = inst.base; |
| 1088 |
} else { |
| 1089 |
cbase = initialBase; |
| 1090 |
|
| 1091 |
toUnmount = initialChildComponent; |
| 1092 |
if (toUnmount) { |
| 1093 |
cbase = component._component = null; |
| 1094 |
} |
| 1095 |
|
| 1096 |
if (initialBase || renderMode === 1) { |
| 1097 |
if (cbase) cbase._component = null; |
| 1098 |
base = diff(cbase, rendered, context, mountAll || !isUpdate, initialBase && initialBase.parentNode, true); |
| 1099 |
} |
| 1100 |
} |
| 1101 |
|
| 1102 |
if (initialBase && base !== initialBase && inst !== initialChildComponent) { |
| 1103 |
var baseParent = initialBase.parentNode; |
| 1104 |
if (baseParent && base !== baseParent) { |
| 1105 |
baseParent.replaceChild(base, initialBase); |
| 1106 |
|
| 1107 |
if (!toUnmount) { |
| 1108 |
initialBase._component = null; |
| 1109 |
recollectNodeTree(initialBase, false); |
| 1110 |
} |
| 1111 |
} |
| 1112 |
} |
| 1113 |
|
| 1114 |
if (toUnmount) { |
| 1115 |
unmountComponent(toUnmount); |
| 1116 |
} |
| 1117 |
|
| 1118 |
component.base = base; |
| 1119 |
if (base && !isChild) { |
| 1120 |
var componentRef = component, |
| 1121 |
t = component; |
| 1122 |
while (t = t._parentComponent) { |
| 1123 |
(componentRef = t).base = base; |
| 1124 |
} |
| 1125 |
base._component = componentRef; |
| 1126 |
base._componentConstructor = componentRef.constructor; |
| 1127 |
} |
| 1128 |
} |
| 1129 |
|
| 1130 |
if (!isUpdate || mountAll) { |
| 1131 |
mounts.push(component); |
| 1132 |
} else if (!skip) { |
| 1133 |
|
| 1134 |
if (component.componentDidUpdate) { |
| 1135 |
component.componentDidUpdate(previousProps, previousState, snapshot); |
| 1136 |
} |
| 1137 |
} |
| 1138 |
|
| 1139 |
while (component._renderCallbacks.length) { |
| 1140 |
component._renderCallbacks.pop().call(component); |
| 1141 |
}if (!diffLevel && !isChild) flushMounts(); |
| 1142 |
} |
| 1143 |
|
| 1144 |
function buildComponentFromVNode(dom, vnode, context, mountAll) { |
| 1145 |
var c = dom && dom._component, |
| 1146 |
originalComponent = c, |
| 1147 |
oldDom = dom, |
| 1148 |
isDirectOwner = c && dom._componentConstructor === vnode.nodeName, |
| 1149 |
isOwner = isDirectOwner, |
| 1150 |
props = getNodeProps(vnode); |
| 1151 |
while (c && !isOwner && (c = c._parentComponent)) { |
| 1152 |
isOwner = c.constructor === vnode.nodeName; |
| 1153 |
} |
| 1154 |
|
| 1155 |
if (c && isOwner && (!mountAll || c._component)) { |
| 1156 |
setComponentProps(c, props, 3, context, mountAll); |
| 1157 |
dom = c.base; |
| 1158 |
} else { |
| 1159 |
if (originalComponent && !isDirectOwner) { |
| 1160 |
unmountComponent(originalComponent); |
| 1161 |
dom = oldDom = null; |
| 1162 |
} |
| 1163 |
|
| 1164 |
c = createComponent(vnode.nodeName, props, context); |
| 1165 |
if (dom && !c.nextBase) { |
| 1166 |
c.nextBase = dom; |
| 1167 |
|
| 1168 |
oldDom = null; |
| 1169 |
} |
| 1170 |
setComponentProps(c, props, 1, context, mountAll); |
| 1171 |
dom = c.base; |
| 1172 |
|
| 1173 |
if (oldDom && dom !== oldDom) { |
| 1174 |
oldDom._component = null; |
| 1175 |
recollectNodeTree(oldDom, false); |
| 1176 |
} |
| 1177 |
} |
| 1178 |
|
| 1179 |
return dom; |
| 1180 |
} |
| 1181 |
|
| 1182 |
function unmountComponent(component) { |
| 1183 |
|
| 1184 |
var base = component.base; |
| 1185 |
|
| 1186 |
component._disable = true; |
| 1187 |
|
| 1188 |
if (component.componentWillUnmount) component.componentWillUnmount(); |
| 1189 |
|
| 1190 |
component.base = null; |
| 1191 |
|
| 1192 |
var inner = component._component; |
| 1193 |
if (inner) { |
| 1194 |
unmountComponent(inner); |
| 1195 |
} else if (base) { |
| 1196 |
if (base['__preactattr_'] != null) applyRef(base['__preactattr_'].ref, null); |
| 1197 |
|
| 1198 |
component.nextBase = base; |
| 1199 |
|
| 1200 |
removeNode(base); |
| 1201 |
recyclerComponents.push(component); |
| 1202 |
|
| 1203 |
removeChildren(base); |
| 1204 |
} |
| 1205 |
|
| 1206 |
applyRef(component.__ref, null); |
| 1207 |
} |
| 1208 |
|
| 1209 |
function Component(props, context) { |
| 1210 |
this._dirty = true; |
| 1211 |
|
| 1212 |
this.context = context; |
| 1213 |
|
| 1214 |
this.props = props; |
| 1215 |
|
| 1216 |
this.state = this.state || {}; |
| 1217 |
|
| 1218 |
this._renderCallbacks = []; |
| 1219 |
} |
| 1220 |
|
| 1221 |
extend(Component.prototype, { |
| 1222 |
setState: function setState(state, callback) { |
| 1223 |
if (!this.prevState) this.prevState = this.state; |
| 1224 |
this.state = extend(extend({}, this.state), typeof state === 'function' ? state(this.state, this.props) : state); |
| 1225 |
if (callback) this._renderCallbacks.push(callback); |
| 1226 |
enqueueRender(this); |
| 1227 |
}, |
| 1228 |
forceUpdate: function forceUpdate(callback) { |
| 1229 |
if (callback) this._renderCallbacks.push(callback); |
| 1230 |
renderComponent(this, 2); |
| 1231 |
}, |
| 1232 |
render: function render() {} |
| 1233 |
}); |
| 1234 |
|
| 1235 |
function render(vnode, parent, merge) { |
| 1236 |
return diff(merge, vnode, {}, false, parent, false); |
| 1237 |
} |
| 1238 |
|
| 1239 |
function createRef() { |
| 1240 |
return {}; |
| 1241 |
} |
| 1242 |
|
| 1243 |
var preact = { |
| 1244 |
h: h, |
| 1245 |
createElement: h, |
| 1246 |
cloneElement: cloneElement, |
| 1247 |
createRef: createRef, |
| 1248 |
Component: Component, |
| 1249 |
render: render, |
| 1250 |
rerender: rerender, |
| 1251 |
options: options |
| 1252 |
}; |
| 1253 |
|
| 1254 |
/** |
| 1255 |
* Checks if `value` is classified as an `HTMLElement`. |
| 1256 |
* @param {*} value The param to check if it is an HTMLElement |
| 1257 |
*/ |
| 1258 |
function isElement(value) { |
| 1259 |
return value instanceof HTMLElement; |
| 1260 |
} |
| 1261 |
/** |
| 1262 |
* Checks if `value` is classified as a `Function` object. |
| 1263 |
* @param {*} value The param to check if it is a function |
| 1264 |
*/ |
| 1265 |
|
| 1266 |
function isFunction(value) { |
| 1267 |
return typeof value === 'function'; |
| 1268 |
} |
| 1269 |
/** |
| 1270 |
* Checks if `value` is classified as a `String` object. |
| 1271 |
* @param {*} value The param to check if it is a string |
| 1272 |
*/ |
| 1273 |
|
| 1274 |
function isString(value) { |
| 1275 |
return typeof value === 'string'; |
| 1276 |
} |
| 1277 |
/** |
| 1278 |
* Checks if `value` is undefined. |
| 1279 |
* @param {*} value The param to check if it is undefined |
| 1280 |
*/ |
| 1281 |
|
| 1282 |
function isUndefined(value) { |
| 1283 |
return value === undefined; |
| 1284 |
} |
| 1285 |
|
| 1286 |
var Evented = |
| 1287 |
/*#__PURE__*/ |
| 1288 |
function () { |
| 1289 |
function Evented() {} |
| 1290 |
|
| 1291 |
var _proto = Evented.prototype; |
| 1292 |
|
| 1293 |
_proto.on = function on(event, handler, ctx) { |
| 1294 |
var once = arguments.length <= 3 || arguments[3] === undefined ? false : arguments[3]; |
| 1295 |
|
| 1296 |
if (isUndefined(this.bindings)) { |
| 1297 |
this.bindings = {}; |
| 1298 |
} |
| 1299 |
|
| 1300 |
if (isUndefined(this.bindings[event])) { |
| 1301 |
this.bindings[event] = []; |
| 1302 |
} |
| 1303 |
|
| 1304 |
this.bindings[event].push({ |
| 1305 |
handler: handler, |
| 1306 |
ctx: ctx, |
| 1307 |
once: once |
| 1308 |
}); |
| 1309 |
}; |
| 1310 |
|
| 1311 |
_proto.once = function once(event, handler, ctx) { |
| 1312 |
this.on(event, handler, ctx, true); |
| 1313 |
}; |
| 1314 |
|
| 1315 |
_proto.off = function off(event, handler) { |
| 1316 |
var _this = this; |
| 1317 |
|
| 1318 |
if (isUndefined(this.bindings) || isUndefined(this.bindings[event])) { |
| 1319 |
return false; |
| 1320 |
} |
| 1321 |
|
| 1322 |
if (isUndefined(handler)) { |
| 1323 |
delete this.bindings[event]; |
| 1324 |
} else { |
| 1325 |
this.bindings[event].forEach(function (binding, index) { |
| 1326 |
if (binding.handler === handler) { |
| 1327 |
_this.bindings[event].splice(index, 1); |
| 1328 |
} |
| 1329 |
}); |
| 1330 |
} |
| 1331 |
}; |
| 1332 |
|
| 1333 |
_proto.trigger = function trigger(event) { |
| 1334 |
var _this2 = this; |
| 1335 |
|
| 1336 |
if (!isUndefined(this.bindings) && this.bindings[event]) { |
| 1337 |
var args = Array.prototype.slice.call(arguments, 1); |
| 1338 |
this.bindings[event].forEach(function (binding, index) { |
| 1339 |
var ctx = binding.ctx, |
| 1340 |
handler = binding.handler, |
| 1341 |
once = binding.once; |
| 1342 |
var context = ctx || _this2; |
| 1343 |
handler.apply(context, args); |
| 1344 |
|
| 1345 |
if (once) { |
| 1346 |
_this2.bindings[event].splice(index, 1); |
| 1347 |
} |
| 1348 |
}); |
| 1349 |
} |
| 1350 |
}; |
| 1351 |
|
| 1352 |
return Evented; |
| 1353 |
}(); |
| 1354 |
|
| 1355 |
/** |
| 1356 |
* Binds all the methods on a JS Class to the `this` context of the class. |
| 1357 |
* Adapted from https://github.com/sindresorhus/auto-bind |
| 1358 |
* @param {object} self The `this` context of the class |
| 1359 |
* @return {object} The `this` context of the class |
| 1360 |
*/ |
| 1361 |
function autoBind(self) { |
| 1362 |
var keys = Object.getOwnPropertyNames(self.constructor.prototype); |
| 1363 |
|
| 1364 |
for (var i = 0; i < keys.length; i++) { |
| 1365 |
var key = keys[i]; |
| 1366 |
var val = self[key]; |
| 1367 |
|
| 1368 |
if (key !== 'constructor' && typeof val === 'function') { |
| 1369 |
self[key] = val.bind(self); |
| 1370 |
} |
| 1371 |
} |
| 1372 |
|
| 1373 |
return self; |
| 1374 |
} |
| 1375 |
|
| 1376 |
/** |
| 1377 |
* Sets up the handler to determine if we should advance the tour |
| 1378 |
* @param {string} selector |
| 1379 |
* @param {Step} step The step instance |
| 1380 |
* @return {Function} |
| 1381 |
* @private |
| 1382 |
*/ |
| 1383 |
|
| 1384 |
function _setupAdvanceOnHandler(selector, step) { |
| 1385 |
return function (event) { |
| 1386 |
if (step.isOpen()) { |
| 1387 |
var targetIsEl = step.el && event.currentTarget === step.el; |
| 1388 |
var targetIsSelector = !isUndefined(selector) && event.currentTarget.matches(selector); |
| 1389 |
|
| 1390 |
if (targetIsSelector || targetIsEl) { |
| 1391 |
step.tour.next(); |
| 1392 |
} |
| 1393 |
} |
| 1394 |
}; |
| 1395 |
} |
| 1396 |
/** |
| 1397 |
* Bind the event handler for advanceOn |
| 1398 |
* @param {Step} step The step instance |
| 1399 |
*/ |
| 1400 |
|
| 1401 |
|
| 1402 |
function bindAdvance(step) { |
| 1403 |
// An empty selector matches the step element |
| 1404 |
var _ref = step.options.advanceOn || {}, |
| 1405 |
event = _ref.event, |
| 1406 |
selector = _ref.selector; |
| 1407 |
|
| 1408 |
if (event) { |
| 1409 |
var handler = _setupAdvanceOnHandler(selector, step); // TODO: this should also bind/unbind on show/hide |
| 1410 |
|
| 1411 |
|
| 1412 |
var el; |
| 1413 |
|
| 1414 |
try { |
| 1415 |
el = document.querySelector(selector); |
| 1416 |
} catch (e) {// TODO |
| 1417 |
} |
| 1418 |
|
| 1419 |
if (!isUndefined(selector) && !el) { |
| 1420 |
return console.error("No element was found for the selector supplied to advanceOn: " + selector); |
| 1421 |
} else if (el) { |
| 1422 |
el.addEventListener(event, handler); |
| 1423 |
step.on('destroy', function () { |
| 1424 |
return el.removeEventListener(event, handler); |
| 1425 |
}); |
| 1426 |
} else { |
| 1427 |
document.body.addEventListener(event, handler, true); |
| 1428 |
step.on('destroy', function () { |
| 1429 |
return document.body.removeEventListener(event, handler, true); |
| 1430 |
}); |
| 1431 |
} |
| 1432 |
} else { |
| 1433 |
return console.error('advanceOn was defined, but no event name was passed.'); |
| 1434 |
} |
| 1435 |
} |
| 1436 |
|
| 1437 |
var addHasTitleClass = function addHasTitleClass(step) { |
| 1438 |
return { |
| 1439 |
addHasTitleClass: _createClassModifier(step.classPrefix + "shepherd-has-title") |
| 1440 |
}; |
| 1441 |
}; |
| 1442 |
/** |
| 1443 |
* Create a popper modifier for adding the passed className to the popper |
| 1444 |
* @param {string} className The class to add to the popper |
| 1445 |
* @return {{fn(*): *, enabled: boolean}|*} |
| 1446 |
* @private |
| 1447 |
*/ |
| 1448 |
|
| 1449 |
|
| 1450 |
function _createClassModifier(className) { |
| 1451 |
return { |
| 1452 |
enabled: true, |
| 1453 |
fn: function fn(data) { |
| 1454 |
data.instance.popper.classList.add(className); |
| 1455 |
return data; |
| 1456 |
} |
| 1457 |
}; |
| 1458 |
} |
| 1459 |
|
| 1460 |
function _getCenteredStylePopperModifier(styles) { |
| 1461 |
return { |
| 1462 |
computeStyle: { |
| 1463 |
enabled: true, |
| 1464 |
fn: function fn(data) { |
| 1465 |
data.styles = _extends({}, data.styles, { |
| 1466 |
left: '50%', |
| 1467 |
top: '50%', |
| 1468 |
transform: 'translate(-50%, -50%)' |
| 1469 |
}); |
| 1470 |
return data; |
| 1471 |
} |
| 1472 |
}, |
| 1473 |
addShepherdClass: _createClassModifier(styles.shepherd.trim()) |
| 1474 |
}; |
| 1475 |
} |
| 1476 |
/** |
| 1477 |
* Used to compose settings for tippyOptions.popperOptions (https://atomiks.github.io/tippyjs/#popper-options-option) |
| 1478 |
* @private |
| 1479 |
*/ |
| 1480 |
|
| 1481 |
|
| 1482 |
function _getDefaultPopperOptions(styles) { |
| 1483 |
return { |
| 1484 |
positionFixed: true, |
| 1485 |
modifiers: { |
| 1486 |
addShepherdClass: _createClassModifier(styles.shepherd.trim()) |
| 1487 |
} |
| 1488 |
}; |
| 1489 |
} |
| 1490 |
/** |
| 1491 |
* Generates the hash of options that will be passed to `Tippy` instances |
| 1492 |
* target an element in the DOM. |
| 1493 |
* |
| 1494 |
* @param {Object} attachToOptions The local `attachTo` options |
| 1495 |
* @param {Step} step The step instance |
| 1496 |
* @return {Object} The final tippy options object |
| 1497 |
*/ |
| 1498 |
|
| 1499 |
|
| 1500 |
function makeAttachedTippyOptions(attachToOptions, step) { |
| 1501 |
var _makeCommonTippyOptio = _makeCommonTippyOptions(step), |
| 1502 |
popperOptions = _makeCommonTippyOptio.popperOptions, |
| 1503 |
tippyOptions = _makeCommonTippyOptio.tippyOptions; |
| 1504 |
|
| 1505 |
tippyOptions.flipOnUpdate = true; |
| 1506 |
tippyOptions.placement = attachToOptions.on || 'right'; |
| 1507 |
var stepPopperOptions = getValue(step, 'options.tippyOptions.popperOptions'); |
| 1508 |
|
| 1509 |
if (stepPopperOptions) { |
| 1510 |
popperOptions = _extends({}, popperOptions, {}, stepPopperOptions, { |
| 1511 |
modifiers: _extends({}, popperOptions.modifiers, {}, stepPopperOptions.modifiers) |
| 1512 |
}); |
| 1513 |
} |
| 1514 |
|
| 1515 |
tippyOptions.popperOptions = popperOptions; |
| 1516 |
return tippyOptions; |
| 1517 |
} |
| 1518 |
/** |
| 1519 |
* Generates the hash of options for a tooltip that doesn't have a |
| 1520 |
* target element in the DOM -- and thus is positioned in the center |
| 1521 |
* of the view |
| 1522 |
* |
| 1523 |
* @param {Step} step The step instance |
| 1524 |
* @return {Object} The final tippy options object |
| 1525 |
*/ |
| 1526 |
|
| 1527 |
function makeCenteredTippy(step) { |
| 1528 |
var centeredStylePopperModifier = _getCenteredStylePopperModifier(step.styles); |
| 1529 |
|
| 1530 |
var _makeCommonTippyOptio2 = _makeCommonTippyOptions(step), |
| 1531 |
popperOptions = _makeCommonTippyOptio2.popperOptions, |
| 1532 |
tippyOptions = _makeCommonTippyOptio2.tippyOptions; |
| 1533 |
|
| 1534 |
tippyOptions.placement = 'top'; |
| 1535 |
tippyOptions.arrow = false; |
| 1536 |
tippyOptions.popperOptions = tippyOptions.popperOptions || {}; |
| 1537 |
popperOptions = _extends({}, popperOptions, {}, tippyOptions.popperOptions, { |
| 1538 |
modifiers: _extends({}, popperOptions.modifiers, {}, centeredStylePopperModifier, {}, tippyOptions.popperOptions.modifiers) |
| 1539 |
}); |
| 1540 |
tippyOptions.popperOptions = popperOptions; |
| 1541 |
return tippyOptions; |
| 1542 |
} |
| 1543 |
|
| 1544 |
function _makeCommonTippyOptions(step) { |
| 1545 |
var popperOptions = _getDefaultPopperOptions(step.styles); |
| 1546 |
|
| 1547 |
var tippyOptions = _extends({ |
| 1548 |
content: step.el |
| 1549 |
}, step.options.tippyOptions); |
| 1550 |
|
| 1551 |
var shepherdElementZIndex = getValue(step, 'tour.options.styleVariables.shepherdElementZIndex'); |
| 1552 |
|
| 1553 |
if (shepherdElementZIndex) { |
| 1554 |
tippyOptions.zIndex = shepherdElementZIndex; |
| 1555 |
} |
| 1556 |
|
| 1557 |
if (step.options.title) { |
| 1558 |
popperOptions.modifiers = _extends({}, popperOptions.modifiers, {}, addHasTitleClass(step)); |
| 1559 |
} |
| 1560 |
|
| 1561 |
return { |
| 1562 |
popperOptions: popperOptions, |
| 1563 |
tippyOptions: tippyOptions |
| 1564 |
}; |
| 1565 |
} |
| 1566 |
|
| 1567 |
/**! |
| 1568 |
* tippy.js v5.0.0-beta.1 |
| 1569 |
* (c) 2017-2019 atomiks |
| 1570 |
* MIT License |
| 1571 |
*/ |
| 1572 |
function _extends$1() { |
| 1573 |
_extends$1 = Object.assign || function (target) { |
| 1574 |
for (var i = 1; i < arguments.length; i++) { |
| 1575 |
var source = arguments[i]; |
| 1576 |
|
| 1577 |
for (var key in source) { |
| 1578 |
if (Object.prototype.hasOwnProperty.call(source, key)) { |
| 1579 |
target[key] = source[key]; |
| 1580 |
} |
| 1581 |
} |
| 1582 |
} |
| 1583 |
|
| 1584 |
return target; |
| 1585 |
}; |
| 1586 |
|
| 1587 |
return _extends$1.apply(this, arguments); |
| 1588 |
} |
| 1589 |
|
| 1590 |
var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; |
| 1591 |
var ua = isBrowser ? navigator.userAgent : ''; |
| 1592 |
var isIE = /MSIE |Trident\//.test(ua); |
| 1593 |
var isUCBrowser = /UCBrowser\//.test(ua); |
| 1594 |
var isIOS = isBrowser && /iPhone|iPad|iPod/.test(navigator.platform); |
| 1595 |
|
| 1596 |
var defaultProps = { |
| 1597 |
allowHTML: true, |
| 1598 |
animateFill: false, |
| 1599 |
animation: 'fade', |
| 1600 |
appendTo: function appendTo() { |
| 1601 |
return document.body; |
| 1602 |
}, |
| 1603 |
aria: 'describedby', |
| 1604 |
arrow: true, |
| 1605 |
boundary: 'scrollParent', |
| 1606 |
content: '', |
| 1607 |
delay: 0, |
| 1608 |
distance: 10, |
| 1609 |
duration: [325, 275], |
| 1610 |
flip: true, |
| 1611 |
flipBehavior: 'flip', |
| 1612 |
flipOnUpdate: false, |
| 1613 |
followCursor: false, |
| 1614 |
hideOnClick: true, |
| 1615 |
ignoreAttributes: false, |
| 1616 |
inertia: false, |
| 1617 |
interactive: false, |
| 1618 |
interactiveBorder: 2, |
| 1619 |
interactiveDebounce: 0, |
| 1620 |
lazy: true, |
| 1621 |
maxWidth: 750, // TODO: Dunno. |
| 1622 |
multiple: false, |
| 1623 |
offset: 0, |
| 1624 |
onCreate: function onCreate() {}, |
| 1625 |
onHidden: function onHidden() {}, |
| 1626 |
onHide: function onHide() {}, |
| 1627 |
onMount: function onMount() {}, |
| 1628 |
onShow: function onShow() {}, |
| 1629 |
onShown: function onShown() {}, |
| 1630 |
onTrigger: function onTrigger() {}, |
| 1631 |
onUntrigger: function onUntrigger() {}, |
| 1632 |
placement: 'top', |
| 1633 |
popperOptions: {}, |
| 1634 |
role: 'tooltip', |
| 1635 |
showOnCreate: false, |
| 1636 |
sticky: false, |
| 1637 |
theme: '', |
| 1638 |
touch: true, |
| 1639 |
trigger: 'mouseenter focus', |
| 1640 |
triggerTarget: null, |
| 1641 |
updateDuration: 0, |
| 1642 |
zIndex: 999901 |
| 1643 |
/** |
| 1644 |
* If the setProps() method encounters one of these, the popperInstance must be |
| 1645 |
* recreated |
| 1646 |
*/ |
| 1647 |
|
| 1648 |
}; |
| 1649 |
var POPPER_INSTANCE_DEPENDENCIES = ['arrow', 'boundary', 'distance', 'flip', 'flipBehavior', 'flipOnUpdate', 'offset', 'placement', 'popperOptions']; |
| 1650 |
|
| 1651 |
var PASSIVE = { |
| 1652 |
passive: true |
| 1653 |
}; |
| 1654 |
var PREVENT_OVERFLOW_PADDING = 5; |
| 1655 |
var ROUND_ARROW_INNER_HTML = '<svg viewBox="0 0 18 7" xmlns="http://www.w3.org/2000/svg"><path d="M0 7s2.021-.015 5.253-4.218C6.584 1.051 7.797.007 9 0c1.203-.007 2.416 1.035 3.761 2.782C16.012 7.005 18 7 18 7H0z"/></svg>'; |
| 1656 |
var IOS_CLASS = "tippy-iOS"; |
| 1657 |
var POPPER_CLASS = "tippy-popper"; |
| 1658 |
var TOOLTIP_CLASS = "tippy-tooltip"; |
| 1659 |
var CONTENT_CLASS = "tippy-content"; |
| 1660 |
var BACKDROP_CLASS = "tippy-backdrop"; |
| 1661 |
var ARROW_CLASS = "tippy-arrow"; |
| 1662 |
var SVG_ARROW_CLASS = "tippy-svg-arrow"; |
| 1663 |
var POPPER_SELECTOR = "." + POPPER_CLASS; |
| 1664 |
var TOOLTIP_SELECTOR = "." + TOOLTIP_CLASS; |
| 1665 |
var CONTENT_SELECTOR = "." + CONTENT_CLASS; |
| 1666 |
var BACKDROP_SELECTOR = "." + BACKDROP_CLASS; |
| 1667 |
var ARROW_SELECTOR = "." + ARROW_CLASS; |
| 1668 |
var SVG_ARROW_SELECTOR = "." + SVG_ARROW_CLASS; // TODO: Work out best way to make these updateable |
| 1669 |
|
| 1670 |
var currentInput = { |
| 1671 |
isTouch: false |
| 1672 |
}; |
| 1673 |
var lastMouseMoveTime = 0; |
| 1674 |
/** |
| 1675 |
* When a `touchstart` event is fired, it's assumed the user is using touch |
| 1676 |
* input. We'll bind a `mousemove` event listener to listen for mouse input in |
| 1677 |
* the future. This way, the `isTouch` property is fully dynamic and will handle |
| 1678 |
* hybrid devices that use a mix of touch + mouse input. |
| 1679 |
*/ |
| 1680 |
|
| 1681 |
function onDocumentTouchStart() { |
| 1682 |
if (currentInput.isTouch) { |
| 1683 |
return; |
| 1684 |
} |
| 1685 |
|
| 1686 |
currentInput.isTouch = true; |
| 1687 |
|
| 1688 |
if (isIOS) { |
| 1689 |
document.body.classList.add(IOS_CLASS); |
| 1690 |
} |
| 1691 |
|
| 1692 |
if (window.performance) { |
| 1693 |
document.addEventListener('mousemove', onDocumentMouseMove); |
| 1694 |
} |
| 1695 |
} |
| 1696 |
/** |
| 1697 |
* When two `mousemove` event are fired consecutively within 20ms, it's assumed |
| 1698 |
* the user is using mouse input again. `mousemove` can fire on touch devices as |
| 1699 |
* well, but very rarely that quickly. |
| 1700 |
*/ |
| 1701 |
|
| 1702 |
function onDocumentMouseMove() { |
| 1703 |
var now = performance.now(); |
| 1704 |
|
| 1705 |
if (now - lastMouseMoveTime < 20) { |
| 1706 |
currentInput.isTouch = false; |
| 1707 |
document.removeEventListener('mousemove', onDocumentMouseMove); |
| 1708 |
|
| 1709 |
if (!isIOS) { |
| 1710 |
document.body.classList.remove(IOS_CLASS); |
| 1711 |
} |
| 1712 |
} |
| 1713 |
|
| 1714 |
lastMouseMoveTime = now; |
| 1715 |
} |
| 1716 |
/** |
| 1717 |
* When an element is in focus and has a tippy, leaving the tab/window and |
| 1718 |
* returning causes it to show again. For mouse users this is unexpected, but |
| 1719 |
* for keyboard use it makes sense. |
| 1720 |
* TODO: find a better technique to solve this problem |
| 1721 |
*/ |
| 1722 |
|
| 1723 |
function onWindowBlur() { |
| 1724 |
var _document = document, |
| 1725 |
activeElement = _document.activeElement; |
| 1726 |
var instance = activeElement._tippy; |
| 1727 |
|
| 1728 |
if (activeElement && activeElement.blur && instance && !instance.state.isVisible) { |
| 1729 |
activeElement.blur(); |
| 1730 |
} |
| 1731 |
} |
| 1732 |
/** |
| 1733 |
* Adds the needed global event listeners |
| 1734 |
*/ |
| 1735 |
|
| 1736 |
function bindGlobalEventListeners() { |
| 1737 |
document.addEventListener('touchstart', onDocumentTouchStart, _extends$1({}, PASSIVE, { |
| 1738 |
capture: true |
| 1739 |
})); |
| 1740 |
window.addEventListener('blur', onWindowBlur); |
| 1741 |
} |
| 1742 |
|
| 1743 |
var keys$2 = Object.keys(defaultProps); |
| 1744 |
/** |
| 1745 |
* Returns an object of optional props from data-tippy-* attributes |
| 1746 |
*/ |
| 1747 |
|
| 1748 |
function getDataAttributeProps(reference) { |
| 1749 |
var props = keys$2.reduce(function (acc, key) { |
| 1750 |
var valueAsString = (reference.getAttribute("data-tippy-" + key) || '').trim(); |
| 1751 |
|
| 1752 |
if (!valueAsString) { |
| 1753 |
return acc; |
| 1754 |
} |
| 1755 |
|
| 1756 |
if (key === 'content') { |
| 1757 |
acc[key] = valueAsString; |
| 1758 |
} else { |
| 1759 |
try { |
| 1760 |
acc[key] = JSON.parse(valueAsString); |
| 1761 |
} catch (e) { |
| 1762 |
acc[key] = valueAsString; |
| 1763 |
} |
| 1764 |
} |
| 1765 |
|
| 1766 |
return acc; |
| 1767 |
}, {}); |
| 1768 |
return props; |
| 1769 |
} |
| 1770 |
|
| 1771 |
/** |
| 1772 |
* Determines if the value is a reference element |
| 1773 |
*/ |
| 1774 |
|
| 1775 |
function isReferenceElement(value) { |
| 1776 |
return !!(value && value._tippy && !value.classList.contains(POPPER_CLASS)); |
| 1777 |
} |
| 1778 |
/** |
| 1779 |
* Safe .hasOwnProperty check, for prototype-less objects |
| 1780 |
*/ |
| 1781 |
|
| 1782 |
function hasOwnProperty$1(obj, key) { |
| 1783 |
return {}.hasOwnProperty.call(obj, key); |
| 1784 |
} |
| 1785 |
/** |
| 1786 |
* Returns an array of elements based on the value |
| 1787 |
*/ |
| 1788 |
|
| 1789 |
function getArrayOfElements(value) { |
| 1790 |
if (isRealElement(value)) { |
| 1791 |
return [value]; |
| 1792 |
} |
| 1793 |
|
| 1794 |
if (value instanceof NodeList) { |
| 1795 |
return arrayFrom(value); |
| 1796 |
} |
| 1797 |
|
| 1798 |
if (Array.isArray(value)) { |
| 1799 |
return value; |
| 1800 |
} |
| 1801 |
|
| 1802 |
return arrayFrom(document.querySelectorAll(value)); |
| 1803 |
} |
| 1804 |
/** |
| 1805 |
* Returns a value at a given index depending on if it's an array or number |
| 1806 |
*/ |
| 1807 |
|
| 1808 |
function getValueAtIndexOrReturn(value, index, defaultValue) { |
| 1809 |
if (Array.isArray(value)) { |
| 1810 |
var v = value[index]; |
| 1811 |
return v == null ? Array.isArray(defaultValue) ? defaultValue[index] : defaultValue : v; |
| 1812 |
} |
| 1813 |
|
| 1814 |
return value; |
| 1815 |
} |
| 1816 |
/** |
| 1817 |
* Prevents errors from being thrown while accessing nested modifier objects |
| 1818 |
* in `popperOptions` |
| 1819 |
*/ |
| 1820 |
|
| 1821 |
function getModifier(obj, key) { |
| 1822 |
return obj && obj.modifiers && obj.modifiers[key]; |
| 1823 |
} |
| 1824 |
/** |
| 1825 |
* Determines if the value is a real element |
| 1826 |
*/ |
| 1827 |
|
| 1828 |
function isRealElement(value) { |
| 1829 |
return value instanceof Element; |
| 1830 |
} |
| 1831 |
/** |
| 1832 |
* Firefox extensions don't allow setting .innerHTML directly, this will trick |
| 1833 |
* it |
| 1834 |
*/ |
| 1835 |
|
| 1836 |
function innerHTML() { |
| 1837 |
return 'innerHTML'; |
| 1838 |
} |
| 1839 |
/** |
| 1840 |
* Evaluates a function if one, or returns the value |
| 1841 |
*/ |
| 1842 |
|
| 1843 |
function invokeWithArgsOrReturn(value, args) { |
| 1844 |
return typeof value === 'function' ? value.apply(null, args) : value; |
| 1845 |
} |
| 1846 |
/** |
| 1847 |
* Sets a popperInstance `flip` modifier's enabled state |
| 1848 |
*/ |
| 1849 |
|
| 1850 |
function setFlipModifierEnabled(modifiers, value) { |
| 1851 |
modifiers.filter(function (m) { |
| 1852 |
return m.name === 'flip'; |
| 1853 |
})[0].enabled = value; |
| 1854 |
} |
| 1855 |
/** |
| 1856 |
* Returns a new `div` element |
| 1857 |
*/ |
| 1858 |
|
| 1859 |
function div() { |
| 1860 |
return document.createElement('div'); |
| 1861 |
} |
| 1862 |
/** |
| 1863 |
* Applies a transition duration to a list of elements |
| 1864 |
*/ |
| 1865 |
|
| 1866 |
function setTransitionDuration(els, value) { |
| 1867 |
els.forEach(function (el) { |
| 1868 |
if (el) { |
| 1869 |
el.style.transitionDuration = value + "ms"; |
| 1870 |
} |
| 1871 |
}); |
| 1872 |
} |
| 1873 |
/** |
| 1874 |
* Sets the visibility state to elements so they can begin to transition |
| 1875 |
*/ |
| 1876 |
|
| 1877 |
function setVisibilityState(els, state) { |
| 1878 |
els.forEach(function (el) { |
| 1879 |
if (el) { |
| 1880 |
el.setAttribute('data-state', state); |
| 1881 |
} |
| 1882 |
}); |
| 1883 |
} |
| 1884 |
/** |
| 1885 |
* Evaluates the props object by merging data attributes and disabling |
| 1886 |
* conflicting props where necessary |
| 1887 |
*/ |
| 1888 |
|
| 1889 |
function evaluateProps(reference, props) { |
| 1890 |
var out = _extends$1({}, props, { |
| 1891 |
content: invokeWithArgsOrReturn(props.content, [reference]) |
| 1892 |
}, props.ignoreAttributes ? {} : getDataAttributeProps(reference)); |
| 1893 |
|
| 1894 |
if (out.animateFill) { |
| 1895 |
out.arrow = false; |
| 1896 |
} |
| 1897 |
|
| 1898 |
if (out.arrow || isUCBrowser) { |
| 1899 |
out.animateFill = false; |
| 1900 |
} |
| 1901 |
|
| 1902 |
return out; |
| 1903 |
} |
| 1904 |
/** |
| 1905 |
* Debounce utility. To avoid bloating bundle size, we're only passing 1 |
| 1906 |
* argument here, a more generic function would pass all arguments. Only |
| 1907 |
* `onMouseMove` uses this which takes the event object for now. |
| 1908 |
*/ |
| 1909 |
|
| 1910 |
function debounce(fn, ms) { |
| 1911 |
// Avoid wrapping in `setTimeout` if ms is 0 anyway |
| 1912 |
if (ms === 0) { |
| 1913 |
return fn; |
| 1914 |
} |
| 1915 |
|
| 1916 |
var timeout; |
| 1917 |
return function (arg) { |
| 1918 |
clearTimeout(timeout); |
| 1919 |
timeout = setTimeout(function () { |
| 1920 |
fn(arg); |
| 1921 |
}, ms); |
| 1922 |
}; |
| 1923 |
} |
| 1924 |
/** |
| 1925 |
* Preserves the original function invocation when another function replaces it |
| 1926 |
*/ |
| 1927 |
|
| 1928 |
function preserveInvocation(originalFn, currentFn, args) { |
| 1929 |
if (originalFn && originalFn !== currentFn) { |
| 1930 |
originalFn.apply(null, args); |
| 1931 |
} |
| 1932 |
} |
| 1933 |
/** |
| 1934 |
* Ponyfill for Array.from - converts iterable values to an array |
| 1935 |
*/ |
| 1936 |
|
| 1937 |
function arrayFrom(value) { |
| 1938 |
return [].slice.call(value); |
| 1939 |
} |
| 1940 |
/** |
| 1941 |
* Works like Element.prototype.closest, but uses a callback instead |
| 1942 |
*/ |
| 1943 |
|
| 1944 |
function closestCallback(element, callback) { |
| 1945 |
while (element) { |
| 1946 |
if (callback(element)) { |
| 1947 |
return element; |
| 1948 |
} |
| 1949 |
|
| 1950 |
element = element.parentElement; |
| 1951 |
} |
| 1952 |
|
| 1953 |
return null; |
| 1954 |
} |
| 1955 |
/** |
| 1956 |
* Determines if an array or string includes a string |
| 1957 |
*/ |
| 1958 |
|
| 1959 |
function includes(a, b) { |
| 1960 |
return a.indexOf(b) > -1; |
| 1961 |
} |
| 1962 |
|
| 1963 |
/** |
| 1964 |
* Sets the innerHTML of an element |
| 1965 |
*/ |
| 1966 |
|
| 1967 |
function setInnerHTML(element, html) { |
| 1968 |
element[innerHTML()] = isRealElement(html) ? html[innerHTML()] : html; |
| 1969 |
} |
| 1970 |
/** |
| 1971 |
* Sets the content of a tooltip |
| 1972 |
*/ |
| 1973 |
|
| 1974 |
function setContent(contentEl, props) { |
| 1975 |
if (isRealElement(props.content)) { |
| 1976 |
setInnerHTML(contentEl, ''); |
| 1977 |
contentEl.appendChild(props.content); |
| 1978 |
} else if (typeof props.content !== 'function') { |
| 1979 |
var key = props.allowHTML ? 'innerHTML' : 'textContent'; |
| 1980 |
contentEl[key] = props.content; |
| 1981 |
} |
| 1982 |
} |
| 1983 |
/** |
| 1984 |
* Returns the child elements of a popper element |
| 1985 |
*/ |
| 1986 |
|
| 1987 |
function getChildren(popper) { |
| 1988 |
return { |
| 1989 |
tooltip: popper.querySelector(TOOLTIP_SELECTOR), |
| 1990 |
backdrop: popper.querySelector(BACKDROP_SELECTOR), |
| 1991 |
content: popper.querySelector(CONTENT_SELECTOR), |
| 1992 |
arrow: popper.querySelector(ARROW_SELECTOR) || popper.querySelector(SVG_ARROW_SELECTOR) |
| 1993 |
}; |
| 1994 |
} |
| 1995 |
/** |
| 1996 |
* Adds `data-inertia` attribute |
| 1997 |
*/ |
| 1998 |
|
| 1999 |
function addInertia(tooltip) { |
| 2000 |
tooltip.setAttribute('data-inertia', ''); |
| 2001 |
} |
| 2002 |
/** |
| 2003 |
* Removes `data-inertia` attribute |
| 2004 |
*/ |
| 2005 |
|
| 2006 |
function removeInertia(tooltip) { |
| 2007 |
tooltip.removeAttribute('data-inertia'); |
| 2008 |
} |
| 2009 |
/** |
| 2010 |
* Creates an arrow element and returns it |
| 2011 |
*/ |
| 2012 |
|
| 2013 |
function createArrowElement(arrow) { |
| 2014 |
var arrowElement = div(); |
| 2015 |
|
| 2016 |
if (arrow === true) { |
| 2017 |
arrowElement.className = ARROW_CLASS; |
| 2018 |
} else { |
| 2019 |
arrowElement.className = SVG_ARROW_CLASS; |
| 2020 |
|
| 2021 |
if (isRealElement(arrow)) { |
| 2022 |
arrowElement.appendChild(arrow); |
| 2023 |
} else { |
| 2024 |
setInnerHTML(arrowElement, arrow === 'round' ? ROUND_ARROW_INNER_HTML : arrow); |
| 2025 |
} |
| 2026 |
} |
| 2027 |
|
| 2028 |
return arrowElement; |
| 2029 |
} |
| 2030 |
/** |
| 2031 |
* Creates a backdrop element and returns it |
| 2032 |
*/ |
| 2033 |
|
| 2034 |
function createBackdropElement(isVisible) { |
| 2035 |
var backdrop = div(); |
| 2036 |
backdrop.className = BACKDROP_CLASS; |
| 2037 |
backdrop.setAttribute('data-state', isVisible ? 'visible' : 'hidden'); |
| 2038 |
return backdrop; |
| 2039 |
} |
| 2040 |
/** |
| 2041 |
* Adds interactive-related attributes |
| 2042 |
*/ |
| 2043 |
|
| 2044 |
function addInteractive(tooltip) { |
| 2045 |
tooltip.setAttribute('data-interactive', ''); |
| 2046 |
} |
| 2047 |
/** |
| 2048 |
* Removes interactive-related attributes |
| 2049 |
*/ |
| 2050 |
|
| 2051 |
function removeInteractive(tooltip) { |
| 2052 |
tooltip.removeAttribute('data-interactive'); |
| 2053 |
} |
| 2054 |
/** |
| 2055 |
* Add/remove transitionend listener from tooltip |
| 2056 |
*/ |
| 2057 |
|
| 2058 |
function updateTransitionEndListener(tooltip, action, listener) { |
| 2059 |
var eventName = isUCBrowser && document.body.style.webkitTransition !== undefined ? 'webkitTransitionEnd' : 'transitionend'; |
| 2060 |
tooltip[action + 'EventListener'](eventName, listener); |
| 2061 |
} |
| 2062 |
/** |
| 2063 |
* Returns the popper's placement, ignoring shifting (top-start, etc) |
| 2064 |
*/ |
| 2065 |
|
| 2066 |
function getBasePlacement(placement) { |
| 2067 |
return placement.split('-')[0]; |
| 2068 |
} |
| 2069 |
/** |
| 2070 |
* Triggers reflow |
| 2071 |
*/ |
| 2072 |
|
| 2073 |
function reflow(popper) { |
| 2074 |
void popper.offsetHeight; |
| 2075 |
} |
| 2076 |
/** |
| 2077 |
* Adds/removes theme from tooltip's classList |
| 2078 |
*/ |
| 2079 |
|
| 2080 |
function updateTheme(tooltip, action, theme) { |
| 2081 |
theme.split(' ').forEach(function (name) { |
| 2082 |
if (name) { |
| 2083 |
tooltip.classList[action](name + "-theme"); |
| 2084 |
} |
| 2085 |
}); |
| 2086 |
} |
| 2087 |
/** |
| 2088 |
* Constructs the popper element and returns it |
| 2089 |
*/ |
| 2090 |
|
| 2091 |
function createPopperElement(id, props) { |
| 2092 |
var popper = div(); |
| 2093 |
popper.className = POPPER_CLASS; |
| 2094 |
popper.style.position = 'absolute'; |
| 2095 |
popper.style.top = '0'; |
| 2096 |
popper.style.left = '0'; |
| 2097 |
var tooltip = div(); |
| 2098 |
tooltip.className = TOOLTIP_CLASS; |
| 2099 |
tooltip.id = "tippy-" + id; |
| 2100 |
tooltip.setAttribute('data-state', 'hidden'); |
| 2101 |
tooltip.setAttribute('tabindex', '-1'); |
| 2102 |
updateTheme(tooltip, 'add', props.theme); |
| 2103 |
var content = div(); |
| 2104 |
content.className = CONTENT_CLASS; |
| 2105 |
content.setAttribute('data-state', 'hidden'); |
| 2106 |
|
| 2107 |
if (props.interactive) { |
| 2108 |
addInteractive(tooltip); |
| 2109 |
} |
| 2110 |
|
| 2111 |
if (props.arrow) { |
| 2112 |
tooltip.setAttribute('data-arrow', ''); |
| 2113 |
tooltip.appendChild(createArrowElement(props.arrow)); |
| 2114 |
} |
| 2115 |
|
| 2116 |
if (props.animateFill) { |
| 2117 |
tooltip.appendChild(createBackdropElement(false)); |
| 2118 |
tooltip.setAttribute('data-animatefill', ''); |
| 2119 |
} |
| 2120 |
|
| 2121 |
if (props.inertia) { |
| 2122 |
addInertia(tooltip); |
| 2123 |
} |
| 2124 |
|
| 2125 |
setContent(content, props); |
| 2126 |
tooltip.appendChild(content); |
| 2127 |
popper.appendChild(tooltip); |
| 2128 |
updatePopperElement(popper, props, props, false); |
| 2129 |
return popper; |
| 2130 |
} |
| 2131 |
/** |
| 2132 |
* Updates the popper element based on the new props |
| 2133 |
*/ |
| 2134 |
|
| 2135 |
function updatePopperElement(popper, prevProps, nextProps, isVisible) { |
| 2136 |
var _getChildren = getChildren(popper), |
| 2137 |
tooltip = _getChildren.tooltip, |
| 2138 |
content = _getChildren.content, |
| 2139 |
backdrop = _getChildren.backdrop, |
| 2140 |
arrow = _getChildren.arrow; |
| 2141 |
|
| 2142 |
popper.style.zIndex = '' + nextProps.zIndex; |
| 2143 |
tooltip.setAttribute('data-animation', nextProps.animation); |
| 2144 |
tooltip.style.maxWidth = nextProps.maxWidth + (typeof nextProps.maxWidth === 'number' ? 'px' : ''); |
| 2145 |
|
| 2146 |
if (nextProps.role) { |
| 2147 |
tooltip.setAttribute('role', nextProps.role); |
| 2148 |
} else { |
| 2149 |
tooltip.removeAttribute('role'); |
| 2150 |
} |
| 2151 |
|
| 2152 |
if (prevProps.content !== nextProps.content) { |
| 2153 |
setContent(content, nextProps); |
| 2154 |
} // animateFill |
| 2155 |
|
| 2156 |
|
| 2157 |
if (!prevProps.animateFill && nextProps.animateFill) { |
| 2158 |
tooltip.appendChild(createBackdropElement(isVisible)); |
| 2159 |
tooltip.setAttribute('data-animatefill', ''); |
| 2160 |
} else if (prevProps.animateFill && !nextProps.animateFill) { |
| 2161 |
tooltip.removeChild(backdrop); |
| 2162 |
tooltip.removeAttribute('data-animatefill'); |
| 2163 |
} // arrow |
| 2164 |
|
| 2165 |
|
| 2166 |
if (!prevProps.arrow && nextProps.arrow) { |
| 2167 |
// false to true |
| 2168 |
tooltip.appendChild(createArrowElement(nextProps.arrow)); |
| 2169 |
tooltip.setAttribute('data-arrow', ''); |
| 2170 |
} else if (prevProps.arrow && !nextProps.arrow) { |
| 2171 |
// true to false |
| 2172 |
tooltip.removeChild(arrow); |
| 2173 |
tooltip.removeAttribute('data-arrow'); |
| 2174 |
} else if (prevProps.arrow !== nextProps.arrow) { |
| 2175 |
// true to 'round' or vice-versa |
| 2176 |
tooltip.removeChild(arrow); |
| 2177 |
tooltip.appendChild(createArrowElement(nextProps.arrow)); |
| 2178 |
} // interactive |
| 2179 |
|
| 2180 |
|
| 2181 |
if (!prevProps.interactive && nextProps.interactive) { |
| 2182 |
addInteractive(tooltip); |
| 2183 |
} else if (prevProps.interactive && !nextProps.interactive) { |
| 2184 |
removeInteractive(tooltip); |
| 2185 |
} // inertia |
| 2186 |
|
| 2187 |
|
| 2188 |
if (!prevProps.inertia && nextProps.inertia) { |
| 2189 |
addInertia(tooltip); |
| 2190 |
} else if (prevProps.inertia && !nextProps.inertia) { |
| 2191 |
removeInertia(tooltip); |
| 2192 |
} // theme |
| 2193 |
|
| 2194 |
|
| 2195 |
if (prevProps.theme !== nextProps.theme) { |
| 2196 |
updateTheme(tooltip, 'remove', prevProps.theme); |
| 2197 |
updateTheme(tooltip, 'add', nextProps.theme); |
| 2198 |
} |
| 2199 |
} |
| 2200 |
/** |
| 2201 |
* Determines if the mouse cursor is outside of the popper's interactive border |
| 2202 |
* region |
| 2203 |
*/ |
| 2204 |
|
| 2205 |
function isCursorOutsideInteractiveBorder(popperPlacement, popperRect, event, props) { |
| 2206 |
if (!popperPlacement) { |
| 2207 |
return true; |
| 2208 |
} |
| 2209 |
|
| 2210 |
var x = event.clientX, |
| 2211 |
y = event.clientY; |
| 2212 |
var interactiveBorder = props.interactiveBorder, |
| 2213 |
distance = props.distance; |
| 2214 |
var exceedsTop = popperRect.top - y > (popperPlacement === 'top' ? interactiveBorder + distance : interactiveBorder); |
| 2215 |
var exceedsBottom = y - popperRect.bottom > (popperPlacement === 'bottom' ? interactiveBorder + distance : interactiveBorder); |
| 2216 |
var exceedsLeft = popperRect.left - x > (popperPlacement === 'left' ? interactiveBorder + distance : interactiveBorder); |
| 2217 |
var exceedsRight = x - popperRect.right > (popperPlacement === 'right' ? interactiveBorder + distance : interactiveBorder); |
| 2218 |
return exceedsTop || exceedsBottom || exceedsLeft || exceedsRight; |
| 2219 |
} |
| 2220 |
|
| 2221 |
/**! |
| 2222 |
* @fileOverview Kickass library to create and place poppers near their reference elements. |
| 2223 |
* @version 1.15.0 |
| 2224 |
* @license |
| 2225 |
* Copyright (c) 2016 Federico Zivolo and contributors |
| 2226 |
* |
