| 1 |
var __create = Object.create; |
| 2 |
var __defProp = Object.defineProperty; |
| 3 |
var __getOwnPropDesc = Object.getOwnPropertyDescriptor; |
| 4 |
var __getOwnPropNames = Object.getOwnPropertyNames; |
| 5 |
var __getProtoOf = Object.getPrototypeOf; |
| 6 |
var __hasOwnProp = Object.prototype.hasOwnProperty; |
| 7 |
var __commonJS = (cb, mod) => function __require() { |
| 8 |
return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports; |
| 9 |
}; |
| 10 |
var __export = (target, all) => { |
| 11 |
for (var name in all) |
| 12 |
__defProp(target, name, { get: all[name], enumerable: true }); |
| 13 |
}; |
| 14 |
var __copyProps = (to, from, except, desc) => { |
| 15 |
if (from && typeof from === "object" || typeof from === "function") { |
| 16 |
for (let key2 of __getOwnPropNames(from)) |
| 17 |
if (!__hasOwnProp.call(to, key2) && key2 !== except) |
| 18 |
__defProp(to, key2, { get: () => from[key2], enumerable: !(desc = __getOwnPropDesc(from, key2)) || desc.enumerable }); |
| 19 |
} |
| 20 |
return to; |
| 21 |
}; |
| 22 |
var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( |
| 23 |
// If the importer is in node compatibility mode or this is not an ESM |
| 24 |
// file that has been converted to a CommonJS file using a Babel- |
| 25 |
// compatible transform (i.e. "__esModule" has not been set), then set |
| 26 |
// "default" to the CommonJS "module.exports" for node compatibility. |
| 27 |
isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, |
| 28 |
mod |
| 29 |
)); |
| 30 |
|
| 31 |
// package-external:@wordpress/i18n |
| 32 |
var require_i18n = __commonJS({ |
| 33 |
"package-external:@wordpress/i18n"(exports, module) { |
| 34 |
module.exports = window.wp.i18n; |
| 35 |
} |
| 36 |
}); |
| 37 |
|
| 38 |
// package-external:@wordpress/element |
| 39 |
var require_element = __commonJS({ |
| 40 |
"package-external:@wordpress/element"(exports, module) { |
| 41 |
module.exports = window.wp.element; |
| 42 |
} |
| 43 |
}); |
| 44 |
|
| 45 |
// vendor-external:react |
| 46 |
var require_react = __commonJS({ |
| 47 |
"vendor-external:react"(exports, module) { |
| 48 |
module.exports = window.React; |
| 49 |
} |
| 50 |
}); |
| 51 |
|
| 52 |
// vendor-external:react/jsx-runtime |
| 53 |
var require_jsx_runtime = __commonJS({ |
| 54 |
"vendor-external:react/jsx-runtime"(exports, module) { |
| 55 |
module.exports = window.ReactJSXRuntime; |
| 56 |
} |
| 57 |
}); |
| 58 |
|
| 59 |
// vendor-external:react-dom |
| 60 |
var require_react_dom = __commonJS({ |
| 61 |
"vendor-external:react-dom"(exports, module) { |
| 62 |
module.exports = window.ReactDOM; |
| 63 |
} |
| 64 |
}); |
| 65 |
|
| 66 |
// node_modules/use-sync-external-store/cjs/use-sync-external-store-shim.development.js |
| 67 |
var require_use_sync_external_store_shim_development = __commonJS({ |
| 68 |
"node_modules/use-sync-external-store/cjs/use-sync-external-store-shim.development.js"(exports) { |
| 69 |
"use strict"; |
| 70 |
(function() { |
| 71 |
function is(x2, y2) { |
| 72 |
return x2 === y2 && (0 !== x2 || 1 / x2 === 1 / y2) || x2 !== x2 && y2 !== y2; |
| 73 |
} |
| 74 |
function useSyncExternalStore$2(subscribe2, getSnapshot) { |
| 75 |
didWarnOld18Alpha || void 0 === React79.startTransition || (didWarnOld18Alpha = true, console.error( |
| 76 |
"You are using an outdated, pre-release alpha of React 18 that does not support useSyncExternalStore. The use-sync-external-store shim will not work correctly. Upgrade to a newer pre-release." |
| 77 |
)); |
| 78 |
var value = getSnapshot(); |
| 79 |
if (!didWarnUncachedGetSnapshot) { |
| 80 |
var cachedValue = getSnapshot(); |
| 81 |
objectIs(value, cachedValue) || (console.error( |
| 82 |
"The result of getSnapshot should be cached to avoid an infinite loop" |
| 83 |
), didWarnUncachedGetSnapshot = true); |
| 84 |
} |
| 85 |
cachedValue = useState50({ |
| 86 |
inst: { value, getSnapshot } |
| 87 |
}); |
| 88 |
var inst = cachedValue[0].inst, forceUpdate = cachedValue[1]; |
| 89 |
useLayoutEffect10( |
| 90 |
function() { |
| 91 |
inst.value = value; |
| 92 |
inst.getSnapshot = getSnapshot; |
| 93 |
checkIfSnapshotChanged(inst) && forceUpdate({ inst }); |
| 94 |
}, |
| 95 |
[subscribe2, value, getSnapshot] |
| 96 |
); |
| 97 |
useEffect47( |
| 98 |
function() { |
| 99 |
checkIfSnapshotChanged(inst) && forceUpdate({ inst }); |
| 100 |
return subscribe2(function() { |
| 101 |
checkIfSnapshotChanged(inst) && forceUpdate({ inst }); |
| 102 |
}); |
| 103 |
}, |
| 104 |
[subscribe2] |
| 105 |
); |
| 106 |
useDebugValue2(value); |
| 107 |
return value; |
| 108 |
} |
| 109 |
function checkIfSnapshotChanged(inst) { |
| 110 |
var latestGetSnapshot = inst.getSnapshot; |
| 111 |
inst = inst.value; |
| 112 |
try { |
| 113 |
var nextValue = latestGetSnapshot(); |
| 114 |
return !objectIs(inst, nextValue); |
| 115 |
} catch (error2) { |
| 116 |
return true; |
| 117 |
} |
| 118 |
} |
| 119 |
function useSyncExternalStore$1(subscribe2, getSnapshot) { |
| 120 |
return getSnapshot(); |
| 121 |
} |
| 122 |
"undefined" !== typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ && "function" === typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStart && __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStart(Error()); |
| 123 |
var React79 = require_react(), objectIs = "function" === typeof Object.is ? Object.is : is, useState50 = React79.useState, useEffect47 = React79.useEffect, useLayoutEffect10 = React79.useLayoutEffect, useDebugValue2 = React79.useDebugValue, didWarnOld18Alpha = false, didWarnUncachedGetSnapshot = false, shim = "undefined" === typeof window || "undefined" === typeof window.document || "undefined" === typeof window.document.createElement ? useSyncExternalStore$1 : useSyncExternalStore$2; |
| 124 |
exports.useSyncExternalStore = void 0 !== React79.useSyncExternalStore ? React79.useSyncExternalStore : shim; |
| 125 |
"undefined" !== typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ && "function" === typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStop && __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStop(Error()); |
| 126 |
})(); |
| 127 |
} |
| 128 |
}); |
| 129 |
|
| 130 |
// node_modules/use-sync-external-store/shim/index.js |
| 131 |
var require_shim = __commonJS({ |
| 132 |
"node_modules/use-sync-external-store/shim/index.js"(exports, module) { |
| 133 |
"use strict"; |
| 134 |
if (false) { |
| 135 |
module.exports = null; |
| 136 |
} else { |
| 137 |
module.exports = require_use_sync_external_store_shim_development(); |
| 138 |
} |
| 139 |
} |
| 140 |
}); |
| 141 |
|
| 142 |
// node_modules/use-sync-external-store/cjs/use-sync-external-store-shim/with-selector.development.js |
| 143 |
var require_with_selector_development = __commonJS({ |
| 144 |
"node_modules/use-sync-external-store/cjs/use-sync-external-store-shim/with-selector.development.js"(exports) { |
| 145 |
"use strict"; |
| 146 |
(function() { |
| 147 |
function is(x2, y2) { |
| 148 |
return x2 === y2 && (0 !== x2 || 1 / x2 === 1 / y2) || x2 !== x2 && y2 !== y2; |
| 149 |
} |
| 150 |
"undefined" !== typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ && "function" === typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStart && __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStart(Error()); |
| 151 |
var React79 = require_react(), shim = require_shim(), objectIs = "function" === typeof Object.is ? Object.is : is, useSyncExternalStore3 = shim.useSyncExternalStore, useRef61 = React79.useRef, useEffect47 = React79.useEffect, useMemo57 = React79.useMemo, useDebugValue2 = React79.useDebugValue; |
| 152 |
exports.useSyncExternalStoreWithSelector = function(subscribe2, getSnapshot, getServerSnapshot, selector2, isEqual) { |
| 153 |
var instRef = useRef61(null); |
| 154 |
if (null === instRef.current) { |
| 155 |
var inst = { hasValue: false, value: null }; |
| 156 |
instRef.current = inst; |
| 157 |
} else inst = instRef.current; |
| 158 |
instRef = useMemo57( |
| 159 |
function() { |
| 160 |
function memoizedSelector(nextSnapshot) { |
| 161 |
if (!hasMemo) { |
| 162 |
hasMemo = true; |
| 163 |
memoizedSnapshot = nextSnapshot; |
| 164 |
nextSnapshot = selector2(nextSnapshot); |
| 165 |
if (void 0 !== isEqual && inst.hasValue) { |
| 166 |
var currentSelection = inst.value; |
| 167 |
if (isEqual(currentSelection, nextSnapshot)) |
| 168 |
return memoizedSelection = currentSelection; |
| 169 |
} |
| 170 |
return memoizedSelection = nextSnapshot; |
| 171 |
} |
| 172 |
currentSelection = memoizedSelection; |
| 173 |
if (objectIs(memoizedSnapshot, nextSnapshot)) |
| 174 |
return currentSelection; |
| 175 |
var nextSelection = selector2(nextSnapshot); |
| 176 |
if (void 0 !== isEqual && isEqual(currentSelection, nextSelection)) |
| 177 |
return memoizedSnapshot = nextSnapshot, currentSelection; |
| 178 |
memoizedSnapshot = nextSnapshot; |
| 179 |
return memoizedSelection = nextSelection; |
| 180 |
} |
| 181 |
var hasMemo = false, memoizedSnapshot, memoizedSelection, maybeGetServerSnapshot = void 0 === getServerSnapshot ? null : getServerSnapshot; |
| 182 |
return [ |
| 183 |
function() { |
| 184 |
return memoizedSelector(getSnapshot()); |
| 185 |
}, |
| 186 |
null === maybeGetServerSnapshot ? void 0 : function() { |
| 187 |
return memoizedSelector(maybeGetServerSnapshot()); |
| 188 |
} |
| 189 |
]; |
| 190 |
}, |
| 191 |
[getSnapshot, getServerSnapshot, selector2, isEqual] |
| 192 |
); |
| 193 |
var value = useSyncExternalStore3(subscribe2, instRef[0], instRef[1]); |
| 194 |
useEffect47( |
| 195 |
function() { |
| 196 |
inst.hasValue = true; |
| 197 |
inst.value = value; |
| 198 |
}, |
| 199 |
[value] |
| 200 |
); |
| 201 |
useDebugValue2(value); |
| 202 |
return value; |
| 203 |
}; |
| 204 |
"undefined" !== typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ && "function" === typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStop && __REACT_DEVTOOLS_GLOBAL_HOOK__.registerInternalModuleStop(Error()); |
| 205 |
})(); |
| 206 |
} |
| 207 |
}); |
| 208 |
|
| 209 |
// node_modules/use-sync-external-store/shim/with-selector.js |
| 210 |
var require_with_selector = __commonJS({ |
| 211 |
"node_modules/use-sync-external-store/shim/with-selector.js"(exports, module) { |
| 212 |
"use strict"; |
| 213 |
if (false) { |
| 214 |
module.exports = null; |
| 215 |
} else { |
| 216 |
module.exports = require_with_selector_development(); |
| 217 |
} |
| 218 |
} |
| 219 |
}); |
| 220 |
|
| 221 |
// package-external:@wordpress/primitives |
| 222 |
var require_primitives = __commonJS({ |
| 223 |
"package-external:@wordpress/primitives"(exports, module) { |
| 224 |
module.exports = window.wp.primitives; |
| 225 |
} |
| 226 |
}); |
| 227 |
|
| 228 |
// package-external:@wordpress/compose |
| 229 |
var require_compose = __commonJS({ |
| 230 |
"package-external:@wordpress/compose"(exports, module) { |
| 231 |
module.exports = window.wp.compose; |
| 232 |
} |
| 233 |
}); |
| 234 |
|
| 235 |
// package-external:@wordpress/theme |
| 236 |
var require_theme = __commonJS({ |
| 237 |
"package-external:@wordpress/theme"(exports, module) { |
| 238 |
module.exports = window.wp.theme; |
| 239 |
} |
| 240 |
}); |
| 241 |
|
| 242 |
// package-external:@wordpress/private-apis |
| 243 |
var require_private_apis = __commonJS({ |
| 244 |
"package-external:@wordpress/private-apis"(exports, module) { |
| 245 |
module.exports = window.wp.privateApis; |
| 246 |
} |
| 247 |
}); |
| 248 |
|
| 249 |
// package-external:@wordpress/components |
| 250 |
var require_components = __commonJS({ |
| 251 |
"package-external:@wordpress/components"(exports, module) { |
| 252 |
module.exports = window.wp.components; |
| 253 |
} |
| 254 |
}); |
| 255 |
|
| 256 |
// package-external:@wordpress/data |
| 257 |
var require_data = __commonJS({ |
| 258 |
"package-external:@wordpress/data"(exports, module) { |
| 259 |
module.exports = window.wp.data; |
| 260 |
} |
| 261 |
}); |
| 262 |
|
| 263 |
// package-external:@wordpress/notices |
| 264 |
var require_notices = __commonJS({ |
| 265 |
"package-external:@wordpress/notices"(exports, module) { |
| 266 |
module.exports = window.wp.notices; |
| 267 |
} |
| 268 |
}); |
| 269 |
|
| 270 |
// package-external:@wordpress/api-fetch |
| 271 |
var require_api_fetch = __commonJS({ |
| 272 |
"package-external:@wordpress/api-fetch"(exports, module) { |
| 273 |
module.exports = window.wp.apiFetch; |
| 274 |
} |
| 275 |
}); |
| 276 |
|
| 277 |
// package-external:@wordpress/preferences |
| 278 |
var require_preferences = __commonJS({ |
| 279 |
"package-external:@wordpress/preferences"(exports, module) { |
| 280 |
module.exports = window.wp.preferences; |
| 281 |
} |
| 282 |
}); |
| 283 |
|
| 284 |
// node_modules/fast-deep-equal/es6/index.js |
| 285 |
var require_es6 = __commonJS({ |
| 286 |
"node_modules/fast-deep-equal/es6/index.js"(exports, module) { |
| 287 |
"use strict"; |
| 288 |
module.exports = function equal(a2, b2) { |
| 289 |
if (a2 === b2) return true; |
| 290 |
if (a2 && b2 && typeof a2 == "object" && typeof b2 == "object") { |
| 291 |
if (a2.constructor !== b2.constructor) return false; |
| 292 |
var length, i2, keys; |
| 293 |
if (Array.isArray(a2)) { |
| 294 |
length = a2.length; |
| 295 |
if (length != b2.length) return false; |
| 296 |
for (i2 = length; i2-- !== 0; ) |
| 297 |
if (!equal(a2[i2], b2[i2])) return false; |
| 298 |
return true; |
| 299 |
} |
| 300 |
if (a2 instanceof Map && b2 instanceof Map) { |
| 301 |
if (a2.size !== b2.size) return false; |
| 302 |
for (i2 of a2.entries()) |
| 303 |
if (!b2.has(i2[0])) return false; |
| 304 |
for (i2 of a2.entries()) |
| 305 |
if (!equal(i2[1], b2.get(i2[0]))) return false; |
| 306 |
return true; |
| 307 |
} |
| 308 |
if (a2 instanceof Set && b2 instanceof Set) { |
| 309 |
if (a2.size !== b2.size) return false; |
| 310 |
for (i2 of a2.entries()) |
| 311 |
if (!b2.has(i2[0])) return false; |
| 312 |
return true; |
| 313 |
} |
| 314 |
if (ArrayBuffer.isView(a2) && ArrayBuffer.isView(b2)) { |
| 315 |
length = a2.length; |
| 316 |
if (length != b2.length) return false; |
| 317 |
for (i2 = length; i2-- !== 0; ) |
| 318 |
if (a2[i2] !== b2[i2]) return false; |
| 319 |
return true; |
| 320 |
} |
| 321 |
if (a2.constructor === RegExp) return a2.source === b2.source && a2.flags === b2.flags; |
| 322 |
if (a2.valueOf !== Object.prototype.valueOf) return a2.valueOf() === b2.valueOf(); |
| 323 |
if (a2.toString !== Object.prototype.toString) return a2.toString() === b2.toString(); |
| 324 |
keys = Object.keys(a2); |
| 325 |
length = keys.length; |
| 326 |
if (length !== Object.keys(b2).length) return false; |
| 327 |
for (i2 = length; i2-- !== 0; ) |
| 328 |
if (!Object.prototype.hasOwnProperty.call(b2, keys[i2])) return false; |
| 329 |
for (i2 = length; i2-- !== 0; ) { |
| 330 |
var key2 = keys[i2]; |
| 331 |
if (!equal(a2[key2], b2[key2])) return false; |
| 332 |
} |
| 333 |
return true; |
| 334 |
} |
| 335 |
return a2 !== a2 && b2 !== b2; |
| 336 |
}; |
| 337 |
} |
| 338 |
}); |
| 339 |
|
| 340 |
// package-external:@wordpress/keycodes |
| 341 |
var require_keycodes = __commonJS({ |
| 342 |
"package-external:@wordpress/keycodes"(exports, module) { |
| 343 |
module.exports = window.wp.keycodes; |
| 344 |
} |
| 345 |
}); |
| 346 |
|
| 347 |
// node_modules/remove-accents/index.js |
| 348 |
var require_remove_accents = __commonJS({ |
| 349 |
"node_modules/remove-accents/index.js"(exports, module) { |
| 350 |
var characterMap = { |
| 351 |
"\xC0": "A", |
| 352 |
"\xC1": "A", |
| 353 |
"\xC2": "A", |
| 354 |
"\xC3": "A", |
| 355 |
"\xC4": "A", |
| 356 |
"\xC5": "A", |
| 357 |
"\u1EA4": "A", |
| 358 |
"\u1EAE": "A", |
| 359 |
"\u1EB2": "A", |
| 360 |
"\u1EB4": "A", |
| 361 |
"\u1EB6": "A", |
| 362 |
"\xC6": "AE", |
| 363 |
"\u1EA6": "A", |
| 364 |
"\u1EB0": "A", |
| 365 |
"\u0202": "A", |
| 366 |
"\u1EA2": "A", |
| 367 |
"\u1EA0": "A", |
| 368 |
"\u1EA8": "A", |
| 369 |
"\u1EAA": "A", |
| 370 |
"\u1EAC": "A", |
| 371 |
"\xC7": "C", |
| 372 |
"\u1E08": "C", |
| 373 |
"\xC8": "E", |
| 374 |
"\xC9": "E", |
| 375 |
"\xCA": "E", |
| 376 |
"\xCB": "E", |
| 377 |
"\u1EBE": "E", |
| 378 |
"\u1E16": "E", |
| 379 |
"\u1EC0": "E", |
| 380 |
"\u1E14": "E", |
| 381 |
"\u1E1C": "E", |
| 382 |
"\u0206": "E", |
| 383 |
"\u1EBA": "E", |
| 384 |
"\u1EBC": "E", |
| 385 |
"\u1EB8": "E", |
| 386 |
"\u1EC2": "E", |
| 387 |
"\u1EC4": "E", |
| 388 |
"\u1EC6": "E", |
| 389 |
"\xCC": "I", |
| 390 |
"\xCD": "I", |
| 391 |
"\xCE": "I", |
| 392 |
"\xCF": "I", |
| 393 |
"\u1E2E": "I", |
| 394 |
"\u020A": "I", |
| 395 |
"\u1EC8": "I", |
| 396 |
"\u1ECA": "I", |
| 397 |
"\xD0": "D", |
| 398 |
"\xD1": "N", |
| 399 |
"\xD2": "O", |
| 400 |
"\xD3": "O", |
| 401 |
"\xD4": "O", |
| 402 |
"\xD5": "O", |
| 403 |
"\xD6": "O", |
| 404 |
"\xD8": "O", |
| 405 |
"\u1ED0": "O", |
| 406 |
"\u1E4C": "O", |
| 407 |
"\u1E52": "O", |
| 408 |
"\u020E": "O", |
| 409 |
"\u1ECE": "O", |
| 410 |
"\u1ECC": "O", |
| 411 |
"\u1ED4": "O", |
| 412 |
"\u1ED6": "O", |
| 413 |
"\u1ED8": "O", |
| 414 |
"\u1EDC": "O", |
| 415 |
"\u1EDE": "O", |
| 416 |
"\u1EE0": "O", |
| 417 |
"\u1EDA": "O", |
| 418 |
"\u1EE2": "O", |
| 419 |
"\xD9": "U", |
| 420 |
"\xDA": "U", |
| 421 |
"\xDB": "U", |
| 422 |
"\xDC": "U", |
| 423 |
"\u1EE6": "U", |
| 424 |
"\u1EE4": "U", |
| 425 |
"\u1EEC": "U", |
| 426 |
"\u1EEE": "U", |
| 427 |
"\u1EF0": "U", |
| 428 |
"\xDD": "Y", |
| 429 |
"\xE0": "a", |
| 430 |
"\xE1": "a", |
| 431 |
"\xE2": "a", |
| 432 |
"\xE3": "a", |
| 433 |
"\xE4": "a", |
| 434 |
"\xE5": "a", |
| 435 |
"\u1EA5": "a", |
| 436 |
"\u1EAF": "a", |
| 437 |
"\u1EB3": "a", |
| 438 |
"\u1EB5": "a", |
| 439 |
"\u1EB7": "a", |
| 440 |
"\xE6": "ae", |
| 441 |
"\u1EA7": "a", |
| 442 |
"\u1EB1": "a", |
| 443 |
"\u0203": "a", |
| 444 |
"\u1EA3": "a", |
| 445 |
"\u1EA1": "a", |
| 446 |
"\u1EA9": "a", |
| 447 |
"\u1EAB": "a", |
| 448 |
"\u1EAD": "a", |
| 449 |
"\xE7": "c", |
| 450 |
"\u1E09": "c", |
| 451 |
"\xE8": "e", |
| 452 |
"\xE9": "e", |
| 453 |
"\xEA": "e", |
| 454 |
"\xEB": "e", |
| 455 |
"\u1EBF": "e", |
| 456 |
"\u1E17": "e", |
| 457 |
"\u1EC1": "e", |
| 458 |
"\u1E15": "e", |
| 459 |
"\u1E1D": "e", |
| 460 |
"\u0207": "e", |
| 461 |
"\u1EBB": "e", |
| 462 |
"\u1EBD": "e", |
| 463 |
"\u1EB9": "e", |
| 464 |
"\u1EC3": "e", |
| 465 |
"\u1EC5": "e", |
| 466 |
"\u1EC7": "e", |
| 467 |
"\xEC": "i", |
| 468 |
"\xED": "i", |
| 469 |
"\xEE": "i", |
| 470 |
"\xEF": "i", |
| 471 |
"\u1E2F": "i", |
| 472 |
"\u020B": "i", |
| 473 |
"\u1EC9": "i", |
| 474 |
"\u1ECB": "i", |
| 475 |
"\xF0": "d", |
| 476 |
"\xF1": "n", |
| 477 |
"\xF2": "o", |
| 478 |
"\xF3": "o", |
| 479 |
"\xF4": "o", |
| 480 |
"\xF5": "o", |
| 481 |
"\xF6": "o", |
| 482 |
"\xF8": "o", |
| 483 |
"\u1ED1": "o", |
| 484 |
"\u1E4D": "o", |
| 485 |
"\u1E53": "o", |
| 486 |
"\u020F": "o", |
| 487 |
"\u1ECF": "o", |
| 488 |
"\u1ECD": "o", |
| 489 |
"\u1ED5": "o", |
| 490 |
"\u1ED7": "o", |
| 491 |
"\u1ED9": "o", |
| 492 |
"\u1EDD": "o", |
| 493 |
"\u1EDF": "o", |
| 494 |
"\u1EE1": "o", |
| 495 |
"\u1EDB": "o", |
| 496 |
"\u1EE3": "o", |
| 497 |
"\xF9": "u", |
| 498 |
"\xFA": "u", |
| 499 |
"\xFB": "u", |
| 500 |
"\xFC": "u", |
| 501 |
"\u1EE7": "u", |
| 502 |
"\u1EE5": "u", |
| 503 |
"\u1EED": "u", |
| 504 |
"\u1EEF": "u", |
| 505 |
"\u1EF1": "u", |
| 506 |
"\xFD": "y", |
| 507 |
"\xFF": "y", |
| 508 |
"\u0100": "A", |
| 509 |
"\u0101": "a", |
| 510 |
"\u0102": "A", |
| 511 |
"\u0103": "a", |
| 512 |
"\u0104": "A", |
| 513 |
"\u0105": "a", |
| 514 |
"\u0106": "C", |
| 515 |
"\u0107": "c", |
| 516 |
"\u0108": "C", |
| 517 |
"\u0109": "c", |
| 518 |
"\u010A": "C", |
| 519 |
"\u010B": "c", |
| 520 |
"\u010C": "C", |
| 521 |
"\u010D": "c", |
| 522 |
"C\u0306": "C", |
| 523 |
"c\u0306": "c", |
| 524 |
"\u010E": "D", |
| 525 |
"\u010F": "d", |
| 526 |
"\u0110": "D", |
| 527 |
"\u0111": "d", |
| 528 |
"\u0112": "E", |
| 529 |
"\u0113": "e", |
| 530 |
"\u0114": "E", |
| 531 |
"\u0115": "e", |
| 532 |
"\u0116": "E", |
| 533 |
"\u0117": "e", |
| 534 |
"\u0118": "E", |
| 535 |
"\u0119": "e", |
| 536 |
"\u011A": "E", |
| 537 |
"\u011B": "e", |
| 538 |
"\u011C": "G", |
| 539 |
"\u01F4": "G", |
| 540 |
"\u011D": "g", |
| 541 |
"\u01F5": "g", |
| 542 |
"\u011E": "G", |
| 543 |
"\u011F": "g", |
| 544 |
"\u0120": "G", |
| 545 |
"\u0121": "g", |
| 546 |
"\u0122": "G", |
| 547 |
"\u0123": "g", |
| 548 |
"\u0124": "H", |
| 549 |
"\u0125": "h", |
| 550 |
"\u0126": "H", |
| 551 |
"\u0127": "h", |
| 552 |
"\u1E2A": "H", |
| 553 |
"\u1E2B": "h", |
| 554 |
"\u0128": "I", |
| 555 |
"\u0129": "i", |
| 556 |
"\u012A": "I", |
| 557 |
"\u012B": "i", |
| 558 |
"\u012C": "I", |
| 559 |
"\u012D": "i", |
| 560 |
"\u012E": "I", |
| 561 |
"\u012F": "i", |
| 562 |
"\u0130": "I", |
| 563 |
"\u0131": "i", |
| 564 |
"\u0132": "IJ", |
| 565 |
"\u0133": "ij", |
| 566 |
"\u0134": "J", |
| 567 |
"\u0135": "j", |
| 568 |
"\u0136": "K", |
| 569 |
"\u0137": "k", |
| 570 |
"\u1E30": "K", |
| 571 |
"\u1E31": "k", |
| 572 |
"K\u0306": "K", |
| 573 |
"k\u0306": "k", |
| 574 |
"\u0139": "L", |
| 575 |
"\u013A": "l", |
| 576 |
"\u013B": "L", |
| 577 |
"\u013C": "l", |
| 578 |
"\u013D": "L", |
| 579 |
"\u013E": "l", |
| 580 |
"\u013F": "L", |
| 581 |
"\u0140": "l", |
| 582 |
"\u0141": "l", |
| 583 |
"\u0142": "l", |
| 584 |
"\u1E3E": "M", |
| 585 |
"\u1E3F": "m", |
| 586 |
"M\u0306": "M", |
| 587 |
"m\u0306": "m", |
| 588 |
"\u0143": "N", |
| 589 |
"\u0144": "n", |
| 590 |
"\u0145": "N", |
| 591 |
"\u0146": "n", |
| 592 |
"\u0147": "N", |
| 593 |
"\u0148": "n", |
| 594 |
"\u0149": "n", |
| 595 |
"N\u0306": "N", |
| 596 |
"n\u0306": "n", |
| 597 |
"\u014C": "O", |
| 598 |
"\u014D": "o", |
| 599 |
"\u014E": "O", |
| 600 |
"\u014F": "o", |
| 601 |
"\u0150": "O", |
| 602 |
"\u0151": "o", |
| 603 |
"\u0152": "OE", |
| 604 |
"\u0153": "oe", |
| 605 |
"P\u0306": "P", |
| 606 |
"p\u0306": "p", |
| 607 |
"\u0154": "R", |
| 608 |
"\u0155": "r", |
| 609 |
"\u0156": "R", |
| 610 |
"\u0157": "r", |
| 611 |
"\u0158": "R", |
| 612 |
"\u0159": "r", |
| 613 |
"R\u0306": "R", |
| 614 |
"r\u0306": "r", |
| 615 |
"\u0212": "R", |
| 616 |
"\u0213": "r", |
| 617 |
"\u015A": "S", |
| 618 |
"\u015B": "s", |
| 619 |
"\u015C": "S", |
| 620 |
"\u015D": "s", |
| 621 |
"\u015E": "S", |
| 622 |
"\u0218": "S", |
| 623 |
"\u0219": "s", |
| 624 |
"\u015F": "s", |
| 625 |
"\u0160": "S", |
| 626 |
"\u0161": "s", |
| 627 |
"\u0162": "T", |
| 628 |
"\u0163": "t", |
| 629 |
"\u021B": "t", |
| 630 |
"\u021A": "T", |
| 631 |
"\u0164": "T", |
| 632 |
"\u0165": "t", |
| 633 |
"\u0166": "T", |
| 634 |
"\u0167": "t", |
| 635 |
"T\u0306": "T", |
| 636 |
"t\u0306": "t", |
| 637 |
"\u0168": "U", |
| 638 |
"\u0169": "u", |
| 639 |
"\u016A": "U", |
| 640 |
"\u016B": "u", |
| 641 |
"\u016C": "U", |
| 642 |
"\u016D": "u", |
| 643 |
"\u016E": "U", |
| 644 |
"\u016F": "u", |
| 645 |
"\u0170": "U", |
| 646 |
"\u0171": "u", |
| 647 |
"\u0172": "U", |
| 648 |
"\u0173": "u", |
| 649 |
"\u0216": "U", |
| 650 |
"\u0217": "u", |
| 651 |
"V\u0306": "V", |
| 652 |
"v\u0306": "v", |
| 653 |
"\u0174": "W", |
| 654 |
"\u0175": "w", |
| 655 |
"\u1E82": "W", |
| 656 |
"\u1E83": "w", |
| 657 |
"X\u0306": "X", |
| 658 |
"x\u0306": "x", |
| 659 |
"\u0176": "Y", |
| 660 |
"\u0177": "y", |
| 661 |
"\u0178": "Y", |
| 662 |
"Y\u0306": "Y", |
| 663 |
"y\u0306": "y", |
| 664 |
"\u0179": "Z", |
| 665 |
"\u017A": "z", |
| 666 |
"\u017B": "Z", |
| 667 |
"\u017C": "z", |
| 668 |
"\u017D": "Z", |
| 669 |
"\u017E": "z", |
| 670 |
"\u017F": "s", |
| 671 |
"\u0192": "f", |
| 672 |
"\u01A0": "O", |
| 673 |
"\u01A1": "o", |
| 674 |
"\u01AF": "U", |
| 675 |
"\u01B0": "u", |
| 676 |
"\u01CD": "A", |
| 677 |
"\u01CE": "a", |
| 678 |
"\u01CF": "I", |
| 679 |
"\u01D0": "i", |
| 680 |
"\u01D1": "O", |
| 681 |
"\u01D2": "o", |
| 682 |
"\u01D3": "U", |
| 683 |
"\u01D4": "u", |
| 684 |
"\u01D5": "U", |
| 685 |
"\u01D6": "u", |
| 686 |
"\u01D7": "U", |
| 687 |
"\u01D8": "u", |
| 688 |
"\u01D9": "U", |
| 689 |
"\u01DA": "u", |
| 690 |
"\u01DB": "U", |
| 691 |
"\u01DC": "u", |
| 692 |
"\u1EE8": "U", |
| 693 |
"\u1EE9": "u", |
| 694 |
"\u1E78": "U", |
| 695 |
"\u1E79": "u", |
| 696 |
"\u01FA": "A", |
| 697 |
"\u01FB": "a", |
| 698 |
"\u01FC": "AE", |
| 699 |
"\u01FD": "ae", |
| 700 |
"\u01FE": "O", |
| 701 |
"\u01FF": "o", |
| 702 |
"\xDE": "TH", |
| 703 |
"\xFE": "th", |
| 704 |
"\u1E54": "P", |
| 705 |
"\u1E55": "p", |
| 706 |
"\u1E64": "S", |
| 707 |
"\u1E65": "s", |
| 708 |
"X\u0301": "X", |
| 709 |
"x\u0301": "x", |
| 710 |
"\u0403": "\u0413", |
| 711 |
"\u0453": "\u0433", |
| 712 |
"\u040C": "\u041A", |
| 713 |
"\u045C": "\u043A", |
| 714 |
"A\u030B": "A", |
| 715 |
"a\u030B": "a", |
| 716 |
"E\u030B": "E", |
| 717 |
"e\u030B": "e", |
| 718 |
"I\u030B": "I", |
| 719 |
"i\u030B": "i", |
| 720 |
"\u01F8": "N", |
| 721 |
"\u01F9": "n", |
| 722 |
"\u1ED2": "O", |
| 723 |
"\u1ED3": "o", |
| 724 |
"\u1E50": "O", |
| 725 |
"\u1E51": "o", |
| 726 |
"\u1EEA": "U", |
| 727 |
"\u1EEB": "u", |
| 728 |
"\u1E80": "W", |
| 729 |
"\u1E81": "w", |
| 730 |
"\u1EF2": "Y", |
| 731 |
"\u1EF3": "y", |
| 732 |
"\u0200": "A", |
| 733 |
"\u0201": "a", |
| 734 |
"\u0204": "E", |
| 735 |
"\u0205": "e", |
| 736 |
"\u0208": "I", |
| 737 |
"\u0209": "i", |
| 738 |
"\u020C": "O", |
| 739 |
"\u020D": "o", |
| 740 |
"\u0210": "R", |
| 741 |
"\u0211": "r", |
| 742 |
"\u0214": "U", |
| 743 |
"\u0215": "u", |
| 744 |
"B\u030C": "B", |
| 745 |
"b\u030C": "b", |
| 746 |
"\u010C\u0323": "C", |
| 747 |
"\u010D\u0323": "c", |
| 748 |
"\xCA\u030C": "E", |
| 749 |
"\xEA\u030C": "e", |
| 750 |
"F\u030C": "F", |
| 751 |
"f\u030C": "f", |
| 752 |
"\u01E6": "G", |
| 753 |
"\u01E7": "g", |
| 754 |
"\u021E": "H", |
| 755 |
"\u021F": "h", |
| 756 |
"J\u030C": "J", |
| 757 |
"\u01F0": "j", |
| 758 |
"\u01E8": "K", |
| 759 |
"\u01E9": "k", |
| 760 |
"M\u030C": "M", |
| 761 |
"m\u030C": "m", |
| 762 |
"P\u030C": "P", |
| 763 |
"p\u030C": "p", |
| 764 |
"Q\u030C": "Q", |
| 765 |
"q\u030C": "q", |
| 766 |
"\u0158\u0329": "R", |
| 767 |
"\u0159\u0329": "r", |
| 768 |
"\u1E66": "S", |
| 769 |
"\u1E67": "s", |
| 770 |
"V\u030C": "V", |
| 771 |
"v\u030C": "v", |
| 772 |
"W\u030C": "W", |
| 773 |
"w\u030C": "w", |
| 774 |
"X\u030C": "X", |
| 775 |
"x\u030C": "x", |
| 776 |
"Y\u030C": "Y", |
| 777 |
"y\u030C": "y", |
| 778 |
"A\u0327": "A", |
| 779 |
"a\u0327": "a", |
| 780 |
"B\u0327": "B", |
| 781 |
"b\u0327": "b", |
| 782 |
"\u1E10": "D", |
| 783 |
"\u1E11": "d", |
| 784 |
"\u0228": "E", |
| 785 |
"\u0229": "e", |
| 786 |
"\u0190\u0327": "E", |
| 787 |
"\u025B\u0327": "e", |
| 788 |
"\u1E28": "H", |
| 789 |
"\u1E29": "h", |
| 790 |
"I\u0327": "I", |
| 791 |
"i\u0327": "i", |
| 792 |
"\u0197\u0327": "I", |
| 793 |
"\u0268\u0327": "i", |
| 794 |
"M\u0327": "M", |
| 795 |
"m\u0327": "m", |
| 796 |
"O\u0327": "O", |
| 797 |
"o\u0327": "o", |
| 798 |
"Q\u0327": "Q", |
| 799 |
"q\u0327": "q", |
| 800 |
"U\u0327": "U", |
| 801 |
"u\u0327": "u", |
| 802 |
"X\u0327": "X", |
| 803 |
"x\u0327": "x", |
| 804 |
"Z\u0327": "Z", |
| 805 |
"z\u0327": "z", |
| 806 |
"\u0439": "\u0438", |
| 807 |
"\u0419": "\u0418", |
| 808 |
"\u0451": "\u0435", |
| 809 |
"\u0401": "\u0415" |
| 810 |
}; |
| 811 |
var chars = Object.keys(characterMap).join("|"); |
| 812 |
var allAccents = new RegExp(chars, "g"); |
| 813 |
var firstAccent = new RegExp(chars, ""); |
| 814 |
function matcher(match2) { |
| 815 |
return characterMap[match2]; |
| 816 |
} |
| 817 |
var removeAccents3 = function(string) { |
| 818 |
return string.replace(allAccents, matcher); |
| 819 |
}; |
| 820 |
var hasAccents = function(string) { |
| 821 |
return !!string.match(firstAccent); |
| 822 |
}; |
| 823 |
module.exports = removeAccents3; |
| 824 |
module.exports.has = hasAccents; |
| 825 |
module.exports.remove = removeAccents3; |
| 826 |
} |
| 827 |
}); |
| 828 |
|
| 829 |
// package-external:@wordpress/date |
| 830 |
var require_date = __commonJS({ |
| 831 |
"package-external:@wordpress/date"(exports, module) { |
| 832 |
module.exports = window.wp.date; |
| 833 |
} |
| 834 |
}); |
| 835 |
|
| 836 |
// package-external:@wordpress/warning |
| 837 |
var require_warning = __commonJS({ |
| 838 |
"package-external:@wordpress/warning"(exports, module) { |
| 839 |
module.exports = window.wp.warning; |
| 840 |
} |
| 841 |
}); |
| 842 |
|
| 843 |
// package-external:@wordpress/deprecated |
| 844 |
var require_deprecated = __commonJS({ |
| 845 |
"package-external:@wordpress/deprecated"(exports, module) { |
| 846 |
module.exports = window.wp.deprecated; |
| 847 |
} |
| 848 |
}); |
| 849 |
|
| 850 |
// package-external:@wordpress/core-data |
| 851 |
var require_core_data = __commonJS({ |
| 852 |
"package-external:@wordpress/core-data"(exports, module) { |
| 853 |
module.exports = window.wp.coreData; |
| 854 |
} |
| 855 |
}); |
| 856 |
|
| 857 |
// node_modules/clsx/dist/clsx.mjs |
| 858 |
function r(e2) { |
| 859 |
var t2, f2, n2 = ""; |
| 860 |
if ("string" == typeof e2 || "number" == typeof e2) n2 += e2; |
| 861 |
else if ("object" == typeof e2) if (Array.isArray(e2)) { |
| 862 |
var o2 = e2.length; |
| 863 |
for (t2 = 0; t2 < o2; t2++) e2[t2] && (f2 = r(e2[t2])) && (n2 && (n2 += " "), n2 += f2); |
| 864 |
} else for (f2 in e2) e2[f2] && (n2 && (n2 += " "), n2 += f2); |
| 865 |
return n2; |
| 866 |
} |
| 867 |
function clsx() { |
| 868 |
for (var e2, t2, f2 = 0, n2 = "", o2 = arguments.length; f2 < o2; f2++) (e2 = arguments[f2]) && (t2 = r(e2)) && (n2 && (n2 += " "), n2 += t2); |
| 869 |
return n2; |
| 870 |
} |
| 871 |
var clsx_default = clsx; |
| 872 |
|
| 873 |
// node_modules/@base-ui/utils/esm/error.js |
| 874 |
var set; |
| 875 |
if (true) { |
| 876 |
set = /* @__PURE__ */ new Set(); |
| 877 |
} |
| 878 |
function error(...messages) { |
| 879 |
if (true) { |
| 880 |
const messageKey = messages.join(" "); |
| 881 |
if (!set.has(messageKey)) { |
| 882 |
set.add(messageKey); |
| 883 |
console.error(`Base UI: ${messageKey}`); |
| 884 |
} |
| 885 |
} |
| 886 |
} |
| 887 |
|
| 888 |
// node_modules/@base-ui/utils/esm/useStableCallback.js |
| 889 |
var React2 = __toESM(require_react(), 1); |
| 890 |
|
| 891 |
// node_modules/@base-ui/utils/esm/useRefWithInit.js |
| 892 |
var React = __toESM(require_react(), 1); |
| 893 |
var UNINITIALIZED = {}; |
| 894 |
function useRefWithInit(init2, initArg) { |
| 895 |
const ref = React.useRef(UNINITIALIZED); |
| 896 |
if (ref.current === UNINITIALIZED) { |
| 897 |
ref.current = init2(initArg); |
| 898 |
} |
| 899 |
return ref; |
| 900 |
} |
| 901 |
|
| 902 |
// node_modules/@base-ui/utils/esm/useStableCallback.js |
| 903 |
var useInsertionEffect = React2[`useInsertionEffect${Math.random().toFixed(1)}`.slice(0, -3)]; |
| 904 |
var useSafeInsertionEffect = ( |
| 905 |
// React 17 doesn't have useInsertionEffect. |
| 906 |
useInsertionEffect && // Preact replaces useInsertionEffect with useLayoutEffect and fires too late. |
| 907 |
useInsertionEffect !== React2.useLayoutEffect ? useInsertionEffect : (fn) => fn() |
| 908 |
); |
| 909 |
function useStableCallback(callback) { |
| 910 |
const stable = useRefWithInit(createStableCallback).current; |
| 911 |
stable.next = callback; |
| 912 |
useSafeInsertionEffect(stable.effect); |
| 913 |
return stable.trampoline; |
| 914 |
} |
| 915 |
function createStableCallback() { |
| 916 |
const stable = { |
| 917 |
next: void 0, |
| 918 |
callback: assertNotCalled, |
| 919 |
trampoline: (...args) => stable.callback?.(...args), |
| 920 |
effect: () => { |
| 921 |
stable.callback = stable.next; |
| 922 |
} |
| 923 |
}; |
| 924 |
return stable; |
| 925 |
} |
| 926 |
function assertNotCalled() { |
| 927 |
if (true) { |
| 928 |
throw ( |
| 929 |
/* minify-error-disabled */ |
| 930 |
new Error("Base UI: Cannot call an event handler while rendering.") |
| 931 |
); |
| 932 |
} |
| 933 |
} |
| 934 |
|
| 935 |
// node_modules/@base-ui/utils/esm/useIsoLayoutEffect.js |
| 936 |
var React3 = __toESM(require_react(), 1); |
| 937 |
var noop = () => { |
| 938 |
}; |
| 939 |
var useIsoLayoutEffect = typeof document !== "undefined" ? React3.useLayoutEffect : noop; |
| 940 |
|
| 941 |
// node_modules/@base-ui/utils/esm/warn.js |
| 942 |
var set2; |
| 943 |
if (true) { |
| 944 |
set2 = /* @__PURE__ */ new Set(); |
| 945 |
} |
| 946 |
function warn(...messages) { |
| 947 |
if (true) { |
| 948 |
const messageKey = messages.join(" "); |
| 949 |
if (!set2.has(messageKey)) { |
| 950 |
set2.add(messageKey); |
| 951 |
console.warn(`Base UI: ${messageKey}`); |
| 952 |
} |
| 953 |
} |
| 954 |
} |
| 955 |
|
| 956 |
// node_modules/@base-ui/react/esm/internals/direction-context/DirectionContext.js |
| 957 |
var React4 = __toESM(require_react(), 1); |
| 958 |
var DirectionContext = /* @__PURE__ */ React4.createContext(void 0); |
| 959 |
if (true) DirectionContext.displayName = "DirectionContext"; |
| 960 |
function useDirection() { |
| 961 |
const context = React4.useContext(DirectionContext); |
| 962 |
return context?.direction ?? "ltr"; |
| 963 |
} |
| 964 |
|
| 965 |
// node_modules/@base-ui/react/esm/internals/useRenderElement.js |
| 966 |
var React7 = __toESM(require_react(), 1); |
| 967 |
|
| 968 |
// node_modules/@base-ui/utils/esm/useMergedRefs.js |
| 969 |
function useMergedRefs(a2, b2, c2, d2) { |
| 970 |
const forkRef = useRefWithInit(createForkRef).current; |
| 971 |
if (didChange(forkRef, a2, b2, c2, d2)) { |
| 972 |
update(forkRef, [a2, b2, c2, d2]); |
| 973 |
} |
| 974 |
return forkRef.callback; |
| 975 |
} |
| 976 |
function useMergedRefsN(refs) { |
| 977 |
const forkRef = useRefWithInit(createForkRef).current; |
| 978 |
if (didChangeN(forkRef, refs)) { |
| 979 |
update(forkRef, refs); |
| 980 |
} |
| 981 |
return forkRef.callback; |
| 982 |
} |
| 983 |
function createForkRef() { |
| 984 |
return { |
| 985 |
callback: null, |
| 986 |
cleanup: null, |
| 987 |
refs: [] |
| 988 |
}; |
| 989 |
} |
| 990 |
function didChange(forkRef, a2, b2, c2, d2) { |
| 991 |
return forkRef.refs[0] !== a2 || forkRef.refs[1] !== b2 || forkRef.refs[2] !== c2 || forkRef.refs[3] !== d2; |
| 992 |
} |
| 993 |
function didChangeN(forkRef, newRefs) { |
| 994 |
return forkRef.refs.length !== newRefs.length || forkRef.refs.some((ref, index2) => ref !== newRefs[index2]); |
| 995 |
} |
| 996 |
function update(forkRef, refs) { |
| 997 |
forkRef.refs = refs; |
| 998 |
if (refs.every((ref) => ref == null)) { |
| 999 |
forkRef.callback = null; |
| 1000 |
return; |
| 1001 |
} |
| 1002 |
forkRef.callback = (instance) => { |
| 1003 |
if (forkRef.cleanup) { |
| 1004 |
forkRef.cleanup(); |
| 1005 |
forkRef.cleanup = null; |
| 1006 |
} |
| 1007 |
if (instance != null) { |
| 1008 |
const cleanupCallbacks = Array(refs.length).fill(null); |
| 1009 |
for (let i2 = 0; i2 < refs.length; i2 += 1) { |
| 1010 |
const ref = refs[i2]; |
| 1011 |
if (ref == null) { |
| 1012 |
continue; |
| 1013 |
} |
| 1014 |
switch (typeof ref) { |
| 1015 |
case "function": { |
| 1016 |
const refCleanup = ref(instance); |
| 1017 |
if (typeof refCleanup === "function") { |
| 1018 |
cleanupCallbacks[i2] = refCleanup; |
| 1019 |
} |
| 1020 |
break; |
| 1021 |
} |
| 1022 |
case "object": { |
| 1023 |
ref.current = instance; |
| 1024 |
break; |
| 1025 |
} |
| 1026 |
default: |
| 1027 |
} |
| 1028 |
} |
| 1029 |
forkRef.cleanup = () => { |
| 1030 |
for (let i2 = 0; i2 < refs.length; i2 += 1) { |
| 1031 |
const ref = refs[i2]; |
| 1032 |
if (ref == null) { |
| 1033 |
continue; |
| 1034 |
} |
| 1035 |
switch (typeof ref) { |
| 1036 |
case "function": { |
| 1037 |
const cleanupCallback = cleanupCallbacks[i2]; |
| 1038 |
if (typeof cleanupCallback === "function") { |
| 1039 |
cleanupCallback(); |
| 1040 |
} else { |
| 1041 |
ref(null); |
| 1042 |
} |
| 1043 |
break; |
| 1044 |
} |
| 1045 |
case "object": { |
| 1046 |
ref.current = null; |
| 1047 |
break; |
| 1048 |
} |
| 1049 |
default: |
| 1050 |
} |
| 1051 |
} |
| 1052 |
}; |
| 1053 |
} |
| 1054 |
}; |
| 1055 |
} |
| 1056 |
|
| 1057 |
// node_modules/@base-ui/utils/esm/getReactElementRef.js |
| 1058 |
var React6 = __toESM(require_react(), 1); |
| 1059 |
|
| 1060 |
// node_modules/@base-ui/utils/esm/reactVersion.js |
| 1061 |
var React5 = __toESM(require_react(), 1); |
| 1062 |
var majorVersion = parseInt(React5.version, 10); |
| 1063 |
function isReactVersionAtLeast(reactVersionToCheck) { |
| 1064 |
return majorVersion >= reactVersionToCheck; |
| 1065 |
} |
| 1066 |
|
| 1067 |
// node_modules/@base-ui/utils/esm/getReactElementRef.js |
| 1068 |
function getReactElementRef(element) { |
| 1069 |
if (!/* @__PURE__ */ React6.isValidElement(element)) { |
| 1070 |
return null; |
| 1071 |
} |
| 1072 |
const reactElement = element; |
| 1073 |
const propsWithRef = reactElement.props; |
| 1074 |
return (isReactVersionAtLeast(19) ? propsWithRef?.ref : reactElement.ref) ?? null; |
| 1075 |
} |
| 1076 |
|
| 1077 |
// node_modules/@base-ui/utils/esm/mergeObjects.js |
| 1078 |
function mergeObjects(a2, b2) { |
| 1079 |
if (a2 && !b2) { |
| 1080 |
return a2; |
| 1081 |
} |
| 1082 |
if (!a2 && b2) { |
| 1083 |
return b2; |
| 1084 |
} |
| 1085 |
if (a2 || b2) { |
| 1086 |
return { |
| 1087 |
...a2, |
| 1088 |
...b2 |
| 1089 |
}; |
| 1090 |
} |
| 1091 |
return void 0; |
| 1092 |
} |
| 1093 |
|
| 1094 |
// node_modules/@base-ui/utils/esm/empty.js |
| 1095 |
function NOOP() { |
| 1096 |
} |
| 1097 |
var EMPTY_ARRAY = Object.freeze([]); |
| 1098 |
var EMPTY_OBJECT = Object.freeze({}); |
| 1099 |
|
| 1100 |
// node_modules/@base-ui/react/esm/internals/getStateAttributesProps.js |
| 1101 |
function getStateAttributesProps(state, customMapping) { |
| 1102 |
const props = {}; |
| 1103 |
for (const key2 in state) { |
| 1104 |
const value = state[key2]; |
| 1105 |
if (customMapping?.hasOwnProperty(key2)) { |
| 1106 |
const customProps = customMapping[key2](value); |
| 1107 |
if (customProps != null) { |
| 1108 |
Object.assign(props, customProps); |
| 1109 |
} |
| 1110 |
continue; |
| 1111 |
} |
| 1112 |
if (value === true) { |
| 1113 |
props[`data-${key2.toLowerCase()}`] = ""; |
| 1114 |
} else if (value) { |
| 1115 |
props[`data-${key2.toLowerCase()}`] = value.toString(); |
| 1116 |
} |
| 1117 |
} |
| 1118 |
return props; |
| 1119 |
} |
| 1120 |
|
| 1121 |
// node_modules/@base-ui/react/esm/utils/resolveClassName.js |
| 1122 |
function resolveClassName(className, state) { |
| 1123 |
return typeof className === "function" ? className(state) : className; |
| 1124 |
} |
| 1125 |
|
| 1126 |
// node_modules/@base-ui/react/esm/utils/resolveStyle.js |
| 1127 |
function resolveStyle(style, state) { |
| 1128 |
return typeof style === "function" ? style(state) : style; |
| 1129 |
} |
| 1130 |
|
| 1131 |
// node_modules/@base-ui/react/esm/merge-props/mergeProps.js |
| 1132 |
var EMPTY_PROPS = {}; |
| 1133 |
function mergeProps(a2, b2, c2, d2, e2) { |
| 1134 |
if (!c2 && !d2 && !e2 && !a2) { |
| 1135 |
return createInitialMergedProps(b2); |
| 1136 |
} |
| 1137 |
let merged = createInitialMergedProps(a2); |
| 1138 |
if (b2) { |
| 1139 |
merged = mergeInto(merged, b2); |
| 1140 |
} |
| 1141 |
if (c2) { |
| 1142 |
merged = mergeInto(merged, c2); |
| 1143 |
} |
| 1144 |
if (d2) { |
| 1145 |
merged = mergeInto(merged, d2); |
| 1146 |
} |
| 1147 |
if (e2) { |
| 1148 |
merged = mergeInto(merged, e2); |
| 1149 |
} |
| 1150 |
return merged; |
| 1151 |
} |
| 1152 |
function mergePropsN(props) { |
| 1153 |
if (props.length === 0) { |
| 1154 |
return EMPTY_PROPS; |
| 1155 |
} |
| 1156 |
if (props.length === 1) { |
| 1157 |
return createInitialMergedProps(props[0]); |
| 1158 |
} |
| 1159 |
let merged = createInitialMergedProps(props[0]); |
| 1160 |
for (let i2 = 1; i2 < props.length; i2 += 1) { |
| 1161 |
merged = mergeInto(merged, props[i2]); |
| 1162 |
} |
| 1163 |
return merged; |
| 1164 |
} |
| 1165 |
function createInitialMergedProps(inputProps) { |
| 1166 |
if (isPropsGetter(inputProps)) { |
| 1167 |
return { |
| 1168 |
...resolvePropsGetter(inputProps, EMPTY_PROPS) |
| 1169 |
}; |
| 1170 |
} |
| 1171 |
return copyInitialProps(inputProps); |
| 1172 |
} |
| 1173 |
function mergeInto(merged, inputProps) { |
| 1174 |
if (isPropsGetter(inputProps)) { |
| 1175 |
return resolvePropsGetter(inputProps, merged); |
| 1176 |
} |
| 1177 |
return mutablyMergeInto(merged, inputProps); |
| 1178 |
} |
| 1179 |
function copyInitialProps(inputProps) { |
| 1180 |
const copiedProps = { |
| 1181 |
...inputProps |
| 1182 |
}; |
| 1183 |
for (const propName in copiedProps) { |
| 1184 |
const propValue = copiedProps[propName]; |
| 1185 |
if (isEventHandler(propName, propValue)) { |
| 1186 |
copiedProps[propName] = wrapEventHandler(propValue); |
| 1187 |
} |
| 1188 |
} |
| 1189 |
return copiedProps; |
| 1190 |
} |
| 1191 |
function mutablyMergeInto(mergedProps, externalProps) { |
| 1192 |
if (!externalProps) { |
| 1193 |
return mergedProps; |
| 1194 |
} |
| 1195 |
for (const propName in externalProps) { |
| 1196 |
const externalPropValue = externalProps[propName]; |
| 1197 |
switch (propName) { |
| 1198 |
case "style": { |
| 1199 |
mergedProps[propName] = mergeObjects(mergedProps.style, externalPropValue); |
| 1200 |
break; |
| 1201 |
} |
| 1202 |
case "className": { |
| 1203 |
mergedProps[propName] = mergeClassNames(mergedProps.className, externalPropValue); |
| 1204 |
break; |
| 1205 |
} |
| 1206 |
default: { |
| 1207 |
if (isEventHandler(propName, externalPropValue)) { |
| 1208 |
mergedProps[propName] = mergeEventHandlers(mergedProps[propName], externalPropValue); |
| 1209 |
} else { |
| 1210 |
mergedProps[propName] = externalPropValue; |
| 1211 |
} |
| 1212 |
} |
| 1213 |
} |
| 1214 |
} |
| 1215 |
return mergedProps; |
| 1216 |
} |
| 1217 |
function isEventHandler(key2, value) { |
| 1218 |
const code0 = key2.charCodeAt(0); |
| 1219 |
const code1 = key2.charCodeAt(1); |
| 1220 |
const code2 = key2.charCodeAt(2); |
| 1221 |
return code0 === 111 && code1 === 110 && code2 >= 65 && code2 <= 90 && (typeof value === "function" || typeof value === "undefined"); |
| 1222 |
} |
| 1223 |
function isPropsGetter(inputProps) { |
| 1224 |
return typeof inputProps === "function"; |
| 1225 |
} |
| 1226 |
function resolvePropsGetter(inputProps, previousProps) { |
| 1227 |
if (isPropsGetter(inputProps)) { |
| 1228 |
return inputProps(previousProps); |
| 1229 |
} |
| 1230 |
return inputProps ?? EMPTY_PROPS; |
| 1231 |
} |
| 1232 |
function mergeEventHandlers(ourHandler, theirHandler) { |
| 1233 |
if (!theirHandler) { |
| 1234 |
return ourHandler; |
| 1235 |
} |
| 1236 |
if (!ourHandler) { |
| 1237 |
return wrapEventHandler(theirHandler); |
| 1238 |
} |
| 1239 |
return (...args) => { |
| 1240 |
const event = args[0]; |
| 1241 |
if (isSyntheticEvent(event)) { |
| 1242 |
const baseUIEvent = event; |
| 1243 |
makeEventPreventable(baseUIEvent); |
| 1244 |
const result2 = theirHandler(...args); |
| 1245 |
if (!baseUIEvent.baseUIHandlerPrevented) { |
| 1246 |
ourHandler?.(...args); |
| 1247 |
} |
| 1248 |
return result2; |
| 1249 |
} |
| 1250 |
const result = theirHandler(...args); |
| 1251 |
ourHandler?.(...args); |
| 1252 |
return result; |
| 1253 |
}; |
| 1254 |
} |
| 1255 |
function wrapEventHandler(handler) { |
| 1256 |
if (!handler) { |
| 1257 |
return handler; |
| 1258 |
} |
| 1259 |
return (...args) => { |
| 1260 |
const event = args[0]; |
| 1261 |
if (isSyntheticEvent(event)) { |
| 1262 |
makeEventPreventable(event); |
| 1263 |
} |
| 1264 |
return handler(...args); |
| 1265 |
}; |
| 1266 |
} |
| 1267 |
function makeEventPreventable(event) { |
| 1268 |
event.preventBaseUIHandler = () => { |
| 1269 |
event.baseUIHandlerPrevented = true; |
| 1270 |
}; |
| 1271 |
return event; |
| 1272 |
} |
| 1273 |
function mergeClassNames(ourClassName, theirClassName) { |
| 1274 |
if (theirClassName) { |
| 1275 |
if (ourClassName) { |
| 1276 |
return theirClassName + " " + ourClassName; |
| 1277 |
} |
| 1278 |
return theirClassName; |
| 1279 |
} |
| 1280 |
return ourClassName; |
| 1281 |
} |
| 1282 |
function isSyntheticEvent(event) { |
| 1283 |
return event != null && typeof event === "object" && "nativeEvent" in event; |
| 1284 |
} |
| 1285 |
|
| 1286 |
// node_modules/@base-ui/react/esm/internals/useRenderElement.js |
| 1287 |
var import_react = __toESM(require_react(), 1); |
| 1288 |
function useRenderElement(element, componentProps, params = {}) { |
| 1289 |
const renderProp = componentProps.render; |
| 1290 |
const outProps = useRenderElementProps(componentProps, params); |
| 1291 |
if (params.enabled === false) { |
| 1292 |
return null; |
| 1293 |
} |
| 1294 |
const state = params.state ?? EMPTY_OBJECT; |
| 1295 |
return evaluateRenderProp(element, renderProp, outProps, state); |
| 1296 |
} |
| 1297 |
function useRenderElementProps(componentProps, params = {}) { |
| 1298 |
const { |
| 1299 |
className: classNameProp, |
| 1300 |
style: styleProp, |
| 1301 |
render: renderProp |
| 1302 |
} = componentProps; |
| 1303 |
const { |
| 1304 |
state = EMPTY_OBJECT, |
| 1305 |
ref, |
| 1306 |
props, |
| 1307 |
stateAttributesMapping: stateAttributesMapping6, |