| 2227 |
* Permission is hereby granted, free of charge, to any person obtaining a copy |
| 2228 |
* of this software and associated documentation files (the "Software"), to deal |
| 2229 |
* in the Software without restriction, including without limitation the rights |
| 2230 |
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell |
| 2231 |
* copies of the Software, and to permit persons to whom the Software is |
| 2232 |
* furnished to do so, subject to the following conditions: |
| 2233 |
* |
| 2234 |
* The above copyright notice and this permission notice shall be included in all |
| 2235 |
* copies or substantial portions of the Software. |
| 2236 |
* |
| 2237 |
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR |
| 2238 |
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, |
| 2239 |
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE |
| 2240 |
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER |
| 2241 |
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, |
| 2242 |
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE |
| 2243 |
* SOFTWARE. |
| 2244 |
*/ |
| 2245 |
var isBrowser$1 = typeof window !== 'undefined' && typeof document !== 'undefined'; |
| 2246 |
|
| 2247 |
var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; |
| 2248 |
var timeoutDuration = 0; |
| 2249 |
for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { |
| 2250 |
if (isBrowser$1 && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { |
| 2251 |
timeoutDuration = 1; |
| 2252 |
break; |
| 2253 |
} |
| 2254 |
} |
| 2255 |
|
| 2256 |
function microtaskDebounce(fn) { |
| 2257 |
var called = false; |
| 2258 |
return function () { |
| 2259 |
if (called) { |
| 2260 |
return; |
| 2261 |
} |
| 2262 |
called = true; |
| 2263 |
window.Promise.resolve().then(function () { |
| 2264 |
called = false; |
| 2265 |
fn(); |
| 2266 |
}); |
| 2267 |
}; |
| 2268 |
} |
| 2269 |
|
| 2270 |
function taskDebounce(fn) { |
| 2271 |
var scheduled = false; |
| 2272 |
return function () { |
| 2273 |
if (!scheduled) { |
| 2274 |
scheduled = true; |
| 2275 |
setTimeout(function () { |
| 2276 |
scheduled = false; |
| 2277 |
fn(); |
| 2278 |
}, timeoutDuration); |
| 2279 |
} |
| 2280 |
}; |
| 2281 |
} |
| 2282 |
|
| 2283 |
var supportsMicroTasks = isBrowser$1 && window.Promise; |
| 2284 |
|
| 2285 |
/** |
| 2286 |
* Create a debounced version of a method, that's asynchronously deferred |
| 2287 |
* but called in the minimum time possible. |
| 2288 |
* |
| 2289 |
* @method |
| 2290 |
* @memberof Popper.Utils |
| 2291 |
* @argument {Function} fn |
| 2292 |
* @returns {Function} |
| 2293 |
*/ |
| 2294 |
var debounce$1 = supportsMicroTasks ? microtaskDebounce : taskDebounce; |
| 2295 |
|
| 2296 |
/** |
| 2297 |
* Check if the given variable is a function |
| 2298 |
* @method |
| 2299 |
* @memberof Popper.Utils |
| 2300 |
* @argument {Any} functionToCheck - variable to check |
| 2301 |
* @returns {Boolean} answer to: is a function? |
| 2302 |
*/ |
| 2303 |
function isFunction$1(functionToCheck) { |
| 2304 |
var getType = {}; |
| 2305 |
return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; |
| 2306 |
} |
| 2307 |
|
| 2308 |
/** |
| 2309 |
* Get CSS computed property of the given element |
| 2310 |
* @method |
| 2311 |
* @memberof Popper.Utils |
| 2312 |
* @argument {Eement} element |
| 2313 |
* @argument {String} property |
| 2314 |
*/ |
| 2315 |
function getStyleComputedProperty(element, property) { |
| 2316 |
if (element.nodeType !== 1) { |
| 2317 |
return []; |
| 2318 |
} |
| 2319 |
// NOTE: 1 DOM access here |
| 2320 |
var window = element.ownerDocument.defaultView; |
| 2321 |
var css = window.getComputedStyle(element, null); |
| 2322 |
return property ? css[property] : css; |
| 2323 |
} |
| 2324 |
|
| 2325 |
/** |
| 2326 |
* Returns the parentNode or the host of the element |
| 2327 |
* @method |
| 2328 |
* @memberof Popper.Utils |
| 2329 |
* @argument {Element} element |
| 2330 |
* @returns {Element} parent |
| 2331 |
*/ |
| 2332 |
function getParentNode(element) { |
| 2333 |
if (element.nodeName === 'HTML') { |
| 2334 |
return element; |
| 2335 |
} |
| 2336 |
return element.parentNode || element.host; |
| 2337 |
} |
| 2338 |
|
| 2339 |
/** |
| 2340 |
* Returns the scrolling parent of the given element |
| 2341 |
* @method |
| 2342 |
* @memberof Popper.Utils |
| 2343 |
* @argument {Element} element |
| 2344 |
* @returns {Element} scroll parent |
| 2345 |
*/ |
| 2346 |
function getScrollParent(element) { |
| 2347 |
// Return body, `getScroll` will take care to get the correct `scrollTop` from it |
| 2348 |
if (!element) { |
| 2349 |
return document.body; |
| 2350 |
} |
| 2351 |
|
| 2352 |
switch (element.nodeName) { |
| 2353 |
case 'HTML': |
| 2354 |
case 'BODY': |
| 2355 |
return element.ownerDocument.body; |
| 2356 |
case '#document': |
| 2357 |
return element.body; |
| 2358 |
} |
| 2359 |
|
| 2360 |
// Firefox want us to check `-x` and `-y` variations as well |
| 2361 |
|
| 2362 |
var _getStyleComputedProp = getStyleComputedProperty(element), |
| 2363 |
overflow = _getStyleComputedProp.overflow, |
| 2364 |
overflowX = _getStyleComputedProp.overflowX, |
| 2365 |
overflowY = _getStyleComputedProp.overflowY; |
| 2366 |
|
| 2367 |
if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { |
| 2368 |
return element; |
| 2369 |
} |
| 2370 |
|
| 2371 |
return getScrollParent(getParentNode(element)); |
| 2372 |
} |
| 2373 |
|
| 2374 |
var isIE11 = isBrowser$1 && !!(window.MSInputMethodContext && document.documentMode); |
| 2375 |
var isIE10 = isBrowser$1 && /MSIE 10/.test(navigator.userAgent); |
| 2376 |
|
| 2377 |
/** |
| 2378 |
* Determines if the browser is Internet Explorer |
| 2379 |
* @method |
| 2380 |
* @memberof Popper.Utils |
| 2381 |
* @param {Number} version to check |
| 2382 |
* @returns {Boolean} isIE |
| 2383 |
*/ |
| 2384 |
function isIE$1(version) { |
| 2385 |
if (version === 11) { |
| 2386 |
return isIE11; |
| 2387 |
} |
| 2388 |
if (version === 10) { |
| 2389 |
return isIE10; |
| 2390 |
} |
| 2391 |
return isIE11 || isIE10; |
| 2392 |
} |
| 2393 |
|
| 2394 |
/** |
| 2395 |
* Returns the offset parent of the given element |
| 2396 |
* @method |
| 2397 |
* @memberof Popper.Utils |
| 2398 |
* @argument {Element} element |
| 2399 |
* @returns {Element} offset parent |
| 2400 |
*/ |
| 2401 |
function getOffsetParent(element) { |
| 2402 |
if (!element) { |
| 2403 |
return document.documentElement; |
| 2404 |
} |
| 2405 |
|
| 2406 |
var noOffsetParent = isIE$1(10) ? document.body : null; |
| 2407 |
|
| 2408 |
// NOTE: 1 DOM access here |
| 2409 |
var offsetParent = element.offsetParent || null; |
| 2410 |
// Skip hidden elements which don't have an offsetParent |
| 2411 |
while (offsetParent === noOffsetParent && element.nextElementSibling) { |
| 2412 |
offsetParent = (element = element.nextElementSibling).offsetParent; |
| 2413 |
} |
| 2414 |
|
| 2415 |
var nodeName = offsetParent && offsetParent.nodeName; |
| 2416 |
|
| 2417 |
if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { |
| 2418 |
return element ? element.ownerDocument.documentElement : document.documentElement; |
| 2419 |
} |
| 2420 |
|
| 2421 |
// .offsetParent will return the closest TH, TD or TABLE in case |
| 2422 |
// no offsetParent is present, I hate this job... |
| 2423 |
if (['TH', 'TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { |
| 2424 |
return getOffsetParent(offsetParent); |
| 2425 |
} |
| 2426 |
|
| 2427 |
return offsetParent; |
| 2428 |
} |
| 2429 |
|
| 2430 |
function isOffsetContainer(element) { |
| 2431 |
var nodeName = element.nodeName; |
| 2432 |
|
| 2433 |
if (nodeName === 'BODY') { |
| 2434 |
return false; |
| 2435 |
} |
| 2436 |
return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; |
| 2437 |
} |
| 2438 |
|
| 2439 |
/** |
| 2440 |
* Finds the root node (document, shadowDOM root) of the given element |
| 2441 |
* @method |
| 2442 |
* @memberof Popper.Utils |
| 2443 |
* @argument {Element} node |
| 2444 |
* @returns {Element} root node |
| 2445 |
*/ |
| 2446 |
function getRoot(node) { |
| 2447 |
if (node.parentNode !== null) { |
| 2448 |
return getRoot(node.parentNode); |
| 2449 |
} |
| 2450 |
|
| 2451 |
return node; |
| 2452 |
} |
| 2453 |
|
| 2454 |
/** |
| 2455 |
* Finds the offset parent common to the two provided nodes |
| 2456 |
* @method |
| 2457 |
* @memberof Popper.Utils |
| 2458 |
* @argument {Element} element1 |
| 2459 |
* @argument {Element} element2 |
| 2460 |
* @returns {Element} common offset parent |
| 2461 |
*/ |
| 2462 |
function findCommonOffsetParent(element1, element2) { |
| 2463 |
// This check is needed to avoid errors in case one of the elements isn't defined for any reason |
| 2464 |
if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { |
| 2465 |
return document.documentElement; |
| 2466 |
} |
| 2467 |
|
| 2468 |
// Here we make sure to give as "start" the element that comes first in the DOM |
| 2469 |
var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; |
| 2470 |
var start = order ? element1 : element2; |
| 2471 |
var end = order ? element2 : element1; |
| 2472 |
|
| 2473 |
// Get common ancestor container |
| 2474 |
var range = document.createRange(); |
| 2475 |
range.setStart(start, 0); |
| 2476 |
range.setEnd(end, 0); |
| 2477 |
var commonAncestorContainer = range.commonAncestorContainer; |
| 2478 |
|
| 2479 |
// Both nodes are inside #document |
| 2480 |
|
| 2481 |
if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { |
| 2482 |
if (isOffsetContainer(commonAncestorContainer)) { |
| 2483 |
return commonAncestorContainer; |
| 2484 |
} |
| 2485 |
|
| 2486 |
return getOffsetParent(commonAncestorContainer); |
| 2487 |
} |
| 2488 |
|
| 2489 |
// one of the nodes is inside shadowDOM, find which one |
| 2490 |
var element1root = getRoot(element1); |
| 2491 |
if (element1root.host) { |
| 2492 |
return findCommonOffsetParent(element1root.host, element2); |
| 2493 |
} else { |
| 2494 |
return findCommonOffsetParent(element1, getRoot(element2).host); |
| 2495 |
} |
| 2496 |
} |
| 2497 |
|
| 2498 |
/** |
| 2499 |
* Gets the scroll value of the given element in the given side (top and left) |
| 2500 |
* @method |
| 2501 |
* @memberof Popper.Utils |
| 2502 |
* @argument {Element} element |
| 2503 |
* @argument {String} side `top` or `left` |
| 2504 |
* @returns {number} amount of scrolled pixels |
| 2505 |
*/ |
| 2506 |
function getScroll(element) { |
| 2507 |
var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; |
| 2508 |
|
| 2509 |
var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; |
| 2510 |
var nodeName = element.nodeName; |
| 2511 |
|
| 2512 |
if (nodeName === 'BODY' || nodeName === 'HTML') { |
| 2513 |
var html = element.ownerDocument.documentElement; |
| 2514 |
var scrollingElement = element.ownerDocument.scrollingElement || html; |
| 2515 |
return scrollingElement[upperSide]; |
| 2516 |
} |
| 2517 |
|
| 2518 |
return element[upperSide]; |
| 2519 |
} |
| 2520 |
|
| 2521 |
/* |
| 2522 |
* Sum or subtract the element scroll values (left and top) from a given rect object |
| 2523 |
* @method |
| 2524 |
* @memberof Popper.Utils |
| 2525 |
* @param {Object} rect - Rect object you want to change |
| 2526 |
* @param {HTMLElement} element - The element from the function reads the scroll values |
| 2527 |
* @param {Boolean} subtract - set to true if you want to subtract the scroll values |
| 2528 |
* @return {Object} rect - The modifier rect object |
| 2529 |
*/ |
| 2530 |
function includeScroll(rect, element) { |
| 2531 |
var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; |
| 2532 |
|
| 2533 |
var scrollTop = getScroll(element, 'top'); |
| 2534 |
var scrollLeft = getScroll(element, 'left'); |
| 2535 |
var modifier = subtract ? -1 : 1; |
| 2536 |
rect.top += scrollTop * modifier; |
| 2537 |
rect.bottom += scrollTop * modifier; |
| 2538 |
rect.left += scrollLeft * modifier; |
| 2539 |
rect.right += scrollLeft * modifier; |
| 2540 |
return rect; |
| 2541 |
} |
| 2542 |
|
| 2543 |
/* |
| 2544 |
* Helper to detect borders of a given element |
| 2545 |
* @method |
| 2546 |
* @memberof Popper.Utils |
| 2547 |
* @param {CSSStyleDeclaration} styles |
| 2548 |
* Result of `getStyleComputedProperty` on the given element |
| 2549 |
* @param {String} axis - `x` or `y` |
| 2550 |
* @return {number} borders - The borders size of the given axis |
| 2551 |
*/ |
| 2552 |
|
| 2553 |
function getBordersSize(styles, axis) { |
| 2554 |
var sideA = axis === 'x' ? 'Left' : 'Top'; |
| 2555 |
var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; |
| 2556 |
|
| 2557 |
return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); |
| 2558 |
} |
| 2559 |
|
| 2560 |
function getSize(axis, body, html, computedStyle) { |
| 2561 |
return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE$1(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0); |
| 2562 |
} |
| 2563 |
|
| 2564 |
function getWindowSizes(document) { |
| 2565 |
var body = document.body; |
| 2566 |
var html = document.documentElement; |
| 2567 |
var computedStyle = isIE$1(10) && getComputedStyle(html); |
| 2568 |
|
| 2569 |
return { |
| 2570 |
height: getSize('Height', body, html, computedStyle), |
| 2571 |
width: getSize('Width', body, html, computedStyle) |
| 2572 |
}; |
| 2573 |
} |
| 2574 |
|
| 2575 |
var classCallCheck = function (instance, Constructor) { |
| 2576 |
if (!(instance instanceof Constructor)) { |
| 2577 |
throw new TypeError("Cannot call a class as a function"); |
| 2578 |
} |
| 2579 |
}; |
| 2580 |
|
| 2581 |
var createClass = function () { |
| 2582 |
function defineProperties(target, props) { |
| 2583 |
for (var i = 0; i < props.length; i++) { |
| 2584 |
var descriptor = props[i]; |
| 2585 |
descriptor.enumerable = descriptor.enumerable || false; |
| 2586 |
descriptor.configurable = true; |
| 2587 |
if ("value" in descriptor) descriptor.writable = true; |
| 2588 |
Object.defineProperty(target, descriptor.key, descriptor); |
| 2589 |
} |
| 2590 |
} |
| 2591 |
|
| 2592 |
return function (Constructor, protoProps, staticProps) { |
| 2593 |
if (protoProps) defineProperties(Constructor.prototype, protoProps); |
| 2594 |
if (staticProps) defineProperties(Constructor, staticProps); |
| 2595 |
return Constructor; |
| 2596 |
}; |
| 2597 |
}(); |
| 2598 |
|
| 2599 |
|
| 2600 |
|
| 2601 |
|
| 2602 |
|
| 2603 |
var defineProperty$1 = function (obj, key, value) { |
| 2604 |
if (key in obj) { |
| 2605 |
Object.defineProperty(obj, key, { |
| 2606 |
value: value, |
| 2607 |
enumerable: true, |
| 2608 |
configurable: true, |
| 2609 |
writable: true |
| 2610 |
}); |
| 2611 |
} else { |
| 2612 |
obj[key] = value; |
| 2613 |
} |
| 2614 |
|
| 2615 |
return obj; |
| 2616 |
}; |
| 2617 |
|
| 2618 |
var _extends$2 = Object.assign || function (target) { |
| 2619 |
for (var i = 1; i < arguments.length; i++) { |
| 2620 |
var source = arguments[i]; |
| 2621 |
|
| 2622 |
for (var key in source) { |
| 2623 |
if (Object.prototype.hasOwnProperty.call(source, key)) { |
| 2624 |
target[key] = source[key]; |
| 2625 |
} |
| 2626 |
} |
| 2627 |
} |
| 2628 |
|
| 2629 |
return target; |
| 2630 |
}; |
| 2631 |
|
| 2632 |
/** |
| 2633 |
* Given element offsets, generate an output similar to getBoundingClientRect |
| 2634 |
* @method |
| 2635 |
* @memberof Popper.Utils |
| 2636 |
* @argument {Object} offsets |
| 2637 |
* @returns {Object} ClientRect like output |
| 2638 |
*/ |
| 2639 |
function getClientRect(offsets) { |
| 2640 |
return _extends$2({}, offsets, { |
| 2641 |
right: offsets.left + offsets.width, |
| 2642 |
bottom: offsets.top + offsets.height |
| 2643 |
}); |
| 2644 |
} |
| 2645 |
|
| 2646 |
/** |
| 2647 |
* Get bounding client rect of given element |
| 2648 |
* @method |
| 2649 |
* @memberof Popper.Utils |
| 2650 |
* @param {HTMLElement} element |
| 2651 |
* @return {Object} client rect |
| 2652 |
*/ |
| 2653 |
function getBoundingClientRect(element) { |
| 2654 |
var rect = {}; |
| 2655 |
|
| 2656 |
// IE10 10 FIX: Please, don't ask, the element isn't |
| 2657 |
// considered in DOM in some circumstances... |
| 2658 |
// This isn't reproducible in IE10 compatibility mode of IE11 |
| 2659 |
try { |
| 2660 |
if (isIE$1(10)) { |
| 2661 |
rect = element.getBoundingClientRect(); |
| 2662 |
var scrollTop = getScroll(element, 'top'); |
| 2663 |
var scrollLeft = getScroll(element, 'left'); |
| 2664 |
rect.top += scrollTop; |
| 2665 |
rect.left += scrollLeft; |
| 2666 |
rect.bottom += scrollTop; |
| 2667 |
rect.right += scrollLeft; |
| 2668 |
} else { |
| 2669 |
rect = element.getBoundingClientRect(); |
| 2670 |
} |
| 2671 |
} catch (e) {} |
| 2672 |
|
| 2673 |
var result = { |
| 2674 |
left: rect.left, |
| 2675 |
top: rect.top, |
| 2676 |
width: rect.right - rect.left, |
| 2677 |
height: rect.bottom - rect.top |
| 2678 |
}; |
| 2679 |
|
| 2680 |
// subtract scrollbar size from sizes |
| 2681 |
var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {}; |
| 2682 |
var width = sizes.width || element.clientWidth || result.right - result.left; |
| 2683 |
var height = sizes.height || element.clientHeight || result.bottom - result.top; |
| 2684 |
|
| 2685 |
var horizScrollbar = element.offsetWidth - width; |
| 2686 |
var vertScrollbar = element.offsetHeight - height; |
| 2687 |
|
| 2688 |
// if an hypothetical scrollbar is detected, we must be sure it's not a `border` |
| 2689 |
// we make this check conditional for performance reasons |
| 2690 |
if (horizScrollbar || vertScrollbar) { |
| 2691 |
var styles = getStyleComputedProperty(element); |
| 2692 |
horizScrollbar -= getBordersSize(styles, 'x'); |
| 2693 |
vertScrollbar -= getBordersSize(styles, 'y'); |
| 2694 |
|
| 2695 |
result.width -= horizScrollbar; |
| 2696 |
result.height -= vertScrollbar; |
| 2697 |
} |
| 2698 |
|
| 2699 |
return getClientRect(result); |
| 2700 |
} |
| 2701 |
|
| 2702 |
function getOffsetRectRelativeToArbitraryNode(children, parent) { |
| 2703 |
var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; |
| 2704 |
|
| 2705 |
var isIE10 = isIE$1(10); |
| 2706 |
var isHTML = parent.nodeName === 'HTML'; |
| 2707 |
var childrenRect = getBoundingClientRect(children); |
| 2708 |
var parentRect = getBoundingClientRect(parent); |
| 2709 |
var scrollParent = getScrollParent(children); |
| 2710 |
|
| 2711 |
var styles = getStyleComputedProperty(parent); |
| 2712 |
var borderTopWidth = parseFloat(styles.borderTopWidth, 10); |
| 2713 |
var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); |
| 2714 |
|
| 2715 |
// In cases where the parent is fixed, we must ignore negative scroll in offset calc |
| 2716 |
if (fixedPosition && isHTML) { |
| 2717 |
parentRect.top = Math.max(parentRect.top, 0); |
| 2718 |
parentRect.left = Math.max(parentRect.left, 0); |
| 2719 |
} |
| 2720 |
var offsets = getClientRect({ |
| 2721 |
top: childrenRect.top - parentRect.top - borderTopWidth, |
| 2722 |
left: childrenRect.left - parentRect.left - borderLeftWidth, |
| 2723 |
width: childrenRect.width, |
| 2724 |
height: childrenRect.height |
| 2725 |
}); |
| 2726 |
offsets.marginTop = 0; |
| 2727 |
offsets.marginLeft = 0; |
| 2728 |
|
| 2729 |
// Subtract margins of documentElement in case it's being used as parent |
| 2730 |
// we do this only on HTML because it's the only element that behaves |
| 2731 |
// differently when margins are applied to it. The margins are included in |
| 2732 |
// the box of the documentElement, in the other cases not. |
| 2733 |
if (!isIE10 && isHTML) { |
| 2734 |
var marginTop = parseFloat(styles.marginTop, 10); |
| 2735 |
var marginLeft = parseFloat(styles.marginLeft, 10); |
| 2736 |
|
| 2737 |
offsets.top -= borderTopWidth - marginTop; |
| 2738 |
offsets.bottom -= borderTopWidth - marginTop; |
| 2739 |
offsets.left -= borderLeftWidth - marginLeft; |
| 2740 |
offsets.right -= borderLeftWidth - marginLeft; |
| 2741 |
|
| 2742 |
// Attach marginTop and marginLeft because in some circumstances we may need them |
| 2743 |
offsets.marginTop = marginTop; |
| 2744 |
offsets.marginLeft = marginLeft; |
| 2745 |
} |
| 2746 |
|
| 2747 |
if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { |
| 2748 |
offsets = includeScroll(offsets, parent); |
| 2749 |
} |
| 2750 |
|
| 2751 |
return offsets; |
| 2752 |
} |
| 2753 |
|
| 2754 |
function getViewportOffsetRectRelativeToArtbitraryNode(element) { |
| 2755 |
var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; |
| 2756 |
|
| 2757 |
var html = element.ownerDocument.documentElement; |
| 2758 |
var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); |
| 2759 |
var width = Math.max(html.clientWidth, window.innerWidth || 0); |
| 2760 |
var height = Math.max(html.clientHeight, window.innerHeight || 0); |
| 2761 |
|
| 2762 |
var scrollTop = !excludeScroll ? getScroll(html) : 0; |
| 2763 |
var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; |
| 2764 |
|
| 2765 |
var offset = { |
| 2766 |
top: scrollTop - relativeOffset.top + relativeOffset.marginTop, |
| 2767 |
left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, |
| 2768 |
width: width, |
| 2769 |
height: height |
| 2770 |
}; |
| 2771 |
|
| 2772 |
return getClientRect(offset); |
| 2773 |
} |
| 2774 |
|
| 2775 |
/** |
| 2776 |
* Check if the given element is fixed or is inside a fixed parent |
| 2777 |
* @method |
| 2778 |
* @memberof Popper.Utils |
| 2779 |
* @argument {Element} element |
| 2780 |
* @argument {Element} customContainer |
| 2781 |
* @returns {Boolean} answer to "isFixed?" |
| 2782 |
*/ |
| 2783 |
function isFixed(element) { |
| 2784 |
var nodeName = element.nodeName; |
| 2785 |
if (nodeName === 'BODY' || nodeName === 'HTML') { |
| 2786 |
return false; |
| 2787 |
} |
| 2788 |
if (getStyleComputedProperty(element, 'position') === 'fixed') { |
| 2789 |
return true; |
| 2790 |
} |
| 2791 |
var parentNode = getParentNode(element); |
| 2792 |
if (!parentNode) { |
| 2793 |
return false; |
| 2794 |
} |
| 2795 |
return isFixed(parentNode); |
| 2796 |
} |
| 2797 |
|
| 2798 |
/** |
| 2799 |
* Finds the first parent of an element that has a transformed property defined |
| 2800 |
* @method |
| 2801 |
* @memberof Popper.Utils |
| 2802 |
* @argument {Element} element |
| 2803 |
* @returns {Element} first transformed parent or documentElement |
| 2804 |
*/ |
| 2805 |
|
| 2806 |
function getFixedPositionOffsetParent(element) { |
| 2807 |
// This check is needed to avoid errors in case one of the elements isn't defined for any reason |
| 2808 |
if (!element || !element.parentElement || isIE$1()) { |
| 2809 |
return document.documentElement; |
| 2810 |
} |
| 2811 |
var el = element.parentElement; |
| 2812 |
while (el && getStyleComputedProperty(el, 'transform') === 'none') { |
| 2813 |
el = el.parentElement; |
| 2814 |
} |
| 2815 |
return el || document.documentElement; |
| 2816 |
} |
| 2817 |
|
| 2818 |
/** |
| 2819 |
* Computed the boundaries limits and return them |
| 2820 |
* @method |
| 2821 |
* @memberof Popper.Utils |
| 2822 |
* @param {HTMLElement} popper |
| 2823 |
* @param {HTMLElement} reference |
| 2824 |
* @param {number} padding |
| 2825 |
* @param {HTMLElement} boundariesElement - Element used to define the boundaries |
| 2826 |
* @param {Boolean} fixedPosition - Is in fixed position mode |
| 2827 |
* @returns {Object} Coordinates of the boundaries |
| 2828 |
*/ |
| 2829 |
function getBoundaries(popper, reference, padding, boundariesElement) { |
| 2830 |
var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; |
| 2831 |
|
| 2832 |
// NOTE: 1 DOM access here |
| 2833 |
|
| 2834 |
var boundaries = { top: 0, left: 0 }; |
| 2835 |
var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); |
| 2836 |
|
| 2837 |
// Handle viewport case |
| 2838 |
if (boundariesElement === 'viewport') { |
| 2839 |
boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); |
| 2840 |
} else { |
| 2841 |
// Handle other cases based on DOM element used as boundaries |
| 2842 |
var boundariesNode = void 0; |
| 2843 |
if (boundariesElement === 'scrollParent') { |
| 2844 |
boundariesNode = getScrollParent(getParentNode(reference)); |
| 2845 |
if (boundariesNode.nodeName === 'BODY') { |
| 2846 |
boundariesNode = popper.ownerDocument.documentElement; |
| 2847 |
} |
| 2848 |
} else if (boundariesElement === 'window') { |
| 2849 |
boundariesNode = popper.ownerDocument.documentElement; |
| 2850 |
} else { |
| 2851 |
boundariesNode = boundariesElement; |
| 2852 |
} |
| 2853 |
|
| 2854 |
var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); |
| 2855 |
|
| 2856 |
// In case of HTML, we need a different computation |
| 2857 |
if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { |
| 2858 |
var _getWindowSizes = getWindowSizes(popper.ownerDocument), |
| 2859 |
height = _getWindowSizes.height, |
| 2860 |
width = _getWindowSizes.width; |
| 2861 |
|
| 2862 |
boundaries.top += offsets.top - offsets.marginTop; |
| 2863 |
boundaries.bottom = height + offsets.top; |
| 2864 |
boundaries.left += offsets.left - offsets.marginLeft; |
| 2865 |
boundaries.right = width + offsets.left; |
| 2866 |
} else { |
| 2867 |
// for all the other DOM elements, this one is good |
| 2868 |
boundaries = offsets; |
| 2869 |
} |
| 2870 |
} |
| 2871 |
|
| 2872 |
// Add paddings |
| 2873 |
padding = padding || 0; |
| 2874 |
var isPaddingNumber = typeof padding === 'number'; |
| 2875 |
boundaries.left += isPaddingNumber ? padding : padding.left || 0; |
| 2876 |
boundaries.top += isPaddingNumber ? padding : padding.top || 0; |
| 2877 |
boundaries.right -= isPaddingNumber ? padding : padding.right || 0; |
| 2878 |
boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0; |
| 2879 |
|
| 2880 |
return boundaries; |
| 2881 |
} |
| 2882 |
|
| 2883 |
function getArea(_ref) { |
| 2884 |
var width = _ref.width, |
| 2885 |
height = _ref.height; |
| 2886 |
|
| 2887 |
return width * height; |
| 2888 |
} |
| 2889 |
|
| 2890 |
/** |
| 2891 |
* Utility used to transform the `auto` placement to the placement with more |
| 2892 |
* available space. |
| 2893 |
* @method |
| 2894 |
* @memberof Popper.Utils |
| 2895 |
* @argument {Object} data - The data object generated by update method |
| 2896 |
* @argument {Object} options - Modifiers configuration and options |
| 2897 |
* @returns {Object} The data object, properly modified |
| 2898 |
*/ |
| 2899 |
function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { |
| 2900 |
var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; |
| 2901 |
|
| 2902 |
if (placement.indexOf('auto') === -1) { |
| 2903 |
return placement; |
| 2904 |
} |
| 2905 |
|
| 2906 |
var boundaries = getBoundaries(popper, reference, padding, boundariesElement); |
| 2907 |
|
| 2908 |
var rects = { |
| 2909 |
top: { |
| 2910 |
width: boundaries.width, |
| 2911 |
height: refRect.top - boundaries.top |
| 2912 |
}, |
| 2913 |
right: { |
| 2914 |
width: boundaries.right - refRect.right, |
| 2915 |
height: boundaries.height |
| 2916 |
}, |
| 2917 |
bottom: { |
| 2918 |
width: boundaries.width, |
| 2919 |
height: boundaries.bottom - refRect.bottom |
| 2920 |
}, |
| 2921 |
left: { |
| 2922 |
width: refRect.left - boundaries.left, |
| 2923 |
height: boundaries.height |
| 2924 |
} |
| 2925 |
}; |
| 2926 |
|
| 2927 |
var sortedAreas = Object.keys(rects).map(function (key) { |
| 2928 |
return _extends$2({ |
| 2929 |
key: key |
| 2930 |
}, rects[key], { |
| 2931 |
area: getArea(rects[key]) |
| 2932 |
}); |
| 2933 |
}).sort(function (a, b) { |
| 2934 |
return b.area - a.area; |
| 2935 |
}); |
| 2936 |
|
| 2937 |
var filteredAreas = sortedAreas.filter(function (_ref2) { |
| 2938 |
var width = _ref2.width, |
| 2939 |
height = _ref2.height; |
| 2940 |
return width >= popper.clientWidth && height >= popper.clientHeight; |
| 2941 |
}); |
| 2942 |
|
| 2943 |
var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; |
| 2944 |
|
| 2945 |
var variation = placement.split('-')[1]; |
| 2946 |
|
| 2947 |
return computedPlacement + (variation ? '-' + variation : ''); |
| 2948 |
} |
| 2949 |
|
| 2950 |
/** |
| 2951 |
* Get offsets to the reference element |
| 2952 |
* @method |
| 2953 |
* @memberof Popper.Utils |
| 2954 |
* @param {Object} state |
| 2955 |
* @param {Element} popper - the popper element |
| 2956 |
* @param {Element} reference - the reference element (the popper will be relative to this) |
| 2957 |
* @param {Element} fixedPosition - is in fixed position mode |
| 2958 |
* @returns {Object} An object containing the offsets which will be applied to the popper |
| 2959 |
*/ |
| 2960 |
function getReferenceOffsets(state, popper, reference) { |
| 2961 |
var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; |
| 2962 |
|
| 2963 |
var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); |
| 2964 |
return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); |
| 2965 |
} |
| 2966 |
|
| 2967 |
/** |
| 2968 |
* Get the outer sizes of the given element (offset size + margins) |
| 2969 |
* @method |
| 2970 |
* @memberof Popper.Utils |
| 2971 |
* @argument {Element} element |
| 2972 |
* @returns {Object} object containing width and height properties |
| 2973 |
*/ |
| 2974 |
function getOuterSizes(element) { |
| 2975 |
var window = element.ownerDocument.defaultView; |
| 2976 |
var styles = window.getComputedStyle(element); |
| 2977 |
var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0); |
| 2978 |
var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0); |
| 2979 |
var result = { |
| 2980 |
width: element.offsetWidth + y, |
| 2981 |
height: element.offsetHeight + x |
| 2982 |
}; |
| 2983 |
return result; |
| 2984 |
} |
| 2985 |
|
| 2986 |
/** |
| 2987 |
* Get the opposite placement of the given one |
| 2988 |
* @method |
| 2989 |
* @memberof Popper.Utils |
| 2990 |
* @argument {String} placement |
| 2991 |
* @returns {String} flipped placement |
| 2992 |
*/ |
| 2993 |
function getOppositePlacement(placement) { |
| 2994 |
var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; |
| 2995 |
return placement.replace(/left|right|bottom|top/g, function (matched) { |
| 2996 |
return hash[matched]; |
| 2997 |
}); |
| 2998 |
} |
| 2999 |
|
| 3000 |
/** |
| 3001 |
* Get offsets to the popper |
| 3002 |
* @method |
| 3003 |
* @memberof Popper.Utils |
| 3004 |
* @param {Object} position - CSS position the Popper will get applied |
| 3005 |
* @param {HTMLElement} popper - the popper element |
| 3006 |
* @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) |
| 3007 |
* @param {String} placement - one of the valid placement options |
| 3008 |
* @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper |
| 3009 |
*/ |
| 3010 |
function getPopperOffsets(popper, referenceOffsets, placement) { |
| 3011 |
placement = placement.split('-')[0]; |
| 3012 |
|
| 3013 |
// Get popper node sizes |
| 3014 |
var popperRect = getOuterSizes(popper); |
| 3015 |
|
| 3016 |
// Add position, width and height to our offsets object |
| 3017 |
var popperOffsets = { |
| 3018 |
width: popperRect.width, |
| 3019 |
height: popperRect.height |
| 3020 |
}; |
| 3021 |
|
| 3022 |
// depending by the popper placement we have to compute its offsets slightly differently |
| 3023 |
var isHoriz = ['right', 'left'].indexOf(placement) !== -1; |
| 3024 |
var mainSide = isHoriz ? 'top' : 'left'; |
| 3025 |
var secondarySide = isHoriz ? 'left' : 'top'; |
| 3026 |
var measurement = isHoriz ? 'height' : 'width'; |
| 3027 |
var secondaryMeasurement = !isHoriz ? 'height' : 'width'; |
| 3028 |
|
| 3029 |
popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; |
| 3030 |
if (placement === secondarySide) { |
| 3031 |
popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; |
| 3032 |
} else { |
| 3033 |
popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; |
| 3034 |
} |
| 3035 |
|
| 3036 |
return popperOffsets; |
| 3037 |
} |
| 3038 |
|
| 3039 |
/** |
| 3040 |
* Mimics the `find` method of Array |
| 3041 |
* @method |
| 3042 |
* @memberof Popper.Utils |
| 3043 |
* @argument {Array} arr |
| 3044 |
* @argument prop |
| 3045 |
* @argument value |
| 3046 |
* @returns index or -1 |
| 3047 |
*/ |
| 3048 |
function find(arr, check) { |
| 3049 |
// use native find if supported |
| 3050 |
if (Array.prototype.find) { |
| 3051 |
return arr.find(check); |
| 3052 |
} |
| 3053 |
|
| 3054 |
// use `filter` to obtain the same behavior of `find` |
| 3055 |
return arr.filter(check)[0]; |
| 3056 |
} |
| 3057 |
|
| 3058 |
/** |
| 3059 |
* Return the index of the matching object |
| 3060 |
* @method |
| 3061 |
* @memberof Popper.Utils |
| 3062 |
* @argument {Array} arr |
| 3063 |
* @argument prop |
| 3064 |
* @argument value |
| 3065 |
* @returns index or -1 |
| 3066 |
*/ |
| 3067 |
function findIndex(arr, prop, value) { |
| 3068 |
// use native findIndex if supported |
| 3069 |
if (Array.prototype.findIndex) { |
| 3070 |
return arr.findIndex(function (cur) { |
| 3071 |
return cur[prop] === value; |
| 3072 |
}); |
| 3073 |
} |
| 3074 |
|
| 3075 |
// use `find` + `indexOf` if `findIndex` isn't supported |
| 3076 |
var match = find(arr, function (obj) { |
| 3077 |
return obj[prop] === value; |
| 3078 |
}); |
| 3079 |
return arr.indexOf(match); |
| 3080 |
} |
| 3081 |
|
| 3082 |
/** |
| 3083 |
* Loop trough the list of modifiers and run them in order, |
| 3084 |
* each of them will then edit the data object. |
| 3085 |
* @method |
| 3086 |
* @memberof Popper.Utils |
| 3087 |
* @param {dataObject} data |
| 3088 |
* @param {Array} modifiers |
| 3089 |
* @param {String} ends - Optional modifier name used as stopper |
| 3090 |
* @returns {dataObject} |
| 3091 |
*/ |
| 3092 |
function runModifiers(modifiers, data, ends) { |
| 3093 |
var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); |
| 3094 |
|
| 3095 |
modifiersToRun.forEach(function (modifier) { |
| 3096 |
if (modifier['function']) { |
| 3097 |
// eslint-disable-line dot-notation |
| 3098 |
console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); |
| 3099 |
} |
| 3100 |
var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation |
| 3101 |
if (modifier.enabled && isFunction$1(fn)) { |
| 3102 |
// Add properties to offsets to make them a complete clientRect object |
| 3103 |
// we do this before each modifier to make sure the previous one doesn't |
| 3104 |
// mess with these values |
| 3105 |
data.offsets.popper = getClientRect(data.offsets.popper); |
| 3106 |
data.offsets.reference = getClientRect(data.offsets.reference); |
| 3107 |
|
| 3108 |
data = fn(data, modifier); |
| 3109 |
} |
| 3110 |
}); |
| 3111 |
|
| 3112 |
return data; |
| 3113 |
} |
| 3114 |
|
| 3115 |
/** |
| 3116 |
* Updates the position of the popper, computing the new offsets and applying |
| 3117 |
* the new style.<br /> |
| 3118 |
* Prefer `scheduleUpdate` over `update` because of performance reasons. |
| 3119 |
* @method |
| 3120 |
* @memberof Popper |
| 3121 |
*/ |
| 3122 |
function update() { |
| 3123 |
// if popper is destroyed, don't perform any further update |
| 3124 |
if (this.state.isDestroyed) { |
| 3125 |
return; |
| 3126 |
} |
| 3127 |
|
| 3128 |
var data = { |
| 3129 |
instance: this, |
| 3130 |
styles: {}, |
| 3131 |
arrowStyles: {}, |
| 3132 |
attributes: {}, |
| 3133 |
flipped: false, |
| 3134 |
offsets: {} |
| 3135 |
}; |
| 3136 |
|
| 3137 |
// compute reference element offsets |
| 3138 |
data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); |
| 3139 |
|
| 3140 |
// compute auto placement, store placement inside the data object, |
| 3141 |
// modifiers will be able to edit `placement` if needed |
| 3142 |
// and refer to originalPlacement to know the original value |
| 3143 |
data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); |
| 3144 |
|
| 3145 |
// store the computed placement inside `originalPlacement` |
| 3146 |
data.originalPlacement = data.placement; |
| 3147 |
|
| 3148 |
data.positionFixed = this.options.positionFixed; |
| 3149 |
|
| 3150 |
// compute the popper offsets |
| 3151 |
data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); |
| 3152 |
|
| 3153 |
data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; |
| 3154 |
|
| 3155 |
// run the modifiers |
| 3156 |
data = runModifiers(this.modifiers, data); |
| 3157 |
|
| 3158 |
// the first `update` will call `onCreate` callback |
| 3159 |
// the other ones will call `onUpdate` callback |
| 3160 |
if (!this.state.isCreated) { |
| 3161 |
this.state.isCreated = true; |
| 3162 |
this.options.onCreate(data); |
| 3163 |
} else { |
| 3164 |
this.options.onUpdate(data); |
| 3165 |
} |
| 3166 |
} |
| 3167 |
|
| 3168 |
/** |
| 3169 |
* Helper used to know if the given modifier is enabled. |
| 3170 |
* @method |
| 3171 |
* @memberof Popper.Utils |
| 3172 |
* @returns {Boolean} |
| 3173 |
*/ |
| 3174 |
function isModifierEnabled(modifiers, modifierName) { |
| 3175 |
return modifiers.some(function (_ref) { |
| 3176 |
var name = _ref.name, |
| 3177 |
enabled = _ref.enabled; |
| 3178 |
return enabled && name === modifierName; |
| 3179 |
}); |
| 3180 |
} |
| 3181 |
|
| 3182 |
/** |
| 3183 |
* Get the prefixed supported property name |
| 3184 |
* @method |
| 3185 |
* @memberof Popper.Utils |
| 3186 |
* @argument {String} property (camelCase) |
| 3187 |
* @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) |
| 3188 |
*/ |
| 3189 |
function getSupportedPropertyName(property) { |
| 3190 |
var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; |
| 3191 |
var upperProp = property.charAt(0).toUpperCase() + property.slice(1); |
| 3192 |
|
| 3193 |
for (var i = 0; i < prefixes.length; i++) { |
| 3194 |
var prefix = prefixes[i]; |
| 3195 |
var toCheck = prefix ? '' + prefix + upperProp : property; |
| 3196 |
if (typeof document.body.style[toCheck] !== 'undefined') { |
| 3197 |
return toCheck; |
| 3198 |
} |
| 3199 |
} |
| 3200 |
return null; |
| 3201 |
} |
| 3202 |
|
| 3203 |
/** |
| 3204 |
* Destroys the popper. |
| 3205 |
* @method |
| 3206 |
* @memberof Popper |
| 3207 |
*/ |
| 3208 |
function destroy() { |
| 3209 |
this.state.isDestroyed = true; |
| 3210 |
|
| 3211 |
// touch DOM only if `applyStyle` modifier is enabled |
| 3212 |
if (isModifierEnabled(this.modifiers, 'applyStyle')) { |
| 3213 |
this.popper.removeAttribute('x-placement'); |
| 3214 |
this.popper.style.position = ''; |
| 3215 |
this.popper.style.top = ''; |
| 3216 |
this.popper.style.left = ''; |
| 3217 |
this.popper.style.right = ''; |
| 3218 |
this.popper.style.bottom = ''; |
| 3219 |
this.popper.style.willChange = ''; |
| 3220 |
this.popper.style[getSupportedPropertyName('transform')] = ''; |
| 3221 |
} |
| 3222 |
|
| 3223 |
this.disableEventListeners(); |
| 3224 |
|
| 3225 |
// remove the popper if user explicity asked for the deletion on destroy |
| 3226 |
// do not use `remove` because IE11 doesn't support it |
| 3227 |
if (this.options.removeOnDestroy) { |
| 3228 |
this.popper.parentNode.removeChild(this.popper); |
| 3229 |
} |
| 3230 |
return this; |
| 3231 |
} |
| 3232 |
|
| 3233 |
/** |
| 3234 |
* Get the window associated with the element |
| 3235 |
* @argument {Element} element |
| 3236 |
* @returns {Window} |
| 3237 |
*/ |
| 3238 |
function getWindow(element) { |
| 3239 |
var ownerDocument = element.ownerDocument; |
| 3240 |
return ownerDocument ? ownerDocument.defaultView : window; |
| 3241 |
} |
| 3242 |
|
| 3243 |
function attachToScrollParents(scrollParent, event, callback, scrollParents) { |
| 3244 |
var isBody = scrollParent.nodeName === 'BODY'; |
| 3245 |
var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; |
| 3246 |
target.addEventListener(event, callback, { passive: true }); |
| 3247 |
|
| 3248 |
if (!isBody) { |
| 3249 |
attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); |
| 3250 |
} |
| 3251 |
scrollParents.push(target); |
| 3252 |
} |
| 3253 |
|
| 3254 |
/** |
| 3255 |
* Setup needed event listeners used to update the popper position |
| 3256 |
* @method |
| 3257 |
* @memberof Popper.Utils |
| 3258 |
* @private |
| 3259 |
*/ |
| 3260 |
function setupEventListeners(reference, options, state, updateBound) { |
| 3261 |
// Resize event listener on window |
| 3262 |
state.updateBound = updateBound; |
| 3263 |
getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); |
| 3264 |
|
| 3265 |
// Scroll event listener on scroll parents |
| 3266 |
var scrollElement = getScrollParent(reference); |
| 3267 |
attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); |
| 3268 |
state.scrollElement = scrollElement; |
| 3269 |
state.eventsEnabled = true; |
| 3270 |
|
| 3271 |
return state; |
| 3272 |
} |
| 3273 |
|
| 3274 |
/** |
| 3275 |
* It will add resize/scroll events and start recalculating |
| 3276 |
* position of the popper element when they are triggered. |
| 3277 |
* @method |
| 3278 |
* @memberof Popper |
| 3279 |
*/ |
| 3280 |
function enableEventListeners() { |
| 3281 |
if (!this.state.eventsEnabled) { |
| 3282 |
this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); |
| 3283 |
} |
| 3284 |
} |
| 3285 |
|
| 3286 |
/** |
| 3287 |
* Remove event listeners used to update the popper position |
| 3288 |
* @method |
| 3289 |
* @memberof Popper.Utils |
| 3290 |
* @private |
| 3291 |
*/ |
| 3292 |
function removeEventListeners(reference, state) { |
| 3293 |
// Remove resize event listener on window |
| 3294 |
getWindow(reference).removeEventListener('resize', state.updateBound); |
| 3295 |
|
| 3296 |
// Remove scroll event listener on scroll parents |
| 3297 |
state.scrollParents.forEach(function (target) { |
| 3298 |
target.removeEventListener('scroll', state.updateBound); |
| 3299 |
}); |
| 3300 |
|
| 3301 |
// Reset state |
| 3302 |
state.updateBound = null; |
| 3303 |
state.scrollParents = []; |
| 3304 |
state.scrollElement = null; |
| 3305 |
state.eventsEnabled = false; |
| 3306 |
return state; |
| 3307 |
} |
| 3308 |
|
| 3309 |
/** |
| 3310 |
* It will remove resize/scroll events and won't recalculate popper position |
| 3311 |
* when they are triggered. It also won't trigger `onUpdate` callback anymore, |
| 3312 |
* unless you call `update` method manually. |
| 3313 |
* @method |
| 3314 |
* @memberof Popper |
| 3315 |
*/ |
| 3316 |
function disableEventListeners() { |
| 3317 |
if (this.state.eventsEnabled) { |
| 3318 |
cancelAnimationFrame(this.scheduleUpdate); |
| 3319 |
this.state = removeEventListeners(this.reference, this.state); |
| 3320 |
} |
| 3321 |
} |
| 3322 |
|
| 3323 |
/** |
| 3324 |
* Tells if a given input is a number |
| 3325 |
* @method |
| 3326 |
* @memberof Popper.Utils |
| 3327 |
* @param {*} input to check |
| 3328 |
* @return {Boolean} |
| 3329 |
*/ |
| 3330 |
function isNumeric(n) { |
| 3331 |
return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); |
| 3332 |
} |
| 3333 |
|
| 3334 |
/** |
| 3335 |
* Set the style to the given popper |
| 3336 |
* @method |
| 3337 |
* @memberof Popper.Utils |
| 3338 |
* @argument {Element} element - Element to apply the style to |
| 3339 |
* @argument {Object} styles |
| 3340 |
* Object with a list of properties and values which will be applied to the element |
| 3341 |
*/ |
| 3342 |
function setStyles(element, styles) { |
| 3343 |
Object.keys(styles).forEach(function (prop) { |
| 3344 |
var unit = ''; |
| 3345 |
// add unit if the value is numeric and is one of the following |
| 3346 |
if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { |
| 3347 |
unit = 'px'; |
| 3348 |
} |
| 3349 |
element.style[prop] = styles[prop] + unit; |
| 3350 |
}); |
| 3351 |
} |
| 3352 |
|
| 3353 |
/** |
| 3354 |
* Set the attributes to the given popper |
| 3355 |
* @method |
| 3356 |
* @memberof Popper.Utils |
| 3357 |
* @argument {Element} element - Element to apply the attributes to |
| 3358 |
* @argument {Object} styles |
| 3359 |
* Object with a list of properties and values which will be applied to the element |
| 3360 |
*/ |
| 3361 |
function setAttributes(element, attributes) { |
| 3362 |
Object.keys(attributes).forEach(function (prop) { |
| 3363 |
var value = attributes[prop]; |
| 3364 |
if (value !== false) { |
| 3365 |
element.setAttribute(prop, attributes[prop]); |
| 3366 |
} else { |
| 3367 |
element.removeAttribute(prop); |
| 3368 |
} |
| 3369 |
}); |
| 3370 |
} |
| 3371 |
|
| 3372 |
/** |
| 3373 |
* @function |
| 3374 |
* @memberof Modifiers |
| 3375 |
* @argument {Object} data - The data object generated by `update` method |
| 3376 |
* @argument {Object} data.styles - List of style properties - values to apply to popper element |
| 3377 |
* @argument {Object} data.attributes - List of attribute properties - values to apply to popper element |
| 3378 |
* @argument {Object} options - Modifiers configuration and options |
| 3379 |
* @returns {Object} The same data object |
| 3380 |
*/ |
| 3381 |
function applyStyle(data) { |
| 3382 |
// any property present in `data.styles` will be applied to the popper, |
| 3383 |
// in this way we can make the 3rd party modifiers add custom styles to it |
| 3384 |
// Be aware, modifiers could override the properties defined in the previous |
| 3385 |
// lines of this modifier! |
| 3386 |
setStyles(data.instance.popper, data.styles); |
| 3387 |
|
| 3388 |
// any property present in `data.attributes` will be applied to the popper, |
| 3389 |
// they will be set as HTML attributes of the element |
| 3390 |
setAttributes(data.instance.popper, data.attributes); |
| 3391 |
|
| 3392 |
// if arrowElement is defined and arrowStyles has some properties |
| 3393 |
if (data.arrowElement && Object.keys(data.arrowStyles).length) { |
| 3394 |
setStyles(data.arrowElement, data.arrowStyles); |
| 3395 |
} |
| 3396 |
|
| 3397 |
return data; |
| 3398 |
} |
| 3399 |
|
| 3400 |
/** |
| 3401 |
* Set the x-placement attribute before everything else because it could be used |
| 3402 |
* to add margins to the popper margins needs to be calculated to get the |
| 3403 |
* correct popper offsets. |
| 3404 |
* @method |
| 3405 |
* @memberof Popper.modifiers |
| 3406 |
* @param {HTMLElement} reference - The reference element used to position the popper |
| 3407 |
* @param {HTMLElement} popper - The HTML element used as popper |
| 3408 |
* @param {Object} options - Popper.js options |
| 3409 |
*/ |
| 3410 |
function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { |
| 3411 |
// compute reference element offsets |
| 3412 |
var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); |
| 3413 |
|
| 3414 |
// compute auto placement, store placement inside the data object, |
| 3415 |
// modifiers will be able to edit `placement` if needed |
| 3416 |
// and refer to originalPlacement to know the original value |
| 3417 |
var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); |
| 3418 |
|
| 3419 |
popper.setAttribute('x-placement', placement); |
| 3420 |
|
| 3421 |
// Apply `position` to popper before anything else because |
| 3422 |
// without the position applied we can't guarantee correct computations |
| 3423 |
setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); |
| 3424 |
|
| 3425 |
return options; |
| 3426 |
} |
| 3427 |
|
| 3428 |
/** |
| 3429 |
* @function |
| 3430 |
* @memberof Popper.Utils |
| 3431 |
* @argument {Object} data - The data object generated by `update` method |
| 3432 |
* @argument {Boolean} shouldRound - If the offsets should be rounded at all |
| 3433 |
* @returns {Object} The popper's position offsets rounded |
| 3434 |
* |
| 3435 |
* The tale of pixel-perfect positioning. It's still not 100% perfect, but as |
| 3436 |
* good as it can be within reason. |
| 3437 |
* Discussion here: https://github.com/FezVrasta/popper.js/pull/715 |
| 3438 |
* |
| 3439 |
* Low DPI screens cause a popper to be blurry if not using full pixels (Safari |
| 3440 |
* as well on High DPI screens). |
| 3441 |
* |
| 3442 |
* Firefox prefers no rounding for positioning and does not have blurriness on |
| 3443 |
* high DPI screens. |
| 3444 |
* |
| 3445 |
* Only horizontal placement and left/right values need to be considered. |
| 3446 |
*/ |
| 3447 |
function getRoundedOffsets(data, shouldRound) { |
| 3448 |
var _data$offsets = data.offsets, |
| 3449 |
popper = _data$offsets.popper, |
| 3450 |
reference = _data$offsets.reference; |
| 3451 |
var round = Math.round, |
| 3452 |
floor = Math.floor; |
| 3453 |
|
| 3454 |
var noRound = function noRound(v) { |
| 3455 |
return v; |
| 3456 |
}; |
| 3457 |
|
| 3458 |
var referenceWidth = round(reference.width); |
| 3459 |
var popperWidth = round(popper.width); |
| 3460 |
|
| 3461 |
var isVertical = ['left', 'right'].indexOf(data.placement) !== -1; |
| 3462 |
var isVariation = data.placement.indexOf('-') !== -1; |
| 3463 |
var sameWidthParity = referenceWidth % 2 === popperWidth % 2; |
| 3464 |
var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1; |
| 3465 |
|
| 3466 |
var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor; |
| 3467 |
var verticalToInteger = !shouldRound ? noRound : round; |
| 3468 |
|
| 3469 |
return { |
| 3470 |
left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left), |
| 3471 |
top: verticalToInteger(popper.top), |
| 3472 |
bottom: verticalToInteger(popper.bottom), |
| 3473 |
right: horizontalToInteger(popper.right) |
| 3474 |
}; |
| 3475 |
} |
| 3476 |
|
| 3477 |
var isFirefox = isBrowser$1 && /Firefox/i.test(navigator.userAgent); |
| 3478 |
|
| 3479 |
/** |
| 3480 |
* @function |
| 3481 |
* @memberof Modifiers |
| 3482 |
* @argument {Object} data - The data object generated by `update` method |
| 3483 |
* @argument {Object} options - Modifiers configuration and options |
| 3484 |
* @returns {Object} The data object, properly modified |
| 3485 |
*/ |
| 3486 |
function computeStyle(data, options) { |
| 3487 |
var x = options.x, |
| 3488 |
y = options.y; |
| 3489 |
var popper = data.offsets.popper; |
| 3490 |
|
| 3491 |
// Remove this legacy support in Popper.js v2 |
| 3492 |
|
| 3493 |
var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { |
| 3494 |
return modifier.name === 'applyStyle'; |
| 3495 |
}).gpuAcceleration; |
| 3496 |
if (legacyGpuAccelerationOption !== undefined) { |
| 3497 |
console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); |
| 3498 |
} |
| 3499 |
var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; |
| 3500 |
|
| 3501 |
var offsetParent = getOffsetParent(data.instance.popper); |
| 3502 |
var offsetParentRect = getBoundingClientRect(offsetParent); |
| 3503 |
|
| 3504 |
// Styles |
| 3505 |
var styles = { |
| 3506 |
position: popper.position |
| 3507 |
}; |
| 3508 |
|
| 3509 |
var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox); |
| 3510 |
|
| 3511 |
var sideA = x === 'bottom' ? 'top' : 'bottom'; |
| 3512 |
var sideB = y === 'right' ? 'left' : 'right'; |
| 3513 |
|
| 3514 |
// if gpuAcceleration is set to `true` and transform is supported, |
| 3515 |
// we use `translate3d` to apply the position to the popper we |
| 3516 |
// automatically use the supported prefixed version if needed |
| 3517 |
var prefixedProperty = getSupportedPropertyName('transform'); |
| 3518 |
|
| 3519 |
// now, let's make a step back and look at this code closely (wtf?) |
| 3520 |
// If the content of the popper grows once it's been positioned, it |
| 3521 |
// may happen that the popper gets misplaced because of the new content |
| 3522 |
// overflowing its reference element |
| 3523 |
// To avoid this problem, we provide two options (x and y), which allow |
| 3524 |
// the consumer to define the offset origin. |
| 3525 |
// If we position a popper on top of a reference element, we can set |
| 3526 |
// `x` to `top` to make the popper grow towards its top instead of |
| 3527 |
// its bottom. |
| 3528 |
var left = void 0, |
| 3529 |
top = void 0; |
| 3530 |
if (sideA === 'bottom') { |
| 3531 |
// when offsetParent is <html> the positioning is relative to the bottom of the screen (excluding the scrollbar) |
| 3532 |
// and not the bottom of the html element |
| 3533 |
if (offsetParent.nodeName === 'HTML') { |
| 3534 |
top = -offsetParent.clientHeight + offsets.bottom; |
| 3535 |
} else { |
| 3536 |
top = -offsetParentRect.height + offsets.bottom; |
| 3537 |
} |
| 3538 |
} else { |
| 3539 |
top = offsets.top; |
| 3540 |
} |
| 3541 |
if (sideB === 'right') { |
| 3542 |
if (offsetParent.nodeName === 'HTML') { |
| 3543 |
left = -offsetParent.clientWidth + offsets.right; |
| 3544 |
} else { |
| 3545 |
left = -offsetParentRect.width + offsets.right; |
| 3546 |
} |
| 3547 |
} else { |
| 3548 |
left = offsets.left; |
| 3549 |
} |
| 3550 |
if (gpuAcceleration && prefixedProperty) { |
| 3551 |
styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; |
| 3552 |
styles[sideA] = 0; |
| 3553 |
styles[sideB] = 0; |
| 3554 |
styles.willChange = 'transform'; |
| 3555 |
} else { |
| 3556 |
// othwerise, we use the standard `top`, `left`, `bottom` and `right` properties |
| 3557 |
var invertTop = sideA === 'bottom' ? -1 : 1; |
| 3558 |
var invertLeft = sideB === 'right' ? -1 : 1; |
| 3559 |
styles[sideA] = top * invertTop; |
| 3560 |
styles[sideB] = left * invertLeft; |
| 3561 |
styles.willChange = sideA + ', ' + sideB; |
| 3562 |
} |
| 3563 |
|
| 3564 |
// Attributes |
| 3565 |
var attributes = { |
| 3566 |
'x-placement': data.placement |
| 3567 |
}; |
| 3568 |
|
| 3569 |
// Update `data` attributes, styles and arrowStyles |
| 3570 |
data.attributes = _extends$2({}, attributes, data.attributes); |
| 3571 |
data.styles = _extends$2({}, styles, data.styles); |
| 3572 |
data.arrowStyles = _extends$2({}, data.offsets.arrow, data.arrowStyles); |
| 3573 |
|
| 3574 |
return data; |
| 3575 |
} |
| 3576 |
|
| 3577 |
/** |
| 3578 |
* Helper used to know if the given modifier depends from another one.<br /> |
| 3579 |
* It checks if the needed modifier is listed and enabled. |
| 3580 |
* @method |
| 3581 |
* @memberof Popper.Utils |
| 3582 |
* @param {Array} modifiers - list of modifiers |
| 3583 |
* @param {String} requestingName - name of requesting modifier |
| 3584 |
* @param {String} requestedName - name of requested modifier |
| 3585 |
* @returns {Boolean} |
| 3586 |
*/ |
| 3587 |
function isModifierRequired(modifiers, requestingName, requestedName) { |
| 3588 |
var requesting = find(modifiers, function (_ref) { |
| 3589 |
var name = _ref.name; |
| 3590 |
return name === requestingName; |
| 3591 |
}); |
| 3592 |
|
| 3593 |
var isRequired = !!requesting && modifiers.some(function (modifier) { |
| 3594 |
return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; |
| 3595 |
}); |
| 3596 |
|
| 3597 |
if (!isRequired) { |
| 3598 |
var _requesting = '`' + requestingName + '`'; |
| 3599 |
var requested = '`' + requestedName + '`'; |
| 3600 |
console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); |
| 3601 |
} |
| 3602 |
return isRequired; |
| 3603 |
} |
| 3604 |
|
| 3605 |
/** |
| 3606 |
* @function |
| 3607 |
* @memberof Modifiers |
| 3608 |
* @argument {Object} data - The data object generated by update method |
| 3609 |
* @argument {Object} options - Modifiers configuration and options |
| 3610 |
* @returns {Object} The data object, properly modified |
| 3611 |
*/ |
| 3612 |
function arrow(data, options) { |
| 3613 |
var _data$offsets$arrow; |
| 3614 |
|
| 3615 |
// arrow depends on keepTogether in order to work |
| 3616 |
if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { |
| 3617 |
return data; |
| 3618 |
} |
| 3619 |
|
| 3620 |
var arrowElement = options.element; |
| 3621 |
|
| 3622 |
// if arrowElement is a string, suppose it's a CSS selector |
| 3623 |
if (typeof arrowElement === 'string') { |
| 3624 |
arrowElement = data.instance.popper.querySelector(arrowElement); |
| 3625 |
|
| 3626 |
// if arrowElement is not found, don't run the modifier |
| 3627 |
if (!arrowElement) { |
| 3628 |
return data; |
| 3629 |
} |
| 3630 |
} else { |
| 3631 |
// if the arrowElement isn't a query selector we must check that the |
| 3632 |
// provided DOM node is child of its popper node |
| 3633 |
if (!data.instance.popper.contains(arrowElement)) { |
| 3634 |
console.warn('WARNING: `arrow.element` must be child of its popper element!'); |
| 3635 |
return data; |
| 3636 |
} |
| 3637 |
} |
| 3638 |
|
| 3639 |
var placement = data.placement.split('-')[0]; |
| 3640 |
var _data$offsets = data.offsets, |
| 3641 |
popper = _data$offsets.popper, |
| 3642 |
reference = _data$offsets.reference; |
| 3643 |
|
| 3644 |
var isVertical = ['left', 'right'].indexOf(placement) !== -1; |
| 3645 |
|
| 3646 |
var len = isVertical ? 'height' : 'width'; |
| 3647 |
var sideCapitalized = isVertical ? 'Top' : 'Left'; |
| 3648 |
var side = sideCapitalized.toLowerCase(); |
| 3649 |
var altSide = isVertical ? 'left' : 'top'; |
| 3650 |
var opSide = isVertical ? 'bottom' : 'right'; |
| 3651 |
var arrowElementSize = getOuterSizes(arrowElement)[len]; |
| 3652 |
|
| 3653 |
// |
| 3654 |
// extends keepTogether behavior making sure the popper and its |
| 3655 |
// reference have enough pixels in conjunction |
| 3656 |
// |
| 3657 |
|
| 3658 |
// top/left side |
| 3659 |
if (reference[opSide] - arrowElementSize < popper[side]) { |
| 3660 |
data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); |
| 3661 |
} |
| 3662 |
// bottom/right side |
| 3663 |
if (reference[side] + arrowElementSize > popper[opSide]) { |
| 3664 |
data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; |
| 3665 |
} |
| 3666 |
data.offsets.popper = getClientRect(data.offsets.popper); |
| 3667 |
|
| 3668 |
// compute center of the popper |
| 3669 |
var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; |
| 3670 |
|
| 3671 |
// Compute the sideValue using the updated popper offsets |
| 3672 |
// take popper margin in account because we don't have this info available |
| 3673 |
var css = getStyleComputedProperty(data.instance.popper); |
| 3674 |
var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); |
| 3675 |
var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); |
| 3676 |
var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; |
| 3677 |
|
| 3678 |
// prevent arrowElement from being placed not contiguously to its popper |
| 3679 |
sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); |
| 3680 |
|
| 3681 |
data.arrowElement = arrowElement; |
| 3682 |
data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty$1(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty$1(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); |
| 3683 |
|
| 3684 |
return data; |
| 3685 |
} |
| 3686 |
|
| 3687 |
/** |
| 3688 |
* Get the opposite placement variation of the given one |
| 3689 |
* @method |
| 3690 |
* @memberof Popper.Utils |
| 3691 |
* @argument {String} placement variation |
| 3692 |
* @returns {String} flipped placement variation |
| 3693 |
*/ |
| 3694 |
function getOppositeVariation(variation) { |
| 3695 |
if (variation === 'end') { |
| 3696 |
return 'start'; |
| 3697 |
} else if (variation === 'start') { |
| 3698 |
return 'end'; |
| 3699 |
} |
| 3700 |
return variation; |
| 3701 |
} |
| 3702 |
|
| 3703 |
/** |
| 3704 |
* List of accepted placements to use as values of the `placement` option.<br /> |
| 3705 |
* Valid placements are: |
| 3706 |
* - `auto` |
| 3707 |
* - `top` |
| 3708 |
* - `right` |
| 3709 |
* - `bottom` |
| 3710 |
* - `left` |
| 3711 |
* |
| 3712 |
* Each placement can have a variation from this list: |
| 3713 |
* - `-start` |
| 3714 |
* - `-end` |
| 3715 |
* |
| 3716 |
* Variations are interpreted easily if you think of them as the left to right |
| 3717 |
* written languages. Horizontally (`top` and `bottom`), `start` is left and `end` |
| 3718 |
* is right.<br /> |
| 3719 |
* Vertically (`left` and `right`), `start` is top and `end` is bottom. |
| 3720 |
* |
| 3721 |
* Some valid examples are: |
| 3722 |
* - `top-end` (on top of reference, right aligned) |
| 3723 |
* - `right-start` (on right of reference, top aligned) |
| 3724 |
* - `bottom` (on bottom, centered) |
| 3725 |
* - `auto-end` (on the side with more space available, alignment depends by placement) |
| 3726 |
* |
| 3727 |
* @static |
| 3728 |
* @type {Array} |
| 3729 |
* @enum {String} |
| 3730 |
* @readonly |
| 3731 |
* @method placements |
| 3732 |
* @memberof Popper |
| 3733 |
*/ |
| 3734 |
var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; |
| 3735 |
|
| 3736 |
// Get rid of `auto` `auto-start` and `auto-end` |
| 3737 |
var validPlacements = placements.slice(3); |
| 3738 |
|
| 3739 |
/** |
| 3740 |
* Given an initial placement, returns all the subsequent placements |
| 3741 |
* clockwise (or counter-clockwise). |
| 3742 |
* |
| 3743 |
* @method |
| 3744 |
* @memberof Popper.Utils |
| 3745 |
* @argument {String} placement - A valid placement (it accepts variations) |
| 3746 |
* @argument {Boolean} counter - Set to true to walk the placements counterclockwise |
| 3747 |
* @returns {Array} placements including their variations |
| 3748 |
*/ |
| 3749 |
function clockwise(placement) { |
| 3750 |
var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; |
| 3751 |
|
| 3752 |
var index = validPlacements.indexOf(placement); |
| 3753 |
var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); |
| 3754 |
return counter ? arr.reverse() : arr; |
| 3755 |
} |
| 3756 |
|
| 3757 |
var BEHAVIORS = { |
| 3758 |
FLIP: 'flip', |
| 3759 |
CLOCKWISE: 'clockwise', |
| 3760 |
COUNTERCLOCKWISE: 'counterclockwise' |
| 3761 |
}; |
| 3762 |
|
| 3763 |
/** |
| 3764 |
* @function |
| 3765 |
* @memberof Modifiers |
| 3766 |
* @argument {Object} data - The data object generated by update method |
| 3767 |
* @argument {Object} options - Modifiers configuration and options |
| 3768 |
* @returns {Object} The data object, properly modified |
| 3769 |
*/ |
| 3770 |
function flip(data, options) { |
| 3771 |
// if `inner` modifier is enabled, we can't use the `flip` modifier |
| 3772 |
if (isModifierEnabled(data.instance.modifiers, 'inner')) { |
| 3773 |
return data; |
| 3774 |
} |
| 3775 |
|
| 3776 |
if (data.flipped && data.placement === data.originalPlacement) { |
| 3777 |
// seems like flip is trying to loop, probably there's not enough space on any of the flippable sides |
| 3778 |
return data; |
| 3779 |
} |
| 3780 |
|
| 3781 |
var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); |
| 3782 |
|
| 3783 |
var placement = data.placement.split('-')[0]; |
| 3784 |
var placementOpposite = getOppositePlacement(placement); |
| 3785 |
var variation = data.placement.split('-')[1] || ''; |
| 3786 |
|
| 3787 |
var flipOrder = []; |
| 3788 |
|
| 3789 |
switch (options.behavior) { |
| 3790 |
case BEHAVIORS.FLIP: |
| 3791 |
flipOrder = [placement, placementOpposite]; |
| 3792 |
break; |
| 3793 |
case BEHAVIORS.CLOCKWISE: |
| 3794 |
flipOrder = clockwise(placement); |
| 3795 |
break; |
| 3796 |
case BEHAVIORS.COUNTERCLOCKWISE: |
| 3797 |
flipOrder = clockwise(placement, true); |
| 3798 |
break; |
| 3799 |
default: |
| 3800 |
flipOrder = options.behavior; |
| 3801 |
} |
| 3802 |
|
| 3803 |
flipOrder.forEach(function (step, index) { |
| 3804 |
if (placement !== step || flipOrder.length === index + 1) { |
| 3805 |
return data; |
| 3806 |
} |
| 3807 |
|
| 3808 |
placement = data.placement.split('-')[0]; |
| 3809 |
placementOpposite = getOppositePlacement(placement); |
| 3810 |
|
| 3811 |
var popperOffsets = data.offsets.popper; |
| 3812 |
var refOffsets = data.offsets.reference; |
| 3813 |
|
| 3814 |
// using floor because the reference offsets may contain decimals we are not going to consider here |
| 3815 |
var floor = Math.floor; |
| 3816 |
var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); |
| 3817 |
|
| 3818 |
var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); |
| 3819 |
var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); |
| 3820 |
var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); |
| 3821 |
var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); |
| 3822 |
|
| 3823 |
var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; |
| 3824 |
|
| 3825 |
// flip the variation if required |
| 3826 |
var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; |
| 3827 |
|
| 3828 |
// flips variation if reference element overflows boundaries |
| 3829 |
var flippedVariationByRef = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); |
| 3830 |
|
| 3831 |
// flips variation if popper content overflows boundaries |
| 3832 |
var flippedVariationByContent = !!options.flipVariationsByContent && (isVertical && variation === 'start' && overflowsRight || isVertical && variation === 'end' && overflowsLeft || !isVertical && variation === 'start' && overflowsBottom || !isVertical && variation === 'end' && overflowsTop); |
| 3833 |
|
| 3834 |
var flippedVariation = flippedVariationByRef || flippedVariationByContent; |
| 3835 |
|
| 3836 |
if (overlapsRef || overflowsBoundaries || flippedVariation) { |
| 3837 |
// this boolean to detect any flip loop |
| 3838 |
data.flipped = true; |
| 3839 |
|
| 3840 |
if (overlapsRef || overflowsBoundaries) { |
| 3841 |
placement = flipOrder[index + 1]; |
| 3842 |
} |
| 3843 |
|
| 3844 |
if (flippedVariation) { |
| 3845 |
variation = getOppositeVariation(variation); |
| 3846 |
} |
| 3847 |
|
| 3848 |
data.placement = placement + (variation ? '-' + variation : ''); |
| 3849 |
|
| 3850 |
// this object contains `position`, we want to preserve it along with |
| 3851 |
// any additional property we may add in the future |
| 3852 |
data.offsets.popper = _extends$2({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); |
| 3853 |
|
| 3854 |
data = runModifiers(data.instance.modifiers, data, 'flip'); |
| 3855 |
} |
| 3856 |
}); |
| 3857 |
return data; |
| 3858 |
} |
| 3859 |
|
| 3860 |
/** |
| 3861 |
* @function |
| 3862 |
* @memberof Modifiers |
| 3863 |
* @argument {Object} data - The data object generated by update method |
| 3864 |
* @argument {Object} options - Modifiers configuration and options |
| 3865 |
* @returns {Object} The data object, properly modified |
| 3866 |
*/ |
| 3867 |
function keepTogether(data) { |
| 3868 |
var _data$offsets = data.offsets, |
| 3869 |
popper = _data$offsets.popper, |
| 3870 |
reference = _data$offsets.reference; |
| 3871 |
|
| 3872 |
var placement = data.placement.split('-')[0]; |
| 3873 |
var floor = Math.floor; |
| 3874 |
var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; |
| 3875 |
var side = isVertical ? 'right' : 'bottom'; |
| 3876 |
var opSide = isVertical ? 'left' : 'top'; |
| 3877 |
var measurement = isVertical ? 'width' : 'height'; |
| 3878 |
|
| 3879 |
if (popper[side] < floor(reference[opSide])) { |
| 3880 |
data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; |
| 3881 |
} |
| 3882 |
if (popper[opSide] > floor(reference[side])) { |
| 3883 |
data.offsets.popper[opSide] = floor(reference[side]); |
| 3884 |
} |
| 3885 |
|
| 3886 |
return data; |
| 3887 |
} |
| 3888 |
|
| 3889 |
/** |
| 3890 |
* Converts a string containing value + unit into a px value number |
| 3891 |
* @function |
| 3892 |
* @memberof {modifiers~offset} |
| 3893 |
* @private |
| 3894 |
* @argument {String} str - Value + unit string |
| 3895 |
* @argument {String} measurement - `height` or `width` |
| 3896 |
* @argument {Object} popperOffsets |
| 3897 |
* @argument {Object} referenceOffsets |
| 3898 |
* @returns {Number|String} |
| 3899 |
* Value in pixels, or original string if no values were extracted |
| 3900 |
*/ |
| 3901 |
function toValue(str, measurement, popperOffsets, referenceOffsets) { |
| 3902 |
// separate value from unit |
| 3903 |
var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); |
| 3904 |
var value = +split[1]; |
| 3905 |
var unit = split[2]; |
| 3906 |
|
| 3907 |
// If it's not a number it's an operator, I guess |
| 3908 |
if (!value) { |
| 3909 |
return str; |
| 3910 |
} |
| 3911 |
|
| 3912 |
if (unit.indexOf('%') === 0) { |
| 3913 |
var element = void 0; |
| 3914 |
switch (unit) { |
| 3915 |
case '%p': |
| 3916 |
element = popperOffsets; |
| 3917 |
break; |
| 3918 |
case '%': |
| 3919 |
case '%r': |
| 3920 |
default: |
| 3921 |
element = referenceOffsets; |
| 3922 |
} |
| 3923 |
|
| 3924 |
var rect = getClientRect(element); |
| 3925 |
return rect[measurement] / 100 * value; |
| 3926 |
} else if (unit === 'vh' || unit === 'vw') { |
| 3927 |
// if is a vh or vw, we calculate the size based on the viewport |
| 3928 |
var size = void 0; |
| 3929 |
if (unit === 'vh') { |
| 3930 |
size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); |
| 3931 |
} else { |
| 3932 |
size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); |
| 3933 |
} |
| 3934 |
return size / 100 * value; |
| 3935 |
} else { |
| 3936 |
// if is an explicit pixel unit, we get rid of the unit and keep the value |
| 3937 |
// if is an implicit unit, it's px, and we return just the value |
| 3938 |
return value; |
| 3939 |
} |
| 3940 |
} |
| 3941 |
|
| 3942 |
/** |
| 3943 |
* Parse an `offset` string to extrapolate `x` and `y` numeric offsets. |
| 3944 |
* @function |
| 3945 |
* @memberof {modifiers~offset} |
| 3946 |
* @private |
| 3947 |
* @argument {String} offset |
| 3948 |
* @argument {Object} popperOffsets |
| 3949 |
* @argument {Object} referenceOffsets |
| 3950 |
* @argument {String} basePlacement |
| 3951 |
* @returns {Array} a two cells array with x and y offsets in numbers |
| 3952 |
*/ |
| 3953 |
function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { |
| 3954 |
var offsets = [0, 0]; |
| 3955 |
|
| 3956 |
// Use height if placement is left or right and index is 0 otherwise use width |
| 3957 |
// in this way the first offset will use an axis and the second one |
| 3958 |
// will use the other one |
| 3959 |
var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; |
| 3960 |
|
| 3961 |
// Split the offset string to obtain a list of values and operands |
| 3962 |
// The regex addresses values with the plus or minus sign in front (+10, -20, etc) |
| 3963 |
var fragments = offset.split(/(\+|\-)/).map(function (frag) { |
| 3964 |
return frag.trim(); |
| 3965 |
}); |
| 3966 |
|
| 3967 |
// Detect if the offset string contains a pair of values or a single one |
| 3968 |
// they could be separated by comma or space |
| 3969 |
var divider = fragments.indexOf(find(fragments, function (frag) { |
| 3970 |
return frag.search(/,|\s/) !== -1; |
| 3971 |
})); |
| 3972 |
|
| 3973 |
if (fragments[divider] && fragments[divider].indexOf(',') === -1) { |
| 3974 |
console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); |
| 3975 |
} |
| 3976 |
|
| 3977 |
// If divider is found, we divide the list of values and operands to divide |
| 3978 |
// them by ofset X and Y. |
| 3979 |
var splitRegex = /\s*,\s*|\s+/; |
| 3980 |
var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; |
| 3981 |
|
| 3982 |
// Convert the values with units to absolute pixels to allow our computations |
| 3983 |
ops = ops.map(function (op, index) { |
| 3984 |
// Most of the units rely on the orientation of the popper |
| 3985 |
var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; |
| 3986 |
var mergeWithPrevious = false; |
| 3987 |
return op |
| 3988 |
// This aggregates any `+` or `-` sign that aren't considered operators |
| 3989 |
// e.g.: 10 + +5 => [10, +, +5] |
| 3990 |
.reduce(function (a, b) { |
| 3991 |
if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { |
| 3992 |
a[a.length - 1] = b; |
| 3993 |
mergeWithPrevious = true; |
| 3994 |
return a; |
| 3995 |
} else if (mergeWithPrevious) { |
| 3996 |
a[a.length - 1] += b; |
| 3997 |
mergeWithPrevious = false; |
| 3998 |
return a; |
| 3999 |
} else { |
| 4000 |
return a.concat(b); |
| 4001 |
} |
| 4002 |
}, []) |
| 4003 |
// Here we convert the string values into number values (in px) |
| 4004 |
.map(function (str) { |
| 4005 |
return toValue(str, measurement, popperOffsets, referenceOffsets); |
| 4006 |
}); |
| 4007 |
}); |
| 4008 |
|
| 4009 |
// Loop trough the offsets arrays and execute the operations |
| 4010 |
ops.forEach(function (op, index) { |
| 4011 |
op.forEach(function (frag, index2) { |
| 4012 |
if (isNumeric(frag)) { |
| 4013 |
offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); |
| 4014 |
} |
| 4015 |
}); |
| 4016 |
}); |
| 4017 |
return offsets; |
| 4018 |
} |
| 4019 |
|
| 4020 |
/** |
| 4021 |
* @function |
| 4022 |
* @memberof Modifiers |
| 4023 |
* @argument {Object} data - The data object generated by update method |
| 4024 |
* @argument {Object} options - Modifiers configuration and options |
| 4025 |
* @argument {Number|String} options.offset=0 |
| 4026 |
* The offset value as described in the modifier description |
| 4027 |
* @returns {Object} The data object, properly modified |
| 4028 |
*/ |
| 4029 |
function offset(data, _ref) { |
| 4030 |
var offset = _ref.offset; |
| 4031 |
var placement = data.placement, |
| 4032 |
_data$offsets = data.offsets, |
| 4033 |
popper = _data$offsets.popper, |
| 4034 |
reference = _data$offsets.reference; |
| 4035 |
|
| 4036 |
var basePlacement = placement.split('-')[0]; |
| 4037 |
|
| 4038 |
var offsets = void 0; |
| 4039 |
if (isNumeric(+offset)) { |
| 4040 |
offsets = [+offset, 0]; |
| 4041 |
} else { |
| 4042 |
offsets = parseOffset(offset, popper, reference, basePlacement); |
| 4043 |
} |
| 4044 |
|
| 4045 |
if (basePlacement === 'left') { |
| 4046 |
popper.top += offsets[0]; |
| 4047 |
popper.left -= offsets[1]; |
| 4048 |
} else if (basePlacement === 'right') { |
| 4049 |
popper.top += offsets[0]; |
| 4050 |
popper.left += offsets[1]; |
| 4051 |
} else if (basePlacement === 'top') { |
| 4052 |
popper.left += offsets[0]; |
| 4053 |
popper.top -= offsets[1]; |
| 4054 |
} else if (basePlacement === 'bottom') { |
| 4055 |
popper.left += offsets[0]; |
| 4056 |
popper.top += offsets[1]; |
| 4057 |
} |
| 4058 |
|
| 4059 |
data.popper = popper; |
| 4060 |
return data; |
| 4061 |
} |
| 4062 |
|
| 4063 |
/** |
| 4064 |
* @function |
| 4065 |
* @memberof Modifiers |
| 4066 |
* @argument {Object} data - The data object generated by `update` method |
| 4067 |
* @argument {Object} options - Modifiers configuration and options |
| 4068 |
* @returns {Object} The data object, properly modified |
| 4069 |
*/ |
| 4070 |
function preventOverflow(data, options) { |
| 4071 |
var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); |
| 4072 |
|
| 4073 |
// If offsetParent is the reference element, we really want to |
| 4074 |
// go one step up and use the next offsetParent as reference to |
| 4075 |
// avoid to make this modifier completely useless and look like broken |
| 4076 |
if (data.instance.reference === boundariesElement) { |
| 4077 |
boundariesElement = getOffsetParent(boundariesElement); |
| 4078 |
} |
| 4079 |
|
| 4080 |
// NOTE: DOM access here |
| 4081 |
// resets the popper's position so that the document size can be calculated excluding |
| 4082 |
// the size of the popper element itself |
| 4083 |
var transformProp = getSupportedPropertyName('transform'); |
| 4084 |
var popperStyles = data.instance.popper.style; // assignment to help minification |
| 4085 |
var top = popperStyles.top, |
| 4086 |
left = popperStyles.left, |
| 4087 |
transform = popperStyles[transformProp]; |
| 4088 |
|
| 4089 |
popperStyles.top = ''; |
| 4090 |
popperStyles.left = ''; |
| 4091 |
popperStyles[transformProp] = ''; |
| 4092 |
|
| 4093 |
var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); |
| 4094 |
|
| 4095 |
// NOTE: DOM access here |
| 4096 |
// restores the original style properties after the offsets have been computed |
| 4097 |
popperStyles.top = top; |
| 4098 |
popperStyles.left = left; |
| 4099 |
popperStyles[transformProp] = transform; |
| 4100 |
|
| 4101 |
options.boundaries = boundaries; |
| 4102 |
|
| 4103 |
var order = options.priority; |
| 4104 |
var popper = data.offsets.popper; |
| 4105 |
|
| 4106 |
var check = { |
| 4107 |
primary: function primary(placement) { |
| 4108 |
var value = popper[placement]; |
| 4109 |
if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { |
| 4110 |
value = Math.max(popper[placement], boundaries[placement]); |
| 4111 |
} |
| 4112 |
return defineProperty$1({}, placement, value); |
| 4113 |
}, |
| 4114 |
secondary: function secondary(placement) { |
| 4115 |
var mainSide = placement === 'right' ? 'left' : 'top'; |
| 4116 |
var value = popper[mainSide]; |
| 4117 |
if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { |
| 4118 |
value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); |
| 4119 |
} |
| 4120 |
return defineProperty$1({}, mainSide, value); |
| 4121 |
} |
| 4122 |
}; |
| 4123 |
|
| 4124 |
order.forEach(function (placement) { |
| 4125 |
var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; |
| 4126 |
popper = _extends$2({}, popper, check[side](placement)); |
| 4127 |
}); |
| 4128 |
|
| 4129 |
data.offsets.popper = popper; |
| 4130 |
|
| 4131 |
return data; |
| 4132 |
} |
| 4133 |
|
| 4134 |
/** |
| 4135 |
* @function |
| 4136 |
* @memberof Modifiers |
| 4137 |
* @argument {Object} data - The data object generated by `update` method |
| 4138 |
* @argument {Object} options - Modifiers configuration and options |
| 4139 |
* @returns {Object} The data object, properly modified |
| 4140 |
*/ |
| 4141 |
function shift(data) { |
| 4142 |
var placement = data.placement; |
| 4143 |
var basePlacement = placement.split('-')[0]; |
| 4144 |
var shiftvariation = placement.split('-')[1]; |
| 4145 |
|
| 4146 |
// if shift shiftvariation is specified, run the modifier |
| 4147 |
if (shiftvariation) { |
| 4148 |
var _data$offsets = data.offsets, |
| 4149 |
reference = _data$offsets.reference, |
| 4150 |
popper = _data$offsets.popper; |
| 4151 |
|
| 4152 |
var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; |
| 4153 |
var side = isVertical ? 'left' : 'top'; |
| 4154 |
var measurement = isVertical ? 'width' : 'height'; |
| 4155 |
|
| 4156 |
var shiftOffsets = { |
| 4157 |
start: defineProperty$1({}, side, reference[side]), |
| 4158 |
end: defineProperty$1({}, side, reference[side] + reference[measurement] - popper[measurement]) |
| 4159 |
}; |
| 4160 |
|
| 4161 |
data.offsets.popper = _extends$2({}, popper, shiftOffsets[shiftvariation]); |
| 4162 |
} |
| 4163 |
|
| 4164 |
return data; |
| 4165 |
} |
| 4166 |
|
| 4167 |
/** |
| 4168 |
* @function |
| 4169 |
* @memberof Modifiers |
| 4170 |
* @argument {Object} data - The data object generated by update method |
| 4171 |
* @argument {Object} options - Modifiers configuration and options |
| 4172 |
* @returns {Object} The data object, properly modified |
| 4173 |
*/ |
| 4174 |
function hide(data) { |
| 4175 |
if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { |
| 4176 |
return data; |
| 4177 |
} |
| 4178 |
|
| 4179 |
var refRect = data.offsets.reference; |
| 4180 |
var bound = find(data.instance.modifiers, function (modifier) { |
| 4181 |
return modifier.name === 'preventOverflow'; |
| 4182 |
}).boundaries; |
| 4183 |
|
| 4184 |
if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { |
| 4185 |
// Avoid unnecessary DOM access if visibility hasn't changed |
| 4186 |
if (data.hide === true) { |
| 4187 |
return data; |
| 4188 |
} |
| 4189 |
|
| 4190 |
data.hide = true; |
| 4191 |
data.attributes['x-out-of-boundaries'] = ''; |
| 4192 |
} else { |
| 4193 |