| 1308 |
enabled = true |
| 1309 |
} = params; |
| 1310 |
const className = enabled ? resolveClassName(classNameProp, state) : void 0; |
| 1311 |
const style = enabled ? resolveStyle(styleProp, state) : void 0; |
| 1312 |
const stateProps = enabled ? getStateAttributesProps(state, stateAttributesMapping6) : EMPTY_OBJECT; |
| 1313 |
const resolvedProps = enabled && props ? resolveRenderFunctionProps(props) : void 0; |
| 1314 |
const outProps = enabled ? mergeObjects(stateProps, resolvedProps) ?? {} : EMPTY_OBJECT; |
| 1315 |
if (typeof document !== "undefined") { |
| 1316 |
if (!enabled) { |
| 1317 |
useMergedRefs(null, null); |
| 1318 |
} else if (Array.isArray(ref)) { |
| 1319 |
outProps.ref = useMergedRefsN([outProps.ref, getReactElementRef(renderProp), ...ref]); |
| 1320 |
} else { |
| 1321 |
outProps.ref = useMergedRefs(outProps.ref, getReactElementRef(renderProp), ref); |
| 1322 |
} |
| 1323 |
} |
| 1324 |
if (!enabled) { |
| 1325 |
return EMPTY_OBJECT; |
| 1326 |
} |
| 1327 |
if (className !== void 0) { |
| 1328 |
outProps.className = mergeClassNames(outProps.className, className); |
| 1329 |
} |
| 1330 |
if (style !== void 0) { |
| 1331 |
outProps.style = mergeObjects(outProps.style, style); |
| 1332 |
} |
| 1333 |
return outProps; |
| 1334 |
} |
| 1335 |
function resolveRenderFunctionProps(props) { |
| 1336 |
if (Array.isArray(props)) { |
| 1337 |
return mergePropsN(props); |
| 1338 |
} |
| 1339 |
return mergeProps(void 0, props); |
| 1340 |
} |
| 1341 |
var REACT_LAZY_TYPE = /* @__PURE__ */ Symbol.for("react.lazy"); |
| 1342 |
var COMPONENT_IDENTIFIER_PATTERN = /^[A-Z][A-Za-z0-9$]*$/; |
| 1343 |
var LOWERCASE_CHARACTER_PATTERN = /[a-z]/; |
| 1344 |
function evaluateRenderProp(element, render4, props, state) { |
| 1345 |
if (render4) { |
| 1346 |
if (typeof render4 === "function") { |
| 1347 |
if (true) { |
| 1348 |
warnIfRenderPropLooksLikeComponent(render4); |
| 1349 |
} |
| 1350 |
return render4(props, state); |
| 1351 |
} |
| 1352 |
const mergedProps = mergeProps(props, render4.props); |
| 1353 |
mergedProps.ref = props.ref; |
| 1354 |
let newElement = render4; |
| 1355 |
if (newElement?.$$typeof === REACT_LAZY_TYPE) { |
| 1356 |
const children = React7.Children.toArray(render4); |
| 1357 |
newElement = children[0]; |
| 1358 |
} |
| 1359 |
if (true) { |
| 1360 |
if (!/* @__PURE__ */ React7.isValidElement(newElement)) { |
| 1361 |
throw new Error(["Base UI: The `render` prop was provided an invalid React element as `React.isValidElement(render)` is `false`.", "A valid React element must be provided to the `render` prop because it is cloned with props to replace the default element.", "https://base-ui.com/r/invalid-render-prop"].join("\n")); |
| 1362 |
} |
| 1363 |
} |
| 1364 |
return /* @__PURE__ */ React7.cloneElement(newElement, mergedProps); |
| 1365 |
} |
| 1366 |
if (element) { |
| 1367 |
if (typeof element === "string") { |
| 1368 |
return renderTag(element, props); |
| 1369 |
} |
| 1370 |
} |
| 1371 |
throw new Error(true ? "Base UI: Render element or function are not defined." : formatErrorMessage_default(8)); |
| 1372 |
} |
| 1373 |
function warnIfRenderPropLooksLikeComponent(renderFn) { |
| 1374 |
const functionName = renderFn.name; |
| 1375 |
if (functionName.length === 0) { |
| 1376 |
return; |
| 1377 |
} |
| 1378 |
if (!COMPONENT_IDENTIFIER_PATTERN.test(functionName)) { |
| 1379 |
return; |
| 1380 |
} |
| 1381 |
if (!LOWERCASE_CHARACTER_PATTERN.test(functionName)) { |
| 1382 |
return; |
| 1383 |
} |
| 1384 |
warn(`The \`render\` prop received a function named \`${functionName}\` that starts with an uppercase letter.`, "This usually means a React component was passed directly as `render={Component}`.", "Base UI calls `render` as a plain function, which can break the Rules of Hooks during reconciliation.", "If this is an intentional render callback, rename it to start with a lowercase letter.", "Use `render={<Component />}` or `render={(props) => <Component {...props} />}` instead.", "https://base-ui.com/r/invalid-render-prop"); |
| 1385 |
} |
| 1386 |
function renderTag(Tag, props) { |
| 1387 |
if (Tag === "button") { |
| 1388 |
return /* @__PURE__ */ (0, import_react.createElement)("button", { |
| 1389 |
type: "button", |
| 1390 |
...props, |
| 1391 |
key: props.key |
| 1392 |
}); |
| 1393 |
} |
| 1394 |
if (Tag === "img") { |
| 1395 |
return /* @__PURE__ */ (0, import_react.createElement)("img", { |
| 1396 |
alt: "", |
| 1397 |
...props, |
| 1398 |
key: props.key |
| 1399 |
}); |
| 1400 |
} |
| 1401 |
return /* @__PURE__ */ React7.createElement(Tag, props); |
| 1402 |
} |
| 1403 |
|
| 1404 |
// node_modules/@base-ui/react/esm/internals/reason-parts.js |
| 1405 |
var reason_parts_exports = {}; |
| 1406 |
__export(reason_parts_exports, { |
| 1407 |
cancelOpen: () => cancelOpen, |
| 1408 |
chipRemovePress: () => chipRemovePress, |
| 1409 |
clearPress: () => clearPress, |
| 1410 |
closePress: () => closePress, |
| 1411 |
closeWatcher: () => closeWatcher, |
| 1412 |
decrementPress: () => decrementPress, |
| 1413 |
disabled: () => disabled, |
| 1414 |
drag: () => drag, |
| 1415 |
escapeKey: () => escapeKey, |
| 1416 |
focusOut: () => focusOut, |
| 1417 |
imperativeAction: () => imperativeAction, |
| 1418 |
incrementPress: () => incrementPress, |
| 1419 |
inputBlur: () => inputBlur, |
| 1420 |
inputChange: () => inputChange, |
| 1421 |
inputClear: () => inputClear, |
| 1422 |
inputPaste: () => inputPaste, |
| 1423 |
inputPress: () => inputPress, |
| 1424 |
itemPress: () => itemPress, |
| 1425 |
keyboard: () => keyboard, |
| 1426 |
linkPress: () => linkPress, |
| 1427 |
listNavigation: () => listNavigation, |
| 1428 |
none: () => none, |
| 1429 |
outsidePress: () => outsidePress, |
| 1430 |
pointer: () => pointer, |
| 1431 |
scrub: () => scrub, |
| 1432 |
siblingOpen: () => siblingOpen, |
| 1433 |
swipe: () => swipe, |
| 1434 |
trackPress: () => trackPress, |
| 1435 |
triggerFocus: () => triggerFocus, |
| 1436 |
triggerHover: () => triggerHover, |
| 1437 |
triggerPress: () => triggerPress, |
| 1438 |
wheel: () => wheel, |
| 1439 |
windowResize: () => windowResize |
| 1440 |
}); |
| 1441 |
var none = "none"; |
| 1442 |
var triggerPress = "trigger-press"; |
| 1443 |
var triggerHover = "trigger-hover"; |
| 1444 |
var triggerFocus = "trigger-focus"; |
| 1445 |
var outsidePress = "outside-press"; |
| 1446 |
var itemPress = "item-press"; |
| 1447 |
var closePress = "close-press"; |
| 1448 |
var linkPress = "link-press"; |
| 1449 |
var clearPress = "clear-press"; |
| 1450 |
var chipRemovePress = "chip-remove-press"; |
| 1451 |
var trackPress = "track-press"; |
| 1452 |
var incrementPress = "increment-press"; |
| 1453 |
var decrementPress = "decrement-press"; |
| 1454 |
var inputChange = "input-change"; |
| 1455 |
var inputClear = "input-clear"; |
| 1456 |
var inputBlur = "input-blur"; |
| 1457 |
var inputPaste = "input-paste"; |
| 1458 |
var inputPress = "input-press"; |
| 1459 |
var focusOut = "focus-out"; |
| 1460 |
var escapeKey = "escape-key"; |
| 1461 |
var closeWatcher = "close-watcher"; |
| 1462 |
var listNavigation = "list-navigation"; |
| 1463 |
var keyboard = "keyboard"; |
| 1464 |
var pointer = "pointer"; |
| 1465 |
var drag = "drag"; |
| 1466 |
var wheel = "wheel"; |
| 1467 |
var scrub = "scrub"; |
| 1468 |
var cancelOpen = "cancel-open"; |
| 1469 |
var siblingOpen = "sibling-open"; |
| 1470 |
var disabled = "disabled"; |
| 1471 |
var imperativeAction = "imperative-action"; |
| 1472 |
var swipe = "swipe"; |
| 1473 |
var windowResize = "window-resize"; |
| 1474 |
|
| 1475 |
// node_modules/@base-ui/react/esm/internals/createBaseUIEventDetails.js |
| 1476 |
function createChangeEventDetails(reason, event, trigger, customProperties) { |
| 1477 |
let canceled = false; |
| 1478 |
let allowPropagation = false; |
| 1479 |
const custom = customProperties ?? EMPTY_OBJECT; |
| 1480 |
const details = { |
| 1481 |
reason, |
| 1482 |
event: event ?? new Event("base-ui"), |
| 1483 |
cancel() { |
| 1484 |
canceled = true; |
| 1485 |
}, |
| 1486 |
allowPropagation() { |
| 1487 |
allowPropagation = true; |
| 1488 |
}, |
| 1489 |
get isCanceled() { |
| 1490 |
return canceled; |
| 1491 |
}, |
| 1492 |
get isPropagationAllowed() { |
| 1493 |
return allowPropagation; |
| 1494 |
}, |
| 1495 |
trigger, |
| 1496 |
...custom |
| 1497 |
}; |
| 1498 |
return details; |
| 1499 |
} |
| 1500 |
|
| 1501 |
// node_modules/@base-ui/utils/esm/useId.js |
| 1502 |
var React9 = __toESM(require_react(), 1); |
| 1503 |
|
| 1504 |
// node_modules/@base-ui/utils/esm/safeReact.js |
| 1505 |
var React8 = __toESM(require_react(), 1); |
| 1506 |
var SafeReact = { |
| 1507 |
...React8 |
| 1508 |
}; |
| 1509 |
|
| 1510 |
// node_modules/@base-ui/utils/esm/useId.js |
| 1511 |
var globalId = 0; |
| 1512 |
function useGlobalId(idOverride, prefix = "mui") { |
| 1513 |
const [defaultId, setDefaultId] = React9.useState(idOverride); |
| 1514 |
const id = idOverride || defaultId; |
| 1515 |
React9.useEffect(() => { |
| 1516 |
if (defaultId == null) { |
| 1517 |
globalId += 1; |
| 1518 |
setDefaultId(`${prefix}-${globalId}`); |
| 1519 |
} |
| 1520 |
}, [defaultId, prefix]); |
| 1521 |
return id; |
| 1522 |
} |
| 1523 |
var maybeReactUseId = SafeReact.useId; |
| 1524 |
function useId(idOverride, prefix) { |
| 1525 |
if (maybeReactUseId !== void 0) { |
| 1526 |
const reactId = maybeReactUseId(); |
| 1527 |
return idOverride ?? (prefix ? `${prefix}-${reactId}` : reactId); |
| 1528 |
} |
| 1529 |
return useGlobalId(idOverride, prefix); |
| 1530 |
} |
| 1531 |
|
| 1532 |
// node_modules/@base-ui/react/esm/internals/useBaseUiId.js |
| 1533 |
function useBaseUiId(idOverride) { |
| 1534 |
return useId(idOverride, "base-ui"); |
| 1535 |
} |
| 1536 |
|
| 1537 |
// node_modules/@base-ui/react/esm/internals/useAnimationsFinished.js |
| 1538 |
var ReactDOM = __toESM(require_react_dom(), 1); |
| 1539 |
|
| 1540 |
// node_modules/@base-ui/utils/esm/useOnMount.js |
| 1541 |
var React10 = __toESM(require_react(), 1); |
| 1542 |
var EMPTY = []; |
| 1543 |
function useOnMount(fn) { |
| 1544 |
React10.useEffect(fn, EMPTY); |
| 1545 |
} |
| 1546 |
|
| 1547 |
// node_modules/@base-ui/utils/esm/useAnimationFrame.js |
| 1548 |
var EMPTY2 = null; |
| 1549 |
var LAST_RAF = globalThis.requestAnimationFrame; |
| 1550 |
var Scheduler = class { |
| 1551 |
/* This implementation uses an array as a backing data-structure for frame callbacks. |
| 1552 |
* It allows `O(1)` callback cancelling by inserting a `null` in the array, though it |
| 1553 |
* never calls the native `cancelAnimationFrame` if there are no frames left. This can |
| 1554 |
* be much more efficient if there is a call pattern that alterns as |
| 1555 |
* "request-cancel-request-cancel-…". |
| 1556 |
* But in the case of "request-request-…-cancel-cancel-…", it leaves the final animation |
| 1557 |
* frame to run anyway. We turn that frame into a `O(1)` no-op via `callbacksCount`. */ |
| 1558 |
callbacks = []; |
| 1559 |
callbacksCount = 0; |
| 1560 |
nextId = 1; |
| 1561 |
startId = 1; |
| 1562 |
isScheduled = false; |
| 1563 |
tick = (timestamp) => { |
| 1564 |
this.isScheduled = false; |
| 1565 |
const currentCallbacks = this.callbacks; |
| 1566 |
const currentCallbacksCount = this.callbacksCount; |
| 1567 |
this.callbacks = []; |
| 1568 |
this.callbacksCount = 0; |
| 1569 |
this.startId = this.nextId; |
| 1570 |
if (currentCallbacksCount > 0) { |
| 1571 |
for (let i2 = 0; i2 < currentCallbacks.length; i2 += 1) { |
| 1572 |
currentCallbacks[i2]?.(timestamp); |
| 1573 |
} |
| 1574 |
} |
| 1575 |
}; |
| 1576 |
request(fn) { |
| 1577 |
const id = this.nextId; |
| 1578 |
this.nextId += 1; |
| 1579 |
this.callbacks.push(fn); |
| 1580 |
this.callbacksCount += 1; |
| 1581 |
const didRAFChange = LAST_RAF !== requestAnimationFrame && (LAST_RAF = requestAnimationFrame, true); |
| 1582 |
if (!this.isScheduled || didRAFChange) { |
| 1583 |
requestAnimationFrame(this.tick); |
| 1584 |
this.isScheduled = true; |
| 1585 |
} |
| 1586 |
return id; |
| 1587 |
} |
| 1588 |
cancel(id) { |
| 1589 |
const index2 = id - this.startId; |
| 1590 |
if (index2 < 0 || index2 >= this.callbacks.length) { |
| 1591 |
return; |
| 1592 |
} |
| 1593 |
this.callbacks[index2] = null; |
| 1594 |
this.callbacksCount -= 1; |
| 1595 |
} |
| 1596 |
}; |
| 1597 |
var scheduler = new Scheduler(); |
| 1598 |
var AnimationFrame = class _AnimationFrame { |
| 1599 |
static create() { |
| 1600 |
return new _AnimationFrame(); |
| 1601 |
} |
| 1602 |
static request(fn) { |
| 1603 |
return scheduler.request(fn); |
| 1604 |
} |
| 1605 |
static cancel(id) { |
| 1606 |
return scheduler.cancel(id); |
| 1607 |
} |
| 1608 |
currentId = EMPTY2; |
| 1609 |
/** |
| 1610 |
* Executes `fn` after `delay`, clearing any previously scheduled call. |
| 1611 |
*/ |
| 1612 |
request(fn) { |
| 1613 |
this.cancel(); |
| 1614 |
this.currentId = scheduler.request(() => { |
| 1615 |
this.currentId = EMPTY2; |
| 1616 |
fn(); |
| 1617 |
}); |
| 1618 |
} |
| 1619 |
cancel = () => { |
| 1620 |
if (this.currentId !== EMPTY2) { |
| 1621 |
scheduler.cancel(this.currentId); |
| 1622 |
this.currentId = EMPTY2; |
| 1623 |
} |
| 1624 |
}; |
| 1625 |
disposeEffect = () => { |
| 1626 |
return this.cancel; |
| 1627 |
}; |
| 1628 |
}; |
| 1629 |
function useAnimationFrame() { |
| 1630 |
const timeout = useRefWithInit(AnimationFrame.create).current; |
| 1631 |
useOnMount(timeout.disposeEffect); |
| 1632 |
return timeout; |
| 1633 |
} |
| 1634 |
|
| 1635 |
// node_modules/@base-ui/react/esm/utils/resolveRef.js |
| 1636 |
function resolveRef(maybeRef) { |
| 1637 |
if (maybeRef == null) { |
| 1638 |
return maybeRef; |
| 1639 |
} |
| 1640 |
return "current" in maybeRef ? maybeRef.current : maybeRef; |
| 1641 |
} |
| 1642 |
|
| 1643 |
// node_modules/@base-ui/react/esm/internals/stateAttributesMapping.js |
| 1644 |
var TransitionStatusDataAttributes = /* @__PURE__ */ (function(TransitionStatusDataAttributes2) { |
| 1645 |
TransitionStatusDataAttributes2["startingStyle"] = "data-starting-style"; |
| 1646 |
TransitionStatusDataAttributes2["endingStyle"] = "data-ending-style"; |
| 1647 |
return TransitionStatusDataAttributes2; |
| 1648 |
})({}); |
| 1649 |
var STARTING_HOOK = { |
| 1650 |
[TransitionStatusDataAttributes.startingStyle]: "" |
| 1651 |
}; |
| 1652 |
var ENDING_HOOK = { |
| 1653 |
[TransitionStatusDataAttributes.endingStyle]: "" |
| 1654 |
}; |
| 1655 |
var transitionStatusMapping = { |
| 1656 |
transitionStatus(value) { |
| 1657 |
if (value === "starting") { |
| 1658 |
return STARTING_HOOK; |
| 1659 |
} |
| 1660 |
if (value === "ending") { |
| 1661 |
return ENDING_HOOK; |
| 1662 |
} |
| 1663 |
return null; |
| 1664 |
} |
| 1665 |
}; |
| 1666 |
|
| 1667 |
// node_modules/@base-ui/react/esm/internals/useAnimationsFinished.js |
| 1668 |
function useAnimationsFinished(elementOrRef, waitForStartingStyleRemoved = false, treatAbortedAsFinished = true) { |
| 1669 |
const frame = useAnimationFrame(); |
| 1670 |
return useStableCallback((fnToExecute, signal = null) => { |
| 1671 |
frame.cancel(); |
| 1672 |
const element = resolveRef(elementOrRef); |
| 1673 |
if (element == null) { |
| 1674 |
return; |
| 1675 |
} |
| 1676 |
const resolvedElement = element; |
| 1677 |
const done = () => { |
| 1678 |
ReactDOM.flushSync(fnToExecute); |
| 1679 |
}; |
| 1680 |
if (typeof resolvedElement.getAnimations !== "function" || globalThis.BASE_UI_ANIMATIONS_DISABLED) { |
| 1681 |
fnToExecute(); |
| 1682 |
return; |
| 1683 |
} |
| 1684 |
function exec() { |
| 1685 |
Promise.all(resolvedElement.getAnimations().map((animation) => animation.finished)).then(() => { |
| 1686 |
if (!signal?.aborted) { |
| 1687 |
done(); |
| 1688 |
} |
| 1689 |
}).catch(() => { |
| 1690 |
if (treatAbortedAsFinished) { |
| 1691 |
if (!signal?.aborted) { |
| 1692 |
done(); |
| 1693 |
} |
| 1694 |
return; |
| 1695 |
} |
| 1696 |
const currentAnimations = resolvedElement.getAnimations(); |
| 1697 |
if (!signal?.aborted && currentAnimations.length > 0 && currentAnimations.some((animation) => animation.pending || animation.playState !== "finished")) { |
| 1698 |
exec(); |
| 1699 |
} |
| 1700 |
}); |
| 1701 |
} |
| 1702 |
if (waitForStartingStyleRemoved) { |
| 1703 |
const startingStyleAttribute = TransitionStatusDataAttributes.startingStyle; |
| 1704 |
if (!resolvedElement.hasAttribute(startingStyleAttribute)) { |
| 1705 |
frame.request(exec); |
| 1706 |
return; |
| 1707 |
} |
| 1708 |
const attributeObserver = new MutationObserver(() => { |
| 1709 |
if (!resolvedElement.hasAttribute(startingStyleAttribute)) { |
| 1710 |
attributeObserver.disconnect(); |
| 1711 |
exec(); |
| 1712 |
} |
| 1713 |
}); |
| 1714 |
attributeObserver.observe(resolvedElement, { |
| 1715 |
attributes: true, |
| 1716 |
attributeFilter: [startingStyleAttribute] |
| 1717 |
}); |
| 1718 |
signal?.addEventListener("abort", () => attributeObserver.disconnect(), { |
| 1719 |
once: true |
| 1720 |
}); |
| 1721 |
return; |
| 1722 |
} |
| 1723 |
frame.request(exec); |
| 1724 |
}); |
| 1725 |
} |
| 1726 |
|
| 1727 |
// node_modules/@base-ui/react/esm/internals/useTransitionStatus.js |
| 1728 |
var React11 = __toESM(require_react(), 1); |
| 1729 |
function useTransitionStatus(open, enableIdleState = false, deferEndingState = false) { |
| 1730 |
const [transitionStatus, setTransitionStatus] = React11.useState(open && enableIdleState ? "idle" : void 0); |
| 1731 |
const [mounted, setMounted] = React11.useState(open); |
| 1732 |
if (open && !mounted) { |
| 1733 |
setMounted(true); |
| 1734 |
setTransitionStatus("starting"); |
| 1735 |
} |
| 1736 |
if (!open && mounted && transitionStatus !== "ending" && !deferEndingState) { |
| 1737 |
setTransitionStatus("ending"); |
| 1738 |
} |
| 1739 |
if (!open && !mounted && transitionStatus === "ending") { |
| 1740 |
setTransitionStatus(void 0); |
| 1741 |
} |
| 1742 |
useIsoLayoutEffect(() => { |
| 1743 |
if (!open && mounted && transitionStatus !== "ending" && deferEndingState) { |
| 1744 |
const frame = AnimationFrame.request(() => { |
| 1745 |
setTransitionStatus("ending"); |
| 1746 |
}); |
| 1747 |
return () => { |
| 1748 |
AnimationFrame.cancel(frame); |
| 1749 |
}; |
| 1750 |
} |
| 1751 |
return void 0; |
| 1752 |
}, [open, mounted, transitionStatus, deferEndingState]); |
| 1753 |
useIsoLayoutEffect(() => { |
| 1754 |
if (!open || enableIdleState) { |
| 1755 |
return void 0; |
| 1756 |
} |
| 1757 |
const frame = AnimationFrame.request(() => { |
| 1758 |
setTransitionStatus(void 0); |
| 1759 |
}); |
| 1760 |
return () => { |
| 1761 |
AnimationFrame.cancel(frame); |
| 1762 |
}; |
| 1763 |
}, [enableIdleState, open]); |
| 1764 |
useIsoLayoutEffect(() => { |
| 1765 |
if (!open || !enableIdleState) { |
| 1766 |
return void 0; |
| 1767 |
} |
| 1768 |
if (open && mounted && transitionStatus !== "idle") { |
| 1769 |
setTransitionStatus("starting"); |
| 1770 |
} |
| 1771 |
const frame = AnimationFrame.request(() => { |
| 1772 |
setTransitionStatus("idle"); |
| 1773 |
}); |
| 1774 |
return () => { |
| 1775 |
AnimationFrame.cancel(frame); |
| 1776 |
}; |
| 1777 |
}, [enableIdleState, open, mounted, transitionStatus]); |
| 1778 |
return { |
| 1779 |
mounted, |
| 1780 |
setMounted, |
| 1781 |
transitionStatus |
| 1782 |
}; |
| 1783 |
} |
| 1784 |
|
| 1785 |
// node_modules/@base-ui/react/esm/internals/use-button/useButton.js |
| 1786 |
var React14 = __toESM(require_react(), 1); |
| 1787 |
|
| 1788 |
// node_modules/@floating-ui/utils/dist/floating-ui.utils.dom.mjs |
| 1789 |
function hasWindow() { |
| 1790 |
return typeof window !== "undefined"; |
| 1791 |
} |
| 1792 |
function getNodeName(node) { |
| 1793 |
if (isNode(node)) { |
| 1794 |
return (node.nodeName || "").toLowerCase(); |
| 1795 |
} |
| 1796 |
return "#document"; |
| 1797 |
} |
| 1798 |
function getWindow(node) { |
| 1799 |
var _node$ownerDocument; |
| 1800 |
return (node == null || (_node$ownerDocument = node.ownerDocument) == null ? void 0 : _node$ownerDocument.defaultView) || window; |
| 1801 |
} |
| 1802 |
function getDocumentElement(node) { |
| 1803 |
var _ref; |
| 1804 |
return (_ref = (isNode(node) ? node.ownerDocument : node.document) || window.document) == null ? void 0 : _ref.documentElement; |
| 1805 |
} |
| 1806 |
function isNode(value) { |
| 1807 |
if (!hasWindow()) { |
| 1808 |
return false; |
| 1809 |
} |
| 1810 |
return value instanceof Node || value instanceof getWindow(value).Node; |
| 1811 |
} |
| 1812 |
function isElement(value) { |
| 1813 |
if (!hasWindow()) { |
| 1814 |
return false; |
| 1815 |
} |
| 1816 |
return value instanceof Element || value instanceof getWindow(value).Element; |
| 1817 |
} |
| 1818 |
function isHTMLElement(value) { |
| 1819 |
if (!hasWindow()) { |
| 1820 |
return false; |
| 1821 |
} |
| 1822 |
return value instanceof HTMLElement || value instanceof getWindow(value).HTMLElement; |
| 1823 |
} |
| 1824 |
function isShadowRoot(value) { |
| 1825 |
if (!hasWindow() || typeof ShadowRoot === "undefined") { |
| 1826 |
return false; |
| 1827 |
} |
| 1828 |
return value instanceof ShadowRoot || value instanceof getWindow(value).ShadowRoot; |
| 1829 |
} |
| 1830 |
function isOverflowElement(element) { |
| 1831 |
const { |
| 1832 |
overflow, |
| 1833 |
overflowX, |
| 1834 |
overflowY, |
| 1835 |
display |
| 1836 |
} = getComputedStyle2(element); |
| 1837 |
return /auto|scroll|overlay|hidden|clip/.test(overflow + overflowY + overflowX) && display !== "inline" && display !== "contents"; |
| 1838 |
} |
| 1839 |
function isTableElement(element) { |
| 1840 |
return /^(table|td|th)$/.test(getNodeName(element)); |
| 1841 |
} |
| 1842 |
function isTopLayer(element) { |
| 1843 |
try { |
| 1844 |
if (element.matches(":popover-open")) { |
| 1845 |
return true; |
| 1846 |
} |
| 1847 |
} catch (_e) { |
| 1848 |
} |
| 1849 |
try { |
| 1850 |
return element.matches(":modal"); |
| 1851 |
} catch (_e) { |
| 1852 |
return false; |
| 1853 |
} |
| 1854 |
} |
| 1855 |
var willChangeRe = /transform|translate|scale|rotate|perspective|filter/; |
| 1856 |
var containRe = /paint|layout|strict|content/; |
| 1857 |
var isNotNone = (value) => !!value && value !== "none"; |
| 1858 |
var isWebKitValue; |
| 1859 |
function isContainingBlock(elementOrCss) { |
| 1860 |
const css = isElement(elementOrCss) ? getComputedStyle2(elementOrCss) : elementOrCss; |
| 1861 |
return isNotNone(css.transform) || isNotNone(css.translate) || isNotNone(css.scale) || isNotNone(css.rotate) || isNotNone(css.perspective) || !isWebKit() && (isNotNone(css.backdropFilter) || isNotNone(css.filter)) || willChangeRe.test(css.willChange || "") || containRe.test(css.contain || ""); |
| 1862 |
} |
| 1863 |
function getContainingBlock(element) { |
| 1864 |
let currentNode = getParentNode(element); |
| 1865 |
while (isHTMLElement(currentNode) && !isLastTraversableNode(currentNode)) { |
| 1866 |
if (isContainingBlock(currentNode)) { |
| 1867 |
return currentNode; |
| 1868 |
} else if (isTopLayer(currentNode)) { |
| 1869 |
return null; |
| 1870 |
} |
| 1871 |
currentNode = getParentNode(currentNode); |
| 1872 |
} |
| 1873 |
return null; |
| 1874 |
} |
| 1875 |
function isWebKit() { |
| 1876 |
if (isWebKitValue == null) { |
| 1877 |
isWebKitValue = typeof CSS !== "undefined" && CSS.supports && CSS.supports("-webkit-backdrop-filter", "none"); |
| 1878 |
} |
| 1879 |
return isWebKitValue; |
| 1880 |
} |
| 1881 |
function isLastTraversableNode(node) { |
| 1882 |
return /^(html|body|#document)$/.test(getNodeName(node)); |
| 1883 |
} |
| 1884 |
function getComputedStyle2(element) { |
| 1885 |
return getWindow(element).getComputedStyle(element); |
| 1886 |
} |
| 1887 |
function getNodeScroll(element) { |
| 1888 |
if (isElement(element)) { |
| 1889 |
return { |
| 1890 |
scrollLeft: element.scrollLeft, |
| 1891 |
scrollTop: element.scrollTop |
| 1892 |
}; |
| 1893 |
} |
| 1894 |
return { |
| 1895 |
scrollLeft: element.scrollX, |
| 1896 |
scrollTop: element.scrollY |
| 1897 |
}; |
| 1898 |
} |
| 1899 |
function getParentNode(node) { |
| 1900 |
if (getNodeName(node) === "html") { |
| 1901 |
return node; |
| 1902 |
} |
| 1903 |
const result = ( |
| 1904 |
// Step into the shadow DOM of the parent of a slotted node. |
| 1905 |
node.assignedSlot || // DOM Element detected. |
| 1906 |
node.parentNode || // ShadowRoot detected. |
| 1907 |
isShadowRoot(node) && node.host || // Fallback. |
| 1908 |
getDocumentElement(node) |
| 1909 |
); |
| 1910 |
return isShadowRoot(result) ? result.host : result; |
| 1911 |
} |
| 1912 |
function getNearestOverflowAncestor(node) { |
| 1913 |
const parentNode = getParentNode(node); |
| 1914 |
if (isLastTraversableNode(parentNode)) { |
| 1915 |
return node.ownerDocument ? node.ownerDocument.body : node.body; |
| 1916 |
} |
| 1917 |
if (isHTMLElement(parentNode) && isOverflowElement(parentNode)) { |
| 1918 |
return parentNode; |
| 1919 |
} |
| 1920 |
return getNearestOverflowAncestor(parentNode); |
| 1921 |
} |
| 1922 |
function getOverflowAncestors(node, list, traverseIframes) { |
| 1923 |
var _node$ownerDocument2; |
| 1924 |
if (list === void 0) { |
| 1925 |
list = []; |
| 1926 |
} |
| 1927 |
if (traverseIframes === void 0) { |
| 1928 |
traverseIframes = true; |
| 1929 |
} |
| 1930 |
const scrollableAncestor = getNearestOverflowAncestor(node); |
| 1931 |
const isBody = scrollableAncestor === ((_node$ownerDocument2 = node.ownerDocument) == null ? void 0 : _node$ownerDocument2.body); |
| 1932 |
const win = getWindow(scrollableAncestor); |
| 1933 |
if (isBody) { |
| 1934 |
const frameElement = getFrameElement(win); |
| 1935 |
return list.concat(win, win.visualViewport || [], isOverflowElement(scrollableAncestor) ? scrollableAncestor : [], frameElement && traverseIframes ? getOverflowAncestors(frameElement) : []); |
| 1936 |
} else { |
| 1937 |
return list.concat(scrollableAncestor, getOverflowAncestors(scrollableAncestor, [], traverseIframes)); |
| 1938 |
} |
| 1939 |
} |
| 1940 |
function getFrameElement(win) { |
| 1941 |
return win.parent && Object.getPrototypeOf(win.parent) ? win.frameElement : null; |
| 1942 |
} |
| 1943 |
|
| 1944 |
// node_modules/@base-ui/react/esm/internals/composite/root/CompositeRootContext.js |
| 1945 |
var React12 = __toESM(require_react(), 1); |
| 1946 |
var CompositeRootContext = /* @__PURE__ */ React12.createContext(void 0); |
| 1947 |
if (true) CompositeRootContext.displayName = "CompositeRootContext"; |
| 1948 |
function useCompositeRootContext(optional = false) { |
| 1949 |
const context = React12.useContext(CompositeRootContext); |
| 1950 |
if (context === void 0 && !optional) { |
| 1951 |
throw new Error(true ? "Base UI: CompositeRootContext is missing. Composite parts must be placed within <Composite.Root>." : formatErrorMessage_default(16)); |
| 1952 |
} |
| 1953 |
return context; |
| 1954 |
} |
| 1955 |
|
| 1956 |
// node_modules/@base-ui/react/esm/utils/useFocusableWhenDisabled.js |
| 1957 |
var React13 = __toESM(require_react(), 1); |
| 1958 |
function useFocusableWhenDisabled(parameters) { |
| 1959 |
const { |
| 1960 |
focusableWhenDisabled, |
| 1961 |
disabled: disabled2, |
| 1962 |
composite = false, |
| 1963 |
tabIndex: tabIndexProp = 0, |
| 1964 |
isNativeButton |
| 1965 |
} = parameters; |
| 1966 |
const isFocusableComposite = composite && focusableWhenDisabled !== false; |
| 1967 |
const isNonFocusableComposite = composite && focusableWhenDisabled === false; |
| 1968 |
const props = React13.useMemo(() => { |
| 1969 |
const additionalProps = { |
| 1970 |
// allow Tabbing away from focusableWhenDisabled elements |
| 1971 |
onKeyDown(event) { |
| 1972 |
if (disabled2 && focusableWhenDisabled && event.key !== "Tab") { |
| 1973 |
event.preventDefault(); |
| 1974 |
} |
| 1975 |
} |
| 1976 |
}; |
| 1977 |
if (!composite) { |
| 1978 |
additionalProps.tabIndex = tabIndexProp; |
| 1979 |
if (!isNativeButton && disabled2) { |
| 1980 |
additionalProps.tabIndex = focusableWhenDisabled ? tabIndexProp : -1; |
| 1981 |
} |
| 1982 |
} |
| 1983 |
if (isNativeButton && (focusableWhenDisabled || isFocusableComposite) || !isNativeButton && disabled2) { |
| 1984 |
additionalProps["aria-disabled"] = disabled2; |
| 1985 |
} |
| 1986 |
if (isNativeButton && (!focusableWhenDisabled || isNonFocusableComposite)) { |
| 1987 |
additionalProps.disabled = disabled2; |
| 1988 |
} |
| 1989 |
return additionalProps; |
| 1990 |
}, [composite, disabled2, focusableWhenDisabled, isFocusableComposite, isNonFocusableComposite, isNativeButton, tabIndexProp]); |
| 1991 |
return { |
| 1992 |
props |
| 1993 |
}; |
| 1994 |
} |
| 1995 |
|
| 1996 |
// node_modules/@base-ui/react/esm/internals/use-button/useButton.js |
| 1997 |
function useButton(parameters = {}) { |
| 1998 |
const { |
| 1999 |
disabled: disabled2 = false, |
| 2000 |
focusableWhenDisabled, |
| 2001 |
tabIndex = 0, |
| 2002 |
native: isNativeButton = true, |
| 2003 |
composite: compositeProp |
| 2004 |
} = parameters; |
| 2005 |
const elementRef = React14.useRef(null); |
| 2006 |
const compositeRootContext = useCompositeRootContext(true); |
| 2007 |
const isCompositeItem = compositeProp ?? compositeRootContext !== void 0; |
| 2008 |
const { |
| 2009 |
props: focusableWhenDisabledProps |
| 2010 |
} = useFocusableWhenDisabled({ |
| 2011 |
focusableWhenDisabled, |
| 2012 |
disabled: disabled2, |
| 2013 |
composite: isCompositeItem, |
| 2014 |
tabIndex, |
| 2015 |
isNativeButton |
| 2016 |
}); |
| 2017 |
if (true) { |
| 2018 |
React14.useEffect(() => { |
| 2019 |
if (!elementRef.current) { |
| 2020 |
return; |
| 2021 |
} |
| 2022 |
const isButtonTag = isButtonElement(elementRef.current); |
| 2023 |
if (isNativeButton) { |
| 2024 |
if (!isButtonTag) { |
| 2025 |
const ownerStackMessage = SafeReact.captureOwnerStack?.() || ""; |
| 2026 |
const message2 = "A component that acts as a button expected a native <button> because the `nativeButton` prop is true. Rendering a non-<button> removes native button semantics, which can impact forms and accessibility. Use a real <button> in the `render` prop, or set `nativeButton` to `false`."; |
| 2027 |
error(`${message2}${ownerStackMessage}`); |
| 2028 |
} |
| 2029 |
} else if (isButtonTag) { |
| 2030 |
const ownerStackMessage = SafeReact.captureOwnerStack?.() || ""; |
| 2031 |
const message2 = "A component that acts as a button expected a non-<button> because the `nativeButton` prop is false. Rendering a <button> keeps native behavior while Base UI applies non-native attributes and handlers, which can add unintended extra attributes (such as `role` or `aria-disabled`). Use a non-<button> in the `render` prop, or set `nativeButton` to `true`."; |
| 2032 |
error(`${message2}${ownerStackMessage}`); |
| 2033 |
} |
| 2034 |
}, [isNativeButton]); |
| 2035 |
} |
| 2036 |
const updateDisabled = React14.useCallback(() => { |
| 2037 |
const element = elementRef.current; |
| 2038 |
if (!isButtonElement(element)) { |
| 2039 |
return; |
| 2040 |
} |
| 2041 |
if (isCompositeItem && disabled2 && focusableWhenDisabledProps.disabled === void 0 && element.disabled) { |
| 2042 |
element.disabled = false; |
| 2043 |
} |
| 2044 |
}, [disabled2, focusableWhenDisabledProps.disabled, isCompositeItem]); |
| 2045 |
useIsoLayoutEffect(updateDisabled, [updateDisabled]); |
| 2046 |
const getButtonProps = React14.useCallback((externalProps = {}) => { |
| 2047 |
const { |
| 2048 |
onClick: externalOnClick, |
| 2049 |
onMouseDown: externalOnMouseDown, |
| 2050 |
onKeyUp: externalOnKeyUp, |
| 2051 |
onKeyDown: externalOnKeyDown, |
| 2052 |
onPointerDown: externalOnPointerDown, |
| 2053 |
...otherExternalProps |
| 2054 |
} = externalProps; |
| 2055 |
const type = isNativeButton ? "button" : void 0; |
| 2056 |
return mergeProps({ |
| 2057 |
type, |
| 2058 |
onClick(event) { |
| 2059 |
if (disabled2) { |
| 2060 |
event.preventDefault(); |
| 2061 |
return; |
| 2062 |
} |
| 2063 |
externalOnClick?.(event); |
| 2064 |
}, |
| 2065 |
onMouseDown(event) { |
| 2066 |
if (!disabled2) { |
| 2067 |
externalOnMouseDown?.(event); |
| 2068 |
} |
| 2069 |
}, |
| 2070 |
onKeyDown(event) { |
| 2071 |
if (disabled2) { |
| 2072 |
return; |
| 2073 |
} |
| 2074 |
makeEventPreventable(event); |
| 2075 |
externalOnKeyDown?.(event); |
| 2076 |
if (event.baseUIHandlerPrevented) { |
| 2077 |
return; |
| 2078 |
} |
| 2079 |
const isCurrentTarget = event.target === event.currentTarget; |
| 2080 |
const currentTarget = event.currentTarget; |
| 2081 |
const isButton2 = isButtonElement(currentTarget); |
| 2082 |
const isLink = !isNativeButton && isValidLinkElement(currentTarget); |
| 2083 |
const shouldClick = isCurrentTarget && (isNativeButton ? isButton2 : !isLink); |
| 2084 |
const isEnterKey = event.key === "Enter"; |
| 2085 |
const isSpaceKey = event.key === " "; |
| 2086 |
const role = currentTarget.getAttribute("role"); |
| 2087 |
const isTextNavigationRole = role?.startsWith("menuitem") || role === "option" || role === "gridcell"; |
| 2088 |
if (isCurrentTarget && isCompositeItem && isSpaceKey) { |
| 2089 |
if (event.defaultPrevented && isTextNavigationRole) { |
| 2090 |
return; |
| 2091 |
} |
| 2092 |
event.preventDefault(); |
| 2093 |
if (isLink || isNativeButton && isButton2) { |
| 2094 |
currentTarget.click(); |
| 2095 |
event.preventBaseUIHandler(); |
| 2096 |
} else if (shouldClick) { |
| 2097 |
externalOnClick?.(event); |
| 2098 |
event.preventBaseUIHandler(); |
| 2099 |
} |
| 2100 |
return; |
| 2101 |
} |
| 2102 |
if (shouldClick) { |
| 2103 |
if (!isNativeButton && (isSpaceKey || isEnterKey)) { |
| 2104 |
event.preventDefault(); |
| 2105 |
} |
| 2106 |
if (!isNativeButton && isEnterKey) { |
| 2107 |
externalOnClick?.(event); |
| 2108 |
} |
| 2109 |
} |
| 2110 |
}, |
| 2111 |
onKeyUp(event) { |
| 2112 |
if (disabled2) { |
| 2113 |
return; |
| 2114 |
} |
| 2115 |
makeEventPreventable(event); |
| 2116 |
externalOnKeyUp?.(event); |
| 2117 |
if (event.target === event.currentTarget && isNativeButton && isCompositeItem && isButtonElement(event.currentTarget) && event.key === " ") { |
| 2118 |
event.preventDefault(); |
| 2119 |
return; |
| 2120 |
} |
| 2121 |
if (event.baseUIHandlerPrevented) { |
| 2122 |
return; |
| 2123 |
} |
| 2124 |
if (event.target === event.currentTarget && !isNativeButton && !isCompositeItem && event.key === " ") { |
| 2125 |
externalOnClick?.(event); |
| 2126 |
} |
| 2127 |
}, |
| 2128 |
onPointerDown(event) { |
| 2129 |
if (disabled2) { |
| 2130 |
event.preventDefault(); |
| 2131 |
return; |
| 2132 |
} |
| 2133 |
externalOnPointerDown?.(event); |
| 2134 |
} |
| 2135 |
}, !isNativeButton ? { |
| 2136 |
role: "button" |
| 2137 |
} : void 0, focusableWhenDisabledProps, otherExternalProps); |
| 2138 |
}, [disabled2, focusableWhenDisabledProps, isCompositeItem, isNativeButton]); |
| 2139 |
const buttonRef = useStableCallback((element) => { |
| 2140 |
elementRef.current = element; |
| 2141 |
updateDisabled(); |
| 2142 |
}); |
| 2143 |
return { |
| 2144 |
getButtonProps, |
| 2145 |
buttonRef |
| 2146 |
}; |
| 2147 |
} |
| 2148 |
function isButtonElement(elem) { |
| 2149 |
return isHTMLElement(elem) && elem.tagName === "BUTTON"; |
| 2150 |
} |
| 2151 |
function isValidLinkElement(elem) { |
| 2152 |
return Boolean(elem?.tagName === "A" && elem?.href); |
| 2153 |
} |
| 2154 |
|
| 2155 |
// node_modules/@base-ui/utils/esm/detectBrowser.js |
| 2156 |
var hasNavigator = typeof navigator !== "undefined"; |
| 2157 |
var nav = getNavigatorData(); |
| 2158 |
var platform = getPlatform(); |
| 2159 |
var userAgent = getUserAgent(); |
| 2160 |
var isWebKit2 = typeof CSS === "undefined" || !CSS.supports ? false : CSS.supports("-webkit-backdrop-filter:none"); |
| 2161 |
var isIOS = ( |
| 2162 |
// iPads can claim to be MacIntel |
| 2163 |
nav.platform === "MacIntel" && nav.maxTouchPoints > 1 ? true : /iP(hone|ad|od)|iOS/.test(nav.platform) |
| 2164 |
); |
| 2165 |
var isFirefox = hasNavigator && /firefox/i.test(userAgent); |
| 2166 |
var isSafari = hasNavigator && /apple/i.test(navigator.vendor); |
| 2167 |
var isEdge = hasNavigator && /Edg/i.test(userAgent); |
| 2168 |
var isAndroid = hasNavigator && /android/i.test(platform) || /android/i.test(userAgent); |
| 2169 |
var isMac = hasNavigator && platform.toLowerCase().startsWith("mac") && !navigator.maxTouchPoints; |
| 2170 |
var isJSDOM = userAgent.includes("jsdom/"); |
| 2171 |
function getNavigatorData() { |
| 2172 |
if (!hasNavigator) { |
| 2173 |
return { |
| 2174 |
platform: "", |
| 2175 |
maxTouchPoints: -1 |
| 2176 |
}; |
| 2177 |
} |
| 2178 |
const uaData = navigator.userAgentData; |
| 2179 |
if (uaData?.platform) { |
| 2180 |
return { |
| 2181 |
platform: uaData.platform, |
| 2182 |
maxTouchPoints: navigator.maxTouchPoints |
| 2183 |
}; |
| 2184 |
} |
| 2185 |
return { |
| 2186 |
platform: navigator.platform ?? "", |
| 2187 |
maxTouchPoints: navigator.maxTouchPoints ?? -1 |
| 2188 |
}; |
| 2189 |
} |
| 2190 |
function getUserAgent() { |
| 2191 |
if (!hasNavigator) { |
| 2192 |
return ""; |
| 2193 |
} |
| 2194 |
const uaData = navigator.userAgentData; |
| 2195 |
if (uaData && Array.isArray(uaData.brands)) { |
| 2196 |
return uaData.brands.map(({ |
| 2197 |
brand, |
| 2198 |
version: version2 |
| 2199 |
}) => `${brand}/${version2}`).join(" "); |
| 2200 |
} |
| 2201 |
return navigator.userAgent; |
| 2202 |
} |
| 2203 |
function getPlatform() { |
| 2204 |
if (!hasNavigator) { |
| 2205 |
return ""; |
| 2206 |
} |
| 2207 |
const uaData = navigator.userAgentData; |
| 2208 |
if (uaData?.platform) { |
| 2209 |
return uaData.platform; |
| 2210 |
} |
| 2211 |
return navigator.platform ?? ""; |
| 2212 |
} |
| 2213 |
|
| 2214 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/constants.js |
| 2215 |
var FOCUSABLE_ATTRIBUTE = "data-base-ui-focusable"; |
| 2216 |
var ACTIVE_KEY = "active"; |
| 2217 |
var SELECTED_KEY = "selected"; |
| 2218 |
var TYPEABLE_SELECTOR = "input:not([type='hidden']):not([disabled]),[contenteditable]:not([contenteditable='false']),textarea:not([disabled])"; |
| 2219 |
|
| 2220 |
// node_modules/@base-ui/react/esm/internals/shadowDom.js |
| 2221 |
function activeElement(doc) { |
| 2222 |
let element = doc.activeElement; |
| 2223 |
while (element?.shadowRoot?.activeElement != null) { |
| 2224 |
element = element.shadowRoot.activeElement; |
| 2225 |
} |
| 2226 |
return element; |
| 2227 |
} |
| 2228 |
function contains(parent, child) { |
| 2229 |
if (!parent || !child) { |
| 2230 |
return false; |
| 2231 |
} |
| 2232 |
const rootNode = child.getRootNode?.(); |
| 2233 |
if (parent.contains(child)) { |
| 2234 |
return true; |
| 2235 |
} |
| 2236 |
if (rootNode && isShadowRoot(rootNode)) { |
| 2237 |
let next = child; |
| 2238 |
while (next) { |
| 2239 |
if (parent === next) { |
| 2240 |
return true; |
| 2241 |
} |
| 2242 |
next = next.parentNode || next.host; |
| 2243 |
} |
| 2244 |
} |
| 2245 |
return false; |
| 2246 |
} |
| 2247 |
function getTarget(event) { |
| 2248 |
if ("composedPath" in event) { |
| 2249 |
return event.composedPath()[0]; |
| 2250 |
} |
| 2251 |
return event.target; |
| 2252 |
} |
| 2253 |
|
| 2254 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/element.js |
| 2255 |
function isTargetInsideEnabledTrigger(target, triggerElements) { |
| 2256 |
if (!isElement(target)) { |
| 2257 |
return false; |
| 2258 |
} |
| 2259 |
const targetElement = target; |
| 2260 |
if (triggerElements.hasElement(targetElement)) { |
| 2261 |
return !targetElement.hasAttribute("data-trigger-disabled"); |
| 2262 |
} |
| 2263 |
for (const [, trigger] of triggerElements.entries()) { |
| 2264 |
if (contains(trigger, targetElement)) { |
| 2265 |
return !trigger.hasAttribute("data-trigger-disabled"); |
| 2266 |
} |
| 2267 |
} |
| 2268 |
return false; |
| 2269 |
} |
| 2270 |
function isEventTargetWithin(event, node) { |
| 2271 |
if (node == null) { |
| 2272 |
return false; |
| 2273 |
} |
| 2274 |
if ("composedPath" in event) { |
| 2275 |
return event.composedPath().includes(node); |
| 2276 |
} |
| 2277 |
const eventAgain = event; |
| 2278 |
return eventAgain.target != null && node.contains(eventAgain.target); |
| 2279 |
} |
| 2280 |
function isRootElement(element) { |
| 2281 |
return element.matches("html,body"); |
| 2282 |
} |
| 2283 |
function isTypeableElement(element) { |
| 2284 |
return isHTMLElement(element) && element.matches(TYPEABLE_SELECTOR); |
| 2285 |
} |
| 2286 |
function isInteractiveElement(element) { |
| 2287 |
return element?.closest(`button,a[href],[role="button"],select,[tabindex]:not([tabindex="-1"]),${TYPEABLE_SELECTOR}`) != null; |
| 2288 |
} |
| 2289 |
function isTypeableCombobox(element) { |
| 2290 |
if (!element) { |
| 2291 |
return false; |
| 2292 |
} |
| 2293 |
return element.getAttribute("role") === "combobox" && isTypeableElement(element); |
| 2294 |
} |
| 2295 |
function matchesFocusVisible(element) { |
| 2296 |
if (!element || isJSDOM) { |
| 2297 |
return true; |
| 2298 |
} |
| 2299 |
try { |
| 2300 |
return element.matches(":focus-visible"); |
| 2301 |
} catch (_e) { |
| 2302 |
return true; |
| 2303 |
} |
| 2304 |
} |
| 2305 |
function getFloatingFocusElement(floatingElement) { |
| 2306 |
if (!floatingElement) { |
| 2307 |
return null; |
| 2308 |
} |
| 2309 |
return floatingElement.hasAttribute(FOCUSABLE_ATTRIBUTE) ? floatingElement : floatingElement.querySelector(`[${FOCUSABLE_ATTRIBUTE}]`) || floatingElement; |
| 2310 |
} |
| 2311 |
|
| 2312 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/nodes.js |
| 2313 |
function getNodeChildren(nodes, id, onlyOpenChildren = true) { |
| 2314 |
const directChildren = nodes.filter((node) => node.parentId === id); |
| 2315 |
return directChildren.flatMap((child) => [...!onlyOpenChildren || child.context?.open ? [child] : [], ...getNodeChildren(nodes, child.id, onlyOpenChildren)]); |
| 2316 |
} |
| 2317 |
function getNodeAncestors(nodes, id) { |
| 2318 |
let allAncestors = []; |
| 2319 |
let currentParentId = nodes.find((node) => node.id === id)?.parentId; |
| 2320 |
while (currentParentId) { |
| 2321 |
const currentNode = nodes.find((node) => node.id === currentParentId); |
| 2322 |
currentParentId = currentNode?.parentId; |
| 2323 |
if (currentNode) { |
| 2324 |
allAncestors = allAncestors.concat(currentNode); |
| 2325 |
} |
| 2326 |
} |
| 2327 |
return allAncestors; |
| 2328 |
} |
| 2329 |
|
| 2330 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/event.js |
| 2331 |
function stopEvent(event) { |
| 2332 |
event.preventDefault(); |
| 2333 |
event.stopPropagation(); |
| 2334 |
} |
| 2335 |
function isReactEvent(event) { |
| 2336 |
return "nativeEvent" in event; |
| 2337 |
} |
| 2338 |
function isVirtualClick(event) { |
| 2339 |
if (event.pointerType === "" && event.isTrusted) { |
| 2340 |
return true; |
| 2341 |
} |
| 2342 |
if (isAndroid && event.pointerType) { |
| 2343 |
return event.type === "click" && event.buttons === 1; |
| 2344 |
} |
| 2345 |
return event.detail === 0 && !event.pointerType; |
| 2346 |
} |
| 2347 |
function isVirtualPointerEvent(event) { |
| 2348 |
if (isJSDOM) { |
| 2349 |
return false; |
| 2350 |
} |
| 2351 |
return !isAndroid && event.width === 0 && event.height === 0 || isAndroid && event.width === 1 && event.height === 1 && event.pressure === 0 && event.detail === 0 && event.pointerType === "mouse" || // iOS VoiceOver returns 0.333• for width/height. |
| 2352 |
event.width < 1 && event.height < 1 && event.pressure === 0 && event.detail === 0 && event.pointerType === "touch"; |
| 2353 |
} |
| 2354 |
function isMouseLikePointerType(pointerType, strict) { |
| 2355 |
const values = ["mouse", "pen"]; |
| 2356 |
if (!strict) { |
| 2357 |
values.push("", void 0); |
| 2358 |
} |
| 2359 |
return values.includes(pointerType); |
| 2360 |
} |
| 2361 |
function isClickLikeEvent(event) { |
| 2362 |
const type = event.type; |
| 2363 |
return type === "click" || type === "mousedown" || type === "keydown" || type === "keyup"; |
| 2364 |
} |
| 2365 |
|
| 2366 |
// node_modules/@floating-ui/utils/dist/floating-ui.utils.mjs |
| 2367 |
var sides = ["top", "right", "bottom", "left"]; |
| 2368 |
var min = Math.min; |
| 2369 |
var max = Math.max; |
| 2370 |
var round = Math.round; |
| 2371 |
var floor = Math.floor; |
| 2372 |
var createCoords = (v2) => ({ |
| 2373 |
x: v2, |
| 2374 |
y: v2 |
| 2375 |
}); |
| 2376 |
var oppositeSideMap = { |
| 2377 |
left: "right", |
| 2378 |
right: "left", |
| 2379 |
bottom: "top", |
| 2380 |
top: "bottom" |
| 2381 |
}; |
| 2382 |
function clamp(start, value, end) { |
| 2383 |
return max(start, min(value, end)); |
| 2384 |
} |
| 2385 |
function evaluate(value, param) { |
| 2386 |
return typeof value === "function" ? value(param) : value; |
| 2387 |
} |
| 2388 |
function getSide(placement) { |
| 2389 |
return placement.split("-")[0]; |
| 2390 |
} |
| 2391 |
function getAlignment(placement) { |
| 2392 |
return placement.split("-")[1]; |
| 2393 |
} |
| 2394 |
function getOppositeAxis(axis) { |