// Avoid unnecessary DOM access if visibility hasn't changed |
| 4194 |
if (data.hide === false) { |
| 4195 |
return data; |
| 4196 |
} |
| 4197 |
|
| 4198 |
data.hide = false; |
| 4199 |
data.attributes['x-out-of-boundaries'] = false; |
| 4200 |
} |
| 4201 |
|
| 4202 |
return data; |
| 4203 |
} |
| 4204 |
|
| 4205 |
/** |
| 4206 |
* @function |
| 4207 |
* @memberof Modifiers |
| 4208 |
* @argument {Object} data - The data object generated by `update` method |
| 4209 |
* @argument {Object} options - Modifiers configuration and options |
| 4210 |
* @returns {Object} The data object, properly modified |
| 4211 |
*/ |
| 4212 |
function inner(data) { |
| 4213 |
var placement = data.placement; |
| 4214 |
var basePlacement = placement.split('-')[0]; |
| 4215 |
var _data$offsets = data.offsets, |
| 4216 |
popper = _data$offsets.popper, |
| 4217 |
reference = _data$offsets.reference; |
| 4218 |
|
| 4219 |
var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; |
| 4220 |
|
| 4221 |
var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; |
| 4222 |
|
| 4223 |
popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); |
| 4224 |
|
| 4225 |
data.placement = getOppositePlacement(placement); |
| 4226 |
data.offsets.popper = getClientRect(popper); |
| 4227 |
|
| 4228 |
return data; |
| 4229 |
} |
| 4230 |
|
| 4231 |
/** |
| 4232 |
* Modifier function, each modifier can have a function of this type assigned |
| 4233 |
* to its `fn` property.<br /> |
| 4234 |
* These functions will be called on each update, this means that you must |
| 4235 |
* make sure they are performant enough to avoid performance bottlenecks. |
| 4236 |
* |
| 4237 |
* @function ModifierFn |
| 4238 |
* @argument {dataObject} data - The data object generated by `update` method |
| 4239 |
* @argument {Object} options - Modifiers configuration and options |
| 4240 |
* @returns {dataObject} The data object, properly modified |
| 4241 |
*/ |
| 4242 |
|
| 4243 |
/** |
| 4244 |
* Modifiers are plugins used to alter the behavior of your poppers.<br /> |
| 4245 |
* Popper.js uses a set of 9 modifiers to provide all the basic functionalities |
| 4246 |
* needed by the library. |
| 4247 |
* |
| 4248 |
* Usually you don't want to override the `order`, `fn` and `onLoad` props. |
| 4249 |
* All the other properties are configurations that could be tweaked. |
| 4250 |
* @namespace modifiers |
| 4251 |
*/ |
| 4252 |
var modifiers = { |
| 4253 |
/** |
| 4254 |
* Modifier used to shift the popper on the start or end of its reference |
| 4255 |
* element.<br /> |
| 4256 |
* It will read the variation of the `placement` property.<br /> |
| 4257 |
* It can be one either `-end` or `-start`. |
| 4258 |
* @memberof modifiers |
| 4259 |
* @inner |
| 4260 |
*/ |
| 4261 |
shift: { |
| 4262 |
/** @prop {number} order=100 - Index used to define the order of execution */ |
| 4263 |
order: 100, |
| 4264 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4265 |
enabled: true, |
| 4266 |
/** @prop {ModifierFn} */ |
| 4267 |
fn: shift |
| 4268 |
}, |
| 4269 |
|
| 4270 |
/** |
| 4271 |
* The `offset` modifier can shift your popper on both its axis. |
| 4272 |
* |
| 4273 |
* It accepts the following units: |
| 4274 |
* - `px` or unit-less, interpreted as pixels |
| 4275 |
* - `%` or `%r`, percentage relative to the length of the reference element |
| 4276 |
* - `%p`, percentage relative to the length of the popper element |
| 4277 |
* - `vw`, CSS viewport width unit |
| 4278 |
* - `vh`, CSS viewport height unit |
| 4279 |
* |
| 4280 |
* For length is intended the main axis relative to the placement of the popper.<br /> |
| 4281 |
* This means that if the placement is `top` or `bottom`, the length will be the |
| 4282 |
* `width`. In case of `left` or `right`, it will be the `height`. |
| 4283 |
* |
| 4284 |
* You can provide a single value (as `Number` or `String`), or a pair of values |
| 4285 |
* as `String` divided by a comma or one (or more) white spaces.<br /> |
| 4286 |
* The latter is a deprecated method because it leads to confusion and will be |
| 4287 |
* removed in v2.<br /> |
| 4288 |
* Additionally, it accepts additions and subtractions between different units. |
| 4289 |
* Note that multiplications and divisions aren't supported. |
| 4290 |
* |
| 4291 |
* Valid examples are: |
| 4292 |
* ``` |
| 4293 |
* 10 |
| 4294 |
* '10%' |
| 4295 |
* '10, 10' |
| 4296 |
* '10%, 10' |
| 4297 |
* '10 + 10%' |
| 4298 |
* '10 - 5vh + 3%' |
| 4299 |
* '-10px + 5vh, 5px - 6%' |
| 4300 |
* ``` |
| 4301 |
* > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap |
| 4302 |
* > with their reference element, unfortunately, you will have to disable the `flip` modifier. |
| 4303 |
* > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373). |
| 4304 |
* |
| 4305 |
* @memberof modifiers |
| 4306 |
* @inner |
| 4307 |
*/ |
| 4308 |
offset: { |
| 4309 |
/** @prop {number} order=200 - Index used to define the order of execution */ |
| 4310 |
order: 200, |
| 4311 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4312 |
enabled: true, |
| 4313 |
/** @prop {ModifierFn} */ |
| 4314 |
fn: offset, |
| 4315 |
/** @prop {Number|String} offset=0 |
| 4316 |
* The offset value as described in the modifier description |
| 4317 |
*/ |
| 4318 |
offset: 0 |
| 4319 |
}, |
| 4320 |
|
| 4321 |
/** |
| 4322 |
* Modifier used to prevent the popper from being positioned outside the boundary. |
| 4323 |
* |
| 4324 |
* A scenario exists where the reference itself is not within the boundaries.<br /> |
| 4325 |
* We can say it has "escaped the boundaries" — or just "escaped".<br /> |
| 4326 |
* In this case we need to decide whether the popper should either: |
| 4327 |
* |
| 4328 |
* - detach from the reference and remain "trapped" in the boundaries, or |
| 4329 |
* - if it should ignore the boundary and "escape with its reference" |
| 4330 |
* |
| 4331 |
* When `escapeWithReference` is set to`true` and reference is completely |
| 4332 |
* outside its boundaries, the popper will overflow (or completely leave) |
| 4333 |
* the boundaries in order to remain attached to the edge of the reference. |
| 4334 |
* |
| 4335 |
* @memberof modifiers |
| 4336 |
* @inner |
| 4337 |
*/ |
| 4338 |
preventOverflow: { |
| 4339 |
/** @prop {number} order=300 - Index used to define the order of execution */ |
| 4340 |
order: 300, |
| 4341 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4342 |
enabled: true, |
| 4343 |
/** @prop {ModifierFn} */ |
| 4344 |
fn: preventOverflow, |
| 4345 |
/** |
| 4346 |
* @prop {Array} [priority=['left','right','top','bottom']] |
| 4347 |
* Popper will try to prevent overflow following these priorities by default, |
| 4348 |
* then, it could overflow on the left and on top of the `boundariesElement` |
| 4349 |
*/ |
| 4350 |
priority: ['left', 'right', 'top', 'bottom'], |
| 4351 |
/** |
| 4352 |
* @prop {number} padding=5 |
| 4353 |
* Amount of pixel used to define a minimum distance between the boundaries |
| 4354 |
* and the popper. This makes sure the popper always has a little padding |
| 4355 |
* between the edges of its container |
| 4356 |
*/ |
| 4357 |
padding: 5, |
| 4358 |
/** |
| 4359 |
* @prop {String|HTMLElement} boundariesElement='scrollParent' |
| 4360 |
* Boundaries used by the modifier. Can be `scrollParent`, `window`, |
| 4361 |
* `viewport` or any DOM element. |
| 4362 |
*/ |
| 4363 |
boundariesElement: 'scrollParent' |
| 4364 |
}, |
| 4365 |
|
| 4366 |
/** |
| 4367 |
* Modifier used to make sure the reference and its popper stay near each other |
| 4368 |
* without leaving any gap between the two. Especially useful when the arrow is |
| 4369 |
* enabled and you want to ensure that it points to its reference element. |
| 4370 |
* It cares only about the first axis. You can still have poppers with margin |
| 4371 |
* between the popper and its reference element. |
| 4372 |
* @memberof modifiers |
| 4373 |
* @inner |
| 4374 |
*/ |
| 4375 |
keepTogether: { |
| 4376 |
/** @prop {number} order=400 - Index used to define the order of execution */ |
| 4377 |
order: 400, |
| 4378 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4379 |
enabled: true, |
| 4380 |
/** @prop {ModifierFn} */ |
| 4381 |
fn: keepTogether |
| 4382 |
}, |
| 4383 |
|
| 4384 |
/** |
| 4385 |
* This modifier is used to move the `arrowElement` of the popper to make |
| 4386 |
* sure it is positioned between the reference element and its popper element. |
| 4387 |
* It will read the outer size of the `arrowElement` node to detect how many |
| 4388 |
* pixels of conjunction are needed. |
| 4389 |
* |
| 4390 |
* It has no effect if no `arrowElement` is provided. |
| 4391 |
* @memberof modifiers |
| 4392 |
* @inner |
| 4393 |
*/ |
| 4394 |
arrow: { |
| 4395 |
/** @prop {number} order=500 - Index used to define the order of execution */ |
| 4396 |
order: 500, |
| 4397 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4398 |
enabled: true, |
| 4399 |
/** @prop {ModifierFn} */ |
| 4400 |
fn: arrow, |
| 4401 |
/** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ |
| 4402 |
element: '[x-arrow]' |
| 4403 |
}, |
| 4404 |
|
| 4405 |
/** |
| 4406 |
* Modifier used to flip the popper's placement when it starts to overlap its |
| 4407 |
* reference element. |
| 4408 |
* |
| 4409 |
* Requires the `preventOverflow` modifier before it in order to work. |
| 4410 |
* |
| 4411 |
* **NOTE:** this modifier will interrupt the current update cycle and will |
| 4412 |
* restart it if it detects the need to flip the placement. |
| 4413 |
* @memberof modifiers |
| 4414 |
* @inner |
| 4415 |
*/ |
| 4416 |
flip: { |
| 4417 |
/** @prop {number} order=600 - Index used to define the order of execution */ |
| 4418 |
order: 600, |
| 4419 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4420 |
enabled: true, |
| 4421 |
/** @prop {ModifierFn} */ |
| 4422 |
fn: flip, |
| 4423 |
/** |
| 4424 |
* @prop {String|Array} behavior='flip' |
| 4425 |
* The behavior used to change the popper's placement. It can be one of |
| 4426 |
* `flip`, `clockwise`, `counterclockwise` or an array with a list of valid |
| 4427 |
* placements (with optional variations) |
| 4428 |
*/ |
| 4429 |
behavior: 'flip', |
| 4430 |
/** |
| 4431 |
* @prop {number} padding=5 |
| 4432 |
* The popper will flip if it hits the edges of the `boundariesElement` |
| 4433 |
*/ |
| 4434 |
padding: 5, |
| 4435 |
/** |
| 4436 |
* @prop {String|HTMLElement} boundariesElement='viewport' |
| 4437 |
* The element which will define the boundaries of the popper position. |
| 4438 |
* The popper will never be placed outside of the defined boundaries |
| 4439 |
* (except if `keepTogether` is enabled) |
| 4440 |
*/ |
| 4441 |
boundariesElement: 'viewport', |
| 4442 |
/** |
| 4443 |
* @prop {Boolean} flipVariations=false |
| 4444 |
* The popper will switch placement variation between `-start` and `-end` when |
| 4445 |
* the reference element overlaps its boundaries. |
| 4446 |
* |
| 4447 |
* The original placement should have a set variation. |
| 4448 |
*/ |
| 4449 |
flipVariations: false, |
| 4450 |
/** |
| 4451 |
* @prop {Boolean} flipVariationsByContent=false |
| 4452 |
* The popper will switch placement variation between `-start` and `-end` when |
| 4453 |
* the popper element overlaps its reference boundaries. |
| 4454 |
* |
| 4455 |
* The original placement should have a set variation. |
| 4456 |
*/ |
| 4457 |
flipVariationsByContent: false |
| 4458 |
}, |
| 4459 |
|
| 4460 |
/** |
| 4461 |
* Modifier used to make the popper flow toward the inner of the reference element. |
| 4462 |
* By default, when this modifier is disabled, the popper will be placed outside |
| 4463 |
* the reference element. |
| 4464 |
* @memberof modifiers |
| 4465 |
* @inner |
| 4466 |
*/ |
| 4467 |
inner: { |
| 4468 |
/** @prop {number} order=700 - Index used to define the order of execution */ |
| 4469 |
order: 700, |
| 4470 |
/** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ |
| 4471 |
enabled: false, |
| 4472 |
/** @prop {ModifierFn} */ |
| 4473 |
fn: inner |
| 4474 |
}, |
| 4475 |
|
| 4476 |
/** |
| 4477 |
* Modifier used to hide the popper when its reference element is outside of the |
| 4478 |
* popper boundaries. It will set a `x-out-of-boundaries` attribute which can |
| 4479 |
* be used to hide with a CSS selector the popper when its reference is |
| 4480 |
* out of boundaries. |
| 4481 |
* |
| 4482 |
* Requires the `preventOverflow` modifier before it in order to work. |
| 4483 |
* @memberof modifiers |
| 4484 |
* @inner |
| 4485 |
*/ |
| 4486 |
hide: { |
| 4487 |
/** @prop {number} order=800 - Index used to define the order of execution */ |
| 4488 |
order: 800, |
| 4489 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4490 |
enabled: true, |
| 4491 |
/** @prop {ModifierFn} */ |
| 4492 |
fn: hide |
| 4493 |
}, |
| 4494 |
|
| 4495 |
/** |
| 4496 |
* Computes the style that will be applied to the popper element to gets |
| 4497 |
* properly positioned. |
| 4498 |
* |
| 4499 |
* Note that this modifier will not touch the DOM, it just prepares the styles |
| 4500 |
* so that `applyStyle` modifier can apply it. This separation is useful |
| 4501 |
* in case you need to replace `applyStyle` with a custom implementation. |
| 4502 |
* |
| 4503 |
* This modifier has `850` as `order` value to maintain backward compatibility |
| 4504 |
* with previous versions of Popper.js. Expect the modifiers ordering method |
| 4505 |
* to change in future major versions of the library. |
| 4506 |
* |
| 4507 |
* @memberof modifiers |
| 4508 |
* @inner |
| 4509 |
*/ |
| 4510 |
computeStyle: { |
| 4511 |
/** @prop {number} order=850 - Index used to define the order of execution */ |
| 4512 |
order: 850, |
| 4513 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4514 |
enabled: true, |
| 4515 |
/** @prop {ModifierFn} */ |
| 4516 |
fn: computeStyle, |
| 4517 |
/** |
| 4518 |
* @prop {Boolean} gpuAcceleration=true |
| 4519 |
* If true, it uses the CSS 3D transformation to position the popper. |
| 4520 |
* Otherwise, it will use the `top` and `left` properties |
| 4521 |
*/ |
| 4522 |
gpuAcceleration: true, |
| 4523 |
/** |
| 4524 |
* @prop {string} [x='bottom'] |
| 4525 |
* Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. |
| 4526 |
* Change this if your popper should grow in a direction different from `bottom` |
| 4527 |
*/ |
| 4528 |
x: 'bottom', |
| 4529 |
/** |
| 4530 |
* @prop {string} [x='left'] |
| 4531 |
* Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. |
| 4532 |
* Change this if your popper should grow in a direction different from `right` |
| 4533 |
*/ |
| 4534 |
y: 'right' |
| 4535 |
}, |
| 4536 |
|
| 4537 |
/** |
| 4538 |
* Applies the computed styles to the popper element. |
| 4539 |
* |
| 4540 |
* All the DOM manipulations are limited to this modifier. This is useful in case |
| 4541 |
* you want to integrate Popper.js inside a framework or view library and you |
| 4542 |
* want to delegate all the DOM manipulations to it. |
| 4543 |
* |
| 4544 |
* Note that if you disable this modifier, you must make sure the popper element |
| 4545 |
* has its position set to `absolute` before Popper.js can do its work! |
| 4546 |
* |
| 4547 |
* Just disable this modifier and define your own to achieve the desired effect. |
| 4548 |
* |
| 4549 |
* @memberof modifiers |
| 4550 |
* @inner |
| 4551 |
*/ |
| 4552 |
applyStyle: { |
| 4553 |
/** @prop {number} order=900 - Index used to define the order of execution */ |
| 4554 |
order: 900, |
| 4555 |
/** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ |
| 4556 |
enabled: true, |
| 4557 |
/** @prop {ModifierFn} */ |
| 4558 |
fn: applyStyle, |
| 4559 |
/** @prop {Function} */ |
| 4560 |
onLoad: applyStyleOnLoad, |
| 4561 |
/** |
| 4562 |
* @deprecated since version 1.10.0, the property moved to `computeStyle` modifier |
| 4563 |
* @prop {Boolean} gpuAcceleration=true |
| 4564 |
* If true, it uses the CSS 3D transformation to position the popper. |
| 4565 |
* Otherwise, it will use the `top` and `left` properties |
| 4566 |
*/ |
| 4567 |
gpuAcceleration: undefined |
| 4568 |
} |
| 4569 |
}; |
| 4570 |
|
| 4571 |
/** |
| 4572 |
* The `dataObject` is an object containing all the information used by Popper.js. |
| 4573 |
* This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks. |
| 4574 |
* @name dataObject |
| 4575 |
* @property {Object} data.instance The Popper.js instance |
| 4576 |
* @property {String} data.placement Placement applied to popper |
| 4577 |
* @property {String} data.originalPlacement Placement originally defined on init |
| 4578 |
* @property {Boolean} data.flipped True if popper has been flipped by flip modifier |
| 4579 |
* @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper |
| 4580 |
* @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier |
| 4581 |
* @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`) |
| 4582 |
* @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`) |
| 4583 |
* @property {Object} data.boundaries Offsets of the popper boundaries |
| 4584 |
* @property {Object} data.offsets The measurements of popper, reference and arrow elements |
| 4585 |
* @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values |
| 4586 |
* @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values |
| 4587 |
* @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 |
| 4588 |
*/ |
| 4589 |
|
| 4590 |
/** |
| 4591 |
* Default options provided to Popper.js constructor.<br /> |
| 4592 |
* These can be overridden using the `options` argument of Popper.js.<br /> |
| 4593 |
* To override an option, simply pass an object with the same |
| 4594 |
* structure of the `options` object, as the 3rd argument. For example: |
| 4595 |
* ``` |
| 4596 |
* new Popper(ref, pop, { |
| 4597 |
* modifiers: { |
| 4598 |
* preventOverflow: { enabled: false } |
| 4599 |
* } |
| 4600 |
* }) |
| 4601 |
* ``` |
| 4602 |
* @type {Object} |
| 4603 |
* @static |
| 4604 |
* @memberof Popper |
| 4605 |
*/ |
| 4606 |
var Defaults = { |
| 4607 |
/** |
| 4608 |
* Popper's placement. |
| 4609 |
* @prop {Popper.placements} placement='bottom' |
| 4610 |
*/ |
| 4611 |
placement: 'bottom', |
| 4612 |
|
| 4613 |
/** |
| 4614 |
* Set this to true if you want popper to position it self in 'fixed' mode |
| 4615 |
* @prop {Boolean} positionFixed=false |
| 4616 |
*/ |
| 4617 |
positionFixed: false, |
| 4618 |
|
| 4619 |
/** |
| 4620 |
* Whether events (resize, scroll) are initially enabled. |
| 4621 |
* @prop {Boolean} eventsEnabled=true |
| 4622 |
*/ |
| 4623 |
eventsEnabled: true, |
| 4624 |
|
| 4625 |
/** |
| 4626 |
* Set to true if you want to automatically remove the popper when |
| 4627 |
* you call the `destroy` method. |
| 4628 |
* @prop {Boolean} removeOnDestroy=false |
| 4629 |
*/ |
| 4630 |
removeOnDestroy: false, |
| 4631 |
|
| 4632 |
/** |
| 4633 |
* Callback called when the popper is created.<br /> |
| 4634 |
* By default, it is set to no-op.<br /> |
| 4635 |
* Access Popper.js instance with `data.instance`. |
| 4636 |
* @prop {onCreate} |
| 4637 |
*/ |
| 4638 |
onCreate: function onCreate() {}, |
| 4639 |
|
| 4640 |
/** |
| 4641 |
* Callback called when the popper is updated. This callback is not called |
| 4642 |
* on the initialization/creation of the popper, but only on subsequent |
| 4643 |
* updates.<br /> |
| 4644 |
* By default, it is set to no-op.<br /> |
| 4645 |
* Access Popper.js instance with `data.instance`. |
| 4646 |
* @prop {onUpdate} |
| 4647 |
*/ |
| 4648 |
onUpdate: function onUpdate() {}, |
| 4649 |
|
| 4650 |
/** |
| 4651 |
* List of modifiers used to modify the offsets before they are applied to the popper. |
| 4652 |
* They provide most of the functionalities of Popper.js. |
| 4653 |
* @prop {modifiers} |
| 4654 |
*/ |
| 4655 |
modifiers: modifiers |
| 4656 |
}; |
| 4657 |
|
| 4658 |
/** |
| 4659 |
* @callback onCreate |
| 4660 |
* @param {dataObject} data |
| 4661 |
*/ |
| 4662 |
|
| 4663 |
/** |
| 4664 |
* @callback onUpdate |
| 4665 |
* @param {dataObject} data |
| 4666 |
*/ |
| 4667 |
|
| 4668 |
// Utils |
| 4669 |
// Methods |
| 4670 |
var Popper = function () { |
| 4671 |
/** |
| 4672 |
* Creates a new Popper.js instance. |
| 4673 |
* @class Popper |
| 4674 |
* @param {Element|referenceObject} reference - The reference element used to position the popper |
| 4675 |
* @param {Element} popper - The HTML / XML element used as the popper |
| 4676 |
* @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) |
| 4677 |
* @return {Object} instance - The generated Popper.js instance |
| 4678 |
*/ |
| 4679 |
function Popper(reference, popper) { |
| 4680 |
var _this = this; |
| 4681 |
|
| 4682 |
var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; |
| 4683 |
classCallCheck(this, Popper); |
| 4684 |
|
| 4685 |
this.scheduleUpdate = function () { |
| 4686 |
return requestAnimationFrame(_this.update); |
| 4687 |
}; |
| 4688 |
|
| 4689 |
// make update() debounced, so that it only runs at most once-per-tick |
| 4690 |
this.update = debounce$1(this.update.bind(this)); |
| 4691 |
|
| 4692 |
// with {} we create a new object with the options inside it |
| 4693 |
this.options = _extends$2({}, Popper.Defaults, options); |
| 4694 |
|
| 4695 |
// init state |
| 4696 |
this.state = { |
| 4697 |
isDestroyed: false, |
| 4698 |
isCreated: false, |
| 4699 |
scrollParents: [] |
| 4700 |
}; |
| 4701 |
|
| 4702 |
// get reference and popper elements (allow jQuery wrappers) |
| 4703 |
this.reference = reference && reference.jquery ? reference[0] : reference; |
| 4704 |
this.popper = popper && popper.jquery ? popper[0] : popper; |
| 4705 |
|
| 4706 |
// Deep merge modifiers options |
| 4707 |
this.options.modifiers = {}; |
| 4708 |
Object.keys(_extends$2({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { |
| 4709 |
_this.options.modifiers[name] = _extends$2({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); |
| 4710 |
}); |
| 4711 |
|
| 4712 |
// Refactoring modifiers' list (Object => Array) |
| 4713 |
this.modifiers = Object.keys(this.options.modifiers).map(function (name) { |
| 4714 |
return _extends$2({ |
| 4715 |
name: name |
| 4716 |
}, _this.options.modifiers[name]); |
| 4717 |
}) |
| 4718 |
// sort the modifiers by order |
| 4719 |
.sort(function (a, b) { |
| 4720 |
return a.order - b.order; |
| 4721 |
}); |
| 4722 |
|
| 4723 |
// modifiers have the ability to execute arbitrary code when Popper.js get inited |
| 4724 |
// such code is executed in the same order of its modifier |
| 4725 |
// they could add new properties to their options configuration |
| 4726 |
// BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! |
| 4727 |
this.modifiers.forEach(function (modifierOptions) { |
| 4728 |
if (modifierOptions.enabled && isFunction$1(modifierOptions.onLoad)) { |
| 4729 |
modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); |
| 4730 |
} |
| 4731 |
}); |
| 4732 |
|
| 4733 |
// fire the first update to position the popper in the right place |
| 4734 |
this.update(); |
| 4735 |
|
| 4736 |
var eventsEnabled = this.options.eventsEnabled; |
| 4737 |
if (eventsEnabled) { |
| 4738 |
// setup event listeners, they will take care of update the position in specific situations |
| 4739 |
this.enableEventListeners(); |
| 4740 |
} |
| 4741 |
|
| 4742 |
this.state.eventsEnabled = eventsEnabled; |
| 4743 |
} |
| 4744 |
|
| 4745 |
// We can't use class properties because they don't get listed in the |
| 4746 |
// class prototype and break stuff like Sinon stubs |
| 4747 |
|
| 4748 |
|
| 4749 |
createClass(Popper, [{ |
| 4750 |
key: 'update', |
| 4751 |
value: function update$$1() { |
| 4752 |
return update.call(this); |
| 4753 |
} |
| 4754 |
}, { |
| 4755 |
key: 'destroy', |
| 4756 |
value: function destroy$$1() { |
| 4757 |
return destroy.call(this); |
| 4758 |
} |
| 4759 |
}, { |
| 4760 |
key: 'enableEventListeners', |
| 4761 |
value: function enableEventListeners$$1() { |
| 4762 |
return enableEventListeners.call(this); |
| 4763 |
} |
| 4764 |
}, { |
| 4765 |
key: 'disableEventListeners', |
| 4766 |
value: function disableEventListeners$$1() { |
| 4767 |
return disableEventListeners.call(this); |
| 4768 |
} |
| 4769 |
|
| 4770 |
/** |
| 4771 |
* Schedules an update. It will run on the next UI update available. |
| 4772 |
* @method scheduleUpdate |
| 4773 |
* @memberof Popper |
| 4774 |
*/ |
| 4775 |
|
| 4776 |
|
| 4777 |
/** |
| 4778 |
* Collection of utilities useful when writing custom modifiers. |
| 4779 |
* Starting from version 1.7, this method is available only if you |
| 4780 |
* include `popper-utils.js` before `popper.js`. |
| 4781 |
* |
| 4782 |
* **DEPRECATION**: This way to access PopperUtils is deprecated |
| 4783 |
* and will be removed in v2! Use the PopperUtils module directly instead. |
| 4784 |
* Due to the high instability of the methods contained in Utils, we can't |
| 4785 |
* guarantee them to follow semver. Use them at your own risk! |
| 4786 |
* @static |
| 4787 |
* @private |
| 4788 |
* @type {Object} |
| 4789 |
* @deprecated since version 1.8 |
| 4790 |
* @member Utils |
| 4791 |
* @memberof Popper |
| 4792 |
*/ |
| 4793 |
|
| 4794 |
}]); |
| 4795 |
return Popper; |
| 4796 |
}(); |
| 4797 |
|
| 4798 |
/** |
| 4799 |
* The `referenceObject` is an object that provides an interface compatible with Popper.js |
| 4800 |
* and lets you use it as replacement of a real DOM node.<br /> |
| 4801 |
* You can use this method to position a popper relatively to a set of coordinates |
| 4802 |
* in case you don't have a DOM node to use as reference. |
| 4803 |
* |
| 4804 |
* ``` |
| 4805 |
* new Popper(referenceObject, popperNode); |
| 4806 |
* ``` |
| 4807 |
* |
| 4808 |
* NB: This feature isn't supported in Internet Explorer 10. |
| 4809 |
* @name referenceObject |
| 4810 |
* @property {Function} data.getBoundingClientRect |
| 4811 |
* A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. |
| 4812 |
* @property {number} data.clientWidth |
| 4813 |
* An ES6 getter that will return the width of the virtual reference element. |
| 4814 |
* @property {number} data.clientHeight |
| 4815 |
* An ES6 getter that will return the height of the virtual reference element. |
| 4816 |
*/ |
| 4817 |
|
| 4818 |
|
| 4819 |
Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; |
| 4820 |
Popper.placements = placements; |
| 4821 |
Popper.Defaults = Defaults; |
| 4822 |
|
| 4823 |
/**! |
| 4824 |
* tippy.js v5.0.0-beta.1 |
| 4825 |
* (c) 2017-2019 atomiks |
| 4826 |
* MIT License |
| 4827 |
*/ |
| 4828 |
|
| 4829 |
var version = "5.0.0-beta.1"; |
| 4830 |
|
| 4831 |
var idCounter = 1; // Workaround for IE11's lack of new MouseEvent constructor |
| 4832 |
|
| 4833 |
var mouseMoveListeners = []; |
| 4834 |
/** |
| 4835 |
* Creates and returns a Tippy object. We're using a closure pattern instead of |
| 4836 |
* a class so that the exposed object API is clean without private members |
| 4837 |
* prefixed with `_`. |
| 4838 |
*/ |
| 4839 |
|
| 4840 |
function createTippy(reference, collectionProps) { |
| 4841 |
var props = evaluateProps(reference, collectionProps); // If the reference shouldn't have multiple tippys, return null early |
| 4842 |
|
| 4843 |
if (!props.multiple && reference._tippy) { |
| 4844 |
return null; |
| 4845 |
} |
| 4846 |
/* ======================= 🔒 Private members 🔒 ======================= */ |
| 4847 |
|
| 4848 |
|
| 4849 |
var lastTriggerEventType; |
| 4850 |
var showTimeout; |
| 4851 |
var hideTimeout; |
| 4852 |
var scheduleHideAnimationFrame; |
| 4853 |
var isBeingDestroyed = false; |
| 4854 |
var hasMountCallbackRun = false; |
| 4855 |
var didHideDueToDocumentMouseDown = false; |
| 4856 |
var currentMountCallback; |
| 4857 |
var currentTransitionEndListener; |
| 4858 |
var listeners = []; |
| 4859 |
var debouncedOnMouseMove = debounce(onMouseMove, props.interactiveDebounce); |
| 4860 |
/* ======================= 🔑 Public members 🔑 ======================= */ |
| 4861 |
|
| 4862 |
var id = idCounter++; |
| 4863 |
var popper = createPopperElement(id, props); |
| 4864 |
var popperChildren = getChildren(popper); |
| 4865 |
var popperInstance = null; // These two elements are static |
| 4866 |
|
| 4867 |
var tooltip = popperChildren.tooltip, |
| 4868 |
content = popperChildren.content; |
| 4869 |
var state = { |
| 4870 |
// The current real placement (`data-placement` attribute) |
| 4871 |
currentPlacement: props.placement, |
| 4872 |
// Does the instance have a pending timeout for show()? |
| 4873 |
isScheduledToShow: false, |
| 4874 |
// Is the instance currently enabled? |
| 4875 |
isEnabled: true, |
| 4876 |
// Is the tippy currently showing and not transitioning out? |
| 4877 |
isVisible: false, |
| 4878 |
// Has the instance been destroyed? |
| 4879 |
isDestroyed: false, |
| 4880 |
// Is the tippy currently mounted to the DOM? |
| 4881 |
isMounted: false, |
| 4882 |
// Has the tippy finished transitioning in? |
| 4883 |
isShown: false |
| 4884 |
}; |
| 4885 |
var instance = { |
| 4886 |
// properties |
| 4887 |
id: id, |
| 4888 |
reference: reference, |
| 4889 |
popper: popper, |
| 4890 |
popperChildren: popperChildren, |
| 4891 |
popperInstance: popperInstance, |
| 4892 |
props: props, |
| 4893 |
state: state, |
| 4894 |
// methods |
| 4895 |
clearDelayTimeouts: clearDelayTimeouts, |
| 4896 |
setProps: setProps, |
| 4897 |
setContent: setContent, |
| 4898 |
show: show, |
| 4899 |
hide: hide, |
| 4900 |
enable: enable, |
| 4901 |
disable: disable, |
| 4902 |
destroy: destroy |
| 4903 |
}; |
| 4904 |
/* ==================== Initial instance mutations =================== */ |
| 4905 |
|
| 4906 |
|
| 4907 |
reference._tippy = instance; |
| 4908 |
popper._tippy = instance; |
| 4909 |
addTriggersToEventListenersTarget(); |
| 4910 |
|
| 4911 |
if (!props.lazy) { |
| 4912 |
createPopperInstance(); |
| 4913 |
} |
| 4914 |
|
| 4915 |
if (props.showOnCreate) { |
| 4916 |
scheduleShow(); |
| 4917 |
} // Prevent a tippy with a delay from hiding if the cursor left then returned |
| 4918 |
// before it started hiding |
| 4919 |
|
| 4920 |
|
| 4921 |
popper.addEventListener('mouseenter', function () { |
| 4922 |
if (instance.props.interactive && instance.state.isVisible && lastTriggerEventType === 'mouseenter') { |
| 4923 |
instance.clearDelayTimeouts(); |
| 4924 |
} |
| 4925 |
}); |
| 4926 |
popper.addEventListener('mouseleave', function () { |
| 4927 |
if (instance.props.interactive && lastTriggerEventType === 'mouseenter') { |
| 4928 |
document.addEventListener('mousemove', debouncedOnMouseMove); |
| 4929 |
} |
| 4930 |
}); |
| 4931 |
props.onCreate(instance); |
| 4932 |
return instance; |
| 4933 |
/* ======================= 🔒 Private methods 🔒 ======================= */ |
| 4934 |
|
| 4935 |
function getNormalizedTouchSettings() { |
| 4936 |
var touch = instance.props.touch; |
| 4937 |
return Array.isArray(touch) ? touch : [touch, 0]; |
| 4938 |
} |
| 4939 |
|
| 4940 |
function getIsCustomTouchBehavior() { |
| 4941 |
return getNormalizedTouchSettings()[0] === 'hold'; |
| 4942 |
} |
| 4943 |
|
| 4944 |
function getTransitionableElements() { |
| 4945 |
return [tooltip, content, instance.popperChildren.backdrop]; |
| 4946 |
} |
| 4947 |
|
| 4948 |
function getEventListenersTarget() { |
| 4949 |
return instance.props.triggerTarget || reference; |
| 4950 |
} |
| 4951 |
|
| 4952 |
function cleanupInteractiveMouseListeners() { |
| 4953 |
document.body.removeEventListener('mouseleave', scheduleHide); |
| 4954 |
document.removeEventListener('mousemove', debouncedOnMouseMove); |
| 4955 |
mouseMoveListeners = mouseMoveListeners.filter(function (listener) { |
| 4956 |
return listener !== debouncedOnMouseMove; |
| 4957 |
}); |
| 4958 |
} |
| 4959 |
|
| 4960 |
function onDocumentMouseDown(event) { |
| 4961 |
// Clicked on interactive popper |
| 4962 |
if (instance.props.interactive && popper.contains(event.target)) { |
| 4963 |
return; |
| 4964 |
} // Clicked on the event listeners target |
| 4965 |
|
| 4966 |
|
| 4967 |
if (getEventListenersTarget().contains(event.target)) { |
| 4968 |
if (currentInput.isTouch) { |
| 4969 |
return; |
| 4970 |
} |
| 4971 |
|
| 4972 |
if (instance.state.isVisible && includes(instance.props.trigger, 'click')) { |
| 4973 |
return; |
| 4974 |
} |
| 4975 |
} |
| 4976 |
|
| 4977 |
if (instance.props.hideOnClick === true) { |
| 4978 |
instance.clearDelayTimeouts(); |
| 4979 |
instance.hide(); // `mousedown` event is fired right before `focus`. This lets a tippy with |
| 4980 |
// `focus` trigger know that it should not show |
| 4981 |
|
| 4982 |
didHideDueToDocumentMouseDown = true; |
| 4983 |
setTimeout(function () { |
| 4984 |
didHideDueToDocumentMouseDown = false; |
| 4985 |
}); // The listener gets added in `scheduleShow()`, but this may be hiding it |
| 4986 |
// before it shows, and hide()'s early bail-out behavior can prevent it |
| 4987 |
// from being cleaned up |
| 4988 |
|
| 4989 |
if (!instance.state.isMounted) { |
| 4990 |
removeDocumentMouseDownListener(); |
| 4991 |
} |
| 4992 |
} |
| 4993 |
} |
| 4994 |
|
| 4995 |
function addDocumentMouseDownListener() { |
| 4996 |
document.addEventListener('mousedown', onDocumentMouseDown, true); |
| 4997 |
} |
| 4998 |
|
| 4999 |
function removeDocumentMouseDownListener() { |
| 5000 |
document.removeEventListener('mousedown', onDocumentMouseDown, true); |
| 5001 |
} |
| 5002 |
|
| 5003 |
function makeSticky() { |
| 5004 |
setTransitionDuration([popper], isIE ? 0 : instance.props.updateDuration); |
| 5005 |
var prevRefRect = reference.getBoundingClientRect(); |
| 5006 |
|
| 5007 |
function updatePosition() { |
| 5008 |
var currentRefRect = reference.getBoundingClientRect(); // Only schedule an update if the reference rect has changed |
| 5009 |
|
| 5010 |
if (prevRefRect.top !== currentRefRect.top || prevRefRect.right !== currentRefRect.right || prevRefRect.bottom !== currentRefRect.bottom || prevRefRect.left !== currentRefRect.left) { |
| 5011 |
instance.popperInstance.scheduleUpdate(); |
| 5012 |
} |
| 5013 |
|
| 5014 |
prevRefRect = currentRefRect; |
| 5015 |
|
| 5016 |
if (instance.state.isMounted) { |
| 5017 |
requestAnimationFrame(updatePosition); |
| 5018 |
} |
| 5019 |
} |
| 5020 |
|
| 5021 |
updatePosition(); |
| 5022 |
} |
| 5023 |
|
| 5024 |
function onTransitionedOut(duration, callback) { |
| 5025 |
onTransitionEnd(duration, function () { |
| 5026 |
if (!instance.state.isVisible && popper.parentNode && popper.parentNode.contains(popper)) { |
| 5027 |
callback(); |
| 5028 |
} |
| 5029 |
}); |
| 5030 |
} |
| 5031 |
|
| 5032 |
function onTransitionedIn(duration, callback) { |
| 5033 |
onTransitionEnd(duration, callback); |
| 5034 |
} |
| 5035 |
|
| 5036 |
function onTransitionEnd(duration, callback) { |
| 5037 |
/** |
| 5038 |
* Listener added as the `transitionend` handler |
| 5039 |
*/ |
| 5040 |
function listener(event) { |
| 5041 |
if (event.target === tooltip) { |
| 5042 |
updateTransitionEndListener(tooltip, 'remove', listener); |
| 5043 |
callback(); |
| 5044 |
} |
| 5045 |
} // Make callback synchronous if duration is 0 |
| 5046 |
// `transitionend` won't fire otherwise |
| 5047 |
|
| 5048 |
|
| 5049 |
if (duration === 0) { |
| 5050 |
return callback(); |
| 5051 |
} |
| 5052 |
|
| 5053 |
updateTransitionEndListener(tooltip, 'remove', currentTransitionEndListener); |
| 5054 |
updateTransitionEndListener(tooltip, 'add', listener); |
| 5055 |
currentTransitionEndListener = listener; |
| 5056 |
} |
| 5057 |
|
| 5058 |
function on(eventType, handler, options) { |
| 5059 |
if (options === void 0) { |
| 5060 |
options = false; |
| 5061 |
} |
| 5062 |
|
| 5063 |
getEventListenersTarget().addEventListener(eventType, handler, options); |
| 5064 |
listeners.push({ |
| 5065 |
eventType: eventType, |
| 5066 |
handler: handler, |
| 5067 |
options: options |
| 5068 |
}); |
| 5069 |
} |
| 5070 |
|
| 5071 |
function addTriggersToEventListenersTarget() { |
| 5072 |
if (getIsCustomTouchBehavior()) { |
| 5073 |
on('touchstart', onTrigger, PASSIVE); |
| 5074 |
on('touchend', onMouseLeave, PASSIVE); |
| 5075 |
} // `click` for keyboard. Mouse uses `mousedown` (onDocumentMouseDown) |
| 5076 |
|
| 5077 |
|
| 5078 |
if (!includes(instance.props.trigger, 'click')) { |
| 5079 |
on('click', function () { |
| 5080 |
if (!currentInput.isTouch && instance.props.hideOnClick === true) { |
| 5081 |
instance.hide(); |
| 5082 |
} |
| 5083 |
}); |
| 5084 |
} |
| 5085 |
|
| 5086 |
instance.props.trigger.trim().split(' ').forEach(function (eventType) { |
| 5087 |
if (eventType === 'manual') { |
| 5088 |
return; |
| 5089 |
} |
| 5090 |
|
| 5091 |
on(eventType, onTrigger); |
| 5092 |
|
| 5093 |
switch (eventType) { |
| 5094 |
case 'mouseenter': |
| 5095 |
on('mouseleave', onMouseLeave); |
| 5096 |
break; |
| 5097 |
|
| 5098 |
case 'focus': |
| 5099 |
on(isIE ? 'focusout' : 'blur', onBlur); |
| 5100 |
break; |
| 5101 |
} |
| 5102 |
}); |
| 5103 |
} |
| 5104 |
|
| 5105 |
function removeTriggersFromEventListenersTarget() { |
| 5106 |
listeners.forEach(function (_ref) { |
| 5107 |
var eventType = _ref.eventType, |
| 5108 |
handler = _ref.handler, |
| 5109 |
options = _ref.options; |
| 5110 |
getEventListenersTarget().removeEventListener(eventType, handler, options); |
| 5111 |
}); |
| 5112 |
listeners = []; |
| 5113 |
} |
| 5114 |
|
| 5115 |
function onTrigger(event) { |
| 5116 |
if (didHideDueToDocumentMouseDown || !instance.state.isEnabled || isEventListenerStopped(event)) { |
| 5117 |
return; |
| 5118 |
} |
| 5119 |
|
| 5120 |
if (!instance.state.isVisible) { |
| 5121 |
lastTriggerEventType = event.type; |
| 5122 |
|
| 5123 |
if (event instanceof MouseEvent) { |
| 5124 |
// If scrolling, `mouseenter` events can be fired if the cursor lands |
| 5125 |
// over a new target, but `mousemove` events don't get fired. This |
| 5126 |
// causes interactive tooltips to get stuck open until the cursor is |
| 5127 |
// moved |
| 5128 |
mouseMoveListeners.forEach(function (listener) { |
| 5129 |
return listener(event); |
| 5130 |
}); |
| 5131 |
} |
| 5132 |
} // Toggle show/hide when clicking click-triggered tooltips |
| 5133 |
|
| 5134 |
|
| 5135 |
if (event.type === 'click' && instance.props.hideOnClick !== false && instance.state.isVisible) { |
| 5136 |
scheduleHide(event); |
| 5137 |
} else { |
| 5138 |
var _getNormalizedTouchSe = getNormalizedTouchSettings(), |
| 5139 |
value = _getNormalizedTouchSe[0], |
| 5140 |
duration = _getNormalizedTouchSe[1]; |
| 5141 |
|
| 5142 |
if (currentInput.isTouch && value === 'hold' && duration) { |
| 5143 |
// We can hijack the show timeout here, it will be cleared by |
| 5144 |
// `scheduleHide()` when necessary |
| 5145 |
showTimeout = setTimeout(function () { |
| 5146 |
scheduleShow(event); |
| 5147 |
}, duration); |
| 5148 |
} else { |
| 5149 |
scheduleShow(event); |
| 5150 |
} |
| 5151 |
} |
| 5152 |
} |
| 5153 |
|
| 5154 |
function onMouseMove(event) { |
| 5155 |
var isCursorOverReferenceOrPopper = closestCallback(event.target, function (el) { |
| 5156 |
return el === reference || el === popper; |
| 5157 |
}); |
| 5158 |
|
| 5159 |
if (isCursorOverReferenceOrPopper) { |
| 5160 |
return; |
| 5161 |
} |
| 5162 |
|
| 5163 |
if (isCursorOutsideInteractiveBorder(getBasePlacement(instance.state.currentPlacement), popper.getBoundingClientRect(), event, instance.props)) { |
| 5164 |
cleanupInteractiveMouseListeners(); |
| 5165 |
scheduleHide(event); |
| 5166 |
} |
| 5167 |
} |
| 5168 |
|
| 5169 |
function onMouseLeave(event) { |
| 5170 |
if (isEventListenerStopped(event)) { |
| 5171 |
return; |
| 5172 |
} |
| 5173 |
|
| 5174 |
if (instance.props.interactive) { |
| 5175 |
document.body.addEventListener('mouseleave', scheduleHide); |
| 5176 |
document.addEventListener('mousemove', debouncedOnMouseMove); |
| 5177 |
mouseMoveListeners.push(debouncedOnMouseMove); |
| 5178 |
return; |
| 5179 |
} |
| 5180 |
|
| 5181 |
scheduleHide(event); |
| 5182 |
} |
| 5183 |
|
| 5184 |
function onBlur(event) { |
| 5185 |
if (event.target !== getEventListenersTarget()) { |
| 5186 |
return; |
| 5187 |
} // If focus was moved to within the popper |
| 5188 |
|
| 5189 |
|
| 5190 |
if (instance.props.interactive && event.relatedTarget && popper.contains(event.relatedTarget)) { |
| 5191 |
return; |
| 5192 |
} |
| 5193 |
|
| 5194 |
scheduleHide(event); |
| 5195 |
} |
| 5196 |
|
| 5197 |
function isEventListenerStopped(event) { |
| 5198 |
var supportsTouch = 'ontouchstart' in window; |
| 5199 |
var isTouchEvent = includes(event.type, 'touch'); |
| 5200 |
var isCustomTouch = getIsCustomTouchBehavior(); |
| 5201 |
return supportsTouch && currentInput.isTouch && isCustomTouch && !isTouchEvent || currentInput.isTouch && !isCustomTouch && isTouchEvent; |
| 5202 |
} |
| 5203 |
|
| 5204 |
function createPopperInstance() { |
| 5205 |
var popperOptions = instance.props.popperOptions; |
| 5206 |
var arrow = instance.popperChildren.arrow; |
| 5207 |
var preventOverflowModifier = getModifier(popperOptions, 'preventOverflow'); |
| 5208 |
|
| 5209 |
function applyMutations(data) { |
| 5210 |
instance.state.currentPlacement = data.placement; |
| 5211 |
|
| 5212 |
if (instance.props.flip && !instance.props.flipOnUpdate) { |
| 5213 |
if (data.flipped) { |
| 5214 |
instance.popperInstance.options.placement = data.placement; |
| 5215 |
} |
| 5216 |
|
| 5217 |
setFlipModifierEnabled(instance.popperInstance.modifiers, false); |
| 5218 |
} |
| 5219 |
|
| 5220 |
tooltip.setAttribute('data-placement', data.placement); |
| 5221 |
|
| 5222 |
if (data.attributes['x-out-of-boundaries'] !== false) { |
| 5223 |
tooltip.setAttribute('data-out-of-boundaries', ''); |
| 5224 |
} else { |
| 5225 |
tooltip.removeAttribute('data-out-of-boundaries'); |
| 5226 |
} |
| 5227 |
|
| 5228 |
var basePlacement = getBasePlacement(data.placement); |
| 5229 |
var isVerticalPlacement = includes(['top', 'bottom'], basePlacement); |
| 5230 |
var isSecondaryPlacement = includes(['bottom', 'right'], basePlacement); // Apply `distance` prop |
| 5231 |
|
| 5232 |
var tooltipStyles = tooltip.style; |
| 5233 |
tooltipStyles.top = '0'; |
| 5234 |
tooltipStyles.left = '0'; |
| 5235 |
tooltipStyles[isVerticalPlacement ? 'top' : 'left'] = (isSecondaryPlacement ? 1 : -1) * instance.props.distance + "px"; |
| 5236 |
} |
| 5237 |
|
| 5238 |
var config = _extends$1({ |
| 5239 |
eventsEnabled: false, |
| 5240 |
placement: instance.props.placement |
| 5241 |
}, popperOptions, { |
| 5242 |
modifiers: _extends$1({}, popperOptions && popperOptions.modifiers, { |
| 5243 |
preventOverflow: _extends$1({ |
| 5244 |
boundariesElement: instance.props.boundary, |
| 5245 |
padding: PREVENT_OVERFLOW_PADDING |
| 5246 |
}, preventOverflowModifier), |
| 5247 |
// Adds the `distance` calculation to preventOverflow padding |
| 5248 |
tippySetPreventOverflowPadding: { |
| 5249 |
enabled: true, |
| 5250 |
order: 299, |
| 5251 |
fn: function fn(data) { |
| 5252 |
var basePlacement = getBasePlacement(data.placement); |
| 5253 |
var padding = preventOverflowModifier && preventOverflowModifier.padding !== undefined ? preventOverflowModifier.padding : PREVENT_OVERFLOW_PADDING; |
| 5254 |
var isPaddingNumber = typeof padding === 'number'; |
| 5255 |
var paddingObject = { |
| 5256 |
top: 0, |
| 5257 |
bottom: 0, |
| 5258 |
left: 0, |
| 5259 |
right: 0 |
| 5260 |
}; |
| 5261 |
var computedPadding = Object.keys(paddingObject).reduce(function (obj, key) { |
| 5262 |
obj[key] = isPaddingNumber ? padding : padding[key]; |
| 5263 |
|
| 5264 |
if (basePlacement === key) { |
| 5265 |
obj[key] = isPaddingNumber ? padding + instance.props.distance : (padding[basePlacement] || 0) + instance.props.distance; |
| 5266 |
} |
| 5267 |
|
| 5268 |
return obj; |
| 5269 |
}, paddingObject); |
| 5270 |
instance.popperInstance.modifiers.filter(function (m) { |
| 5271 |
return m.name === 'preventOverflow'; |
| 5272 |
})[0].padding = computedPadding; |
| 5273 |
return data; |
| 5274 |
} |
| 5275 |
}, |
| 5276 |
arrow: _extends$1({ |
| 5277 |
element: arrow, |
| 5278 |
enabled: !!arrow |
| 5279 |
}, getModifier(popperOptions, 'arrow')), |
| 5280 |
flip: _extends$1({ |
| 5281 |
enabled: instance.props.flip, |
| 5282 |
padding: instance.props.distance + PREVENT_OVERFLOW_PADDING, |
| 5283 |
behavior: instance.props.flipBehavior |
| 5284 |
}, getModifier(popperOptions, 'flip')), |
| 5285 |
offset: _extends$1({ |
| 5286 |
offset: instance.props.offset |
| 5287 |
}, getModifier(popperOptions, 'offset')) |
| 5288 |
}), |
| 5289 |
onCreate: function onCreate(data) { |
| 5290 |
applyMutations(data); |
| 5291 |
preserveInvocation(popperOptions && popperOptions.onCreate, config.onCreate, [data]); |
| 5292 |
runMountCallback(); |
| 5293 |
}, |
| 5294 |
onUpdate: function onUpdate(data) { |
| 5295 |
applyMutations(data); |
| 5296 |
preserveInvocation(popperOptions && popperOptions.onUpdate, config.onUpdate, [data]); |
| 5297 |
runMountCallback(); |
| 5298 |
} |
| 5299 |
}); |
| 5300 |
|
| 5301 |
instance.popperInstance = new Popper(reference, popper, config); |
| 5302 |
} |
| 5303 |
|
| 5304 |
function runMountCallback() { |
| 5305 |
if (!hasMountCallbackRun && currentMountCallback) { |
| 5306 |
hasMountCallbackRun = true; |
| 5307 |
reflow(popper); |
| 5308 |
currentMountCallback(); |
| 5309 |
} |
| 5310 |
} |
| 5311 |
|
| 5312 |
function mount() { |
| 5313 |
// The mounting callback (`currentMountCallback`) is only run due to a |
| 5314 |
// popperInstance update/create |
| 5315 |
hasMountCallbackRun = false; |
| 5316 |
var appendTo = instance.props.appendTo; |
| 5317 |
var parentNode = appendTo === 'parent' ? reference.parentNode : invokeWithArgsOrReturn(appendTo, [reference]); // The popper element needs to exist on the DOM before its position can be |
| 5318 |
// updated as Popper.js needs to read its dimensions |
| 5319 |
|
| 5320 |
if (!parentNode.contains(popper)) { |
| 5321 |
parentNode.appendChild(popper); |
| 5322 |
} |
| 5323 |
|
| 5324 |
if (instance.popperInstance) { |
| 5325 |
setFlipModifierEnabled(instance.popperInstance.modifiers, instance.props.flip); |
| 5326 |
instance.popperInstance.enableEventListeners(); // Mounting callback invoked in `onUpdate` |
| 5327 |
|
| 5328 |
instance.popperInstance.scheduleUpdate(); |
| 5329 |
} else { |
| 5330 |
// Mounting callback invoked in `onCreate` |
| 5331 |
createPopperInstance(); |
| 5332 |
instance.popperInstance.enableEventListeners(); |
| 5333 |
} |
| 5334 |
} |
| 5335 |
|
| 5336 |
function scheduleShow(event) { |
| 5337 |
instance.clearDelayTimeouts(); |
| 5338 |
instance.state.isScheduledToShow = true; |
| 5339 |
|
| 5340 |
if (!instance.popperInstance) { |
| 5341 |
createPopperInstance(); |
| 5342 |
} |
| 5343 |
|
| 5344 |
if (event) { |
| 5345 |
instance.props.onTrigger(instance, event); |
| 5346 |
} |
| 5347 |
|
| 5348 |
addDocumentMouseDownListener(); |
| 5349 |
var delay = getValueAtIndexOrReturn(instance.props.delay, 0, defaultProps.delay); |
| 5350 |
|
| 5351 |
if (delay) { |
| 5352 |
showTimeout = setTimeout(function () { |
| 5353 |
instance.show(); |
| 5354 |
}, delay); |
| 5355 |
} else { |
| 5356 |
instance.show(); |
| 5357 |
} |
| 5358 |
} |
| 5359 |
|
| 5360 |
function scheduleHide(event) { |
| 5361 |
instance.clearDelayTimeouts(); |
| 5362 |
instance.props.onUntrigger(instance, event); |
| 5363 |
|
| 5364 |
if (!instance.state.isVisible) { |
| 5365 |
removeDocumentMouseDownListener(); |
| 5366 |
return; |
| 5367 |
} |
| 5368 |
|
| 5369 |
instance.state.isScheduledToShow = false; |
| 5370 |
var delay = getValueAtIndexOrReturn(instance.props.delay, 1, defaultProps.delay); |
| 5371 |
|
| 5372 |
if (delay) { |
| 5373 |
hideTimeout = setTimeout(function () { |
| 5374 |
if (instance.state.isVisible) { |
| 5375 |
instance.hide(); |
| 5376 |
} |
| 5377 |
}, delay); |
| 5378 |
} else { |
| 5379 |
// Fixes a `transitionend` problem when it fires 1 frame too |
| 5380 |
// late sometimes, we don't want hide() to be called. |
| 5381 |
scheduleHideAnimationFrame = requestAnimationFrame(function () { |
| 5382 |
instance.hide(); |
| 5383 |
}); |
| 5384 |
} |
| 5385 |
} |
| 5386 |
/* ======================= 🔑 Public methods 🔑 ======================= */ |
| 5387 |
|
| 5388 |
|
| 5389 |
function enable() { |
| 5390 |
instance.state.isEnabled = true; |
| 5391 |
} |
| 5392 |
|
| 5393 |
function disable() { |
| 5394 |
// Disabling the instance should also hide it |
| 5395 |
// https://github.com/atomiks/tippy.js-react/issues/106 |
| 5396 |
instance.hide(); |
| 5397 |
instance.state.isEnabled = false; |
| 5398 |
} |
| 5399 |
|
| 5400 |
function clearDelayTimeouts() { |
| 5401 |
clearTimeout(showTimeout); |
| 5402 |
clearTimeout(hideTimeout); |
| 5403 |
cancelAnimationFrame(scheduleHideAnimationFrame); |
| 5404 |
} // Cloning as we're deleting non-updateable props in DEV mode |
| 5405 |
|
| 5406 |
|
| 5407 |
function setProps(_ref2) { |
| 5408 |
var partialProps = _extends$1({}, _ref2); |
| 5409 |
|
| 5410 |
if (instance.state.isDestroyed) { |
| 5411 |
return; |
| 5412 |
} |
| 5413 |
|
| 5414 |
removeTriggersFromEventListenersTarget(); |
| 5415 |
var prevProps = instance.props; |
| 5416 |
var nextProps = evaluateProps(reference, _extends$1({}, instance.props, {}, partialProps, { |
| 5417 |
ignoreAttributes: true |
| 5418 |
})); |
| 5419 |
nextProps.ignoreAttributes = hasOwnProperty$1(partialProps, 'ignoreAttributes') ? partialProps.ignoreAttributes || false : prevProps.ignoreAttributes; |
| 5420 |
instance.props = nextProps; |
| 5421 |
addTriggersToEventListenersTarget(); |
| 5422 |
cleanupInteractiveMouseListeners(); |
| 5423 |
debouncedOnMouseMove = debounce(onMouseMove, nextProps.interactiveDebounce); |
| 5424 |
updatePopperElement(popper, prevProps, nextProps, instance.state.isVisible); |
| 5425 |
instance.popperChildren = getChildren(popper); |
| 5426 |
|
| 5427 |
if (instance.popperInstance) { |
| 5428 |
if (POPPER_INSTANCE_DEPENDENCIES.some(function (prop) { |
| 5429 |
return hasOwnProperty$1(partialProps, prop) && partialProps[prop] !== prevProps[prop]; |
| 5430 |
})) { |
| 5431 |
instance.popperInstance.destroy(); |
| 5432 |
createPopperInstance(); |
| 5433 |
|
| 5434 |
if (instance.state.isVisible) { |
| 5435 |
instance.popperInstance.enableEventListeners(); |
| 5436 |
} |
| 5437 |
} else { |
| 5438 |
instance.popperInstance.update(); |
| 5439 |
} |
| 5440 |
} |
| 5441 |
} |
| 5442 |
|
| 5443 |
function setContent(content) { |
| 5444 |
instance.setProps({ |
| 5445 |
content: content |
| 5446 |
}); |
| 5447 |
} |
| 5448 |
|
| 5449 |
function show(duration, shouldPreventPopperTransition) { |
| 5450 |
if (duration === void 0) { |
| 5451 |
duration = getValueAtIndexOrReturn(instance.props.duration, 0, defaultProps.duration); |
| 5452 |
} |
| 5453 |
|
| 5454 |
if (shouldPreventPopperTransition === void 0) { |
| 5455 |
shouldPreventPopperTransition = true; |
| 5456 |
} |
| 5457 |
|
| 5458 |
|
| 5459 |
var isAlreadyVisible = instance.state.isVisible; |
| 5460 |
var isDestroyed = instance.state.isDestroyed; |
| 5461 |
var isDisabled = !instance.state.isEnabled; |
| 5462 |
var isTouchAndTouchDisabled = currentInput.isTouch && !instance.props.touch; |
| 5463 |
|
| 5464 |
if (isAlreadyVisible || isDestroyed || isDisabled || isTouchAndTouchDisabled) { |
| 5465 |
return; |
| 5466 |
} // Normalize `disabled` behavior across browsers. |
| 5467 |
// Firefox allows events on disabled elements, but Chrome doesn't. |
| 5468 |
// Using a wrapper element (i.e. <span>) is recommended. |
| 5469 |
|
| 5470 |
|
| 5471 |
if (getEventListenersTarget().hasAttribute('disabled')) { |
| 5472 |
return; |
| 5473 |
} |
| 5474 |
|
| 5475 |
if (instance.props.onShow(instance) === false) { |
| 5476 |
return; |
| 5477 |
} |
| 5478 |
|
| 5479 |
addDocumentMouseDownListener(); |
| 5480 |
popper.style.visibility = 'visible'; |
| 5481 |
instance.state.isVisible = true; // Prevent a transition of the popper from its previous position and of the |
| 5482 |
// elements at a different placement. |
| 5483 |
|
| 5484 |
var transitionableElements = getTransitionableElements(); |
| 5485 |
setTransitionDuration(shouldPreventPopperTransition ? transitionableElements.concat(popper) : transitionableElements, 0); |
| 5486 |
|
| 5487 |
currentMountCallback = function currentMountCallback() { |
| 5488 |
if (!instance.state.isVisible) { |
| 5489 |
return; |
| 5490 |
} // Double update will apply correct mutations |
| 5491 |
|
| 5492 |
|
| 5493 |
instance.popperInstance.update(); |
| 5494 |
instance.props.onMount(instance); |
| 5495 |
instance.state.isMounted = true; // The content should fade in after the backdrop has mostly filled the |
| 5496 |
// tooltip element. `clip-path` is the other alternative but is not well- |
| 5497 |
// supported and is buggy on some devices. |
| 5498 |
|
| 5499 |
content.style.transitionDelay = instance.popperChildren.backdrop ? Math.round(duration / 12) + "ms" : ''; |
| 5500 |
|
| 5501 |
if (instance.props.sticky) { |
| 5502 |
makeSticky(); |
| 5503 |
} |
| 5504 |
|
| 5505 |
setTransitionDuration([popper], instance.props.updateDuration); |
| 5506 |
setTransitionDuration(transitionableElements, duration); |
| 5507 |
setVisibilityState(transitionableElements, 'visible'); |
| 5508 |
onTransitionedIn(duration, function () { |
| 5509 |
if (instance.props.aria) { |
| 5510 |
var node = getEventListenersTarget(); |
| 5511 |
var attrName = "aria-" + instance.props.aria; |
| 5512 |
var currentAttrValue = node.getAttribute(attrName); |
| 5513 |
var nextAttrValue = currentAttrValue ? currentAttrValue + " " + tooltip.id : tooltip.id; |
| 5514 |
node.setAttribute(attrName, nextAttrValue); |
| 5515 |
} |
| 5516 |
|
| 5517 |
instance.props.onShown(instance); |
| 5518 |
instance.state.isShown = true; |
| 5519 |
}); |
| 5520 |
}; |
| 5521 |
|
| 5522 |
mount(); |
| 5523 |
} |
| 5524 |
|
| 5525 |
function hide(duration) { |
| 5526 |
if (duration === void 0) { |
| 5527 |
duration = getValueAtIndexOrReturn(instance.props.duration, 1, defaultProps.duration); |
| 5528 |
} |
| 5529 |
|
| 5530 |
|
| 5531 |
var isAlreadyHidden = !instance.state.isVisible && !isBeingDestroyed; |
| 5532 |
var isDestroyed = instance.state.isDestroyed; |
| 5533 |
var isDisabled = !instance.state.isEnabled && !isBeingDestroyed; |
| 5534 |
|
| 5535 |
if (isAlreadyHidden || isDestroyed || isDisabled) { |
| 5536 |
return; |
| 5537 |
} |
| 5538 |
|
| 5539 |
if (instance.props.onHide(instance) === false && !isBeingDestroyed) { |
| 5540 |
return; |
| 5541 |
} |
| 5542 |
|
| 5543 |
removeDocumentMouseDownListener(); |
| 5544 |
popper.style.visibility = 'hidden'; |
| 5545 |
instance.state.isVisible = false; |
| 5546 |
instance.state.isShown = false; |
| 5547 |
var transitionableElements = getTransitionableElements(); |
| 5548 |
setTransitionDuration(transitionableElements, duration); |
| 5549 |
setVisibilityState(transitionableElements, 'hidden'); |
| 5550 |
onTransitionedOut(duration, function () { |
| 5551 |
if (instance.props.aria) { |
| 5552 |
var node = getEventListenersTarget(); |
| 5553 |
var attrName = "aria-" + instance.props.aria; |
| 5554 |
var currentAttrValue = node.getAttribute(attrName); |
| 5555 |
var nextAttrValue = currentAttrValue ? currentAttrValue.replace(tooltip.id, '').trim() : null; |
| 5556 |
|
| 5557 |
if (nextAttrValue) { |
| 5558 |
node.setAttribute(attrName, nextAttrValue); |
| 5559 |
} else { |
| 5560 |
node.removeAttribute(attrName); |
| 5561 |
} |
| 5562 |
} |
| 5563 |
|
| 5564 |
instance.popperInstance.disableEventListeners(); |
| 5565 |
instance.popperInstance.options.placement = instance.props.placement; |
| 5566 |
popper.parentNode.removeChild(popper); |
| 5567 |
instance.props.onHidden(instance); |
| 5568 |
instance.state.isMounted = false; |
| 5569 |
}); |
| 5570 |
} |
| 5571 |
|
| 5572 |
function destroy() { |
| 5573 |
|
| 5574 |
if (instance.state.isDestroyed) { |
| 5575 |
return; |
| 5576 |
} |
| 5577 |
|
| 5578 |
isBeingDestroyed = true; |
| 5579 |
instance.hide(0); |
| 5580 |
removeTriggersFromEventListenersTarget(); |
| 5581 |
delete reference._tippy; |
| 5582 |
|
| 5583 |
if (instance.popperInstance) { |
| 5584 |
instance.popperInstance.destroy(); |
| 5585 |
} |
| 5586 |
|
| 5587 |
isBeingDestroyed = false; |
| 5588 |
instance.state.isDestroyed = true; |
| 5589 |
} |
| 5590 |
} |
| 5591 |
|
| 5592 |
/** |
| 5593 |
* Exported module |
| 5594 |
*/ |
| 5595 |
function tippy(targets, optionalProps) { |
| 5596 |
|
| 5597 |
bindGlobalEventListeners(); |
| 5598 |
|
| 5599 |
var props = _extends$1({}, defaultProps, {}, optionalProps); |
| 5600 |
|
| 5601 |
var elements = getArrayOfElements(targets); |
| 5602 |
|
| 5603 |
var instances = elements.reduce(function (acc, reference) { |
| 5604 |
var instance = reference && createTippy(reference, props); |
| 5605 |
|
| 5606 |
if (instance) { |
| 5607 |
|
| 5608 |
acc.push(instance); |
| 5609 |
} |
| 5610 |
|
| 5611 |
return acc; |
| 5612 |
}, []); |
| 5613 |
return isRealElement(targets) ? instances[0] : instances; |
| 5614 |
} |
| 5615 |
|
| 5616 |
tippy.version = version; |
| 5617 |
tippy.defaultProps = defaultProps; |
| 5618 |
tippy.currentInput = currentInput; |
| 5619 |
/** |
| 5620 |
* Mutates the defaultProps object by setting the props specified |
| 5621 |
*/ |
| 5622 |
|
| 5623 |
tippy.setDefaultProps = function (partialProps) { |
| 5624 |
|
| 5625 |
Object.keys(partialProps).forEach(function (key) { |
| 5626 |
// @ts-ignore |
| 5627 |
defaultProps[key] = partialProps[key]; |
| 5628 |
}); |
| 5629 |
}; |
| 5630 |
/** |
| 5631 |
* Hides all visible poppers on the document |
| 5632 |
*/ |
| 5633 |
|
| 5634 |
|
| 5635 |
tippy.hideAll = function (_temp) { |
| 5636 |
var _ref = _temp === void 0 ? {} : _temp, |
| 5637 |
excludedReferenceOrInstance = _ref.exclude, |
| 5638 |
duration = _ref.duration; |
| 5639 |
|
| 5640 |
arrayFrom(document.querySelectorAll(POPPER_SELECTOR)).forEach(function (popper) { |
| 5641 |
var instance = popper._tippy; |
| 5642 |
|
| 5643 |
if (instance) { |
| 5644 |
var isExcluded = false; |
| 5645 |
|
| 5646 |
if (excludedReferenceOrInstance) { |
| 5647 |
isExcluded = isReferenceElement(excludedReferenceOrInstance) ? instance.reference === excludedReferenceOrInstance : popper === excludedReferenceOrInstance.popper; |
| 5648 |
} |
| 5649 |
|
| 5650 |
if (!isExcluded) { |
| 5651 |
instance.hide(duration); |
| 5652 |
} |
| 5653 |
} |
| 5654 |
}); |
| 5655 |
}; |
| 5656 |
/** |
| 5657 |
* Auto-init tooltips for elements with a `data-tippy="..."` attribute |
| 5658 |
*/ |
| 5659 |
|
| 5660 |
|
| 5661 |
function autoInit() { |
| 5662 |
arrayFrom(document.querySelectorAll('[data-tippy]')).forEach(function (el) { |
| 5663 |
var content = el.getAttribute('data-tippy'); |
| 5664 |
|
| 5665 |
if (content) { |
| 5666 |
tippy(el, { |
| 5667 |
content: content |
| 5668 |
}); |
| 5669 |
} |
| 5670 |
}); |
| 5671 |
} |
| 5672 |
|
| 5673 |
if (isBrowser) { |
| 5674 |
setTimeout(autoInit); |
| 5675 |
} |
| 5676 |
|
| 5677 |
/**! |
| 5678 |
* tippy.js v5.0.0-beta.1 |
| 5679 |
* (c) 2017-2019 atomiks |
| 5680 |
* MIT License |
| 5681 |
*/ |
| 5682 |
|
| 5683 |
var css = ".tippy-tooltip[data-animation=fade][data-state=hidden]{opacity:0}.tippy-iOS{cursor:pointer!important;-webkit-tap-highlight-color:transparent}.tippy-popper{pointer-events:none;max-width:calc(100% - 10px);transition-timing-function:cubic-bezier(.165,.84,.44,1)}.tippy-tooltip{position:relative;color:#fff;border-radius:.25rem;font-size:.875rem;line-height:1.4;background-color:#333;overflow:hidden;transition-property:visibility,opacity,transform;outline:0}.tippy-tooltip[data-placement^=top] .tippy-arrow{border-width:8px 8px 0;border-top-color:#333;margin:0 3px;transform-origin:50% 0;bottom:-7px}.tippy-tooltip[data-placement^=bottom] .tippy-arrow{border-width:0 8px 8px;border-bottom-color:#333;margin:0 3px;transform-origin:50% 7px;top:-7px}.tippy-tooltip[data-placement^=left] .tippy-arrow{border-width:8px 0 8px 8px;border-left-color:#333;margin:3px 0;transform-origin:0 50%;right:-7px}.tippy-tooltip[data-placement^=right] .tippy-arrow{border-width:8px 8px 8px 0;border-right-color:#333;margin:3px 0;transform-origin:7px 50%;left:-7px}.tippy-tooltip[data-arrow]{overflow:visible}.tippy-tooltip[data-animatefill]{background-color:transparent!important}.tippy-tooltip[data-interactive]{pointer-events:auto}.tippy-tooltip[data-inertia][data-state=visible]{transition-timing-function:cubic-bezier(.54,1.5,.38,1.11)}.tippy-tooltip[data-inertia][data-state=hidden]{transition-timing-function:ease}.tippy-arrow{border-color:transparent;border-style:solid;position:absolute}.tippy-arrow[data-state=hidden]{opacity:0}.tippy-content{padding:.3125rem .5625rem}"; |
| 5684 |
|
| 5685 |
/** |
| 5686 |
* Injects a string of CSS styles to a style node in <head> |
| 5687 |
*/ |
| 5688 |
function injectCSS(css) { |
| 5689 |
var style = document.createElement('style'); |
| 5690 |
style.textContent = css; |
| 5691 |
style.setAttribute('data-tippy-stylesheet', ''); |
| 5692 |
var head = document.head; |
| 5693 |
var firstStyleOrLinkTag = head.querySelector('style,link'); |
| 5694 |
|
| 5695 |
if (firstStyleOrLinkTag) { |
| 5696 |
head.insertBefore(style, firstStyleOrLinkTag); |
| 5697 |
} else { |
| 5698 |
head.appendChild(style); |
| 5699 |
} |
| 5700 |
} |
| 5701 |
|
| 5702 |
if (isBrowser) { |
| 5703 |
injectCSS(css); |
| 5704 |
} |
| 5705 |
|
| 5706 |
/** |
| 5707 |
* Ensure class prefix ends in `-` |
| 5708 |
* @param {string} prefix The prefix to prepend to the class names generated by nano-css |
| 5709 |
* @return {string} The prefix ending in `-` |
| 5710 |
*/ |
| 5711 |
|
| 5712 |
function normalizePrefix(prefix) { |
| 5713 |
if (!isString(prefix) || prefix === '') { |
| 5714 |
return ''; |
| 5715 |
} |
| 5716 |
|
| 5717 |
return prefix.charAt(prefix.length - 1) !== '-' ? prefix + "-" : prefix; |
| 5718 |
} |
| 5719 |
/** |
| 5720 |
* Checks if options.attachTo.element is a string, and if so, tries to find the element |
| 5721 |
* @param {Step} step The step instance |
| 5722 |
* @returns {{element, on}} |
| 5723 |
* `element` is a qualified HTML Element |
| 5724 |
* `on` is a string position value |
| 5725 |
*/ |
| 5726 |
|
| 5727 |
function parseAttachTo(step) { |
| 5728 |
var options = step.options.attachTo || {}; |
| 5729 |
|
| 5730 |
var returnOpts = _extends({}, options); |
| 5731 |
|
| 5732 |
if (isString(options.element)) { |
| 5733 |
// Can't override the element in user opts reference because we can't |
| 5734 |
// guarantee that the element will exist in the future. |
| 5735 |
try { |
| 5736 |
returnOpts.element = document.querySelector(options.element); |
| 5737 |
} catch (e) {// TODO |
| 5738 |
} |
| 5739 |
|
| 5740 |
if (!returnOpts.element) { |
| 5741 |
console.error("The element for this Shepherd step was not found " + options.element); |
| 5742 |
} |
| 5743 |
} |
| 5744 |
|
| 5745 |
return returnOpts; |
| 5746 |
} |
| 5747 |
/** |
| 5748 |
* Determines options for the tooltip and initializes |
| 5749 |
* `step.tooltip` as a Tippy.js instance. |
| 5750 |
* @param {Step} step The step instance |
| 5751 |
*/ |
| 5752 |
|
| 5753 |
function setupTooltip(step) { |
| 5754 |
if (isUndefined(tippy)) { |
| 5755 |
throw new Error('Using the attachment feature of Shepherd requires the Tippy.js library'); |
| 5756 |
} |
| 5757 |
|
| 5758 |
if (step.tooltip) { |
| 5759 |
step.tooltip.destroy(); |
| 5760 |
} |
| 5761 |
|
| 5762 |
var attachToOpts = parseAttachTo(step); |
| 5763 |
step.tooltip = _makeTippyInstance(attachToOpts, step); |
| 5764 |
step.target = attachToOpts.element; |
| 5765 |
} |
| 5766 |
/** |
| 5767 |
* Generates a `Tippy` instance from a set of base `attachTo` options |
| 5768 |
* @param attachToOptions |
| 5769 |
* @param {Step} step The step instance |
| 5770 |
* @return {tippy|Instance | Instance[]} The final tippy instance |
| 5771 |
* @private |
| 5772 |
*/ |
| 5773 |
|
| 5774 |
function _makeTippyInstance(attachToOptions, step) { |
| 5775 |
var tippyOptions = {}; |
| 5776 |
var element = document.body; |
| 5777 |
|
| 5778 |
if (!attachToOptions.element || !attachToOptions.on) { |
| 5779 |
tippyOptions = makeCenteredTippy(step); |
| 5780 |
} else { |
| 5781 |
tippyOptions = makeAttachedTippyOptions(attachToOptions, step); |
| 5782 |
element = attachToOptions.element; |
| 5783 |
} |
| 5784 |
|
| 5785 |
return tippy(element, tippyOptions); |
| 5786 |
} |
| 5787 |
|
| 5788 |
/** |
| 5789 |
* Remove any leftover modal target classes and add the modal target class to the currentElement |
| 5790 |
* @param {HTMLElement} currentElement The element for the current step |
| 5791 |
* @param {string} classPrefix The prefix to add to the class name |
| 5792 |
*/ |
| 5793 |
function toggleShepherdModalClass(currentElement, classPrefix) { |
| 5794 |
var shepherdModalTarget = document.querySelector("." + classPrefix + "shepherd-modal-target"); |
| 5795 |
|
| 5796 |
if (shepherdModalTarget) { |
| 5797 |
shepherdModalTarget.classList.remove(classPrefix + "shepherd-modal-target"); |
| 5798 |
} |
| 5799 |
|
| 5800 |
currentElement.classList.add(classPrefix + "shepherd-modal-target"); |
| 5801 |
} |
| 5802 |
|
| 5803 |
var Component$1 = preact.Component; |
| 5804 |
|
| 5805 |
var ShepherdButton = |
| 5806 |
/*#__PURE__*/ |
| 5807 |
function (_Component) { |
| 5808 |
_inheritsLoose(ShepherdButton, _Component); |
| 5809 |
|
| 5810 |
function ShepherdButton() { |
| 5811 |
return _Component.apply(this, arguments) || this; |
| 5812 |
} |
| 5813 |
|
| 5814 |
var _proto = ShepherdButton.prototype; |
| 5815 |
|
| 5816 |
_proto.render = function render(props) { |
| 5817 |
var classPrefix = props.classPrefix, |
| 5818 |
config = props.config, |
| 5819 |
step = props.step, |
| 5820 |
styles = props.styles; |
| 5821 |
var action = config.action, |
| 5822 |
classes = config.classes, |
| 5823 |
secondary = config.secondary, |
| 5824 |
text = config.text; |
| 5825 |
return preact.h("button", { |
| 5826 |
className: (classes || '') + styles.button + (secondary ? " " + classPrefix + "shepherd-button-secondary" : ''), |
| 5827 |
onClick: action ? action.bind(step.tour) : null, |
| 5828 |
tabindex: "0" |
| 5829 |
}, text); |
| 5830 |
}; |
| 5831 |
|
| 5832 |
return ShepherdButton; |
| 5833 |
}(Component$1); |
| 5834 |
|
| 5835 |
var Component$2 = preact.Component; |
| 5836 |
|
| 5837 |
var ShepherdFooter = |
| 5838 |
/*#__PURE__*/ |
| 5839 |
function (_Component) { |
| 5840 |
_inheritsLoose(ShepherdFooter, _Component); |
| 5841 |
|
| 5842 |
function ShepherdFooter() { |
| 5843 |
return _Component.apply(this, arguments) || this; |
| 5844 |
} |
| 5845 |
|
| 5846 |
var _proto = ShepherdFooter.prototype; |
| 5847 |
|
| 5848 |
_proto.render = function render(props) { |
| 5849 |
var classPrefix = props.classPrefix, |
| 5850 |
step = props.step, |
| 5851 |
styles = props.styles; |
| 5852 |
var buttons = step.options.buttons; |
| 5853 |
return preact.h("footer", { |
| 5854 |
className: styles.footer.trim() |
| 5855 |
}, this._addButtons(buttons, classPrefix, step, styles)); |
| 5856 |
}; |
| 5857 |
|
| 5858 |
_proto._addButtons = function _addButtons(buttons, classPrefix, step, styles) { |
| 5859 |
if (buttons) { |
| 5860 |
return buttons.map(function (config) { |
| 5861 |
return preact.h(ShepherdButton, { |
| 5862 |
classPrefix: classPrefix, |
| 5863 |
config: config, |
| 5864 |
key: config.toString(), |
| 5865 |
step: step, |
| 5866 |
styles: styles |
| 5867 |
}); |
| 5868 |
}); |
| 5869 |
} |
| 5870 |
|
| 5871 |
return null; |
| 5872 |
}; |
| 5873 |
|
| 5874 |
return ShepherdFooter; |
| 5875 |
}(Component$2); |
| 5876 |
|
| 5877 |
var Component$3 = preact.Component; |
| 5878 |
|
| 5879 |
var ShepherdHeader = |
| 5880 |
/*#__PURE__*/ |
| 5881 |
function (_Component) { |
| 5882 |
_inheritsLoose(ShepherdHeader, _Component); |
| 5883 |
|
| 5884 |
function ShepherdHeader(props) { |
| 5885 |
var _this; |
| 5886 |
|
| 5887 |
_this = _Component.call(this, props) || this; |
| 5888 |
_this.step = props.step; |
| 5889 |
_this.handleCancelClick = _this.handleCancelClick.bind(_assertThisInitialized(_this)); |
| 5890 |
return _this; |
| 5891 |
} |
| 5892 |
|
| 5893 |
var _proto = ShepherdHeader.prototype; |
| 5894 |
|
| 5895 |
_proto.render = function render(props) { |
| 5896 |
var labelId = props.labelId, |
| 5897 |
step = props.step, |
| 5898 |
styles = props.styles; |
| 5899 |
var _step$options = step.options, |
| 5900 |
cancelIcon = _step$options.cancelIcon, |
| 5901 |
title = _step$options.title; |
| 5902 |
return preact.h("header", { |
| 5903 |
className: styles.header.trim() |
| 5904 |
}, this.constructor._addTitle(labelId, styles, title), this._addCancelLink(cancelIcon, styles)); |
| 5905 |
} |
| 5906 |
/** |
| 5907 |
* Add a click listener to the cancel link that cancels the tour |
| 5908 |
*/ |
| 5909 |
; |
| 5910 |
|
| 5911 |
_proto.handleCancelClick = function handleCancelClick(e) { |
| 5912 |
e.preventDefault(); |
| 5913 |
this.step.cancel(); |
| 5914 |
}; |
| 5915 |
|
| 5916 |
ShepherdHeader._addTitle = function _addTitle(labelId, styles, title) { |
| 5917 |
if (title) { |
| 5918 |
return preact.h("h3", { |
| 5919 |
id: labelId, |
| 5920 |
className: styles.title.trim() |
| 5921 |
}, title); |
| 5922 |
} |
| 5923 |
|
| 5924 |
return null; |
| 5925 |
} |
| 5926 |
/** |
| 5927 |
* If enabled, add the cancel "x" icon |
| 5928 |
* @param {object} cancelIcon The options for the cancel icon |
| 5929 |
* @param styles |
| 5930 |
* @return {null|*} |
| 5931 |
* @private |
| 5932 |
*/ |
| 5933 |
; |
| 5934 |
|
| 5935 |
_proto._addCancelLink = function _addCancelLink(cancelIcon, styles) { |
| 5936 |
if (cancelIcon && cancelIcon.enabled) { |
| 5937 |
return preact.h("button", { |
| 5938 |
"aria-label": cancelIcon.label ? cancelIcon.label : 'Close Tour', |
| 5939 |
className: styles['cancel-icon'].trim(), |
| 5940 |
onClick: this.handleCancelClick, |
| 5941 |
type: "button" |
| 5942 |
}, preact.h("span", { |
| 5943 |
"aria-hidden": "true" |
| 5944 |
}, "\xD7")); |
| 5945 |
} |
| 5946 |
|
| 5947 |
return null; |
| 5948 |
}; |
| 5949 |
|
| 5950 |
return ShepherdHeader; |
| 5951 |
}(Component$3); |
| 5952 |
|
| 5953 |
var Component$4 = preact.Component; |
| 5954 |
|
| 5955 |
var ShepherdText = |
| 5956 |
/*#__PURE__*/ |
| 5957 |
function (_Component) { |
| 5958 |
_inheritsLoose(ShepherdText, _Component); |
| 5959 |
|
| 5960 |
function ShepherdText() { |
| 5961 |
return _Component.apply(this, arguments) || this; |
| 5962 |
} |
| 5963 |
|
| 5964 |
var _proto = ShepherdText.prototype; |
| 5965 |
|
| 5966 |
_proto.shouldComponentUpdate = function shouldComponentUpdate() { |
| 5967 |
return false; |
| 5968 |
}; |
| 5969 |
|
| 5970 |
_proto.componentDidMount = function componentDidMount() { |
| 5971 |
var step = this.props.step; |
| 5972 |
var text = step.options.text; |
| 5973 |
|
| 5974 |
if (isFunction(text)) { |
| 5975 |
text = text.call(step); |
| 5976 |
} |
| 5977 |
|
| 5978 |
if (isElement(text)) { |
| 5979 |
this.base.appendChild(text); |
| 5980 |
} |
| 5981 |
}; |
| 5982 |
|
| 5983 |
_proto.render = function render(props) { |
| 5984 |
var descriptionId = props.descriptionId, |
| 5985 |
step = props.step, |
| 5986 |
styles = props.styles; |
| 5987 |
var text = step.options.text; |
| 5988 |
|
| 5989 |
if (isFunction(text)) { |
| 5990 |
text = text.call(step); |
| 5991 |
} |
| 5992 |
|
| 5993 |
return preact.h("div", { |
| 5994 |
className: styles.text.trim(), |
| 5995 |
dangerouslySetInnerHTML: { |
| 5996 |
__html: !isElement(text) ? text : null |
| 5997 |
}, |
| 5998 |
id: descriptionId |
| 5999 |
}); |
| 6000 |
}; |
| 6001 |
|
| 6002 |
return ShepherdText; |
| 6003 |
}(Component$4); |
| 6004 |
|
| 6005 |
var Component$5 = preact.Component; |
| 6006 |
|
| 6007 |
var ShepherdContent = |
| 6008 |
/*#__PURE__*/ |
| 6009 |
function (_Component) { |
| 6010 |
_inheritsLoose(ShepherdContent, _Component); |
| 6011 |
|
| 6012 |
function ShepherdContent() { |
| 6013 |
return _Component.apply(this, arguments) || this; |
| 6014 |
} |
| 6015 |
|
| 6016 |
var _proto = ShepherdContent.prototype; |
| 6017 |
|
| 6018 |
_proto.render = function render(props) { |
| 6019 |
var classPrefix = props.classPrefix, |
| 6020 |
descriptionId = props.descriptionId, |
| 6021 |
labelId = props.labelId, |
| 6022 |
step = props.step, |
| 6023 |
styles = props.styles; |
| 6024 |
return preact.h("div", { |
| 6025 |
className: styles.content.trim() |
| 6026 |
}, preact.h(ShepherdHeader, { |
| 6027 |
labelId: labelId, |
| 6028 |
step: step, |
| 6029 |
styles: styles |
| 6030 |
}), ShepherdContent._addShepherdText(descriptionId, step, styles), ShepherdContent._addShepherdFooter(classPrefix, step, styles)); |
| 6031 |
}; |
| 6032 |
|
| 6033 |
ShepherdContent._addShepherdText = function _addShepherdText(descriptionId, step, styles) { |
| 6034 |
if (!isUndefined(step.options.text)) { |
| 6035 |
return preact.h(ShepherdText, { |
| 6036 |
descriptionId: descriptionId, |
| 6037 |
step: step, |
| 6038 |
styles: styles |
| 6039 |
}); |
| 6040 |
} |
| 6041 |
|
| 6042 |
return null; |
| 6043 |
}; |
| 6044 |
|
| 6045 |
ShepherdContent._addShepherdFooter = function _addShepherdFooter(classPrefix, step, styles) { |
| 6046 |
if (Array.isArray(step.options.buttons) && step.options.buttons.length) { |
| 6047 |
return preact.h(ShepherdFooter, { |
| 6048 |
classPrefix: classPrefix, |
| 6049 |
step: step, |
| 6050 |
styles: styles |
| 6051 |
}); |
| 6052 |
} |
| 6053 |
|
| 6054 |
return null; |
| 6055 |
}; |
| 6056 |
|
| 6057 |
return ShepherdContent; |
| 6058 |
}(Component$5); |
| 6059 |
|
| 6060 |
var Component$6 = preact.Component; |
| 6061 |
var KEY_TAB = 9; |
| 6062 |
var KEY_ESC = 27; |
| 6063 |
var LEFT_ARROW = 37; |
| 6064 |
var RIGHT_ARROW = 39; |
| 6065 |
|
| 6066 |
var ShepherdElement = |
| 6067 |
/*#__PURE__*/ |
| 6068 |
function (_Component) { |
| 6069 |
_inheritsLoose(ShepherdElement, _Component); |
| 6070 |
|
| 6071 |
function ShepherdElement(props) { |
| 6072 |
var _this; |
| 6073 |
|
| 6074 |
_this = _Component.call(this, props) || this; |
| 6075 |
_this.step = props.step; |
| 6076 |
_this.handleKeyDown = _this.handleKeyDown.bind(_assertThisInitialized(_this)); |
| 6077 |
return _this; |
| 6078 |
} |
| 6079 |
|
| 6080 |
var _proto = ShepherdElement.prototype; |
| 6081 |
|
| 6082 |
_proto.componentDidMount = function componentDidMount() { |
| 6083 |
// Get all elements that are focusable |
| 6084 |
var focusableElements = this.element.querySelectorAll('a[href], area[href], input:not([disabled]), select:not([disabled]), textarea:not([disabled]), button:not([disabled]), [tabindex="0"]'); |
| 6085 |
var firstFocusableElement = focusableElements[0]; |
| 6086 |
var lastFocusableElement = focusableElements[focusableElements.length - 1]; |
| 6087 |
this.focusableElements = focusableElements; |
| 6088 |
this.firstFocusableElement = firstFocusableElement; |
| 6089 |
this.lastFocusableElement = lastFocusableElement; |
| 6090 |
}; |
| 6091 |
|
| 6092 |
_proto.render = function render(props) { |
| 6093 |
var _dataStepId, |
| 6094 |
_this2 = this; |
| 6095 |
|
| 6096 |
var classes = props.classes, |
| 6097 |
classPrefix = props.classPrefix, |
| 6098 |
descriptionId = props.descriptionId, |
| 6099 |
labelId = props.labelId, |
| 6100 |
step = props.step, |
| 6101 |
styles = props.styles; |
| 6102 |
var dataStepId = (_dataStepId = {}, _dataStepId["data-" + classPrefix + "shepherd-step-id"] = step.id, _dataStepId); |
| 6103 |
return preact.h("div", _extends({ |
| 6104 |
"aria-describedby": !isUndefined(step.options.text) ? descriptionId : null, |
| 6105 |
"aria-labeledby": step.options.title ? labelId : null, |
| 6106 |
className: classes + styles.element |
| 6107 |
}, dataStepId, { |
| 6108 |
onKeyDown: this.handleKeyDown, |
| 6109 |
ref: function ref(c) { |
| 6110 |
return _this2.element = c; |
| 6111 |
}, |
| 6112 |
role: "dialog", |
| 6113 |
tabindex: "0" |
| 6114 |
}), preact.h(ShepherdContent, { |
| 6115 |
classPrefix: classPrefix, |
| 6116 |
descriptionId: descriptionId, |
| 6117 |
labelId: labelId, |
| 6118 |
step: step, |
| 6119 |
styles: styles |
| 6120 |
})); |
| 6121 |
} |
| 6122 |
/** |
| 6123 |
* Setup keydown events to allow closing the modal with ESC |
| 6124 |
* |
| 6125 |
* Borrowed from this great post! https://bitsofco.de/accessible-modal-dialog/ |
| 6126 |
* |
| 6127 |
* @private |
| 6128 |
*/ |
| 6129 |
; |
| 6130 |
|
| 6131 |
_proto.handleKeyDown = function handleKeyDown(e) { |
| 6132 |
var tour = this.step.tour; |
| 6133 |
|
| 6134 |
switch (e.keyCode) { |
| 6135 |
case KEY_TAB: |
| 6136 |
if (this.focusableElements.length === 1) { |
| 6137 |
e.preventDefault(); |
| 6138 |
break; |
| 6139 |
} // Backward tab |
| 6140 |
|
| 6141 |
|
| 6142 |
if (e.shiftKey) { |
| 6143 |
if (document.activeElement === this.firstFocusableElement) { |
| 6144 |
e.preventDefault(); |
| 6145 |
this.lastFocusableElement.focus(); |
| 6146 |
} |
| 6147 |
} else { |
| 6148 |
if (document.activeElement === this.lastFocusableElement) { |
| 6149 |
e.preventDefault(); |
| 6150 |
this.firstFocusableElement.focus(); |
| 6151 |
} |
| 6152 |
} |
| 6153 |
|
| 6154 |
break; |
| 6155 |
|
| 6156 |
case KEY_ESC: |
| 6157 |
if (tour.options.exitOnEsc) { |
| 6158 |
this.step.cancel(); |
| 6159 |
} |
| 6160 |
|
| 6161 |
break; |
| 6162 |
|
| 6163 |
case LEFT_ARROW: |
| 6164 |
if (tour.options.keyboardNavigation) { |
| 6165 |
tour.back(); |
| 6166 |
} |
| 6167 |
|
| 6168 |
break; |
| 6169 |
|
| 6170 |
case RIGHT_ARROW: |
| 6171 |
if (tour.options.keyboardNavigation) { |
| 6172 |
tour.next(); |
| 6173 |
} |
| 6174 |
|
| 6175 |
break; |
| 6176 |
|
| 6177 |
default: |
| 6178 |
break; |
| 6179 |
} |
| 6180 |
}; |
| 6181 |
|
| 6182 |
return ShepherdElement; |
| 6183 |
}(Component$6); |
| 6184 |
|
| 6185 |
if (!Element.prototype.matches) { |
| 6186 |
Element.prototype.matches = |
| 6187 |
Element.prototype.matchesSelector || |
| 6188 |
Element.prototype.msMatchesSelector || |
| 6189 |
Element.prototype.webkitMatchesSelector; |
| 6190 |
} |
| 6191 |
|
| 6192 |
var smoothscroll = createCommonjsModule(function (module, exports) { |
| 6193 |
/* smoothscroll v0.4.4 - 2019 - Dustan Kasten, Jeremias Menichelli - MIT License */ |
| 6194 |
(function () { |
| 6195 |
|
| 6196 |
// polyfill |
| 6197 |
function polyfill() { |
| 6198 |
// aliases |
| 6199 |
var w = window; |
| 6200 |
var d = document; |
| 6201 |
|
| 6202 |
// return if scroll behavior is supported and polyfill is not forced |
| 6203 |
if ( |
| 6204 |
'scrollBehavior' in d.documentElement.style && |
| 6205 |
w.__forceSmoothScrollPolyfill__ !== true |
| 6206 |
) { |
| 6207 |
return; |
| 6208 |
} |
| 6209 |
|
| 6210 |
// globals |
| 6211 |
var Element = w.HTMLElement || w.Element; |
| 6212 |
var SCROLL_TIME = 468; |
| 6213 |
|
| 6214 |
// object gathering original scroll methods |
| 6215 |
var original = { |
| 6216 |
scroll: w.scroll || w.scrollTo, |
| 6217 |
scrollBy: w.scrollBy, |
| 6218 |
elementScroll: Element.prototype.scroll || scrollElement, |
| 6219 |
scrollIntoView: Element.prototype.scrollIntoView |
| 6220 |
}; |
| 6221 |
|
| 6222 |