| 2395 |
return axis === "x" ? "y" : "x"; |
| 2396 |
} |
| 2397 |
function getAxisLength(axis) { |
| 2398 |
return axis === "y" ? "height" : "width"; |
| 2399 |
} |
| 2400 |
function getSideAxis(placement) { |
| 2401 |
const firstChar = placement[0]; |
| 2402 |
return firstChar === "t" || firstChar === "b" ? "y" : "x"; |
| 2403 |
} |
| 2404 |
function getAlignmentAxis(placement) { |
| 2405 |
return getOppositeAxis(getSideAxis(placement)); |
| 2406 |
} |
| 2407 |
function getAlignmentSides(placement, rects, rtl) { |
| 2408 |
if (rtl === void 0) { |
| 2409 |
rtl = false; |
| 2410 |
} |
| 2411 |
const alignment = getAlignment(placement); |
| 2412 |
const alignmentAxis = getAlignmentAxis(placement); |
| 2413 |
const length = getAxisLength(alignmentAxis); |
| 2414 |
let mainAlignmentSide = alignmentAxis === "x" ? alignment === (rtl ? "end" : "start") ? "right" : "left" : alignment === "start" ? "bottom" : "top"; |
| 2415 |
if (rects.reference[length] > rects.floating[length]) { |
| 2416 |
mainAlignmentSide = getOppositePlacement(mainAlignmentSide); |
| 2417 |
} |
| 2418 |
return [mainAlignmentSide, getOppositePlacement(mainAlignmentSide)]; |
| 2419 |
} |
| 2420 |
function getExpandedPlacements(placement) { |
| 2421 |
const oppositePlacement = getOppositePlacement(placement); |
| 2422 |
return [getOppositeAlignmentPlacement(placement), oppositePlacement, getOppositeAlignmentPlacement(oppositePlacement)]; |
| 2423 |
} |
| 2424 |
function getOppositeAlignmentPlacement(placement) { |
| 2425 |
return placement.includes("start") ? placement.replace("start", "end") : placement.replace("end", "start"); |
| 2426 |
} |
| 2427 |
var lrPlacement = ["left", "right"]; |
| 2428 |
var rlPlacement = ["right", "left"]; |
| 2429 |
var tbPlacement = ["top", "bottom"]; |
| 2430 |
var btPlacement = ["bottom", "top"]; |
| 2431 |
function getSideList(side, isStart, rtl) { |
| 2432 |
switch (side) { |
| 2433 |
case "top": |
| 2434 |
case "bottom": |
| 2435 |
if (rtl) return isStart ? rlPlacement : lrPlacement; |
| 2436 |
return isStart ? lrPlacement : rlPlacement; |
| 2437 |
case "left": |
| 2438 |
case "right": |
| 2439 |
return isStart ? tbPlacement : btPlacement; |
| 2440 |
default: |
| 2441 |
return []; |
| 2442 |
} |
| 2443 |
} |
| 2444 |
function getOppositeAxisPlacements(placement, flipAlignment, direction, rtl) { |
| 2445 |
const alignment = getAlignment(placement); |
| 2446 |
let list = getSideList(getSide(placement), direction === "start", rtl); |
| 2447 |
if (alignment) { |
| 2448 |
list = list.map((side) => side + "-" + alignment); |
| 2449 |
if (flipAlignment) { |
| 2450 |
list = list.concat(list.map(getOppositeAlignmentPlacement)); |
| 2451 |
} |
| 2452 |
} |
| 2453 |
return list; |
| 2454 |
} |
| 2455 |
function getOppositePlacement(placement) { |
| 2456 |
const side = getSide(placement); |
| 2457 |
return oppositeSideMap[side] + placement.slice(side.length); |
| 2458 |
} |
| 2459 |
function expandPaddingObject(padding) { |
| 2460 |
return { |
| 2461 |
top: 0, |
| 2462 |
right: 0, |
| 2463 |
bottom: 0, |
| 2464 |
left: 0, |
| 2465 |
...padding |
| 2466 |
}; |
| 2467 |
} |
| 2468 |
function getPaddingObject(padding) { |
| 2469 |
return typeof padding !== "number" ? expandPaddingObject(padding) : { |
| 2470 |
top: padding, |
| 2471 |
right: padding, |
| 2472 |
bottom: padding, |
| 2473 |
left: padding |
| 2474 |
}; |
| 2475 |
} |
| 2476 |
function rectToClientRect(rect) { |
| 2477 |
const { |
| 2478 |
x: x2, |
| 2479 |
y: y2, |
| 2480 |
width, |
| 2481 |
height |
| 2482 |
} = rect; |
| 2483 |
return { |
| 2484 |
width, |
| 2485 |
height, |
| 2486 |
top: y2, |
| 2487 |
left: x2, |
| 2488 |
right: x2 + width, |
| 2489 |
bottom: y2 + height, |
| 2490 |
x: x2, |
| 2491 |
y: y2 |
| 2492 |
}; |
| 2493 |
} |
| 2494 |
|
| 2495 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/composite.js |
| 2496 |
function isHiddenByStyles(styles) { |
| 2497 |
return styles.visibility === "hidden" || styles.visibility === "collapse"; |
| 2498 |
} |
| 2499 |
function isElementVisible(element, styles = element ? getComputedStyle2(element) : null) { |
| 2500 |
if (!element || !element.isConnected || !styles || isHiddenByStyles(styles)) { |
| 2501 |
return false; |
| 2502 |
} |
| 2503 |
if (typeof element.checkVisibility === "function") { |
| 2504 |
return element.checkVisibility(); |
| 2505 |
} |
| 2506 |
return styles.display !== "none" && styles.display !== "contents"; |
| 2507 |
} |
| 2508 |
|
| 2509 |
// node_modules/@base-ui/utils/esm/owner.js |
| 2510 |
function ownerDocument(node) { |
| 2511 |
return node?.ownerDocument || document; |
| 2512 |
} |
| 2513 |
|
| 2514 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/tabbable.js |
| 2515 |
var CANDIDATE_SELECTOR = 'a[href],button,input,select,textarea,summary,details,iframe,object,embed,[tabindex],[contenteditable]:not([contenteditable="false"]),audio[controls],video[controls]'; |
| 2516 |
function getParentElement(element) { |
| 2517 |
const assignedSlot = element.assignedSlot; |
| 2518 |
if (assignedSlot) { |
| 2519 |
return assignedSlot; |
| 2520 |
} |
| 2521 |
if (element.parentElement) { |
| 2522 |
return element.parentElement; |
| 2523 |
} |
| 2524 |
const rootNode = element.getRootNode(); |
| 2525 |
return isShadowRoot(rootNode) ? rootNode.host : null; |
| 2526 |
} |
| 2527 |
function getDetailsSummary(details) { |
| 2528 |
for (const child of Array.from(details.children)) { |
| 2529 |
if (getNodeName(child) === "summary") { |
| 2530 |
return child; |
| 2531 |
} |
| 2532 |
} |
| 2533 |
return null; |
| 2534 |
} |
| 2535 |
function isWithinOpenDetailsSummary(element, details) { |
| 2536 |
const summary = getDetailsSummary(details); |
| 2537 |
return !!summary && (element === summary || contains(summary, element)); |
| 2538 |
} |
| 2539 |
function isFocusableCandidate(element) { |
| 2540 |
const nodeName = element ? getNodeName(element) : ""; |
| 2541 |
return element != null && element.matches(CANDIDATE_SELECTOR) && (nodeName !== "summary" || element.parentElement != null && getNodeName(element.parentElement) === "details" && getDetailsSummary(element.parentElement) === element) && (nodeName !== "details" || getDetailsSummary(element) == null) && (nodeName !== "input" || element.type !== "hidden"); |
| 2542 |
} |
| 2543 |
function isFocusableElement(element) { |
| 2544 |
if (!isFocusableCandidate(element) || !element.isConnected || element.matches(":disabled")) { |
| 2545 |
return false; |
| 2546 |
} |
| 2547 |
for (let current = element; current; current = getParentElement(current)) { |
| 2548 |
const isAncestor = current !== element; |
| 2549 |
const isSlot = getNodeName(current) === "slot"; |
| 2550 |
if (current.hasAttribute("inert")) { |
| 2551 |
return false; |
| 2552 |
} |
| 2553 |
if (isAncestor && getNodeName(current) === "details" && !current.open && !isWithinOpenDetailsSummary(element, current) || current.hasAttribute("hidden") || !isSlot && !isVisibleInTabbableTree(current, isAncestor)) { |
| 2554 |
return false; |
| 2555 |
} |
| 2556 |
} |
| 2557 |
return true; |
| 2558 |
} |
| 2559 |
function isVisibleInTabbableTree(element, isAncestor) { |
| 2560 |
const styles = getComputedStyle2(element); |
| 2561 |
if (!isAncestor) { |
| 2562 |
return isElementVisible(element, styles); |
| 2563 |
} |
| 2564 |
return styles.display !== "none"; |
| 2565 |
} |
| 2566 |
function getTabIndex(element) { |
| 2567 |
const tabIndex = element.tabIndex; |
| 2568 |
if (tabIndex < 0) { |
| 2569 |
const nodeName = getNodeName(element); |
| 2570 |
if (nodeName === "details" || nodeName === "audio" || nodeName === "video" || isHTMLElement(element) && element.isContentEditable) { |
| 2571 |
return 0; |
| 2572 |
} |
| 2573 |
} |
| 2574 |
return tabIndex; |
| 2575 |
} |
| 2576 |
function getNamedRadioInput(element) { |
| 2577 |
if (getNodeName(element) !== "input") { |
| 2578 |
return null; |
| 2579 |
} |
| 2580 |
const input = element; |
| 2581 |
return input.type === "radio" && input.name !== "" ? input : null; |
| 2582 |
} |
| 2583 |
function isTabbableRadio(element, candidates) { |
| 2584 |
const input = getNamedRadioInput(element); |
| 2585 |
if (!input) { |
| 2586 |
return true; |
| 2587 |
} |
| 2588 |
const checkedRadio = candidates.find((candidate) => { |
| 2589 |
const radio = getNamedRadioInput(candidate); |
| 2590 |
return radio?.name === input.name && radio.form === input.form && radio.checked; |
| 2591 |
}); |
| 2592 |
if (checkedRadio) { |
| 2593 |
return checkedRadio === input; |
| 2594 |
} |
| 2595 |
return candidates.find((candidate) => { |
| 2596 |
const radio = getNamedRadioInput(candidate); |
| 2597 |
return radio?.name === input.name && radio.form === input.form; |
| 2598 |
}) === input; |
| 2599 |
} |
| 2600 |
function getComposedChildren(container) { |
| 2601 |
if (isHTMLElement(container) && getNodeName(container) === "slot") { |
| 2602 |
const assignedElements = container.assignedElements({ |
| 2603 |
flatten: true |
| 2604 |
}); |
| 2605 |
if (assignedElements.length > 0) { |
| 2606 |
return assignedElements; |
| 2607 |
} |
| 2608 |
} |
| 2609 |
if (isHTMLElement(container) && container.shadowRoot) { |
| 2610 |
return Array.from(container.shadowRoot.children); |
| 2611 |
} |
| 2612 |
return Array.from(container.children); |
| 2613 |
} |
| 2614 |
function appendCandidates(container, list) { |
| 2615 |
getComposedChildren(container).forEach((child) => { |
| 2616 |
if (isFocusableCandidate(child)) { |
| 2617 |
list.push(child); |
| 2618 |
} |
| 2619 |
appendCandidates(child, list); |
| 2620 |
}); |
| 2621 |
} |
| 2622 |
function appendMatchingElements(container, selector2, list) { |
| 2623 |
getComposedChildren(container).forEach((child) => { |
| 2624 |
if (isHTMLElement(child) && child.matches(selector2)) { |
| 2625 |
list.push(child); |
| 2626 |
} |
| 2627 |
appendMatchingElements(child, selector2, list); |
| 2628 |
}); |
| 2629 |
} |
| 2630 |
function isTabbable(element) { |
| 2631 |
return isFocusableElement(element) && getTabIndex(element) >= 0; |
| 2632 |
} |
| 2633 |
function focusable(container) { |
| 2634 |
const candidates = []; |
| 2635 |
appendCandidates(container, candidates); |
| 2636 |
return candidates.filter(isFocusableElement); |
| 2637 |
} |
| 2638 |
function tabbable(container) { |
| 2639 |
const candidates = focusable(container); |
| 2640 |
return candidates.filter((element) => getTabIndex(element) >= 0 && isTabbableRadio(element, candidates)); |
| 2641 |
} |
| 2642 |
function getTabbableIn(container, dir) { |
| 2643 |
const list = tabbable(container); |
| 2644 |
const len = list.length; |
| 2645 |
if (len === 0) { |
| 2646 |
return void 0; |
| 2647 |
} |
| 2648 |
const active = activeElement(ownerDocument(container)); |
| 2649 |
const index2 = list.indexOf(active); |
| 2650 |
const nextIndex = index2 === -1 ? dir === 1 ? 0 : len - 1 : index2 + dir; |
| 2651 |
return list[nextIndex]; |
| 2652 |
} |
| 2653 |
function getNextTabbable(referenceElement) { |
| 2654 |
return getTabbableIn(ownerDocument(referenceElement).body, 1) || referenceElement; |
| 2655 |
} |
| 2656 |
function getPreviousTabbable(referenceElement) { |
| 2657 |
return getTabbableIn(ownerDocument(referenceElement).body, -1) || referenceElement; |
| 2658 |
} |
| 2659 |
function isOutsideEvent(event, container) { |
| 2660 |
const containerElement = container || event.currentTarget; |
| 2661 |
const relatedTarget = event.relatedTarget; |
| 2662 |
return !relatedTarget || !contains(containerElement, relatedTarget); |
| 2663 |
} |
| 2664 |
function disableFocusInside(container) { |
| 2665 |
const tabbableElements = tabbable(container); |
| 2666 |
tabbableElements.forEach((element) => { |
| 2667 |
element.dataset.tabindex = element.getAttribute("tabindex") || ""; |
| 2668 |
element.setAttribute("tabindex", "-1"); |
| 2669 |
}); |
| 2670 |
} |
| 2671 |
function enableFocusInside(container) { |
| 2672 |
const elements = []; |
| 2673 |
appendMatchingElements(container, "[data-tabindex]", elements); |
| 2674 |
elements.forEach((element) => { |
| 2675 |
const tabindex = element.dataset.tabindex; |
| 2676 |
delete element.dataset.tabindex; |
| 2677 |
if (tabindex) { |
| 2678 |
element.setAttribute("tabindex", tabindex); |
| 2679 |
} else { |
| 2680 |
element.removeAttribute("tabindex"); |
| 2681 |
} |
| 2682 |
}); |
| 2683 |
} |
| 2684 |
|
| 2685 |
// node_modules/@base-ui/react/esm/internals/composite/composite.js |
| 2686 |
var ARROW_UP = "ArrowUp"; |
| 2687 |
var ARROW_DOWN = "ArrowDown"; |
| 2688 |
var ARROW_LEFT = "ArrowLeft"; |
| 2689 |
var ARROW_RIGHT = "ArrowRight"; |
| 2690 |
var HOME = "Home"; |
| 2691 |
var END = "End"; |
| 2692 |
var HORIZONTAL_KEYS = /* @__PURE__ */ new Set([ARROW_LEFT, ARROW_RIGHT]); |
| 2693 |
var VERTICAL_KEYS = /* @__PURE__ */ new Set([ARROW_UP, ARROW_DOWN]); |
| 2694 |
var ARROW_KEYS = /* @__PURE__ */ new Set([...HORIZONTAL_KEYS, ...VERTICAL_KEYS]); |
| 2695 |
var ALL_KEYS = /* @__PURE__ */ new Set([...ARROW_KEYS, HOME, END]); |
| 2696 |
var COMPOSITE_KEYS = /* @__PURE__ */ new Set([ARROW_UP, ARROW_DOWN, ARROW_LEFT, ARROW_RIGHT, HOME, END]); |
| 2697 |
|
| 2698 |
// node_modules/@base-ui/utils/esm/addEventListener.js |
| 2699 |
function addEventListener(target, type, listener, options) { |
| 2700 |
target.addEventListener(type, listener, options); |
| 2701 |
return () => { |
| 2702 |
target.removeEventListener(type, listener, options); |
| 2703 |
}; |
| 2704 |
} |
| 2705 |
|
| 2706 |
// node_modules/@base-ui/react/esm/internals/useOpenChangeComplete.js |
| 2707 |
var React15 = __toESM(require_react(), 1); |
| 2708 |
function useOpenChangeComplete(parameters) { |
| 2709 |
const { |
| 2710 |
enabled = true, |
| 2711 |
open, |
| 2712 |
ref, |
| 2713 |
onComplete: onCompleteParam |
| 2714 |
} = parameters; |
| 2715 |
const onComplete = useStableCallback(onCompleteParam); |
| 2716 |
const runOnceAnimationsFinish = useAnimationsFinished(ref, open, false); |
| 2717 |
React15.useEffect(() => { |
| 2718 |
if (!enabled) { |
| 2719 |
return void 0; |
| 2720 |
} |
| 2721 |
const abortController = new AbortController(); |
| 2722 |
runOnceAnimationsFinish(onComplete, abortController.signal); |
| 2723 |
return () => { |
| 2724 |
abortController.abort(); |
| 2725 |
}; |
| 2726 |
}, [enabled, open, onComplete, runOnceAnimationsFinish]); |
| 2727 |
} |
| 2728 |
|
| 2729 |
// node_modules/@base-ui/react/esm/alert-dialog/index.parts.js |
| 2730 |
var index_parts_exports = {}; |
| 2731 |
__export(index_parts_exports, { |
| 2732 |
Backdrop: () => DialogBackdrop, |
| 2733 |
Close: () => DialogClose, |
| 2734 |
Description: () => DialogDescription, |
| 2735 |
Handle: () => DialogHandle, |
| 2736 |
Popup: () => DialogPopup, |
| 2737 |
Portal: () => DialogPortal, |
| 2738 |
Root: () => AlertDialogRoot, |
| 2739 |
Title: () => DialogTitle, |
| 2740 |
Trigger: () => DialogTrigger, |
| 2741 |
Viewport: () => DialogViewport, |
| 2742 |
createHandle: () => createAlertDialogHandle |
| 2743 |
}); |
| 2744 |
|
| 2745 |
// node_modules/@base-ui/react/esm/alert-dialog/root/AlertDialogRoot.js |
| 2746 |
var React43 = __toESM(require_react(), 1); |
| 2747 |
|
| 2748 |
// node_modules/@base-ui/react/esm/dialog/root/DialogRoot.js |
| 2749 |
var React42 = __toESM(require_react(), 1); |
| 2750 |
|
| 2751 |
// node_modules/@base-ui/utils/esm/useOnFirstRender.js |
| 2752 |
var React16 = __toESM(require_react(), 1); |
| 2753 |
function useOnFirstRender(fn) { |
| 2754 |
const ref = React16.useRef(true); |
| 2755 |
if (ref.current) { |
| 2756 |
ref.current = false; |
| 2757 |
fn(); |
| 2758 |
} |
| 2759 |
} |
| 2760 |
|
| 2761 |
// node_modules/@base-ui/react/esm/dialog/root/useDialogRoot.js |
| 2762 |
var React39 = __toESM(require_react(), 1); |
| 2763 |
|
| 2764 |
// node_modules/@base-ui/utils/esm/useTimeout.js |
| 2765 |
var EMPTY3 = 0; |
| 2766 |
var Timeout = class _Timeout { |
| 2767 |
static create() { |
| 2768 |
return new _Timeout(); |
| 2769 |
} |
| 2770 |
currentId = EMPTY3; |
| 2771 |
/** |
| 2772 |
* Executes `fn` after `delay`, clearing any previously scheduled call. |
| 2773 |
*/ |
| 2774 |
start(delay, fn) { |
| 2775 |
this.clear(); |
| 2776 |
this.currentId = setTimeout(() => { |
| 2777 |
this.currentId = EMPTY3; |
| 2778 |
fn(); |
| 2779 |
}, delay); |
| 2780 |
} |
| 2781 |
isStarted() { |
| 2782 |
return this.currentId !== EMPTY3; |
| 2783 |
} |
| 2784 |
clear = () => { |
| 2785 |
if (this.currentId !== EMPTY3) { |
| 2786 |
clearTimeout(this.currentId); |
| 2787 |
this.currentId = EMPTY3; |
| 2788 |
} |
| 2789 |
}; |
| 2790 |
disposeEffect = () => { |
| 2791 |
return this.clear; |
| 2792 |
}; |
| 2793 |
}; |
| 2794 |
function useTimeout() { |
| 2795 |
const timeout = useRefWithInit(Timeout.create).current; |
| 2796 |
useOnMount(timeout.disposeEffect); |
| 2797 |
return timeout; |
| 2798 |
} |
| 2799 |
|
| 2800 |
// node_modules/@base-ui/utils/esm/useScrollLock.js |
| 2801 |
var originalHtmlStyles = {}; |
| 2802 |
var originalBodyStyles = {}; |
| 2803 |
var originalHtmlScrollBehavior = ""; |
| 2804 |
function hasInsetScrollbars(referenceElement) { |
| 2805 |
if (typeof document === "undefined") { |
| 2806 |
return false; |
| 2807 |
} |
| 2808 |
const doc = ownerDocument(referenceElement); |
| 2809 |
const win = getWindow(doc); |
| 2810 |
return win.innerWidth - doc.documentElement.clientWidth > 0; |
| 2811 |
} |
| 2812 |
function supportsStableScrollbarGutter(referenceElement) { |
| 2813 |
const supported = typeof CSS !== "undefined" && CSS.supports && CSS.supports("scrollbar-gutter", "stable"); |
| 2814 |
if (!supported || typeof document === "undefined") { |
| 2815 |
return false; |
| 2816 |
} |
| 2817 |
const doc = ownerDocument(referenceElement); |
| 2818 |
const html = doc.documentElement; |
| 2819 |
const body = doc.body; |
| 2820 |
const scrollContainer = isOverflowElement(html) ? html : body; |
| 2821 |
const originalScrollContainerOverflowY = scrollContainer.style.overflowY; |
| 2822 |
const originalHtmlStyleGutter = html.style.scrollbarGutter; |
| 2823 |
html.style.scrollbarGutter = "stable"; |
| 2824 |
scrollContainer.style.overflowY = "scroll"; |
| 2825 |
const before = scrollContainer.offsetWidth; |
| 2826 |
scrollContainer.style.overflowY = "hidden"; |
| 2827 |
const after = scrollContainer.offsetWidth; |
| 2828 |
scrollContainer.style.overflowY = originalScrollContainerOverflowY; |
| 2829 |
html.style.scrollbarGutter = originalHtmlStyleGutter; |
| 2830 |
return before === after; |
| 2831 |
} |
| 2832 |
function preventScrollOverlayScrollbars(referenceElement) { |
| 2833 |
const doc = ownerDocument(referenceElement); |
| 2834 |
const html = doc.documentElement; |
| 2835 |
const body = doc.body; |
| 2836 |
const elementToLock = isOverflowElement(html) ? html : body; |
| 2837 |
const originalElementToLockStyles = { |
| 2838 |
overflowY: elementToLock.style.overflowY, |
| 2839 |
overflowX: elementToLock.style.overflowX |
| 2840 |
}; |
| 2841 |
Object.assign(elementToLock.style, { |
| 2842 |
overflowY: "hidden", |
| 2843 |
overflowX: "hidden" |
| 2844 |
}); |
| 2845 |
return () => { |
| 2846 |
Object.assign(elementToLock.style, originalElementToLockStyles); |
| 2847 |
}; |
| 2848 |
} |
| 2849 |
function preventScrollInsetScrollbars(referenceElement) { |
| 2850 |
const doc = ownerDocument(referenceElement); |
| 2851 |
const html = doc.documentElement; |
| 2852 |
const body = doc.body; |
| 2853 |
const win = getWindow(html); |
| 2854 |
let scrollTop = 0; |
| 2855 |
let scrollLeft = 0; |
| 2856 |
let updateGutterOnly = false; |
| 2857 |
const resizeFrame = AnimationFrame.create(); |
| 2858 |
if (isWebKit2 && (win.visualViewport?.scale ?? 1) !== 1) { |
| 2859 |
return () => { |
| 2860 |
}; |
| 2861 |
} |
| 2862 |
function lockScroll() { |
| 2863 |
const htmlStyles = win.getComputedStyle(html); |
| 2864 |
const bodyStyles = win.getComputedStyle(body); |
| 2865 |
const htmlScrollbarGutterValue = htmlStyles.scrollbarGutter || ""; |
| 2866 |
const hasBothEdges = htmlScrollbarGutterValue.includes("both-edges"); |
| 2867 |
const scrollbarGutterValue = hasBothEdges ? "stable both-edges" : "stable"; |
| 2868 |
scrollTop = html.scrollTop; |
| 2869 |
scrollLeft = html.scrollLeft; |
| 2870 |
originalHtmlStyles = { |
| 2871 |
scrollbarGutter: html.style.scrollbarGutter, |
| 2872 |
overflowY: html.style.overflowY, |
| 2873 |
overflowX: html.style.overflowX |
| 2874 |
}; |
| 2875 |
originalHtmlScrollBehavior = html.style.scrollBehavior; |
| 2876 |
originalBodyStyles = { |
| 2877 |
position: body.style.position, |
| 2878 |
height: body.style.height, |
| 2879 |
width: body.style.width, |
| 2880 |
boxSizing: body.style.boxSizing, |
| 2881 |
overflowY: body.style.overflowY, |
| 2882 |
overflowX: body.style.overflowX, |
| 2883 |
scrollBehavior: body.style.scrollBehavior |
| 2884 |
}; |
| 2885 |
const isScrollableY = html.scrollHeight > html.clientHeight; |
| 2886 |
const isScrollableX = html.scrollWidth > html.clientWidth; |
| 2887 |
const hasConstantOverflowY = htmlStyles.overflowY === "scroll" || bodyStyles.overflowY === "scroll"; |
| 2888 |
const hasConstantOverflowX = htmlStyles.overflowX === "scroll" || bodyStyles.overflowX === "scroll"; |
| 2889 |
const scrollbarWidth = Math.max(0, win.innerWidth - body.clientWidth); |
| 2890 |
const scrollbarHeight = Math.max(0, win.innerHeight - body.clientHeight); |
| 2891 |
const marginY = parseFloat(bodyStyles.marginTop) + parseFloat(bodyStyles.marginBottom); |
| 2892 |
const marginX = parseFloat(bodyStyles.marginLeft) + parseFloat(bodyStyles.marginRight); |
| 2893 |
const elementToLock = isOverflowElement(html) ? html : body; |
| 2894 |
updateGutterOnly = supportsStableScrollbarGutter(referenceElement); |
| 2895 |
if (updateGutterOnly) { |
| 2896 |
html.style.scrollbarGutter = scrollbarGutterValue; |
| 2897 |
elementToLock.style.overflowY = "hidden"; |
| 2898 |
elementToLock.style.overflowX = "hidden"; |
| 2899 |
return; |
| 2900 |
} |
| 2901 |
Object.assign(html.style, { |
| 2902 |
scrollbarGutter: scrollbarGutterValue, |
| 2903 |
overflowY: "hidden", |
| 2904 |
overflowX: "hidden" |
| 2905 |
}); |
| 2906 |
if (isScrollableY || hasConstantOverflowY) { |
| 2907 |
html.style.overflowY = "scroll"; |
| 2908 |
} |
| 2909 |
if (isScrollableX || hasConstantOverflowX) { |
| 2910 |
html.style.overflowX = "scroll"; |
| 2911 |
} |
| 2912 |
Object.assign(body.style, { |
| 2913 |
position: "relative", |
| 2914 |
height: marginY || scrollbarHeight ? `calc(100dvh - ${marginY + scrollbarHeight}px)` : "100dvh", |
| 2915 |
width: marginX || scrollbarWidth ? `calc(100vw - ${marginX + scrollbarWidth}px)` : "100vw", |
| 2916 |
boxSizing: "border-box", |
| 2917 |
overflow: "hidden", |
| 2918 |
scrollBehavior: "unset" |
| 2919 |
}); |
| 2920 |
body.scrollTop = scrollTop; |
| 2921 |
body.scrollLeft = scrollLeft; |
| 2922 |
html.setAttribute("data-base-ui-scroll-locked", ""); |
| 2923 |
html.style.scrollBehavior = "unset"; |
| 2924 |
} |
| 2925 |
function cleanup() { |
| 2926 |
Object.assign(html.style, originalHtmlStyles); |
| 2927 |
Object.assign(body.style, originalBodyStyles); |
| 2928 |
if (!updateGutterOnly) { |
| 2929 |
html.scrollTop = scrollTop; |
| 2930 |
html.scrollLeft = scrollLeft; |
| 2931 |
html.removeAttribute("data-base-ui-scroll-locked"); |
| 2932 |
html.style.scrollBehavior = originalHtmlScrollBehavior; |
| 2933 |
} |
| 2934 |
} |
| 2935 |
function handleResize() { |
| 2936 |
cleanup(); |
| 2937 |
resizeFrame.request(lockScroll); |
| 2938 |
} |
| 2939 |
lockScroll(); |
| 2940 |
const unsubscribeResize = addEventListener(win, "resize", handleResize); |
| 2941 |
return () => { |
| 2942 |
resizeFrame.cancel(); |
| 2943 |
cleanup(); |
| 2944 |
if (typeof win.removeEventListener === "function") { |
| 2945 |
unsubscribeResize(); |
| 2946 |
} |
| 2947 |
}; |
| 2948 |
} |
| 2949 |
var ScrollLocker = class { |
| 2950 |
lockCount = 0; |
| 2951 |
restore = null; |
| 2952 |
timeoutLock = Timeout.create(); |
| 2953 |
timeoutUnlock = Timeout.create(); |
| 2954 |
acquire(referenceElement) { |
| 2955 |
this.lockCount += 1; |
| 2956 |
if (this.lockCount === 1 && this.restore === null) { |
| 2957 |
this.timeoutLock.start(0, () => this.lock(referenceElement)); |
| 2958 |
} |
| 2959 |
return this.release; |
| 2960 |
} |
| 2961 |
release = () => { |
| 2962 |
this.lockCount -= 1; |
| 2963 |
if (this.lockCount === 0 && this.restore) { |
| 2964 |
this.timeoutUnlock.start(0, this.unlock); |
| 2965 |
} |
| 2966 |
}; |
| 2967 |
unlock = () => { |
| 2968 |
if (this.lockCount === 0 && this.restore) { |
| 2969 |
this.restore?.(); |
| 2970 |
this.restore = null; |
| 2971 |
} |
| 2972 |
}; |
| 2973 |
lock(referenceElement) { |
| 2974 |
if (this.lockCount === 0 || this.restore !== null) { |
| 2975 |
return; |
| 2976 |
} |
| 2977 |
const doc = ownerDocument(referenceElement); |
| 2978 |
const html = doc.documentElement; |
| 2979 |
const htmlOverflowY = getWindow(html).getComputedStyle(html).overflowY; |
| 2980 |
if (htmlOverflowY === "hidden" || htmlOverflowY === "clip") { |
| 2981 |
this.restore = NOOP; |
| 2982 |
return; |
| 2983 |
} |
| 2984 |
const hasOverlayScrollbars = isIOS || !hasInsetScrollbars(referenceElement); |
| 2985 |
this.restore = hasOverlayScrollbars ? preventScrollOverlayScrollbars(referenceElement) : preventScrollInsetScrollbars(referenceElement); |
| 2986 |
} |
| 2987 |
}; |
| 2988 |
var SCROLL_LOCKER = new ScrollLocker(); |
| 2989 |
function useScrollLock(enabled = true, referenceElement = null) { |
| 2990 |
useIsoLayoutEffect(() => { |
| 2991 |
if (!enabled) { |
| 2992 |
return void 0; |
| 2993 |
} |
| 2994 |
return SCROLL_LOCKER.acquire(referenceElement); |
| 2995 |
}, [enabled, referenceElement]); |
| 2996 |
} |
| 2997 |
|
| 2998 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingDelayGroup.js |
| 2999 |
var React17 = __toESM(require_react(), 1); |
| 3000 |
|
| 3001 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useHoverShared.js |
| 3002 |
function resolveValue(value, pointerType) { |
| 3003 |
if (pointerType != null && !isMouseLikePointerType(pointerType)) { |
| 3004 |
return 0; |
| 3005 |
} |
| 3006 |
if (typeof value === "function") { |
| 3007 |
return value(); |
| 3008 |
} |
| 3009 |
return value; |
| 3010 |
} |
| 3011 |
function getDelay(value, prop, pointerType) { |
| 3012 |
const result = resolveValue(value, pointerType); |
| 3013 |
if (typeof result === "number") { |
| 3014 |
return result; |
| 3015 |
} |
| 3016 |
return result?.[prop]; |
| 3017 |
} |
| 3018 |
function getRestMs(value) { |
| 3019 |
if (typeof value === "function") { |
| 3020 |
return value(); |
| 3021 |
} |
| 3022 |
return value; |
| 3023 |
} |
| 3024 |
function isClickLikeOpenEvent(openEventType, interactedInside) { |
| 3025 |
return interactedInside || openEventType === "click" || openEventType === "mousedown"; |
| 3026 |
} |
| 3027 |
|
| 3028 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingDelayGroup.js |
| 3029 |
var import_jsx_runtime = __toESM(require_jsx_runtime(), 1); |
| 3030 |
var FloatingDelayGroupContext = /* @__PURE__ */ React17.createContext({ |
| 3031 |
hasProvider: false, |
| 3032 |
timeoutMs: 0, |
| 3033 |
delayRef: { |
| 3034 |
current: 0 |
| 3035 |
}, |
| 3036 |
initialDelayRef: { |
| 3037 |
current: 0 |
| 3038 |
}, |
| 3039 |
timeout: new Timeout(), |
| 3040 |
currentIdRef: { |
| 3041 |
current: null |
| 3042 |
}, |
| 3043 |
currentContextRef: { |
| 3044 |
current: null |
| 3045 |
} |
| 3046 |
}); |
| 3047 |
if (true) FloatingDelayGroupContext.displayName = "FloatingDelayGroupContext"; |
| 3048 |
function FloatingDelayGroup(props) { |
| 3049 |
const { |
| 3050 |
children, |
| 3051 |
delay, |
| 3052 |
timeoutMs = 0 |
| 3053 |
} = props; |
| 3054 |
const delayRef = React17.useRef(delay); |
| 3055 |
const initialDelayRef = React17.useRef(delay); |
| 3056 |
const currentIdRef = React17.useRef(null); |
| 3057 |
const currentContextRef = React17.useRef(null); |
| 3058 |
const timeout = useTimeout(); |
| 3059 |
return /* @__PURE__ */ (0, import_jsx_runtime.jsx)(FloatingDelayGroupContext.Provider, { |
| 3060 |
value: React17.useMemo(() => ({ |
| 3061 |
hasProvider: true, |
| 3062 |
delayRef, |
| 3063 |
initialDelayRef, |
| 3064 |
currentIdRef, |
| 3065 |
timeoutMs, |
| 3066 |
currentContextRef, |
| 3067 |
timeout |
| 3068 |
}), [timeoutMs, timeout]), |
| 3069 |
children |
| 3070 |
}); |
| 3071 |
} |
| 3072 |
function useDelayGroup(context, options = { |
| 3073 |
open: false |
| 3074 |
}) { |
| 3075 |
const store = "rootStore" in context ? context.rootStore : context; |
| 3076 |
const floatingId = store.useState("floatingId"); |
| 3077 |
const { |
| 3078 |
open |
| 3079 |
} = options; |
| 3080 |
const groupContext = React17.useContext(FloatingDelayGroupContext); |
| 3081 |
const { |
| 3082 |
currentIdRef, |
| 3083 |
delayRef, |
| 3084 |
timeoutMs, |
| 3085 |
initialDelayRef, |
| 3086 |
currentContextRef, |
| 3087 |
hasProvider, |
| 3088 |
timeout |
| 3089 |
} = groupContext; |
| 3090 |
const [isInstantPhase, setIsInstantPhase] = React17.useState(false); |
| 3091 |
useIsoLayoutEffect(() => { |
| 3092 |
function unset() { |
| 3093 |
setIsInstantPhase(false); |
| 3094 |
currentContextRef.current?.setIsInstantPhase(false); |
| 3095 |
currentIdRef.current = null; |
| 3096 |
currentContextRef.current = null; |
| 3097 |
delayRef.current = initialDelayRef.current; |
| 3098 |
} |
| 3099 |
if (!currentIdRef.current) { |
| 3100 |
return void 0; |
| 3101 |
} |
| 3102 |
if (!open && currentIdRef.current === floatingId) { |
| 3103 |
setIsInstantPhase(false); |
| 3104 |
if (timeoutMs) { |
| 3105 |
const closingId = floatingId; |
| 3106 |
timeout.start(timeoutMs, () => { |
| 3107 |
if (store.select("open") || currentIdRef.current && currentIdRef.current !== closingId) { |
| 3108 |
return; |
| 3109 |
} |
| 3110 |
unset(); |
| 3111 |
}); |
| 3112 |
return () => { |
| 3113 |
timeout.clear(); |
| 3114 |
}; |
| 3115 |
} |
| 3116 |
unset(); |
| 3117 |
} |
| 3118 |
return void 0; |
| 3119 |
}, [open, floatingId, currentIdRef, delayRef, timeoutMs, initialDelayRef, currentContextRef, timeout, store]); |
| 3120 |
useIsoLayoutEffect(() => { |
| 3121 |
if (!open) { |
| 3122 |
return; |
| 3123 |
} |
| 3124 |
const prevContext = currentContextRef.current; |
| 3125 |
const prevId = currentIdRef.current; |
| 3126 |
timeout.clear(); |
| 3127 |
currentContextRef.current = { |
| 3128 |
onOpenChange: store.setOpen, |
| 3129 |
setIsInstantPhase |
| 3130 |
}; |
| 3131 |
currentIdRef.current = floatingId; |
| 3132 |
delayRef.current = { |
| 3133 |
open: 0, |
| 3134 |
close: getDelay(initialDelayRef.current, "close") |
| 3135 |
}; |
| 3136 |
if (prevId !== null && prevId !== floatingId) { |
| 3137 |
setIsInstantPhase(true); |
| 3138 |
prevContext?.setIsInstantPhase(true); |
| 3139 |
prevContext?.onOpenChange(false, createChangeEventDetails(reason_parts_exports.none)); |
| 3140 |
} else { |
| 3141 |
setIsInstantPhase(false); |
| 3142 |
prevContext?.setIsInstantPhase(false); |
| 3143 |
} |
| 3144 |
}, [open, floatingId, store, currentIdRef, delayRef, timeoutMs, initialDelayRef, currentContextRef, timeout]); |
| 3145 |
useIsoLayoutEffect(() => { |
| 3146 |
return () => { |
| 3147 |
currentContextRef.current = null; |
| 3148 |
}; |
| 3149 |
}, [currentContextRef]); |
| 3150 |
return React17.useMemo(() => ({ |
| 3151 |
hasProvider, |
| 3152 |
delayRef, |
| 3153 |
isInstantPhase |
| 3154 |
}), [hasProvider, delayRef, isInstantPhase]); |
| 3155 |
} |
| 3156 |
|
| 3157 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingFocusManager.js |
| 3158 |
var React21 = __toESM(require_react(), 1); |
| 3159 |
|
| 3160 |
// node_modules/@base-ui/utils/esm/mergeCleanups.js |
| 3161 |
function mergeCleanups(...cleanups) { |
| 3162 |
return () => { |
| 3163 |
for (let i2 = 0; i2 < cleanups.length; i2 += 1) { |
| 3164 |
const cleanup = cleanups[i2]; |
| 3165 |
if (cleanup) { |
| 3166 |
cleanup(); |
| 3167 |
} |
| 3168 |
} |
| 3169 |
}; |
| 3170 |
} |
| 3171 |
|
| 3172 |
// node_modules/@base-ui/utils/esm/useValueAsRef.js |
| 3173 |
function useValueAsRef(value) { |
| 3174 |
const latest = useRefWithInit(createLatestRef, value).current; |
| 3175 |
latest.next = value; |
| 3176 |
useIsoLayoutEffect(latest.effect); |
| 3177 |
return latest; |
| 3178 |
} |
| 3179 |
function createLatestRef(value) { |
| 3180 |
const latest = { |
| 3181 |
current: value, |
| 3182 |
next: value, |
| 3183 |
effect: () => { |
| 3184 |
latest.current = latest.next; |
| 3185 |
} |
| 3186 |
}; |
| 3187 |
return latest; |
| 3188 |
} |
| 3189 |
|
| 3190 |
// node_modules/@base-ui/react/esm/utils/FocusGuard.js |
| 3191 |
var React18 = __toESM(require_react(), 1); |
| 3192 |
|
| 3193 |
// node_modules/@base-ui/utils/esm/visuallyHidden.js |
| 3194 |
var visuallyHiddenBase = { |
| 3195 |
clipPath: "inset(50%)", |
| 3196 |
overflow: "hidden", |
| 3197 |
whiteSpace: "nowrap", |
| 3198 |
border: 0, |
| 3199 |
padding: 0, |
| 3200 |
width: 1, |
| 3201 |
height: 1, |
| 3202 |
margin: -1 |
| 3203 |
}; |
| 3204 |
var visuallyHidden = { |
| 3205 |
...visuallyHiddenBase, |
| 3206 |
position: "fixed", |
| 3207 |
top: 0, |
| 3208 |
left: 0 |
| 3209 |
}; |
| 3210 |
var visuallyHiddenInput = { |
| 3211 |
...visuallyHiddenBase, |
| 3212 |
position: "absolute" |
| 3213 |
}; |
| 3214 |
|
| 3215 |
// node_modules/@base-ui/react/esm/utils/FocusGuard.js |
| 3216 |
var import_jsx_runtime2 = __toESM(require_jsx_runtime(), 1); |
| 3217 |
var FocusGuard = /* @__PURE__ */ React18.forwardRef(function FocusGuard2(props, ref) { |
| 3218 |
const [role, setRole] = React18.useState(); |
| 3219 |
useIsoLayoutEffect(() => { |
| 3220 |
if (isSafari) { |
| 3221 |
setRole("button"); |
| 3222 |
} |
| 3223 |
}, []); |
| 3224 |
const restProps = { |
| 3225 |
tabIndex: 0, |
| 3226 |
// Role is only for VoiceOver |
| 3227 |
role |
| 3228 |
}; |
| 3229 |
return /* @__PURE__ */ (0, import_jsx_runtime2.jsx)("span", { |
| 3230 |
...props, |
| 3231 |
ref, |
| 3232 |
style: visuallyHidden, |
| 3233 |
"aria-hidden": role ? void 0 : true, |
| 3234 |
...restProps, |
| 3235 |
"data-base-ui-focus-guard": "" |
| 3236 |
}); |
| 3237 |
}); |
| 3238 |
if (true) FocusGuard.displayName = "FocusGuard"; |
| 3239 |
|
| 3240 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/createAttribute.js |
| 3241 |
function createAttribute(name) { |
| 3242 |
return `data-base-ui-${name}`; |
| 3243 |
} |
| 3244 |
|
| 3245 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/enqueueFocus.js |
| 3246 |
var rafId = 0; |
| 3247 |
function enqueueFocus(el, options = {}) { |
| 3248 |
const { |
| 3249 |
preventScroll = false, |
| 3250 |
cancelPrevious = true, |
| 3251 |
sync: sync2 = false |
| 3252 |
} = options; |
| 3253 |
if (cancelPrevious) { |
| 3254 |
cancelAnimationFrame(rafId); |
| 3255 |
} |
| 3256 |
const exec = () => el?.focus({ |
| 3257 |
preventScroll |
| 3258 |
}); |
| 3259 |
if (sync2) { |
| 3260 |
exec(); |
| 3261 |
return NOOP; |
| 3262 |
} |
| 3263 |
const currentRafId = requestAnimationFrame(exec); |
| 3264 |
rafId = currentRafId; |
| 3265 |
return () => { |
| 3266 |
if (rafId === currentRafId) { |
| 3267 |
cancelAnimationFrame(currentRafId); |
| 3268 |
rafId = 0; |
| 3269 |
} |
| 3270 |
}; |
| 3271 |
} |
| 3272 |
|
| 3273 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/markOthers.js |
| 3274 |
var counters = { |
| 3275 |
inert: /* @__PURE__ */ new WeakMap(), |
| 3276 |
"aria-hidden": /* @__PURE__ */ new WeakMap() |
| 3277 |
}; |
| 3278 |
var markerName = "data-base-ui-inert"; |
| 3279 |
var uncontrolledElementsSets = { |
| 3280 |
inert: /* @__PURE__ */ new WeakSet(), |
| 3281 |
"aria-hidden": /* @__PURE__ */ new WeakSet() |
| 3282 |
}; |
| 3283 |
var markerCounterMap = /* @__PURE__ */ new WeakMap(); |
| 3284 |
var lockCount = 0; |
| 3285 |
function getUncontrolledElementsSet(controlAttribute) { |
| 3286 |
return uncontrolledElementsSets[controlAttribute]; |
| 3287 |
} |
| 3288 |
function unwrapHost(node) { |
| 3289 |
if (!node) { |
| 3290 |
return null; |
| 3291 |
} |
| 3292 |
return isShadowRoot(node) ? node.host : unwrapHost(node.parentNode); |
| 3293 |
} |
| 3294 |
var correctElements = (parent, targets) => targets.map((target) => { |
| 3295 |
if (parent.contains(target)) { |
| 3296 |
return target; |
| 3297 |
} |
| 3298 |
const correctedTarget = unwrapHost(target); |
| 3299 |
if (parent.contains(correctedTarget)) { |
| 3300 |
return correctedTarget; |
| 3301 |
} |
| 3302 |
return null; |
| 3303 |
}).filter((x2) => x2 != null); |
| 3304 |
var buildKeepSet = (targets) => { |
| 3305 |
const keep = /* @__PURE__ */ new Set(); |
| 3306 |
targets.forEach((target) => { |
| 3307 |
let node = target; |
| 3308 |
while (node && !keep.has(node)) { |
| 3309 |
keep.add(node); |
| 3310 |
node = node.parentNode; |
| 3311 |
} |
| 3312 |
}); |
| 3313 |
return keep; |
| 3314 |
}; |
| 3315 |
var collectOutsideElements = (root, keepElements, stopElements) => { |
| 3316 |
const outside = []; |
| 3317 |
const walk = (parent) => { |
| 3318 |
if (!parent || stopElements.has(parent)) { |
| 3319 |
return; |
| 3320 |
} |
| 3321 |
Array.from(parent.children).forEach((node) => { |
| 3322 |
if (getNodeName(node) === "script") { |
| 3323 |
return; |
| 3324 |
} |
| 3325 |
if (keepElements.has(node)) { |
| 3326 |
walk(node); |
| 3327 |
} else { |
| 3328 |
outside.push(node); |
| 3329 |
} |
| 3330 |
}); |
| 3331 |
}; |
| 3332 |
walk(root); |
| 3333 |
return outside; |
| 3334 |
}; |
| 3335 |
function applyAttributeToOthers(uncorrectedAvoidElements, body, ariaHidden, inert, { |
| 3336 |
mark = true, |
| 3337 |
markerIgnoreElements = [] |
| 3338 |
}) { |
| 3339 |
const controlAttribute = inert ? "inert" : ariaHidden ? "aria-hidden" : null; |
| 3340 |
let counterMap = null; |
| 3341 |
let uncontrolledElementsSet = null; |
| 3342 |
const avoidElements = correctElements(body, uncorrectedAvoidElements); |
| 3343 |
const markerIgnoreTargets = mark ? correctElements(body, markerIgnoreElements) : []; |
| 3344 |
const markerIgnoreSet = new Set(markerIgnoreTargets); |
| 3345 |
const markerTargets = mark ? collectOutsideElements(body, buildKeepSet(avoidElements), new Set(avoidElements)).filter((target) => !markerIgnoreSet.has(target)) : []; |
| 3346 |
const hiddenElements = []; |
| 3347 |
const markedElements = []; |
| 3348 |
if (controlAttribute) { |
| 3349 |
const map = counters[controlAttribute]; |
| 3350 |
const currentUncontrolledElementsSet = getUncontrolledElementsSet(controlAttribute); |
| 3351 |
uncontrolledElementsSet = currentUncontrolledElementsSet; |
| 3352 |
counterMap = map; |
| 3353 |
const ariaLiveElements = correctElements(body, Array.from(body.querySelectorAll("[aria-live]"))); |
| 3354 |
const controlElements = avoidElements.concat(ariaLiveElements); |
| 3355 |
const controlTargets = collectOutsideElements(body, buildKeepSet(controlElements), new Set(controlElements)); |
| 3356 |
controlTargets.forEach((node) => { |
| 3357 |
const attr2 = node.getAttribute(controlAttribute); |
| 3358 |
const alreadyHidden = attr2 !== null && attr2 !== "false"; |
| 3359 |
const counterValue = (map.get(node) || 0) + 1; |
| 3360 |
map.set(node, counterValue); |
| 3361 |
hiddenElements.push(node); |
| 3362 |
if (counterValue === 1 && alreadyHidden) { |
| 3363 |
currentUncontrolledElementsSet.add(node); |
| 3364 |
} |
| 3365 |
if (!alreadyHidden) { |
| 3366 |
node.setAttribute(controlAttribute, controlAttribute === "inert" ? "" : "true"); |
| 3367 |
} |
| 3368 |
}); |
| 3369 |
} |
| 3370 |
if (mark) { |
| 3371 |
markerTargets.forEach((node) => { |
| 3372 |
const markerValue = (markerCounterMap.get(node) || 0) + 1; |
| 3373 |
markerCounterMap.set(node, markerValue); |
| 3374 |
markedElements.push(node); |
| 3375 |
if (markerValue === 1) { |
| 3376 |
node.setAttribute(markerName, ""); |
| 3377 |
} |
| 3378 |
}); |
| 3379 |
} |
| 3380 |
lockCount += 1; |
| 3381 |
return () => { |
| 3382 |
if (counterMap) { |
| 3383 |
hiddenElements.forEach((element) => { |
| 3384 |
const currentCounterValue = counterMap.get(element) || 0; |
| 3385 |
const counterValue = currentCounterValue - 1; |
| 3386 |
counterMap.set(element, counterValue); |
| 3387 |
if (!counterValue) { |
| 3388 |
if (!uncontrolledElementsSet?.has(element) && controlAttribute) { |
| 3389 |
element.removeAttribute(controlAttribute); |
| 3390 |
} |
| 3391 |
uncontrolledElementsSet?.delete(element); |
| 3392 |
} |
| 3393 |
}); |
| 3394 |
} |
| 3395 |
if (mark) { |
| 3396 |
markedElements.forEach((element) => { |
| 3397 |
const markerValue = (markerCounterMap.get(element) || 0) - 1; |
| 3398 |
markerCounterMap.set(element, markerValue); |
| 3399 |
if (!markerValue) { |
| 3400 |
element.removeAttribute(markerName); |
| 3401 |
} |
| 3402 |
}); |
| 3403 |
} |
| 3404 |
lockCount -= 1; |
| 3405 |
if (!lockCount) { |
| 3406 |
counters.inert = /* @__PURE__ */ new WeakMap(); |
| 3407 |
counters["aria-hidden"] = /* @__PURE__ */ new WeakMap(); |
| 3408 |
uncontrolledElementsSets.inert = /* @__PURE__ */ new WeakSet(); |
| 3409 |
uncontrolledElementsSets["aria-hidden"] = /* @__PURE__ */ new WeakSet(); |
| 3410 |
markerCounterMap = /* @__PURE__ */ new WeakMap(); |
| 3411 |
} |
| 3412 |
}; |
| 3413 |
} |
| 3414 |
function markOthers(avoidElements, options = {}) { |
| 3415 |
const { |
| 3416 |
ariaHidden = false, |
| 3417 |
inert = false, |
| 3418 |
mark = true, |
| 3419 |
markerIgnoreElements = [] |
| 3420 |
} = options; |
| 3421 |
const body = ownerDocument(avoidElements[0]).body; |
| 3422 |
return applyAttributeToOthers(avoidElements, body, ariaHidden, inert, { |
| 3423 |
mark, |
| 3424 |
markerIgnoreElements |
| 3425 |
}); |
| 3426 |
} |
| 3427 |
|
| 3428 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingPortal.js |
| 3429 |
var React19 = __toESM(require_react(), 1); |
| 3430 |
var ReactDOM2 = __toESM(require_react_dom(), 1); |
| 3431 |
|
| 3432 |
// node_modules/@base-ui/react/esm/internals/constants.js |
| 3433 |
var DISABLED_TRANSITIONS_STYLE = { |
| 3434 |
style: { |
| 3435 |
transition: "none" |
| 3436 |
} |
| 3437 |
}; |
| 3438 |
var CLICK_TRIGGER_IDENTIFIER = "data-base-ui-click-trigger"; |
| 3439 |
var BASE_UI_SWIPE_IGNORE_ATTRIBUTE = "data-base-ui-swipe-ignore"; |
| 3440 |
var LEGACY_SWIPE_IGNORE_ATTRIBUTE = "data-swipe-ignore"; |
| 3441 |
var BASE_UI_SWIPE_IGNORE_SELECTOR = `[${BASE_UI_SWIPE_IGNORE_ATTRIBUTE}]`; |
| 3442 |
var LEGACY_SWIPE_IGNORE_SELECTOR = `[${LEGACY_SWIPE_IGNORE_ATTRIBUTE}]`; |
| 3443 |
var POPUP_COLLISION_AVOIDANCE = { |
| 3444 |
fallbackAxisSide: "end" |
| 3445 |
}; |
| 3446 |
var ownerVisuallyHidden = { |
| 3447 |
clipPath: "inset(50%)", |
| 3448 |
position: "fixed", |
| 3449 |
top: 0, |
| 3450 |
left: 0 |
| 3451 |
}; |
| 3452 |
|
| 3453 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingPortal.js |
| 3454 |
var import_jsx_runtime3 = __toESM(require_jsx_runtime(), 1); |
| 3455 |
var PortalContext = /* @__PURE__ */ React19.createContext(null); |
| 3456 |
if (true) PortalContext.displayName = "PortalContext"; |
| 3457 |
var usePortalContext = () => React19.useContext(PortalContext); |
| 3458 |
var attr = createAttribute("portal"); |
| 3459 |
function useFloatingPortalNode(props = {}) { |
| 3460 |
const { |
| 3461 |
ref, |
| 3462 |
container: containerProp, |
| 3463 |
componentProps = EMPTY_OBJECT, |
| 3464 |
elementProps |
| 3465 |
} = props; |
| 3466 |
const uniqueId = useId(); |
| 3467 |
const portalContext = usePortalContext(); |
| 3468 |
const parentPortalNode = portalContext?.portalNode; |
| 3469 |
const [containerElement, setContainerElement] = React19.useState(null); |
| 3470 |
const [portalNode, setPortalNode] = React19.useState(null); |
| 3471 |
const setPortalNodeRef = useStableCallback((node) => { |
| 3472 |
if (node !== null) { |
| 3473 |
setPortalNode(node); |
| 3474 |
} |
| 3475 |
}); |
| 3476 |
const containerRef = React19.useRef(null); |
| 3477 |
useIsoLayoutEffect(() => { |
| 3478 |
if (containerProp === null) { |
| 3479 |
if (containerRef.current) { |
| 3480 |
containerRef.current = null; |
| 3481 |
setPortalNode(null); |
| 3482 |
setContainerElement(null); |
| 3483 |
} |
| 3484 |
return; |
| 3485 |
} |
| 3486 |
if (uniqueId == null) { |
| 3487 |
return; |
| 3488 |
} |
| 3489 |
const resolvedContainer = (containerProp && (isNode(containerProp) ? containerProp : containerProp.current)) ?? parentPortalNode ?? document.body; |
| 3490 |
if (resolvedContainer == null) { |
| 3491 |
if (containerRef.current) { |
| 3492 |
containerRef.current = null; |
| 3493 |
setPortalNode(null); |
| 3494 |
setContainerElement(null); |
| 3495 |
} |
| 3496 |
return; |
| 3497 |
} |
| 3498 |
if (containerRef.current !== resolvedContainer) { |
| 3499 |
containerRef.current = resolvedContainer; |
| 3500 |
setPortalNode(null); |
| 3501 |
setContainerElement(resolvedContainer); |
| 3502 |
} |
| 3503 |
}, [containerProp, parentPortalNode, uniqueId]); |
| 3504 |
const portalElement = useRenderElement("div", componentProps, { |