// define timing method |
| 6223 |
var now = |
| 6224 |
w.performance && w.performance.now |
| 6225 |
? w.performance.now.bind(w.performance) |
| 6226 |
: Date.now; |
| 6227 |
|
| 6228 |
/** |
| 6229 |
* indicates if a the current browser is made by Microsoft |
| 6230 |
* @method isMicrosoftBrowser |
| 6231 |
* @param {String} userAgent |
| 6232 |
* @returns {Boolean} |
| 6233 |
*/ |
| 6234 |
function isMicrosoftBrowser(userAgent) { |
| 6235 |
var userAgentPatterns = ['MSIE ', 'Trident/', 'Edge/']; |
| 6236 |
|
| 6237 |
return new RegExp(userAgentPatterns.join('|')).test(userAgent); |
| 6238 |
} |
| 6239 |
|
| 6240 |
/* |
| 6241 |
* IE has rounding bug rounding down clientHeight and clientWidth and |
| 6242 |
* rounding up scrollHeight and scrollWidth causing false positives |
| 6243 |
* on hasScrollableSpace |
| 6244 |
*/ |
| 6245 |
var ROUNDING_TOLERANCE = isMicrosoftBrowser(w.navigator.userAgent) ? 1 : 0; |
| 6246 |
|
| 6247 |
/** |
| 6248 |
* changes scroll position inside an element |
| 6249 |
* @method scrollElement |
| 6250 |
* @param {Number} x |
| 6251 |
* @param {Number} y |
| 6252 |
* @returns {undefined} |
| 6253 |
*/ |
| 6254 |
function scrollElement(x, y) { |
| 6255 |
this.scrollLeft = x; |
| 6256 |
this.scrollTop = y; |
| 6257 |
} |
| 6258 |
|
| 6259 |
/** |
| 6260 |
* returns result of applying ease math function to a number |
| 6261 |
* @method ease |
| 6262 |
* @param {Number} k |
| 6263 |
* @returns {Number} |
| 6264 |
*/ |
| 6265 |
function ease(k) { |
| 6266 |
return 0.5 * (1 - Math.cos(Math.PI * k)); |
| 6267 |
} |
| 6268 |
|
| 6269 |
/** |
| 6270 |
* indicates if a smooth behavior should be applied |
| 6271 |
* @method shouldBailOut |
| 6272 |
* @param {Number|Object} firstArg |
| 6273 |
* @returns {Boolean} |
| 6274 |
*/ |
| 6275 |
function shouldBailOut(firstArg) { |
| 6276 |
if ( |
| 6277 |
firstArg === null || |
| 6278 |
typeof firstArg !== 'object' || |
| 6279 |
firstArg.behavior === undefined || |
| 6280 |
firstArg.behavior === 'auto' || |
| 6281 |
firstArg.behavior === 'instant' |
| 6282 |
) { |
| 6283 |
// first argument is not an object/null |
| 6284 |
// or behavior is auto, instant or undefined |
| 6285 |
return true; |
| 6286 |
} |
| 6287 |
|
| 6288 |
if (typeof firstArg === 'object' && firstArg.behavior === 'smooth') { |
| 6289 |
// first argument is an object and behavior is smooth |
| 6290 |
return false; |
| 6291 |
} |
| 6292 |
|
| 6293 |
// throw error when behavior is not supported |
| 6294 |
throw new TypeError( |
| 6295 |
'behavior member of ScrollOptions ' + |
| 6296 |
firstArg.behavior + |
| 6297 |
' is not a valid value for enumeration ScrollBehavior.' |
| 6298 |
); |
| 6299 |
} |
| 6300 |
|
| 6301 |
/** |
| 6302 |
* indicates if an element has scrollable space in the provided axis |
| 6303 |
* @method hasScrollableSpace |
| 6304 |
* @param {Node} el |
| 6305 |
* @param {String} axis |
| 6306 |
* @returns {Boolean} |
| 6307 |
*/ |
| 6308 |
function hasScrollableSpace(el, axis) { |
| 6309 |
if (axis === 'Y') { |
| 6310 |
return el.clientHeight + ROUNDING_TOLERANCE < el.scrollHeight; |
| 6311 |
} |
| 6312 |
|
| 6313 |
if (axis === 'X') { |
| 6314 |
return el.clientWidth + ROUNDING_TOLERANCE < el.scrollWidth; |
| 6315 |
} |
| 6316 |
} |
| 6317 |
|
| 6318 |
/** |
| 6319 |
* indicates if an element has a scrollable overflow property in the axis |
| 6320 |
* @method canOverflow |
| 6321 |
* @param {Node} el |
| 6322 |
* @param {String} axis |
| 6323 |
* @returns {Boolean} |
| 6324 |
*/ |
| 6325 |
function canOverflow(el, axis) { |
| 6326 |
var overflowValue = w.getComputedStyle(el, null)['overflow' + axis]; |
| 6327 |
|
| 6328 |
return overflowValue === 'auto' || overflowValue === 'scroll'; |
| 6329 |
} |
| 6330 |
|
| 6331 |
/** |
| 6332 |
* indicates if an element can be scrolled in either axis |
| 6333 |
* @method isScrollable |
| 6334 |
* @param {Node} el |
| 6335 |
* @param {String} axis |
| 6336 |
* @returns {Boolean} |
| 6337 |
*/ |
| 6338 |
function isScrollable(el) { |
| 6339 |
var isScrollableY = hasScrollableSpace(el, 'Y') && canOverflow(el, 'Y'); |
| 6340 |
var isScrollableX = hasScrollableSpace(el, 'X') && canOverflow(el, 'X'); |
| 6341 |
|
| 6342 |
return isScrollableY || isScrollableX; |
| 6343 |
} |
| 6344 |
|
| 6345 |
/** |
| 6346 |
* finds scrollable parent of an element |
| 6347 |
* @method findScrollableParent |
| 6348 |
* @param {Node} el |
| 6349 |
* @returns {Node} el |
| 6350 |
*/ |
| 6351 |
function findScrollableParent(el) { |
| 6352 |
while (el !== d.body && isScrollable(el) === false) { |
| 6353 |
el = el.parentNode || el.host; |
| 6354 |
} |
| 6355 |
|
| 6356 |
return el; |
| 6357 |
} |
| 6358 |
|
| 6359 |
/** |
| 6360 |
* self invoked function that, given a context, steps through scrolling |
| 6361 |
* @method step |
| 6362 |
* @param {Object} context |
| 6363 |
* @returns {undefined} |
| 6364 |
*/ |
| 6365 |
function step(context) { |
| 6366 |
var time = now(); |
| 6367 |
var value; |
| 6368 |
var currentX; |
| 6369 |
var currentY; |
| 6370 |
var elapsed = (time - context.startTime) / SCROLL_TIME; |
| 6371 |
|
| 6372 |
// avoid elapsed times higher than one |
| 6373 |
elapsed = elapsed > 1 ? 1 : elapsed; |
| 6374 |
|
| 6375 |
// apply easing to elapsed time |
| 6376 |
value = ease(elapsed); |
| 6377 |
|
| 6378 |
currentX = context.startX + (context.x - context.startX) * value; |
| 6379 |
currentY = context.startY + (context.y - context.startY) * value; |
| 6380 |
|
| 6381 |
context.method.call(context.scrollable, currentX, currentY); |
| 6382 |
|
| 6383 |
// scroll more if we have not reached our destination |
| 6384 |
if (currentX !== context.x || currentY !== context.y) { |
| 6385 |
w.requestAnimationFrame(step.bind(w, context)); |
| 6386 |
} |
| 6387 |
} |
| 6388 |
|
| 6389 |
/** |
| 6390 |
* scrolls window or element with a smooth behavior |
| 6391 |
* @method smoothScroll |
| 6392 |
* @param {Object|Node} el |
| 6393 |
* @param {Number} x |
| 6394 |
* @param {Number} y |
| 6395 |
* @returns {undefined} |
| 6396 |
*/ |
| 6397 |
function smoothScroll(el, x, y) { |
| 6398 |
var scrollable; |
| 6399 |
var startX; |
| 6400 |
var startY; |
| 6401 |
var method; |
| 6402 |
var startTime = now(); |
| 6403 |
|
| 6404 |
// define scroll context |
| 6405 |
if (el === d.body) { |
| 6406 |
scrollable = w; |
| 6407 |
startX = w.scrollX || w.pageXOffset; |
| 6408 |
startY = w.scrollY || w.pageYOffset; |
| 6409 |
method = original.scroll; |
| 6410 |
} else { |
| 6411 |
scrollable = el; |
| 6412 |
startX = el.scrollLeft; |
| 6413 |
startY = el.scrollTop; |
| 6414 |
method = scrollElement; |
| 6415 |
} |
| 6416 |
|
| 6417 |
// scroll looping over a frame |
| 6418 |
step({ |
| 6419 |
scrollable: scrollable, |
| 6420 |
method: method, |
| 6421 |
startTime: startTime, |
| 6422 |
startX: startX, |
| 6423 |
startY: startY, |
| 6424 |
x: x, |
| 6425 |
y: y |
| 6426 |
}); |
| 6427 |
} |
| 6428 |
|
| 6429 |
// ORIGINAL METHODS OVERRIDES |
| 6430 |
// w.scroll and w.scrollTo |
| 6431 |
w.scroll = w.scrollTo = function() { |
| 6432 |
// avoid action when no arguments are passed |
| 6433 |
if (arguments[0] === undefined) { |
| 6434 |
return; |
| 6435 |
} |
| 6436 |
|
| 6437 |
// avoid smooth behavior if not required |
| 6438 |
if (shouldBailOut(arguments[0]) === true) { |
| 6439 |
original.scroll.call( |
| 6440 |
w, |
| 6441 |
arguments[0].left !== undefined |
| 6442 |
? arguments[0].left |
| 6443 |
: typeof arguments[0] !== 'object' |
| 6444 |
? arguments[0] |
| 6445 |
: w.scrollX || w.pageXOffset, |
| 6446 |
// use top prop, second argument if present or fallback to scrollY |
| 6447 |
arguments[0].top !== undefined |
| 6448 |
? arguments[0].top |
| 6449 |
: arguments[1] !== undefined |
| 6450 |
? arguments[1] |
| 6451 |
: w.scrollY || w.pageYOffset |
| 6452 |
); |
| 6453 |
|
| 6454 |
return; |
| 6455 |
} |
| 6456 |
|
| 6457 |
// LET THE SMOOTHNESS BEGIN! |
| 6458 |
smoothScroll.call( |
| 6459 |
w, |
| 6460 |
d.body, |
| 6461 |
arguments[0].left !== undefined |
| 6462 |
? ~~arguments[0].left |
| 6463 |
: w.scrollX || w.pageXOffset, |
| 6464 |
arguments[0].top !== undefined |
| 6465 |
? ~~arguments[0].top |
| 6466 |
: w.scrollY || w.pageYOffset |
| 6467 |
); |
| 6468 |
}; |
| 6469 |
|
| 6470 |
// w.scrollBy |
| 6471 |
w.scrollBy = function() { |
| 6472 |
// avoid action when no arguments are passed |
| 6473 |
if (arguments[0] === undefined) { |
| 6474 |
return; |
| 6475 |
} |
| 6476 |
|
| 6477 |
// avoid smooth behavior if not required |
| 6478 |
if (shouldBailOut(arguments[0])) { |
| 6479 |
original.scrollBy.call( |
| 6480 |
w, |
| 6481 |
arguments[0].left !== undefined |
| 6482 |
? arguments[0].left |
| 6483 |
: typeof arguments[0] !== 'object' ? arguments[0] : 0, |
| 6484 |
arguments[0].top !== undefined |
| 6485 |
? arguments[0].top |
| 6486 |
: arguments[1] !== undefined ? arguments[1] : 0 |
| 6487 |
); |
| 6488 |
|
| 6489 |
return; |
| 6490 |
} |
| 6491 |
|
| 6492 |
// LET THE SMOOTHNESS BEGIN! |
| 6493 |
smoothScroll.call( |
| 6494 |
w, |
| 6495 |
d.body, |
| 6496 |
~~arguments[0].left + (w.scrollX || w.pageXOffset), |
| 6497 |
~~arguments[0].top + (w.scrollY || w.pageYOffset) |
| 6498 |
); |
| 6499 |
}; |
| 6500 |
|
| 6501 |
// Element.prototype.scroll and Element.prototype.scrollTo |
| 6502 |
Element.prototype.scroll = Element.prototype.scrollTo = function() { |
| 6503 |
// avoid action when no arguments are passed |
| 6504 |
if (arguments[0] === undefined) { |
| 6505 |
return; |
| 6506 |
} |
| 6507 |
|
| 6508 |
// avoid smooth behavior if not required |
| 6509 |
if (shouldBailOut(arguments[0]) === true) { |
| 6510 |
// if one number is passed, throw error to match Firefox implementation |
| 6511 |
if (typeof arguments[0] === 'number' && arguments[1] === undefined) { |
| 6512 |
throw new SyntaxError('Value could not be converted'); |
| 6513 |
} |
| 6514 |
|
| 6515 |
original.elementScroll.call( |
| 6516 |
this, |
| 6517 |
// use left prop, first number argument or fallback to scrollLeft |
| 6518 |
arguments[0].left !== undefined |
| 6519 |
? ~~arguments[0].left |
| 6520 |
: typeof arguments[0] !== 'object' ? ~~arguments[0] : this.scrollLeft, |
| 6521 |
// use top prop, second argument or fallback to scrollTop |
| 6522 |
arguments[0].top !== undefined |
| 6523 |
? ~~arguments[0].top |
| 6524 |
: arguments[1] !== undefined ? ~~arguments[1] : this.scrollTop |
| 6525 |
); |
| 6526 |
|
| 6527 |
return; |
| 6528 |
} |
| 6529 |
|
| 6530 |
var left = arguments[0].left; |
| 6531 |
var top = arguments[0].top; |
| 6532 |
|
| 6533 |
// LET THE SMOOTHNESS BEGIN! |
| 6534 |
smoothScroll.call( |
| 6535 |
this, |
| 6536 |
this, |
| 6537 |
typeof left === 'undefined' ? this.scrollLeft : ~~left, |
| 6538 |
typeof top === 'undefined' ? this.scrollTop : ~~top |
| 6539 |
); |
| 6540 |
}; |
| 6541 |
|
| 6542 |
// Element.prototype.scrollBy |
| 6543 |
Element.prototype.scrollBy = function() { |
| 6544 |
// avoid action when no arguments are passed |
| 6545 |
if (arguments[0] === undefined) { |
| 6546 |
return; |
| 6547 |
} |
| 6548 |
|
| 6549 |
// avoid smooth behavior if not required |
| 6550 |
if (shouldBailOut(arguments[0]) === true) { |
| 6551 |
original.elementScroll.call( |
| 6552 |
this, |
| 6553 |
arguments[0].left !== undefined |
| 6554 |
? ~~arguments[0].left + this.scrollLeft |
| 6555 |
: ~~arguments[0] + this.scrollLeft, |
| 6556 |
arguments[0].top !== undefined |
| 6557 |
? ~~arguments[0].top + this.scrollTop |
| 6558 |
: ~~arguments[1] + this.scrollTop |
| 6559 |
); |
| 6560 |
|
| 6561 |
return; |
| 6562 |
} |
| 6563 |
|
| 6564 |
this.scroll({ |
| 6565 |
left: ~~arguments[0].left + this.scrollLeft, |
| 6566 |
top: ~~arguments[0].top + this.scrollTop, |
| 6567 |
behavior: arguments[0].behavior |
| 6568 |
}); |
| 6569 |
}; |
| 6570 |
|
| 6571 |
// Element.prototype.scrollIntoView |
| 6572 |
Element.prototype.scrollIntoView = function() { |
| 6573 |
// avoid smooth behavior if not required |
| 6574 |
if (shouldBailOut(arguments[0]) === true) { |
| 6575 |
original.scrollIntoView.call( |
| 6576 |
this, |
| 6577 |
arguments[0] === undefined ? true : arguments[0] |
| 6578 |
); |
| 6579 |
|
| 6580 |
return; |
| 6581 |
} |
| 6582 |
|
| 6583 |
// LET THE SMOOTHNESS BEGIN! |
| 6584 |
var scrollableParent = findScrollableParent(this); |
| 6585 |
var parentRects = scrollableParent.getBoundingClientRect(); |
| 6586 |
var clientRects = this.getBoundingClientRect(); |
| 6587 |
|
| 6588 |
if (scrollableParent !== d.body) { |
| 6589 |
// reveal element inside parent |
| 6590 |
smoothScroll.call( |
| 6591 |
this, |
| 6592 |
scrollableParent, |
| 6593 |
scrollableParent.scrollLeft + clientRects.left - parentRects.left, |
| 6594 |
scrollableParent.scrollTop + clientRects.top - parentRects.top |
| 6595 |
); |
| 6596 |
|
| 6597 |
// reveal parent in viewport unless is fixed |
| 6598 |
if (w.getComputedStyle(scrollableParent).position !== 'fixed') { |
| 6599 |
w.scrollBy({ |
| 6600 |
left: parentRects.left, |
| 6601 |
top: parentRects.top, |
| 6602 |
behavior: 'smooth' |
| 6603 |
}); |
| 6604 |
} |
| 6605 |
} else { |
| 6606 |
// reveal element in viewport |
| 6607 |
w.scrollBy({ |
| 6608 |
left: clientRects.left, |
| 6609 |
top: clientRects.top, |
| 6610 |
behavior: 'smooth' |
| 6611 |
}); |
| 6612 |
} |
| 6613 |
}; |
| 6614 |
} |
| 6615 |
|
| 6616 |
{ |
| 6617 |
// commonjs |
| 6618 |
module.exports = { polyfill: polyfill }; |
| 6619 |
} |
| 6620 |
|
| 6621 |
}()); |
| 6622 |
}); |
| 6623 |
var smoothscroll_1 = smoothscroll.polyfill; |
| 6624 |
|
| 6625 |
smoothscroll.polyfill(); |
| 6626 |
var render$1 = preact.render; |
| 6627 |
/** |
| 6628 |
* Creates incremented ID for each newly created step |
| 6629 |
* |
| 6630 |
* @return {Function} A function that returns the unique id for the step |
| 6631 |
* @private |
| 6632 |
*/ |
| 6633 |
|
| 6634 |
var uniqueId = function () { |
| 6635 |
var id = 0; |
| 6636 |
return function () { |
| 6637 |
return ++id; |
| 6638 |
}; |
| 6639 |
}(); |
| 6640 |
/** |
| 6641 |
* A class representing steps to be added to a tour. |
| 6642 |
* @extends {Evented} |
| 6643 |
*/ |
| 6644 |
|
| 6645 |
|
| 6646 |
var Step = |
| 6647 |
/*#__PURE__*/ |
| 6648 |
function (_Evented) { |
| 6649 |
_inheritsLoose(Step, _Evented); |
| 6650 |
|
| 6651 |
/** |
| 6652 |
* Create a step |
| 6653 |
* @param {Tour} tour The tour for the step |
| 6654 |
* @param {Object} options The options for the step |
| 6655 |
* @param {Object} options.attachTo What element the step should be attached to on the page. |
| 6656 |
* It should be an object with the properties `element` and `on`, where `element` is an element selector string |
| 6657 |
* or a DOM element and `on` is the optional direction to place the Tippy tooltip. |
| 6658 |
* |
| 6659 |
* ```js |
| 6660 |
* const new Step(tour, { |
| 6661 |
* attachTo: { element: '.some .selector-path', on: 'left' }, |
| 6662 |
* ...moreOptions |
| 6663 |
* })' |
| 6664 |
* ``` |
| 6665 |
* |
| 6666 |
* If you don’t specify an attachTo the element will appear in the middle of the screen. |
| 6667 |
* If you omit the `on` portion of `attachTo`, the element will still be highlighted, but the tooltip will appear |
| 6668 |
* in the middle of the screen, without an arrow pointing to the target. |
| 6669 |
* @param {HTMLElement|string} options.attachTo.element |
| 6670 |
* @param {string} options.attachTo.on |
| 6671 |
* @param {Object} options.advanceOn An action on the page which should advance shepherd to the next step. |
| 6672 |
* It should be an object with a string `selector` and an `event` name |
| 6673 |
* ```js |
| 6674 |
* const new Step(tour, { |
| 6675 |
* advanceOn: { selector: '.some .selector-path', event: 'click' }, |
| 6676 |
* ...moreOptions |
| 6677 |
* })' |
| 6678 |
* ``` |
| 6679 |
* `event` doesn’t have to be an event inside the tour, it can be any event fired on any element on the page. |
| 6680 |
* You can also always manually advance the Tour by calling `myTour.next()`. |
| 6681 |
* @param {function} options.beforeShowPromise A function that returns a promise. |
| 6682 |
* When the promise resolves, the rest of the `show` code for the step will execute. |
| 6683 |
* @param {Object[]} options.buttons An array of buttons to add to the step. These will be rendered in a |
| 6684 |
* footer below the main body text. |
| 6685 |
* @param {function} options.buttons.button.action A function executed when the button is clicked on. |
| 6686 |
* It is automatically bound to the `tour` the step is associated with, so things like `this.next` will |
| 6687 |
* work inside the action. |
| 6688 |
* You can use action to skip steps or navigate to specific steps, with something like: |
| 6689 |
* ```js |
| 6690 |
* action() { |
| 6691 |
* return this.show('some_step_name'); |
| 6692 |
* } |
| 6693 |
* ``` |
| 6694 |
* @param {string} options.buttons.button.classes Extra classes to apply to the `<a>` |
| 6695 |
* @param {boolean} options.buttons.button.secondary If true, a shepherd-button-secondary class is applied to the button |
| 6696 |
* @param {string} options.buttons.button.text The HTML text of the button |
| 6697 |
* @param {boolean} options.canClickTarget A boolean, that when set to false, will set `pointer-events: none` on the target |
| 6698 |
* @param {object} options.cancelIcon Options for the cancel icon |
| 6699 |
* @param {boolean} options.cancelIcon.enabled Should a cancel “✕” be shown in the header of the step? |
| 6700 |
* @param {string} options.cancelIcon.label The label to add for `aria-label` |
| 6701 |
* @param {string} options.classes A string of extra classes to add to the step's content element. |
| 6702 |
* @param {string} options.highlightClass An extra class to apply to the `attachTo` element when it is |
| 6703 |
* highlighted (that is, when its step is active). You can then target that selector in your CSS. |
| 6704 |
* @param {string} options.id The string to use as the `id` for the step. |
| 6705 |
* @param {Object} options.tippyOptions Extra [options to pass to tippy.js]{@link https://atomiks.github.io/tippyjs/#all-options} |
| 6706 |
* @param {boolean|Object} options.scrollTo Should the element be scrolled to when this step is shown? If true, uses the default `scrollIntoView`, |
| 6707 |
* if an object, passes that object as the params to `scrollIntoView` i.e. `{behavior: 'smooth', block: 'center'}` |
| 6708 |
* @param {function} options.scrollToHandler A function that lets you override the default scrollTo behavior and |
| 6709 |
* define a custom action to do the scrolling, and possibly other logic. |
| 6710 |
* @param {function} options.showOn A function that, when it returns `true`, will show the step. |
| 6711 |
* If it returns false, the step will be skipped. |
| 6712 |
* @param {string} options.text The text in the body of the step. It can be one of three types: |
| 6713 |
* ``` |
| 6714 |
* - HTML string |
| 6715 |
* - `HTMLElement` object |
| 6716 |
* - `Function` to be executed when the step is built. It must return one the two options above. |
| 6717 |
* ``` |
| 6718 |
* @param {string} options.title The step's title. It becomes an `h3` at the top of the step. |
| 6719 |
* @param {Object} options.when You can define `show`, `hide`, etc events inside `when`. For example: |
| 6720 |
* ```js |
| 6721 |
* when: { |
| 6722 |
* show: function() { |
| 6723 |
* window.scrollTo(0, 0); |
| 6724 |
* } |
| 6725 |
* } |
| 6726 |
* ``` |
| 6727 |
* @param {Number} options.modalOverlayOpeningPadding An amount of padding to add around the modal overlay opening |
| 6728 |
* @return {Step} The newly created Step instance |
| 6729 |
*/ |
| 6730 |
function Step(tour, options) { |
| 6731 |
var _this; |
| 6732 |
|
| 6733 |
if (options === void 0) { |
| 6734 |
options = {}; |
| 6735 |
} |
| 6736 |
|
| 6737 |
_this = _Evented.call(this, tour, options) || this; |
| 6738 |
_this.tour = tour; |
| 6739 |
_this.classPrefix = _this.tour.options ? normalizePrefix(_this.tour.options.classPrefix) : ''; |
| 6740 |
_this.styles = tour.styles; |
| 6741 |
autoBind(_assertThisInitialized(_this)); |
| 6742 |
|
| 6743 |
_this._setOptions(options); |
| 6744 |
|
| 6745 |
return _assertThisInitialized(_this) || _assertThisInitialized(_this); |
| 6746 |
} |
| 6747 |
/** |
| 6748 |
* Cancel the tour |
| 6749 |
* Triggers the `cancel` event |
| 6750 |
*/ |
| 6751 |
|
| 6752 |
|
| 6753 |
var _proto = Step.prototype; |
| 6754 |
|
| 6755 |
_proto.cancel = function cancel() { |
| 6756 |
this.tour.cancel(); |
| 6757 |
this.trigger('cancel'); |
| 6758 |
} |
| 6759 |
/** |
| 6760 |
* Complete the tour |
| 6761 |
* Triggers the `complete` event |
| 6762 |
*/ |
| 6763 |
; |
| 6764 |
|
| 6765 |
_proto.complete = function complete() { |
| 6766 |
this.tour.complete(); |
| 6767 |
this.trigger('complete'); |
| 6768 |
} |
| 6769 |
/** |
| 6770 |
* Remove the step, delete the step's element, and destroy the tippy instance for the step |
| 6771 |
* Triggers `destroy` event |
| 6772 |
*/ |
| 6773 |
; |
| 6774 |
|
| 6775 |
_proto.destroy = function destroy() { |
| 6776 |
if (this.tooltip) { |
| 6777 |
this.tooltip.destroy(); |
| 6778 |
this.tooltip = null; |
| 6779 |
} |
| 6780 |
|
| 6781 |
if (isElement(this.el) && this.el.parentNode) { |
| 6782 |
this.el.parentNode.removeChild(this.el); |
| 6783 |
this.el = null; |
| 6784 |
} |
| 6785 |
|
| 6786 |
if (this.target) { |
| 6787 |
this._updateStepTargetOnHide(); |
| 6788 |
} |
| 6789 |
|
| 6790 |
this.trigger('destroy'); |
| 6791 |
} |
| 6792 |
/** |
| 6793 |
* Returns the tour for the step |
| 6794 |
* @return {Tour} The tour instance |
| 6795 |
*/ |
| 6796 |
; |
| 6797 |
|
| 6798 |
_proto.getTour = function getTour() { |
| 6799 |
return this.tour; |
| 6800 |
} |
| 6801 |
/** |
| 6802 |
* Hide the step and destroy the tippy instance |
| 6803 |
*/ |
| 6804 |
; |
| 6805 |
|
| 6806 |
_proto.hide = function hide() { |
| 6807 |
this.tour.modal.hide(); |
| 6808 |
this.trigger('before-hide'); |
| 6809 |
document.body.removeAttribute("data-" + this.classPrefix + "shepherd-step"); |
| 6810 |
|
| 6811 |
if (this.target) { |
| 6812 |
this._updateStepTargetOnHide(); |
| 6813 |
} |
| 6814 |
|
| 6815 |
if (this.tooltip) { |
| 6816 |
this.tooltip.hide(); |
| 6817 |
} |
| 6818 |
|
| 6819 |
this.trigger('hide'); |
| 6820 |
} |
| 6821 |
/** |
| 6822 |
* Check if the step is open and visible |
| 6823 |
* @return {boolean} True if the step is open and visible |
| 6824 |
*/ |
| 6825 |
; |
| 6826 |
|
| 6827 |
_proto.isOpen = function isOpen() { |
| 6828 |
return Boolean(this.tooltip && this.tooltip.state && this.tooltip.state.isVisible); |
| 6829 |
} |
| 6830 |
/** |
| 6831 |
* Wraps `_show` and ensures `beforeShowPromise` resolves before calling show |
| 6832 |
* @return {*|Promise} |
| 6833 |
*/ |
| 6834 |
; |
| 6835 |
|
| 6836 |
_proto.show = function show() { |
| 6837 |
var _this2 = this; |
| 6838 |
|
| 6839 |
if (isFunction(this.options.beforeShowPromise)) { |
| 6840 |
var beforeShowPromise = this.options.beforeShowPromise(); |
| 6841 |
|
| 6842 |
if (!isUndefined(beforeShowPromise)) { |
| 6843 |
return beforeShowPromise.then(function () { |
| 6844 |
return _this2._show(); |
| 6845 |
}); |
| 6846 |
} |
| 6847 |
} |
| 6848 |
|
| 6849 |
this._show(); |
| 6850 |
} |
| 6851 |
/** |
| 6852 |
* Creates Shepherd element for step based on options |
| 6853 |
* |
| 6854 |
* @return {Element} The DOM element for the step tooltip |
| 6855 |
* @private |
| 6856 |
*/ |
| 6857 |
; |
| 6858 |
|
| 6859 |
_proto._createTooltipContent = function _createTooltipContent() { |
| 6860 |
var cancelIconEnabled = getValue(this, 'options.cancelIcon.enabled'); |
| 6861 |
var classes = this.options.classes || ''; |
| 6862 |
var descriptionId = this.id + "-description"; |
| 6863 |
var labelId = this.id + "-label"; |
| 6864 |
|
| 6865 |
if (cancelIconEnabled) { |
| 6866 |
classes += " " + this.classPrefix + "shepherd-has-cancel-icon"; |
| 6867 |
} |
| 6868 |
|
| 6869 |
return render$1(preact.h(ShepherdElement, { |
| 6870 |
classPrefix: this.classPrefix, |
| 6871 |
classes: classes, |
| 6872 |
descriptionId: descriptionId, |
| 6873 |
labelId: labelId, |
| 6874 |
step: this, |
| 6875 |
styles: this.styles |
| 6876 |
}), null); |
| 6877 |
} |
| 6878 |
/** |
| 6879 |
* If a custom scrollToHandler is defined, call that, otherwise do the generic |
| 6880 |
* scrollIntoView call. |
| 6881 |
* |
| 6882 |
* @param {boolean|Object} scrollToOptions If true, uses the default `scrollIntoView`, |
| 6883 |
* if an object, passes that object as the params to `scrollIntoView` i.e. `{ behavior: 'smooth', block: 'center' }` |
| 6884 |
* @private |
| 6885 |
*/ |
| 6886 |
; |
| 6887 |
|
| 6888 |
_proto._scrollTo = function _scrollTo(scrollToOptions) { |
| 6889 |
var _parseAttachTo = parseAttachTo(this), |
| 6890 |
element = _parseAttachTo.element; |
| 6891 |
|
| 6892 |
if (isFunction(this.options.scrollToHandler)) { |
| 6893 |
this.options.scrollToHandler(element); |
| 6894 |
} else if (isElement(element)) { |
| 6895 |
element.scrollIntoView(scrollToOptions); |
| 6896 |
} |
| 6897 |
} |
| 6898 |
/** |
| 6899 |
* Sets the options for the step, maps `when` to events, sets up buttons |
| 6900 |
* @param {Object} options The options for the step |
| 6901 |
* @private |
| 6902 |
*/ |
| 6903 |
; |
| 6904 |
|
| 6905 |
_proto._setOptions = function _setOptions(options) { |
| 6906 |
var _this3 = this; |
| 6907 |
|
| 6908 |
if (options === void 0) { |
| 6909 |
options = {}; |
| 6910 |
} |
| 6911 |
|
| 6912 |
this.options = options; |
| 6913 |
var when = this.options.when; |
| 6914 |
this.destroy(); |
| 6915 |
this.id = this.options.id || "step-" + uniqueId(); |
| 6916 |
|
| 6917 |
if (when) { |
| 6918 |
Object.keys(when).forEach(function (event) { |
| 6919 |
_this3.on(event, when[event], _this3); |
| 6920 |
}); |
| 6921 |
} |
| 6922 |
} |
| 6923 |
/** |
| 6924 |
* Create the element and set up the tippy instance |
| 6925 |
* @private |
| 6926 |
*/ |
| 6927 |
; |
| 6928 |
|
| 6929 |
_proto._setupElements = function _setupElements() { |
| 6930 |
if (!isUndefined(this.el)) { |
| 6931 |
this.destroy(); |
| 6932 |
} |
| 6933 |
|
| 6934 |
this.el = this._createTooltipContent(); |
| 6935 |
|
| 6936 |
if (this.options.advanceOn) { |
| 6937 |
bindAdvance(this); |
| 6938 |
} |
| 6939 |
|
| 6940 |
setupTooltip(this); |
| 6941 |
} |
| 6942 |
/** |
| 6943 |
* Triggers `before-show`, generates the tooltip DOM content, |
| 6944 |
* sets up a tippy instance for the tooltip, then triggers `show`. |
| 6945 |
* @private |
| 6946 |
*/ |
| 6947 |
; |
| 6948 |
|
| 6949 |
_proto._show = function _show() { |
| 6950 |
var _this4 = this; |
| 6951 |
|
| 6952 |
this.trigger('before-show'); |
| 6953 |
|
| 6954 |
if (!this.el) { |
| 6955 |
this._setupElements(); |
| 6956 |
} |
| 6957 |
|
| 6958 |
this.tour.modal.setupForStep(this); |
| 6959 |
|
| 6960 |
this._styleTargetElementForStep(this); |
| 6961 |
|
| 6962 |
var target = this.target || document.body; |
| 6963 |
target.classList.add(this.classPrefix + "shepherd-enabled", this.classPrefix + "shepherd-target"); |
| 6964 |
document.body.setAttribute("data-" + this.classPrefix + "shepherd-step", this.id); |
| 6965 |
|
| 6966 |
if (this.options.scrollTo) { |
| 6967 |
setTimeout(function () { |
| 6968 |
_this4._scrollTo(_this4.options.scrollTo); |
| 6969 |
}); |
| 6970 |
} |
| 6971 |
|
| 6972 |
this.tooltip.show(); |
| 6973 |
this.trigger('show'); |
| 6974 |
this.el.focus(); |
| 6975 |
} |
| 6976 |
/** |
| 6977 |
* Modulates the styles of the passed step's target element, based on the step's options and |
| 6978 |
* the tour's `modal` option, to visually emphasize the element |
| 6979 |
* |
| 6980 |
* @param step The step object that attaches to the element |
| 6981 |
* @private |
| 6982 |
*/ |
| 6983 |
; |
| 6984 |
|
| 6985 |
_proto._styleTargetElementForStep = function _styleTargetElementForStep(step) { |
| 6986 |
var targetElement = step.target; |
| 6987 |
|
| 6988 |
if (!targetElement) { |
| 6989 |
return; |
| 6990 |
} |
| 6991 |
|
| 6992 |
toggleShepherdModalClass(targetElement, step.classPrefix); |
| 6993 |
|
| 6994 |
if (step.options.highlightClass) { |
| 6995 |
targetElement.classList.add(step.options.highlightClass); |
| 6996 |
} |
| 6997 |
|
| 6998 |
if (step.options.canClickTarget === false) { |
| 6999 |
targetElement.style.pointerEvents = 'none'; |
| 7000 |
} |
| 7001 |
} |
| 7002 |
/** |
| 7003 |
* When a step is hidden, remove the highlightClass and 'shepherd-enabled' |
| 7004 |
* and 'shepherd-target' classes |
| 7005 |
* @private |
| 7006 |
*/ |
| 7007 |
; |
| 7008 |
|
| 7009 |
_proto._updateStepTargetOnHide = function _updateStepTargetOnHide() { |
| 7010 |
if (this.options.highlightClass) { |
| 7011 |
this.target.classList.remove(this.options.highlightClass); |
| 7012 |
} |
| 7013 |
|
| 7014 |
this.target.classList.remove(this.classPrefix + "shepherd-enabled", this.classPrefix + "shepherd-target"); |
| 7015 |
}; |
| 7016 |
|
| 7017 |
return Step; |
| 7018 |
}(Evented); |
| 7019 |
|
| 7020 |
var bodyScrollLock_min = createCommonjsModule(function (module, exports) { |
| 7021 |
!function(e,t){t(exports);}(commonjsGlobal,function(exports){function r(e){if(Array.isArray(e)){for(var t=0,o=Array(e.length);t<e.length;t++)o[t]=e[t];return o}return Array.from(e)}Object.defineProperty(exports,"__esModule",{value:!0});var l=!1;if("undefined"!=typeof window){var e={get passive(){l=!0;}};window.addEventListener("testPassive",null,e),window.removeEventListener("testPassive",null,e);}var d="undefined"!=typeof window&&window.navigator&&window.navigator.platform&&/iP(ad|hone|od)/.test(window.navigator.platform),c=[],u=!1,a=-1,s=void 0,v=void 0,f=function(t){return c.some(function(e){return !(!e.options.allowTouchMove||!e.options.allowTouchMove(t))})},m=function(e){var t=e||window.event;return !!f(t.target)||(1<t.touches.length||(t.preventDefault&&t.preventDefault(),!1))},o=function(){setTimeout(function(){void 0!==v&&(document.body.style.paddingRight=v,v=void 0),void 0!==s&&(document.body.style.overflow=s,s=void 0);});};exports.disableBodyScroll=function(i,e){if(d){if(!i)return void console.error("disableBodyScroll unsuccessful - targetElement must be provided when calling disableBodyScroll on IOS devices.");if(i&&!c.some(function(e){return e.targetElement===i})){var t={targetElement:i,options:e||{}};c=[].concat(r(c),[t]),i.ontouchstart=function(e){1===e.targetTouches.length&&(a=e.targetTouches[0].clientY);},i.ontouchmove=function(e){var t,o,n,r;1===e.targetTouches.length&&(o=i,r=(t=e).targetTouches[0].clientY-a,!f(t.target)&&(o&&0===o.scrollTop&&0<r?m(t):(n=o)&&n.scrollHeight-n.scrollTop<=n.clientHeight&&r<0?m(t):t.stopPropagation()));},u||(document.addEventListener("touchmove",m,l?{passive:!1}:void 0),u=!0);}}else{n=e,setTimeout(function(){if(void 0===v){var e=!!n&&!0===n.reserveScrollBarGap,t=window.innerWidth-document.documentElement.clientWidth;e&&0<t&&(v=document.body.style.paddingRight,document.body.style.paddingRight=t+"px");}void 0===s&&(s=document.body.style.overflow,document.body.style.overflow="hidden");});var o={targetElement:i,options:e||{}};c=[].concat(r(c),[o]);}var n;},exports.clearAllBodyScrollLocks=function(){d?(c.forEach(function(e){e.targetElement.ontouchstart=null,e.targetElement.ontouchmove=null;}),u&&(document.removeEventListener("touchmove",m,l?{passive:!1}:void 0),u=!1),c=[],a=-1):(o(),c=[]);},exports.enableBodyScroll=function(t){if(d){if(!t)return void console.error("enableBodyScroll unsuccessful - targetElement must be provided when calling enableBodyScroll on IOS devices.");t.ontouchstart=null,t.ontouchmove=null,c=c.filter(function(e){return e.targetElement!==t}),u&&0===c.length&&(document.removeEventListener("touchmove",m,l?{passive:!1}:void 0),u=!1);}else(c=c.filter(function(e){return e.targetElement!==t})).length||o();};}); |
| 7022 |
}); |
| 7023 |
|
| 7024 |
var bodyScrollLock = unwrapExports(bodyScrollLock_min); |
| 7025 |
|
| 7026 |
var defaults = { |
| 7027 |
trigger: 'manual', |
| 7028 |
arrow: true, |
| 7029 |
animation: 'fade', |
| 7030 |
duration: 420, |
| 7031 |
flip: true, |
| 7032 |
animateFill: false, |
| 7033 |
// https://atomiks.github.io/tippyjs/#animate-fill-option |
| 7034 |
interactive: true, |
| 7035 |
// https://atomiks.github.io/tippyjs/#interactive-option |
| 7036 |
hideOnClick: 'toggle', |
| 7037 |
// https://atomiks.github.io/tippyjs/#hide-on-click-option |
| 7038 |
multiple: true // https://atomiks.github.io/tippyjs/#multiple-option |
| 7039 |
|
| 7040 |
}; |
| 7041 |
|
| 7042 |
/** |
| 7043 |
* Cleanup the steps and set pointerEvents back to 'auto' |
| 7044 |
* @param tour The tour object |
| 7045 |
*/ |
| 7046 |
function cleanupSteps(tour) { |
| 7047 |
if (tour) { |
| 7048 |
var steps = tour.steps; |
| 7049 |
steps.forEach(function (step) { |
| 7050 |
if (step.options && step.options.canClickTarget === false && step.options.attachTo) { |
| 7051 |
var stepElement = step.target; |
| 7052 |
|
| 7053 |
if (stepElement instanceof HTMLElement) { |
| 7054 |
stepElement.style.pointerEvents = 'auto'; |
| 7055 |
} |
| 7056 |
} |
| 7057 |
}); |
| 7058 |
} |
| 7059 |
} |
| 7060 |
|
| 7061 |
function _extends$3() { |
| 7062 |
_extends$3 = Object.assign || function (target) { |
| 7063 |
for (var i = 1; i < arguments.length; i++) { |
| 7064 |
var source = arguments[i]; |
| 7065 |
|
| 7066 |
for (var key in source) { |
| 7067 |
if (Object.prototype.hasOwnProperty.call(source, key)) { |
| 7068 |
target[key] = source[key]; |
| 7069 |
} |
| 7070 |
} |
| 7071 |
} |
| 7072 |
|
| 7073 |
return target; |
| 7074 |
}; |
| 7075 |
|
| 7076 |
return _extends$3.apply(this, arguments); |
| 7077 |
} |
| 7078 |
|
| 7079 |
function _assertThisInitialized$1(self) { |
| 7080 |
if (self === void 0) { |
| 7081 |
throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); |
| 7082 |
} |
| 7083 |
|
| 7084 |
return self; |
| 7085 |
} |
| 7086 |
|
| 7087 |
function _inheritsLoose$1(subClass, superClass) { |
| 7088 |
subClass.prototype = Object.create(superClass.prototype); |
| 7089 |
subClass.prototype.constructor = subClass; |
| 7090 |
subClass.__proto__ = superClass; |
| 7091 |
} |
| 7092 |
|
| 7093 |
function _getPrototypeOf(o) { |
| 7094 |
_getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { |
| 7095 |
return o.__proto__ || Object.getPrototypeOf(o); |
| 7096 |
}; |
| 7097 |
return _getPrototypeOf(o); |
| 7098 |
} |
| 7099 |
|
| 7100 |
function _setPrototypeOf(o, p) { |
| 7101 |
_setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { |
| 7102 |
o.__proto__ = p; |
| 7103 |
return o; |
| 7104 |
}; |
| 7105 |
|
| 7106 |
return _setPrototypeOf(o, p); |
| 7107 |
} |
| 7108 |
|
| 7109 |
function _isNativeFunction(fn) { |
| 7110 |
return Function.toString.call(fn).indexOf("[native code]") !== -1; |
| 7111 |
} |
| 7112 |
|
| 7113 |
function isNativeReflectConstruct() { |
| 7114 |
if (typeof Reflect === "undefined" || !Reflect.construct) return false; |
| 7115 |
if (Reflect.construct.sham) return false; |
| 7116 |
if (typeof Proxy === "function") return true; |
| 7117 |
|
| 7118 |
try { |
| 7119 |
Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); |
| 7120 |
return true; |
| 7121 |
} catch (e) { |
| 7122 |
return false; |
| 7123 |
} |
| 7124 |
} |
| 7125 |
|
| 7126 |
function _construct(Parent, args, Class) { |
| 7127 |
if (isNativeReflectConstruct()) { |
| 7128 |
_construct = Reflect.construct; |
| 7129 |
} else { |
| 7130 |
_construct = function _construct(Parent, args, Class) { |
| 7131 |
var a = [null]; |
| 7132 |
a.push.apply(a, args); |
| 7133 |
var Constructor = Function.bind.apply(Parent, a); |
| 7134 |
var instance = new Constructor(); |
| 7135 |
if (Class) _setPrototypeOf(instance, Class.prototype); |
| 7136 |
return instance; |
| 7137 |
}; |
| 7138 |
} |
| 7139 |
|
| 7140 |
return _construct.apply(null, arguments); |
| 7141 |
} |
| 7142 |
|
| 7143 |
function _wrapNativeSuper(Class) { |
| 7144 |
var _cache = typeof Map === "function" ? new Map() : undefined; |
| 7145 |
|
| 7146 |
_wrapNativeSuper = function _wrapNativeSuper(Class) { |
| 7147 |
if (Class === null || !_isNativeFunction(Class)) return Class; |
| 7148 |
|
| 7149 |
if (typeof Class !== "function") { |
| 7150 |
throw new TypeError("Super expression must either be null or a function"); |
| 7151 |
} |
| 7152 |
|
| 7153 |
if (typeof _cache !== "undefined") { |
| 7154 |
if (_cache.has(Class)) return _cache.get(Class); |
| 7155 |
|
| 7156 |
_cache.set(Class, Wrapper); |
| 7157 |
} |
| 7158 |
|
| 7159 |
function Wrapper() { |
| 7160 |
return _construct(Class, arguments, _getPrototypeOf(this).constructor); |
| 7161 |
} |
| 7162 |
|
| 7163 |
Wrapper.prototype = Object.create(Class.prototype, { |
| 7164 |
constructor: { |
| 7165 |
value: Wrapper, |
| 7166 |
enumerable: false, |
| 7167 |
writable: true, |
| 7168 |
configurable: true |
| 7169 |
} |
| 7170 |
}); |
| 7171 |
return _setPrototypeOf(Wrapper, Class); |
| 7172 |
}; |
| 7173 |
|
| 7174 |
return _wrapNativeSuper(Class); |
| 7175 |
} |
| 7176 |
|
| 7177 |
/** |
| 7178 |
* Create an error file out of errors.md for development and a simple web link to the full errors |
| 7179 |
* in production mode. |
| 7180 |
* @private |
| 7181 |
*/ |
| 7182 |
|
| 7183 |
|
| 7184 |
var PolishedError = |
| 7185 |
/*#__PURE__*/ |
| 7186 |
function (_Error) { |
| 7187 |
_inheritsLoose$1(PolishedError, _Error); |
| 7188 |
|
| 7189 |
function PolishedError(code) { |
| 7190 |
var _this; |
| 7191 |
|
| 7192 |
{ |
| 7193 |
_this = _Error.call(this, "An error occurred. See https://github.com/styled-components/polished/blob/master/src/internalHelpers/errors.md#" + code + " for more information.") || this; |
| 7194 |
} |
| 7195 |
|
| 7196 |
return _assertThisInitialized$1(_this); |
| 7197 |
} |
| 7198 |
|
| 7199 |
return PolishedError; |
| 7200 |
}( |
| 7201 |
/*#__PURE__*/ |
| 7202 |
_wrapNativeSuper(Error)); |
| 7203 |
|
| 7204 |
function colorToInt(color) { |
| 7205 |
return Math.round(color * 255); |
| 7206 |
} |
| 7207 |
|
| 7208 |
function convertToInt(red, green, blue) { |
| 7209 |
return colorToInt(red) + "," + colorToInt(green) + "," + colorToInt(blue); |
| 7210 |
} |
| 7211 |
|
| 7212 |
function hslToRgb(hue, saturation, lightness, convert) { |
| 7213 |
if (convert === void 0) { |
| 7214 |
convert = convertToInt; |
| 7215 |
} |
| 7216 |
|
| 7217 |
if (saturation === 0) { |
| 7218 |
// achromatic |
| 7219 |
return convert(lightness, lightness, lightness); |
| 7220 |
} // formulae from https://en.wikipedia.org/wiki/HSL_and_HSV |
| 7221 |
|
| 7222 |
|
| 7223 |
var huePrime = (hue % 360 + 360) % 360 / 60; |
| 7224 |
var chroma = (1 - Math.abs(2 * lightness - 1)) * saturation; |
| 7225 |
var secondComponent = chroma * (1 - Math.abs(huePrime % 2 - 1)); |
| 7226 |
var red = 0; |
| 7227 |
var green = 0; |
| 7228 |
var blue = 0; |
| 7229 |
|
| 7230 |
if (huePrime >= 0 && huePrime < 1) { |
| 7231 |
red = chroma; |
| 7232 |
green = secondComponent; |
| 7233 |
} else if (huePrime >= 1 && huePrime < 2) { |
| 7234 |
red = secondComponent; |
| 7235 |
green = chroma; |
| 7236 |
} else if (huePrime >= 2 && huePrime < 3) { |
| 7237 |
green = chroma; |
| 7238 |
blue = secondComponent; |
| 7239 |
} else if (huePrime >= 3 && huePrime < 4) { |
| 7240 |
green = secondComponent; |
| 7241 |
blue = chroma; |
| 7242 |
} else if (huePrime >= 4 && huePrime < 5) { |
| 7243 |
red = secondComponent; |
| 7244 |
blue = chroma; |
| 7245 |
} else if (huePrime >= 5 && huePrime < 6) { |
| 7246 |
red = chroma; |
| 7247 |
blue = secondComponent; |
| 7248 |