| 3505 |
ref: [ref, setPortalNodeRef], |
| 3506 |
props: [{ |
| 3507 |
id: uniqueId, |
| 3508 |
[attr]: "" |
| 3509 |
}, elementProps] |
| 3510 |
}); |
| 3511 |
const portalSubtree = containerElement && portalElement ? /* @__PURE__ */ ReactDOM2.createPortal(portalElement, containerElement) : null; |
| 3512 |
return { |
| 3513 |
portalNode, |
| 3514 |
portalSubtree |
| 3515 |
}; |
| 3516 |
} |
| 3517 |
var FloatingPortal = /* @__PURE__ */ React19.forwardRef(function FloatingPortal2(componentProps, forwardedRef) { |
| 3518 |
const { |
| 3519 |
children, |
| 3520 |
container, |
| 3521 |
className, |
| 3522 |
render: render4, |
| 3523 |
renderGuards, |
| 3524 |
style, |
| 3525 |
...elementProps |
| 3526 |
} = componentProps; |
| 3527 |
const { |
| 3528 |
portalNode, |
| 3529 |
portalSubtree |
| 3530 |
} = useFloatingPortalNode({ |
| 3531 |
container, |
| 3532 |
ref: forwardedRef, |
| 3533 |
componentProps, |
| 3534 |
elementProps |
| 3535 |
}); |
| 3536 |
const beforeOutsideRef = React19.useRef(null); |
| 3537 |
const afterOutsideRef = React19.useRef(null); |
| 3538 |
const beforeInsideRef = React19.useRef(null); |
| 3539 |
const afterInsideRef = React19.useRef(null); |
| 3540 |
const [focusManagerState, setFocusManagerState] = React19.useState(null); |
| 3541 |
const focusInsideDisabledRef = React19.useRef(false); |
| 3542 |
const modal = focusManagerState?.modal; |
| 3543 |
const open = focusManagerState?.open; |
| 3544 |
const shouldRenderGuards = typeof renderGuards === "boolean" ? renderGuards : !!focusManagerState && !focusManagerState.modal && focusManagerState.open && !!portalNode; |
| 3545 |
React19.useEffect(() => { |
| 3546 |
if (!portalNode || modal) { |
| 3547 |
return void 0; |
| 3548 |
} |
| 3549 |
function onFocus(event) { |
| 3550 |
if (portalNode && event.relatedTarget && isOutsideEvent(event)) { |
| 3551 |
if (event.type === "focusin") { |
| 3552 |
if (focusInsideDisabledRef.current) { |
| 3553 |
enableFocusInside(portalNode); |
| 3554 |
focusInsideDisabledRef.current = false; |
| 3555 |
} |
| 3556 |
} else { |
| 3557 |
disableFocusInside(portalNode); |
| 3558 |
focusInsideDisabledRef.current = true; |
| 3559 |
} |
| 3560 |
} |
| 3561 |
} |
| 3562 |
return mergeCleanups(addEventListener(portalNode, "focusin", onFocus, true), addEventListener(portalNode, "focusout", onFocus, true)); |
| 3563 |
}, [portalNode, modal]); |
| 3564 |
React19.useEffect(() => { |
| 3565 |
if (!portalNode || open !== false) { |
| 3566 |
return; |
| 3567 |
} |
| 3568 |
enableFocusInside(portalNode); |
| 3569 |
focusInsideDisabledRef.current = false; |
| 3570 |
}, [open, portalNode]); |
| 3571 |
const portalContextValue = React19.useMemo(() => ({ |
| 3572 |
beforeOutsideRef, |
| 3573 |
afterOutsideRef, |
| 3574 |
beforeInsideRef, |
| 3575 |
afterInsideRef, |
| 3576 |
portalNode, |
| 3577 |
setFocusManagerState |
| 3578 |
}), [portalNode]); |
| 3579 |
return /* @__PURE__ */ (0, import_jsx_runtime3.jsxs)(React19.Fragment, { |
| 3580 |
children: [portalSubtree, /* @__PURE__ */ (0, import_jsx_runtime3.jsxs)(PortalContext.Provider, { |
| 3581 |
value: portalContextValue, |
| 3582 |
children: [shouldRenderGuards && portalNode && /* @__PURE__ */ (0, import_jsx_runtime3.jsx)(FocusGuard, { |
| 3583 |
"data-type": "outside", |
| 3584 |
ref: beforeOutsideRef, |
| 3585 |
onFocus: (event) => { |
| 3586 |
if (isOutsideEvent(event, portalNode)) { |
| 3587 |
beforeInsideRef.current?.focus(); |
| 3588 |
} else { |
| 3589 |
const domReference = focusManagerState ? focusManagerState.domReference : null; |
| 3590 |
const prevTabbable = getPreviousTabbable(domReference); |
| 3591 |
prevTabbable?.focus(); |
| 3592 |
} |
| 3593 |
} |
| 3594 |
}), shouldRenderGuards && portalNode && /* @__PURE__ */ (0, import_jsx_runtime3.jsx)("span", { |
| 3595 |
"aria-owns": portalNode.id, |
| 3596 |
style: ownerVisuallyHidden |
| 3597 |
}), portalNode && /* @__PURE__ */ ReactDOM2.createPortal(children, portalNode), shouldRenderGuards && portalNode && /* @__PURE__ */ (0, import_jsx_runtime3.jsx)(FocusGuard, { |
| 3598 |
"data-type": "outside", |
| 3599 |
ref: afterOutsideRef, |
| 3600 |
onFocus: (event) => { |
| 3601 |
if (isOutsideEvent(event, portalNode)) { |
| 3602 |
afterInsideRef.current?.focus(); |
| 3603 |
} else { |
| 3604 |
const domReference = focusManagerState ? focusManagerState.domReference : null; |
| 3605 |
const nextTabbable = getNextTabbable(domReference); |
| 3606 |
nextTabbable?.focus(); |
| 3607 |
if (focusManagerState?.closeOnFocusOut) { |
| 3608 |
focusManagerState?.onOpenChange(false, createChangeEventDetails(reason_parts_exports.focusOut, event.nativeEvent)); |
| 3609 |
} |
| 3610 |
} |
| 3611 |
} |
| 3612 |
})] |
| 3613 |
})] |
| 3614 |
}); |
| 3615 |
}); |
| 3616 |
if (true) FloatingPortal.displayName = "FloatingPortal"; |
| 3617 |
|
| 3618 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingTree.js |
| 3619 |
var React20 = __toESM(require_react(), 1); |
| 3620 |
|
| 3621 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/createEventEmitter.js |
| 3622 |
function createEventEmitter() { |
| 3623 |
const map = /* @__PURE__ */ new Map(); |
| 3624 |
return { |
| 3625 |
emit(event, data) { |
| 3626 |
map.get(event)?.forEach((listener) => listener(data)); |
| 3627 |
}, |
| 3628 |
on(event, listener) { |
| 3629 |
if (!map.has(event)) { |
| 3630 |
map.set(event, /* @__PURE__ */ new Set()); |
| 3631 |
} |
| 3632 |
map.get(event).add(listener); |
| 3633 |
}, |
| 3634 |
off(event, listener) { |
| 3635 |
map.get(event)?.delete(listener); |
| 3636 |
} |
| 3637 |
}; |
| 3638 |
} |
| 3639 |
|
| 3640 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingTree.js |
| 3641 |
var import_jsx_runtime4 = __toESM(require_jsx_runtime(), 1); |
| 3642 |
var FloatingNodeContext = /* @__PURE__ */ React20.createContext(null); |
| 3643 |
if (true) FloatingNodeContext.displayName = "FloatingNodeContext"; |
| 3644 |
var FloatingTreeContext = /* @__PURE__ */ React20.createContext(null); |
| 3645 |
if (true) FloatingTreeContext.displayName = "FloatingTreeContext"; |
| 3646 |
var useFloatingParentNodeId = () => React20.useContext(FloatingNodeContext)?.id || null; |
| 3647 |
var useFloatingTree = (externalTree) => { |
| 3648 |
const contextTree = React20.useContext(FloatingTreeContext); |
| 3649 |
return externalTree ?? contextTree; |
| 3650 |
}; |
| 3651 |
|
| 3652 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingFocusManager.js |
| 3653 |
var import_jsx_runtime5 = __toESM(require_jsx_runtime(), 1); |
| 3654 |
function getEventType(event, lastInteractionType) { |
| 3655 |
const win = getWindow(getTarget(event)); |
| 3656 |
if (event instanceof win.KeyboardEvent) { |
| 3657 |
return "keyboard"; |
| 3658 |
} |
| 3659 |
if (event instanceof win.FocusEvent) { |
| 3660 |
return lastInteractionType || "keyboard"; |
| 3661 |
} |
| 3662 |
if ("pointerType" in event) { |
| 3663 |
return event.pointerType || "keyboard"; |
| 3664 |
} |
| 3665 |
if ("touches" in event) { |
| 3666 |
return "touch"; |
| 3667 |
} |
| 3668 |
if (event instanceof win.MouseEvent) { |
| 3669 |
return lastInteractionType || (event.detail === 0 ? "keyboard" : "mouse"); |
| 3670 |
} |
| 3671 |
return ""; |
| 3672 |
} |
| 3673 |
var LIST_LIMIT = 20; |
| 3674 |
var previouslyFocusedElements = []; |
| 3675 |
function clearDisconnectedPreviouslyFocusedElements() { |
| 3676 |
previouslyFocusedElements = previouslyFocusedElements.filter((entry) => { |
| 3677 |
return entry.deref()?.isConnected; |
| 3678 |
}); |
| 3679 |
} |
| 3680 |
function addPreviouslyFocusedElement(element) { |
| 3681 |
clearDisconnectedPreviouslyFocusedElements(); |
| 3682 |
if (element && getNodeName(element) !== "body") { |
| 3683 |
previouslyFocusedElements.push(new WeakRef(element)); |
| 3684 |
if (previouslyFocusedElements.length > LIST_LIMIT) { |
| 3685 |
previouslyFocusedElements = previouslyFocusedElements.slice(-LIST_LIMIT); |
| 3686 |
} |
| 3687 |
} |
| 3688 |
} |
| 3689 |
function getPreviouslyFocusedElement() { |
| 3690 |
clearDisconnectedPreviouslyFocusedElements(); |
| 3691 |
return previouslyFocusedElements[previouslyFocusedElements.length - 1]?.deref(); |
| 3692 |
} |
| 3693 |
function getFirstTabbableElement(container) { |
| 3694 |
if (!container) { |
| 3695 |
return null; |
| 3696 |
} |
| 3697 |
if (isTabbable(container)) { |
| 3698 |
return container; |
| 3699 |
} |
| 3700 |
return tabbable(container)[0] || container; |
| 3701 |
} |
| 3702 |
function handleTabIndex(floatingFocusElement, orderRef) { |
| 3703 |
if (floatingFocusElement.hasAttribute("tabindex") && !floatingFocusElement.hasAttribute("data-tabindex")) { |
| 3704 |
return; |
| 3705 |
} |
| 3706 |
if (!orderRef.current.includes("floating") && !floatingFocusElement.getAttribute("role")?.includes("dialog")) { |
| 3707 |
return; |
| 3708 |
} |
| 3709 |
const focusableElements = focusable(floatingFocusElement); |
| 3710 |
const tabbableContent = focusableElements.filter((element) => { |
| 3711 |
const dataTabIndex = element.getAttribute("data-tabindex") || ""; |
| 3712 |
return isTabbable(element) || element.hasAttribute("data-tabindex") && !dataTabIndex.startsWith("-"); |
| 3713 |
}); |
| 3714 |
const tabIndex = floatingFocusElement.getAttribute("tabindex"); |
| 3715 |
if (orderRef.current.includes("floating") || tabbableContent.length === 0) { |
| 3716 |
if (tabIndex !== "0") { |
| 3717 |
floatingFocusElement.setAttribute("tabindex", "0"); |
| 3718 |
} |
| 3719 |
} else if (tabIndex !== "-1" || floatingFocusElement.hasAttribute("data-tabindex") && floatingFocusElement.getAttribute("data-tabindex") !== "-1") { |
| 3720 |
floatingFocusElement.setAttribute("tabindex", "-1"); |
| 3721 |
floatingFocusElement.setAttribute("data-tabindex", "-1"); |
| 3722 |
} |
| 3723 |
} |
| 3724 |
function FloatingFocusManager(props) { |
| 3725 |
const { |
| 3726 |
context, |
| 3727 |
children, |
| 3728 |
disabled: disabled2 = false, |
| 3729 |
initialFocus = true, |
| 3730 |
returnFocus = true, |
| 3731 |
restoreFocus = false, |
| 3732 |
modal = true, |
| 3733 |
closeOnFocusOut = true, |
| 3734 |
openInteractionType = "", |
| 3735 |
nextFocusableElement, |
| 3736 |
previousFocusableElement, |
| 3737 |
beforeContentFocusGuardRef, |
| 3738 |
externalTree, |
| 3739 |
getInsideElements |
| 3740 |
} = props; |
| 3741 |
const store = "rootStore" in context ? context.rootStore : context; |
| 3742 |
const open = store.useState("open"); |
| 3743 |
const domReference = store.useState("domReferenceElement"); |
| 3744 |
const floating = store.useState("floatingElement"); |
| 3745 |
const { |
| 3746 |
events: events2, |
| 3747 |
dataRef |
| 3748 |
} = store.context; |
| 3749 |
const getNodeId = useStableCallback(() => dataRef.current.floatingContext?.nodeId); |
| 3750 |
const ignoreInitialFocus = initialFocus === false; |
| 3751 |
const isUntrappedTypeableCombobox = isTypeableCombobox(domReference) && ignoreInitialFocus; |
| 3752 |
const orderRef = React21.useRef(["content"]); |
| 3753 |
const initialFocusRef = useValueAsRef(initialFocus); |
| 3754 |
const returnFocusRef = useValueAsRef(returnFocus); |
| 3755 |
const openInteractionTypeRef = useValueAsRef(openInteractionType); |
| 3756 |
const tree = useFloatingTree(externalTree); |
| 3757 |
const portalContext = usePortalContext(); |
| 3758 |
const preventReturnFocusRef = React21.useRef(false); |
| 3759 |
const isPointerDownRef = React21.useRef(false); |
| 3760 |
const pointerDownOutsideRef = React21.useRef(false); |
| 3761 |
const lastFocusedTabbableRef = React21.useRef(null); |
| 3762 |
const closeTypeRef = React21.useRef(""); |
| 3763 |
const lastInteractionTypeRef = React21.useRef(""); |
| 3764 |
const beforeGuardRef = React21.useRef(null); |
| 3765 |
const afterGuardRef = React21.useRef(null); |
| 3766 |
const mergedBeforeGuardRef = useMergedRefs(beforeGuardRef, beforeContentFocusGuardRef, portalContext?.beforeInsideRef); |
| 3767 |
const mergedAfterGuardRef = useMergedRefs(afterGuardRef, portalContext?.afterInsideRef); |
| 3768 |
const blurTimeout = useTimeout(); |
| 3769 |
const pointerDownTimeout = useTimeout(); |
| 3770 |
const restoreFocusFrame = useAnimationFrame(); |
| 3771 |
const isInsidePortal = portalContext != null; |
| 3772 |
const floatingFocusElement = getFloatingFocusElement(floating); |
| 3773 |
const getTabbableContent = useStableCallback((container = floatingFocusElement) => { |
| 3774 |
return container ? tabbable(container) : []; |
| 3775 |
}); |
| 3776 |
const getResolvedInsideElements = useStableCallback(() => getInsideElements?.().filter((element) => element != null) ?? []); |
| 3777 |
React21.useEffect(() => { |
| 3778 |
if (disabled2 || !modal) { |
| 3779 |
return void 0; |
| 3780 |
} |
| 3781 |
function onKeyDown(event) { |
| 3782 |
if (event.key === "Tab") { |
| 3783 |
if (contains(floatingFocusElement, activeElement(ownerDocument(floatingFocusElement))) && getTabbableContent().length === 0 && !isUntrappedTypeableCombobox) { |
| 3784 |
stopEvent(event); |
| 3785 |
} |
| 3786 |
} |
| 3787 |
} |
| 3788 |
const doc = ownerDocument(floatingFocusElement); |
| 3789 |
return addEventListener(doc, "keydown", onKeyDown); |
| 3790 |
}, [disabled2, domReference, floatingFocusElement, modal, orderRef, isUntrappedTypeableCombobox, getTabbableContent]); |
| 3791 |
React21.useEffect(() => { |
| 3792 |
if (disabled2 || !open) { |
| 3793 |
return void 0; |
| 3794 |
} |
| 3795 |
const doc = ownerDocument(floatingFocusElement); |
| 3796 |
function clearPointerDownOutside() { |
| 3797 |
pointerDownOutsideRef.current = false; |
| 3798 |
} |
| 3799 |
function onPointerDown(event) { |
| 3800 |
const target = getTarget(event); |
| 3801 |
const insideElements = getResolvedInsideElements(); |
| 3802 |
const pointerTargetInside = contains(floating, target) || contains(domReference, target) || contains(portalContext?.portalNode, target) || insideElements.some((element) => element === target || contains(element, target)); |
| 3803 |
pointerDownOutsideRef.current = !pointerTargetInside; |
| 3804 |
lastInteractionTypeRef.current = event.pointerType || "keyboard"; |
| 3805 |
if (target?.closest(`[${CLICK_TRIGGER_IDENTIFIER}]`)) { |
| 3806 |
isPointerDownRef.current = true; |
| 3807 |
} |
| 3808 |
} |
| 3809 |
function onKeyDown() { |
| 3810 |
lastInteractionTypeRef.current = "keyboard"; |
| 3811 |
} |
| 3812 |
return mergeCleanups(addEventListener(doc, "pointerdown", onPointerDown, true), addEventListener(doc, "pointerup", clearPointerDownOutside, true), addEventListener(doc, "pointercancel", clearPointerDownOutside, true), addEventListener(doc, "keydown", onKeyDown, true)); |
| 3813 |
}, [disabled2, floating, domReference, floatingFocusElement, open, portalContext, getResolvedInsideElements]); |
| 3814 |
React21.useEffect(() => { |
| 3815 |
if (disabled2 || !closeOnFocusOut) { |
| 3816 |
return void 0; |
| 3817 |
} |
| 3818 |
const doc = ownerDocument(floatingFocusElement); |
| 3819 |
function handlePointerDown() { |
| 3820 |
isPointerDownRef.current = true; |
| 3821 |
pointerDownTimeout.start(0, () => { |
| 3822 |
isPointerDownRef.current = false; |
| 3823 |
}); |
| 3824 |
} |
| 3825 |
function handleFocusIn(event) { |
| 3826 |
const target = getTarget(event); |
| 3827 |
if (isTabbable(target)) { |
| 3828 |
lastFocusedTabbableRef.current = target; |
| 3829 |
} |
| 3830 |
} |
| 3831 |
function handleFocusOutside(event) { |
| 3832 |
const relatedTarget = event.relatedTarget; |
| 3833 |
const currentTarget = event.currentTarget; |
| 3834 |
const target = getTarget(event); |
| 3835 |
queueMicrotask(() => { |
| 3836 |
const nodeId = getNodeId(); |
| 3837 |
const triggers = store.context.triggerElements; |
| 3838 |
const insideElements = getResolvedInsideElements(); |
| 3839 |
const isRelatedFocusGuard = relatedTarget?.hasAttribute(createAttribute("focus-guard")) && [beforeGuardRef.current, afterGuardRef.current, portalContext?.beforeInsideRef.current, portalContext?.afterInsideRef.current, portalContext?.beforeOutsideRef.current, portalContext?.afterOutsideRef.current, resolveRef(previousFocusableElement), resolveRef(nextFocusableElement)].includes(relatedTarget); |
| 3840 |
const movedToUnrelatedNode = !(contains(domReference, relatedTarget) || contains(floating, relatedTarget) || contains(relatedTarget, floating) || contains(portalContext?.portalNode, relatedTarget) || insideElements.some((element) => element === relatedTarget || contains(element, relatedTarget)) || relatedTarget != null && triggers.hasElement(relatedTarget) || triggers.hasMatchingElement((trigger) => contains(trigger, relatedTarget)) || isRelatedFocusGuard || tree && (getNodeChildren(tree.nodesRef.current, nodeId).find((node) => contains(node.context?.elements.floating, relatedTarget) || contains(node.context?.elements.domReference, relatedTarget)) || getNodeAncestors(tree.nodesRef.current, nodeId).find((node) => [node.context?.elements.floating, getFloatingFocusElement(node.context?.elements.floating)].includes(relatedTarget) || node.context?.elements.domReference === relatedTarget))); |
| 3841 |
if (currentTarget === domReference && floatingFocusElement) { |
| 3842 |
handleTabIndex(floatingFocusElement, orderRef); |
| 3843 |
} |
| 3844 |
if (restoreFocus && currentTarget !== domReference && !isElementVisible(target) && activeElement(doc) === doc.body) { |
| 3845 |
if (isHTMLElement(floatingFocusElement)) { |
| 3846 |
floatingFocusElement.focus(); |
| 3847 |
if (restoreFocus === "popup") { |
| 3848 |
restoreFocusFrame.request(() => { |
| 3849 |
floatingFocusElement.focus(); |
| 3850 |
}); |
| 3851 |
return; |
| 3852 |
} |
| 3853 |
} |
| 3854 |
const tabbableContent = getTabbableContent(); |
| 3855 |
const prevTabbable = lastFocusedTabbableRef.current; |
| 3856 |
const nodeToFocus = (prevTabbable && tabbableContent.includes(prevTabbable) ? prevTabbable : null) || tabbableContent[tabbableContent.length - 1] || floatingFocusElement; |
| 3857 |
if (isHTMLElement(nodeToFocus)) { |
| 3858 |
nodeToFocus.focus(); |
| 3859 |
} |
| 3860 |
} |
| 3861 |
if (dataRef.current.insideReactTree) { |
| 3862 |
dataRef.current.insideReactTree = false; |
| 3863 |
return; |
| 3864 |
} |
| 3865 |
if ((isUntrappedTypeableCombobox ? true : !modal) && relatedTarget && movedToUnrelatedNode && !isPointerDownRef.current && // Fix React 18 Strict Mode returnFocus due to double rendering. |
| 3866 |
// For an "untrapped" typeable combobox (input role=combobox with |
| 3867 |
// initialFocus=false), re-opening the popup and tabbing out should still close it even |
| 3868 |
// when the previously focused element (e.g. the next tabbable outside the popup) is |
| 3869 |
// focused again. Otherwise, the popup remains open on the second Tab sequence: |
| 3870 |
// click input -> Tab (closes) -> click input -> Tab. |
| 3871 |
// Allow closing when `isUntrappedTypeableCombobox` regardless of the previously focused element. |
| 3872 |
(isUntrappedTypeableCombobox || relatedTarget !== getPreviouslyFocusedElement())) { |
| 3873 |
preventReturnFocusRef.current = true; |
| 3874 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.focusOut, event)); |
| 3875 |
} |
| 3876 |
}); |
| 3877 |
} |
| 3878 |
function markInsideReactTree() { |
| 3879 |
if (pointerDownOutsideRef.current) { |
| 3880 |
return; |
| 3881 |
} |
| 3882 |
dataRef.current.insideReactTree = true; |
| 3883 |
blurTimeout.start(0, () => { |
| 3884 |
dataRef.current.insideReactTree = false; |
| 3885 |
}); |
| 3886 |
} |
| 3887 |
const domReferenceElement = isHTMLElement(domReference) ? domReference : null; |
| 3888 |
if (!floating && !domReferenceElement) { |
| 3889 |
return void 0; |
| 3890 |
} |
| 3891 |
return mergeCleanups(domReferenceElement && addEventListener(domReferenceElement, "focusout", handleFocusOutside), domReferenceElement && addEventListener(domReferenceElement, "pointerdown", handlePointerDown), floating && addEventListener(floating, "focusin", handleFocusIn), floating && addEventListener(floating, "focusout", handleFocusOutside), floating && portalContext && addEventListener(floating, "focusout", markInsideReactTree, true)); |
| 3892 |
}, [disabled2, domReference, floating, floatingFocusElement, modal, tree, portalContext, store, closeOnFocusOut, restoreFocus, getTabbableContent, isUntrappedTypeableCombobox, getNodeId, orderRef, dataRef, blurTimeout, pointerDownTimeout, restoreFocusFrame, nextFocusableElement, previousFocusableElement, getResolvedInsideElements]); |
| 3893 |
React21.useEffect(() => { |
| 3894 |
if (disabled2 || !floating || !open) { |
| 3895 |
return void 0; |
| 3896 |
} |
| 3897 |
const portalNodes = Array.from(portalContext?.portalNode?.querySelectorAll(`[${createAttribute("portal")}]`) || []); |
| 3898 |
const ancestors = tree ? getNodeAncestors(tree.nodesRef.current, getNodeId()) : []; |
| 3899 |
const rootAncestorComboboxDomReference = ancestors.find((node) => isTypeableCombobox(node.context?.elements.domReference || null))?.context?.elements.domReference; |
| 3900 |
const controlInsideElements = [floating, ...portalNodes, beforeGuardRef.current, afterGuardRef.current, portalContext?.beforeOutsideRef.current, portalContext?.afterOutsideRef.current, ...getResolvedInsideElements()]; |
| 3901 |
const insideElements = [...controlInsideElements, rootAncestorComboboxDomReference, resolveRef(previousFocusableElement), resolveRef(nextFocusableElement), isUntrappedTypeableCombobox ? domReference : null].filter((x2) => x2 != null); |
| 3902 |
const ariaHiddenCleanup = markOthers(insideElements, { |
| 3903 |
ariaHidden: modal || isUntrappedTypeableCombobox, |
| 3904 |
mark: false |
| 3905 |
}); |
| 3906 |
const markerInsideElements = [floating, ...portalNodes].filter((x2) => x2 != null); |
| 3907 |
const markerCleanup = markOthers(markerInsideElements); |
| 3908 |
return () => { |
| 3909 |
markerCleanup(); |
| 3910 |
ariaHiddenCleanup(); |
| 3911 |
}; |
| 3912 |
}, [open, disabled2, domReference, floating, modal, orderRef, portalContext, isUntrappedTypeableCombobox, tree, getNodeId, nextFocusableElement, previousFocusableElement, getResolvedInsideElements]); |
| 3913 |
useIsoLayoutEffect(() => { |
| 3914 |
if (!open || disabled2 || !isHTMLElement(floatingFocusElement)) { |
| 3915 |
return; |
| 3916 |
} |
| 3917 |
const doc = ownerDocument(floatingFocusElement); |
| 3918 |
const previouslyFocusedElement = activeElement(doc); |
| 3919 |
queueMicrotask(() => { |
| 3920 |
const initialFocusValueOrFn = initialFocusRef.current; |
| 3921 |
const resolvedInitialFocus = typeof initialFocusValueOrFn === "function" ? initialFocusValueOrFn(openInteractionTypeRef.current || "") : initialFocusValueOrFn; |
| 3922 |
if (resolvedInitialFocus === void 0 || resolvedInitialFocus === false) { |
| 3923 |
return; |
| 3924 |
} |
| 3925 |
const focusAlreadyInsideFloatingEl = contains(floatingFocusElement, previouslyFocusedElement); |
| 3926 |
if (focusAlreadyInsideFloatingEl) { |
| 3927 |
return; |
| 3928 |
} |
| 3929 |
let focusableElements = null; |
| 3930 |
const getDefaultFocusElement = () => { |
| 3931 |
if (focusableElements == null) { |
| 3932 |
focusableElements = getTabbableContent(floatingFocusElement); |
| 3933 |
} |
| 3934 |
return focusableElements[0] || floatingFocusElement; |
| 3935 |
}; |
| 3936 |
let elToFocus; |
| 3937 |
if (resolvedInitialFocus === true || resolvedInitialFocus === null) { |
| 3938 |
elToFocus = getDefaultFocusElement(); |
| 3939 |
} else { |
| 3940 |
elToFocus = resolveRef(resolvedInitialFocus); |
| 3941 |
} |
| 3942 |
elToFocus = elToFocus || getDefaultFocusElement(); |
| 3943 |
enqueueFocus(elToFocus, { |
| 3944 |
preventScroll: elToFocus === floatingFocusElement |
| 3945 |
}); |
| 3946 |
}); |
| 3947 |
}, [disabled2, open, floatingFocusElement, ignoreInitialFocus, getTabbableContent, initialFocusRef, openInteractionTypeRef]); |
| 3948 |
useIsoLayoutEffect(() => { |
| 3949 |
if (disabled2 || !floatingFocusElement) { |
| 3950 |
return void 0; |
| 3951 |
} |
| 3952 |
const doc = ownerDocument(floatingFocusElement); |
| 3953 |
const previouslyFocusedElement = activeElement(doc); |
| 3954 |
addPreviouslyFocusedElement(previouslyFocusedElement); |
| 3955 |
function onOpenChangeLocal(details) { |
| 3956 |
if (!details.open) { |
| 3957 |
closeTypeRef.current = getEventType(details.nativeEvent, lastInteractionTypeRef.current); |
| 3958 |
} |
| 3959 |
if (details.reason === reason_parts_exports.triggerHover && details.nativeEvent.type === "mouseleave") { |
| 3960 |
preventReturnFocusRef.current = true; |
| 3961 |
} |
| 3962 |
if (details.reason !== reason_parts_exports.outsidePress) { |
| 3963 |
return; |
| 3964 |
} |
| 3965 |
if (details.nested) { |
| 3966 |
preventReturnFocusRef.current = false; |
| 3967 |
} else if (isVirtualClick(details.nativeEvent) || isVirtualPointerEvent(details.nativeEvent)) { |
| 3968 |
preventReturnFocusRef.current = false; |
| 3969 |
} else { |
| 3970 |
let isPreventScrollSupported = false; |
| 3971 |
ownerDocument(floatingFocusElement).createElement("div").focus({ |
| 3972 |
get preventScroll() { |
| 3973 |
isPreventScrollSupported = true; |
| 3974 |
return false; |
| 3975 |
} |
| 3976 |
}); |
| 3977 |
if (isPreventScrollSupported) { |
| 3978 |
preventReturnFocusRef.current = false; |
| 3979 |
} else { |
| 3980 |
preventReturnFocusRef.current = true; |
| 3981 |
} |
| 3982 |
} |
| 3983 |
} |
| 3984 |
events2.on("openchange", onOpenChangeLocal); |
| 3985 |
function getReturnElement() { |
| 3986 |
const returnFocusValueOrFn = returnFocusRef.current; |
| 3987 |
let resolvedReturnFocusValue = typeof returnFocusValueOrFn === "function" ? returnFocusValueOrFn(closeTypeRef.current) : returnFocusValueOrFn; |
| 3988 |
if (resolvedReturnFocusValue === void 0 || resolvedReturnFocusValue === false) { |
| 3989 |
return null; |
| 3990 |
} |
| 3991 |
if (resolvedReturnFocusValue === null) { |
| 3992 |
resolvedReturnFocusValue = true; |
| 3993 |
} |
| 3994 |
if (typeof resolvedReturnFocusValue === "boolean") { |
| 3995 |
const el = domReference || getPreviouslyFocusedElement(); |
| 3996 |
return el && el.isConnected ? el : null; |
| 3997 |
} |
| 3998 |
const fallback = domReference || getPreviouslyFocusedElement(); |
| 3999 |
return resolveRef(resolvedReturnFocusValue) || fallback || null; |
| 4000 |
} |
| 4001 |
return () => { |
| 4002 |
events2.off("openchange", onOpenChangeLocal); |
| 4003 |
const activeEl = activeElement(doc); |
| 4004 |
const insideElements = getResolvedInsideElements(); |
| 4005 |
const isFocusInsideFloatingTree = contains(floating, activeEl) || insideElements.some((element) => element === activeEl || contains(element, activeEl)) || tree && getNodeChildren(tree.nodesRef.current, getNodeId(), false).some((node) => contains(node.context?.elements.floating, activeEl)); |
| 4006 |
const returnFocusValueOrFn = returnFocusRef.current; |
| 4007 |
const returnElement = getReturnElement(); |
| 4008 |
queueMicrotask(() => { |
| 4009 |
const tabbableReturnElement = getFirstTabbableElement(returnElement); |
| 4010 |
const hasExplicitReturnFocus = typeof returnFocusValueOrFn !== "boolean"; |
| 4011 |
if (returnFocusValueOrFn && !preventReturnFocusRef.current && isHTMLElement(tabbableReturnElement) && // If the focus moved somewhere else after mount, avoid returning focus |
| 4012 |
// since it likely entered a different element which should be |
| 4013 |
// respected: https://github.com/floating-ui/floating-ui/issues/2607 |
| 4014 |
(!hasExplicitReturnFocus && tabbableReturnElement !== activeEl && activeEl !== doc.body ? isFocusInsideFloatingTree : true)) { |
| 4015 |
tabbableReturnElement.focus({ |
| 4016 |
preventScroll: true |
| 4017 |
}); |
| 4018 |
} |
| 4019 |
preventReturnFocusRef.current = false; |
| 4020 |
}); |
| 4021 |
}; |
| 4022 |
}, [disabled2, floating, floatingFocusElement, returnFocusRef, dataRef, events2, tree, domReference, getNodeId, getResolvedInsideElements]); |
| 4023 |
useIsoLayoutEffect(() => { |
| 4024 |
if (!isWebKit2 || open || !floating) { |
| 4025 |
return; |
| 4026 |
} |
| 4027 |
const activeEl = activeElement(ownerDocument(floating)); |
| 4028 |
if (!isHTMLElement(activeEl) || !isTypeableElement(activeEl)) { |
| 4029 |
return; |
| 4030 |
} |
| 4031 |
if (contains(floating, activeEl)) { |
| 4032 |
activeEl.blur(); |
| 4033 |
} |
| 4034 |
}, [open, floating]); |
| 4035 |
useIsoLayoutEffect(() => { |
| 4036 |
if (disabled2 || !portalContext) { |
| 4037 |
return void 0; |
| 4038 |
} |
| 4039 |
portalContext.setFocusManagerState({ |
| 4040 |
modal, |
| 4041 |
closeOnFocusOut, |
| 4042 |
open, |
| 4043 |
onOpenChange: store.setOpen, |
| 4044 |
domReference |
| 4045 |
}); |
| 4046 |
return () => { |
| 4047 |
portalContext.setFocusManagerState(null); |
| 4048 |
}; |
| 4049 |
}, [disabled2, portalContext, modal, open, store, closeOnFocusOut, domReference]); |
| 4050 |
useIsoLayoutEffect(() => { |
| 4051 |
if (disabled2 || !floatingFocusElement) { |
| 4052 |
return void 0; |
| 4053 |
} |
| 4054 |
handleTabIndex(floatingFocusElement, orderRef); |
| 4055 |
return () => { |
| 4056 |
queueMicrotask(clearDisconnectedPreviouslyFocusedElements); |
| 4057 |
}; |
| 4058 |
}, [disabled2, floatingFocusElement, orderRef]); |
| 4059 |
const shouldRenderGuards = !disabled2 && (modal ? !isUntrappedTypeableCombobox : true) && (isInsidePortal || modal); |
| 4060 |
return /* @__PURE__ */ (0, import_jsx_runtime5.jsxs)(React21.Fragment, { |
| 4061 |
children: [shouldRenderGuards && /* @__PURE__ */ (0, import_jsx_runtime5.jsx)(FocusGuard, { |
| 4062 |
"data-type": "inside", |
| 4063 |
ref: mergedBeforeGuardRef, |
| 4064 |
onFocus: (event) => { |
| 4065 |
if (modal) { |
| 4066 |
const els = getTabbableContent(); |
| 4067 |
enqueueFocus(els[els.length - 1]); |
| 4068 |
} else if (portalContext?.portalNode) { |
| 4069 |
preventReturnFocusRef.current = false; |
| 4070 |
if (isOutsideEvent(event, portalContext.portalNode)) { |
| 4071 |
const nextTabbable = getNextTabbable(domReference); |
| 4072 |
nextTabbable?.focus(); |
| 4073 |
} else { |
| 4074 |
resolveRef(previousFocusableElement ?? portalContext.beforeOutsideRef)?.focus(); |
| 4075 |
} |
| 4076 |
} |
| 4077 |
} |
| 4078 |
}), children, shouldRenderGuards && /* @__PURE__ */ (0, import_jsx_runtime5.jsx)(FocusGuard, { |
| 4079 |
"data-type": "inside", |
| 4080 |
ref: mergedAfterGuardRef, |
| 4081 |
onFocus: (event) => { |
| 4082 |
if (modal) { |
| 4083 |
enqueueFocus(getTabbableContent()[0]); |
| 4084 |
} else if (portalContext?.portalNode) { |
| 4085 |
if (closeOnFocusOut) { |
| 4086 |
preventReturnFocusRef.current = true; |
| 4087 |
} |
| 4088 |
if (isOutsideEvent(event, portalContext.portalNode)) { |
| 4089 |
const prevTabbable = getPreviousTabbable(domReference); |
| 4090 |
prevTabbable?.focus(); |
| 4091 |
} else { |
| 4092 |
resolveRef(nextFocusableElement ?? portalContext.afterOutsideRef)?.focus(); |
| 4093 |
} |
| 4094 |
} |
| 4095 |
} |
| 4096 |
})] |
| 4097 |
}); |
| 4098 |
} |
| 4099 |
|
| 4100 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useClick.js |
| 4101 |
var React22 = __toESM(require_react(), 1); |
| 4102 |
function useClick(context, props = {}) { |
| 4103 |
const store = "rootStore" in context ? context.rootStore : context; |
| 4104 |
const dataRef = store.context.dataRef; |
| 4105 |
const { |
| 4106 |
enabled = true, |
| 4107 |
event: eventOption = "click", |
| 4108 |
toggle = true, |
| 4109 |
ignoreMouse = false, |
| 4110 |
stickIfOpen = true, |
| 4111 |
touchOpenDelay = 0, |
| 4112 |
reason = reason_parts_exports.triggerPress |
| 4113 |
} = props; |
| 4114 |
const pointerTypeRef = React22.useRef(void 0); |
| 4115 |
const frame = useAnimationFrame(); |
| 4116 |
const touchOpenTimeout = useTimeout(); |
| 4117 |
const reference = React22.useMemo(() => ({ |
| 4118 |
onPointerDown(event) { |
| 4119 |
pointerTypeRef.current = event.pointerType; |
| 4120 |
}, |
| 4121 |
onMouseDown(event) { |
| 4122 |
const pointerType = pointerTypeRef.current; |
| 4123 |
const nativeEvent = event.nativeEvent; |
| 4124 |
const open = store.select("open"); |
| 4125 |
if (event.button !== 0 || eventOption === "click" || isMouseLikePointerType(pointerType, true) && ignoreMouse) { |
| 4126 |
return; |
| 4127 |
} |
| 4128 |
const openEvent = dataRef.current.openEvent; |
| 4129 |
const openEventType = openEvent?.type; |
| 4130 |
const hasClickedOnInactiveTrigger = store.select("domReferenceElement") !== event.currentTarget; |
| 4131 |
const nextOpen = open && hasClickedOnInactiveTrigger || !(open && toggle && (openEvent && stickIfOpen ? openEventType === "click" || openEventType === "mousedown" : true)); |
| 4132 |
const target = getTarget(nativeEvent); |
| 4133 |
if (isTypeableElement(target)) { |
| 4134 |
const details = createChangeEventDetails(reason, nativeEvent, target); |
| 4135 |
if (nextOpen && pointerType === "touch" && touchOpenDelay > 0) { |
| 4136 |
touchOpenTimeout.start(touchOpenDelay, () => { |
| 4137 |
store.setOpen(true, details); |
| 4138 |
}); |
| 4139 |
} else { |
| 4140 |
store.setOpen(nextOpen, details); |
| 4141 |
} |
| 4142 |
return; |
| 4143 |
} |
| 4144 |
const eventCurrentTarget = event.currentTarget; |
| 4145 |
frame.request(() => { |
| 4146 |
const details = createChangeEventDetails(reason, nativeEvent, eventCurrentTarget); |
| 4147 |
if (nextOpen && pointerType === "touch" && touchOpenDelay > 0) { |
| 4148 |
touchOpenTimeout.start(touchOpenDelay, () => { |
| 4149 |
store.setOpen(true, details); |
| 4150 |
}); |
| 4151 |
} else { |
| 4152 |
store.setOpen(nextOpen, details); |
| 4153 |
} |
| 4154 |
}); |
| 4155 |
}, |
| 4156 |
onClick(event) { |
| 4157 |
if (eventOption === "mousedown-only") { |
| 4158 |
return; |
| 4159 |
} |
| 4160 |
const pointerType = pointerTypeRef.current; |
| 4161 |
if (eventOption === "mousedown" && pointerType) { |
| 4162 |
pointerTypeRef.current = void 0; |
| 4163 |
return; |
| 4164 |
} |
| 4165 |
if (isMouseLikePointerType(pointerType, true) && ignoreMouse) { |
| 4166 |
return; |
| 4167 |
} |
| 4168 |
const open = store.select("open"); |
| 4169 |
const openEvent = dataRef.current.openEvent; |
| 4170 |
const hasClickedOnInactiveTrigger = store.select("domReferenceElement") !== event.currentTarget; |
| 4171 |
const nextOpen = open && hasClickedOnInactiveTrigger || !(open && toggle && (openEvent && stickIfOpen ? isClickLikeEvent(openEvent) : true)); |
| 4172 |
const details = createChangeEventDetails(reason, event.nativeEvent, event.currentTarget); |
| 4173 |
if (nextOpen && pointerType === "touch" && touchOpenDelay > 0) { |
| 4174 |
touchOpenTimeout.start(touchOpenDelay, () => { |
| 4175 |
store.setOpen(true, details); |
| 4176 |
}); |
| 4177 |
} else { |
| 4178 |
store.setOpen(nextOpen, details); |
| 4179 |
} |
| 4180 |
}, |
| 4181 |
onKeyDown() { |
| 4182 |
pointerTypeRef.current = void 0; |
| 4183 |
} |
| 4184 |
}), [dataRef, eventOption, ignoreMouse, store, stickIfOpen, toggle, frame, touchOpenTimeout, touchOpenDelay, reason]); |
| 4185 |
return React22.useMemo(() => enabled ? { |
| 4186 |
reference |
| 4187 |
} : EMPTY_OBJECT, [enabled, reference]); |
| 4188 |
} |
| 4189 |
|
| 4190 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useClientPoint.js |
| 4191 |
var React23 = __toESM(require_react(), 1); |
| 4192 |
function createVirtualElement(domElement, data) { |
| 4193 |
let offsetX = null; |
| 4194 |
let offsetY = null; |
| 4195 |
let isAutoUpdateEvent = false; |
| 4196 |
return { |
| 4197 |
contextElement: domElement || void 0, |
| 4198 |
getBoundingClientRect() { |
| 4199 |
const domRect = domElement?.getBoundingClientRect() || { |
| 4200 |
width: 0, |
| 4201 |
height: 0, |
| 4202 |
x: 0, |
| 4203 |
y: 0 |
| 4204 |
}; |
| 4205 |
const isXAxis = data.axis === "x" || data.axis === "both"; |
| 4206 |
const isYAxis = data.axis === "y" || data.axis === "both"; |
| 4207 |
const canTrackCursorOnAutoUpdate = ["mouseenter", "mousemove"].includes(data.dataRef.current.openEvent?.type || "") && data.pointerType !== "touch"; |
| 4208 |
let width = domRect.width; |
| 4209 |
let height = domRect.height; |
| 4210 |
let x2 = domRect.x; |
| 4211 |
let y2 = domRect.y; |
| 4212 |
if (offsetX == null && data.x && isXAxis) { |
| 4213 |
offsetX = domRect.x - data.x; |
| 4214 |
} |
| 4215 |
if (offsetY == null && data.y && isYAxis) { |
| 4216 |
offsetY = domRect.y - data.y; |
| 4217 |
} |
| 4218 |
x2 -= offsetX || 0; |
| 4219 |
y2 -= offsetY || 0; |
| 4220 |
width = 0; |
| 4221 |
height = 0; |
| 4222 |
if (!isAutoUpdateEvent || canTrackCursorOnAutoUpdate) { |
| 4223 |
width = data.axis === "y" ? domRect.width : 0; |
| 4224 |
height = data.axis === "x" ? domRect.height : 0; |
| 4225 |
x2 = isXAxis && data.x != null ? data.x : x2; |
| 4226 |
y2 = isYAxis && data.y != null ? data.y : y2; |
| 4227 |
} else if (isAutoUpdateEvent && !canTrackCursorOnAutoUpdate) { |
| 4228 |
height = data.axis === "x" ? domRect.height : height; |
| 4229 |
width = data.axis === "y" ? domRect.width : width; |
| 4230 |
} |
| 4231 |
isAutoUpdateEvent = true; |
| 4232 |
return { |
| 4233 |
width, |
| 4234 |
height, |
| 4235 |
x: x2, |
| 4236 |
y: y2, |
| 4237 |
top: y2, |
| 4238 |
right: x2 + width, |
| 4239 |
bottom: y2 + height, |
| 4240 |
left: x2 |
| 4241 |
}; |
| 4242 |
} |
| 4243 |
}; |
| 4244 |
} |
| 4245 |
function isMouseBasedEvent(event) { |
| 4246 |
return event != null && event.clientX != null; |
| 4247 |
} |
| 4248 |
function useClientPoint(context, props = {}) { |
| 4249 |
const store = "rootStore" in context ? context.rootStore : context; |
| 4250 |
const open = store.useState("open"); |
| 4251 |
const floating = store.useState("floatingElement"); |
| 4252 |
const domReference = store.useState("domReferenceElement"); |
| 4253 |
const dataRef = store.context.dataRef; |
| 4254 |
const { |
| 4255 |
enabled = true, |
| 4256 |
axis = "both" |
| 4257 |
} = props; |
| 4258 |
const initialRef = React23.useRef(false); |
| 4259 |
const cleanupListenerRef = React23.useRef(null); |
| 4260 |
const [pointerType, setPointerType] = React23.useState(); |
| 4261 |
const [reactive, setReactive] = React23.useState([]); |
| 4262 |
const setReference = useStableCallback((newX, newY, referenceElement) => { |
| 4263 |
if (initialRef.current) { |
| 4264 |
return; |
| 4265 |
} |
| 4266 |
if (dataRef.current.openEvent && !isMouseBasedEvent(dataRef.current.openEvent)) { |
| 4267 |
return; |
| 4268 |
} |
| 4269 |
store.set("positionReference", createVirtualElement(referenceElement ?? domReference, { |
| 4270 |
x: newX, |
| 4271 |
y: newY, |
| 4272 |
axis, |
| 4273 |
dataRef, |
| 4274 |
pointerType |
| 4275 |
})); |
| 4276 |
}); |
| 4277 |
const handleReferenceEnterOrMove = useStableCallback((event) => { |
| 4278 |
if (!open) { |
| 4279 |
setReference(event.clientX, event.clientY, event.currentTarget); |
| 4280 |
} else if (!cleanupListenerRef.current) { |
| 4281 |
setReactive([]); |
| 4282 |
} |
| 4283 |
}); |
| 4284 |
const openCheck = isMouseLikePointerType(pointerType) ? floating : open; |
| 4285 |
const addListener = React23.useCallback(() => { |
| 4286 |
if (!openCheck || !enabled) { |
| 4287 |
return void 0; |
| 4288 |
} |
| 4289 |
const win = getWindow(floating); |
| 4290 |
function handleMouseMove(event) { |
| 4291 |
const target = getTarget(event); |
| 4292 |
if (!contains(floating, target)) { |
| 4293 |
setReference(event.clientX, event.clientY); |
| 4294 |
} else { |
| 4295 |
cleanupListenerRef.current?.(); |
| 4296 |
cleanupListenerRef.current = null; |
| 4297 |
} |
| 4298 |
} |
| 4299 |
if (!dataRef.current.openEvent || isMouseBasedEvent(dataRef.current.openEvent)) { |
| 4300 |
const cleanup = () => { |
| 4301 |
cleanupListenerRef.current?.(); |
| 4302 |
cleanupListenerRef.current = null; |
| 4303 |
}; |
| 4304 |
cleanupListenerRef.current = addEventListener(win, "mousemove", handleMouseMove); |
| 4305 |
return cleanup; |
| 4306 |
} |
| 4307 |
store.set("positionReference", domReference); |
| 4308 |
return void 0; |
| 4309 |
}, [openCheck, enabled, floating, dataRef, domReference, store, setReference]); |
| 4310 |
React23.useEffect(() => { |
| 4311 |
return addListener(); |
| 4312 |
}, [addListener, reactive]); |
| 4313 |
React23.useEffect(() => { |
| 4314 |
if (enabled && !floating) { |
| 4315 |
initialRef.current = false; |
| 4316 |
} |
| 4317 |
}, [enabled, floating]); |
| 4318 |
React23.useEffect(() => { |
| 4319 |
if (!enabled && open) { |
| 4320 |
initialRef.current = true; |
| 4321 |
} |
| 4322 |
}, [enabled, open]); |
| 4323 |
const reference = React23.useMemo(() => { |
| 4324 |
function setPointerTypeRef(event) { |
| 4325 |
setPointerType(event.pointerType); |
| 4326 |
} |
| 4327 |
return { |
| 4328 |
onPointerDown: setPointerTypeRef, |
| 4329 |
onPointerEnter: setPointerTypeRef, |
| 4330 |
onMouseMove: handleReferenceEnterOrMove, |
| 4331 |
onMouseEnter: handleReferenceEnterOrMove |
| 4332 |
}; |
| 4333 |
}, [handleReferenceEnterOrMove]); |
| 4334 |
return React23.useMemo(() => enabled ? { |
| 4335 |
reference, |
| 4336 |
trigger: reference |
| 4337 |
} : {}, [enabled, reference]); |
| 4338 |
} |
| 4339 |
|
| 4340 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useDismiss.js |
| 4341 |
var React24 = __toESM(require_react(), 1); |
| 4342 |
var bubbleHandlerKeys = { |
| 4343 |
intentional: "onClick", |
| 4344 |
sloppy: "onPointerDown" |
| 4345 |
}; |
| 4346 |
function alwaysFalse() { |
| 4347 |
return false; |
| 4348 |
} |
| 4349 |
function normalizeProp(normalizable) { |
| 4350 |
return { |
| 4351 |
escapeKey: typeof normalizable === "boolean" ? normalizable : normalizable?.escapeKey ?? false, |
| 4352 |
outsidePress: typeof normalizable === "boolean" ? normalizable : normalizable?.outsidePress ?? true |
| 4353 |
}; |
| 4354 |
} |
| 4355 |
function useDismiss(context, props = {}) { |
| 4356 |
const store = "rootStore" in context ? context.rootStore : context; |
| 4357 |
const open = store.useState("open"); |
| 4358 |
const floatingElement = store.useState("floatingElement"); |
| 4359 |
const { |
| 4360 |
dataRef |
| 4361 |
} = store.context; |
| 4362 |
const { |
| 4363 |
enabled = true, |
| 4364 |
escapeKey: escapeKey2 = true, |
| 4365 |
outsidePress: outsidePressProp = true, |
| 4366 |
outsidePressEvent = "sloppy", |
| 4367 |
referencePress = alwaysFalse, |
| 4368 |
referencePressEvent = "sloppy", |
| 4369 |
bubbles, |
| 4370 |
externalTree |
| 4371 |
} = props; |
| 4372 |
const tree = useFloatingTree(externalTree); |
| 4373 |
const outsidePressFn = useStableCallback(typeof outsidePressProp === "function" ? outsidePressProp : () => false); |
| 4374 |
const outsidePress2 = typeof outsidePressProp === "function" ? outsidePressFn : outsidePressProp; |
| 4375 |
const outsidePressEnabled = outsidePress2 !== false; |
| 4376 |
const getOutsidePressEventProp = useStableCallback(() => outsidePressEvent); |
| 4377 |
const pressStartedInsideRef = React24.useRef(false); |
| 4378 |
const pressStartPreventedRef = React24.useRef(false); |
| 4379 |
const suppressNextOutsideClickRef = React24.useRef(false); |
| 4380 |
const { |
| 4381 |
escapeKey: escapeKeyBubbles, |
| 4382 |
outsidePress: outsidePressBubbles |
| 4383 |
} = normalizeProp(bubbles); |
| 4384 |
const touchStateRef = React24.useRef(null); |
| 4385 |
const cancelDismissOnEndTimeout = useTimeout(); |
| 4386 |
const clearInsideReactTreeTimeout = useTimeout(); |
| 4387 |
const clearInsideReactTree = useStableCallback(() => { |
| 4388 |
clearInsideReactTreeTimeout.clear(); |
| 4389 |
dataRef.current.insideReactTree = false; |
| 4390 |
}); |
| 4391 |
const isComposingRef = React24.useRef(false); |
| 4392 |
const currentPointerTypeRef = React24.useRef(""); |
| 4393 |
const isReferencePressEnabled = useStableCallback(referencePress); |
| 4394 |
const closeOnEscapeKeyDown = useStableCallback((event) => { |
| 4395 |
if (!open || !enabled || !escapeKey2 || event.key !== "Escape") { |
| 4396 |
return; |
| 4397 |
} |
| 4398 |
if (isComposingRef.current) { |
| 4399 |
return; |
| 4400 |
} |
| 4401 |
const nodeId = dataRef.current.floatingContext?.nodeId; |
| 4402 |
const children = tree ? getNodeChildren(tree.nodesRef.current, nodeId) : []; |
| 4403 |
if (!escapeKeyBubbles) { |
| 4404 |
if (children.length > 0) { |
| 4405 |
let shouldDismiss = true; |
| 4406 |
children.forEach((child) => { |
| 4407 |
if (child.context?.open && !child.context.dataRef.current.__escapeKeyBubbles) { |
| 4408 |
shouldDismiss = false; |
| 4409 |
} |
| 4410 |
}); |
| 4411 |
if (!shouldDismiss) { |
| 4412 |
return; |
| 4413 |
} |
| 4414 |
} |
| 4415 |
} |
| 4416 |
const native = isReactEvent(event) ? event.nativeEvent : event; |
| 4417 |
const eventDetails = createChangeEventDetails(reason_parts_exports.escapeKey, native); |
| 4418 |
store.setOpen(false, eventDetails); |
| 4419 |
if (!escapeKeyBubbles && !eventDetails.isPropagationAllowed) { |
| 4420 |
event.stopPropagation(); |
| 4421 |
} |
| 4422 |
}); |
| 4423 |
const markInsideReactTree = useStableCallback(() => { |
| 4424 |
dataRef.current.insideReactTree = true; |
| 4425 |
clearInsideReactTreeTimeout.start(0, clearInsideReactTree); |
| 4426 |
}); |
| 4427 |
React24.useEffect(() => { |
| 4428 |
if (!open || !enabled) { |
| 4429 |
return void 0; |
| 4430 |
} |
| 4431 |
dataRef.current.__escapeKeyBubbles = escapeKeyBubbles; |
| 4432 |
dataRef.current.__outsidePressBubbles = outsidePressBubbles; |
| 4433 |
const compositionTimeout = new Timeout(); |
| 4434 |
const preventedPressSuppressionTimeout = new Timeout(); |
| 4435 |
function handleCompositionStart() { |
| 4436 |
compositionTimeout.clear(); |
| 4437 |
isComposingRef.current = true; |
| 4438 |
} |
| 4439 |
function handleCompositionEnd() { |
| 4440 |
compositionTimeout.start( |
| 4441 |
// 0ms or 1ms don't work in Safari. 5ms appears to consistently work. |
| 4442 |
// Only apply to WebKit for the test to remain 0ms. |
| 4443 |
isWebKit() ? 5 : 0, |
| 4444 |
() => { |
| 4445 |
isComposingRef.current = false; |
| 4446 |
} |
| 4447 |
); |
| 4448 |
} |
| 4449 |
function suppressImmediateOutsideClickAfterPreventedStart() { |
| 4450 |
suppressNextOutsideClickRef.current = true; |
| 4451 |
preventedPressSuppressionTimeout.start(0, () => { |
| 4452 |
suppressNextOutsideClickRef.current = false; |
| 4453 |
}); |
| 4454 |
} |
| 4455 |
function resetPressStartState() { |
| 4456 |
pressStartedInsideRef.current = false; |
| 4457 |
pressStartPreventedRef.current = false; |
| 4458 |
} |
| 4459 |
function getOutsidePressEvent() { |
| 4460 |
const type = currentPointerTypeRef.current; |
| 4461 |
const computedType = type === "pen" || !type ? "mouse" : type; |
| 4462 |
const outsidePressEventValue = getOutsidePressEventProp(); |
| 4463 |
const resolved = typeof outsidePressEventValue === "function" ? outsidePressEventValue() : outsidePressEventValue; |
| 4464 |
if (typeof resolved === "string") { |
| 4465 |
return resolved; |
| 4466 |
} |
| 4467 |
return resolved[computedType]; |
| 4468 |
} |
| 4469 |
function shouldIgnoreEvent(event) { |
| 4470 |
const computedOutsidePressEvent = getOutsidePressEvent(); |
| 4471 |
return computedOutsidePressEvent === "intentional" && event.type !== "click" || computedOutsidePressEvent === "sloppy" && event.type === "click"; |
| 4472 |
} |
| 4473 |
function isEventWithinFloatingTree(event) { |
| 4474 |
const nodeId = dataRef.current.floatingContext?.nodeId; |
| 4475 |
const targetIsInsideChildren = tree && getNodeChildren(tree.nodesRef.current, nodeId).some((node) => isEventTargetWithin(event, node.context?.elements.floating)); |
| 4476 |
return isEventTargetWithin(event, store.select("floatingElement")) || isEventTargetWithin(event, store.select("domReferenceElement")) || targetIsInsideChildren; |
| 4477 |
} |
| 4478 |
function closeOnPressOutside(event) { |
| 4479 |
if (shouldIgnoreEvent(event)) { |
| 4480 |
clearInsideReactTree(); |
| 4481 |
return; |
| 4482 |
} |
| 4483 |
if (dataRef.current.insideReactTree) { |
| 4484 |
clearInsideReactTree(); |
| 4485 |
return; |
| 4486 |
} |
| 4487 |
const target = getTarget(event); |
| 4488 |
const inertSelector = `[${createAttribute("inert")}]`; |
| 4489 |
const targetRoot = isElement(target) ? target.getRootNode() : null; |
| 4490 |
const markers = Array.from((isShadowRoot(targetRoot) ? targetRoot : ownerDocument(store.select("floatingElement"))).querySelectorAll(inertSelector)); |
| 4491 |
const triggers = store.context.triggerElements; |
| 4492 |
if (target && (triggers.hasElement(target) || triggers.hasMatchingElement((trigger) => contains(trigger, target)))) { |
| 4493 |
return; |
| 4494 |
} |
| 4495 |
let targetRootAncestor = isElement(target) ? target : null; |
| 4496 |
while (targetRootAncestor && !isLastTraversableNode(targetRootAncestor)) { |
| 4497 |
const nextParent = getParentNode(targetRootAncestor); |
| 4498 |
if (isLastTraversableNode(nextParent) || !isElement(nextParent)) { |
| 4499 |
break; |
| 4500 |
} |
| 4501 |
targetRootAncestor = nextParent; |
| 4502 |
} |
| 4503 |
if (markers.length && isElement(target) && !isRootElement(target) && // Clicked on a direct ancestor (e.g. FloatingOverlay). |
| 4504 |
!contains(target, store.select("floatingElement")) && // If the target root element contains none of the markers, then the |
| 4505 |
// element was injected after the floating element rendered. |
| 4506 |
markers.every((marker) => !contains(targetRootAncestor, marker))) { |
| 4507 |
return; |
| 4508 |
} |
| 4509 |
if (isHTMLElement(target) && !("touches" in event)) { |
| 4510 |
const lastTraversableNode = isLastTraversableNode(target); |
| 4511 |
const style = getComputedStyle2(target); |
| 4512 |
const scrollRe = /auto|scroll/; |
| 4513 |
const isScrollableX = lastTraversableNode || scrollRe.test(style.overflowX); |
| 4514 |
const isScrollableY = lastTraversableNode || scrollRe.test(style.overflowY); |
| 4515 |
const canScrollX = isScrollableX && target.clientWidth > 0 && target.scrollWidth > target.clientWidth; |
| 4516 |
const canScrollY = isScrollableY && target.clientHeight > 0 && target.scrollHeight > target.clientHeight; |
| 4517 |
const isRTL7 = style.direction === "rtl"; |
| 4518 |
const pressedVerticalScrollbar = canScrollY && (isRTL7 ? event.offsetX <= target.offsetWidth - target.clientWidth : event.offsetX > target.clientWidth); |
| 4519 |
const pressedHorizontalScrollbar = canScrollX && event.offsetY > target.clientHeight; |
| 4520 |
if (pressedVerticalScrollbar || pressedHorizontalScrollbar) { |
| 4521 |
return; |
| 4522 |
} |
| 4523 |
} |
| 4524 |
if (isEventWithinFloatingTree(event)) { |
| 4525 |
return; |
| 4526 |
} |
| 4527 |
if (getOutsidePressEvent() === "intentional" && suppressNextOutsideClickRef.current) { |
| 4528 |
preventedPressSuppressionTimeout.clear(); |
| 4529 |
suppressNextOutsideClickRef.current = false; |
| 4530 |
return; |
| 4531 |
} |
| 4532 |
if (typeof outsidePress2 === "function" && !outsidePress2(event)) { |
| 4533 |
return; |
| 4534 |
} |
| 4535 |
const nodeId = dataRef.current.floatingContext?.nodeId; |
| 4536 |
const children = tree ? getNodeChildren(tree.nodesRef.current, nodeId) : []; |
| 4537 |
if (children.length > 0) { |
| 4538 |
let shouldDismiss = true; |
| 4539 |
children.forEach((child) => { |
| 4540 |
if (child.context?.open && !child.context.dataRef.current.__outsidePressBubbles) { |
| 4541 |
shouldDismiss = false; |
| 4542 |
} |
| 4543 |
}); |
| 4544 |
if (!shouldDismiss) { |
| 4545 |
return; |
| 4546 |
} |
| 4547 |
} |
| 4548 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.outsidePress, event)); |
| 4549 |
clearInsideReactTree(); |
| 4550 |
} |
| 4551 |
function handlePointerDown(event) { |
| 4552 |
if (getOutsidePressEvent() !== "sloppy" || event.pointerType === "touch" || !store.select("open") || !enabled || isEventTargetWithin(event, store.select("floatingElement")) || isEventTargetWithin(event, store.select("domReferenceElement"))) { |
| 4553 |
return; |
| 4554 |
} |
| 4555 |
closeOnPressOutside(event); |
| 4556 |
} |
| 4557 |
function handleTouchStart(event) { |
| 4558 |
if (getOutsidePressEvent() !== "sloppy" || !store.select("open") || !enabled || isEventTargetWithin(event, store.select("floatingElement")) || isEventTargetWithin(event, store.select("domReferenceElement"))) { |
| 4559 |
return; |
| 4560 |
} |
| 4561 |
const touch = event.touches[0]; |
| 4562 |
if (touch) { |
| 4563 |
touchStateRef.current = { |
| 4564 |
startTime: Date.now(), |
| 4565 |
startX: touch.clientX, |
| 4566 |
startY: touch.clientY, |
| 4567 |
dismissOnTouchEnd: false, |
| 4568 |
dismissOnMouseDown: true |
| 4569 |
}; |
| 4570 |
cancelDismissOnEndTimeout.start(1e3, () => { |
| 4571 |
if (touchStateRef.current) { |
| 4572 |
touchStateRef.current.dismissOnTouchEnd = false; |
| 4573 |
touchStateRef.current.dismissOnMouseDown = false; |
| 4574 |
} |
| 4575 |
}); |
| 4576 |
} |
| 4577 |
} |
| 4578 |
function addTargetEventListenerOnce(event, listener) { |
| 4579 |
const target = getTarget(event); |
| 4580 |
if (!target) { |
| 4581 |
return; |
| 4582 |
} |
| 4583 |
const unsubscribe2 = addEventListener(target, event.type, () => { |
| 4584 |
listener(event); |
| 4585 |
unsubscribe2(); |
| 4586 |
}); |
| 4587 |
} |
| 4588 |
function handleTouchStartCapture(event) { |
| 4589 |
currentPointerTypeRef.current = "touch"; |
| 4590 |
addTargetEventListenerOnce(event, handleTouchStart); |
| 4591 |
} |
| 4592 |
function closeOnPressOutsideCapture(event) { |
| 4593 |
cancelDismissOnEndTimeout.clear(); |
| 4594 |
if (event.type === "pointerdown") { |
| 4595 |
currentPointerTypeRef.current = event.pointerType; |
| 4596 |
} |
| 4597 |
if (event.type === "mousedown" && touchStateRef.current && !touchStateRef.current.dismissOnMouseDown) { |
| 4598 |
return; |
| 4599 |
} |
| 4600 |
addTargetEventListenerOnce(event, (targetEvent) => { |
| 4601 |
if (targetEvent.type === "pointerdown") { |
| 4602 |
handlePointerDown(targetEvent); |
| 4603 |
} else { |
| 4604 |
closeOnPressOutside(targetEvent); |
| 4605 |
} |
| 4606 |
}); |
| 4607 |
} |
| 4608 |
function handlePressEndCapture(event) { |
| 4609 |
if (!pressStartedInsideRef.current) { |
| 4610 |
return; |
| 4611 |
} |
| 4612 |
const pressStartedInsideDefaultPrevented = pressStartPreventedRef.current; |
| 4613 |
resetPressStartState(); |
| 4614 |
if (getOutsidePressEvent() !== "intentional") { |
| 4615 |
return; |
| 4616 |
} |
| 4617 |
if (event.type === "pointercancel") { |
| 4618 |
if (pressStartedInsideDefaultPrevented) { |
| 4619 |
suppressImmediateOutsideClickAfterPreventedStart(); |
| 4620 |
} |
| 4621 |
return; |
| 4622 |
} |
| 4623 |
if (isEventWithinFloatingTree(event)) { |
| 4624 |
return; |
| 4625 |
} |
| 4626 |
if (pressStartedInsideDefaultPrevented) { |
| 4627 |
suppressImmediateOutsideClickAfterPreventedStart(); |
| 4628 |
return; |
| 4629 |
} |
| 4630 |
if (typeof outsidePress2 === "function" && !outsidePress2(event)) { |
| 4631 |
return; |
| 4632 |
} |
| 4633 |
preventedPressSuppressionTimeout.clear(); |
| 4634 |
suppressNextOutsideClickRef.current = true; |
| 4635 |
clearInsideReactTree(); |
| 4636 |
} |
| 4637 |
function handleTouchMove(event) { |
| 4638 |
if (getOutsidePressEvent() !== "sloppy" || !touchStateRef.current || isEventTargetWithin(event, store.select("floatingElement")) || isEventTargetWithin(event, store.select("domReferenceElement"))) { |
| 4639 |
return; |
| 4640 |
} |
| 4641 |
const touch = event.touches[0]; |
| 4642 |
if (!touch) { |
| 4643 |
return; |
| 4644 |
} |
| 4645 |
const deltaX = Math.abs(touch.clientX - touchStateRef.current.startX); |
| 4646 |
const deltaY = Math.abs(touch.clientY - touchStateRef.current.startY); |
| 4647 |
const distance = Math.sqrt(deltaX * deltaX + deltaY * deltaY); |
| 4648 |
if (distance > 5) { |
| 4649 |
touchStateRef.current.dismissOnTouchEnd = true; |
| 4650 |
} |
| 4651 |
if (distance > 10) { |
| 4652 |
closeOnPressOutside(event); |
| 4653 |
cancelDismissOnEndTimeout.clear(); |
| 4654 |
touchStateRef.current = null; |
| 4655 |
} |
| 4656 |
} |
| 4657 |
function handleTouchMoveCapture(event) { |
| 4658 |
addTargetEventListenerOnce(event, handleTouchMove); |
| 4659 |
} |
| 4660 |
function handleTouchEnd(event) { |
| 4661 |
if (getOutsidePressEvent() !== "sloppy" || !touchStateRef.current || isEventTargetWithin(event, store.select("floatingElement")) || isEventTargetWithin(event, store.select("domReferenceElement"))) { |
| 4662 |
return; |
| 4663 |
} |
| 4664 |
if (touchStateRef.current.dismissOnTouchEnd) { |
| 4665 |
closeOnPressOutside(event); |
| 4666 |
} |
| 4667 |
cancelDismissOnEndTimeout.clear(); |
| 4668 |
touchStateRef.current = null; |
| 4669 |
} |
| 4670 |
function handleTouchEndCapture(event) { |
| 4671 |
addTargetEventListenerOnce(event, handleTouchEnd); |
| 4672 |
} |
| 4673 |
const doc = ownerDocument(floatingElement); |
| 4674 |
const unsubscribe = mergeCleanups(escapeKey2 && mergeCleanups(addEventListener(doc, "keydown", closeOnEscapeKeyDown), addEventListener(doc, "compositionstart", handleCompositionStart), addEventListener(doc, "compositionend", handleCompositionEnd)), outsidePressEnabled && mergeCleanups(addEventListener(doc, "click", closeOnPressOutsideCapture, true), addEventListener(doc, "pointerdown", closeOnPressOutsideCapture, true), addEventListener(doc, "pointerup", handlePressEndCapture, true), addEventListener(doc, "pointercancel", handlePressEndCapture, true), addEventListener(doc, "mousedown", closeOnPressOutsideCapture, true), addEventListener(doc, "mouseup", handlePressEndCapture, true), addEventListener(doc, "touchstart", handleTouchStartCapture, true), addEventListener(doc, "touchmove", handleTouchMoveCapture, true), addEventListener(doc, "touchend", handleTouchEndCapture, true))); |
| 4675 |
return () => { |
| 4676 |
unsubscribe(); |
| 4677 |
compositionTimeout.clear(); |
| 4678 |
preventedPressSuppressionTimeout.clear(); |
| 4679 |
resetPressStartState(); |
| 4680 |
suppressNextOutsideClickRef.current = false; |
| 4681 |
}; |
| 4682 |
}, [dataRef, floatingElement, escapeKey2, outsidePressEnabled, outsidePress2, open, enabled, escapeKeyBubbles, outsidePressBubbles, closeOnEscapeKeyDown, clearInsideReactTree, getOutsidePressEventProp, tree, store, cancelDismissOnEndTimeout]); |
| 4683 |
React24.useEffect(clearInsideReactTree, [outsidePress2, clearInsideReactTree]); |
| 4684 |
const reference = React24.useMemo(() => ({ |
| 4685 |
onKeyDown: closeOnEscapeKeyDown, |
| 4686 |
[bubbleHandlerKeys[referencePressEvent]]: (event) => { |
| 4687 |
if (!isReferencePressEnabled()) { |
| 4688 |
return; |
| 4689 |
} |
| 4690 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerPress, event.nativeEvent)); |
| 4691 |
}, |
| 4692 |
...referencePressEvent !== "intentional" && { |
| 4693 |
onClick(event) { |
| 4694 |
if (!isReferencePressEnabled()) { |
| 4695 |
return; |
| 4696 |
} |
| 4697 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerPress, event.nativeEvent)); |
| 4698 |
} |
| 4699 |
} |
| 4700 |
}), [closeOnEscapeKeyDown, store, referencePressEvent, isReferencePressEnabled]); |
| 4701 |
const markPressStartedInsideReactTree = useStableCallback((event) => { |
| 4702 |
if (!open || !enabled || event.button !== 0) { |
| 4703 |
return; |
| 4704 |
} |
| 4705 |
const target = getTarget(event.nativeEvent); |
| 4706 |
if (!contains(store.select("floatingElement"), target)) { |
| 4707 |
return; |
| 4708 |
} |
| 4709 |
if (!pressStartedInsideRef.current) { |
| 4710 |
pressStartedInsideRef.current = true; |
| 4711 |
pressStartPreventedRef.current = false; |
| 4712 |
} |
| 4713 |
}); |
| 4714 |
const markInsidePressStartPrevented = useStableCallback((event) => { |
| 4715 |
if (!open || !enabled) { |
| 4716 |
return; |
| 4717 |
} |
| 4718 |
if (!(event.defaultPrevented || event.nativeEvent.defaultPrevented)) { |
| 4719 |
return; |
| 4720 |
} |
| 4721 |
if (pressStartedInsideRef.current) { |
| 4722 |
pressStartPreventedRef.current = true; |
| 4723 |
} |
| 4724 |
}); |
| 4725 |
const floating = React24.useMemo(() => ({ |
| 4726 |
onKeyDown: closeOnEscapeKeyDown, |
| 4727 |
// `onMouseDown` may be blocked if `event.preventDefault()` is called in |
| 4728 |
// `onPointerDown`, such as with <NumberField.ScrubArea>. |
| 4729 |
// See https://github.com/mui/base-ui/pull/3379 |
| 4730 |
onPointerDown: markInsidePressStartPrevented, |
| 4731 |
onMouseDown: markInsidePressStartPrevented, |
| 4732 |
onClickCapture: markInsideReactTree, |
| 4733 |
onMouseDownCapture(event) { |
| 4734 |
markInsideReactTree(); |
| 4735 |
markPressStartedInsideReactTree(event); |
| 4736 |
}, |
| 4737 |
onPointerDownCapture(event) { |
| 4738 |
markInsideReactTree(); |
| 4739 |
markPressStartedInsideReactTree(event); |
| 4740 |
}, |
| 4741 |
onMouseUpCapture: markInsideReactTree, |
| 4742 |
onTouchEndCapture: markInsideReactTree, |
| 4743 |
onTouchMoveCapture: markInsideReactTree |
| 4744 |
}), [closeOnEscapeKeyDown, markInsideReactTree, markPressStartedInsideReactTree, markInsidePressStartPrevented]); |
| 4745 |
return React24.useMemo(() => enabled ? { |
| 4746 |
reference, |
| 4747 |
floating, |
| 4748 |
trigger: reference |
| 4749 |
} : {}, [enabled, reference, floating]); |
| 4750 |
} |
| 4751 |
|
| 4752 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useFloating.js |
| 4753 |
var React30 = __toESM(require_react(), 1); |
| 4754 |
|
| 4755 |
// node_modules/@floating-ui/core/dist/floating-ui.core.mjs |
| 4756 |
function computeCoordsFromPlacement(_ref, placement, rtl) { |
| 4757 |
let { |
| 4758 |
reference, |
| 4759 |
floating |
| 4760 |
} = _ref; |
| 4761 |
const sideAxis = getSideAxis(placement); |
| 4762 |
const alignmentAxis = getAlignmentAxis(placement); |
| 4763 |
const alignLength = getAxisLength(alignmentAxis); |
| 4764 |
const side = getSide(placement); |
| 4765 |
const isVertical = sideAxis === "y"; |
| 4766 |
const commonX = reference.x + reference.width / 2 - floating.width / 2; |
| 4767 |
const commonY = reference.y + reference.height / 2 - floating.height / 2; |
| 4768 |
const commonAlign = reference[alignLength] / 2 - floating[alignLength] / 2; |
| 4769 |
let coords; |
| 4770 |
switch (side) { |
| 4771 |
case "top": |
| 4772 |
coords = { |
| 4773 |
x: commonX, |
| 4774 |
y: reference.y - floating.height |
| 4775 |
}; |
| 4776 |
break; |
| 4777 |
case "bottom": |
| 4778 |
coords = { |
| 4779 |
x: commonX, |
| 4780 |
y: reference.y + reference.height |
| 4781 |
}; |
| 4782 |
break; |
| 4783 |
case "right": |
| 4784 |
coords = { |
| 4785 |
x: reference.x + reference.width, |
| 4786 |
y: commonY |
| 4787 |
}; |
| 4788 |
break; |
| 4789 |
case "left": |
| 4790 |
coords = { |
| 4791 |
x: reference.x - floating.width, |
| 4792 |
y: commonY |
| 4793 |
}; |
| 4794 |
break; |
| 4795 |
default: |
| 4796 |
coords = { |
| 4797 |
x: reference.x, |
| 4798 |
y: reference.y |
| 4799 |
}; |
| 4800 |
} |
| 4801 |
switch (getAlignment(placement)) { |
| 4802 |
case "start": |
| 4803 |
coords[alignmentAxis] -= commonAlign * (rtl && isVertical ? -1 : 1); |
| 4804 |
break; |
| 4805 |
case "end": |
| 4806 |
coords[alignmentAxis] += commonAlign * (rtl && isVertical ? -1 : 1); |
| 4807 |
break; |
| 4808 |
} |
| 4809 |
return coords; |
| 4810 |
} |
| 4811 |
async function detectOverflow(state, options) { |
| 4812 |
var _await$platform$isEle; |
| 4813 |
if (options === void 0) { |
| 4814 |
options = {}; |
| 4815 |
} |
| 4816 |
const { |
| 4817 |
x: x2, |
| 4818 |
y: y2, |
| 4819 |
platform: platform3, |
| 4820 |
rects, |
| 4821 |
elements, |
| 4822 |
strategy |
| 4823 |
} = state; |
| 4824 |
const { |
| 4825 |
boundary = "clippingAncestors", |
| 4826 |
rootBoundary = "viewport", |
| 4827 |
elementContext = "floating", |
| 4828 |
altBoundary = false, |
| 4829 |
padding = 0 |
| 4830 |
} = evaluate(options, state); |
| 4831 |
const paddingObject = getPaddingObject(padding); |
| 4832 |
const altContext = elementContext === "floating" ? "reference" : "floating"; |
| 4833 |
const element = elements[altBoundary ? altContext : elementContext]; |
| 4834 |
const clippingClientRect = rectToClientRect(await platform3.getClippingRect({ |
| 4835 |
element: ((_await$platform$isEle = await (platform3.isElement == null ? void 0 : platform3.isElement(element))) != null ? _await$platform$isEle : true) ? element : element.contextElement || await (platform3.getDocumentElement == null ? void 0 : platform3.getDocumentElement(elements.floating)), |
| 4836 |
boundary, |
| 4837 |
rootBoundary, |
| 4838 |
strategy |
| 4839 |
})); |
| 4840 |
const rect = elementContext === "floating" ? { |
| 4841 |
x: x2, |
| 4842 |
y: y2, |
| 4843 |
width: rects.floating.width, |
| 4844 |
height: rects.floating.height |
| 4845 |
} : rects.reference; |
| 4846 |
const offsetParent = await (platform3.getOffsetParent == null ? void 0 : platform3.getOffsetParent(elements.floating)); |
| 4847 |
const offsetScale = await (platform3.isElement == null ? void 0 : platform3.isElement(offsetParent)) ? await (platform3.getScale == null ? void 0 : platform3.getScale(offsetParent)) || { |
| 4848 |
x: 1, |
| 4849 |
y: 1 |
| 4850 |
} : { |
| 4851 |
x: 1, |
| 4852 |
y: 1 |
| 4853 |
}; |
| 4854 |
const elementClientRect = rectToClientRect(platform3.convertOffsetParentRelativeRectToViewportRelativeRect ? await platform3.convertOffsetParentRelativeRectToViewportRelativeRect({ |
| 4855 |
elements, |
| 4856 |
rect, |
| 4857 |
offsetParent, |
| 4858 |
strategy |
| 4859 |
}) : rect); |
| 4860 |
return { |
| 4861 |
top: (clippingClientRect.top - elementClientRect.top + paddingObject.top) / offsetScale.y, |
| 4862 |
bottom: (elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom) / offsetScale.y, |
| 4863 |
left: (clippingClientRect.left - elementClientRect.left + paddingObject.left) / offsetScale.x, |
| 4864 |
right: (elementClientRect.right - clippingClientRect.right + paddingObject.right) / offsetScale.x |
| 4865 |
}; |
| 4866 |
} |
| 4867 |
var MAX_RESET_COUNT = 50; |
| 4868 |
var computePosition = async (reference, floating, config) => { |
| 4869 |
const { |
| 4870 |
placement = "bottom", |
| 4871 |
strategy = "absolute", |
| 4872 |
middleware = [], |
| 4873 |
platform: platform3 |
| 4874 |
} = config; |
| 4875 |
const platformWithDetectOverflow = platform3.detectOverflow ? platform3 : { |
| 4876 |
...platform3, |
| 4877 |
detectOverflow |
| 4878 |
}; |
| 4879 |
const rtl = await (platform3.isRTL == null ? void 0 : platform3.isRTL(floating)); |
| 4880 |
let rects = await platform3.getElementRects({ |
| 4881 |
reference, |
| 4882 |
floating, |
| 4883 |
strategy |
| 4884 |
}); |
| 4885 |
let { |
| 4886 |
x: x2, |
| 4887 |
y: y2 |
| 4888 |
} = computeCoordsFromPlacement(rects, placement, rtl); |
| 4889 |
let statefulPlacement = placement; |
| 4890 |
let resetCount = 0; |
| 4891 |
const middlewareData = {}; |
| 4892 |
for (let i2 = 0; i2 < middleware.length; i2++) { |
| 4893 |
const currentMiddleware = middleware[i2]; |
| 4894 |
if (!currentMiddleware) { |
| 4895 |
continue; |
| 4896 |
} |
| 4897 |
const { |
| 4898 |
name, |
| 4899 |
fn |
| 4900 |
} = currentMiddleware; |
| 4901 |
const { |
| 4902 |
x: nextX, |
| 4903 |
y: nextY, |
| 4904 |
data, |
| 4905 |
reset |
| 4906 |
} = await fn({ |
| 4907 |
x: x2, |
| 4908 |
y: y2, |
| 4909 |
initialPlacement: placement, |
| 4910 |
placement: statefulPlacement, |
| 4911 |
strategy, |
| 4912 |
middlewareData, |
| 4913 |
rects, |
| 4914 |
platform: platformWithDetectOverflow, |
| 4915 |
elements: { |
| 4916 |
reference, |
| 4917 |
floating |
| 4918 |
} |
| 4919 |
}); |
| 4920 |
x2 = nextX != null ? nextX : x2; |
| 4921 |
y2 = nextY != null ? nextY : y2; |
| 4922 |
middlewareData[name] = { |
| 4923 |
...middlewareData[name], |
| 4924 |
...data |
| 4925 |
}; |
| 4926 |
if (reset && resetCount < MAX_RESET_COUNT) { |
| 4927 |
resetCount++; |
| 4928 |
if (typeof reset === "object") { |
| 4929 |
if (reset.placement) { |
| 4930 |
statefulPlacement = reset.placement; |
| 4931 |
} |
| 4932 |
if (reset.rects) { |
| 4933 |
rects = reset.rects === true ? await platform3.getElementRects({ |
| 4934 |
reference, |
| 4935 |
floating, |
| 4936 |
strategy |
| 4937 |
}) : reset.rects; |
| 4938 |
} |
| 4939 |
({ |
| 4940 |
x: x2, |
| 4941 |
y: y2 |
| 4942 |
} = computeCoordsFromPlacement(rects, statefulPlacement, rtl)); |
| 4943 |
} |
| 4944 |
i2 = -1; |
| 4945 |
} |
| 4946 |
} |
| 4947 |
return { |
| 4948 |
x: x2, |
| 4949 |
y: y2, |
| 4950 |
placement: statefulPlacement, |
| 4951 |
strategy, |
| 4952 |
middlewareData |
| 4953 |
}; |
| 4954 |
}; |
| 4955 |
var flip = function(options) { |
| 4956 |
if (options === void 0) { |
| 4957 |
options = {}; |
| 4958 |
} |
| 4959 |
return { |
| 4960 |
name: "flip", |
| 4961 |
options, |
| 4962 |
async fn(state) { |
| 4963 |
var _middlewareData$arrow, _middlewareData$flip; |
| 4964 |
const { |
| 4965 |
placement, |
| 4966 |
middlewareData, |
| 4967 |
rects, |
| 4968 |
initialPlacement, |
| 4969 |
platform: platform3, |
| 4970 |
elements |
| 4971 |
} = state; |
| 4972 |
const { |
| 4973 |
mainAxis: checkMainAxis = true, |
| 4974 |
crossAxis: checkCrossAxis = true, |
| 4975 |
fallbackPlacements: specifiedFallbackPlacements, |
| 4976 |
fallbackStrategy = "bestFit", |
| 4977 |
fallbackAxisSideDirection = "none", |
| 4978 |
flipAlignment = true, |
| 4979 |
...detectOverflowOptions |
| 4980 |
} = evaluate(options, state); |
| 4981 |
if ((_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) { |
| 4982 |
return {}; |
| 4983 |
} |
| 4984 |
const side = getSide(placement); |
| 4985 |
const initialSideAxis = getSideAxis(initialPlacement); |
| 4986 |
const isBasePlacement = getSide(initialPlacement) === initialPlacement; |
| 4987 |
const rtl = await (platform3.isRTL == null ? void 0 : platform3.isRTL(elements.floating)); |
| 4988 |
const fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipAlignment ? [getOppositePlacement(initialPlacement)] : getExpandedPlacements(initialPlacement)); |
| 4989 |
const hasFallbackAxisSideDirection = fallbackAxisSideDirection !== "none"; |
| 4990 |
if (!specifiedFallbackPlacements && hasFallbackAxisSideDirection) { |
| 4991 |
fallbackPlacements.push(...getOppositeAxisPlacements(initialPlacement, flipAlignment, fallbackAxisSideDirection, rtl)); |
| 4992 |
} |
| 4993 |
const placements2 = [initialPlacement, ...fallbackPlacements]; |
| 4994 |
const overflow = await platform3.detectOverflow(state, detectOverflowOptions); |
| 4995 |
const overflows = []; |
| 4996 |
let overflowsData = ((_middlewareData$flip = middlewareData.flip) == null ? void 0 : _middlewareData$flip.overflows) || []; |
| 4997 |
if (checkMainAxis) { |
| 4998 |
overflows.push(overflow[side]); |
| 4999 |
} |
| 5000 |
if (checkCrossAxis) { |
| 5001 |
const sides2 = getAlignmentSides(placement, rects, rtl); |
| 5002 |
overflows.push(overflow[sides2[0]], overflow[sides2[1]]); |
| 5003 |
} |
| 5004 |
overflowsData = [...overflowsData, { |
| 5005 |
placement, |
| 5006 |
overflows |
| 5007 |
}]; |
| 5008 |
if (!overflows.every((side2) => side2 <= 0)) { |
| 5009 |
var _middlewareData$flip2, _overflowsData$filter; |
| 5010 |
const nextIndex = (((_middlewareData$flip2 = middlewareData.flip) == null ? void 0 : _middlewareData$flip2.index) || 0) + 1; |
| 5011 |
const nextPlacement = placements2[nextIndex]; |
| 5012 |
if (nextPlacement) { |
| 5013 |
const ignoreCrossAxisOverflow = checkCrossAxis === "alignment" ? initialSideAxis !== getSideAxis(nextPlacement) : false; |
| 5014 |
if (!ignoreCrossAxisOverflow || // We leave the current main axis only if every placement on that axis |
| 5015 |
// overflows the main axis. |
| 5016 |
overflowsData.every((d2) => getSideAxis(d2.placement) === initialSideAxis ? d2.overflows[0] > 0 : true)) { |
| 5017 |
return { |
| 5018 |
data: { |
| 5019 |
index: nextIndex, |
| 5020 |
overflows: overflowsData |
| 5021 |
}, |
| 5022 |
reset: { |
| 5023 |
placement: nextPlacement |
| 5024 |
} |
| 5025 |
}; |
| 5026 |
} |
| 5027 |
} |
| 5028 |
let resetPlacement = (_overflowsData$filter = overflowsData.filter((d2) => d2.overflows[0] <= 0).sort((a2, b2) => a2.overflows[1] - b2.overflows[1])[0]) == null ? void 0 : _overflowsData$filter.placement; |
| 5029 |
if (!resetPlacement) { |
| 5030 |
switch (fallbackStrategy) { |
| 5031 |
case "bestFit": { |
| 5032 |
var _overflowsData$filter2; |
| 5033 |
const placement2 = (_overflowsData$filter2 = overflowsData.filter((d2) => { |
| 5034 |
if (hasFallbackAxisSideDirection) { |
| 5035 |
const currentSideAxis = getSideAxis(d2.placement); |
| 5036 |
return currentSideAxis === initialSideAxis || // Create a bias to the `y` side axis due to horizontal |
| 5037 |
// reading directions favoring greater width. |
| 5038 |
currentSideAxis === "y"; |
| 5039 |
} |
| 5040 |
return true; |
| 5041 |
}).map((d2) => [d2.placement, d2.overflows.filter((overflow2) => overflow2 > 0).reduce((acc, overflow2) => acc + overflow2, 0)]).sort((a2, b2) => a2[1] - b2[1])[0]) == null ? void 0 : _overflowsData$filter2[0]; |
| 5042 |
if (placement2) { |
| 5043 |
resetPlacement = placement2; |
| 5044 |
} |
| 5045 |
break; |
| 5046 |
} |
| 5047 |
case "initialPlacement": |
| 5048 |
resetPlacement = initialPlacement; |
| 5049 |
break; |
| 5050 |
} |
| 5051 |
} |
| 5052 |
if (placement !== resetPlacement) { |
| 5053 |
return { |
| 5054 |
reset: { |
| 5055 |
placement: resetPlacement |
| 5056 |
} |
| 5057 |
}; |
| 5058 |
} |
| 5059 |
} |
| 5060 |
return {}; |
| 5061 |
} |
| 5062 |
}; |
| 5063 |
}; |
| 5064 |
function getSideOffsets(overflow, rect) { |
| 5065 |
return { |
| 5066 |
top: overflow.top - rect.height, |
| 5067 |
right: overflow.right - rect.width, |
| 5068 |
bottom: overflow.bottom - rect.height, |
| 5069 |
left: overflow.left - rect.width |
| 5070 |
}; |
| 5071 |
} |
| 5072 |
function isAnySideFullyClipped(overflow) { |
| 5073 |
return sides.some((side) => overflow[side] >= 0); |
| 5074 |
} |
| 5075 |
var hide = function(options) { |
| 5076 |
if (options === void 0) { |
| 5077 |
options = {}; |
| 5078 |
} |
| 5079 |
return { |
| 5080 |
name: "hide", |
| 5081 |
options, |
| 5082 |
async fn(state) { |
| 5083 |
const { |
| 5084 |
rects, |
| 5085 |
platform: platform3 |
| 5086 |
} = state; |
| 5087 |
const { |
| 5088 |
strategy = "referenceHidden", |
| 5089 |
...detectOverflowOptions |
| 5090 |
} = evaluate(options, state); |
| 5091 |
switch (strategy) { |
| 5092 |
case "referenceHidden": { |
| 5093 |
const overflow = await platform3.detectOverflow(state, { |
| 5094 |
...detectOverflowOptions, |
| 5095 |
elementContext: "reference" |
| 5096 |
}); |
| 5097 |
const offsets = getSideOffsets(overflow, rects.reference); |
| 5098 |
return { |
| 5099 |
data: { |
| 5100 |
referenceHiddenOffsets: offsets, |
| 5101 |
referenceHidden: isAnySideFullyClipped(offsets) |
| 5102 |
} |
| 5103 |
}; |
| 5104 |
} |
| 5105 |
case "escaped": { |
| 5106 |
const overflow = await platform3.detectOverflow(state, { |
| 5107 |
...detectOverflowOptions, |
| 5108 |
altBoundary: true |
| 5109 |
}); |
| 5110 |
const offsets = getSideOffsets(overflow, rects.floating); |
| 5111 |
return { |
| 5112 |
data: { |
| 5113 |
escapedOffsets: offsets, |
| 5114 |
escaped: isAnySideFullyClipped(offsets) |
| 5115 |
} |
| 5116 |
}; |
| 5117 |
} |
| 5118 |
default: { |
| 5119 |
return {}; |
| 5120 |
} |
| 5121 |
} |
| 5122 |
} |
| 5123 |
}; |
| 5124 |
}; |
| 5125 |
var originSides = /* @__PURE__ */ new Set(["left", "top"]); |
| 5126 |
async function convertValueToCoords(state, options) { |
| 5127 |
const { |
| 5128 |
placement, |
| 5129 |
platform: platform3, |
| 5130 |
elements |
| 5131 |
} = state; |
| 5132 |
const rtl = await (platform3.isRTL == null ? void 0 : platform3.isRTL(elements.floating)); |
| 5133 |
const side = getSide(placement); |
| 5134 |
const alignment = getAlignment(placement); |
| 5135 |
const isVertical = getSideAxis(placement) === "y"; |
| 5136 |
const mainAxisMulti = originSides.has(side) ? -1 : 1; |
| 5137 |
const crossAxisMulti = rtl && isVertical ? -1 : 1; |
| 5138 |
const rawValue = evaluate(options, state); |
| 5139 |
let { |
| 5140 |
mainAxis, |
| 5141 |
crossAxis, |
| 5142 |
alignmentAxis |
| 5143 |
} = typeof rawValue === "number" ? { |
| 5144 |
mainAxis: rawValue, |
| 5145 |
crossAxis: 0, |
| 5146 |
alignmentAxis: null |
| 5147 |
} : { |
| 5148 |
mainAxis: rawValue.mainAxis || 0, |
| 5149 |
crossAxis: rawValue.crossAxis || 0, |
| 5150 |
alignmentAxis: rawValue.alignmentAxis |
| 5151 |
}; |
| 5152 |
if (alignment && typeof alignmentAxis === "number") { |
| 5153 |
crossAxis = alignment === "end" ? alignmentAxis * -1 : alignmentAxis; |
| 5154 |
} |
| 5155 |
return isVertical ? { |
| 5156 |
x: crossAxis * crossAxisMulti, |
| 5157 |
y: mainAxis * mainAxisMulti |
| 5158 |
} : { |
| 5159 |
x: mainAxis * mainAxisMulti, |
| 5160 |
y: crossAxis * crossAxisMulti |
| 5161 |
}; |
| 5162 |
} |
| 5163 |
var offset = function(options) { |
| 5164 |
if (options === void 0) { |
| 5165 |
options = 0; |
| 5166 |
} |
| 5167 |
return { |
| 5168 |
name: "offset", |
| 5169 |
options, |
| 5170 |
async fn(state) { |
| 5171 |
var _middlewareData$offse, _middlewareData$arrow; |
| 5172 |
const { |
| 5173 |
x: x2, |
| 5174 |
y: y2, |
| 5175 |
placement, |
| 5176 |
middlewareData |
| 5177 |
} = state; |
| 5178 |
const diffCoords = await convertValueToCoords(state, options); |
| 5179 |
if (placement === ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse.placement) && (_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) { |
| 5180 |
return {}; |
| 5181 |
} |
| 5182 |
return { |
| 5183 |
x: x2 + diffCoords.x, |
| 5184 |
y: y2 + diffCoords.y, |
| 5185 |
data: { |
| 5186 |
...diffCoords, |
| 5187 |
placement |
| 5188 |
} |
| 5189 |
}; |
| 5190 |
} |
| 5191 |
}; |
| 5192 |
}; |
| 5193 |
var shift = function(options) { |
| 5194 |
if (options === void 0) { |
| 5195 |
options = {}; |
| 5196 |
} |
| 5197 |
return { |
| 5198 |
name: "shift", |
| 5199 |
options, |
| 5200 |
async fn(state) { |
| 5201 |
const { |
| 5202 |
x: x2, |
| 5203 |
y: y2, |
| 5204 |
placement, |
| 5205 |
platform: platform3 |
| 5206 |
} = state; |
| 5207 |
const { |
| 5208 |
mainAxis: checkMainAxis = true, |
| 5209 |
crossAxis: checkCrossAxis = false, |
| 5210 |
limiter = { |
| 5211 |
fn: (_ref) => { |
| 5212 |
let { |
| 5213 |
x: x3, |
| 5214 |
y: y3 |
| 5215 |
} = _ref; |
| 5216 |
return { |
| 5217 |
x: x3, |
| 5218 |
y: y3 |
| 5219 |
}; |
| 5220 |
} |
| 5221 |
}, |
| 5222 |
...detectOverflowOptions |
| 5223 |
} = evaluate(options, state); |
| 5224 |
const coords = { |
| 5225 |
x: x2, |
| 5226 |
y: y2 |
| 5227 |
}; |
| 5228 |
const overflow = await platform3.detectOverflow(state, detectOverflowOptions); |
| 5229 |
const crossAxis = getSideAxis(getSide(placement)); |
| 5230 |
const mainAxis = getOppositeAxis(crossAxis); |
| 5231 |
let mainAxisCoord = coords[mainAxis]; |
| 5232 |
let crossAxisCoord = coords[crossAxis]; |
| 5233 |
if (checkMainAxis) { |
| 5234 |
const minSide = mainAxis === "y" ? "top" : "left"; |
| 5235 |
const maxSide = mainAxis === "y" ? "bottom" : "right"; |
| 5236 |
const min2 = mainAxisCoord + overflow[minSide]; |
| 5237 |
const max2 = mainAxisCoord - overflow[maxSide]; |
| 5238 |
mainAxisCoord = clamp(min2, mainAxisCoord, max2); |
| 5239 |
} |
| 5240 |
if (checkCrossAxis) { |
| 5241 |
const minSide = crossAxis === "y" ? "top" : "left"; |
| 5242 |
const maxSide = crossAxis === "y" ? "bottom" : "right"; |
| 5243 |
const min2 = crossAxisCoord + overflow[minSide]; |
| 5244 |
const max2 = crossAxisCoord - overflow[maxSide]; |
| 5245 |
crossAxisCoord = clamp(min2, crossAxisCoord, max2); |
| 5246 |
} |
| 5247 |
const limitedCoords = limiter.fn({ |
| 5248 |
...state, |
| 5249 |
[mainAxis]: mainAxisCoord, |
| 5250 |
[crossAxis]: crossAxisCoord |
| 5251 |
}); |
| 5252 |
return { |
| 5253 |
...limitedCoords, |
| 5254 |
data: { |
| 5255 |
x: limitedCoords.x - x2, |
| 5256 |
y: limitedCoords.y - y2, |
| 5257 |
enabled: { |
| 5258 |
[mainAxis]: checkMainAxis, |
| 5259 |
[crossAxis]: checkCrossAxis |
| 5260 |
} |
| 5261 |
} |
| 5262 |
}; |
| 5263 |
} |
| 5264 |
}; |
| 5265 |
}; |
| 5266 |
var limitShift = function(options) { |
| 5267 |
if (options === void 0) { |
| 5268 |
options = {}; |
| 5269 |
} |
| 5270 |
return { |
| 5271 |
options, |
| 5272 |
fn(state) { |
| 5273 |
const { |
| 5274 |
x: x2, |
| 5275 |
y: y2, |
| 5276 |
placement, |
| 5277 |
rects, |
| 5278 |
middlewareData |
| 5279 |
} = state; |
| 5280 |
const { |
| 5281 |
offset: offset4 = 0, |
| 5282 |
mainAxis: checkMainAxis = true, |
| 5283 |
crossAxis: checkCrossAxis = true |
| 5284 |
} = evaluate(options, state); |
| 5285 |
const coords = { |
| 5286 |
x: x2, |
| 5287 |
y: y2 |
| 5288 |
}; |
| 5289 |
const crossAxis = getSideAxis(placement); |
| 5290 |
const mainAxis = getOppositeAxis(crossAxis); |
| 5291 |
let mainAxisCoord = coords[mainAxis]; |
| 5292 |
let crossAxisCoord = coords[crossAxis]; |
| 5293 |
const rawOffset = evaluate(offset4, state); |
| 5294 |
const computedOffset = typeof rawOffset === "number" ? { |
| 5295 |
mainAxis: rawOffset, |
| 5296 |
crossAxis: 0 |
| 5297 |
} : { |
| 5298 |
mainAxis: 0, |
| 5299 |
crossAxis: 0, |
| 5300 |
...rawOffset |
| 5301 |
}; |
| 5302 |
if (checkMainAxis) { |
| 5303 |
const len = mainAxis === "y" ? "height" : "width"; |
| 5304 |
const limitMin = rects.reference[mainAxis] - rects.floating[len] + computedOffset.mainAxis; |
| 5305 |
const limitMax = rects.reference[mainAxis] + rects.reference[len] - computedOffset.mainAxis; |
| 5306 |
if (mainAxisCoord < limitMin) { |
| 5307 |
mainAxisCoord = limitMin; |
| 5308 |
} else if (mainAxisCoord > limitMax) { |
| 5309 |
mainAxisCoord = limitMax; |
| 5310 |
} |
| 5311 |
} |
| 5312 |
if (checkCrossAxis) { |
| 5313 |
var _middlewareData$offse, _middlewareData$offse2; |
| 5314 |
const len = mainAxis === "y" ? "width" : "height"; |
| 5315 |
const isOriginSide = originSides.has(getSide(placement)); |
| 5316 |
const limitMin = rects.reference[crossAxis] - rects.floating[len] + (isOriginSide ? ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse[crossAxis]) || 0 : 0) + (isOriginSide ? 0 : computedOffset.crossAxis); |
| 5317 |
const limitMax = rects.reference[crossAxis] + rects.reference[len] + (isOriginSide ? 0 : ((_middlewareData$offse2 = middlewareData.offset) == null ? void 0 : _middlewareData$offse2[crossAxis]) || 0) - (isOriginSide ? computedOffset.crossAxis : 0); |
| 5318 |
if (crossAxisCoord < limitMin) { |
| 5319 |
crossAxisCoord = limitMin; |
| 5320 |
} else if (crossAxisCoord > limitMax) { |
| 5321 |
crossAxisCoord = limitMax; |
| 5322 |
} |
| 5323 |
} |
| 5324 |
return { |
| 5325 |
[mainAxis]: mainAxisCoord, |
| 5326 |
[crossAxis]: crossAxisCoord |
| 5327 |
}; |
| 5328 |
} |
| 5329 |
}; |
| 5330 |
}; |
| 5331 |
var size = function(options) { |
| 5332 |
if (options === void 0) { |
| 5333 |
options = {}; |
| 5334 |
} |
| 5335 |
return { |
| 5336 |
name: "size", |
| 5337 |
options, |
| 5338 |
async fn(state) { |
| 5339 |
var _state$middlewareData, _state$middlewareData2; |
| 5340 |
const { |
| 5341 |
placement, |
| 5342 |
rects, |
| 5343 |
platform: platform3, |
| 5344 |
elements |
| 5345 |
} = state; |
| 5346 |
const { |
| 5347 |
apply = () => { |
| 5348 |
}, |
| 5349 |
...detectOverflowOptions |
| 5350 |
} = evaluate(options, state); |
| 5351 |
const overflow = await platform3.detectOverflow(state, detectOverflowOptions); |
| 5352 |
const side = getSide(placement); |
| 5353 |
const alignment = getAlignment(placement); |
| 5354 |
const isYAxis = getSideAxis(placement) === "y"; |
| 5355 |
const { |
| 5356 |
width, |
| 5357 |
height |
| 5358 |
} = rects.floating; |
| 5359 |
let heightSide; |
| 5360 |
let widthSide; |
| 5361 |
if (side === "top" || side === "bottom") { |
| 5362 |
heightSide = side; |
| 5363 |
widthSide = alignment === (await (platform3.isRTL == null ? void 0 : platform3.isRTL(elements.floating)) ? "start" : "end") ? "left" : "right"; |
| 5364 |
} else { |
| 5365 |
widthSide = side; |
| 5366 |
heightSide = alignment === "end" ? "top" : "bottom"; |
| 5367 |
} |
| 5368 |
const maximumClippingHeight = height - overflow.top - overflow.bottom; |
| 5369 |
const maximumClippingWidth = width - overflow.left - overflow.right; |
| 5370 |
const overflowAvailableHeight = min(height - overflow[heightSide], maximumClippingHeight); |
| 5371 |
const overflowAvailableWidth = min(width - overflow[widthSide], maximumClippingWidth); |
| 5372 |
const noShift = !state.middlewareData.shift; |
| 5373 |
let availableHeight = overflowAvailableHeight; |
| 5374 |
let availableWidth = overflowAvailableWidth; |
| 5375 |
if ((_state$middlewareData = state.middlewareData.shift) != null && _state$middlewareData.enabled.x) { |
| 5376 |
availableWidth = maximumClippingWidth; |
| 5377 |
} |
| 5378 |
if ((_state$middlewareData2 = state.middlewareData.shift) != null && _state$middlewareData2.enabled.y) { |
| 5379 |
availableHeight = maximumClippingHeight; |
| 5380 |
} |
| 5381 |
if (noShift && !alignment) { |
| 5382 |
const xMin = max(overflow.left, 0); |
| 5383 |
const xMax = max(overflow.right, 0); |
| 5384 |
const yMin = max(overflow.top, 0); |
| 5385 |
const yMax = max(overflow.bottom, 0); |
| 5386 |
if (isYAxis) { |
| 5387 |
availableWidth = width - 2 * (xMin !== 0 || xMax !== 0 ? xMin + xMax : max(overflow.left, overflow.right)); |
| 5388 |
} else { |
| 5389 |
availableHeight = height - 2 * (yMin !== 0 || yMax !== 0 ? yMin + yMax : max(overflow.top, overflow.bottom)); |
| 5390 |
} |
| 5391 |
} |
| 5392 |
await apply({ |
| 5393 |
...state, |
| 5394 |
availableWidth, |
| 5395 |
availableHeight |
| 5396 |
}); |
| 5397 |
const nextDimensions = await platform3.getDimensions(elements.floating); |
| 5398 |
if (width !== nextDimensions.width || height !== nextDimensions.height) { |
| 5399 |
return { |
| 5400 |
reset: { |
| 5401 |
rects: true |
| 5402 |
} |
| 5403 |
}; |
| 5404 |
} |
| 5405 |
return {}; |
| 5406 |
} |
| 5407 |
}; |
| 5408 |
}; |
| 5409 |
|
| 5410 |
// node_modules/@floating-ui/dom/dist/floating-ui.dom.mjs |
| 5411 |
function getCssDimensions(element) { |
| 5412 |
const css = getComputedStyle2(element); |
| 5413 |
let width = parseFloat(css.width) || 0; |
| 5414 |
let height = parseFloat(css.height) || 0; |
| 5415 |
const hasOffset = isHTMLElement(element); |
| 5416 |
const offsetWidth = hasOffset ? element.offsetWidth : width; |
| 5417 |
const offsetHeight = hasOffset ? element.offsetHeight : height; |
| 5418 |
const shouldFallback = round(width) !== offsetWidth || round(height) !== offsetHeight; |
| 5419 |
if (shouldFallback) { |
| 5420 |
width = offsetWidth; |
| 5421 |
height = offsetHeight; |
| 5422 |
} |
| 5423 |
return { |
| 5424 |
width, |
| 5425 |
height, |
| 5426 |
$: shouldFallback |
| 5427 |
}; |
| 5428 |
} |
| 5429 |
function unwrapElement(element) { |
| 5430 |
return !isElement(element) ? element.contextElement : element; |
| 5431 |
} |
| 5432 |
function getScale(element) { |
| 5433 |
const domElement = unwrapElement(element); |
| 5434 |
if (!isHTMLElement(domElement)) { |
| 5435 |
return createCoords(1); |
| 5436 |
} |
| 5437 |
const rect = domElement.getBoundingClientRect(); |
| 5438 |
const { |
| 5439 |
width, |
| 5440 |
height, |
| 5441 |
$: $2 |
| 5442 |
} = getCssDimensions(domElement); |
| 5443 |
let x2 = ($2 ? round(rect.width) : rect.width) / width; |
| 5444 |
let y2 = ($2 ? round(rect.height) : rect.height) / height; |
| 5445 |
if (!x2 || !Number.isFinite(x2)) { |
| 5446 |
x2 = 1; |
| 5447 |
} |
| 5448 |
if (!y2 || !Number.isFinite(y2)) { |
| 5449 |
y2 = 1; |
| 5450 |
} |
| 5451 |
return { |
| 5452 |
x: x2, |
| 5453 |
y: y2 |
| 5454 |
}; |
| 5455 |
} |
| 5456 |
var noOffsets = /* @__PURE__ */ createCoords(0); |
| 5457 |
function getVisualOffsets(element) { |
| 5458 |
const win = getWindow(element); |
| 5459 |
if (!isWebKit() || !win.visualViewport) { |
| 5460 |
return noOffsets; |
| 5461 |
} |
| 5462 |
return { |
| 5463 |
x: win.visualViewport.offsetLeft, |
| 5464 |
y: win.visualViewport.offsetTop |
| 5465 |
}; |
| 5466 |
} |
| 5467 |
function shouldAddVisualOffsets(element, isFixed2, floatingOffsetParent) { |
| 5468 |
if (isFixed2 === void 0) { |
| 5469 |
isFixed2 = false; |
| 5470 |
} |
| 5471 |
if (!floatingOffsetParent || isFixed2 && floatingOffsetParent !== getWindow(element)) { |
| 5472 |
return false; |
| 5473 |
} |
| 5474 |
return isFixed2; |
| 5475 |
} |
| 5476 |
function getBoundingClientRect(element, includeScale, isFixedStrategy, offsetParent) { |
| 5477 |
if (includeScale === void 0) { |
| 5478 |
includeScale = false; |
| 5479 |
} |
| 5480 |
if (isFixedStrategy === void 0) { |
| 5481 |
isFixedStrategy = false; |
| 5482 |
} |
| 5483 |
const clientRect = element.getBoundingClientRect(); |
| 5484 |
const domElement = unwrapElement(element); |
| 5485 |
let scale = createCoords(1); |
| 5486 |
if (includeScale) { |
| 5487 |
if (offsetParent) { |
| 5488 |
if (isElement(offsetParent)) { |
| 5489 |
scale = getScale(offsetParent); |
| 5490 |
} |
| 5491 |
} else { |
| 5492 |
scale = getScale(element); |
| 5493 |
} |
| 5494 |
} |
| 5495 |
const visualOffsets = shouldAddVisualOffsets(domElement, isFixedStrategy, offsetParent) ? getVisualOffsets(domElement) : createCoords(0); |
| 5496 |
let x2 = (clientRect.left + visualOffsets.x) / scale.x; |
| 5497 |
let y2 = (clientRect.top + visualOffsets.y) / scale.y; |
| 5498 |
let width = clientRect.width / scale.x; |
| 5499 |
let height = clientRect.height / scale.y; |
| 5500 |
if (domElement) { |
| 5501 |
const win = getWindow(domElement); |
| 5502 |
const offsetWin = offsetParent && isElement(offsetParent) ? getWindow(offsetParent) : offsetParent; |
| 5503 |
let currentWin = win; |
| 5504 |
let currentIFrame = getFrameElement(currentWin); |
| 5505 |
while (currentIFrame && offsetParent && offsetWin !== currentWin) { |
| 5506 |
const iframeScale = getScale(currentIFrame); |
| 5507 |
const iframeRect = currentIFrame.getBoundingClientRect(); |
| 5508 |
const css = getComputedStyle2(currentIFrame); |