} |
| 7249 |
|
| 7250 |
var lightnessModification = lightness - chroma / 2; |
| 7251 |
var finalRed = red + lightnessModification; |
| 7252 |
var finalGreen = green + lightnessModification; |
| 7253 |
var finalBlue = blue + lightnessModification; |
| 7254 |
return convert(finalRed, finalGreen, finalBlue); |
| 7255 |
} |
| 7256 |
|
| 7257 |
var namedColorMap = { |
| 7258 |
aliceblue: 'f0f8ff', |
| 7259 |
antiquewhite: 'faebd7', |
| 7260 |
aqua: '00ffff', |
| 7261 |
aquamarine: '7fffd4', |
| 7262 |
azure: 'f0ffff', |
| 7263 |
beige: 'f5f5dc', |
| 7264 |
bisque: 'ffe4c4', |
| 7265 |
black: '000', |
| 7266 |
blanchedalmond: 'ffebcd', |
| 7267 |
blue: '0000ff', |
| 7268 |
blueviolet: '8a2be2', |
| 7269 |
brown: 'a52a2a', |
| 7270 |
burlywood: 'deb887', |
| 7271 |
cadetblue: '5f9ea0', |
| 7272 |
chartreuse: '7fff00', |
| 7273 |
chocolate: 'd2691e', |
| 7274 |
coral: 'ff7f50', |
| 7275 |
cornflowerblue: '6495ed', |
| 7276 |
cornsilk: 'fff8dc', |
| 7277 |
crimson: 'dc143c', |
| 7278 |
cyan: '00ffff', |
| 7279 |
darkblue: '00008b', |
| 7280 |
darkcyan: '008b8b', |
| 7281 |
darkgoldenrod: 'b8860b', |
| 7282 |
darkgray: 'a9a9a9', |
| 7283 |
darkgreen: '006400', |
| 7284 |
darkgrey: 'a9a9a9', |
| 7285 |
darkkhaki: 'bdb76b', |
| 7286 |
darkmagenta: '8b008b', |
| 7287 |
darkolivegreen: '556b2f', |
| 7288 |
darkorange: 'ff8c00', |
| 7289 |
darkorchid: '9932cc', |
| 7290 |
darkred: '8b0000', |
| 7291 |
darksalmon: 'e9967a', |
| 7292 |
darkseagreen: '8fbc8f', |
| 7293 |
darkslateblue: '483d8b', |
| 7294 |
darkslategray: '2f4f4f', |
| 7295 |
darkslategrey: '2f4f4f', |
| 7296 |
darkturquoise: '00ced1', |
| 7297 |
darkviolet: '9400d3', |
| 7298 |
deeppink: 'ff1493', |
| 7299 |
deepskyblue: '00bfff', |
| 7300 |
dimgray: '696969', |
| 7301 |
dimgrey: '696969', |
| 7302 |
dodgerblue: '1e90ff', |
| 7303 |
firebrick: 'b22222', |
| 7304 |
floralwhite: 'fffaf0', |
| 7305 |
forestgreen: '228b22', |
| 7306 |
fuchsia: 'ff00ff', |
| 7307 |
gainsboro: 'dcdcdc', |
| 7308 |
ghostwhite: 'f8f8ff', |
| 7309 |
gold: 'ffd700', |
| 7310 |
goldenrod: 'daa520', |
| 7311 |
gray: '808080', |
| 7312 |
green: '008000', |
| 7313 |
greenyellow: 'adff2f', |
| 7314 |
grey: '808080', |
| 7315 |
honeydew: 'f0fff0', |
| 7316 |
hotpink: 'ff69b4', |
| 7317 |
indianred: 'cd5c5c', |
| 7318 |
indigo: '4b0082', |
| 7319 |
ivory: 'fffff0', |
| 7320 |
khaki: 'f0e68c', |
| 7321 |
lavender: 'e6e6fa', |
| 7322 |
lavenderblush: 'fff0f5', |
| 7323 |
lawngreen: '7cfc00', |
| 7324 |
lemonchiffon: 'fffacd', |
| 7325 |
lightblue: 'add8e6', |
| 7326 |
lightcoral: 'f08080', |
| 7327 |
lightcyan: 'e0ffff', |
| 7328 |
lightgoldenrodyellow: 'fafad2', |
| 7329 |
lightgray: 'd3d3d3', |
| 7330 |
lightgreen: '90ee90', |
| 7331 |
lightgrey: 'd3d3d3', |
| 7332 |
lightpink: 'ffb6c1', |
| 7333 |
lightsalmon: 'ffa07a', |
| 7334 |
lightseagreen: '20b2aa', |
| 7335 |
lightskyblue: '87cefa', |
| 7336 |
lightslategray: '789', |
| 7337 |
lightslategrey: '789', |
| 7338 |
lightsteelblue: 'b0c4de', |
| 7339 |
lightyellow: 'ffffe0', |
| 7340 |
lime: '0f0', |
| 7341 |
limegreen: '32cd32', |
| 7342 |
linen: 'faf0e6', |
| 7343 |
magenta: 'f0f', |
| 7344 |
maroon: '800000', |
| 7345 |
mediumaquamarine: '66cdaa', |
| 7346 |
mediumblue: '0000cd', |
| 7347 |
mediumorchid: 'ba55d3', |
| 7348 |
mediumpurple: '9370db', |
| 7349 |
mediumseagreen: '3cb371', |
| 7350 |
mediumslateblue: '7b68ee', |
| 7351 |
mediumspringgreen: '00fa9a', |
| 7352 |
mediumturquoise: '48d1cc', |
| 7353 |
mediumvioletred: 'c71585', |
| 7354 |
midnightblue: '191970', |
| 7355 |
mintcream: 'f5fffa', |
| 7356 |
mistyrose: 'ffe4e1', |
| 7357 |
moccasin: 'ffe4b5', |
| 7358 |
navajowhite: 'ffdead', |
| 7359 |
navy: '000080', |
| 7360 |
oldlace: 'fdf5e6', |
| 7361 |
olive: '808000', |
| 7362 |
olivedrab: '6b8e23', |
| 7363 |
orange: 'ffa500', |
| 7364 |
orangered: 'ff4500', |
| 7365 |
orchid: 'da70d6', |
| 7366 |
palegoldenrod: 'eee8aa', |
| 7367 |
palegreen: '98fb98', |
| 7368 |
paleturquoise: 'afeeee', |
| 7369 |
palevioletred: 'db7093', |
| 7370 |
papayawhip: 'ffefd5', |
| 7371 |
peachpuff: 'ffdab9', |
| 7372 |
peru: 'cd853f', |
| 7373 |
pink: 'ffc0cb', |
| 7374 |
plum: 'dda0dd', |
| 7375 |
powderblue: 'b0e0e6', |
| 7376 |
purple: '800080', |
| 7377 |
rebeccapurple: '639', |
| 7378 |
red: 'f00', |
| 7379 |
rosybrown: 'bc8f8f', |
| 7380 |
royalblue: '4169e1', |
| 7381 |
saddlebrown: '8b4513', |
| 7382 |
salmon: 'fa8072', |
| 7383 |
sandybrown: 'f4a460', |
| 7384 |
seagreen: '2e8b57', |
| 7385 |
seashell: 'fff5ee', |
| 7386 |
sienna: 'a0522d', |
| 7387 |
silver: 'c0c0c0', |
| 7388 |
skyblue: '87ceeb', |
| 7389 |
slateblue: '6a5acd', |
| 7390 |
slategray: '708090', |
| 7391 |
slategrey: '708090', |
| 7392 |
snow: 'fffafa', |
| 7393 |
springgreen: '00ff7f', |
| 7394 |
steelblue: '4682b4', |
| 7395 |
tan: 'd2b48c', |
| 7396 |
teal: '008080', |
| 7397 |
thistle: 'd8bfd8', |
| 7398 |
tomato: 'ff6347', |
| 7399 |
turquoise: '40e0d0', |
| 7400 |
violet: 'ee82ee', |
| 7401 |
wheat: 'f5deb3', |
| 7402 |
white: 'fff', |
| 7403 |
whitesmoke: 'f5f5f5', |
| 7404 |
yellow: 'ff0', |
| 7405 |
yellowgreen: '9acd32' |
| 7406 |
/** |
| 7407 |
* Checks if a string is a CSS named color and returns its equivalent hex value, otherwise returns the original color. |
| 7408 |
* @private |
| 7409 |
*/ |
| 7410 |
|
| 7411 |
}; |
| 7412 |
|
| 7413 |
function nameToHex(color) { |
| 7414 |
if (typeof color !== 'string') return color; |
| 7415 |
var normalizedColorName = color.toLowerCase(); |
| 7416 |
return namedColorMap[normalizedColorName] ? "#" + namedColorMap[normalizedColorName] : color; |
| 7417 |
} |
| 7418 |
|
| 7419 |
var hexRegex = /^#[a-fA-F0-9]{6}$/; |
| 7420 |
var hexRgbaRegex = /^#[a-fA-F0-9]{8}$/; |
| 7421 |
var reducedHexRegex = /^#[a-fA-F0-9]{3}$/; |
| 7422 |
var reducedRgbaHexRegex = /^#[a-fA-F0-9]{4}$/; |
| 7423 |
var rgbRegex = /^rgb\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*\)$/i; |
| 7424 |
var rgbaRegex = /^rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*([-+]?[0-9]*[.]?[0-9]+)\s*\)$/i; |
| 7425 |
var hslRegex = /^hsl\(\s*(\d{0,3}[.]?[0-9]+)\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*\)$/i; |
| 7426 |
var hslaRegex = /^hsla\(\s*(\d{0,3}[.]?[0-9]+)\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*,\s*([-+]?[0-9]*[.]?[0-9]+)\s*\)$/i; |
| 7427 |
/** |
| 7428 |
* Returns an RgbColor or RgbaColor object. This utility function is only useful |
| 7429 |
* if want to extract a color component. With the color util `toColorString` you |
| 7430 |
* can convert a RgbColor or RgbaColor object back to a string. |
| 7431 |
* |
| 7432 |
* @example |
| 7433 |
* // Assigns `{ red: 255, green: 0, blue: 0 }` to color1 |
| 7434 |
* const color1 = parseToRgb('rgb(255, 0, 0)'); |
| 7435 |
* // Assigns `{ red: 92, green: 102, blue: 112, alpha: 0.75 }` to color2 |
| 7436 |
* const color2 = parseToRgb('hsla(210, 10%, 40%, 0.75)'); |
| 7437 |
*/ |
| 7438 |
|
| 7439 |
function parseToRgb(color) { |
| 7440 |
if (typeof color !== 'string') { |
| 7441 |
throw new PolishedError(3); |
| 7442 |
} |
| 7443 |
|
| 7444 |
var normalizedColor = nameToHex(color); |
| 7445 |
|
| 7446 |
if (normalizedColor.match(hexRegex)) { |
| 7447 |
return { |
| 7448 |
red: parseInt("" + normalizedColor[1] + normalizedColor[2], 16), |
| 7449 |
green: parseInt("" + normalizedColor[3] + normalizedColor[4], 16), |
| 7450 |
blue: parseInt("" + normalizedColor[5] + normalizedColor[6], 16) |
| 7451 |
}; |
| 7452 |
} |
| 7453 |
|
| 7454 |
if (normalizedColor.match(hexRgbaRegex)) { |
| 7455 |
var alpha = parseFloat((parseInt("" + normalizedColor[7] + normalizedColor[8], 16) / 255).toFixed(2)); |
| 7456 |
return { |
| 7457 |
red: parseInt("" + normalizedColor[1] + normalizedColor[2], 16), |
| 7458 |
green: parseInt("" + normalizedColor[3] + normalizedColor[4], 16), |
| 7459 |
blue: parseInt("" + normalizedColor[5] + normalizedColor[6], 16), |
| 7460 |
alpha: alpha |
| 7461 |
}; |
| 7462 |
} |
| 7463 |
|
| 7464 |
if (normalizedColor.match(reducedHexRegex)) { |
| 7465 |
return { |
| 7466 |
red: parseInt("" + normalizedColor[1] + normalizedColor[1], 16), |
| 7467 |
green: parseInt("" + normalizedColor[2] + normalizedColor[2], 16), |
| 7468 |
blue: parseInt("" + normalizedColor[3] + normalizedColor[3], 16) |
| 7469 |
}; |
| 7470 |
} |
| 7471 |
|
| 7472 |
if (normalizedColor.match(reducedRgbaHexRegex)) { |
| 7473 |
var _alpha = parseFloat((parseInt("" + normalizedColor[4] + normalizedColor[4], 16) / 255).toFixed(2)); |
| 7474 |
|
| 7475 |
return { |
| 7476 |
red: parseInt("" + normalizedColor[1] + normalizedColor[1], 16), |
| 7477 |
green: parseInt("" + normalizedColor[2] + normalizedColor[2], 16), |
| 7478 |
blue: parseInt("" + normalizedColor[3] + normalizedColor[3], 16), |
| 7479 |
alpha: _alpha |
| 7480 |
}; |
| 7481 |
} |
| 7482 |
|
| 7483 |
var rgbMatched = rgbRegex.exec(normalizedColor); |
| 7484 |
|
| 7485 |
if (rgbMatched) { |
| 7486 |
return { |
| 7487 |
red: parseInt("" + rgbMatched[1], 10), |
| 7488 |
green: parseInt("" + rgbMatched[2], 10), |
| 7489 |
blue: parseInt("" + rgbMatched[3], 10) |
| 7490 |
}; |
| 7491 |
} |
| 7492 |
|
| 7493 |
var rgbaMatched = rgbaRegex.exec(normalizedColor); |
| 7494 |
|
| 7495 |
if (rgbaMatched) { |
| 7496 |
return { |
| 7497 |
red: parseInt("" + rgbaMatched[1], 10), |
| 7498 |
green: parseInt("" + rgbaMatched[2], 10), |
| 7499 |
blue: parseInt("" + rgbaMatched[3], 10), |
| 7500 |
alpha: parseFloat("" + rgbaMatched[4]) |
| 7501 |
}; |
| 7502 |
} |
| 7503 |
|
| 7504 |
var hslMatched = hslRegex.exec(normalizedColor); |
| 7505 |
|
| 7506 |
if (hslMatched) { |
| 7507 |
var hue = parseInt("" + hslMatched[1], 10); |
| 7508 |
var saturation = parseInt("" + hslMatched[2], 10) / 100; |
| 7509 |
var lightness = parseInt("" + hslMatched[3], 10) / 100; |
| 7510 |
var rgbColorString = "rgb(" + hslToRgb(hue, saturation, lightness) + ")"; |
| 7511 |
var hslRgbMatched = rgbRegex.exec(rgbColorString); |
| 7512 |
|
| 7513 |
if (!hslRgbMatched) { |
| 7514 |
throw new PolishedError(4, normalizedColor, rgbColorString); |
| 7515 |
} |
| 7516 |
|
| 7517 |
return { |
| 7518 |
red: parseInt("" + hslRgbMatched[1], 10), |
| 7519 |
green: parseInt("" + hslRgbMatched[2], 10), |
| 7520 |
blue: parseInt("" + hslRgbMatched[3], 10) |
| 7521 |
}; |
| 7522 |
} |
| 7523 |
|
| 7524 |
var hslaMatched = hslaRegex.exec(normalizedColor); |
| 7525 |
|
| 7526 |
if (hslaMatched) { |
| 7527 |
var _hue = parseInt("" + hslaMatched[1], 10); |
| 7528 |
|
| 7529 |
var _saturation = parseInt("" + hslaMatched[2], 10) / 100; |
| 7530 |
|
| 7531 |
var _lightness = parseInt("" + hslaMatched[3], 10) / 100; |
| 7532 |
|
| 7533 |
var _rgbColorString = "rgb(" + hslToRgb(_hue, _saturation, _lightness) + ")"; |
| 7534 |
|
| 7535 |
var _hslRgbMatched = rgbRegex.exec(_rgbColorString); |
| 7536 |
|
| 7537 |
if (!_hslRgbMatched) { |
| 7538 |
throw new PolishedError(4, normalizedColor, _rgbColorString); |
| 7539 |
} |
| 7540 |
|
| 7541 |
return { |
| 7542 |
red: parseInt("" + _hslRgbMatched[1], 10), |
| 7543 |
green: parseInt("" + _hslRgbMatched[2], 10), |
| 7544 |
blue: parseInt("" + _hslRgbMatched[3], 10), |
| 7545 |
alpha: parseFloat("" + hslaMatched[4]) |
| 7546 |
}; |
| 7547 |
} |
| 7548 |
|
| 7549 |
throw new PolishedError(5); |
| 7550 |
} |
| 7551 |
|
| 7552 |
function rgbToHsl(color) { |
| 7553 |
// make sure rgb are contained in a set of [0, 255] |
| 7554 |
var red = color.red / 255; |
| 7555 |
var green = color.green / 255; |
| 7556 |
var blue = color.blue / 255; |
| 7557 |
var max = Math.max(red, green, blue); |
| 7558 |
var min = Math.min(red, green, blue); |
| 7559 |
var lightness = (max + min) / 2; |
| 7560 |
|
| 7561 |
if (max === min) { |
| 7562 |
// achromatic |
| 7563 |
if (color.alpha !== undefined) { |
| 7564 |
return { |
| 7565 |
hue: 0, |
| 7566 |
saturation: 0, |
| 7567 |
lightness: lightness, |
| 7568 |
alpha: color.alpha |
| 7569 |
}; |
| 7570 |
} else { |
| 7571 |
return { |
| 7572 |
hue: 0, |
| 7573 |
saturation: 0, |
| 7574 |
lightness: lightness |
| 7575 |
}; |
| 7576 |
} |
| 7577 |
} |
| 7578 |
|
| 7579 |
var hue; |
| 7580 |
var delta = max - min; |
| 7581 |
var saturation = lightness > 0.5 ? delta / (2 - max - min) : delta / (max + min); |
| 7582 |
|
| 7583 |
switch (max) { |
| 7584 |
case red: |
| 7585 |
hue = (green - blue) / delta + (green < blue ? 6 : 0); |
| 7586 |
break; |
| 7587 |
|
| 7588 |
case green: |
| 7589 |
hue = (blue - red) / delta + 2; |
| 7590 |
break; |
| 7591 |
|
| 7592 |
default: |
| 7593 |
// blue case |
| 7594 |
hue = (red - green) / delta + 4; |
| 7595 |
break; |
| 7596 |
} |
| 7597 |
|
| 7598 |
hue *= 60; |
| 7599 |
|
| 7600 |
if (color.alpha !== undefined) { |
| 7601 |
return { |
| 7602 |
hue: hue, |
| 7603 |
saturation: saturation, |
| 7604 |
lightness: lightness, |
| 7605 |
alpha: color.alpha |
| 7606 |
}; |
| 7607 |
} |
| 7608 |
|
| 7609 |
return { |
| 7610 |
hue: hue, |
| 7611 |
saturation: saturation, |
| 7612 |
lightness: lightness |
| 7613 |
}; |
| 7614 |
} |
| 7615 |
|
| 7616 |
/** |
| 7617 |
* Returns an HslColor or HslaColor object. This utility function is only useful |
| 7618 |
* if want to extract a color component. With the color util `toColorString` you |
| 7619 |
* can convert a HslColor or HslaColor object back to a string. |
| 7620 |
* |
| 7621 |
* @example |
| 7622 |
* // Assigns `{ hue: 0, saturation: 1, lightness: 0.5 }` to color1 |
| 7623 |
* const color1 = parseToHsl('rgb(255, 0, 0)'); |
| 7624 |
* // Assigns `{ hue: 128, saturation: 1, lightness: 0.5, alpha: 0.75 }` to color2 |
| 7625 |
* const color2 = parseToHsl('hsla(128, 100%, 50%, 0.75)'); |
| 7626 |
*/ |
| 7627 |
function parseToHsl(color) { |
| 7628 |
// Note: At a later stage we can optimize this function as right now a hsl |
| 7629 |
// color would be parsed converted to rgb values and converted back to hsl. |
| 7630 |
return rgbToHsl(parseToRgb(color)); |
| 7631 |
} |
| 7632 |
|
| 7633 |
/** |
| 7634 |
* Reduces hex values if possible e.g. #ff8866 to #f86 |
| 7635 |
* @private |
| 7636 |
*/ |
| 7637 |
var reduceHexValue = function reduceHexValue(value) { |
| 7638 |
if (value.length === 7 && value[1] === value[2] && value[3] === value[4] && value[5] === value[6]) { |
| 7639 |
return "#" + value[1] + value[3] + value[5]; |
| 7640 |
} |
| 7641 |
|
| 7642 |
return value; |
| 7643 |
}; |
| 7644 |
|
| 7645 |
function numberToHex(value) { |
| 7646 |
var hex = value.toString(16); |
| 7647 |
return hex.length === 1 ? "0" + hex : hex; |
| 7648 |
} |
| 7649 |
|
| 7650 |
function colorToHex(color) { |
| 7651 |
return numberToHex(Math.round(color * 255)); |
| 7652 |
} |
| 7653 |
|
| 7654 |
function convertToHex(red, green, blue) { |
| 7655 |
return reduceHexValue("#" + colorToHex(red) + colorToHex(green) + colorToHex(blue)); |
| 7656 |
} |
| 7657 |
|
| 7658 |
function hslToHex(hue, saturation, lightness) { |
| 7659 |
return hslToRgb(hue, saturation, lightness, convertToHex); |
| 7660 |
} |
| 7661 |
|
| 7662 |
/** |
| 7663 |
* Returns a string value for the color. The returned result is the smallest possible hex notation. |
| 7664 |
* |
| 7665 |
* @example |
| 7666 |
* // Styles as object usage |
| 7667 |
* const styles = { |
| 7668 |
* background: hsl(359, 0.75, 0.4), |
| 7669 |
* background: hsl({ hue: 360, saturation: 0.75, lightness: 0.4 }), |
| 7670 |
* } |
| 7671 |
* |
| 7672 |
* // styled-components usage |
| 7673 |
* const div = styled.div` |
| 7674 |
* background: ${hsl(359, 0.75, 0.4)}; |
| 7675 |
* background: ${hsl({ hue: 360, saturation: 0.75, lightness: 0.4 })}; |
| 7676 |
* ` |
| 7677 |
* |
| 7678 |
* // CSS in JS Output |
| 7679 |
* |
| 7680 |
* element { |
| 7681 |
* background: "#b3191c"; |
| 7682 |
* background: "#b3191c"; |
| 7683 |
* } |
| 7684 |
*/ |
| 7685 |
function hsl(value, saturation, lightness) { |
| 7686 |
if (typeof value === 'number' && typeof saturation === 'number' && typeof lightness === 'number') { |
| 7687 |
return hslToHex(value, saturation, lightness); |
| 7688 |
} else if (typeof value === 'object' && saturation === undefined && lightness === undefined) { |
| 7689 |
return hslToHex(value.hue, value.saturation, value.lightness); |
| 7690 |
} |
| 7691 |
|
| 7692 |
throw new PolishedError(1); |
| 7693 |
} |
| 7694 |
|
| 7695 |
/** |
| 7696 |
* Returns a string value for the color. The returned result is the smallest possible rgba or hex notation. |
| 7697 |
* |
| 7698 |
* @example |
| 7699 |
* // Styles as object usage |
| 7700 |
* const styles = { |
| 7701 |
* background: hsla(359, 0.75, 0.4, 0.7), |
| 7702 |
* background: hsla({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0,7 }), |
| 7703 |
* background: hsla(359, 0.75, 0.4, 1), |
| 7704 |
* } |
| 7705 |
* |
| 7706 |
* // styled-components usage |
| 7707 |
* const div = styled.div` |
| 7708 |
* background: ${hsla(359, 0.75, 0.4, 0.7)}; |
| 7709 |
* background: ${hsla({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0,7 })}; |
| 7710 |
* background: ${hsla(359, 0.75, 0.4, 1)}; |
| 7711 |
* ` |
| 7712 |
* |
| 7713 |
* // CSS in JS Output |
| 7714 |
* |
| 7715 |
* element { |
| 7716 |
* background: "rgba(179,25,28,0.7)"; |
| 7717 |
* background: "rgba(179,25,28,0.7)"; |
| 7718 |
* background: "#b3191c"; |
| 7719 |
* } |
| 7720 |
*/ |
| 7721 |
function hsla(value, saturation, lightness, alpha) { |
| 7722 |
if (typeof value === 'number' && typeof saturation === 'number' && typeof lightness === 'number' && typeof alpha === 'number') { |
| 7723 |
return alpha >= 1 ? hslToHex(value, saturation, lightness) : "rgba(" + hslToRgb(value, saturation, lightness) + "," + alpha + ")"; |
| 7724 |
} else if (typeof value === 'object' && saturation === undefined && lightness === undefined && alpha === undefined) { |
| 7725 |
return value.alpha >= 1 ? hslToHex(value.hue, value.saturation, value.lightness) : "rgba(" + hslToRgb(value.hue, value.saturation, value.lightness) + "," + value.alpha + ")"; |
| 7726 |
} |
| 7727 |
|
| 7728 |
throw new PolishedError(2); |
| 7729 |
} |
| 7730 |
|
| 7731 |
/** |
| 7732 |
* Returns a string value for the color. The returned result is the smallest possible hex notation. |
| 7733 |
* |
| 7734 |
* @example |
| 7735 |
* // Styles as object usage |
| 7736 |
* const styles = { |
| 7737 |
* background: rgb(255, 205, 100), |
| 7738 |
* background: rgb({ red: 255, green: 205, blue: 100 }), |
| 7739 |
* } |
| 7740 |
* |
| 7741 |
* // styled-components usage |
| 7742 |
* const div = styled.div` |
| 7743 |
* background: ${rgb(255, 205, 100)}; |
| 7744 |
* background: ${rgb({ red: 255, green: 205, blue: 100 })}; |
| 7745 |
* ` |
| 7746 |
* |
| 7747 |
* // CSS in JS Output |
| 7748 |
* |
| 7749 |
* element { |
| 7750 |
* background: "#ffcd64"; |
| 7751 |
* background: "#ffcd64"; |
| 7752 |
* } |
| 7753 |
*/ |
| 7754 |
function rgb(value, green, blue) { |
| 7755 |
if (typeof value === 'number' && typeof green === 'number' && typeof blue === 'number') { |
| 7756 |
return reduceHexValue("#" + numberToHex(value) + numberToHex(green) + numberToHex(blue)); |
| 7757 |
} else if (typeof value === 'object' && green === undefined && blue === undefined) { |
| 7758 |
return reduceHexValue("#" + numberToHex(value.red) + numberToHex(value.green) + numberToHex(value.blue)); |
| 7759 |
} |
| 7760 |
|
| 7761 |
throw new PolishedError(6); |
| 7762 |
} |
| 7763 |
|
| 7764 |
/** |
| 7765 |
* Returns a string value for the color. The returned result is the smallest possible rgba or hex notation. |
| 7766 |
* |
| 7767 |
* Can also be used to fade a color by passing a hex value or named CSS color along with an alpha value. |
| 7768 |
* |
| 7769 |
* @example |
| 7770 |
* // Styles as object usage |
| 7771 |
* const styles = { |
| 7772 |
* background: rgba(255, 205, 100, 0.7), |
| 7773 |
* background: rgba({ red: 255, green: 205, blue: 100, alpha: 0.7 }), |
| 7774 |
* background: rgba(255, 205, 100, 1), |
| 7775 |
* background: rgba('#ffffff', 0.4), |
| 7776 |
* background: rgba('black', 0.7), |
| 7777 |
* } |
| 7778 |
* |
| 7779 |
* // styled-components usage |
| 7780 |
* const div = styled.div` |
| 7781 |
* background: ${rgba(255, 205, 100, 0.7)}; |
| 7782 |
* background: ${rgba({ red: 255, green: 205, blue: 100, alpha: 0.7 })}; |
| 7783 |
* background: ${rgba(255, 205, 100, 1)}; |
| 7784 |
* background: ${rgba('#ffffff', 0.4)}; |
| 7785 |
* background: ${rgba('black', 0.7)}; |
| 7786 |
* ` |
| 7787 |
* |
| 7788 |
* // CSS in JS Output |
| 7789 |
* |
| 7790 |
* element { |
| 7791 |
* background: "rgba(255,205,100,0.7)"; |
| 7792 |
* background: "rgba(255,205,100,0.7)"; |
| 7793 |
* background: "#ffcd64"; |
| 7794 |
* background: "rgba(255,255,255,0.4)"; |
| 7795 |
* background: "rgba(0,0,0,0.7)"; |
| 7796 |
* } |
| 7797 |
*/ |
| 7798 |
function rgba(firstValue, secondValue, thirdValue, fourthValue) { |
| 7799 |
if (typeof firstValue === 'string' && typeof secondValue === 'number') { |
| 7800 |
var rgbValue = parseToRgb(firstValue); |
| 7801 |
return "rgba(" + rgbValue.red + "," + rgbValue.green + "," + rgbValue.blue + "," + secondValue + ")"; |
| 7802 |
} else if (typeof firstValue === 'number' && typeof secondValue === 'number' && typeof thirdValue === 'number' && typeof fourthValue === 'number') { |
| 7803 |
return fourthValue >= 1 ? rgb(firstValue, secondValue, thirdValue) : "rgba(" + firstValue + "," + secondValue + "," + thirdValue + "," + fourthValue + ")"; |
| 7804 |
} else if (typeof firstValue === 'object' && secondValue === undefined && thirdValue === undefined && fourthValue === undefined) { |
| 7805 |
return firstValue.alpha >= 1 ? rgb(firstValue.red, firstValue.green, firstValue.blue) : "rgba(" + firstValue.red + "," + firstValue.green + "," + firstValue.blue + "," + firstValue.alpha + ")"; |
| 7806 |
} |
| 7807 |
|
| 7808 |
throw new PolishedError(7); |
| 7809 |
} |
| 7810 |
|
| 7811 |
var isRgb = function isRgb(color) { |
| 7812 |
return typeof color.red === 'number' && typeof color.green === 'number' && typeof color.blue === 'number' && (typeof color.alpha !== 'number' || typeof color.alpha === 'undefined'); |
| 7813 |
}; |
| 7814 |
|
| 7815 |
var isRgba = function isRgba(color) { |
| 7816 |
return typeof color.red === 'number' && typeof color.green === 'number' && typeof color.blue === 'number' && typeof color.alpha === 'number'; |
| 7817 |
}; |
| 7818 |
|
| 7819 |
var isHsl = function isHsl(color) { |
| 7820 |
return typeof color.hue === 'number' && typeof color.saturation === 'number' && typeof color.lightness === 'number' && (typeof color.alpha !== 'number' || typeof color.alpha === 'undefined'); |
| 7821 |
}; |
| 7822 |
|
| 7823 |
var isHsla = function isHsla(color) { |
| 7824 |
return typeof color.hue === 'number' && typeof color.saturation === 'number' && typeof color.lightness === 'number' && typeof color.alpha === 'number'; |
| 7825 |
}; |
| 7826 |
/** |
| 7827 |
* Converts a RgbColor, RgbaColor, HslColor or HslaColor object to a color string. |
| 7828 |
* This util is useful in case you only know on runtime which color object is |
| 7829 |
* used. Otherwise we recommend to rely on `rgb`, `rgba`, `hsl` or `hsla`. |
| 7830 |
* |
| 7831 |
* @example |
| 7832 |
* // Styles as object usage |
| 7833 |
* const styles = { |
| 7834 |
* background: toColorString({ red: 255, green: 205, blue: 100 }), |
| 7835 |
* background: toColorString({ red: 255, green: 205, blue: 100, alpha: 0.72 }), |
| 7836 |
* background: toColorString({ hue: 240, saturation: 1, lightness: 0.5 }), |
| 7837 |
* background: toColorString({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0.72 }), |
| 7838 |
* } |
| 7839 |
* |
| 7840 |
* // styled-components usage |
| 7841 |
* const div = styled.div` |
| 7842 |
* background: ${toColorString({ red: 255, green: 205, blue: 100 })}; |
| 7843 |
* background: ${toColorString({ red: 255, green: 205, blue: 100, alpha: 0.72 })}; |
| 7844 |
* background: ${toColorString({ hue: 240, saturation: 1, lightness: 0.5 })}; |
| 7845 |
* background: ${toColorString({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0.72 })}; |
| 7846 |
* ` |
| 7847 |
* |
| 7848 |
* // CSS in JS Output |
| 7849 |
* element { |
| 7850 |
* background: "#ffcd64"; |
| 7851 |
* background: "rgba(255,205,100,0.72)"; |
| 7852 |
* background: "#00f"; |
| 7853 |
* background: "rgba(179,25,25,0.72)"; |
| 7854 |
* } |
| 7855 |
*/ |
| 7856 |
|
| 7857 |
|
| 7858 |
function toColorString(color) { |
| 7859 |
if (typeof color !== 'object') throw new PolishedError(8); |
| 7860 |
if (isRgba(color)) return rgba(color); |
| 7861 |
if (isRgb(color)) return rgb(color); |
| 7862 |
if (isHsla(color)) return hsla(color); |
| 7863 |
if (isHsl(color)) return hsl(color); |
| 7864 |
throw new PolishedError(8); |
| 7865 |
} |
| 7866 |
|
| 7867 |
// Type definitions taken from https://github.com/gcanti/flow-static-land/blob/master/src/Fun.js |
| 7868 |
// eslint-disable-next-line no-unused-vars |
| 7869 |
// eslint-disable-next-line no-unused-vars |
| 7870 |
// eslint-disable-next-line no-redeclare |
| 7871 |
function curried(f, length, acc) { |
| 7872 |
return function fn() { |
| 7873 |
// eslint-disable-next-line prefer-rest-params |
| 7874 |
var combined = acc.concat(Array.prototype.slice.call(arguments)); |
| 7875 |
return combined.length >= length ? f.apply(this, combined) : curried(f, length, combined); |
| 7876 |
}; |
| 7877 |
} // eslint-disable-next-line no-redeclare |
| 7878 |
|
| 7879 |
|
| 7880 |
function curry(f) { |
| 7881 |
// eslint-disable-line no-redeclare |
| 7882 |
return curried(f, f.length, []); |
| 7883 |
} |
| 7884 |
|
| 7885 |
function guard(lowerBoundary, upperBoundary, value) { |
| 7886 |
return Math.max(lowerBoundary, Math.min(upperBoundary, value)); |
| 7887 |
} |
| 7888 |
|
| 7889 |
/** |
| 7890 |
* Returns a string value for the darkened color. |
| 7891 |
* |
| 7892 |
* @example |
| 7893 |
* // Styles as object usage |
| 7894 |
* const styles = { |
| 7895 |
* background: darken(0.2, '#FFCD64'), |
| 7896 |
* background: darken('0.2', 'rgba(255,205,100,0.7)'), |
| 7897 |
* } |
| 7898 |
* |
| 7899 |
* // styled-components usage |
| 7900 |
* const div = styled.div` |
| 7901 |
* background: ${darken(0.2, '#FFCD64')}; |
| 7902 |
* background: ${darken('0.2', 'rgba(255,205,100,0.7)')}; |
| 7903 |
* ` |
| 7904 |
* |
| 7905 |
* // CSS in JS Output |
| 7906 |
* |
| 7907 |
* element { |
| 7908 |
* background: "#ffbd31"; |
| 7909 |
* background: "rgba(255,189,49,0.7)"; |
| 7910 |
* } |
| 7911 |
*/ |
| 7912 |
|
| 7913 |
function darken(amount, color) { |
| 7914 |
if (color === 'transparent') return color; |
| 7915 |
var hslColor = parseToHsl(color); |
| 7916 |
return toColorString(_extends$3({}, hslColor, { |
| 7917 |
lightness: guard(0, 1, hslColor.lightness - parseFloat(amount)) |
| 7918 |
})); |
| 7919 |
} // prettier-ignore |
| 7920 |
|
| 7921 |
|
| 7922 |
var curriedDarken = |
| 7923 |
/*#__PURE__*/ |
| 7924 |
curry |
| 7925 |
/* ::<number | string, string, string> */ |
| 7926 |
(darken); |
| 7927 |
|
| 7928 |
/** |
| 7929 |
* Decreases the intensity of a color. Its range is between 0 to 1. The first |
| 7930 |
* argument of the desaturate function is the amount by how much the color |
| 7931 |
* intensity should be decreased. |
| 7932 |
* |
| 7933 |
* @example |
| 7934 |
* // Styles as object usage |
| 7935 |
* const styles = { |
| 7936 |
* background: desaturate(0.2, '#CCCD64'), |
| 7937 |
* background: desaturate('0.2', 'rgba(204,205,100,0.7)'), |
| 7938 |
* } |
| 7939 |
* |
| 7940 |
* // styled-components usage |
| 7941 |
* const div = styled.div` |
| 7942 |
* background: ${desaturate(0.2, '#CCCD64')}; |
| 7943 |
* background: ${desaturate('0.2', 'rgba(204,205,100,0.7)')}; |
| 7944 |
* ` |
| 7945 |
* |
| 7946 |
* // CSS in JS Output |
| 7947 |
* element { |
| 7948 |
* background: "#b8b979"; |
| 7949 |
* background: "rgba(184,185,121,0.7)"; |
| 7950 |
* } |
| 7951 |
*/ |
| 7952 |
|
| 7953 |
function desaturate(amount, color) { |
| 7954 |
if (color === 'transparent') return color; |
| 7955 |
var hslColor = parseToHsl(color); |
| 7956 |
return toColorString(_extends$3({}, hslColor, { |
| 7957 |
saturation: guard(0, 1, hslColor.saturation - parseFloat(amount)) |
| 7958 |
})); |
| 7959 |
} // prettier-ignore |
| 7960 |
|
| 7961 |
|
| 7962 |
var curriedDesaturate = |
| 7963 |
/*#__PURE__*/ |
| 7964 |
curry |
| 7965 |
/* ::<number | string, string, string> */ |
| 7966 |
(desaturate); |
| 7967 |
|
| 7968 |
/** |
| 7969 |
* Returns a number (float) representing the luminance of a color. |
| 7970 |
* |
| 7971 |
* @example |
| 7972 |
* // Styles as object usage |
| 7973 |
* const styles = { |
| 7974 |
* background: getLuminance('#CCCD64') >= getLuminance('#0000ff') ? '#CCCD64' : '#0000ff', |
| 7975 |
* background: getLuminance('rgba(58, 133, 255, 1)') >= getLuminance('rgba(255, 57, 149, 1)') ? |
| 7976 |
* 'rgba(58, 133, 255, 1)' : |
| 7977 |
* 'rgba(255, 57, 149, 1)', |
| 7978 |
* } |
| 7979 |
* |
| 7980 |
* // styled-components usage |
| 7981 |
* const div = styled.div` |
| 7982 |
* background: ${getLuminance('#CCCD64') >= getLuminance('#0000ff') ? '#CCCD64' : '#0000ff'}; |
| 7983 |
* background: ${getLuminance('rgba(58, 133, 255, 1)') >= getLuminance('rgba(255, 57, 149, 1)') ? |
| 7984 |
* 'rgba(58, 133, 255, 1)' : |
| 7985 |
* 'rgba(255, 57, 149, 1)'}; |
| 7986 |
* |
| 7987 |
* // CSS in JS Output |
| 7988 |
* |
| 7989 |
* div { |
| 7990 |
* background: "#CCCD64"; |
| 7991 |
* background: "rgba(58, 133, 255, 1)"; |
| 7992 |
* } |
| 7993 |
*/ |
| 7994 |
|
| 7995 |
function getLuminance(color) { |
| 7996 |
if (color === 'transparent') return 0; |
| 7997 |
var rgbColor = parseToRgb(color); |
| 7998 |
|
| 7999 |
var _Object$keys$map = Object.keys(rgbColor).map(function (key) { |
| 8000 |
var channel = rgbColor[key] / 255; |
| 8001 |
return channel <= 0.03928 ? channel / 12.92 : Math.pow((channel + 0.055) / 1.055, 2.4); |
| 8002 |
}), |
| 8003 |
r = _Object$keys$map[0], |
| 8004 |
g = _Object$keys$map[1], |
| 8005 |
b = _Object$keys$map[2]; |
| 8006 |
|
| 8007 |
return parseFloat((0.2126 * r + 0.7152 * g + 0.0722 * b).toFixed(3)); |
| 8008 |
} |
| 8009 |
|
| 8010 |
/** |
| 8011 |
* Returns a string value for the lightened color. |
| 8012 |
* |
| 8013 |
* @example |
| 8014 |
* // Styles as object usage |
| 8015 |
* const styles = { |
| 8016 |
* background: lighten(0.2, '#CCCD64'), |
| 8017 |
* background: lighten('0.2', 'rgba(204,205,100,0.7)'), |
| 8018 |
* } |
| 8019 |
* |
| 8020 |
* // styled-components usage |
| 8021 |
* const div = styled.div` |
| 8022 |
* background: ${lighten(0.2, '#FFCD64')}; |
| 8023 |
* background: ${lighten('0.2', 'rgba(204,205,100,0.7)')}; |
| 8024 |
* ` |
| 8025 |
* |
| 8026 |
* // CSS in JS Output |
| 8027 |
* |
| 8028 |
* element { |
| 8029 |
* background: "#e5e6b1"; |
| 8030 |
* background: "rgba(229,230,177,0.7)"; |
| 8031 |
* } |
| 8032 |
*/ |
| 8033 |
|
| 8034 |
function lighten(amount, color) { |
| 8035 |
if (color === 'transparent') return color; |
| 8036 |
var hslColor = parseToHsl(color); |
| 8037 |
return toColorString(_extends$3({}, hslColor, { |
| 8038 |
lightness: guard(0, 1, hslColor.lightness + parseFloat(amount)) |
| 8039 |
})); |
| 8040 |
} // prettier-ignore |
| 8041 |
|
| 8042 |
|
| 8043 |
var curriedLighten = |
| 8044 |
/*#__PURE__*/ |
| 8045 |
curry |
| 8046 |
/* ::<number | string, string, string> */ |
| 8047 |
(lighten); |
| 8048 |
|
| 8049 |
/** |
| 8050 |
* Returns black or white (or optional light and dark return colors) for best contrast depending on the luminosity of the given color. |
| 8051 |
* Follows [W3C specs for readability](https://www.w3.org/TR/WCAG20-TECHS/G18.html). |
| 8052 |
* |
| 8053 |
* @example |
| 8054 |
* // Styles as object usage |
| 8055 |
* const styles = { |
| 8056 |
* color: readableColor('#000'), |
| 8057 |
* color: readableColor('black', '#001', '#ff8'), |
| 8058 |
* color: readableColor('white', '#001', '#ff8'), |
| 8059 |
* } |
| 8060 |
* |
| 8061 |
* // styled-components usage |
| 8062 |
* const div = styled.div` |
| 8063 |
* color: ${readableColor('#000')}; |
| 8064 |
* color: ${readableColor('black', '#001', '#ff8')}; |
| 8065 |
* color: ${readableColor('white', '#001', '#ff8')}; |
| 8066 |
* ` |
| 8067 |
* |
| 8068 |
* // CSS in JS Output |
| 8069 |
* |
| 8070 |
* element { |
| 8071 |
* color: "#fff"; |
| 8072 |
* color: "#ff8"; |
| 8073 |
* color: "#001"; |
| 8074 |
* } |
| 8075 |
*/ |
| 8076 |
|
| 8077 |
function readableColor(color, lightReturnColor, darkReturnColor) { |
| 8078 |
if (lightReturnColor === void 0) { |
| 8079 |
lightReturnColor = '#000'; |
| 8080 |
} |
| 8081 |
|
| 8082 |
if (darkReturnColor === void 0) { |
| 8083 |
darkReturnColor = '#fff'; |
| 8084 |
} |
| 8085 |
|
| 8086 |
return getLuminance(color) > 0.179 ? lightReturnColor : darkReturnColor; |
| 8087 |
} |
| 8088 |
|
| 8089 |
/** |
| 8090 |
* Decreases the opacity of a color. Its range for the amount is between 0 to 1. |
| 8091 |
* |
| 8092 |
* |
| 8093 |
* @example |
| 8094 |
* // Styles as object usage |
| 8095 |
* const styles = { |
| 8096 |
* background: transparentize(0.1, '#fff'); |
| 8097 |
* background: transparentize(0.2, 'hsl(0, 0%, 100%)'), |
| 8098 |
* background: transparentize('0.5', 'rgba(255, 0, 0, 0.8)'), |
| 8099 |
* } |
| 8100 |
* |
| 8101 |
* // styled-components usage |
| 8102 |
* const div = styled.div` |
| 8103 |
* background: ${transparentize(0.1, '#fff')}; |
| 8104 |
* background: ${transparentize(0.2, 'hsl(0, 0%, 100%)')}, |
| 8105 |
* background: ${transparentize('0.5', 'rgba(255, 0, 0, 0.8)')}, |
| 8106 |
* ` |
| 8107 |
* |
| 8108 |
* // CSS in JS Output |
| 8109 |
* |
| 8110 |
* element { |
| 8111 |
* background: "rgba(255,255,255,0.9)"; |
| 8112 |
* background: "rgba(255,255,255,0.8)"; |
| 8113 |
* background: "rgba(255,0,0,0.3)"; |
| 8114 |
* } |
| 8115 |
*/ |
| 8116 |
|
| 8117 |
function transparentize(amount, color) { |
| 8118 |
if (color === 'transparent') return color; |
| 8119 |
var parsedColor = parseToRgb(color); |
| 8120 |
var alpha = typeof parsedColor.alpha === 'number' ? parsedColor.alpha : 1; |
| 8121 |
|
| 8122 |
var colorWithAlpha = _extends$3({}, parsedColor, { |
| 8123 |
alpha: guard(0, 1, (alpha * 100 - parseFloat(amount) * 100) / 100) |
| 8124 |
}); |
| 8125 |
|
| 8126 |
return rgba(colorWithAlpha); |
| 8127 |
} // prettier-ignore |
| 8128 |
|
| 8129 |
|
| 8130 |
var curriedTransparentize = |
| 8131 |
/*#__PURE__*/ |
| 8132 |
curry |
| 8133 |
/* ::<number | string, string, string> */ |
| 8134 |
(transparentize); |
| 8135 |
|
| 8136 |
var styles = { |
| 8137 |
arrowSize: 2.1, |
| 8138 |
overlayOpacity: 0.25, |
| 8139 |
shepherdButtonBorderRadius: '3px', |
| 8140 |
shepherdElementBorderRadius: '5px', |
| 8141 |
shepherdElementMaxHeight: '100%', |
| 8142 |
shepherdElementMaxWidth: '100%', |
| 8143 |
shepherdElementZIndex: 999901, |
| 8144 |
shepherdTextBackground: '#ffffff', |
| 8145 |
shepherdTextLineHeight: '1.3em', |
| 8146 |
shepherdTextFontSize: '1rem', |
| 8147 |
shepherdThemePrimary: '#3288e6' |
| 8148 |
}; |
| 8149 |
function getVariables(options) { |
| 8150 |
if (options.styleVariables) { |
| 8151 |
_extends(styles, options.styleVariables); |
| 8152 |
} |
| 8153 |
|
| 8154 |
if (!styles.shepherdHeaderBackground) { |
| 8155 |
styles.shepherdHeaderBackground = curriedDarken(0.1, styles.shepherdTextBackground); |
| 8156 |
} |
| 8157 |
|
| 8158 |
if (!styles.shepherdThemeSecondary) { |
| 8159 |
styles.shepherdThemeSecondary = curriedDesaturate(0.7, curriedLighten(0.4, styles.shepherdThemePrimary)); |
| 8160 |
} |
| 8161 |
|
| 8162 |
_setTextColors(); |
| 8163 |
|
| 8164 |
return styles; |
| 8165 |
} |
| 8166 |
/** |
| 8167 |
* Set all the text colors to contrasting ones, for readability, if not already defined. |
| 8168 |
* @private |
| 8169 |
*/ |
| 8170 |
|
| 8171 |
function _setTextColors() { |
| 8172 |
if (!styles.shepherdThemeTextPrimary) { |
| 8173 |
styles.shepherdThemeTextPrimary = curriedTransparentize(0.25, readableColor(styles.shepherdThemePrimary)); |
| 8174 |
} |
| 8175 |
|
| 8176 |
if (!styles.shepherdThemeTextSecondary) { |
| 8177 |
styles.shepherdThemeTextSecondary = curriedTransparentize(0.25, readableColor(styles.shepherdThemeSecondary)); |
| 8178 |
} |
| 8179 |
|
| 8180 |
if (!styles.shepherdThemeTextHeader) { |
| 8181 |
styles.shepherdThemeTextHeader = curriedTransparentize(0.25, readableColor(styles.shepherdHeaderBackground)); |
| 8182 |
} |
| 8183 |
|
| 8184 |
if (!styles.shepherdThemeTextColor) { |
| 8185 |
styles.shepherdThemeTextColor = curriedTransparentize(0.25, readableColor(styles.shepherdTextBackground)); |
| 8186 |
} |
| 8187 |
} |
| 8188 |
|
| 8189 |
/** |
| 8190 |
* Code refactored from Mozilla Developer Network: |
| 8191 |
* https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign |
| 8192 |
*/ |
| 8193 |
|
| 8194 |
function assign$1(target, firstSource) { |
| 8195 |
if (target === undefined || target === null) { |
| 8196 |
throw new TypeError('Cannot convert first argument to object'); |
| 8197 |
} |
| 8198 |
|
| 8199 |
var to = Object(target); |
| 8200 |
for (var i = 1; i < arguments.length; i++) { |
| 8201 |
var nextSource = arguments[i]; |
| 8202 |
if (nextSource === undefined || nextSource === null) { |
| 8203 |
continue; |
| 8204 |
} |
| 8205 |
|
| 8206 |
var keysArray = Object.keys(Object(nextSource)); |
| 8207 |
for (var nextIndex = 0, len = keysArray.length; nextIndex < len; nextIndex++) { |
| 8208 |
var nextKey = keysArray[nextIndex]; |
| 8209 |
var desc = Object.getOwnPropertyDescriptor(nextSource, nextKey); |
| 8210 |
if (desc !== undefined && desc.enumerable) { |
| 8211 |
to[nextKey] = nextSource[nextKey]; |
| 8212 |
} |
| 8213 |
} |
| 8214 |
} |
| 8215 |
return to; |
| 8216 |
} |
| 8217 |
|
| 8218 |
function polyfill$1() { |
| 8219 |
if (!Object.assign) { |
| 8220 |
Object.defineProperty(Object, 'assign', { |
| 8221 |
enumerable: false, |
| 8222 |
configurable: true, |
| 8223 |
writable: true, |
| 8224 |
value: assign$1 |
| 8225 |
}); |
| 8226 |
} |
| 8227 |
} |
| 8228 |
|
| 8229 |
var es6ObjectAssign = { |
| 8230 |
assign: assign$1, |
| 8231 |
polyfill: polyfill$1 |
| 8232 |
}; |
| 8233 |
var es6ObjectAssign_1 = es6ObjectAssign.assign; |
| 8234 |
|
| 8235 |
var KEBAB_REGEX = /[A-Z]/g; |
| 8236 |
|
| 8237 |
var _hash = function hash(str) { |
| 8238 |
var hash = 5381, |
| 8239 |
i = str.length; |
| 8240 |
|
| 8241 |
while (i) { |
| 8242 |
hash = hash * 33 ^ str.charCodeAt(--i); |
| 8243 |
} |
| 8244 |
|
| 8245 |
return '_' + (hash >>> 0).toString(36); |
| 8246 |
}; |
| 8247 |
|
| 8248 |
var create$2 = function create(config) { |
| 8249 |
config = config || {}; |
| 8250 |
var assign = config.assign || Object.assign; |
| 8251 |
var client = typeof window === 'object'; // Check if we are really in browser environment. |
| 8252 |
|
| 8253 |
var renderer = assign({ |
| 8254 |
raw: '', |
| 8255 |
pfx: '_', |
| 8256 |
client: client, |
| 8257 |
assign: assign, |
| 8258 |
stringify: JSON.stringify, |
| 8259 |
kebab: function kebab(prop) { |
| 8260 |
return prop.replace(KEBAB_REGEX, '-$&').toLowerCase(); |
| 8261 |
}, |
| 8262 |
decl: function decl(key, value) { |
| 8263 |
key = renderer.kebab(key); |
| 8264 |
return key + ':' + value + ';'; |
| 8265 |
}, |
| 8266 |
hash: function hash(obj) { |
| 8267 |
return _hash(renderer.stringify(obj)); |
| 8268 |
}, |
| 8269 |
selector: function selector(parent, _selector) { |
| 8270 |
return parent + (_selector[0] === ':' ? '' : ' ') + _selector; |
| 8271 |
}, |
| 8272 |
putRaw: function putRaw(rawCssRule) { |
| 8273 |
renderer.raw += rawCssRule; |
| 8274 |
} |
| 8275 |
}, config); |