| 5509 |
const left = iframeRect.left + (currentIFrame.clientLeft + parseFloat(css.paddingLeft)) * iframeScale.x; |
| 5510 |
const top = iframeRect.top + (currentIFrame.clientTop + parseFloat(css.paddingTop)) * iframeScale.y; |
| 5511 |
x2 *= iframeScale.x; |
| 5512 |
y2 *= iframeScale.y; |
| 5513 |
width *= iframeScale.x; |
| 5514 |
height *= iframeScale.y; |
| 5515 |
x2 += left; |
| 5516 |
y2 += top; |
| 5517 |
currentWin = getWindow(currentIFrame); |
| 5518 |
currentIFrame = getFrameElement(currentWin); |
| 5519 |
} |
| 5520 |
} |
| 5521 |
return rectToClientRect({ |
| 5522 |
width, |
| 5523 |
height, |
| 5524 |
x: x2, |
| 5525 |
y: y2 |
| 5526 |
}); |
| 5527 |
} |
| 5528 |
function getWindowScrollBarX(element, rect) { |
| 5529 |
const leftScroll = getNodeScroll(element).scrollLeft; |
| 5530 |
if (!rect) { |
| 5531 |
return getBoundingClientRect(getDocumentElement(element)).left + leftScroll; |
| 5532 |
} |
| 5533 |
return rect.left + leftScroll; |
| 5534 |
} |
| 5535 |
function getHTMLOffset(documentElement, scroll) { |
| 5536 |
const htmlRect = documentElement.getBoundingClientRect(); |
| 5537 |
const x2 = htmlRect.left + scroll.scrollLeft - getWindowScrollBarX(documentElement, htmlRect); |
| 5538 |
const y2 = htmlRect.top + scroll.scrollTop; |
| 5539 |
return { |
| 5540 |
x: x2, |
| 5541 |
y: y2 |
| 5542 |
}; |
| 5543 |
} |
| 5544 |
function convertOffsetParentRelativeRectToViewportRelativeRect(_ref) { |
| 5545 |
let { |
| 5546 |
elements, |
| 5547 |
rect, |
| 5548 |
offsetParent, |
| 5549 |
strategy |
| 5550 |
} = _ref; |
| 5551 |
const isFixed2 = strategy === "fixed"; |
| 5552 |
const documentElement = getDocumentElement(offsetParent); |
| 5553 |
const topLayer = elements ? isTopLayer(elements.floating) : false; |
| 5554 |
if (offsetParent === documentElement || topLayer && isFixed2) { |
| 5555 |
return rect; |
| 5556 |
} |
| 5557 |
let scroll = { |
| 5558 |
scrollLeft: 0, |
| 5559 |
scrollTop: 0 |
| 5560 |
}; |
| 5561 |
let scale = createCoords(1); |
| 5562 |
const offsets = createCoords(0); |
| 5563 |
const isOffsetParentAnElement = isHTMLElement(offsetParent); |
| 5564 |
if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed2) { |
| 5565 |
if (getNodeName(offsetParent) !== "body" || isOverflowElement(documentElement)) { |
| 5566 |
scroll = getNodeScroll(offsetParent); |
| 5567 |
} |
| 5568 |
if (isOffsetParentAnElement) { |
| 5569 |
const offsetRect = getBoundingClientRect(offsetParent); |
| 5570 |
scale = getScale(offsetParent); |
| 5571 |
offsets.x = offsetRect.x + offsetParent.clientLeft; |
| 5572 |
offsets.y = offsetRect.y + offsetParent.clientTop; |
| 5573 |
} |
| 5574 |
} |
| 5575 |
const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed2 ? getHTMLOffset(documentElement, scroll) : createCoords(0); |
| 5576 |
return { |
| 5577 |
width: rect.width * scale.x, |
| 5578 |
height: rect.height * scale.y, |
| 5579 |
x: rect.x * scale.x - scroll.scrollLeft * scale.x + offsets.x + htmlOffset.x, |
| 5580 |
y: rect.y * scale.y - scroll.scrollTop * scale.y + offsets.y + htmlOffset.y |
| 5581 |
}; |
| 5582 |
} |
| 5583 |
function getClientRects(element) { |
| 5584 |
return Array.from(element.getClientRects()); |
| 5585 |
} |
| 5586 |
function getDocumentRect(element) { |
| 5587 |
const html = getDocumentElement(element); |
| 5588 |
const scroll = getNodeScroll(element); |
| 5589 |
const body = element.ownerDocument.body; |
| 5590 |
const width = max(html.scrollWidth, html.clientWidth, body.scrollWidth, body.clientWidth); |
| 5591 |
const height = max(html.scrollHeight, html.clientHeight, body.scrollHeight, body.clientHeight); |
| 5592 |
let x2 = -scroll.scrollLeft + getWindowScrollBarX(element); |
| 5593 |
const y2 = -scroll.scrollTop; |
| 5594 |
if (getComputedStyle2(body).direction === "rtl") { |
| 5595 |
x2 += max(html.clientWidth, body.clientWidth) - width; |
| 5596 |
} |
| 5597 |
return { |
| 5598 |
width, |
| 5599 |
height, |
| 5600 |
x: x2, |
| 5601 |
y: y2 |
| 5602 |
}; |
| 5603 |
} |
| 5604 |
var SCROLLBAR_MAX = 25; |
| 5605 |
function getViewportRect(element, strategy) { |
| 5606 |
const win = getWindow(element); |
| 5607 |
const html = getDocumentElement(element); |
| 5608 |
const visualViewport = win.visualViewport; |
| 5609 |
let width = html.clientWidth; |
| 5610 |
let height = html.clientHeight; |
| 5611 |
let x2 = 0; |
| 5612 |
let y2 = 0; |
| 5613 |
if (visualViewport) { |
| 5614 |
width = visualViewport.width; |
| 5615 |
height = visualViewport.height; |
| 5616 |
const visualViewportBased = isWebKit(); |
| 5617 |
if (!visualViewportBased || visualViewportBased && strategy === "fixed") { |
| 5618 |
x2 = visualViewport.offsetLeft; |
| 5619 |
y2 = visualViewport.offsetTop; |
| 5620 |
} |
| 5621 |
} |
| 5622 |
const windowScrollbarX = getWindowScrollBarX(html); |
| 5623 |
if (windowScrollbarX <= 0) { |
| 5624 |
const doc = html.ownerDocument; |
| 5625 |
const body = doc.body; |
| 5626 |
const bodyStyles = getComputedStyle(body); |
| 5627 |
const bodyMarginInline = doc.compatMode === "CSS1Compat" ? parseFloat(bodyStyles.marginLeft) + parseFloat(bodyStyles.marginRight) || 0 : 0; |
| 5628 |
const clippingStableScrollbarWidth = Math.abs(html.clientWidth - body.clientWidth - bodyMarginInline); |
| 5629 |
if (clippingStableScrollbarWidth <= SCROLLBAR_MAX) { |
| 5630 |
width -= clippingStableScrollbarWidth; |
| 5631 |
} |
| 5632 |
} else if (windowScrollbarX <= SCROLLBAR_MAX) { |
| 5633 |
width += windowScrollbarX; |
| 5634 |
} |
| 5635 |
return { |
| 5636 |
width, |
| 5637 |
height, |
| 5638 |
x: x2, |
| 5639 |
y: y2 |
| 5640 |
}; |
| 5641 |
} |
| 5642 |
function getInnerBoundingClientRect(element, strategy) { |
| 5643 |
const clientRect = getBoundingClientRect(element, true, strategy === "fixed"); |
| 5644 |
const top = clientRect.top + element.clientTop; |
| 5645 |
const left = clientRect.left + element.clientLeft; |
| 5646 |
const scale = isHTMLElement(element) ? getScale(element) : createCoords(1); |
| 5647 |
const width = element.clientWidth * scale.x; |
| 5648 |
const height = element.clientHeight * scale.y; |
| 5649 |
const x2 = left * scale.x; |
| 5650 |
const y2 = top * scale.y; |
| 5651 |
return { |
| 5652 |
width, |
| 5653 |
height, |
| 5654 |
x: x2, |
| 5655 |
y: y2 |
| 5656 |
}; |
| 5657 |
} |
| 5658 |
function getClientRectFromClippingAncestor(element, clippingAncestor, strategy) { |
| 5659 |
let rect; |
| 5660 |
if (clippingAncestor === "viewport") { |
| 5661 |
rect = getViewportRect(element, strategy); |
| 5662 |
} else if (clippingAncestor === "document") { |
| 5663 |
rect = getDocumentRect(getDocumentElement(element)); |
| 5664 |
} else if (isElement(clippingAncestor)) { |
| 5665 |
rect = getInnerBoundingClientRect(clippingAncestor, strategy); |
| 5666 |
} else { |
| 5667 |
const visualOffsets = getVisualOffsets(element); |
| 5668 |
rect = { |
| 5669 |
x: clippingAncestor.x - visualOffsets.x, |
| 5670 |
y: clippingAncestor.y - visualOffsets.y, |
| 5671 |
width: clippingAncestor.width, |
| 5672 |
height: clippingAncestor.height |
| 5673 |
}; |
| 5674 |
} |
| 5675 |
return rectToClientRect(rect); |
| 5676 |
} |
| 5677 |
function hasFixedPositionAncestor(element, stopNode) { |
| 5678 |
const parentNode = getParentNode(element); |
| 5679 |
if (parentNode === stopNode || !isElement(parentNode) || isLastTraversableNode(parentNode)) { |
| 5680 |
return false; |
| 5681 |
} |
| 5682 |
return getComputedStyle2(parentNode).position === "fixed" || hasFixedPositionAncestor(parentNode, stopNode); |
| 5683 |
} |
| 5684 |
function getClippingElementAncestors(element, cache) { |
| 5685 |
const cachedResult = cache.get(element); |
| 5686 |
if (cachedResult) { |
| 5687 |
return cachedResult; |
| 5688 |
} |
| 5689 |
let result = getOverflowAncestors(element, [], false).filter((el) => isElement(el) && getNodeName(el) !== "body"); |
| 5690 |
let currentContainingBlockComputedStyle = null; |
| 5691 |
const elementIsFixed = getComputedStyle2(element).position === "fixed"; |
| 5692 |
let currentNode = elementIsFixed ? getParentNode(element) : element; |
| 5693 |
while (isElement(currentNode) && !isLastTraversableNode(currentNode)) { |
| 5694 |
const computedStyle = getComputedStyle2(currentNode); |
| 5695 |
const currentNodeIsContaining = isContainingBlock(currentNode); |
| 5696 |
if (!currentNodeIsContaining && computedStyle.position === "fixed") { |
| 5697 |
currentContainingBlockComputedStyle = null; |
| 5698 |
} |
| 5699 |
const shouldDropCurrentNode = elementIsFixed ? !currentNodeIsContaining && !currentContainingBlockComputedStyle : !currentNodeIsContaining && computedStyle.position === "static" && !!currentContainingBlockComputedStyle && (currentContainingBlockComputedStyle.position === "absolute" || currentContainingBlockComputedStyle.position === "fixed") || isOverflowElement(currentNode) && !currentNodeIsContaining && hasFixedPositionAncestor(element, currentNode); |
| 5700 |
if (shouldDropCurrentNode) { |
| 5701 |
result = result.filter((ancestor) => ancestor !== currentNode); |
| 5702 |
} else { |
| 5703 |
currentContainingBlockComputedStyle = computedStyle; |
| 5704 |
} |
| 5705 |
currentNode = getParentNode(currentNode); |
| 5706 |
} |
| 5707 |
cache.set(element, result); |
| 5708 |
return result; |
| 5709 |
} |
| 5710 |
function getClippingRect(_ref) { |
| 5711 |
let { |
| 5712 |
element, |
| 5713 |
boundary, |
| 5714 |
rootBoundary, |
| 5715 |
strategy |
| 5716 |
} = _ref; |
| 5717 |
const elementClippingAncestors = boundary === "clippingAncestors" ? isTopLayer(element) ? [] : getClippingElementAncestors(element, this._c) : [].concat(boundary); |
| 5718 |
const clippingAncestors = [...elementClippingAncestors, rootBoundary]; |
| 5719 |
const firstRect = getClientRectFromClippingAncestor(element, clippingAncestors[0], strategy); |
| 5720 |
let top = firstRect.top; |
| 5721 |
let right = firstRect.right; |
| 5722 |
let bottom = firstRect.bottom; |
| 5723 |
let left = firstRect.left; |
| 5724 |
for (let i2 = 1; i2 < clippingAncestors.length; i2++) { |
| 5725 |
const rect = getClientRectFromClippingAncestor(element, clippingAncestors[i2], strategy); |
| 5726 |
top = max(rect.top, top); |
| 5727 |
right = min(rect.right, right); |
| 5728 |
bottom = min(rect.bottom, bottom); |
| 5729 |
left = max(rect.left, left); |
| 5730 |
} |
| 5731 |
return { |
| 5732 |
width: right - left, |
| 5733 |
height: bottom - top, |
| 5734 |
x: left, |
| 5735 |
y: top |
| 5736 |
}; |
| 5737 |
} |
| 5738 |
function getDimensions(element) { |
| 5739 |
const { |
| 5740 |
width, |
| 5741 |
height |
| 5742 |
} = getCssDimensions(element); |
| 5743 |
return { |
| 5744 |
width, |
| 5745 |
height |
| 5746 |
}; |
| 5747 |
} |
| 5748 |
function getRectRelativeToOffsetParent(element, offsetParent, strategy) { |
| 5749 |
const isOffsetParentAnElement = isHTMLElement(offsetParent); |
| 5750 |
const documentElement = getDocumentElement(offsetParent); |
| 5751 |
const isFixed2 = strategy === "fixed"; |
| 5752 |
const rect = getBoundingClientRect(element, true, isFixed2, offsetParent); |
| 5753 |
let scroll = { |
| 5754 |
scrollLeft: 0, |
| 5755 |
scrollTop: 0 |
| 5756 |
}; |
| 5757 |
const offsets = createCoords(0); |
| 5758 |
function setLeftRTLScrollbarOffset() { |
| 5759 |
offsets.x = getWindowScrollBarX(documentElement); |
| 5760 |
} |
| 5761 |
if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed2) { |
| 5762 |
if (getNodeName(offsetParent) !== "body" || isOverflowElement(documentElement)) { |
| 5763 |
scroll = getNodeScroll(offsetParent); |
| 5764 |
} |
| 5765 |
if (isOffsetParentAnElement) { |
| 5766 |
const offsetRect = getBoundingClientRect(offsetParent, true, isFixed2, offsetParent); |
| 5767 |
offsets.x = offsetRect.x + offsetParent.clientLeft; |
| 5768 |
offsets.y = offsetRect.y + offsetParent.clientTop; |
| 5769 |
} else if (documentElement) { |
| 5770 |
setLeftRTLScrollbarOffset(); |
| 5771 |
} |
| 5772 |
} |
| 5773 |
if (isFixed2 && !isOffsetParentAnElement && documentElement) { |
| 5774 |
setLeftRTLScrollbarOffset(); |
| 5775 |
} |
| 5776 |
const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed2 ? getHTMLOffset(documentElement, scroll) : createCoords(0); |
| 5777 |
const x2 = rect.left + scroll.scrollLeft - offsets.x - htmlOffset.x; |
| 5778 |
const y2 = rect.top + scroll.scrollTop - offsets.y - htmlOffset.y; |
| 5779 |
return { |
| 5780 |
x: x2, |
| 5781 |
y: y2, |
| 5782 |
width: rect.width, |
| 5783 |
height: rect.height |
| 5784 |
}; |
| 5785 |
} |
| 5786 |
function isStaticPositioned(element) { |
| 5787 |
return getComputedStyle2(element).position === "static"; |
| 5788 |
} |
| 5789 |
function getTrueOffsetParent(element, polyfill) { |
| 5790 |
if (!isHTMLElement(element) || getComputedStyle2(element).position === "fixed") { |
| 5791 |
return null; |
| 5792 |
} |
| 5793 |
if (polyfill) { |
| 5794 |
return polyfill(element); |
| 5795 |
} |
| 5796 |
let rawOffsetParent = element.offsetParent; |
| 5797 |
if (getDocumentElement(element) === rawOffsetParent) { |
| 5798 |
rawOffsetParent = rawOffsetParent.ownerDocument.body; |
| 5799 |
} |
| 5800 |
return rawOffsetParent; |
| 5801 |
} |
| 5802 |
function getOffsetParent(element, polyfill) { |
| 5803 |
const win = getWindow(element); |
| 5804 |
if (isTopLayer(element)) { |
| 5805 |
return win; |
| 5806 |
} |
| 5807 |
if (!isHTMLElement(element)) { |
| 5808 |
let svgOffsetParent = getParentNode(element); |
| 5809 |
while (svgOffsetParent && !isLastTraversableNode(svgOffsetParent)) { |
| 5810 |
if (isElement(svgOffsetParent) && !isStaticPositioned(svgOffsetParent)) { |
| 5811 |
return svgOffsetParent; |
| 5812 |
} |
| 5813 |
svgOffsetParent = getParentNode(svgOffsetParent); |
| 5814 |
} |
| 5815 |
return win; |
| 5816 |
} |
| 5817 |
let offsetParent = getTrueOffsetParent(element, polyfill); |
| 5818 |
while (offsetParent && isTableElement(offsetParent) && isStaticPositioned(offsetParent)) { |
| 5819 |
offsetParent = getTrueOffsetParent(offsetParent, polyfill); |
| 5820 |
} |
| 5821 |
if (offsetParent && isLastTraversableNode(offsetParent) && isStaticPositioned(offsetParent) && !isContainingBlock(offsetParent)) { |
| 5822 |
return win; |
| 5823 |
} |
| 5824 |
return offsetParent || getContainingBlock(element) || win; |
| 5825 |
} |
| 5826 |
var getElementRects = async function(data) { |
| 5827 |
const getOffsetParentFn = this.getOffsetParent || getOffsetParent; |
| 5828 |
const getDimensionsFn = this.getDimensions; |
| 5829 |
const floatingDimensions = await getDimensionsFn(data.floating); |
| 5830 |
return { |
| 5831 |
reference: getRectRelativeToOffsetParent(data.reference, await getOffsetParentFn(data.floating), data.strategy), |
| 5832 |
floating: { |
| 5833 |
x: 0, |
| 5834 |
y: 0, |
| 5835 |
width: floatingDimensions.width, |
| 5836 |
height: floatingDimensions.height |
| 5837 |
} |
| 5838 |
}; |
| 5839 |
}; |
| 5840 |
function isRTL(element) { |
| 5841 |
return getComputedStyle2(element).direction === "rtl"; |
| 5842 |
} |
| 5843 |
var platform2 = { |
| 5844 |
convertOffsetParentRelativeRectToViewportRelativeRect, |
| 5845 |
getDocumentElement, |
| 5846 |
getClippingRect, |
| 5847 |
getOffsetParent, |
| 5848 |
getElementRects, |
| 5849 |
getClientRects, |
| 5850 |
getDimensions, |
| 5851 |
getScale, |
| 5852 |
isElement, |
| 5853 |
isRTL |
| 5854 |
}; |
| 5855 |
function rectsAreEqual(a2, b2) { |
| 5856 |
return a2.x === b2.x && a2.y === b2.y && a2.width === b2.width && a2.height === b2.height; |
| 5857 |
} |
| 5858 |
function observeMove(element, onMove) { |
| 5859 |
let io = null; |
| 5860 |
let timeoutId; |
| 5861 |
const root = getDocumentElement(element); |
| 5862 |
function cleanup() { |
| 5863 |
var _io; |
| 5864 |
clearTimeout(timeoutId); |
| 5865 |
(_io = io) == null || _io.disconnect(); |
| 5866 |
io = null; |
| 5867 |
} |
| 5868 |
function refresh(skip, threshold) { |
| 5869 |
if (skip === void 0) { |
| 5870 |
skip = false; |
| 5871 |
} |
| 5872 |
if (threshold === void 0) { |
| 5873 |
threshold = 1; |
| 5874 |
} |
| 5875 |
cleanup(); |
| 5876 |
const elementRectForRootMargin = element.getBoundingClientRect(); |
| 5877 |
const { |
| 5878 |
left, |
| 5879 |
top, |
| 5880 |
width, |
| 5881 |
height |
| 5882 |
} = elementRectForRootMargin; |
| 5883 |
if (!skip) { |
| 5884 |
onMove(); |
| 5885 |
} |
| 5886 |
if (!width || !height) { |
| 5887 |
return; |
| 5888 |
} |
| 5889 |
const insetTop = floor(top); |
| 5890 |
const insetRight = floor(root.clientWidth - (left + width)); |
| 5891 |
const insetBottom = floor(root.clientHeight - (top + height)); |
| 5892 |
const insetLeft = floor(left); |
| 5893 |
const rootMargin = -insetTop + "px " + -insetRight + "px " + -insetBottom + "px " + -insetLeft + "px"; |
| 5894 |
const options = { |
| 5895 |
rootMargin, |
| 5896 |
threshold: max(0, min(1, threshold)) || 1 |
| 5897 |
}; |
| 5898 |
let isFirstUpdate = true; |
| 5899 |
function handleObserve(entries) { |
| 5900 |
const ratio = entries[0].intersectionRatio; |
| 5901 |
if (ratio !== threshold) { |
| 5902 |
if (!isFirstUpdate) { |
| 5903 |
return refresh(); |
| 5904 |
} |
| 5905 |
if (!ratio) { |
| 5906 |
timeoutId = setTimeout(() => { |
| 5907 |
refresh(false, 1e-7); |
| 5908 |
}, 1e3); |
| 5909 |
} else { |
| 5910 |
refresh(false, ratio); |
| 5911 |
} |
| 5912 |
} |
| 5913 |
if (ratio === 1 && !rectsAreEqual(elementRectForRootMargin, element.getBoundingClientRect())) { |
| 5914 |
refresh(); |
| 5915 |
} |
| 5916 |
isFirstUpdate = false; |
| 5917 |
} |
| 5918 |
try { |
| 5919 |
io = new IntersectionObserver(handleObserve, { |
| 5920 |
...options, |
| 5921 |
// Handle <iframe>s |
| 5922 |
root: root.ownerDocument |
| 5923 |
}); |
| 5924 |
} catch (_e) { |
| 5925 |
io = new IntersectionObserver(handleObserve, options); |
| 5926 |
} |
| 5927 |
io.observe(element); |
| 5928 |
} |
| 5929 |
refresh(true); |
| 5930 |
return cleanup; |
| 5931 |
} |
| 5932 |
function autoUpdate(reference, floating, update2, options) { |
| 5933 |
if (options === void 0) { |
| 5934 |
options = {}; |
| 5935 |
} |
| 5936 |
const { |
| 5937 |
ancestorScroll = true, |
| 5938 |
ancestorResize = true, |
| 5939 |
elementResize = typeof ResizeObserver === "function", |
| 5940 |
layoutShift = typeof IntersectionObserver === "function", |
| 5941 |
animationFrame = false |
| 5942 |
} = options; |
| 5943 |
const referenceEl = unwrapElement(reference); |
| 5944 |
const ancestors = ancestorScroll || ancestorResize ? [...referenceEl ? getOverflowAncestors(referenceEl) : [], ...floating ? getOverflowAncestors(floating) : []] : []; |
| 5945 |
ancestors.forEach((ancestor) => { |
| 5946 |
ancestorScroll && ancestor.addEventListener("scroll", update2, { |
| 5947 |
passive: true |
| 5948 |
}); |
| 5949 |
ancestorResize && ancestor.addEventListener("resize", update2); |
| 5950 |
}); |
| 5951 |
const cleanupIo = referenceEl && layoutShift ? observeMove(referenceEl, update2) : null; |
| 5952 |
let reobserveFrame = -1; |
| 5953 |
let resizeObserver = null; |
| 5954 |
if (elementResize) { |
| 5955 |
resizeObserver = new ResizeObserver((_ref) => { |
| 5956 |
let [firstEntry] = _ref; |
| 5957 |
if (firstEntry && firstEntry.target === referenceEl && resizeObserver && floating) { |
| 5958 |
resizeObserver.unobserve(floating); |
| 5959 |
cancelAnimationFrame(reobserveFrame); |
| 5960 |
reobserveFrame = requestAnimationFrame(() => { |
| 5961 |
var _resizeObserver; |
| 5962 |
(_resizeObserver = resizeObserver) == null || _resizeObserver.observe(floating); |
| 5963 |
}); |
| 5964 |
} |
| 5965 |
update2(); |
| 5966 |
}); |
| 5967 |
if (referenceEl && !animationFrame) { |
| 5968 |
resizeObserver.observe(referenceEl); |
| 5969 |
} |
| 5970 |
if (floating) { |
| 5971 |
resizeObserver.observe(floating); |
| 5972 |
} |
| 5973 |
} |
| 5974 |
let frameId; |
| 5975 |
let prevRefRect = animationFrame ? getBoundingClientRect(reference) : null; |
| 5976 |
if (animationFrame) { |
| 5977 |
frameLoop(); |
| 5978 |
} |
| 5979 |
function frameLoop() { |
| 5980 |
const nextRefRect = getBoundingClientRect(reference); |
| 5981 |
if (prevRefRect && !rectsAreEqual(prevRefRect, nextRefRect)) { |
| 5982 |
update2(); |
| 5983 |
} |
| 5984 |
prevRefRect = nextRefRect; |
| 5985 |
frameId = requestAnimationFrame(frameLoop); |
| 5986 |
} |
| 5987 |
update2(); |
| 5988 |
return () => { |
| 5989 |
var _resizeObserver2; |
| 5990 |
ancestors.forEach((ancestor) => { |
| 5991 |
ancestorScroll && ancestor.removeEventListener("scroll", update2); |
| 5992 |
ancestorResize && ancestor.removeEventListener("resize", update2); |
| 5993 |
}); |
| 5994 |
cleanupIo == null || cleanupIo(); |
| 5995 |
(_resizeObserver2 = resizeObserver) == null || _resizeObserver2.disconnect(); |
| 5996 |
resizeObserver = null; |
| 5997 |
if (animationFrame) { |
| 5998 |
cancelAnimationFrame(frameId); |
| 5999 |
} |
| 6000 |
}; |
| 6001 |
} |
| 6002 |
var offset2 = offset; |
| 6003 |
var shift2 = shift; |
| 6004 |
var flip2 = flip; |
| 6005 |
var size2 = size; |
| 6006 |
var hide2 = hide; |
| 6007 |
var limitShift2 = limitShift; |
| 6008 |
var computePosition2 = (reference, floating, options) => { |
| 6009 |
const cache = /* @__PURE__ */ new Map(); |
| 6010 |
const mergedOptions = { |
| 6011 |
platform: platform2, |
| 6012 |
...options |
| 6013 |
}; |
| 6014 |
const platformWithCache = { |
| 6015 |
...mergedOptions.platform, |
| 6016 |
_c: cache |
| 6017 |
}; |
| 6018 |
return computePosition(reference, floating, { |
| 6019 |
...mergedOptions, |
| 6020 |
platform: platformWithCache |
| 6021 |
}); |
| 6022 |
}; |
| 6023 |
|
| 6024 |
// node_modules/@base-ui/react/node_modules/@floating-ui/react-dom/dist/floating-ui.react-dom.mjs |
| 6025 |
var React25 = __toESM(require_react(), 1); |
| 6026 |
var import_react2 = __toESM(require_react(), 1); |
| 6027 |
var ReactDOM3 = __toESM(require_react_dom(), 1); |
| 6028 |
var isClient = typeof document !== "undefined"; |
| 6029 |
var noop2 = function noop3() { |
| 6030 |
}; |
| 6031 |
var index = isClient ? import_react2.useLayoutEffect : noop2; |
| 6032 |
function deepEqual(a2, b2) { |
| 6033 |
if (a2 === b2) { |
| 6034 |
return true; |
| 6035 |
} |
| 6036 |
if (typeof a2 !== typeof b2) { |
| 6037 |
return false; |
| 6038 |
} |
| 6039 |
if (typeof a2 === "function" && a2.toString() === b2.toString()) { |
| 6040 |
return true; |
| 6041 |
} |
| 6042 |
let length; |
| 6043 |
let i2; |
| 6044 |
let keys; |
| 6045 |
if (a2 && b2 && typeof a2 === "object") { |
| 6046 |
if (Array.isArray(a2)) { |
| 6047 |
length = a2.length; |
| 6048 |
if (length !== b2.length) return false; |
| 6049 |
for (i2 = length; i2-- !== 0; ) { |
| 6050 |
if (!deepEqual(a2[i2], b2[i2])) { |
| 6051 |
return false; |
| 6052 |
} |
| 6053 |
} |
| 6054 |
return true; |
| 6055 |
} |
| 6056 |
keys = Object.keys(a2); |
| 6057 |
length = keys.length; |
| 6058 |
if (length !== Object.keys(b2).length) { |
| 6059 |
return false; |
| 6060 |
} |
| 6061 |
for (i2 = length; i2-- !== 0; ) { |
| 6062 |
if (!{}.hasOwnProperty.call(b2, keys[i2])) { |
| 6063 |
return false; |
| 6064 |
} |
| 6065 |
} |
| 6066 |
for (i2 = length; i2-- !== 0; ) { |
| 6067 |
const key2 = keys[i2]; |
| 6068 |
if (key2 === "_owner" && a2.$$typeof) { |
| 6069 |
continue; |
| 6070 |
} |
| 6071 |
if (!deepEqual(a2[key2], b2[key2])) { |
| 6072 |
return false; |
| 6073 |
} |
| 6074 |
} |
| 6075 |
return true; |
| 6076 |
} |
| 6077 |
return a2 !== a2 && b2 !== b2; |
| 6078 |
} |
| 6079 |
function getDPR(element) { |
| 6080 |
if (typeof window === "undefined") { |
| 6081 |
return 1; |
| 6082 |
} |
| 6083 |
const win = element.ownerDocument.defaultView || window; |
| 6084 |
return win.devicePixelRatio || 1; |
| 6085 |
} |
| 6086 |
function roundByDPR(element, value) { |
| 6087 |
const dpr = getDPR(element); |
| 6088 |
return Math.round(value * dpr) / dpr; |
| 6089 |
} |
| 6090 |
function useLatestRef(value) { |
| 6091 |
const ref = React25.useRef(value); |
| 6092 |
index(() => { |
| 6093 |
ref.current = value; |
| 6094 |
}); |
| 6095 |
return ref; |
| 6096 |
} |
| 6097 |
function useFloating(options) { |
| 6098 |
if (options === void 0) { |
| 6099 |
options = {}; |
| 6100 |
} |
| 6101 |
const { |
| 6102 |
placement = "bottom", |
| 6103 |
strategy = "absolute", |
| 6104 |
middleware = [], |
| 6105 |
platform: platform3, |
| 6106 |
elements: { |
| 6107 |
reference: externalReference, |
| 6108 |
floating: externalFloating |
| 6109 |
} = {}, |
| 6110 |
transform = true, |
| 6111 |
whileElementsMounted, |
| 6112 |
open |
| 6113 |
} = options; |
| 6114 |
const [data, setData] = React25.useState({ |
| 6115 |
x: 0, |
| 6116 |
y: 0, |
| 6117 |
strategy, |
| 6118 |
placement, |
| 6119 |
middlewareData: {}, |
| 6120 |
isPositioned: false |
| 6121 |
}); |
| 6122 |
const [latestMiddleware, setLatestMiddleware] = React25.useState(middleware); |
| 6123 |
if (!deepEqual(latestMiddleware, middleware)) { |
| 6124 |
setLatestMiddleware(middleware); |
| 6125 |
} |
| 6126 |
const [_reference, _setReference] = React25.useState(null); |
| 6127 |
const [_floating, _setFloating] = React25.useState(null); |
| 6128 |
const setReference = React25.useCallback((node) => { |
| 6129 |
if (node !== referenceRef.current) { |
| 6130 |
referenceRef.current = node; |
| 6131 |
_setReference(node); |
| 6132 |
} |
| 6133 |
}, []); |
| 6134 |
const setFloating = React25.useCallback((node) => { |
| 6135 |
if (node !== floatingRef.current) { |
| 6136 |
floatingRef.current = node; |
| 6137 |
_setFloating(node); |
| 6138 |
} |
| 6139 |
}, []); |
| 6140 |
const referenceEl = externalReference || _reference; |
| 6141 |
const floatingEl = externalFloating || _floating; |
| 6142 |
const referenceRef = React25.useRef(null); |
| 6143 |
const floatingRef = React25.useRef(null); |
| 6144 |
const dataRef = React25.useRef(data); |
| 6145 |
const hasWhileElementsMounted = whileElementsMounted != null; |
| 6146 |
const whileElementsMountedRef = useLatestRef(whileElementsMounted); |
| 6147 |
const platformRef = useLatestRef(platform3); |
| 6148 |
const openRef = useLatestRef(open); |
| 6149 |
const update2 = React25.useCallback(() => { |
| 6150 |
if (!referenceRef.current || !floatingRef.current) { |
| 6151 |
return; |
| 6152 |
} |
| 6153 |
const config = { |
| 6154 |
placement, |
| 6155 |
strategy, |
| 6156 |
middleware: latestMiddleware |
| 6157 |
}; |
| 6158 |
if (platformRef.current) { |
| 6159 |
config.platform = platformRef.current; |
| 6160 |
} |
| 6161 |
computePosition2(referenceRef.current, floatingRef.current, config).then((data2) => { |
| 6162 |
const fullData = { |
| 6163 |
...data2, |
| 6164 |
// The floating element's position may be recomputed while it's closed |
| 6165 |
// but still mounted (such as when transitioning out). To ensure |
| 6166 |
// `isPositioned` will be `false` initially on the next open, avoid |
| 6167 |
// setting it to `true` when `open === false` (must be specified). |
| 6168 |
isPositioned: openRef.current !== false |
| 6169 |
}; |
| 6170 |
if (isMountedRef.current && !deepEqual(dataRef.current, fullData)) { |
| 6171 |
dataRef.current = fullData; |
| 6172 |
ReactDOM3.flushSync(() => { |
| 6173 |
setData(fullData); |
| 6174 |
}); |
| 6175 |
} |
| 6176 |
}); |
| 6177 |
}, [latestMiddleware, placement, strategy, platformRef, openRef]); |
| 6178 |
index(() => { |
| 6179 |
if (open === false && dataRef.current.isPositioned) { |
| 6180 |
dataRef.current.isPositioned = false; |
| 6181 |
setData((data2) => ({ |
| 6182 |
...data2, |
| 6183 |
isPositioned: false |
| 6184 |
})); |
| 6185 |
} |
| 6186 |
}, [open]); |
| 6187 |
const isMountedRef = React25.useRef(false); |
| 6188 |
index(() => { |
| 6189 |
isMountedRef.current = true; |
| 6190 |
return () => { |
| 6191 |
isMountedRef.current = false; |
| 6192 |
}; |
| 6193 |
}, []); |
| 6194 |
index(() => { |
| 6195 |
if (referenceEl) referenceRef.current = referenceEl; |
| 6196 |
if (floatingEl) floatingRef.current = floatingEl; |
| 6197 |
if (referenceEl && floatingEl) { |
| 6198 |
if (whileElementsMountedRef.current) { |
| 6199 |
return whileElementsMountedRef.current(referenceEl, floatingEl, update2); |
| 6200 |
} |
| 6201 |
update2(); |
| 6202 |
} |
| 6203 |
}, [referenceEl, floatingEl, update2, whileElementsMountedRef, hasWhileElementsMounted]); |
| 6204 |
const refs = React25.useMemo(() => ({ |
| 6205 |
reference: referenceRef, |
| 6206 |
floating: floatingRef, |
| 6207 |
setReference, |
| 6208 |
setFloating |
| 6209 |
}), [setReference, setFloating]); |
| 6210 |
const elements = React25.useMemo(() => ({ |
| 6211 |
reference: referenceEl, |
| 6212 |
floating: floatingEl |
| 6213 |
}), [referenceEl, floatingEl]); |
| 6214 |
const floatingStyles = React25.useMemo(() => { |
| 6215 |
const initialStyles = { |
| 6216 |
position: strategy, |
| 6217 |
left: 0, |
| 6218 |
top: 0 |
| 6219 |
}; |
| 6220 |
if (!elements.floating) { |
| 6221 |
return initialStyles; |
| 6222 |
} |
| 6223 |
const x2 = roundByDPR(elements.floating, data.x); |
| 6224 |
const y2 = roundByDPR(elements.floating, data.y); |
| 6225 |
if (transform) { |
| 6226 |
return { |
| 6227 |
...initialStyles, |
| 6228 |
transform: "translate(" + x2 + "px, " + y2 + "px)", |
| 6229 |
...getDPR(elements.floating) >= 1.5 && { |
| 6230 |
willChange: "transform" |
| 6231 |
} |
| 6232 |
}; |
| 6233 |
} |
| 6234 |
return { |
| 6235 |
position: strategy, |
| 6236 |
left: x2, |
| 6237 |
top: y2 |
| 6238 |
}; |
| 6239 |
}, [strategy, transform, elements.floating, data.x, data.y]); |
| 6240 |
return React25.useMemo(() => ({ |
| 6241 |
...data, |
| 6242 |
update: update2, |
| 6243 |
refs, |
| 6244 |
elements, |
| 6245 |
floatingStyles |
| 6246 |
}), [data, update2, refs, elements, floatingStyles]); |
| 6247 |
} |
| 6248 |
var offset3 = (options, deps) => { |
| 6249 |
const result = offset2(options); |
| 6250 |
return { |
| 6251 |
name: result.name, |
| 6252 |
fn: result.fn, |
| 6253 |
options: [options, deps] |
| 6254 |
}; |
| 6255 |
}; |
| 6256 |
var shift3 = (options, deps) => { |
| 6257 |
const result = shift2(options); |
| 6258 |
return { |
| 6259 |
name: result.name, |
| 6260 |
fn: result.fn, |
| 6261 |
options: [options, deps] |
| 6262 |
}; |
| 6263 |
}; |
| 6264 |
var limitShift3 = (options, deps) => { |
| 6265 |
const result = limitShift2(options); |
| 6266 |
return { |
| 6267 |
fn: result.fn, |
| 6268 |
options: [options, deps] |
| 6269 |
}; |
| 6270 |
}; |
| 6271 |
var flip3 = (options, deps) => { |
| 6272 |
const result = flip2(options); |
| 6273 |
return { |
| 6274 |
name: result.name, |
| 6275 |
fn: result.fn, |
| 6276 |
options: [options, deps] |
| 6277 |
}; |
| 6278 |
}; |
| 6279 |
var size3 = (options, deps) => { |
| 6280 |
const result = size2(options); |
| 6281 |
return { |
| 6282 |
name: result.name, |
| 6283 |
fn: result.fn, |
| 6284 |
options: [options, deps] |
| 6285 |
}; |
| 6286 |
}; |
| 6287 |
var hide3 = (options, deps) => { |
| 6288 |
const result = hide2(options); |
| 6289 |
return { |
| 6290 |
name: result.name, |
| 6291 |
fn: result.fn, |
| 6292 |
options: [options, deps] |
| 6293 |
}; |
| 6294 |
}; |
| 6295 |
|
| 6296 |
// node_modules/@base-ui/utils/esm/store/createSelector.js |
| 6297 |
var createSelector = (a2, b2, c2, d2, e2, f2, ...other) => { |
| 6298 |
if (other.length > 0) { |
| 6299 |
throw new Error(true ? "Unsupported number of selectors" : formatErrorMessage_default(1)); |
| 6300 |
} |
| 6301 |
let selector2; |
| 6302 |
if (a2 && b2 && c2 && d2 && e2 && f2) { |
| 6303 |
selector2 = (state, a1, a22, a3) => { |
| 6304 |
const va = a2(state, a1, a22, a3); |
| 6305 |
const vb = b2(state, a1, a22, a3); |
| 6306 |
const vc = c2(state, a1, a22, a3); |
| 6307 |
const vd = d2(state, a1, a22, a3); |
| 6308 |
const ve = e2(state, a1, a22, a3); |
| 6309 |
return f2(va, vb, vc, vd, ve, a1, a22, a3); |
| 6310 |
}; |
| 6311 |
} else if (a2 && b2 && c2 && d2 && e2) { |
| 6312 |
selector2 = (state, a1, a22, a3) => { |
| 6313 |
const va = a2(state, a1, a22, a3); |
| 6314 |
const vb = b2(state, a1, a22, a3); |
| 6315 |
const vc = c2(state, a1, a22, a3); |
| 6316 |
const vd = d2(state, a1, a22, a3); |
| 6317 |
return e2(va, vb, vc, vd, a1, a22, a3); |
| 6318 |
}; |
| 6319 |
} else if (a2 && b2 && c2 && d2) { |
| 6320 |
selector2 = (state, a1, a22, a3) => { |
| 6321 |
const va = a2(state, a1, a22, a3); |
| 6322 |
const vb = b2(state, a1, a22, a3); |
| 6323 |
const vc = c2(state, a1, a22, a3); |
| 6324 |
return d2(va, vb, vc, a1, a22, a3); |
| 6325 |
}; |
| 6326 |
} else if (a2 && b2 && c2) { |
| 6327 |
selector2 = (state, a1, a22, a3) => { |
| 6328 |
const va = a2(state, a1, a22, a3); |
| 6329 |
const vb = b2(state, a1, a22, a3); |
| 6330 |
return c2(va, vb, a1, a22, a3); |
| 6331 |
}; |
| 6332 |
} else if (a2 && b2) { |
| 6333 |
selector2 = (state, a1, a22, a3) => { |
| 6334 |
const va = a2(state, a1, a22, a3); |
| 6335 |
return b2(va, a1, a22, a3); |
| 6336 |
}; |
| 6337 |
} else if (a2) { |
| 6338 |
selector2 = a2; |
| 6339 |
} else { |
| 6340 |
throw ( |
| 6341 |
/* minify-error-disabled */ |
| 6342 |
new Error("Missing arguments") |
| 6343 |
); |
| 6344 |
} |
| 6345 |
return selector2; |
| 6346 |
}; |
| 6347 |
|
| 6348 |
// node_modules/@base-ui/utils/esm/store/useStore.js |
| 6349 |
var React27 = __toESM(require_react(), 1); |
| 6350 |
var import_shim = __toESM(require_shim(), 1); |
| 6351 |
var import_with_selector = __toESM(require_with_selector(), 1); |
| 6352 |
|
| 6353 |
// node_modules/@base-ui/utils/esm/fastHooks.js |
| 6354 |
var React26 = __toESM(require_react(), 1); |
| 6355 |
var hooks = []; |
| 6356 |
var currentInstance = void 0; |
| 6357 |
function getInstance() { |
| 6358 |
return currentInstance; |
| 6359 |
} |
| 6360 |
function register(hook) { |
| 6361 |
hooks.push(hook); |
| 6362 |
} |
| 6363 |
function fastComponent(fn) { |
| 6364 |
const FastComponent = (props, forwardedRef) => { |
| 6365 |
const instance = useRefWithInit(createInstance).current; |
| 6366 |
let result; |
| 6367 |
try { |
| 6368 |
currentInstance = instance; |
| 6369 |
for (const hook of hooks) { |
| 6370 |
hook.before(instance); |
| 6371 |
} |
| 6372 |
result = fn(props, forwardedRef); |
| 6373 |
for (const hook of hooks) { |
| 6374 |
hook.after(instance); |
| 6375 |
} |
| 6376 |
instance.didInitialize = true; |
| 6377 |
} finally { |
| 6378 |
currentInstance = void 0; |
| 6379 |
} |
| 6380 |
return result; |
| 6381 |
}; |
| 6382 |
FastComponent.displayName = fn.displayName || fn.name; |
| 6383 |
return FastComponent; |
| 6384 |
} |
| 6385 |
function fastComponentRef(fn) { |
| 6386 |
return /* @__PURE__ */ React26.forwardRef(fastComponent(fn)); |
| 6387 |
} |
| 6388 |
function createInstance() { |
| 6389 |
return { |
| 6390 |
didInitialize: false |
| 6391 |
}; |
| 6392 |
} |
| 6393 |
|
| 6394 |
// node_modules/@base-ui/utils/esm/store/useStore.js |
| 6395 |
var canUseRawUseSyncExternalStore = isReactVersionAtLeast(19); |
| 6396 |
var useStoreImplementation = canUseRawUseSyncExternalStore ? useStoreFast : useStoreLegacy; |
| 6397 |
function useStore(store, selector2, a1, a2, a3) { |
| 6398 |
return useStoreImplementation(store, selector2, a1, a2, a3); |
| 6399 |
} |
| 6400 |
function useStoreR19(store, selector2, a1, a2, a3) { |
| 6401 |
const getSelection = React27.useCallback(() => selector2(store.getSnapshot(), a1, a2, a3), [store, selector2, a1, a2, a3]); |
| 6402 |
return (0, import_shim.useSyncExternalStore)(store.subscribe, getSelection, getSelection); |
| 6403 |
} |
| 6404 |
register({ |
| 6405 |
before(instance) { |
| 6406 |
instance.syncIndex = 0; |
| 6407 |
if (!instance.didInitialize) { |
| 6408 |
instance.syncTick = 1; |
| 6409 |
instance.syncHooks = []; |
| 6410 |
instance.didChangeStore = true; |
| 6411 |
instance.getSnapshot = () => { |
| 6412 |
let didChange2 = false; |
| 6413 |
for (let i2 = 0; i2 < instance.syncHooks.length; i2 += 1) { |
| 6414 |
const hook = instance.syncHooks[i2]; |
| 6415 |
const value = hook.selector(hook.store.state, hook.a1, hook.a2, hook.a3); |
| 6416 |
if (hook.didChange || !Object.is(hook.value, value)) { |
| 6417 |
didChange2 = true; |
| 6418 |
hook.value = value; |
| 6419 |
hook.didChange = false; |
| 6420 |
} |
| 6421 |
} |
| 6422 |
if (didChange2) { |
| 6423 |
instance.syncTick += 1; |
| 6424 |
} |
| 6425 |
return instance.syncTick; |
| 6426 |
}; |
| 6427 |
} |
| 6428 |
}, |
| 6429 |
after(instance) { |
| 6430 |
if (instance.syncHooks.length > 0) { |
| 6431 |
if (instance.didChangeStore) { |
| 6432 |
instance.didChangeStore = false; |
| 6433 |
instance.subscribe = (onStoreChange) => { |
| 6434 |
const stores = /* @__PURE__ */ new Set(); |
| 6435 |
for (const hook of instance.syncHooks) { |
| 6436 |
stores.add(hook.store); |
| 6437 |
} |
| 6438 |
const unsubscribes = []; |
| 6439 |
for (const store of stores) { |
| 6440 |
unsubscribes.push(store.subscribe(onStoreChange)); |
| 6441 |
} |
| 6442 |
return () => { |
| 6443 |
for (const unsubscribe of unsubscribes) { |
| 6444 |
unsubscribe(); |
| 6445 |
} |
| 6446 |
}; |
| 6447 |
}; |
| 6448 |
} |
| 6449 |
(0, import_shim.useSyncExternalStore)(instance.subscribe, instance.getSnapshot, instance.getSnapshot); |
| 6450 |
} |
| 6451 |
} |
| 6452 |
}); |
| 6453 |
function useStoreFast(store, selector2, a1, a2, a3) { |
| 6454 |
const instance = getInstance(); |
| 6455 |
if (!instance) { |
| 6456 |
return useStoreR19(store, selector2, a1, a2, a3); |
| 6457 |
} |
| 6458 |
const index2 = instance.syncIndex; |
| 6459 |
instance.syncIndex += 1; |
| 6460 |
let hook; |
| 6461 |
if (!instance.didInitialize) { |
| 6462 |
hook = { |
| 6463 |
store, |
| 6464 |
selector: selector2, |
| 6465 |
a1, |
| 6466 |
a2, |
| 6467 |
a3, |
| 6468 |
value: selector2(store.getSnapshot(), a1, a2, a3), |
| 6469 |
didChange: false |
| 6470 |
}; |
| 6471 |
instance.syncHooks.push(hook); |
| 6472 |
} else { |
| 6473 |
hook = instance.syncHooks[index2]; |
| 6474 |
if (hook.store !== store || hook.selector !== selector2 || !Object.is(hook.a1, a1) || !Object.is(hook.a2, a2) || !Object.is(hook.a3, a3)) { |
| 6475 |
if (hook.store !== store) { |
| 6476 |
instance.didChangeStore = true; |
| 6477 |
} |
| 6478 |
hook.store = store; |
| 6479 |
hook.selector = selector2; |
| 6480 |
hook.a1 = a1; |
| 6481 |
hook.a2 = a2; |
| 6482 |
hook.a3 = a3; |
| 6483 |
hook.didChange = true; |
| 6484 |
} |
| 6485 |
} |
| 6486 |
return hook.value; |
| 6487 |
} |
| 6488 |
function useStoreLegacy(store, selector2, a1, a2, a3) { |
| 6489 |
return (0, import_with_selector.useSyncExternalStoreWithSelector)(store.subscribe, store.getSnapshot, store.getSnapshot, (state) => selector2(state, a1, a2, a3)); |
| 6490 |
} |
| 6491 |
|
| 6492 |
// node_modules/@base-ui/utils/esm/store/Store.js |
| 6493 |
var Store = class { |
| 6494 |
/** |
| 6495 |
* The current state of the store. |
| 6496 |
* This property is updated immediately when the state changes as a result of calling {@link setState}, {@link update}, or {@link set}. |
| 6497 |
* To subscribe to state changes, use the {@link useState} method. The value returned by {@link useState} is updated after the component renders (similarly to React's useState). |
| 6498 |
* The values can be used directly (to avoid subscribing to the store) in effects or event handlers. |
| 6499 |
* |
| 6500 |
* Do not modify properties in state directly. Instead, use the provided methods to ensure proper state management and listener notification. |
| 6501 |
*/ |
| 6502 |
// Internal state to handle recursive `setState()` calls |
| 6503 |
constructor(state) { |
| 6504 |
this.state = state; |
| 6505 |
this.listeners = /* @__PURE__ */ new Set(); |
| 6506 |
this.updateTick = 0; |
| 6507 |
} |
| 6508 |
/** |
| 6509 |
* Registers a listener that will be called whenever the store's state changes. |
| 6510 |
* |
| 6511 |
* @param fn The listener function to be called on state changes. |
| 6512 |
* @returns A function to unsubscribe the listener. |
| 6513 |
*/ |
| 6514 |
subscribe = (fn) => { |
| 6515 |
this.listeners.add(fn); |
| 6516 |
return () => { |
| 6517 |
this.listeners.delete(fn); |
| 6518 |
}; |
| 6519 |
}; |
| 6520 |
/** |
| 6521 |
* Returns the current state of the store. |
| 6522 |
*/ |
| 6523 |
getSnapshot = () => { |
| 6524 |
return this.state; |
| 6525 |
}; |
| 6526 |
/** |
| 6527 |
* Updates the entire store's state and notifies all registered listeners. |
| 6528 |
* |
| 6529 |
* @param newState The new state to set for the store. |
| 6530 |
*/ |
| 6531 |
setState(newState) { |
| 6532 |
if (this.state === newState) { |
| 6533 |
return; |
| 6534 |
} |
| 6535 |
this.state = newState; |
| 6536 |
this.updateTick += 1; |
| 6537 |
const currentTick = this.updateTick; |
| 6538 |
for (const listener of this.listeners) { |
| 6539 |
if (currentTick !== this.updateTick) { |
| 6540 |
return; |
| 6541 |
} |
| 6542 |
listener(newState); |
| 6543 |
} |
| 6544 |
} |
| 6545 |
/** |
| 6546 |
* Merges the provided changes into the current state and notifies listeners if there are changes. |
| 6547 |
* |
| 6548 |
* @param changes An object containing the changes to apply to the current state. |
| 6549 |
*/ |
| 6550 |
update(changes) { |
| 6551 |
for (const key2 in changes) { |
| 6552 |
if (!Object.is(this.state[key2], changes[key2])) { |
| 6553 |
this.setState({ |
| 6554 |
...this.state, |
| 6555 |
...changes |
| 6556 |
}); |
| 6557 |
return; |
| 6558 |
} |
| 6559 |
} |
| 6560 |
} |
| 6561 |
/** |
| 6562 |
* Sets a specific key in the store's state to a new value and notifies listeners if the value has changed. |
| 6563 |
* |
| 6564 |
* @param key The key in the store's state to update. |
| 6565 |
* @param value The new value to set for the specified key. |
| 6566 |
*/ |
| 6567 |
set(key2, value) { |
| 6568 |
if (!Object.is(this.state[key2], value)) { |
| 6569 |
this.setState({ |
| 6570 |
...this.state, |
| 6571 |
[key2]: value |
| 6572 |
}); |
| 6573 |
} |
| 6574 |
} |
| 6575 |
/** |
| 6576 |
* Gives the state a new reference and updates all registered listeners. |
| 6577 |
*/ |
| 6578 |
notifyAll() { |
| 6579 |
const newState = { |
| 6580 |
...this.state |
| 6581 |
}; |
| 6582 |
this.setState(newState); |
| 6583 |
} |
| 6584 |
use(selector2, a1, a2, a3) { |
| 6585 |
return useStore(this, selector2, a1, a2, a3); |
| 6586 |
} |
| 6587 |
}; |
| 6588 |
|
| 6589 |
// node_modules/@base-ui/utils/esm/store/ReactStore.js |
| 6590 |
var React28 = __toESM(require_react(), 1); |
| 6591 |
var ReactStore = class extends Store { |
| 6592 |
/** |
| 6593 |
* Creates a new ReactStore instance. |
| 6594 |
* |
| 6595 |
* @param state Initial state of the store. |
| 6596 |
* @param context Non-reactive context values. |
| 6597 |
* @param selectors Optional selectors for use with `useState`. |
| 6598 |
*/ |
| 6599 |
constructor(state, context = {}, selectors4) { |
| 6600 |
super(state); |
| 6601 |
this.context = context; |
| 6602 |
this.selectors = selectors4; |
| 6603 |
} |
| 6604 |
/** |
| 6605 |
* Non-reactive values such as refs, callbacks, etc. |
| 6606 |
*/ |
| 6607 |
/** |
| 6608 |
* Synchronizes a single external value into the store. |
| 6609 |
* |
| 6610 |
* Note that the while the value in `state` is updated immediately, the value returned |
| 6611 |
* by `useState` is updated before the next render (similarly to React's `useState`). |
| 6612 |
*/ |
| 6613 |
useSyncedValue(key2, value) { |
| 6614 |
React28.useDebugValue(key2); |
| 6615 |
useIsoLayoutEffect(() => { |
| 6616 |
if (this.state[key2] !== value) { |
| 6617 |
this.set(key2, value); |
| 6618 |
} |
| 6619 |
}, [key2, value]); |
| 6620 |
} |
| 6621 |
/** |
| 6622 |
* Synchronizes a single external value into the store and |
| 6623 |
* cleans it up (sets to `undefined`) on unmount. |
| 6624 |
* |
| 6625 |
* Note that the while the value in `state` is updated immediately, the value returned |
| 6626 |
* by `useState` is updated before the next render (similarly to React's `useState`). |
| 6627 |
*/ |
| 6628 |
useSyncedValueWithCleanup(key2, value) { |
| 6629 |
const store = this; |
| 6630 |
useIsoLayoutEffect(() => { |
| 6631 |
if (store.state[key2] !== value) { |
| 6632 |
store.set(key2, value); |
| 6633 |
} |
| 6634 |
return () => { |
| 6635 |
store.set(key2, void 0); |
| 6636 |
}; |
| 6637 |
}, [store, key2, value]); |
| 6638 |
} |
| 6639 |
/** |
| 6640 |
* Synchronizes multiple external values into the store. |
| 6641 |
* |
| 6642 |
* Note that the while the values in `state` are updated immediately, the values returned |
| 6643 |
* by `useState` are updated before the next render (similarly to React's `useState`). |
| 6644 |
*/ |
| 6645 |
useSyncedValues(statePart) { |
| 6646 |
const store = this; |
| 6647 |
if (true) { |
| 6648 |
React28.useDebugValue(statePart, (p2) => Object.keys(p2)); |
| 6649 |
const keys = React28.useRef(Object.keys(statePart)).current; |
| 6650 |
const nextKeys = Object.keys(statePart); |
| 6651 |
if (keys.length !== nextKeys.length || keys.some((key2, index2) => key2 !== nextKeys[index2])) { |
| 6652 |
console.error("ReactStore.useSyncedValues expects the same prop keys on every render. Keys should be stable."); |
| 6653 |
} |
| 6654 |
} |
| 6655 |
const dependencies = Object.values(statePart); |
| 6656 |
useIsoLayoutEffect(() => { |
| 6657 |
store.update(statePart); |
| 6658 |
}, [store, ...dependencies]); |
| 6659 |
} |
| 6660 |
/** |
| 6661 |
* Registers a controllable prop pair (`controlled`, `defaultValue`) for a specific key. If `controlled` |
| 6662 |
* is non-undefined, the store's state at `key` is updated to match `controlled`. |
| 6663 |
*/ |
| 6664 |
useControlledProp(key2, controlled) { |
| 6665 |
React28.useDebugValue(key2); |
| 6666 |
const isControlled = controlled !== void 0; |
| 6667 |
useIsoLayoutEffect(() => { |
| 6668 |
if (isControlled && !Object.is(this.state[key2], controlled)) { |
| 6669 |
super.setState({ |
| 6670 |
...this.state, |
| 6671 |
[key2]: controlled |
| 6672 |
}); |
| 6673 |
} |
| 6674 |
}, [key2, controlled, isControlled]); |
| 6675 |
if (true) { |
| 6676 |
const cache = this.controlledValues ??= /* @__PURE__ */ new Map(); |
| 6677 |
if (!cache.has(key2)) { |
| 6678 |
cache.set(key2, isControlled); |
| 6679 |
} |
| 6680 |
const previouslyControlled = cache.get(key2); |
| 6681 |
if (previouslyControlled !== void 0 && previouslyControlled !== isControlled) { |
| 6682 |
console.error(`A component is changing the ${isControlled ? "" : "un"}controlled state of ${key2.toString()} to be ${isControlled ? "un" : ""}controlled. Elements should not switch from uncontrolled to controlled (or vice versa).`); |
| 6683 |
} |
| 6684 |
} |
| 6685 |
} |
| 6686 |
/** Gets the current value from the store using a selector with the provided key. |
| 6687 |
* |
| 6688 |
* @param key Key of the selector to use. |
| 6689 |
*/ |
| 6690 |
select(key2, a1, a2, a3) { |
| 6691 |
const selector2 = this.selectors[key2]; |
| 6692 |
return selector2(this.state, a1, a2, a3); |
| 6693 |
} |
| 6694 |
/** |
| 6695 |
* Returns a value from the store's state using a selector function. |
| 6696 |
* Used to subscribe to specific parts of the state. |
| 6697 |
* This methods causes a rerender whenever the selected state changes. |
| 6698 |
* |
| 6699 |
* @param key Key of the selector to use. |
| 6700 |
*/ |
| 6701 |
useState(key2, a1, a2, a3) { |
| 6702 |
React28.useDebugValue(key2); |
| 6703 |
return useStore(this, this.selectors[key2], a1, a2, a3); |
| 6704 |
} |
| 6705 |
/** |
| 6706 |
* Wraps a function with `useStableCallback` to ensure it has a stable reference |
| 6707 |
* and assigns it to the context. |
| 6708 |
* |
| 6709 |
* @param key Key of the event callback. Must be a function in the context. |
| 6710 |
* @param fn Function to assign. |
| 6711 |
*/ |
| 6712 |
useContextCallback(key2, fn) { |
| 6713 |
React28.useDebugValue(key2); |
| 6714 |
const stableFunction = useStableCallback(fn ?? NOOP); |
| 6715 |
this.context[key2] = stableFunction; |
| 6716 |
} |
| 6717 |
/** |
| 6718 |
* Returns a stable setter function for a specific key in the store's state. |
| 6719 |
* It's commonly used to pass as a ref callback to React elements. |
| 6720 |
* |
| 6721 |
* @param key Key of the state to set. |
| 6722 |
*/ |
| 6723 |
useStateSetter(key2) { |
| 6724 |
const ref = React28.useRef(void 0); |
| 6725 |
if (ref.current === void 0) { |
| 6726 |
ref.current = (value) => { |
| 6727 |
this.set(key2, value); |
| 6728 |
}; |
| 6729 |
} |
| 6730 |
return ref.current; |
| 6731 |
} |
| 6732 |
/** |
| 6733 |
* Observes changes derived from the store's selectors and calls the listener when the selected value changes. |
| 6734 |
* |
| 6735 |
* @param key Key of the selector to observe. |
| 6736 |
* @param listener Listener function called when the selector result changes. |
| 6737 |
*/ |
| 6738 |
observe(selector2, listener) { |
| 6739 |
let selectFn; |
| 6740 |
if (typeof selector2 === "function") { |
| 6741 |
selectFn = selector2; |
| 6742 |
} else { |
| 6743 |
selectFn = this.selectors[selector2]; |
| 6744 |
} |
| 6745 |
let prevValue = selectFn(this.state); |
| 6746 |
listener(prevValue, prevValue, this); |
| 6747 |
return this.subscribe((nextState) => { |
| 6748 |
const nextValue = selectFn(nextState); |
| 6749 |
if (!Object.is(prevValue, nextValue)) { |
| 6750 |
const oldValue = prevValue; |
| 6751 |
prevValue = nextValue; |
| 6752 |
listener(nextValue, oldValue, this); |
| 6753 |
} |
| 6754 |
}); |
| 6755 |
} |
| 6756 |
}; |
| 6757 |
|
| 6758 |
// node_modules/@base-ui/react/esm/floating-ui-react/components/FloatingRootStore.js |
| 6759 |
var selectors = { |
| 6760 |
open: createSelector((state) => state.open), |
| 6761 |
transitionStatus: createSelector((state) => state.transitionStatus), |
| 6762 |
domReferenceElement: createSelector((state) => state.domReferenceElement), |
| 6763 |
referenceElement: createSelector((state) => state.positionReference ?? state.referenceElement), |
| 6764 |
floatingElement: createSelector((state) => state.floatingElement), |
| 6765 |
floatingId: createSelector((state) => state.floatingId) |
| 6766 |
}; |
| 6767 |
var FloatingRootStore = class extends ReactStore { |
| 6768 |
constructor(options) { |
| 6769 |
const { |
| 6770 |
syncOnly, |
| 6771 |
nested, |
| 6772 |
onOpenChange, |
| 6773 |
triggerElements, |
| 6774 |
...initialState |
| 6775 |
} = options; |
| 6776 |
super({ |
| 6777 |
...initialState, |
| 6778 |
positionReference: initialState.referenceElement, |
| 6779 |
domReferenceElement: initialState.referenceElement |
| 6780 |
}, { |
| 6781 |
onOpenChange, |
| 6782 |
dataRef: { |
| 6783 |
current: {} |
| 6784 |
}, |
| 6785 |
events: createEventEmitter(), |
| 6786 |
nested, |
| 6787 |
triggerElements |
| 6788 |
}, selectors); |
| 6789 |
this.syncOnly = syncOnly; |
| 6790 |
} |
| 6791 |
/** |
| 6792 |
* Syncs the event used by hover logic to distinguish hover-open from click-like interaction. |
| 6793 |
*/ |
| 6794 |
syncOpenEvent = (newOpen, event) => { |
| 6795 |
if (!newOpen || !this.state.open || // Prevent a pending hover-open from overwriting a click-open event, while allowing |
| 6796 |
// click events to upgrade a hover-open. |
| 6797 |
event != null && isClickLikeEvent(event)) { |
| 6798 |
this.context.dataRef.current.openEvent = newOpen ? event : void 0; |
| 6799 |
} |
| 6800 |
}; |
| 6801 |
/** |
| 6802 |
* Runs the root-owned side effects for an open state change. |
| 6803 |
*/ |
| 6804 |
dispatchOpenChange = (newOpen, eventDetails) => { |
| 6805 |
this.syncOpenEvent(newOpen, eventDetails.event); |
| 6806 |
const details = { |
| 6807 |
open: newOpen, |
| 6808 |
reason: eventDetails.reason, |
| 6809 |
nativeEvent: eventDetails.event, |
| 6810 |
nested: this.context.nested, |
| 6811 |
triggerElement: eventDetails.trigger |
| 6812 |
}; |
| 6813 |
this.context.events.emit("openchange", details); |
| 6814 |
}; |
| 6815 |
/** |
| 6816 |
* Emits the `openchange` event through the internal event emitter and calls the `onOpenChange` handler with the provided arguments. |
| 6817 |
* |
| 6818 |
* @param newOpen The new open state. |
| 6819 |
* @param eventDetails Details about the event that triggered the open state change. |
| 6820 |
*/ |
| 6821 |
setOpen = (newOpen, eventDetails) => { |
| 6822 |
if (this.syncOnly) { |
| 6823 |
this.context.onOpenChange?.(newOpen, eventDetails); |
| 6824 |
return; |
| 6825 |
} |
| 6826 |
this.dispatchOpenChange(newOpen, eventDetails); |
| 6827 |
this.context.onOpenChange?.(newOpen, eventDetails); |
| 6828 |
}; |
| 6829 |
}; |
| 6830 |
|
| 6831 |
// node_modules/@base-ui/react/esm/utils/popups/popupStoreUtils.js |
| 6832 |
var React29 = __toESM(require_react(), 1); |
| 6833 |
function useTriggerRegistration(id, store) { |
| 6834 |
const registeredElementIdRef = React29.useRef(null); |
| 6835 |
const registeredElementRef = React29.useRef(null); |
| 6836 |
return React29.useCallback((element) => { |
| 6837 |
if (id === void 0) { |
| 6838 |
return; |
| 6839 |
} |
| 6840 |
if (registeredElementIdRef.current !== null) { |
| 6841 |
const registeredId = registeredElementIdRef.current; |
| 6842 |
const registeredElement = registeredElementRef.current; |
| 6843 |
const currentElement = store.context.triggerElements.getById(registeredId); |
| 6844 |
if (registeredElement && currentElement === registeredElement) { |
| 6845 |
store.context.triggerElements.delete(registeredId); |
| 6846 |
} |
| 6847 |
registeredElementIdRef.current = null; |
| 6848 |
registeredElementRef.current = null; |
| 6849 |
} |
| 6850 |
if (element !== null) { |
| 6851 |
registeredElementIdRef.current = id; |
| 6852 |
registeredElementRef.current = element; |
| 6853 |
store.context.triggerElements.add(id, element); |
| 6854 |
} |
| 6855 |
}, [store, id]); |
| 6856 |
} |
| 6857 |
function useTriggerDataForwarding(triggerId, triggerElementRef, store, stateUpdates) { |
| 6858 |
const isMountedByThisTrigger = store.useState("isMountedByTrigger", triggerId); |
| 6859 |
const baseRegisterTrigger = useTriggerRegistration(triggerId, store); |
| 6860 |
const registerTrigger = useStableCallback((element) => { |
| 6861 |
baseRegisterTrigger(element); |
| 6862 |
if (!element || !store.select("open")) { |
| 6863 |
return; |
| 6864 |
} |
| 6865 |
const activeTriggerId = store.select("activeTriggerId"); |
| 6866 |
if (activeTriggerId === triggerId) { |
| 6867 |
store.update({ |
| 6868 |
activeTriggerElement: element, |
| 6869 |
...stateUpdates |
| 6870 |
}); |
| 6871 |
return; |
| 6872 |
} |
| 6873 |
if (activeTriggerId == null) { |
| 6874 |
store.update({ |
| 6875 |
activeTriggerId: triggerId, |
| 6876 |
activeTriggerElement: element, |
| 6877 |
...stateUpdates |
| 6878 |
}); |
| 6879 |
} |
| 6880 |
}); |
| 6881 |
useIsoLayoutEffect(() => { |
| 6882 |
if (isMountedByThisTrigger) { |
| 6883 |
store.update({ |
| 6884 |
activeTriggerElement: triggerElementRef.current, |
| 6885 |
...stateUpdates |
| 6886 |
}); |
| 6887 |
} |
| 6888 |
}, [isMountedByThisTrigger, store, triggerElementRef, ...Object.values(stateUpdates)]); |
| 6889 |
return { |
| 6890 |
registerTrigger, |
| 6891 |
isMountedByThisTrigger |
| 6892 |
}; |
| 6893 |
} |
| 6894 |
function useImplicitActiveTrigger(store) { |
| 6895 |
const open = store.useState("open"); |
| 6896 |
useIsoLayoutEffect(() => { |
| 6897 |
if (open && !store.select("activeTriggerId") && store.context.triggerElements.size === 1) { |
| 6898 |
const iteratorResult = store.context.triggerElements.entries().next(); |
| 6899 |
if (!iteratorResult.done) { |
| 6900 |
const [implicitTriggerId, implicitTriggerElement] = iteratorResult.value; |
| 6901 |
store.update({ |
| 6902 |
activeTriggerId: implicitTriggerId, |
| 6903 |
activeTriggerElement: implicitTriggerElement |
| 6904 |
}); |
| 6905 |
} |
| 6906 |
} |
| 6907 |
}, [open, store]); |
| 6908 |
} |
| 6909 |
function useOpenStateTransitions(open, store, onUnmount) { |
| 6910 |
const { |
| 6911 |
mounted, |
| 6912 |
setMounted, |
| 6913 |
transitionStatus |
| 6914 |
} = useTransitionStatus(open); |
| 6915 |
store.useSyncedValues({ |
| 6916 |
mounted, |
| 6917 |
transitionStatus |
| 6918 |
}); |
| 6919 |
const forceUnmount = useStableCallback(() => { |
| 6920 |
setMounted(false); |
| 6921 |
store.update({ |
| 6922 |
activeTriggerId: null, |
| 6923 |
activeTriggerElement: null, |
| 6924 |
mounted: false |
| 6925 |
}); |
| 6926 |
onUnmount?.(); |
| 6927 |
store.context.onOpenChangeComplete?.(false); |
| 6928 |
}); |
| 6929 |
const preventUnmountingOnClose = store.useState("preventUnmountingOnClose"); |
| 6930 |
useOpenChangeComplete({ |
| 6931 |
enabled: !preventUnmountingOnClose, |
| 6932 |
open, |
| 6933 |
ref: store.context.popupRef, |
| 6934 |
onComplete() { |
| 6935 |
if (!open) { |
| 6936 |
forceUnmount(); |
| 6937 |
} |
| 6938 |
} |
| 6939 |
}); |
| 6940 |
return { |
| 6941 |
forceUnmount, |
| 6942 |
transitionStatus |
| 6943 |
}; |
| 6944 |
} |
| 6945 |
|
| 6946 |
// node_modules/@base-ui/react/esm/utils/popups/popupTriggerMap.js |
| 6947 |
var PopupTriggerMap = class { |
| 6948 |
constructor() { |
| 6949 |
this.elementsSet = /* @__PURE__ */ new Set(); |
| 6950 |
this.idMap = /* @__PURE__ */ new Map(); |
| 6951 |
} |
| 6952 |
/** |
| 6953 |
* Adds a trigger element with the given ID. |
| 6954 |
* |
| 6955 |
* Note: The provided element is assumed to not be registered under multiple IDs. |
| 6956 |
*/ |
| 6957 |
add(id, element) { |
| 6958 |
const existingElement = this.idMap.get(id); |
| 6959 |
if (existingElement === element) { |
| 6960 |
return; |
| 6961 |
} |
| 6962 |
if (existingElement !== void 0) { |
| 6963 |
this.elementsSet.delete(existingElement); |
| 6964 |
} |
| 6965 |
this.elementsSet.add(element); |
| 6966 |
this.idMap.set(id, element); |
| 6967 |
if (true) { |
| 6968 |
if (this.elementsSet.size !== this.idMap.size) { |
| 6969 |
throw new Error("Base UI: A trigger element cannot be registered under multiple IDs in PopupTriggerMap."); |
| 6970 |
} |
| 6971 |
} |
| 6972 |
} |
| 6973 |
/** |
| 6974 |
* Removes the trigger element with the given ID. |
| 6975 |
*/ |
| 6976 |
delete(id) { |
| 6977 |
const element = this.idMap.get(id); |
| 6978 |
if (element) { |
| 6979 |
this.elementsSet.delete(element); |
| 6980 |
this.idMap.delete(id); |
| 6981 |
} |
| 6982 |
} |
| 6983 |
/** |
| 6984 |
* Whether the given element is registered as a trigger. |
| 6985 |
*/ |
| 6986 |
hasElement(element) { |
| 6987 |
return this.elementsSet.has(element); |
| 6988 |
} |
| 6989 |
/** |
| 6990 |
* Whether there is a registered trigger element matching the given predicate. |
| 6991 |
*/ |
| 6992 |
hasMatchingElement(predicate) { |
| 6993 |
for (const element of this.elementsSet) { |
| 6994 |
if (predicate(element)) { |
| 6995 |
return true; |
| 6996 |
} |
| 6997 |
} |
| 6998 |
return false; |
| 6999 |
} |
| 7000 |
/** |
| 7001 |
* Returns the trigger element associated with the given ID, or undefined if no such element exists. |
| 7002 |
*/ |
| 7003 |
getById(id) { |
| 7004 |
return this.idMap.get(id); |
| 7005 |
} |
| 7006 |
/** |
| 7007 |
* Returns an iterable of all registered trigger entries, where each entry is a tuple of [id, element]. |
| 7008 |
*/ |
| 7009 |
entries() { |
| 7010 |
return this.idMap.entries(); |
| 7011 |
} |
| 7012 |
/** |
| 7013 |
* Returns an iterable of all registered trigger elements. |
| 7014 |
*/ |
| 7015 |
elements() { |
| 7016 |
return this.elementsSet.values(); |
| 7017 |
} |
| 7018 |
/** |
| 7019 |
* Returns the number of registered trigger elements. |
| 7020 |
*/ |
| 7021 |
get size() { |
| 7022 |
return this.idMap.size; |
| 7023 |
} |
| 7024 |
}; |
| 7025 |
|
| 7026 |
// node_modules/@base-ui/react/esm/floating-ui-react/utils/getEmptyRootContext.js |
| 7027 |
function getEmptyRootContext() { |
| 7028 |
return new FloatingRootStore({ |
| 7029 |
open: false, |
| 7030 |
transitionStatus: void 0, |
| 7031 |
floatingElement: null, |
| 7032 |
referenceElement: null, |
| 7033 |
triggerElements: new PopupTriggerMap(), |
| 7034 |
floatingId: "", |
| 7035 |
syncOnly: false, |
| 7036 |
nested: false, |
| 7037 |
onOpenChange: void 0 |
| 7038 |
}); |
| 7039 |
} |
| 7040 |
|
| 7041 |
// node_modules/@base-ui/react/esm/utils/popups/store.js |
| 7042 |
function createInitialPopupStoreState() { |
| 7043 |
return { |
| 7044 |
open: false, |
| 7045 |
openProp: void 0, |
| 7046 |
mounted: false, |
| 7047 |
transitionStatus: void 0, |
| 7048 |
floatingRootContext: getEmptyRootContext(), |
| 7049 |
preventUnmountingOnClose: false, |
| 7050 |
payload: void 0, |
| 7051 |
activeTriggerId: null, |
| 7052 |
activeTriggerElement: null, |
| 7053 |
triggerIdProp: void 0, |
| 7054 |
popupElement: null, |
| 7055 |
positionerElement: null, |
| 7056 |
activeTriggerProps: EMPTY_OBJECT, |
| 7057 |
inactiveTriggerProps: EMPTY_OBJECT, |
| 7058 |
popupProps: EMPTY_OBJECT |
| 7059 |
}; |
| 7060 |
} |
| 7061 |
var activeTriggerIdSelector = createSelector((state) => state.triggerIdProp ?? state.activeTriggerId); |
| 7062 |
var popupStoreSelectors = { |
| 7063 |
open: createSelector((state) => state.openProp ?? state.open), |
| 7064 |
mounted: createSelector((state) => state.mounted), |
| 7065 |
transitionStatus: createSelector((state) => state.transitionStatus), |
| 7066 |
floatingRootContext: createSelector((state) => state.floatingRootContext), |
| 7067 |
preventUnmountingOnClose: createSelector((state) => state.preventUnmountingOnClose), |
| 7068 |
payload: createSelector((state) => state.payload), |
| 7069 |
activeTriggerId: activeTriggerIdSelector, |
| 7070 |
activeTriggerElement: createSelector((state) => state.mounted ? state.activeTriggerElement : null), |
| 7071 |
/** |
| 7072 |
* Whether the trigger with the given ID was used to open the popup. |
| 7073 |
*/ |
| 7074 |
isTriggerActive: createSelector((state, triggerId) => triggerId !== void 0 && activeTriggerIdSelector(state) === triggerId), |
| 7075 |
/** |
| 7076 |
* Whether the popup is open and was activated by a trigger with the given ID. |
| 7077 |
*/ |
| 7078 |
isOpenedByTrigger: createSelector((state, triggerId) => triggerId !== void 0 && activeTriggerIdSelector(state) === triggerId && state.open), |
| 7079 |
/** |
| 7080 |
* Whether the popup is mounted and was activated by a trigger with the given ID. |
| 7081 |
*/ |
| 7082 |
isMountedByTrigger: createSelector((state, triggerId) => triggerId !== void 0 && activeTriggerIdSelector(state) === triggerId && state.mounted), |
| 7083 |
triggerProps: createSelector((state, isActive) => isActive ? state.activeTriggerProps : state.inactiveTriggerProps), |
| 7084 |
popupProps: createSelector((state) => state.popupProps), |
| 7085 |
popupElement: createSelector((state) => state.popupElement), |
| 7086 |
positionerElement: createSelector((state) => state.positionerElement) |
| 7087 |
}; |
| 7088 |
|
| 7089 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useFloatingRootContext.js |
| 7090 |
function useFloatingRootContext(options) { |
| 7091 |
const { |
| 7092 |
open = false, |
| 7093 |
onOpenChange, |
| 7094 |
elements = {} |
| 7095 |
} = options; |
| 7096 |
const floatingId = useId(); |
| 7097 |
const nested = useFloatingParentNodeId() != null; |
| 7098 |
if (true) { |
| 7099 |
const optionDomReference = elements.reference; |
| 7100 |
if (optionDomReference && !isElement(optionDomReference)) { |
| 7101 |
console.error("Cannot pass a virtual element to the `elements.reference` option,", "as it must be a real DOM element. Use `context.setPositionReference()`", "instead."); |
| 7102 |
} |
| 7103 |
} |
| 7104 |
const store = useRefWithInit(() => new FloatingRootStore({ |
| 7105 |
open, |
| 7106 |
transitionStatus: void 0, |
| 7107 |
onOpenChange, |
| 7108 |
referenceElement: elements.reference ?? null, |
| 7109 |
floatingElement: elements.floating ?? null, |
| 7110 |
triggerElements: new PopupTriggerMap(), |
| 7111 |
floatingId, |
| 7112 |
syncOnly: false, |
| 7113 |
nested |
| 7114 |
})).current; |
| 7115 |
useIsoLayoutEffect(() => { |
| 7116 |
const valuesToSync = { |
| 7117 |
open, |
| 7118 |
floatingId |
| 7119 |
}; |
| 7120 |
if (elements.reference !== void 0) { |
| 7121 |
valuesToSync.referenceElement = elements.reference; |
| 7122 |
valuesToSync.domReferenceElement = isElement(elements.reference) ? elements.reference : null; |
| 7123 |
} |
| 7124 |
if (elements.floating !== void 0) { |
| 7125 |
valuesToSync.floatingElement = elements.floating; |
| 7126 |
} |
| 7127 |
store.update(valuesToSync); |
| 7128 |
}, [open, floatingId, elements.reference, elements.floating, store]); |
| 7129 |
store.context.onOpenChange = onOpenChange; |
| 7130 |
store.context.nested = nested; |
| 7131 |
return store; |
| 7132 |
} |
| 7133 |
|
| 7134 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useFloating.js |
| 7135 |
function useFloating2(options = {}) { |
| 7136 |
const { |
| 7137 |
nodeId, |
| 7138 |
externalTree |
| 7139 |
} = options; |
| 7140 |
const internalRootStore = useFloatingRootContext(options); |
| 7141 |
const rootContext = options.rootContext || internalRootStore; |
| 7142 |
const rootContextElements = { |
| 7143 |
reference: rootContext.useState("referenceElement"), |
| 7144 |
floating: rootContext.useState("floatingElement"), |
| 7145 |
domReference: rootContext.useState("domReferenceElement") |
| 7146 |
}; |
| 7147 |
const [positionReference, setPositionReferenceRaw] = React30.useState(null); |
| 7148 |
const domReferenceRef = React30.useRef(null); |
| 7149 |
const tree = useFloatingTree(externalTree); |
| 7150 |
useIsoLayoutEffect(() => { |
| 7151 |
if (rootContextElements.domReference) { |
| 7152 |
domReferenceRef.current = rootContextElements.domReference; |
| 7153 |
} |
| 7154 |
}, [rootContextElements.domReference]); |
| 7155 |
const position = useFloating({ |
| 7156 |
...options, |
| 7157 |
elements: { |
| 7158 |
...rootContextElements, |
| 7159 |
...positionReference && { |
| 7160 |
reference: positionReference |
| 7161 |
} |
| 7162 |
} |
| 7163 |
}); |
| 7164 |
const setPositionReference = React30.useCallback((node) => { |
| 7165 |
const computedPositionReference = isElement(node) ? { |
| 7166 |
getBoundingClientRect: () => node.getBoundingClientRect(), |
| 7167 |
getClientRects: () => node.getClientRects(), |
| 7168 |
contextElement: node |
| 7169 |
} : node; |
| 7170 |
setPositionReferenceRaw(computedPositionReference); |
| 7171 |
position.refs.setReference(computedPositionReference); |
| 7172 |
}, [position.refs]); |
| 7173 |
const [localDomReference, setLocalDomReference] = React30.useState(void 0); |
| 7174 |
const [localFloatingElement, setLocalFloatingElement] = React30.useState(null); |
| 7175 |
rootContext.useSyncedValue("referenceElement", localDomReference ?? null); |
| 7176 |
const localDomReferenceElement = isElement(localDomReference) ? localDomReference : null; |
| 7177 |
rootContext.useSyncedValue("domReferenceElement", localDomReference === void 0 ? rootContextElements.domReference : localDomReferenceElement); |
| 7178 |
rootContext.useSyncedValue("floatingElement", localFloatingElement); |
| 7179 |
const setReference = React30.useCallback((node) => { |
| 7180 |
if (isElement(node) || node === null) { |
| 7181 |
domReferenceRef.current = node; |
| 7182 |
setLocalDomReference(node); |
| 7183 |
} |
| 7184 |
if (isElement(position.refs.reference.current) || position.refs.reference.current === null || // Don't allow setting virtual elements using the old technique back to |
| 7185 |
// `null` to support `positionReference` + an unstable `reference` |
| 7186 |
// callback ref. |
| 7187 |
node !== null && !isElement(node)) { |
| 7188 |
position.refs.setReference(node); |
| 7189 |
} |
| 7190 |
}, [position.refs, setLocalDomReference]); |
| 7191 |
const setFloating = React30.useCallback((node) => { |
| 7192 |
setLocalFloatingElement(node); |
| 7193 |
position.refs.setFloating(node); |
| 7194 |
}, [position.refs]); |
| 7195 |
const refs = React30.useMemo(() => ({ |
| 7196 |
...position.refs, |
| 7197 |
setReference, |
| 7198 |
setFloating, |
| 7199 |
setPositionReference, |
| 7200 |
domReference: domReferenceRef |
| 7201 |
}), [position.refs, setReference, setFloating, setPositionReference]); |
| 7202 |
const elements = React30.useMemo(() => ({ |
| 7203 |
...position.elements, |
| 7204 |
domReference: rootContextElements.domReference |
| 7205 |
}), [position.elements, rootContextElements.domReference]); |
| 7206 |
const open = rootContext.useState("open"); |
| 7207 |
const floatingId = rootContext.useState("floatingId"); |
| 7208 |
const context = React30.useMemo(() => ({ |
| 7209 |
...position, |
| 7210 |
dataRef: rootContext.context.dataRef, |
| 7211 |
open, |
| 7212 |
onOpenChange: rootContext.setOpen, |
| 7213 |
events: rootContext.context.events, |
| 7214 |
floatingId, |
| 7215 |
refs, |
| 7216 |
elements, |
| 7217 |
nodeId, |
| 7218 |
rootStore: rootContext |
| 7219 |
}), [position, refs, elements, nodeId, rootContext, open, floatingId]); |
| 7220 |
useIsoLayoutEffect(() => { |
| 7221 |
rootContext.context.dataRef.current.floatingContext = context; |
| 7222 |
const node = tree?.nodesRef.current.find((n2) => n2.id === nodeId); |
| 7223 |
if (node) { |
| 7224 |
node.context = context; |
| 7225 |
} |
| 7226 |
}); |
| 7227 |
return React30.useMemo(() => ({ |
| 7228 |
...position, |
| 7229 |
context, |
| 7230 |
refs, |
| 7231 |
elements, |
| 7232 |
rootStore: rootContext |
| 7233 |
}), [position, refs, elements, context, rootContext]); |
| 7234 |
} |
| 7235 |
|
| 7236 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useSyncedFloatingRootContext.js |
| 7237 |
function useSyncedFloatingRootContext(options) { |
| 7238 |
const { |
| 7239 |
popupStore, |
| 7240 |
treatPopupAsFloatingElement = false, |
| 7241 |
onOpenChange |
| 7242 |
} = options; |
| 7243 |
const floatingId = useId(); |
| 7244 |
const nested = useFloatingParentNodeId() != null; |
| 7245 |
const open = popupStore.useState("open"); |
| 7246 |
const referenceElement = popupStore.useState("activeTriggerElement"); |
| 7247 |
const floatingElement = popupStore.useState(treatPopupAsFloatingElement ? "popupElement" : "positionerElement"); |
| 7248 |
const triggerElements = popupStore.context.triggerElements; |
| 7249 |
const store = useRefWithInit(() => new FloatingRootStore({ |
| 7250 |
open, |
| 7251 |
transitionStatus: void 0, |
| 7252 |
referenceElement, |
| 7253 |
floatingElement, |
| 7254 |
triggerElements, |
| 7255 |
onOpenChange, |
| 7256 |
floatingId, |
| 7257 |
syncOnly: true, |
| 7258 |
nested |
| 7259 |
})).current; |
| 7260 |
useIsoLayoutEffect(() => { |
| 7261 |
const valuesToSync = { |
| 7262 |
open, |
| 7263 |
floatingId, |
| 7264 |
referenceElement, |
| 7265 |
floatingElement |
| 7266 |
}; |
| 7267 |
if (isElement(referenceElement)) { |
| 7268 |
valuesToSync.domReferenceElement = referenceElement; |
| 7269 |
} |
| 7270 |
if (store.state.positionReference === store.state.referenceElement) { |
| 7271 |
valuesToSync.positionReference = referenceElement; |
| 7272 |
} |
| 7273 |
store.update(valuesToSync); |
| 7274 |
}, [open, floatingId, referenceElement, floatingElement, store]); |
| 7275 |
store.context.onOpenChange = onOpenChange; |
| 7276 |
store.context.nested = nested; |
| 7277 |
return store; |
| 7278 |
} |
| 7279 |
|
| 7280 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useFocus.js |
| 7281 |
var React31 = __toESM(require_react(), 1); |
| 7282 |
var isMacSafari = isMac && isSafari; |
| 7283 |
function useFocus(context, props = {}) { |
| 7284 |
const store = "rootStore" in context ? context.rootStore : context; |
| 7285 |
const { |
| 7286 |
events: events2, |
| 7287 |
dataRef |
| 7288 |
} = store.context; |
| 7289 |
const { |
| 7290 |
enabled = true, |
| 7291 |
delay |
| 7292 |
} = props; |
| 7293 |
const blockFocusRef = React31.useRef(false); |
| 7294 |
const blockedReferenceRef = React31.useRef(null); |
| 7295 |
const timeout = useTimeout(); |
| 7296 |
const keyboardModalityRef = React31.useRef(true); |
| 7297 |
React31.useEffect(() => { |
| 7298 |
const domReference = store.select("domReferenceElement"); |
| 7299 |
if (!enabled) { |
| 7300 |
return void 0; |
| 7301 |
} |
| 7302 |
const win = getWindow(domReference); |
| 7303 |
function onBlur() { |
| 7304 |
const currentDomReference = store.select("domReferenceElement"); |
| 7305 |
if (!store.select("open") && isHTMLElement(currentDomReference) && currentDomReference === activeElement(ownerDocument(currentDomReference))) { |
| 7306 |
blockFocusRef.current = true; |
| 7307 |
} |
| 7308 |
} |
| 7309 |
function onKeyDown() { |
| 7310 |
keyboardModalityRef.current = true; |
| 7311 |
} |
| 7312 |
function onPointerDown() { |
| 7313 |
keyboardModalityRef.current = false; |
| 7314 |
} |
| 7315 |
return mergeCleanups(addEventListener(win, "blur", onBlur), isMacSafari && addEventListener(win, "keydown", onKeyDown, true), isMacSafari && addEventListener(win, "pointerdown", onPointerDown, true)); |
| 7316 |
}, [store, enabled]); |
| 7317 |
React31.useEffect(() => { |
| 7318 |
if (!enabled) { |
| 7319 |
return void 0; |
| 7320 |
} |
| 7321 |
function onOpenChangeLocal(details) { |
| 7322 |
if (details.reason === reason_parts_exports.triggerPress || details.reason === reason_parts_exports.escapeKey) { |
| 7323 |
const referenceElement = store.select("domReferenceElement"); |
| 7324 |
if (isElement(referenceElement)) { |
| 7325 |
blockedReferenceRef.current = referenceElement; |
| 7326 |
blockFocusRef.current = true; |
| 7327 |
} |
| 7328 |
} |
| 7329 |
} |
| 7330 |
events2.on("openchange", onOpenChangeLocal); |
| 7331 |
return () => { |
| 7332 |
events2.off("openchange", onOpenChangeLocal); |
| 7333 |
}; |
| 7334 |
}, [events2, enabled, store]); |
| 7335 |
const reference = React31.useMemo(() => ({ |
| 7336 |
onMouseLeave() { |
| 7337 |
blockFocusRef.current = false; |
| 7338 |
blockedReferenceRef.current = null; |
| 7339 |
}, |
| 7340 |
onFocus(event) { |
| 7341 |
const focusTarget = event.currentTarget; |
| 7342 |
if (blockFocusRef.current) { |
| 7343 |
if (blockedReferenceRef.current === focusTarget) { |
| 7344 |
return; |
| 7345 |
} |
| 7346 |
blockFocusRef.current = false; |
| 7347 |
blockedReferenceRef.current = null; |
| 7348 |
} |
| 7349 |
const target = getTarget(event.nativeEvent); |
| 7350 |
if (isElement(target)) { |
| 7351 |
if (isMacSafari && !event.relatedTarget) { |
| 7352 |
if (!keyboardModalityRef.current && !isTypeableElement(target)) { |
| 7353 |
return; |
| 7354 |
} |
| 7355 |
} else if (!matchesFocusVisible(target)) { |
| 7356 |
return; |
| 7357 |
} |
| 7358 |
} |
| 7359 |
const movedFromOtherEnabledTrigger = isTargetInsideEnabledTrigger(event.relatedTarget, store.context.triggerElements); |
| 7360 |
const { |
| 7361 |
nativeEvent, |
| 7362 |
currentTarget |
| 7363 |
} = event; |
| 7364 |
const delayValue = typeof delay === "function" ? delay() : delay; |
| 7365 |
if (store.select("open") && movedFromOtherEnabledTrigger || delayValue === 0 || delayValue === void 0) { |
| 7366 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerFocus, nativeEvent, currentTarget)); |
| 7367 |
return; |
| 7368 |
} |
| 7369 |
timeout.start(delayValue, () => { |
| 7370 |
if (blockFocusRef.current) { |
| 7371 |
return; |
| 7372 |
} |
| 7373 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerFocus, nativeEvent, currentTarget)); |
| 7374 |
}); |
| 7375 |
}, |
| 7376 |
onBlur(event) { |
| 7377 |
blockFocusRef.current = false; |
| 7378 |
blockedReferenceRef.current = null; |
| 7379 |
const relatedTarget = event.relatedTarget; |
| 7380 |
const nativeEvent = event.nativeEvent; |
| 7381 |
const movedToFocusGuard = isElement(relatedTarget) && relatedTarget.hasAttribute(createAttribute("focus-guard")) && relatedTarget.getAttribute("data-type") === "outside"; |
| 7382 |
timeout.start(0, () => { |
| 7383 |
const domReference = store.select("domReferenceElement"); |
| 7384 |
const activeEl = activeElement(ownerDocument(domReference)); |
| 7385 |
if (!relatedTarget && activeEl === domReference) { |
| 7386 |
return; |
| 7387 |
} |
| 7388 |
if (contains(dataRef.current.floatingContext?.refs.floating.current, activeEl) || contains(domReference, activeEl) || movedToFocusGuard) { |
| 7389 |
return; |
| 7390 |
} |
| 7391 |
const nextFocusedElement = relatedTarget ?? activeEl; |
| 7392 |
if (isTargetInsideEnabledTrigger(nextFocusedElement, store.context.triggerElements)) { |
| 7393 |
return; |
| 7394 |
} |
| 7395 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerFocus, nativeEvent)); |
| 7396 |
}); |
| 7397 |
} |
| 7398 |
}), [dataRef, store, timeout, delay]); |
| 7399 |
return React31.useMemo(() => enabled ? { |
| 7400 |
reference, |
| 7401 |
trigger: reference |
| 7402 |
} : {}, [enabled, reference]); |
| 7403 |
} |
| 7404 |
|
| 7405 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useHoverFloatingInteraction.js |
| 7406 |
var React32 = __toESM(require_react(), 1); |
| 7407 |
|
| 7408 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useHoverInteractionSharedState.js |
| 7409 |
var HoverInteraction = class _HoverInteraction { |
| 7410 |
constructor() { |
| 7411 |
this.pointerType = void 0; |
| 7412 |
this.interactedInside = false; |
| 7413 |
this.handler = void 0; |
| 7414 |
this.blockMouseMove = true; |
| 7415 |
this.performedPointerEventsMutation = false; |
| 7416 |
this.pointerEventsScopeElement = null; |
| 7417 |
this.pointerEventsReferenceElement = null; |
| 7418 |
this.pointerEventsFloatingElement = null; |
| 7419 |
this.restTimeoutPending = false; |
| 7420 |
this.openChangeTimeout = new Timeout(); |
| 7421 |
this.restTimeout = new Timeout(); |
| 7422 |
this.handleCloseOptions = void 0; |
| 7423 |
} |
| 7424 |
static create() { |
| 7425 |
return new _HoverInteraction(); |
| 7426 |
} |
| 7427 |
dispose = () => { |
| 7428 |
this.openChangeTimeout.clear(); |
| 7429 |
this.restTimeout.clear(); |
| 7430 |
}; |
| 7431 |
disposeEffect = () => { |
| 7432 |
return this.dispose; |
| 7433 |
}; |
| 7434 |
}; |
| 7435 |
var pointerEventsMutationOwnerByScopeElement = /* @__PURE__ */ new WeakMap(); |
| 7436 |
function clearSafePolygonPointerEventsMutation(instance) { |
| 7437 |
if (!instance.performedPointerEventsMutation) { |
| 7438 |
return; |
| 7439 |
} |
| 7440 |
const scopeElement = instance.pointerEventsScopeElement; |
| 7441 |
if (scopeElement && pointerEventsMutationOwnerByScopeElement.get(scopeElement) === instance) { |
| 7442 |
instance.pointerEventsScopeElement?.style.removeProperty("pointer-events"); |
| 7443 |
instance.pointerEventsReferenceElement?.style.removeProperty("pointer-events"); |
| 7444 |
instance.pointerEventsFloatingElement?.style.removeProperty("pointer-events"); |
| 7445 |
pointerEventsMutationOwnerByScopeElement.delete(scopeElement); |
| 7446 |
} |
| 7447 |
instance.performedPointerEventsMutation = false; |
| 7448 |
instance.pointerEventsScopeElement = null; |
| 7449 |
instance.pointerEventsReferenceElement = null; |
| 7450 |
instance.pointerEventsFloatingElement = null; |
| 7451 |
} |
| 7452 |
function applySafePolygonPointerEventsMutation(instance, options) { |
| 7453 |
const { |
| 7454 |
scopeElement, |
| 7455 |
referenceElement, |
| 7456 |
floatingElement |
| 7457 |
} = options; |
| 7458 |
const existingOwner = pointerEventsMutationOwnerByScopeElement.get(scopeElement); |
| 7459 |
if (existingOwner && existingOwner !== instance) { |
| 7460 |
clearSafePolygonPointerEventsMutation(existingOwner); |
| 7461 |
} |
| 7462 |
clearSafePolygonPointerEventsMutation(instance); |
| 7463 |
instance.performedPointerEventsMutation = true; |
| 7464 |
instance.pointerEventsScopeElement = scopeElement; |
| 7465 |
instance.pointerEventsReferenceElement = referenceElement; |
| 7466 |
instance.pointerEventsFloatingElement = floatingElement; |
| 7467 |
pointerEventsMutationOwnerByScopeElement.set(scopeElement, instance); |
| 7468 |
scopeElement.style.pointerEvents = "none"; |
| 7469 |
referenceElement.style.pointerEvents = "auto"; |
| 7470 |
floatingElement.style.pointerEvents = "auto"; |
| 7471 |
} |
| 7472 |
function useHoverInteractionSharedState(store) { |
| 7473 |
const instance = useRefWithInit(HoverInteraction.create).current; |
| 7474 |
const data = store.context.dataRef.current; |
| 7475 |
if (!data.hoverInteractionState) { |
| 7476 |
data.hoverInteractionState = instance; |
| 7477 |
} |
| 7478 |
useOnMount(data.hoverInteractionState.disposeEffect); |
| 7479 |
return data.hoverInteractionState; |
| 7480 |
} |
| 7481 |
|
| 7482 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useHoverFloatingInteraction.js |
| 7483 |
function useHoverFloatingInteraction(context, parameters = {}) { |
| 7484 |
const store = "rootStore" in context ? context.rootStore : context; |
| 7485 |
const open = store.useState("open"); |
| 7486 |
const floatingElement = store.useState("floatingElement"); |
| 7487 |
const domReferenceElement = store.useState("domReferenceElement"); |
| 7488 |
const { |
| 7489 |
dataRef |
| 7490 |
} = store.context; |
| 7491 |
const { |
| 7492 |
enabled = true, |
| 7493 |
closeDelay: closeDelayProp = 0, |
| 7494 |
nodeId: nodeIdProp |
| 7495 |
} = parameters; |
| 7496 |
const instance = useHoverInteractionSharedState(store); |
| 7497 |
const tree = useFloatingTree(); |
| 7498 |
const parentId = useFloatingParentNodeId(); |
| 7499 |
const isClickLikeOpenEvent2 = useStableCallback(() => { |
| 7500 |
return isClickLikeOpenEvent(dataRef.current.openEvent?.type, instance.interactedInside); |
| 7501 |
}); |
| 7502 |
const isHoverOpen = useStableCallback(() => { |
| 7503 |
const type = dataRef.current.openEvent?.type; |
| 7504 |
return type?.includes("mouse") && type !== "mousedown"; |
| 7505 |
}); |
| 7506 |
const isRelatedTargetInsideEnabledTrigger = useStableCallback((target) => { |
| 7507 |
return isTargetInsideEnabledTrigger(target, store.context.triggerElements); |
| 7508 |
}); |
| 7509 |
const closeWithDelay = React32.useCallback((event) => { |
| 7510 |
const closeDelay = getDelay(closeDelayProp, "close", instance.pointerType); |
| 7511 |
const close = () => { |
| 7512 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerHover, event)); |
| 7513 |
tree?.events.emit("floating.closed", event); |
| 7514 |
}; |
| 7515 |
if (closeDelay) { |
| 7516 |
instance.openChangeTimeout.start(closeDelay, close); |
| 7517 |
} else { |
| 7518 |
instance.openChangeTimeout.clear(); |
| 7519 |
close(); |
| 7520 |
} |
| 7521 |
}, [closeDelayProp, store, instance, tree]); |
| 7522 |
const clearPointerEvents = useStableCallback(() => { |
| 7523 |
clearSafePolygonPointerEventsMutation(instance); |
| 7524 |
}); |
| 7525 |
const handleInteractInside = useStableCallback((event) => { |
| 7526 |
const target = getTarget(event); |
| 7527 |
if (!isInteractiveElement(target)) { |
| 7528 |
instance.interactedInside = false; |
| 7529 |
return; |
| 7530 |
} |
| 7531 |
instance.interactedInside = target?.closest("[aria-haspopup]") != null; |
| 7532 |
}); |
| 7533 |
useIsoLayoutEffect(() => { |
| 7534 |
if (!open) { |
| 7535 |
instance.pointerType = void 0; |
| 7536 |
instance.restTimeoutPending = false; |
| 7537 |
instance.interactedInside = false; |
| 7538 |
clearPointerEvents(); |
| 7539 |
} |
| 7540 |
}, [open, instance, clearPointerEvents]); |
| 7541 |
React32.useEffect(() => { |
| 7542 |
return clearPointerEvents; |
| 7543 |
}, [clearPointerEvents]); |
| 7544 |
useIsoLayoutEffect(() => { |
| 7545 |
if (!enabled) { |
| 7546 |
return void 0; |
| 7547 |
} |
| 7548 |
if (open && instance.handleCloseOptions?.blockPointerEvents && isHoverOpen() && isElement(domReferenceElement) && floatingElement) { |
| 7549 |
const ref = domReferenceElement; |
| 7550 |
const floatingEl = floatingElement; |
| 7551 |
const doc = ownerDocument(floatingElement); |
| 7552 |
const parentFloating = tree?.nodesRef.current.find((node) => node.id === parentId)?.context?.elements.floating; |
| 7553 |
if (parentFloating) { |
| 7554 |
parentFloating.style.pointerEvents = ""; |
| 7555 |
} |
| 7556 |
const scopeElement = instance.handleCloseOptions?.getScope?.() ?? instance.pointerEventsScopeElement ?? parentFloating ?? ref.closest("[data-rootownerid]") ?? doc.body; |
| 7557 |
applySafePolygonPointerEventsMutation(instance, { |
| 7558 |
scopeElement, |
| 7559 |
referenceElement: ref, |
| 7560 |
floatingElement: floatingEl |
| 7561 |
}); |
| 7562 |
return () => { |
| 7563 |
clearPointerEvents(); |
| 7564 |
}; |
| 7565 |
} |
| 7566 |
return void 0; |
| 7567 |
}, [enabled, open, domReferenceElement, floatingElement, instance, isHoverOpen, tree, parentId, clearPointerEvents]); |
| 7568 |
const childClosedTimeout = useTimeout(); |
| 7569 |
React32.useEffect(() => { |
| 7570 |
if (!enabled) { |
| 7571 |
return void 0; |
| 7572 |
} |
| 7573 |
function onFloatingMouseEnter() { |
| 7574 |
instance.openChangeTimeout.clear(); |
| 7575 |
childClosedTimeout.clear(); |
| 7576 |
tree?.events.off("floating.closed", onNodeClosed); |
| 7577 |
clearPointerEvents(); |
| 7578 |
} |
| 7579 |
function onFloatingMouseLeave(event) { |
| 7580 |
if (tree && parentId && getNodeChildren(tree.nodesRef.current, parentId).length > 0) { |
| 7581 |
tree.events.on("floating.closed", onNodeClosed); |
| 7582 |
return; |
| 7583 |
} |
| 7584 |
if (isRelatedTargetInsideEnabledTrigger(event.relatedTarget)) { |
| 7585 |
return; |
| 7586 |
} |
| 7587 |
const currentNodeId = dataRef.current.floatingContext?.nodeId ?? nodeIdProp; |
| 7588 |
const relatedTarget = event.relatedTarget; |
| 7589 |
const isMovingIntoDescendantFloating = tree && currentNodeId && isElement(relatedTarget) && getNodeChildren(tree.nodesRef.current, currentNodeId, false).some((node) => contains(node.context?.elements.floating, relatedTarget)); |
| 7590 |
if (isMovingIntoDescendantFloating) { |
| 7591 |
return; |
| 7592 |
} |
| 7593 |
if (instance.handler) { |
| 7594 |
instance.handler(event); |
| 7595 |
return; |
| 7596 |
} |
| 7597 |
clearPointerEvents(); |
| 7598 |
if (!isClickLikeOpenEvent2()) { |
| 7599 |
closeWithDelay(event); |
| 7600 |
} |
| 7601 |
} |
| 7602 |
function onNodeClosed(event) { |
| 7603 |
if (!tree || !parentId || getNodeChildren(tree.nodesRef.current, parentId).length > 0) { |
| 7604 |
return; |
| 7605 |
} |
| 7606 |
childClosedTimeout.start(0, () => { |
| 7607 |
tree.events.off("floating.closed", onNodeClosed); |
| 7608 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerHover, event)); |
| 7609 |
tree.events.emit("floating.closed", event); |
| 7610 |
}); |
| 7611 |
} |
| 7612 |
const floating = floatingElement; |
| 7613 |
return mergeCleanups(floating && addEventListener(floating, "mouseenter", onFloatingMouseEnter), floating && addEventListener(floating, "mouseleave", onFloatingMouseLeave), floating && addEventListener(floating, "pointerdown", handleInteractInside, true), () => { |
| 7614 |
tree?.events.off("floating.closed", onNodeClosed); |
| 7615 |
}); |
| 7616 |
}, [enabled, floatingElement, store, dataRef, nodeIdProp, isClickLikeOpenEvent2, isRelatedTargetInsideEnabledTrigger, closeWithDelay, clearPointerEvents, handleInteractInside, instance, tree, parentId, childClosedTimeout]); |
| 7617 |
} |
| 7618 |
|
| 7619 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useHoverReferenceInteraction.js |
| 7620 |
var React33 = __toESM(require_react(), 1); |
| 7621 |
var ReactDOM4 = __toESM(require_react_dom(), 1); |
| 7622 |
var EMPTY_REF = { |
| 7623 |
current: null |
| 7624 |
}; |
| 7625 |
function useHoverReferenceInteraction(context, props = {}) { |
| 7626 |
const store = "rootStore" in context ? context.rootStore : context; |
| 7627 |
const { |
| 7628 |
dataRef, |
| 7629 |
events: events2 |
| 7630 |
} = store.context; |
| 7631 |
const { |
| 7632 |
enabled = true, |
| 7633 |
delay = 0, |
| 7634 |
handleClose = null, |
| 7635 |
mouseOnly = false, |
| 7636 |
restMs = 0, |
| 7637 |
move = true, |
| 7638 |
triggerElementRef = EMPTY_REF, |
| 7639 |
externalTree, |
| 7640 |
isActiveTrigger = true, |
| 7641 |
getHandleCloseContext, |
| 7642 |
isClosing |
| 7643 |
} = props; |
| 7644 |
const tree = useFloatingTree(externalTree); |
| 7645 |
const instance = useHoverInteractionSharedState(store); |
| 7646 |
const isHoverCloseActiveRef = React33.useRef(false); |
| 7647 |
const handleCloseRef = useValueAsRef(handleClose); |
| 7648 |
const delayRef = useValueAsRef(delay); |
| 7649 |
const restMsRef = useValueAsRef(restMs); |
| 7650 |
const enabledRef = useValueAsRef(enabled); |
| 7651 |
const isClosingRef = useValueAsRef(isClosing); |
| 7652 |
if (isActiveTrigger) { |
| 7653 |
instance.handleCloseOptions = handleCloseRef.current?.__options; |
| 7654 |
} |
| 7655 |
const isClickLikeOpenEvent2 = useStableCallback(() => { |
| 7656 |
return isClickLikeOpenEvent(dataRef.current.openEvent?.type, instance.interactedInside); |
| 7657 |
}); |
| 7658 |
const isRelatedTargetInsideEnabledTrigger = useStableCallback((target) => { |
| 7659 |
return isTargetInsideEnabledTrigger(target, store.context.triggerElements); |
| 7660 |
}); |
| 7661 |
const isOverInactiveTrigger = useStableCallback((currentDomReference, currentTarget, target) => { |
| 7662 |
const allTriggers = store.context.triggerElements; |
| 7663 |
if (allTriggers.hasElement(currentTarget)) { |
| 7664 |
return !currentDomReference || !contains(currentDomReference, currentTarget); |
| 7665 |
} |
| 7666 |
if (!isElement(target)) { |
| 7667 |
return false; |
| 7668 |
} |
| 7669 |
const targetElement = target; |
| 7670 |
return allTriggers.hasMatchingElement((trigger) => contains(trigger, targetElement)) && (!currentDomReference || !contains(currentDomReference, targetElement)); |
| 7671 |
}); |
| 7672 |
const closeWithDelay = useStableCallback((event, runElseBranch = true) => { |
| 7673 |
const closeDelay = getDelay(delayRef.current, "close", instance.pointerType); |
| 7674 |
if (closeDelay) { |
| 7675 |
instance.openChangeTimeout.start(closeDelay, () => { |
| 7676 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerHover, event)); |
| 7677 |
tree?.events.emit("floating.closed", event); |