| 8276 |
|
| 8277 |
if (renderer.client) { |
| 8278 |
if (!renderer.sh) document.head.appendChild(renderer.sh = document.createElement('style')); |
| 8279 |
|
| 8280 |
renderer.putRaw = function (rawCssRule) { |
| 8281 |
// .insertRule() is faster than .appendChild(), that's why we use it in PROD. |
| 8282 |
// But CSS injected using .insertRule() is not displayed in Chrome Devtools, |
| 8283 |
// that's why we use .appendChild in DEV. |
| 8284 |
{ |
| 8285 |
var sheet = renderer.sh.sheet; // Unknown pseudo-selectors will throw, this try/catch swallows all errors. |
| 8286 |
|
| 8287 |
try { |
| 8288 |
sheet.insertRule(rawCssRule, sheet.cssRules.length); // eslint-disable-next-line no-empty |
| 8289 |
} catch (error) {} |
| 8290 |
} |
| 8291 |
}; |
| 8292 |
} |
| 8293 |
|
| 8294 |
renderer.put = function (selector, decls, atrule) { |
| 8295 |
var str = ''; |
| 8296 |
var prop, value; |
| 8297 |
var postponed = []; |
| 8298 |
|
| 8299 |
for (prop in decls) { |
| 8300 |
value = decls[prop]; |
| 8301 |
|
| 8302 |
if (value instanceof Object && !(value instanceof Array)) { |
| 8303 |
postponed.push(prop); |
| 8304 |
} else { |
| 8305 |
{ |
| 8306 |
str += renderer.decl(prop, value, selector, atrule); |
| 8307 |
} |
| 8308 |
} |
| 8309 |
} |
| 8310 |
|
| 8311 |
if (str) { |
| 8312 |
{ |
| 8313 |
str = selector + '{' + str + '}'; |
| 8314 |
} |
| 8315 |
|
| 8316 |
renderer.putRaw(atrule ? atrule + '{' + str + '}' : str); |
| 8317 |
} |
| 8318 |
|
| 8319 |
for (var i = 0; i < postponed.length; i++) { |
| 8320 |
prop = postponed[i]; |
| 8321 |
|
| 8322 |
if (prop[0] === "@" && prop !== "@font-face") { |
| 8323 |
renderer.putAt(selector, decls[prop], prop); |
| 8324 |
} else { |
| 8325 |
renderer.put(renderer.selector(selector, prop), decls[prop], atrule); |
| 8326 |
} |
| 8327 |
} |
| 8328 |
}; |
| 8329 |
|
| 8330 |
renderer.putAt = renderer.put; |
| 8331 |
return renderer; |
| 8332 |
}; |
| 8333 |
|
| 8334 |
var addon = function addon(renderer) { |
| 8335 |
var cache = {}; |
| 8336 |
|
| 8337 |
renderer.cache = function (css) { |
| 8338 |
if (!css) return ''; |
| 8339 |
var key = renderer.hash(css); |
| 8340 |
|
| 8341 |
if (!cache[key]) { |
| 8342 |
cache[key] = renderer.rule(css, key); |
| 8343 |
} |
| 8344 |
|
| 8345 |
return cache[key]; |
| 8346 |
}; |
| 8347 |
}; |
| 8348 |
|
| 8349 |
var addon$1 = function addon(renderer) { |
| 8350 |
renderer.selector = function (parentSelectors, selector) { |
| 8351 |
var parents = parentSelectors.split(','); |
| 8352 |
var result = []; |
| 8353 |
var selectors = selector.split(','); |
| 8354 |
var len1 = parents.length; |
| 8355 |
var len2 = selectors.length; |
| 8356 |
var i, j, sel, pos, parent, replacedSelector; |
| 8357 |
|
| 8358 |
for (i = 0; i < len2; i++) { |
| 8359 |
sel = selectors[i]; |
| 8360 |
pos = sel.indexOf('&'); |
| 8361 |
|
| 8362 |
if (pos > -1) { |
| 8363 |
for (j = 0; j < len1; j++) { |
| 8364 |
parent = parents[j]; |
| 8365 |
replacedSelector = sel.replace(/&/g, parent); |
| 8366 |
result.push(replacedSelector); |
| 8367 |
} |
| 8368 |
} else { |
| 8369 |
for (j = 0; j < len1; j++) { |
| 8370 |
parent = parents[j]; |
| 8371 |
|
| 8372 |
if (parent) { |
| 8373 |
result.push(parent + ' ' + sel); |
| 8374 |
} else { |
| 8375 |
result.push(sel); |
| 8376 |
} |
| 8377 |
} |
| 8378 |
} |
| 8379 |
} |
| 8380 |
|
| 8381 |
return result.join(','); |
| 8382 |
}; |
| 8383 |
}; |
| 8384 |
|
| 8385 |
var addon$2 = function addon(renderer) { |
| 8386 |
|
| 8387 |
renderer.rule = function (css, block) { |
| 8388 |
|
| 8389 |
block = block || renderer.hash(css); |
| 8390 |
block = renderer.pfx + block; |
| 8391 |
renderer.put('.' + block, css); |
| 8392 |
return ' ' + block; |
| 8393 |
}; |
| 8394 |
}; |
| 8395 |
|
| 8396 |
var addon$3 = function addon(renderer) { |
| 8397 |
|
| 8398 |
renderer.sheet = function (map, block) { |
| 8399 |
var result = {}; |
| 8400 |
|
| 8401 |
if (!block) { |
| 8402 |
block = renderer.hash(map); |
| 8403 |
} |
| 8404 |
|
| 8405 |
var onElementModifier = function onElementModifier(elementModifier) { |
| 8406 |
var styles = map[elementModifier]; |
| 8407 |
|
| 8408 |
{ |
| 8409 |
Object.defineProperty(result, elementModifier, { |
| 8410 |
configurable: true, |
| 8411 |
enumerable: true, |
| 8412 |
get: function get() { |
| 8413 |
var classNames = renderer.rule(styles, block + '-' + elementModifier); |
| 8414 |
Object.defineProperty(result, elementModifier, { |
| 8415 |
value: classNames, |
| 8416 |
enumerable: true |
| 8417 |
}); |
| 8418 |
return classNames; |
| 8419 |
} |
| 8420 |
}); |
| 8421 |
} |
| 8422 |
}; |
| 8423 |
|
| 8424 |
for (var elementModifier in map) { |
| 8425 |
onElementModifier(elementModifier); |
| 8426 |
} |
| 8427 |
|
| 8428 |
return result; |
| 8429 |
}; |
| 8430 |
}; |
| 8431 |
|
| 8432 |
var nano = create$2({ |
| 8433 |
assign: es6ObjectAssign_1, |
| 8434 |
h: h, |
| 8435 |
pfx: '' |
| 8436 |
}); |
| 8437 |
addon(nano); |
| 8438 |
addon$1(nano); |
| 8439 |
addon$2(nano); |
| 8440 |
addon$3(nano); |
| 8441 |
var rule = nano.rule, |
| 8442 |
sheet = nano.sheet; |
| 8443 |
|
| 8444 |
function buttonStyles(classPrefix, variables, includeStyles) { |
| 8445 |
if (includeStyles) { |
| 8446 |
var _button; |
| 8447 |
|
| 8448 |
return { |
| 8449 |
button: (_button = { |
| 8450 |
background: variables.shepherdThemePrimary, |
| 8451 |
borderRadius: variables.shepherdButtonBorderRadius, |
| 8452 |
border: 0, |
| 8453 |
color: variables.shepherdThemeTextPrimary, |
| 8454 |
cursor: 'pointer', |
| 8455 |
display: 'inline-block', |
| 8456 |
fontFamily: 'inherit', |
| 8457 |
fontSize: '0.8em', |
| 8458 |
letterSpacing: '0.1em', |
| 8459 |
lineHeight: '1em', |
| 8460 |
marginRight: '0.5em', |
| 8461 |
padding: '0.75em 2em', |
| 8462 |
textTransform: 'uppercase', |
| 8463 |
transition: 'all 0.5s ease', |
| 8464 |
verticalAlign: 'middle', |
| 8465 |
'&:hover': { |
| 8466 |
background: curriedDarken(0.1, variables.shepherdThemePrimary) |
| 8467 |
} |
| 8468 |
}, _button["&." + classPrefix + "shepherd-button-secondary"] = { |
| 8469 |
background: variables.shepherdThemeSecondary, |
| 8470 |
color: variables.shepherdThemeTextSecondary, |
| 8471 |
'&:hover': { |
| 8472 |
background: curriedDarken(0.1, variables.shepherdThemeSecondary), |
| 8473 |
color: curriedDarken(0.1, variables.shepherdThemeTextSecondary) |
| 8474 |
} |
| 8475 |
}, _button) |
| 8476 |
}; |
| 8477 |
} |
| 8478 |
|
| 8479 |
return { |
| 8480 |
button: {} |
| 8481 |
}; |
| 8482 |
} |
| 8483 |
|
| 8484 |
function contentStyles(variables, includeStyles) { |
| 8485 |
if (includeStyles) { |
| 8486 |
return { |
| 8487 |
content: { |
| 8488 |
background: variables.shepherdTextBackground, |
| 8489 |
borderRadius: variables.shepherdElementBorderRadius, |
| 8490 |
fontSize: 'inherit', |
| 8491 |
outline: 'none', |
| 8492 |
padding: 0 |
| 8493 |
} |
| 8494 |
}; |
| 8495 |
} |
| 8496 |
|
| 8497 |
return { |
| 8498 |
content: {} |
| 8499 |
}; |
| 8500 |
} |
| 8501 |
|
| 8502 |
function elementStyles() { |
| 8503 |
return { |
| 8504 |
element: { |
| 8505 |
'outline': 'none', |
| 8506 |
// We need box-sizing: border-box on shepherd-element and everything under it |
| 8507 |
'&, *': { |
| 8508 |
'&, &:after, &:before': { |
| 8509 |
boxSizing: 'border-box' |
| 8510 |
} |
| 8511 |
} |
| 8512 |
} |
| 8513 |
}; |
| 8514 |
} |
| 8515 |
|
| 8516 |
function footerStyles(classPrefix, variables, includeStyles) { |
| 8517 |
if (includeStyles) { |
| 8518 |
var _footer; |
| 8519 |
|
| 8520 |
return { |
| 8521 |
footer: (_footer = { |
| 8522 |
borderBottomLeftRadius: variables.shepherdElementBorderRadius, |
| 8523 |
borderBottomRightRadius: variables.shepherdElementBorderRadius, |
| 8524 |
display: 'flex', |
| 8525 |
justifyContent: 'flex-end', |
| 8526 |
padding: '0 0.75em 0.75em' |
| 8527 |
}, _footer["." + classPrefix + "shepherd-button"] = { |
| 8528 |
'&:last-child': { |
| 8529 |
marginRight: 0 |
| 8530 |
} |
| 8531 |
}, _footer) |
| 8532 |
}; |
| 8533 |
} |
| 8534 |
|
| 8535 |
return { |
| 8536 |
footer: {} |
| 8537 |
}; |
| 8538 |
} |
| 8539 |
|
| 8540 |
/** |
| 8541 |
* Check the luminance of the color and lighten or darken accordingly |
| 8542 |
* @param {string} color The color to check |
| 8543 |
* @return {string} The lightened or darkened color |
| 8544 |
*/ |
| 8545 |
|
| 8546 |
function getLighterOrDarker(color) { |
| 8547 |
var l = getLuminance(color); |
| 8548 |
|
| 8549 |
if (l > 0.6) { |
| 8550 |
return curriedDarken(l / 2, color); |
| 8551 |
} |
| 8552 |
|
| 8553 |
return curriedLighten((1 - l) / 2, color); |
| 8554 |
} |
| 8555 |
|
| 8556 |
function headerStyles(classPrefix, variables, includeStyles) { |
| 8557 |
var _header, _cancelIcon; |
| 8558 |
|
| 8559 |
var header = (_header = { |
| 8560 |
alignItems: 'center', |
| 8561 |
borderTopLeftRadius: variables.shepherdElementBorderRadius, |
| 8562 |
borderTopRightRadius: variables.shepherdElementBorderRadius, |
| 8563 |
display: 'flex', |
| 8564 |
justifyContent: 'flex-end', |
| 8565 |
lineHeight: '2em', |
| 8566 |
padding: '0.75em 0.75em 0' |
| 8567 |
}, _header["." + classPrefix + "shepherd-has-title ." + classPrefix + "shepherd-content &"] = { |
| 8568 |
background: variables.shepherdHeaderBackground, |
| 8569 |
padding: '1em' |
| 8570 |
}, _header); |
| 8571 |
var title = { |
| 8572 |
color: variables.shepherdThemeTextHeader, |
| 8573 |
display: 'flex', |
| 8574 |
flex: '1 0 auto', |
| 8575 |
fontSize: '1.1em', |
| 8576 |
fontWeight: 'normal', |
| 8577 |
margin: 0, |
| 8578 |
padding: 0, |
| 8579 |
position: 'relative', |
| 8580 |
verticalAlign: 'middle' |
| 8581 |
}; |
| 8582 |
var styles = { |
| 8583 |
'cancel-icon': (_cancelIcon = { |
| 8584 |
background: 'transparent', |
| 8585 |
border: 'none', |
| 8586 |
color: getLighterOrDarker(variables.shepherdThemeTextColor), |
| 8587 |
fontSize: '2em', |
| 8588 |
fontWeight: 'normal', |
| 8589 |
margin: 0, |
| 8590 |
padding: 0, |
| 8591 |
position: 'relative', |
| 8592 |
textDecoration: 'none', |
| 8593 |
transition: 'color 0.5s ease', |
| 8594 |
verticalAlign: 'middle', |
| 8595 |
'&:hover': { |
| 8596 |
color: variables.shepherdThemeTextColor, |
| 8597 |
cursor: 'pointer' |
| 8598 |
} |
| 8599 |
}, _cancelIcon["." + classPrefix + "shepherd-has-title ." + classPrefix + "shepherd-content &"] = { |
| 8600 |
color: getLighterOrDarker(variables.shepherdThemeTextHeader), |
| 8601 |
'&:hover': { |
| 8602 |
color: variables.shepherdThemeTextHeader |
| 8603 |
} |
| 8604 |
}, _cancelIcon) |
| 8605 |
}; |
| 8606 |
|
| 8607 |
if (includeStyles) { |
| 8608 |
styles = _extends({}, styles, { |
| 8609 |
header: header, |
| 8610 |
title: title |
| 8611 |
}); |
| 8612 |
} else { |
| 8613 |
styles = _extends({}, styles, { |
| 8614 |
header: {}, |
| 8615 |
title: {} |
| 8616 |
}); |
| 8617 |
} |
| 8618 |
|
| 8619 |
return styles; |
| 8620 |
} |
| 8621 |
|
| 8622 |
function modalStyles(classPrefix, variables) { |
| 8623 |
var _modalOverlayContai; |
| 8624 |
|
| 8625 |
return { |
| 8626 |
'modal-overlay-container': (_modalOverlayContai = { |
| 8627 |
'-ms-filter': 'progid:dximagetransform.microsoft.gradient.alpha(Opacity=50)', |
| 8628 |
filter: 'alpha(opacity=35)', |
| 8629 |
height: 0, |
| 8630 |
left: 0, |
| 8631 |
opacity: 0, |
| 8632 |
overflow: 'hidden', |
| 8633 |
position: 'fixed', |
| 8634 |
top: 0, |
| 8635 |
transition: 'all 0.3s ease-out, height 0ms 0.3s, opacity 0.3s 0ms', |
| 8636 |
width: '100vw', |
| 8637 |
zIndex: variables.shepherdElementZIndex - 2 |
| 8638 |
}, _modalOverlayContai["." + classPrefix + "shepherd-modal-is-visible &"] = { |
| 8639 |
height: '100vh', |
| 8640 |
opacity: variables.overlayOpacity, |
| 8641 |
transition: 'all 0.3s ease-out, height 0s 0s, opacity 0.3s 0s' |
| 8642 |
}, _modalOverlayContai), |
| 8643 |
'modal-mask-rect': { |
| 8644 |
height: '100vh', |
| 8645 |
width: '100vw' |
| 8646 |
} |
| 8647 |
}; |
| 8648 |
} |
| 8649 |
|
| 8650 |
function textStyles(variables, includeStyles) { |
| 8651 |
if (includeStyles) { |
| 8652 |
return { |
| 8653 |
text: { |
| 8654 |
color: variables.shepherdThemeTextColor, |
| 8655 |
fontSize: variables.shepherdTextFontSize, |
| 8656 |
lineHeight: variables.shepherdTextLineHeight, |
| 8657 |
padding: '0.75em', |
| 8658 |
p: { |
| 8659 |
marginTop: 0, |
| 8660 |
'&:last-child': { |
| 8661 |
marginBottom: 0 |
| 8662 |
} |
| 8663 |
} |
| 8664 |
} |
| 8665 |
}; |
| 8666 |
} |
| 8667 |
|
| 8668 |
return { |
| 8669 |
text: {} |
| 8670 |
}; |
| 8671 |
} |
| 8672 |
|
| 8673 |
function generateStyles(options) { |
| 8674 |
var _ref, _active, _xPlacementTop, _ref2, _xPlacementBott, _xPlacementLeft, _xPlacementRigh, _ref3, _extends2, _rule; |
| 8675 |
|
| 8676 |
var variables = getVariables(options); |
| 8677 |
var classPrefix = normalizePrefix(options.classPrefix); |
| 8678 |
var tippyPrefix = normalizePrefix(options.tippyClassPrefix); |
| 8679 |
var includeStyles = options.includeStyles; |
| 8680 |
|
| 8681 |
var styles = _extends({ |
| 8682 |
active: (_active = {}, _active["&." + classPrefix + "shepherd-modal-is-visible"] = (_ref = {}, _ref[":not(." + classPrefix + "shepherd-target)"] = { |
| 8683 |
pointerEvents: 'none' |
| 8684 |
}, _ref["." + classPrefix + "shepherd-button, ." + classPrefix + "shepherd-cancel-icon, ." + classPrefix + "shepherd-element, ." + classPrefix + "shepherd-target"] = { |
| 8685 |
pointerEvents: 'auto', |
| 8686 |
'*': { |
| 8687 |
pointerEvents: 'auto' |
| 8688 |
} |
| 8689 |
}, _ref), _active) |
| 8690 |
}, buttonStyles(classPrefix, variables, includeStyles), {}, contentStyles(variables, includeStyles), {}, elementStyles(), {}, footerStyles(classPrefix, variables, includeStyles), {}, headerStyles(classPrefix, variables, includeStyles), {}, modalStyles(classPrefix, variables), {}, textStyles(variables, includeStyles)); |
| 8691 |
|
| 8692 |
if (variables.useDropShadow) { |
| 8693 |
styles.element.filter = 'drop-shadow(0 1px 4px rgba(0, 0, 0, 0.2))'; |
| 8694 |
} |
| 8695 |
|
| 8696 |
var classes = sheet(styles, classPrefix + "shepherd"); |
| 8697 |
var arrowMargin = "calc((" + variables.arrowSize + " / 2.1) * 16px)"; |
| 8698 |
var popperThemeArrows = { |
| 8699 |
'&[x-placement^="top"]': (_xPlacementTop = { |
| 8700 |
marginBottom: arrowMargin |
| 8701 |
}, _xPlacementTop["." + tippyPrefix + "tippy-arrow"] = { |
| 8702 |
borderTopColor: variables.shepherdTextBackground |
| 8703 |
}, _xPlacementTop), |
| 8704 |
'&[x-placement^="bottom"]': (_xPlacementBott = { |
| 8705 |
marginTop: arrowMargin |
| 8706 |
}, _xPlacementBott["." + tippyPrefix + "tippy-arrow"] = { |
| 8707 |
borderBottomColor: variables.shepherdTextBackground |
| 8708 |
}, _xPlacementBott["&." + classPrefix + "shepherd-has-title"] = (_ref2 = {}, _ref2["." + tippyPrefix + "tippy-arrow"] = { |
| 8709 |
borderBottomColor: variables.shepherdHeaderBackground |
| 8710 |
}, _ref2), _xPlacementBott), |
| 8711 |
'&[x-placement^="left"]': (_xPlacementLeft = { |
| 8712 |
marginRight: arrowMargin |
| 8713 |
}, _xPlacementLeft["." + tippyPrefix + "tippy-arrow"] = { |
| 8714 |
borderLeftColor: variables.shepherdTextBackground |
| 8715 |
}, _xPlacementLeft), |
| 8716 |
'&[x-placement^="right"]': (_xPlacementRigh = { |
| 8717 |
marginLeft: arrowMargin |
| 8718 |
}, _xPlacementRigh["." + tippyPrefix + "tippy-arrow"] = { |
| 8719 |
borderRightColor: variables.shepherdTextBackground |
| 8720 |
}, _xPlacementRigh) |
| 8721 |
}; // We have to add the root shepherd class separately |
| 8722 |
|
| 8723 |
classes.shepherd = rule((_rule = {}, _rule["&." + tippyPrefix + "tippy-popper"] = _extends({}, popperThemeArrows, (_extends2 = { |
| 8724 |
zIndex: variables.shepherdElementZIndex |
| 8725 |
}, _extends2["." + tippyPrefix + "tippy-tooltip"] = (_ref3 = { |
| 8726 |
backgroundColor: variables.shepherdTextBackground |
| 8727 |
}, _ref3["." + tippyPrefix + "tippy-arrow"] = { |
| 8728 |
transform: "scale(" + variables.arrowSize + ")", |
| 8729 |
zIndex: variables.shepherdElementZIndex + 1 |
| 8730 |
}, _ref3["." + tippyPrefix + "tippy-content"] = { |
| 8731 |
maxHeight: variables.shepherdElementMaxHeight, |
| 8732 |
maxWidth: variables.shepherdElementMaxWidth, |
| 8733 |
padding: 0, |
| 8734 |
textAlign: 'center' |
| 8735 |
}, _ref3), _extends2)), _rule), classPrefix + "shepherd"); |
| 8736 |
return classes; |
| 8737 |
} |
| 8738 |
|
| 8739 |
var Component$7 = preact.Component; |
| 8740 |
|
| 8741 |
var ShepherdModal = |
| 8742 |
/*#__PURE__*/ |
| 8743 |
function (_Component) { |
| 8744 |
_inheritsLoose(ShepherdModal, _Component); |
| 8745 |
|
| 8746 |
function ShepherdModal(props) { |
| 8747 |
var _this; |
| 8748 |
|
| 8749 |
_this = _Component.call(this, props) || this; |
| 8750 |
_this._onScreenChange = null; |
| 8751 |
_this.classPrefix = props.classPrefix; |
| 8752 |
autoBind(_assertThisInitialized(_this)); // Setup initial state |
| 8753 |
|
| 8754 |
_this.closeModalOpening(); |
| 8755 |
|
| 8756 |
return _this; |
| 8757 |
} |
| 8758 |
|
| 8759 |
var _proto = ShepherdModal.prototype; |
| 8760 |
|
| 8761 |
_proto.render = function render(props, state) { |
| 8762 |
var classPrefix = props.classPrefix, |
| 8763 |
styles = props.styles; |
| 8764 |
return preact.h("svg", { |
| 8765 |
className: styles['modal-overlay-container'], |
| 8766 |
onTouchMove: ShepherdModal.handlePreventModalOverlayTouch |
| 8767 |
}, preact.h("defs", null, preact.h("mask", { |
| 8768 |
className: classPrefix + "shepherd-modal-mask", |
| 8769 |
height: "100%", |
| 8770 |
id: classPrefix + "shepherd-modal-mask", |
| 8771 |
width: "100%", |
| 8772 |
x: "0", |
| 8773 |
y: "0" |
| 8774 |
}, preact.h("rect", { |
| 8775 |
className: styles['modal-mask-rect'], |
| 8776 |
fill: "#FFFFFF", |
| 8777 |
height: "100%", |
| 8778 |
width: "100%", |
| 8779 |
x: "0", |
| 8780 |
y: "0" |
| 8781 |
}), preact.h("rect", { |
| 8782 |
className: classPrefix + "shepherd-modal-mask-opening", |
| 8783 |
fill: "#000000", |
| 8784 |
height: state.openingProperties.height, |
| 8785 |
x: state.openingProperties.x, |
| 8786 |
y: state.openingProperties.y, |
| 8787 |
width: state.openingProperties.width |
| 8788 |
}))), preact.h("rect", { |
| 8789 |
height: "100%", |
| 8790 |
width: "100%", |
| 8791 |
x: "0", |
| 8792 |
y: "0", |
| 8793 |
mask: "url(#" + classPrefix + "shepherd-modal-mask)" |
| 8794 |
})); |
| 8795 |
}; |
| 8796 |
|
| 8797 |
_proto.closeModalOpening = function closeModalOpening() { |
| 8798 |
this.setState({ |
| 8799 |
openingProperties: { |
| 8800 |
height: 0, |
| 8801 |
x: 0, |
| 8802 |
y: 0, |
| 8803 |
width: 0 |
| 8804 |
} |
| 8805 |
}); |
| 8806 |
} |
| 8807 |
/** |
| 8808 |
* Hide the modal overlay |
| 8809 |
*/ |
| 8810 |
; |
| 8811 |
|
| 8812 |
_proto.hide = function hide() { |
| 8813 |
document.body.classList.remove(this.classPrefix + "shepherd-modal-is-visible"); // Ensure we cleanup all event listeners when we hide the modal |
| 8814 |
|
| 8815 |
this._cleanupStepEventListeners(); |
| 8816 |
} |
| 8817 |
/** |
| 8818 |
* Uses the bounds of the element we want the opening overtop of to set the dimensions of the opening and position it |
| 8819 |
* @param {HTMLElement} targetElement The element the opening will expose |
| 8820 |
* @param {Number} modalOverlayOpeningPadding An amount of padding to add around the modal overlay opening |
| 8821 |
*/ |
| 8822 |
; |
| 8823 |
|
| 8824 |
_proto.positionModalOpening = function positionModalOpening(targetElement, modalOverlayOpeningPadding) { |
| 8825 |
if (modalOverlayOpeningPadding === void 0) { |
| 8826 |
modalOverlayOpeningPadding = 0; |
| 8827 |
} |
| 8828 |
|
| 8829 |
if (targetElement.getBoundingClientRect) { |
| 8830 |
var _targetElement$getBou = targetElement.getBoundingClientRect(), |
| 8831 |
x = _targetElement$getBou.x, |
| 8832 |
y = _targetElement$getBou.y, |
| 8833 |
width = _targetElement$getBou.width, |
| 8834 |
height = _targetElement$getBou.height, |
| 8835 |
left = _targetElement$getBou.left, |
| 8836 |
top = _targetElement$getBou.top; // getBoundingClientRect is not consistent. Some browsers use x and y, while others use left and top |
| 8837 |
|
| 8838 |
|
| 8839 |
this.setState({ |
| 8840 |
openingProperties: { |
| 8841 |
x: (x || left) - modalOverlayOpeningPadding, |
| 8842 |
y: (y || top) - modalOverlayOpeningPadding, |
| 8843 |
width: width + modalOverlayOpeningPadding * 2, |
| 8844 |
height: height + modalOverlayOpeningPadding * 2 |
| 8845 |
} |
| 8846 |
}); |
| 8847 |
} |
| 8848 |
} |
| 8849 |
/** |
| 8850 |
* If modal is enabled, setup the svg mask opening and modal overlay for the step |
| 8851 |
* @param {Step} step The step instance |
| 8852 |
*/ |
| 8853 |
; |
| 8854 |
|
| 8855 |
_proto.setupForStep = function setupForStep(step) { |
| 8856 |
// Ensure we move listeners from the previous step, before we setup new ones |
| 8857 |
this._cleanupStepEventListeners(); |
| 8858 |
|
| 8859 |
if (step.tour.options.useModalOverlay) { |
| 8860 |
this._styleForStep(step); |
| 8861 |
|
| 8862 |
this.show(); |
| 8863 |
} else { |
| 8864 |
this.hide(); |
| 8865 |
} |
| 8866 |
} |
| 8867 |
/** |
| 8868 |
* Show the modal overlay |
| 8869 |
*/ |
| 8870 |
; |
| 8871 |
|
| 8872 |
_proto.show = function show() { |
| 8873 |
document.body.classList.add(this.classPrefix + "shepherd-modal-is-visible"); |
| 8874 |
} |
| 8875 |
/** |
| 8876 |
* Add touchmove event listener |
| 8877 |
* @private |
| 8878 |
*/ |
| 8879 |
; |
| 8880 |
|
| 8881 |
_proto._addStepEventListeners = function _addStepEventListeners() { |
| 8882 |
// Prevents window from moving on touch. |
| 8883 |
window.addEventListener('touchmove', ShepherdModal._preventModalBodyTouch, { |
| 8884 |
passive: false |
| 8885 |
}); |
| 8886 |
} |
| 8887 |
/** |
| 8888 |
* Cancel the requestAnimationFrame loop and remove touchmove event listeners |
| 8889 |
* @private |
| 8890 |
*/ |
| 8891 |
; |
| 8892 |
|
| 8893 |
_proto._cleanupStepEventListeners = function _cleanupStepEventListeners() { |
| 8894 |
if (this.rafId) { |
| 8895 |
cancelAnimationFrame(this.rafId); |
| 8896 |
this.rafId = undefined; |
| 8897 |
} |
| 8898 |
|
| 8899 |
window.removeEventListener('touchmove', ShepherdModal._preventModalBodyTouch, { |
| 8900 |
passive: false |
| 8901 |
}); |
| 8902 |
} |
| 8903 |
/** |
| 8904 |
* Style the modal for the step |
| 8905 |
* @param {Step} step The step to style the opening for |
| 8906 |
* @private |
| 8907 |
*/ |
| 8908 |
; |
| 8909 |
|
| 8910 |
_proto._styleForStep = function _styleForStep(step) { |
| 8911 |
var _this2 = this; |
| 8912 |
|
| 8913 |
var modalOverlayOpeningPadding = step.options.modalOverlayOpeningPadding; |
| 8914 |
|
| 8915 |
if (step.target) { |
| 8916 |
// Setup recursive function to call requestAnimationFrame to update the modal opening position |
| 8917 |
var rafLoop = function rafLoop() { |
| 8918 |
_this2.rafId = undefined; |
| 8919 |
|
| 8920 |
_this2.positionModalOpening(step.target, modalOverlayOpeningPadding); |
| 8921 |
|
| 8922 |
_this2.rafId = requestAnimationFrame(rafLoop); |
| 8923 |
}; |
| 8924 |
|
| 8925 |
rafLoop(); |
| 8926 |
|
| 8927 |
this._addStepEventListeners(); |
| 8928 |
} else { |
| 8929 |
this.closeModalOpening(); |
| 8930 |
} |
| 8931 |
}; |
| 8932 |
|
| 8933 |
ShepherdModal._preventModalBodyTouch = function _preventModalBodyTouch(e) { |
| 8934 |
e.preventDefault(); |
| 8935 |
}; |
| 8936 |
|
| 8937 |
ShepherdModal.handlePreventModalOverlayTouch = function handlePreventModalOverlayTouch(e) { |
| 8938 |
e.stopPropagation(); |
| 8939 |
}; |
| 8940 |
|
| 8941 |
return ShepherdModal; |
| 8942 |
}(Component$7); |
| 8943 |
|
| 8944 |
var render$2 = preact.render; |
| 8945 |
/** |
| 8946 |
* Creates incremented ID for each newly created tour |
| 8947 |
* |
| 8948 |
* @return {Function} A function that returns the unique id for the tour |
| 8949 |
* @private |
| 8950 |
*/ |
| 8951 |
|
| 8952 |
var uniqueId$1 = function () { |
| 8953 |
var id = 0; |
| 8954 |
return function () { |
| 8955 |
return ++id; |
| 8956 |
}; |
| 8957 |
}(); |
| 8958 |
|
| 8959 |
var Shepherd = new Evented(); |
| 8960 |
/** |
| 8961 |
* Class representing the site tour |
| 8962 |
* @extends {Evented} |
| 8963 |
*/ |
| 8964 |
|
| 8965 |
var Tour = |
| 8966 |
/*#__PURE__*/ |
| 8967 |
function (_Evented) { |
| 8968 |
_inheritsLoose(Tour, _Evented); |
| 8969 |
|
| 8970 |
/** |
| 8971 |
* @param {Object} options The options for the tour |
| 8972 |
* @param {boolean} options.confirmCancel If true, will issue a `window.confirm` before cancelling |
| 8973 |
* @param {string} options.confirmCancelMessage The message to display in the confirm dialog |
| 8974 |
* @param {string} options.classPrefix The prefix to add to all the `shepherd-*` class names. |
| 8975 |
* @param {Object} options.defaultStepOptions Default options for Steps ({@link Step#constructor}), created through `addStep` |
| 8976 |
* @param {boolean} options.disableScroll When set to true, will keep the user from scrolling with the scrollbar, |
| 8977 |
* mousewheel, arrow keys, etc. You may want to use this to ensure you are driving the scroll position with the tour. |
| 8978 |
* @param {boolean} options.exitOnEsc Exiting the tour with the escape key will be enabled unless this is explicitly |
| 8979 |
* set to false. |
| 8980 |
* @param {boolean} options.includeStyles If false, the majority of the Shepherd styles will not be included. |
| 8981 |
* You may want to use this option if you find yourself overriding a lot of the Shepherd styles. |
| 8982 |
* @param {boolean} options.keyboardNavigation Navigating the tour via left and right arrow keys will be enabled |
| 8983 |
* unless this is explicitly set to false. |
| 8984 |
* @param {HTMLElement} options.modalContainer An optional container element for the modal. |
| 8985 |
* If not set, the modal will be appended to `document.body`. |
| 8986 |
* @param {object[] | Step[]} options.steps An array of step options objects or Step instances to initialize the tour with |
| 8987 |
* @param {object} options.styleVariables An object hash of style variables to override |
| 8988 |
* @param {string} options.tourName An optional "name" for the tour. This will be appended to the the tour's |
| 8989 |
* dynamically generated `id` property -- which is also set on the `body` element as the `data-shepherd-active-tour` attribute |
| 8990 |
* whenever the tour becomes active. |
| 8991 |
* @param {boolean} options.useModalOverlay Whether or not steps should be placed above a darkened |
| 8992 |
* modal overlay. If true, the overlay will create an opening around the target element so that it |
| 8993 |
* can remain interactive |
| 8994 |
* @returns {Tour} |
| 8995 |
*/ |
| 8996 |
function Tour(options) { |
| 8997 |
var _this; |
| 8998 |
|
| 8999 |
if (options === void 0) { |
| 9000 |
options = {}; |
| 9001 |
} |
| 9002 |
|
| 9003 |
_this = _Evented.call(this, options) || this; |
| 9004 |
autoBind(_assertThisInitialized(_this)); |
| 9005 |
var defaultTourOptions = { |
| 9006 |
exitOnEsc: true, |
| 9007 |
includeStyles: true, |
| 9008 |
keyboardNavigation: true |
| 9009 |
}; |
| 9010 |
_this.options = _extends({}, defaultTourOptions, options); |
| 9011 |
_this.classPrefix = _this.options ? normalizePrefix(_this.options.classPrefix) : ''; |
| 9012 |
_this.styles = generateStyles(_this.options); |
| 9013 |
_this.steps = []; |
| 9014 |
|
| 9015 |
_this.addSteps(_this.options.steps); // Pass these events onto the global Shepherd object |
| 9016 |
|
| 9017 |
|
| 9018 |
var events = ['active', 'cancel', 'complete', 'inactive', 'show', 'start']; |
| 9019 |
events.map(function (event) { |
| 9020 |
(function (e) { |
| 9021 |
_this.on(e, function (opts) { |
| 9022 |
opts = opts || {}; |
| 9023 |
opts.tour = _assertThisInitialized(_this); |
| 9024 |
Shepherd.trigger(e, opts); |
| 9025 |
}); |
| 9026 |
})(event); |
| 9027 |
}); |
| 9028 |
var existingModal = document.querySelector("." + _this.classPrefix + "shepherd-modal-overlay-container"); |
| 9029 |
render$2(preact.h(ShepherdModal, { |
| 9030 |
classPrefix: _this.classPrefix, |
| 9031 |
ref: function ref(c) { |
| 9032 |
return _this.modal = c; |
| 9033 |
}, |
| 9034 |
styles: _this.styles |
| 9035 |
}), options.modalContainer || document.body, existingModal); |
| 9036 |
|
| 9037 |
_this._setTooltipDefaults(); |
| 9038 |
|
| 9039 |
_this._setTourID(); |
| 9040 |
|
| 9041 |
return _assertThisInitialized(_this) || _assertThisInitialized(_this); |
| 9042 |
} |
| 9043 |
/** |
| 9044 |
* Adds a new step to the tour |
| 9045 |
* @param {Object|Step} options An object containing step options or a Step instance |
| 9046 |
* @return {Step} The newly added step |
| 9047 |
*/ |
| 9048 |
|
| 9049 |
|
| 9050 |
var _proto = Tour.prototype; |
| 9051 |
|
| 9052 |
_proto.addStep = function addStep(options) { |
| 9053 |
var step = options; |
| 9054 |
|
| 9055 |
if (!(step instanceof Step)) { |
| 9056 |
step = this._setupStep(step); |
| 9057 |
} else { |
| 9058 |
step.tour = this; |
| 9059 |
} |
| 9060 |
|
| 9061 |
this.steps.push(step); |
| 9062 |
return step; |
| 9063 |
} |
| 9064 |
/** |
| 9065 |
* Add multiple steps to the tour |
| 9066 |
* @param {Array<object> | Array<Step>} steps The steps to add to the tour |
| 9067 |
*/ |
| 9068 |
; |
| 9069 |
|
| 9070 |
_proto.addSteps = function addSteps(steps) { |
| 9071 |
var _this2 = this; |
| 9072 |
|
| 9073 |
if (Array.isArray(steps)) { |
| 9074 |
steps.forEach(function (step) { |
| 9075 |
_this2.addStep(step); |
| 9076 |
}); |
| 9077 |
} |
| 9078 |
|
| 9079 |
return this; |
| 9080 |
} |
| 9081 |
/** |
| 9082 |
* Go to the previous step in the tour |
| 9083 |
*/ |
| 9084 |
; |
| 9085 |
|
| 9086 |
_proto.back = function back() { |
| 9087 |
var index = this.steps.indexOf(this.currentStep); |
| 9088 |
this.show(index - 1, false); |
| 9089 |
} |
| 9090 |
/** |
| 9091 |
* Calls _done() triggering the 'cancel' event |
| 9092 |
* If `confirmCancel` is true, will show a window.confirm before cancelling |
| 9093 |
*/ |
| 9094 |
; |
| 9095 |
|
| 9096 |
_proto.cancel = function cancel() { |
| 9097 |
if (this.options.confirmCancel) { |
| 9098 |
var cancelMessage = this.options.confirmCancelMessage || 'Are you sure you want to stop the tour?'; |
| 9099 |
var stopTour = window.confirm(cancelMessage); |
| 9100 |
|
| 9101 |
if (stopTour) { |
| 9102 |
this._done('cancel'); |
| 9103 |
} |
| 9104 |
} else { |
| 9105 |
this._done('cancel'); |
| 9106 |
} |
| 9107 |
} |
| 9108 |
/** |
| 9109 |
* Calls _done() triggering the `complete` event |
| 9110 |
*/ |
| 9111 |
; |
| 9112 |
|
| 9113 |
_proto.complete = function complete() { |
| 9114 |
this._done('complete'); |
| 9115 |
} |
| 9116 |
/** |
| 9117 |
* Gets the step from a given id |
| 9118 |
* @param {Number|String} id The id of the step to retrieve |
| 9119 |
* @return {Step} The step corresponding to the `id` |
| 9120 |
*/ |
| 9121 |
; |
| 9122 |
|
| 9123 |
_proto.getById = function getById(id) { |
| 9124 |
return this.steps.find(function (step) { |
| 9125 |
return step.id === id; |
| 9126 |
}); |
| 9127 |
} |
| 9128 |
/** |
| 9129 |
* Gets the current step |
| 9130 |
* @returns {Step|null} |
| 9131 |
*/ |
| 9132 |
; |
| 9133 |
|
| 9134 |
_proto.getCurrentStep = function getCurrentStep() { |
| 9135 |
return this.currentStep; |
| 9136 |
} |
| 9137 |
/** |
| 9138 |
* Hide the current step |
| 9139 |
*/ |
| 9140 |
; |
| 9141 |
|
| 9142 |
_proto.hide = function hide() { |
| 9143 |
var currentStep = this.getCurrentStep(); |
| 9144 |
|
| 9145 |
if (currentStep) { |
| 9146 |
return currentStep.hide(); |
| 9147 |
} |
| 9148 |
} |
| 9149 |
/** |
| 9150 |
* Check if the tour is active |
| 9151 |
* @return {boolean} |
| 9152 |
*/ |
| 9153 |
; |
| 9154 |
|
| 9155 |
_proto.isActive = function isActive() { |
| 9156 |
return Shepherd.activeTour === this; |
| 9157 |
} |
| 9158 |
/** |
| 9159 |
* Go to the next step in the tour |
| 9160 |
* If we are at the end, call `complete` |
| 9161 |
*/ |
| 9162 |
; |
| 9163 |
|
| 9164 |
_proto.next = function next() { |
| 9165 |
var index = this.steps.indexOf(this.currentStep); |
| 9166 |
|
| 9167 |
if (index === this.steps.length - 1) { |
| 9168 |
this.complete(); |
| 9169 |
} else { |
| 9170 |
this.show(index + 1, true); |
| 9171 |
} |
| 9172 |
} |
| 9173 |
/** |
| 9174 |
* Removes the step from the tour |
| 9175 |
* @param {String} name The id for the step to remove |
| 9176 |
*/ |
| 9177 |
; |
| 9178 |
|
| 9179 |
_proto.removeStep = function removeStep(name) { |
| 9180 |
var _this3 = this; |
| 9181 |
|
| 9182 |
var current = this.getCurrentStep(); // Find the step, destroy it and remove it from this.steps |
| 9183 |
|
| 9184 |
this.steps.some(function (step, i) { |
| 9185 |
if (step.id === name) { |
| 9186 |
if (step.isOpen()) { |
| 9187 |
step.hide(); |
| 9188 |
} |
| 9189 |
|
| 9190 |
step.destroy(); |
| 9191 |
|
| 9192 |
_this3.steps.splice(i, 1); |
| 9193 |
|
| 9194 |
return true; |
| 9195 |
} |
| 9196 |
}); |
| 9197 |
|
| 9198 |
if (current && current.id === name) { |
| 9199 |
this.currentStep = undefined; // If we have steps left, show the first one, otherwise just cancel the tour |
| 9200 |
|
| 9201 |
this.steps.length ? this.show(0) : this.cancel(); |
| 9202 |
} |
| 9203 |
} |
| 9204 |
/** |
| 9205 |
* Show a specific step in the tour |
| 9206 |
* @param {Number|String} key The key to look up the step by |
| 9207 |
* @param {Boolean} forward True if we are going forward, false if backward |
| 9208 |
*/ |
| 9209 |
; |
| 9210 |
|
| 9211 |
_proto.show = function show(key, forward) { |
| 9212 |
if (key === void 0) { |
| 9213 |
key = 0; |
| 9214 |
} |
| 9215 |
|
| 9216 |
if (forward === void 0) { |
| 9217 |
forward = true; |
| 9218 |
} |
| 9219 |
|
| 9220 |
var step = isString(key) ? this.getById(key) : this.steps[key]; |
| 9221 |
|
| 9222 |
if (step) { |
| 9223 |
this._updateStateBeforeShow(); |
| 9224 |
|
| 9225 |
var shouldSkipStep = isFunction(step.options.showOn) && !step.options.showOn(); // If `showOn` returns false, we want to skip the step, otherwise, show the step like normal |
| 9226 |
|
| 9227 |
if (shouldSkipStep) { |
| 9228 |
this._skipStep(step, forward); |
| 9229 |
} else { |
| 9230 |
this.trigger('show', { |
| 9231 |
step: step, |
| 9232 |
previous: this.currentStep |
| 9233 |
}); |
| 9234 |
this.currentStep = step; |
| 9235 |
step.show(); |
| 9236 |
} |
| 9237 |
} |
| 9238 |
} |
| 9239 |
/** |
| 9240 |
* Start the tour |
| 9241 |
*/ |
| 9242 |
; |
| 9243 |
|
| 9244 |
_proto.start = function start() { |
| 9245 |
this.trigger('start'); |
| 9246 |
|
| 9247 |
if (this.options.disableScroll) { |
| 9248 |
bodyScrollLock.disableBodyScroll(); |
| 9249 |
} // Save the focused element before the tour opens |
| 9250 |
|
| 9251 |
|
| 9252 |
this.focusedElBeforeOpen = document.activeElement; |
| 9253 |
this.currentStep = null; |
| 9254 |
|
| 9255 |
this._setupActiveTour(); |
| 9256 |
|
| 9257 |
this.next(); |
| 9258 |
} |
| 9259 |
/** |
| 9260 |
* Called whenever the tour is cancelled or completed, basically anytime we exit the tour |
| 9261 |
* @param {String} event The event name to trigger |
| 9262 |
* @private |
| 9263 |
*/ |
| 9264 |
; |
| 9265 |
|
| 9266 |
_proto._done = function _done(event) { |
| 9267 |
var index = this.steps.indexOf(this.currentStep); |
| 9268 |
|
| 9269 |
if (Array.isArray(this.steps)) { |
| 9270 |
this.steps.forEach(function (step) { |
| 9271 |
return step.destroy(); |
| 9272 |
}); |
| 9273 |
} |
| 9274 |
|
| 9275 |
cleanupSteps(this); |
| 9276 |
this.trigger(event, { |
| 9277 |
index: index |
| 9278 |
}); |
| 9279 |
Shepherd.activeTour = null; |
| 9280 |
|
| 9281 |
this._removeBodyAttrs(); |
| 9282 |
|
| 9283 |
this.trigger('inactive', { |
| 9284 |
tour: this |
| 9285 |
}); |
| 9286 |
|
| 9287 |
if (this.options.disableScroll) { |
| 9288 |
bodyScrollLock.clearAllBodyScrollLocks(); |
| 9289 |
} |
| 9290 |
|
| 9291 |
this.modal.hide(); // Focus the element that was focused before the tour started |
| 9292 |
|
| 9293 |
if (isElement(this.focusedElBeforeOpen)) { |
| 9294 |
this.focusedElBeforeOpen.focus(); |
| 9295 |
} |
| 9296 |
} |
| 9297 |
/** |
| 9298 |
* Make this tour "active" |
| 9299 |
* @private |
| 9300 |
*/ |
| 9301 |
; |
| 9302 |
|
| 9303 |
_proto._setupActiveTour = function _setupActiveTour() { |
| 9304 |
this._addBodyAttrs(); |
| 9305 |
|
| 9306 |
this.trigger('active', { |
| 9307 |
tour: this |
| 9308 |
}); |
| 9309 |
Shepherd.activeTour = this; |
| 9310 |
} |
| 9311 |
/** |
| 9312 |
* Setup a new step object |
| 9313 |
* @param {Object} stepOptions The object describing the options for the step |
| 9314 |
* @return {Step} The step instance |
| 9315 |
* @private |
| 9316 |
*/ |
| 9317 |
; |
| 9318 |
|
| 9319 |
_proto._setupStep = function _setupStep(stepOptions) { |
| 9320 |
stepOptions = _extends({}, this.options.defaultStepOptions, stepOptions); |
| 9321 |
return new Step(this, stepOptions); |
| 9322 |
} |
| 9323 |
/** |
| 9324 |
* Called when `showOn` evaluates to false, to skip the step |
| 9325 |
* @param {Step} step The step to skip |
| 9326 |
* @param {Boolean} forward True if we are going forward, false if backward |
| 9327 |
* @private |
| 9328 |
*/ |
| 9329 |
; |
| 9330 |
|
| 9331 |
_proto._skipStep = function _skipStep(step, forward) { |
| 9332 |
var index = this.steps.indexOf(step); |
| 9333 |
var nextIndex = forward ? index + 1 : index - 1; |
| 9334 |
this.show(nextIndex, forward); |
| 9335 |
} |
| 9336 |
/** |
| 9337 |
* Set the tippy defaults |
| 9338 |
* @private |
| 9339 |
*/ |
| 9340 |
; |
| 9341 |
|
| 9342 |
_proto._setTooltipDefaults = function _setTooltipDefaults() { |
| 9343 |
tippy.setDefaultProps(defaults); |
| 9344 |
} |
| 9345 |
/** |
| 9346 |
* Before showing, hide the current step and if the tour is not |
| 9347 |
* already active, call `this._setupActiveTour`. |
| 9348 |
* @private |
| 9349 |
*/ |
| 9350 |
; |
| 9351 |
|
| 9352 |
_proto._updateStateBeforeShow = function _updateStateBeforeShow() { |
| 9353 |
if (this.currentStep) { |
| 9354 |
this.currentStep.hide(); |
| 9355 |
} |
| 9356 |
|
| 9357 |
if (!this.isActive()) { |
| 9358 |
this._setupActiveTour(); |
| 9359 |
} |
| 9360 |
} |
| 9361 |
/** |
| 9362 |
* Sets this.id to `${tourName}--${uuid}` |
| 9363 |
* @private |
| 9364 |
*/ |
| 9365 |
; |
| 9366 |
|
| 9367 |
_proto._setTourID = function _setTourID() { |
| 9368 |
var tourName = this.options.tourName || 'tour'; |
| 9369 |
var uuid = uniqueId$1(); |
| 9370 |
this.id = tourName + "--" + uuid; |
| 9371 |
} |
| 9372 |
/** |
| 9373 |
* Adds the data-shepherd-active-tour attribute and the 'shepherd-active' |
| 9374 |
* class to the body. |
| 9375 |
* @private |
| 9376 |
*/ |
| 9377 |
; |
| 9378 |
|
| 9379 |
_proto._addBodyAttrs = function _addBodyAttrs() { |
| 9380 |
document.body.setAttribute("data-" + this.classPrefix + "shepherd-active-tour", this.id); |
| 9381 |
document.body.classList.add(this.styles.active.trim()); |
| 9382 |
} |
| 9383 |
/** |
| 9384 |
* Removes the data-shepherd-active-tour attribute and the 'shepherd-active' |
| 9385 |
* class from the body. |
| 9386 |
* @private |
| 9387 |
*/ |
| 9388 |
; |
| 9389 |
|
| 9390 |
_proto._removeBodyAttrs = function _removeBodyAttrs() { |
| 9391 |
document.body.removeAttribute("data-" + this.classPrefix + "shepherd-active-tour"); |
| 9392 |
document.body.classList.remove(this.styles.active.trim()); |
| 9393 |
}; |
| 9394 |
|
| 9395 |
return Tour; |
| 9396 |
}(Evented); |
| 9397 |
|
| 9398 |
_extends(Shepherd, { |
| 9399 |
Tour: Tour, |
| 9400 |
Step: Step |
| 9401 |
}); |
| 9402 |
|
| 9403 |
return Shepherd; |
| 9404 |
|
| 9405 |
})); |
| 9406 |
//# sourceMappingURL=shepherd.js.map |
| 9407 |
|