| 7678 |
}); |
| 7679 |
} else if (runElseBranch) { |
| 7680 |
instance.openChangeTimeout.clear(); |
| 7681 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.triggerHover, event)); |
| 7682 |
tree?.events.emit("floating.closed", event); |
| 7683 |
} |
| 7684 |
}); |
| 7685 |
const cleanupMouseMoveHandler = useStableCallback(() => { |
| 7686 |
if (!instance.handler) { |
| 7687 |
return; |
| 7688 |
} |
| 7689 |
const doc = ownerDocument(store.select("domReferenceElement")); |
| 7690 |
doc.removeEventListener("mousemove", instance.handler); |
| 7691 |
instance.handler = void 0; |
| 7692 |
}); |
| 7693 |
const clearPointerEvents = useStableCallback(() => { |
| 7694 |
clearSafePolygonPointerEventsMutation(instance); |
| 7695 |
}); |
| 7696 |
React33.useEffect(() => cleanupMouseMoveHandler, [cleanupMouseMoveHandler]); |
| 7697 |
React33.useEffect(() => { |
| 7698 |
if (!enabled) { |
| 7699 |
return void 0; |
| 7700 |
} |
| 7701 |
function onOpenChangeLocal(details) { |
| 7702 |
if (!details.open) { |
| 7703 |
isHoverCloseActiveRef.current = details.reason === reason_parts_exports.triggerHover; |
| 7704 |
cleanupMouseMoveHandler(); |
| 7705 |
instance.openChangeTimeout.clear(); |
| 7706 |
instance.restTimeout.clear(); |
| 7707 |
instance.blockMouseMove = true; |
| 7708 |
instance.restTimeoutPending = false; |
| 7709 |
} else { |
| 7710 |
isHoverCloseActiveRef.current = false; |
| 7711 |
} |
| 7712 |
} |
| 7713 |
events2.on("openchange", onOpenChangeLocal); |
| 7714 |
return () => { |
| 7715 |
events2.off("openchange", onOpenChangeLocal); |
| 7716 |
}; |
| 7717 |
}, [enabled, events2, instance, cleanupMouseMoveHandler]); |
| 7718 |
React33.useEffect(() => { |
| 7719 |
if (!enabled) { |
| 7720 |
return void 0; |
| 7721 |
} |
| 7722 |
const trigger = triggerElementRef.current ?? (isActiveTrigger ? store.select("domReferenceElement") : null); |
| 7723 |
if (!isElement(trigger)) { |
| 7724 |
return void 0; |
| 7725 |
} |
| 7726 |
function onMouseEnter(event) { |
| 7727 |
instance.openChangeTimeout.clear(); |
| 7728 |
instance.blockMouseMove = false; |
| 7729 |
if (mouseOnly && !isMouseLikePointerType(instance.pointerType)) { |
| 7730 |
return; |
| 7731 |
} |
| 7732 |
const restMsValue = getRestMs(restMsRef.current); |
| 7733 |
const openDelay = getDelay(delayRef.current, "open", instance.pointerType); |
| 7734 |
const eventTarget = getTarget(event); |
| 7735 |
const currentTarget = event.currentTarget ?? null; |
| 7736 |
const currentDomReference = store.select("domReferenceElement"); |
| 7737 |
let triggerNode = currentTarget; |
| 7738 |
if (isElement(eventTarget) && !store.context.triggerElements.hasElement(eventTarget)) { |
| 7739 |
for (const triggerElement of store.context.triggerElements.elements()) { |
| 7740 |
if (contains(triggerElement, eventTarget)) { |
| 7741 |
triggerNode = triggerElement; |
| 7742 |
break; |
| 7743 |
} |
| 7744 |
} |
| 7745 |
} |
| 7746 |
if (isElement(currentTarget) && isElement(currentDomReference) && !store.context.triggerElements.hasElement(currentTarget) && contains(currentTarget, currentDomReference)) { |
| 7747 |
triggerNode = currentDomReference; |
| 7748 |
} |
| 7749 |
const isOverInactive = triggerNode == null ? false : isOverInactiveTrigger(currentDomReference, triggerNode, eventTarget); |
| 7750 |
const isOpen = store.select("open"); |
| 7751 |
const isInClosingTransition = isClosingRef.current?.() ?? store.select("transitionStatus") === "ending"; |
| 7752 |
const isHoverCloseTransition = !isOpen && isInClosingTransition && isHoverCloseActiveRef.current; |
| 7753 |
const isReenteringSameTriggerDuringCloseTransition = !isOverInactive && isElement(triggerNode) && isElement(currentDomReference) && contains(currentDomReference, triggerNode) && isHoverCloseTransition; |
| 7754 |
const isRestOnlyDelay = restMsValue > 0 && !openDelay; |
| 7755 |
const shouldOpenImmediately = isOverInactive && (isOpen || isHoverCloseTransition) || isReenteringSameTriggerDuringCloseTransition; |
| 7756 |
const shouldOpen = !isOpen || isOverInactive; |
| 7757 |
if (shouldOpenImmediately) { |
| 7758 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerHover, event, triggerNode)); |
| 7759 |
return; |
| 7760 |
} |
| 7761 |
if (isRestOnlyDelay) { |
| 7762 |
return; |
| 7763 |
} |
| 7764 |
if (openDelay) { |
| 7765 |
instance.openChangeTimeout.start(openDelay, () => { |
| 7766 |
if (shouldOpen) { |
| 7767 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerHover, event, triggerNode)); |
| 7768 |
} |
| 7769 |
}); |
| 7770 |
} else if (shouldOpen) { |
| 7771 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerHover, event, triggerNode)); |
| 7772 |
} |
| 7773 |
} |
| 7774 |
function onMouseLeave(event) { |
| 7775 |
if (isClickLikeOpenEvent2()) { |
| 7776 |
clearPointerEvents(); |
| 7777 |
return; |
| 7778 |
} |
| 7779 |
cleanupMouseMoveHandler(); |
| 7780 |
const domReferenceElement = store.select("domReferenceElement"); |
| 7781 |
const doc = ownerDocument(domReferenceElement); |
| 7782 |
instance.restTimeout.clear(); |
| 7783 |
instance.restTimeoutPending = false; |
| 7784 |
const handleCloseContextBase = dataRef.current.floatingContext ?? getHandleCloseContext?.(); |
| 7785 |
const ignoreRelatedTargetTrigger = isRelatedTargetInsideEnabledTrigger(event.relatedTarget); |
| 7786 |
if (ignoreRelatedTargetTrigger) { |
| 7787 |
return; |
| 7788 |
} |
| 7789 |
if (handleCloseRef.current && handleCloseContextBase) { |
| 7790 |
if (!store.select("open")) { |
| 7791 |
instance.openChangeTimeout.clear(); |
| 7792 |
} |
| 7793 |
const currentTrigger = triggerElementRef.current; |
| 7794 |
instance.handler = handleCloseRef.current({ |
| 7795 |
...handleCloseContextBase, |
| 7796 |
tree, |
| 7797 |
x: event.clientX, |
| 7798 |
y: event.clientY, |
| 7799 |
onClose() { |
| 7800 |
clearPointerEvents(); |
| 7801 |
cleanupMouseMoveHandler(); |
| 7802 |
if (enabledRef.current && !isClickLikeOpenEvent2() && currentTrigger === store.select("domReferenceElement")) { |
| 7803 |
closeWithDelay(event, true); |
| 7804 |
} |
| 7805 |
} |
| 7806 |
}); |
| 7807 |
doc.addEventListener("mousemove", instance.handler); |
| 7808 |
instance.handler(event); |
| 7809 |
return; |
| 7810 |
} |
| 7811 |
const shouldClose = instance.pointerType === "touch" ? !contains(store.select("floatingElement"), event.relatedTarget) : true; |
| 7812 |
if (shouldClose) { |
| 7813 |
closeWithDelay(event); |
| 7814 |
} |
| 7815 |
} |
| 7816 |
if (move) { |
| 7817 |
return mergeCleanups(addEventListener(trigger, "mousemove", onMouseEnter, { |
| 7818 |
once: true |
| 7819 |
}), addEventListener(trigger, "mouseenter", onMouseEnter), addEventListener(trigger, "mouseleave", onMouseLeave)); |
| 7820 |
} |
| 7821 |
return mergeCleanups(addEventListener(trigger, "mouseenter", onMouseEnter), addEventListener(trigger, "mouseleave", onMouseLeave)); |
| 7822 |
}, [cleanupMouseMoveHandler, clearPointerEvents, dataRef, delayRef, closeWithDelay, store, enabled, handleCloseRef, instance, isActiveTrigger, isOverInactiveTrigger, isClickLikeOpenEvent2, isRelatedTargetInsideEnabledTrigger, mouseOnly, move, restMsRef, triggerElementRef, tree, enabledRef, getHandleCloseContext, isClosingRef]); |
| 7823 |
return React33.useMemo(() => { |
| 7824 |
if (!enabled) { |
| 7825 |
return void 0; |
| 7826 |
} |
| 7827 |
function setPointerRef(event) { |
| 7828 |
instance.pointerType = event.pointerType; |
| 7829 |
} |
| 7830 |
return { |
| 7831 |
onPointerDown: setPointerRef, |
| 7832 |
onPointerEnter: setPointerRef, |
| 7833 |
onMouseMove(event) { |
| 7834 |
const { |
| 7835 |
nativeEvent |
| 7836 |
} = event; |
| 7837 |
const trigger = event.currentTarget; |
| 7838 |
const currentDomReference = store.select("domReferenceElement"); |
| 7839 |
const currentOpen = store.select("open"); |
| 7840 |
const isOverInactive = isOverInactiveTrigger(currentDomReference, trigger, event.target); |
| 7841 |
if (mouseOnly && !isMouseLikePointerType(instance.pointerType)) { |
| 7842 |
return; |
| 7843 |
} |
| 7844 |
if (currentOpen && isOverInactive && instance.handleCloseOptions?.blockPointerEvents) { |
| 7845 |
const floatingElement = store.select("floatingElement"); |
| 7846 |
if (floatingElement) { |
| 7847 |
const scopeElement = instance.handleCloseOptions?.getScope?.() ?? trigger.ownerDocument.body; |
| 7848 |
applySafePolygonPointerEventsMutation(instance, { |
| 7849 |
scopeElement, |
| 7850 |
referenceElement: trigger, |
| 7851 |
floatingElement |
| 7852 |
}); |
| 7853 |
} |
| 7854 |
} |
| 7855 |
const restMsValue = getRestMs(restMsRef.current); |
| 7856 |
if (currentOpen && !isOverInactive || restMsValue === 0) { |
| 7857 |
return; |
| 7858 |
} |
| 7859 |
if (!isOverInactive && instance.restTimeoutPending && event.movementX ** 2 + event.movementY ** 2 < 2) { |
| 7860 |
return; |
| 7861 |
} |
| 7862 |
instance.restTimeout.clear(); |
| 7863 |
function handleMouseMove() { |
| 7864 |
instance.restTimeoutPending = false; |
| 7865 |
if (isClickLikeOpenEvent2()) { |
| 7866 |
return; |
| 7867 |
} |
| 7868 |
const latestOpen = store.select("open"); |
| 7869 |
if (!instance.blockMouseMove && (!latestOpen || isOverInactive)) { |
| 7870 |
store.setOpen(true, createChangeEventDetails(reason_parts_exports.triggerHover, nativeEvent, trigger)); |
| 7871 |
} |
| 7872 |
} |
| 7873 |
if (instance.pointerType === "touch") { |
| 7874 |
ReactDOM4.flushSync(() => { |
| 7875 |
handleMouseMove(); |
| 7876 |
}); |
| 7877 |
} else if (isOverInactive && currentOpen) { |
| 7878 |
handleMouseMove(); |
| 7879 |
} else { |
| 7880 |
instance.restTimeoutPending = true; |
| 7881 |
instance.restTimeout.start(restMsValue, handleMouseMove); |
| 7882 |
} |
| 7883 |
} |
| 7884 |
}; |
| 7885 |
}, [enabled, instance, isClickLikeOpenEvent2, isOverInactiveTrigger, mouseOnly, store, restMsRef]); |
| 7886 |
} |
| 7887 |
|
| 7888 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useInteractions.js |
| 7889 |
var React34 = __toESM(require_react(), 1); |
| 7890 |
function useInteractions(propsList = []) { |
| 7891 |
const referenceDeps = propsList.map((key2) => key2?.reference); |
| 7892 |
const floatingDeps = propsList.map((key2) => key2?.floating); |
| 7893 |
const itemDeps = propsList.map((key2) => key2?.item); |
| 7894 |
const triggerDeps = propsList.map((key2) => key2?.trigger); |
| 7895 |
const getReferenceProps = React34.useCallback( |
| 7896 |
(userProps) => mergeProps2(userProps, propsList, "reference"), |
| 7897 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 7898 |
referenceDeps |
| 7899 |
); |
| 7900 |
const getFloatingProps = React34.useCallback( |
| 7901 |
(userProps) => mergeProps2(userProps, propsList, "floating"), |
| 7902 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 7903 |
floatingDeps |
| 7904 |
); |
| 7905 |
const getItemProps = React34.useCallback( |
| 7906 |
(userProps) => mergeProps2(userProps, propsList, "item"), |
| 7907 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 7908 |
itemDeps |
| 7909 |
); |
| 7910 |
const getTriggerProps = React34.useCallback( |
| 7911 |
(userProps) => mergeProps2(userProps, propsList, "trigger"), |
| 7912 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 7913 |
triggerDeps |
| 7914 |
); |
| 7915 |
return React34.useMemo(() => ({ |
| 7916 |
getReferenceProps, |
| 7917 |
getFloatingProps, |
| 7918 |
getItemProps, |
| 7919 |
getTriggerProps |
| 7920 |
}), [getReferenceProps, getFloatingProps, getItemProps, getTriggerProps]); |
| 7921 |
} |
| 7922 |
function mergeProps2(userProps, propsList, elementKey) { |
| 7923 |
const eventHandlers = /* @__PURE__ */ new Map(); |
| 7924 |
const isItem2 = elementKey === "item"; |
| 7925 |
const outputProps = {}; |
| 7926 |
if (elementKey === "floating") { |
| 7927 |
outputProps.tabIndex = -1; |
| 7928 |
outputProps[FOCUSABLE_ATTRIBUTE] = ""; |
| 7929 |
} |
| 7930 |
for (const key2 in userProps) { |
| 7931 |
if (isItem2 && userProps) { |
| 7932 |
if (key2 === ACTIVE_KEY || key2 === SELECTED_KEY) { |
| 7933 |
continue; |
| 7934 |
} |
| 7935 |
} |
| 7936 |
outputProps[key2] = userProps[key2]; |
| 7937 |
} |
| 7938 |
for (let i2 = 0; i2 < propsList.length; i2 += 1) { |
| 7939 |
let props; |
| 7940 |
const propsOrGetProps = propsList[i2]?.[elementKey]; |
| 7941 |
if (typeof propsOrGetProps === "function") { |
| 7942 |
props = userProps ? propsOrGetProps(userProps) : null; |
| 7943 |
} else { |
| 7944 |
props = propsOrGetProps; |
| 7945 |
} |
| 7946 |
if (!props) { |
| 7947 |
continue; |
| 7948 |
} |
| 7949 |
mutablyMergeProps(outputProps, props, isItem2, eventHandlers); |
| 7950 |
} |
| 7951 |
mutablyMergeProps(outputProps, userProps, isItem2, eventHandlers); |
| 7952 |
return outputProps; |
| 7953 |
} |
| 7954 |
function mutablyMergeProps(outputProps, props, isItem2, eventHandlers) { |
| 7955 |
for (const key2 in props) { |
| 7956 |
const value = props[key2]; |
| 7957 |
if (isItem2 && (key2 === ACTIVE_KEY || key2 === SELECTED_KEY)) { |
| 7958 |
continue; |
| 7959 |
} |
| 7960 |
if (!key2.startsWith("on")) { |
| 7961 |
outputProps[key2] = value; |
| 7962 |
} else { |
| 7963 |
if (!eventHandlers.has(key2)) { |
| 7964 |
eventHandlers.set(key2, []); |
| 7965 |
} |
| 7966 |
if (typeof value === "function") { |
| 7967 |
eventHandlers.get(key2)?.push(value); |
| 7968 |
outputProps[key2] = (...args) => { |
| 7969 |
return eventHandlers.get(key2)?.map((fn) => fn(...args)).find((val) => val !== void 0); |
| 7970 |
}; |
| 7971 |
} |
| 7972 |
} |
| 7973 |
} |
| 7974 |
} |
| 7975 |
|
| 7976 |
// node_modules/@base-ui/react/esm/floating-ui-react/hooks/useRole.js |
| 7977 |
var React35 = __toESM(require_react(), 1); |
| 7978 |
var componentRoleToAriaRoleMap = /* @__PURE__ */ new Map([["select", "listbox"], ["combobox", "listbox"], ["label", false]]); |
| 7979 |
function useRole(context, props = {}) { |
| 7980 |
const store = "rootStore" in context ? context.rootStore : context; |
| 7981 |
const open = store.useState("open"); |
| 7982 |
const defaultFloatingId = store.useState("floatingId"); |
| 7983 |
const domReference = store.useState("domReferenceElement"); |
| 7984 |
const floatingElement = store.useState("floatingElement"); |
| 7985 |
const { |
| 7986 |
role = "dialog" |
| 7987 |
} = props; |
| 7988 |
const defaultReferenceId = useId(); |
| 7989 |
const referenceId = domReference?.id || defaultReferenceId; |
| 7990 |
const floatingId = React35.useMemo(() => getFloatingFocusElement(floatingElement)?.id || defaultFloatingId, [floatingElement, defaultFloatingId]); |
| 7991 |
const ariaRole = componentRoleToAriaRoleMap.get(role) ?? role; |
| 7992 |
const parentId = useFloatingParentNodeId(); |
| 7993 |
const isNested = parentId != null; |
| 7994 |
const trigger = React35.useMemo(() => { |
| 7995 |
if (ariaRole === "tooltip" || role === "label") { |
| 7996 |
return EMPTY_OBJECT; |
| 7997 |
} |
| 7998 |
return { |
| 7999 |
"aria-haspopup": ariaRole === "alertdialog" ? "dialog" : ariaRole, |
| 8000 |
"aria-expanded": "false", |
| 8001 |
...ariaRole === "listbox" && { |
| 8002 |
role: "combobox" |
| 8003 |
}, |
| 8004 |
...ariaRole === "menu" && isNested && { |
| 8005 |
role: "menuitem" |
| 8006 |
}, |
| 8007 |
...role === "select" && { |
| 8008 |
"aria-autocomplete": "none" |
| 8009 |
}, |
| 8010 |
...role === "combobox" && { |
| 8011 |
"aria-autocomplete": "list" |
| 8012 |
} |
| 8013 |
}; |
| 8014 |
}, [ariaRole, isNested, role]); |
| 8015 |
const reference = React35.useMemo(() => { |
| 8016 |
if (ariaRole === "tooltip" || role === "label") { |
| 8017 |
return { |
| 8018 |
[`aria-${role === "label" ? "labelledby" : "describedby"}`]: open ? floatingId : void 0 |
| 8019 |
}; |
| 8020 |
} |
| 8021 |
const triggerProps = trigger; |
| 8022 |
return { |
| 8023 |
...triggerProps, |
| 8024 |
"aria-expanded": open ? "true" : "false", |
| 8025 |
"aria-controls": open ? floatingId : void 0, |
| 8026 |
...ariaRole === "menu" && { |
| 8027 |
id: referenceId |
| 8028 |
} |
| 8029 |
}; |
| 8030 |
}, [ariaRole, floatingId, open, referenceId, role, trigger]); |
| 8031 |
const floating = React35.useMemo(() => { |
| 8032 |
const floatingProps = { |
| 8033 |
id: floatingId, |
| 8034 |
...ariaRole && { |
| 8035 |
role: ariaRole |
| 8036 |
} |
| 8037 |
}; |
| 8038 |
if (ariaRole === "tooltip" || role === "label") { |
| 8039 |
return floatingProps; |
| 8040 |
} |
| 8041 |
return { |
| 8042 |
...floatingProps, |
| 8043 |
...ariaRole === "menu" && { |
| 8044 |
"aria-labelledby": referenceId |
| 8045 |
} |
| 8046 |
}; |
| 8047 |
}, [ariaRole, floatingId, referenceId, role]); |
| 8048 |
const item = React35.useCallback(({ |
| 8049 |
active, |
| 8050 |
selected |
| 8051 |
}) => { |
| 8052 |
const commonProps = { |
| 8053 |
role: "option", |
| 8054 |
...active && { |
| 8055 |
id: `${floatingId}-fui-option` |
| 8056 |
} |
| 8057 |
}; |
| 8058 |
switch (role) { |
| 8059 |
case "select": |
| 8060 |
case "combobox": |
| 8061 |
return { |
| 8062 |
...commonProps, |
| 8063 |
"aria-selected": selected |
| 8064 |
}; |
| 8065 |
default: |
| 8066 |
} |
| 8067 |
return {}; |
| 8068 |
}, [floatingId, role]); |
| 8069 |
return React35.useMemo(() => ({ |
| 8070 |
reference, |
| 8071 |
floating, |
| 8072 |
item, |
| 8073 |
trigger |
| 8074 |
}), [reference, floating, trigger, item]); |
| 8075 |
} |
| 8076 |
|
| 8077 |
// node_modules/@base-ui/react/esm/floating-ui-react/safePolygon.js |
| 8078 |
var CURSOR_SPEED_THRESHOLD = 0.1; |
| 8079 |
var CURSOR_SPEED_THRESHOLD_SQUARED = CURSOR_SPEED_THRESHOLD * CURSOR_SPEED_THRESHOLD; |
| 8080 |
var POLYGON_BUFFER = 0.5; |
| 8081 |
function hasIntersectingEdge(pointX, pointY, xi, yi, xj, yj) { |
| 8082 |
return yi >= pointY !== yj >= pointY && pointX <= (xj - xi) * (pointY - yi) / (yj - yi) + xi; |
| 8083 |
} |
| 8084 |
function isPointInQuadrilateral(pointX, pointY, x1, y1, x2, y2, x3, y3, x4, y4) { |
| 8085 |
let isInsideValue = false; |
| 8086 |
if (hasIntersectingEdge(pointX, pointY, x1, y1, x2, y2)) { |
| 8087 |
isInsideValue = !isInsideValue; |
| 8088 |
} |
| 8089 |
if (hasIntersectingEdge(pointX, pointY, x2, y2, x3, y3)) { |
| 8090 |
isInsideValue = !isInsideValue; |
| 8091 |
} |
| 8092 |
if (hasIntersectingEdge(pointX, pointY, x3, y3, x4, y4)) { |
| 8093 |
isInsideValue = !isInsideValue; |
| 8094 |
} |
| 8095 |
if (hasIntersectingEdge(pointX, pointY, x4, y4, x1, y1)) { |
| 8096 |
isInsideValue = !isInsideValue; |
| 8097 |
} |
| 8098 |
return isInsideValue; |
| 8099 |
} |
| 8100 |
function isInsideRect(pointX, pointY, rect) { |
| 8101 |
return pointX >= rect.x && pointX <= rect.x + rect.width && pointY >= rect.y && pointY <= rect.y + rect.height; |
| 8102 |
} |
| 8103 |
function isInsideAxisAlignedRect(pointX, pointY, x1, y1, x2, y2) { |
| 8104 |
const minX = Math.min(x1, x2); |
| 8105 |
const maxX = Math.max(x1, x2); |
| 8106 |
const minY = Math.min(y1, y2); |
| 8107 |
const maxY = Math.max(y1, y2); |
| 8108 |
return pointX >= minX && pointX <= maxX && pointY >= minY && pointY <= maxY; |
| 8109 |
} |
| 8110 |
function safePolygon(options = {}) { |
| 8111 |
const { |
| 8112 |
blockPointerEvents = false |
| 8113 |
} = options; |
| 8114 |
const timeout = new Timeout(); |
| 8115 |
const fn = ({ |
| 8116 |
x: x2, |
| 8117 |
y: y2, |
| 8118 |
placement, |
| 8119 |
elements, |
| 8120 |
onClose, |
| 8121 |
nodeId, |
| 8122 |
tree |
| 8123 |
}) => { |
| 8124 |
const side = placement?.split("-")[0]; |
| 8125 |
let hasLanded = false; |
| 8126 |
let lastX = null; |
| 8127 |
let lastY = null; |
| 8128 |
let lastCursorTime = typeof performance !== "undefined" ? performance.now() : 0; |
| 8129 |
function isCursorMovingSlowly(nextX, nextY) { |
| 8130 |
const currentTime = performance.now(); |
| 8131 |
const elapsedTime = currentTime - lastCursorTime; |
| 8132 |
if (lastX === null || lastY === null || elapsedTime === 0) { |
| 8133 |
lastX = nextX; |
| 8134 |
lastY = nextY; |
| 8135 |
lastCursorTime = currentTime; |
| 8136 |
return false; |
| 8137 |
} |
| 8138 |
const deltaX = nextX - lastX; |
| 8139 |
const deltaY = nextY - lastY; |
| 8140 |
const distanceSquared = deltaX * deltaX + deltaY * deltaY; |
| 8141 |
const thresholdSquared = elapsedTime * elapsedTime * CURSOR_SPEED_THRESHOLD_SQUARED; |
| 8142 |
lastX = nextX; |
| 8143 |
lastY = nextY; |
| 8144 |
lastCursorTime = currentTime; |
| 8145 |
return distanceSquared < thresholdSquared; |
| 8146 |
} |
| 8147 |
function close() { |
| 8148 |
timeout.clear(); |
| 8149 |
onClose(); |
| 8150 |
} |
| 8151 |
return function onMouseMove(event) { |
| 8152 |
timeout.clear(); |
| 8153 |
const domReference = elements.domReference; |
| 8154 |
const floating = elements.floating; |
| 8155 |
if (!domReference || !floating || side == null || x2 == null || y2 == null) { |
| 8156 |
return void 0; |
| 8157 |
} |
| 8158 |
const { |
| 8159 |
clientX, |
| 8160 |
clientY |
| 8161 |
} = event; |
| 8162 |
const target = getTarget(event); |
| 8163 |
const isLeave = event.type === "mouseleave"; |
| 8164 |
const isOverFloatingEl = contains(floating, target); |
| 8165 |
const isOverReferenceEl = contains(domReference, target); |
| 8166 |
if (isOverFloatingEl) { |
| 8167 |
hasLanded = true; |
| 8168 |
if (!isLeave) { |
| 8169 |
return void 0; |
| 8170 |
} |
| 8171 |
} |
| 8172 |
if (isOverReferenceEl) { |
| 8173 |
hasLanded = false; |
| 8174 |
if (!isLeave) { |
| 8175 |
hasLanded = true; |
| 8176 |
return void 0; |
| 8177 |
} |
| 8178 |
} |
| 8179 |
if (isLeave && isElement(event.relatedTarget) && contains(floating, event.relatedTarget)) { |
| 8180 |
return void 0; |
| 8181 |
} |
| 8182 |
function hasOpenChildNode() { |
| 8183 |
return Boolean(tree && getNodeChildren(tree.nodesRef.current, nodeId).length > 0); |
| 8184 |
} |
| 8185 |
function closeIfNoOpenChild() { |
| 8186 |
if (!hasOpenChildNode()) { |
| 8187 |
close(); |
| 8188 |
} |
| 8189 |
} |
| 8190 |
if (hasOpenChildNode()) { |
| 8191 |
return void 0; |
| 8192 |
} |
| 8193 |
const refRect = domReference.getBoundingClientRect(); |
| 8194 |
const rect = floating.getBoundingClientRect(); |
| 8195 |
const cursorLeaveFromRight = x2 > rect.right - rect.width / 2; |
| 8196 |
const cursorLeaveFromBottom = y2 > rect.bottom - rect.height / 2; |
| 8197 |
const isFloatingWider = rect.width > refRect.width; |
| 8198 |
const isFloatingTaller = rect.height > refRect.height; |
| 8199 |
const left = (isFloatingWider ? refRect : rect).left; |
| 8200 |
const right = (isFloatingWider ? refRect : rect).right; |
| 8201 |
const top = (isFloatingTaller ? refRect : rect).top; |
| 8202 |
const bottom = (isFloatingTaller ? refRect : rect).bottom; |
| 8203 |
if (side === "top" && y2 >= refRect.bottom - 1 || side === "bottom" && y2 <= refRect.top + 1 || side === "left" && x2 >= refRect.right - 1 || side === "right" && x2 <= refRect.left + 1) { |
| 8204 |
closeIfNoOpenChild(); |
| 8205 |
return void 0; |
| 8206 |
} |
| 8207 |
let isInsideTroughRect = false; |
| 8208 |
switch (side) { |
| 8209 |
case "top": |
| 8210 |
isInsideTroughRect = isInsideAxisAlignedRect(clientX, clientY, left, refRect.top + 1, right, rect.bottom - 1); |
| 8211 |
break; |
| 8212 |
case "bottom": |
| 8213 |
isInsideTroughRect = isInsideAxisAlignedRect(clientX, clientY, left, rect.top + 1, right, refRect.bottom - 1); |
| 8214 |
break; |
| 8215 |
case "left": |
| 8216 |
isInsideTroughRect = isInsideAxisAlignedRect(clientX, clientY, rect.right - 1, bottom, refRect.left + 1, top); |
| 8217 |
break; |
| 8218 |
case "right": |
| 8219 |
isInsideTroughRect = isInsideAxisAlignedRect(clientX, clientY, refRect.right - 1, bottom, rect.left + 1, top); |
| 8220 |
break; |
| 8221 |
default: |
| 8222 |
} |
| 8223 |
if (isInsideTroughRect) { |
| 8224 |
return void 0; |
| 8225 |
} |
| 8226 |
if (hasLanded && !isInsideRect(clientX, clientY, refRect)) { |
| 8227 |
closeIfNoOpenChild(); |
| 8228 |
return void 0; |
| 8229 |
} |
| 8230 |
if (!isLeave && isCursorMovingSlowly(clientX, clientY)) { |
| 8231 |
closeIfNoOpenChild(); |
| 8232 |
return void 0; |
| 8233 |
} |
| 8234 |
let isInsidePolygon = false; |
| 8235 |
switch (side) { |
| 8236 |
case "top": { |
| 8237 |
const cursorXOffset = isFloatingWider ? POLYGON_BUFFER / 2 : POLYGON_BUFFER * 4; |
| 8238 |
const cursorPointOneX = isFloatingWider ? x2 + cursorXOffset : cursorLeaveFromRight ? x2 + cursorXOffset : x2 - cursorXOffset; |
| 8239 |
const cursorPointTwoX = isFloatingWider ? x2 - cursorXOffset : cursorLeaveFromRight ? x2 + cursorXOffset : x2 - cursorXOffset; |
| 8240 |
const cursorPointY = y2 + POLYGON_BUFFER + 1; |
| 8241 |
const commonYLeft = cursorLeaveFromRight ? rect.bottom - POLYGON_BUFFER : isFloatingWider ? rect.bottom - POLYGON_BUFFER : rect.top; |
| 8242 |
const commonYRight = cursorLeaveFromRight ? isFloatingWider ? rect.bottom - POLYGON_BUFFER : rect.top : rect.bottom - POLYGON_BUFFER; |
| 8243 |
isInsidePolygon = isPointInQuadrilateral(clientX, clientY, cursorPointOneX, cursorPointY, cursorPointTwoX, cursorPointY, rect.left, commonYLeft, rect.right, commonYRight); |
| 8244 |
break; |
| 8245 |
} |
| 8246 |
case "bottom": { |
| 8247 |
const cursorXOffset = isFloatingWider ? POLYGON_BUFFER / 2 : POLYGON_BUFFER * 4; |
| 8248 |
const cursorPointOneX = isFloatingWider ? x2 + cursorXOffset : cursorLeaveFromRight ? x2 + cursorXOffset : x2 - cursorXOffset; |
| 8249 |
const cursorPointTwoX = isFloatingWider ? x2 - cursorXOffset : cursorLeaveFromRight ? x2 + cursorXOffset : x2 - cursorXOffset; |
| 8250 |
const cursorPointY = y2 - POLYGON_BUFFER; |
| 8251 |
const commonYLeft = cursorLeaveFromRight ? rect.top + POLYGON_BUFFER : isFloatingWider ? rect.top + POLYGON_BUFFER : rect.bottom; |
| 8252 |
const commonYRight = cursorLeaveFromRight ? isFloatingWider ? rect.top + POLYGON_BUFFER : rect.bottom : rect.top + POLYGON_BUFFER; |
| 8253 |
isInsidePolygon = isPointInQuadrilateral(clientX, clientY, cursorPointOneX, cursorPointY, cursorPointTwoX, cursorPointY, rect.left, commonYLeft, rect.right, commonYRight); |
| 8254 |
break; |
| 8255 |
} |
| 8256 |
case "left": { |
| 8257 |
const cursorYOffset = isFloatingTaller ? POLYGON_BUFFER / 2 : POLYGON_BUFFER * 4; |
| 8258 |
const cursorPointOneY = isFloatingTaller ? y2 + cursorYOffset : cursorLeaveFromBottom ? y2 + cursorYOffset : y2 - cursorYOffset; |
| 8259 |
const cursorPointTwoY = isFloatingTaller ? y2 - cursorYOffset : cursorLeaveFromBottom ? y2 + cursorYOffset : y2 - cursorYOffset; |
| 8260 |
const cursorPointX = x2 + POLYGON_BUFFER + 1; |
| 8261 |
const commonXTop = cursorLeaveFromBottom ? rect.right - POLYGON_BUFFER : isFloatingTaller ? rect.right - POLYGON_BUFFER : rect.left; |
| 8262 |
const commonXBottom = cursorLeaveFromBottom ? isFloatingTaller ? rect.right - POLYGON_BUFFER : rect.left : rect.right - POLYGON_BUFFER; |
| 8263 |
isInsidePolygon = isPointInQuadrilateral(clientX, clientY, commonXTop, rect.top, commonXBottom, rect.bottom, cursorPointX, cursorPointOneY, cursorPointX, cursorPointTwoY); |
| 8264 |
break; |
| 8265 |
} |
| 8266 |
case "right": { |
| 8267 |
const cursorYOffset = isFloatingTaller ? POLYGON_BUFFER / 2 : POLYGON_BUFFER * 4; |
| 8268 |
const cursorPointOneY = isFloatingTaller ? y2 + cursorYOffset : cursorLeaveFromBottom ? y2 + cursorYOffset : y2 - cursorYOffset; |
| 8269 |
const cursorPointTwoY = isFloatingTaller ? y2 - cursorYOffset : cursorLeaveFromBottom ? y2 + cursorYOffset : y2 - cursorYOffset; |
| 8270 |
const cursorPointX = x2 - POLYGON_BUFFER; |
| 8271 |
const commonXTop = cursorLeaveFromBottom ? rect.left + POLYGON_BUFFER : isFloatingTaller ? rect.left + POLYGON_BUFFER : rect.right; |
| 8272 |
const commonXBottom = cursorLeaveFromBottom ? isFloatingTaller ? rect.left + POLYGON_BUFFER : rect.right : rect.left + POLYGON_BUFFER; |
| 8273 |
isInsidePolygon = isPointInQuadrilateral(clientX, clientY, cursorPointX, cursorPointOneY, cursorPointX, cursorPointTwoY, commonXTop, rect.top, commonXBottom, rect.bottom); |
| 8274 |
break; |
| 8275 |
} |
| 8276 |
default: |
| 8277 |
} |
| 8278 |
if (!isInsidePolygon) { |
| 8279 |
closeIfNoOpenChild(); |
| 8280 |
} else if (!hasLanded) { |
| 8281 |
timeout.start(40, closeIfNoOpenChild); |
| 8282 |
} |
| 8283 |
return void 0; |
| 8284 |
}; |
| 8285 |
}; |
| 8286 |
fn.__options = { |
| 8287 |
...options, |
| 8288 |
blockPointerEvents |
| 8289 |
}; |
| 8290 |
return fn; |
| 8291 |
} |
| 8292 |
|
| 8293 |
// node_modules/@base-ui/react/esm/utils/useOpenInteractionType.js |
| 8294 |
var React38 = __toESM(require_react(), 1); |
| 8295 |
|
| 8296 |
// node_modules/@base-ui/utils/esm/useEnhancedClickHandler.js |
| 8297 |
var React36 = __toESM(require_react(), 1); |
| 8298 |
function useEnhancedClickHandler(handler) { |
| 8299 |
const lastClickInteractionTypeRef = React36.useRef(""); |
| 8300 |
const handlePointerDown = React36.useCallback((event) => { |
| 8301 |
if (event.defaultPrevented) { |
| 8302 |
return; |
| 8303 |
} |
| 8304 |
lastClickInteractionTypeRef.current = event.pointerType; |
| 8305 |
handler(event, event.pointerType); |
| 8306 |
}, [handler]); |
| 8307 |
const handleClick = React36.useCallback((event) => { |
| 8308 |
if (event.detail === 0) { |
| 8309 |
handler(event, "keyboard"); |
| 8310 |
return; |
| 8311 |
} |
| 8312 |
if ("pointerType" in event) { |
| 8313 |
handler(event, event.pointerType); |
| 8314 |
} else { |
| 8315 |
handler(event, lastClickInteractionTypeRef.current); |
| 8316 |
} |
| 8317 |
lastClickInteractionTypeRef.current = ""; |
| 8318 |
}, [handler]); |
| 8319 |
return { |
| 8320 |
onClick: handleClick, |
| 8321 |
onPointerDown: handlePointerDown |
| 8322 |
}; |
| 8323 |
} |
| 8324 |
|
| 8325 |
// node_modules/@base-ui/react/esm/internals/useValueChanged.js |
| 8326 |
var React37 = __toESM(require_react(), 1); |
| 8327 |
function useValueChanged(value, onChange) { |
| 8328 |
const valueRef = React37.useRef(value); |
| 8329 |
const onChangeCallback = useStableCallback(onChange); |
| 8330 |
useIsoLayoutEffect(() => { |
| 8331 |
if (valueRef.current === value) { |
| 8332 |
return; |
| 8333 |
} |
| 8334 |
onChangeCallback(valueRef.current); |
| 8335 |
}, [value, onChangeCallback]); |
| 8336 |
useIsoLayoutEffect(() => { |
| 8337 |
valueRef.current = value; |
| 8338 |
}, [value]); |
| 8339 |
} |
| 8340 |
|
| 8341 |
// node_modules/@base-ui/react/esm/utils/useOpenInteractionType.js |
| 8342 |
function useOpenInteractionType(open) { |
| 8343 |
const [openMethod, setOpenMethod] = React38.useState(null); |
| 8344 |
const handleTriggerClick = useStableCallback((_, interactionType) => { |
| 8345 |
if (!open) { |
| 8346 |
setOpenMethod(interactionType || // On iOS Safari, the hitslop around touch targets means tapping outside an element's |
| 8347 |
// bounds does not fire `pointerdown` but does fire `mousedown`. The `interactionType` |
| 8348 |
// will be "" in that case. |
| 8349 |
(isIOS ? "touch" : "")); |
| 8350 |
} |
| 8351 |
}); |
| 8352 |
useValueChanged(open, (previousOpen) => { |
| 8353 |
if (previousOpen && !open) { |
| 8354 |
setOpenMethod(null); |
| 8355 |
} |
| 8356 |
}); |
| 8357 |
const { |
| 8358 |
onClick, |
| 8359 |
onPointerDown |
| 8360 |
} = useEnhancedClickHandler(handleTriggerClick); |
| 8361 |
return React38.useMemo(() => ({ |
| 8362 |
openMethod, |
| 8363 |
triggerProps: { |
| 8364 |
onClick, |
| 8365 |
onPointerDown |
| 8366 |
} |
| 8367 |
}), [openMethod, onClick, onPointerDown]); |
| 8368 |
} |
| 8369 |
|
| 8370 |
// node_modules/@base-ui/react/esm/dialog/root/useDialogRoot.js |
| 8371 |
function useDialogRoot(params) { |
| 8372 |
const { |
| 8373 |
store, |
| 8374 |
parentContext, |
| 8375 |
actionsRef, |
| 8376 |
isDrawer |
| 8377 |
} = params; |
| 8378 |
const open = store.useState("open"); |
| 8379 |
const disablePointerDismissal = store.useState("disablePointerDismissal"); |
| 8380 |
const modal = store.useState("modal"); |
| 8381 |
const popupElement = store.useState("popupElement"); |
| 8382 |
const { |
| 8383 |
openMethod, |
| 8384 |
triggerProps |
| 8385 |
} = useOpenInteractionType(open); |
| 8386 |
useImplicitActiveTrigger(store); |
| 8387 |
const { |
| 8388 |
forceUnmount |
| 8389 |
} = useOpenStateTransitions(open, store); |
| 8390 |
const handleImperativeClose = React39.useCallback(() => { |
| 8391 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.imperativeAction)); |
| 8392 |
}, [store]); |
| 8393 |
React39.useImperativeHandle(actionsRef, () => ({ |
| 8394 |
unmount: forceUnmount, |
| 8395 |
close: handleImperativeClose |
| 8396 |
}), [forceUnmount, handleImperativeClose]); |
| 8397 |
const floatingRootContext = useSyncedFloatingRootContext({ |
| 8398 |
popupStore: store, |
| 8399 |
onOpenChange: store.setOpen, |
| 8400 |
treatPopupAsFloatingElement: true |
| 8401 |
}); |
| 8402 |
const [ownNestedOpenDialogs, setOwnNestedOpenDialogs] = React39.useState(0); |
| 8403 |
const [ownNestedOpenDrawers, setOwnNestedOpenDrawers] = React39.useState(0); |
| 8404 |
const isTopmost = ownNestedOpenDialogs === 0; |
| 8405 |
const role = useRole(floatingRootContext); |
| 8406 |
const dismiss = useDismiss(floatingRootContext, { |
| 8407 |
outsidePressEvent() { |
| 8408 |
if (store.context.internalBackdropRef.current || store.context.backdropRef.current) { |
| 8409 |
return "intentional"; |
| 8410 |
} |
| 8411 |
return { |
| 8412 |
mouse: modal === "trap-focus" ? "sloppy" : "intentional", |
| 8413 |
touch: "sloppy" |
| 8414 |
}; |
| 8415 |
}, |
| 8416 |
outsidePress(event) { |
| 8417 |
if (!store.context.outsidePressEnabledRef.current) { |
| 8418 |
return false; |
| 8419 |
} |
| 8420 |
if ("button" in event && event.button !== 0) { |
| 8421 |
return false; |
| 8422 |
} |
| 8423 |
if ("touches" in event && event.touches.length !== 1) { |
| 8424 |
return false; |
| 8425 |
} |
| 8426 |
const target = getTarget(event); |
| 8427 |
if (isTopmost && !disablePointerDismissal) { |
| 8428 |
const eventTarget = target; |
| 8429 |
if (modal) { |
| 8430 |
return store.context.internalBackdropRef.current || store.context.backdropRef.current ? store.context.internalBackdropRef.current === eventTarget || store.context.backdropRef.current === eventTarget || contains(eventTarget, popupElement) && !eventTarget?.hasAttribute("data-base-ui-portal") : true; |
| 8431 |
} |
| 8432 |
return true; |
| 8433 |
} |
| 8434 |
return false; |
| 8435 |
}, |
| 8436 |
escapeKey: isTopmost |
| 8437 |
}); |
| 8438 |
useScrollLock(open && modal === true, popupElement); |
| 8439 |
const { |
| 8440 |
getReferenceProps, |
| 8441 |
getFloatingProps, |
| 8442 |
getTriggerProps |
| 8443 |
} = useInteractions([role, dismiss]); |
| 8444 |
store.useContextCallback("onNestedDialogOpen", (dialogCount, drawerCount) => { |
| 8445 |
setOwnNestedOpenDialogs(dialogCount); |
| 8446 |
setOwnNestedOpenDrawers(drawerCount); |
| 8447 |
}); |
| 8448 |
store.useContextCallback("onNestedDialogClose", () => { |
| 8449 |
setOwnNestedOpenDialogs(0); |
| 8450 |
setOwnNestedOpenDrawers(0); |
| 8451 |
}); |
| 8452 |
React39.useEffect(() => { |
| 8453 |
if (parentContext?.onNestedDialogOpen && open) { |
| 8454 |
parentContext.onNestedDialogOpen(ownNestedOpenDialogs + 1, ownNestedOpenDrawers + (isDrawer ? 1 : 0)); |
| 8455 |
} |
| 8456 |
if (parentContext?.onNestedDialogClose && !open) { |
| 8457 |
parentContext.onNestedDialogClose(); |
| 8458 |
} |
| 8459 |
return () => { |
| 8460 |
if (parentContext?.onNestedDialogClose && open) { |
| 8461 |
parentContext.onNestedDialogClose(); |
| 8462 |
} |
| 8463 |
}; |
| 8464 |
}, [isDrawer, open, ownNestedOpenDialogs, ownNestedOpenDrawers, parentContext]); |
| 8465 |
const activeTriggerProps = React39.useMemo(() => getReferenceProps(triggerProps), [getReferenceProps, triggerProps]); |
| 8466 |
const inactiveTriggerProps = React39.useMemo(() => getTriggerProps(triggerProps), [getTriggerProps, triggerProps]); |
| 8467 |
const popupProps = React39.useMemo(() => getFloatingProps(), [getFloatingProps]); |
| 8468 |
store.useSyncedValues({ |
| 8469 |
openMethod, |
| 8470 |
activeTriggerProps, |
| 8471 |
inactiveTriggerProps, |
| 8472 |
popupProps, |
| 8473 |
floatingRootContext, |
| 8474 |
nestedOpenDialogCount: ownNestedOpenDialogs, |
| 8475 |
nestedOpenDrawerCount: ownNestedOpenDrawers |
| 8476 |
}); |
| 8477 |
} |
| 8478 |
|
| 8479 |
// node_modules/@base-ui/react/esm/dialog/root/DialogRootContext.js |
| 8480 |
var React40 = __toESM(require_react(), 1); |
| 8481 |
var DialogRootContext = /* @__PURE__ */ React40.createContext(void 0); |
| 8482 |
if (true) DialogRootContext.displayName = "DialogRootContext"; |
| 8483 |
function useDialogRootContext(optional) { |
| 8484 |
const dialogRootContext = React40.useContext(DialogRootContext); |
| 8485 |
if (optional === false && dialogRootContext === void 0) { |
| 8486 |
throw new Error(true ? "Base UI: DialogRootContext is missing. Dialog parts must be placed within <Dialog.Root>." : formatErrorMessage_default(27)); |
| 8487 |
} |
| 8488 |
return dialogRootContext; |
| 8489 |
} |
| 8490 |
|
| 8491 |
// node_modules/@base-ui/react/esm/dialog/store/DialogStore.js |
| 8492 |
var React41 = __toESM(require_react(), 1); |
| 8493 |
var selectors2 = { |
| 8494 |
...popupStoreSelectors, |
| 8495 |
modal: createSelector((state) => state.modal), |
| 8496 |
nested: createSelector((state) => state.nested), |
| 8497 |
nestedOpenDialogCount: createSelector((state) => state.nestedOpenDialogCount), |
| 8498 |
nestedOpenDrawerCount: createSelector((state) => state.nestedOpenDrawerCount), |
| 8499 |
disablePointerDismissal: createSelector((state) => state.disablePointerDismissal), |
| 8500 |
openMethod: createSelector((state) => state.openMethod), |
| 8501 |
descriptionElementId: createSelector((state) => state.descriptionElementId), |
| 8502 |
titleElementId: createSelector((state) => state.titleElementId), |
| 8503 |
viewportElement: createSelector((state) => state.viewportElement), |
| 8504 |
role: createSelector((state) => state.role) |
| 8505 |
}; |
| 8506 |
var DialogStore = class _DialogStore extends ReactStore { |
| 8507 |
constructor(initialState) { |
| 8508 |
super(createInitialState(initialState), { |
| 8509 |
popupRef: /* @__PURE__ */ React41.createRef(), |
| 8510 |
backdropRef: /* @__PURE__ */ React41.createRef(), |
| 8511 |
internalBackdropRef: /* @__PURE__ */ React41.createRef(), |
| 8512 |
outsidePressEnabledRef: { |
| 8513 |
current: true |
| 8514 |
}, |
| 8515 |
triggerElements: new PopupTriggerMap(), |
| 8516 |
onOpenChange: void 0, |
| 8517 |
onOpenChangeComplete: void 0 |
| 8518 |
}, selectors2); |
| 8519 |
} |
| 8520 |
setOpen = (nextOpen, eventDetails) => { |
| 8521 |
eventDetails.preventUnmountOnClose = () => { |
| 8522 |
this.set("preventUnmountingOnClose", true); |
| 8523 |
}; |
| 8524 |
if (!nextOpen && eventDetails.trigger == null && this.state.activeTriggerId != null) { |
| 8525 |
eventDetails.trigger = this.state.activeTriggerElement ?? void 0; |
| 8526 |
} |
| 8527 |
this.context.onOpenChange?.(nextOpen, eventDetails); |
| 8528 |
if (eventDetails.isCanceled) { |
| 8529 |
return; |
| 8530 |
} |
| 8531 |
this.state.floatingRootContext.dispatchOpenChange(nextOpen, eventDetails); |
| 8532 |
const updatedState = { |
| 8533 |
open: nextOpen |
| 8534 |
}; |
| 8535 |
const newTriggerId = eventDetails.trigger?.id ?? null; |
| 8536 |
if (newTriggerId || nextOpen) { |
| 8537 |
updatedState.activeTriggerId = newTriggerId; |
| 8538 |
updatedState.activeTriggerElement = eventDetails.trigger ?? null; |
| 8539 |
} |
| 8540 |
this.update(updatedState); |
| 8541 |
}; |
| 8542 |
static useStore(externalStore, initialState) { |
| 8543 |
const internalStore = useRefWithInit(() => { |
| 8544 |
return new _DialogStore(initialState); |
| 8545 |
}).current; |
| 8546 |
return externalStore ?? internalStore; |
| 8547 |
} |
| 8548 |
}; |
| 8549 |
function createInitialState(initialState = {}) { |
| 8550 |
return { |
| 8551 |
...createInitialPopupStoreState(), |
| 8552 |
modal: true, |
| 8553 |
disablePointerDismissal: false, |
| 8554 |
popupElement: null, |
| 8555 |
viewportElement: null, |
| 8556 |
descriptionElementId: void 0, |
| 8557 |
titleElementId: void 0, |
| 8558 |
openMethod: null, |
| 8559 |
nested: false, |
| 8560 |
nestedOpenDialogCount: 0, |
| 8561 |
nestedOpenDrawerCount: 0, |
| 8562 |
role: "dialog", |
| 8563 |
...initialState |
| 8564 |
}; |
| 8565 |
} |
| 8566 |
|
| 8567 |
// node_modules/@base-ui/react/esm/dialog/root/DialogRoot.js |
| 8568 |
var import_jsx_runtime6 = __toESM(require_jsx_runtime(), 1); |
| 8569 |
var IsDrawerContext = /* @__PURE__ */ React42.createContext(false); |
| 8570 |
if (true) IsDrawerContext.displayName = "IsDrawerContext"; |
| 8571 |
function DialogRoot(props) { |
| 8572 |
const { |
| 8573 |
children, |
| 8574 |
open: openProp, |
| 8575 |
defaultOpen = false, |
| 8576 |
onOpenChange, |
| 8577 |
onOpenChangeComplete, |
| 8578 |
disablePointerDismissal = false, |
| 8579 |
modal = true, |
| 8580 |
actionsRef, |
| 8581 |
handle, |
| 8582 |
triggerId: triggerIdProp, |
| 8583 |
defaultTriggerId: defaultTriggerIdProp = null |
| 8584 |
} = props; |
| 8585 |
const parentDialogRootContext = useDialogRootContext(true); |
| 8586 |
const isDrawer = React42.useContext(IsDrawerContext); |
| 8587 |
const nested = Boolean(parentDialogRootContext); |
| 8588 |
const store = DialogStore.useStore(handle?.store, { |
| 8589 |
open: defaultOpen, |
| 8590 |
openProp, |
| 8591 |
activeTriggerId: defaultTriggerIdProp, |
| 8592 |
triggerIdProp, |
| 8593 |
modal, |
| 8594 |
disablePointerDismissal, |
| 8595 |
nested |
| 8596 |
}); |
| 8597 |
useOnFirstRender(() => { |
| 8598 |
if (openProp === void 0 && store.state.open === false && defaultOpen === true) { |
| 8599 |
store.update({ |
| 8600 |
open: true, |
| 8601 |
activeTriggerId: defaultTriggerIdProp |
| 8602 |
}); |
| 8603 |
} |
| 8604 |
}); |
| 8605 |
store.useControlledProp("openProp", openProp); |
| 8606 |
store.useControlledProp("triggerIdProp", triggerIdProp); |
| 8607 |
store.useSyncedValues({ |
| 8608 |
disablePointerDismissal, |
| 8609 |
nested, |
| 8610 |
modal |
| 8611 |
}); |
| 8612 |
store.useContextCallback("onOpenChange", onOpenChange); |
| 8613 |
store.useContextCallback("onOpenChangeComplete", onOpenChangeComplete); |
| 8614 |
const payload = store.useState("payload"); |
| 8615 |
useDialogRoot({ |
| 8616 |
store, |
| 8617 |
actionsRef, |
| 8618 |
parentContext: parentDialogRootContext?.store.context, |
| 8619 |
isDrawer, |
| 8620 |
onOpenChange, |
| 8621 |
triggerIdProp |
| 8622 |
}); |
| 8623 |
const contextValue = React42.useMemo(() => ({ |
| 8624 |
store |
| 8625 |
}), [store]); |
| 8626 |
return /* @__PURE__ */ (0, import_jsx_runtime6.jsx)(IsDrawerContext.Provider, { |
| 8627 |
value: false, |
| 8628 |
children: /* @__PURE__ */ (0, import_jsx_runtime6.jsx)(DialogRootContext.Provider, { |
| 8629 |
value: contextValue, |
| 8630 |
children: typeof children === "function" ? children({ |
| 8631 |
payload |
| 8632 |
}) : children |
| 8633 |
}) |
| 8634 |
}); |
| 8635 |
} |
| 8636 |
|
| 8637 |
// node_modules/@base-ui/react/esm/alert-dialog/root/AlertDialogRoot.js |
| 8638 |
var import_jsx_runtime7 = __toESM(require_jsx_runtime(), 1); |
| 8639 |
function AlertDialogRoot(props) { |
| 8640 |
const { |
| 8641 |
children, |
| 8642 |
open: openProp, |
| 8643 |
defaultOpen = false, |
| 8644 |
onOpenChange, |
| 8645 |
onOpenChangeComplete, |
| 8646 |
actionsRef, |
| 8647 |
handle, |
| 8648 |
triggerId: triggerIdProp, |
| 8649 |
defaultTriggerId: defaultTriggerIdProp = null |
| 8650 |
} = props; |
| 8651 |
const parentDialogRootContext = useDialogRootContext(true); |
| 8652 |
const nested = Boolean(parentDialogRootContext); |
| 8653 |
const store = DialogStore.useStore(handle?.store, { |
| 8654 |
open: defaultOpen, |
| 8655 |
openProp, |
| 8656 |
activeTriggerId: defaultTriggerIdProp, |
| 8657 |
triggerIdProp, |
| 8658 |
modal: true, |
| 8659 |
disablePointerDismissal: true, |
| 8660 |
nested, |
| 8661 |
role: "alertdialog" |
| 8662 |
}); |
| 8663 |
store.useControlledProp("openProp", openProp); |
| 8664 |
store.useControlledProp("triggerIdProp", triggerIdProp); |
| 8665 |
store.useSyncedValue("nested", nested); |
| 8666 |
store.useContextCallback("onOpenChange", onOpenChange); |
| 8667 |
store.useContextCallback("onOpenChangeComplete", onOpenChangeComplete); |
| 8668 |
const payload = store.useState("payload"); |
| 8669 |
useDialogRoot({ |
| 8670 |
store, |
| 8671 |
actionsRef, |
| 8672 |
parentContext: parentDialogRootContext?.store.context, |
| 8673 |
isDrawer: false, |
| 8674 |
onOpenChange, |
| 8675 |
triggerIdProp |
| 8676 |
}); |
| 8677 |
const contextValue = React43.useMemo(() => ({ |
| 8678 |
store |
| 8679 |
}), [store]); |
| 8680 |
return /* @__PURE__ */ (0, import_jsx_runtime7.jsx)(IsDrawerContext.Provider, { |
| 8681 |
value: false, |
| 8682 |
children: /* @__PURE__ */ (0, import_jsx_runtime7.jsx)(DialogRootContext.Provider, { |
| 8683 |
value: contextValue, |
| 8684 |
children: typeof children === "function" ? children({ |
| 8685 |
payload |
| 8686 |
}) : children |
| 8687 |
}) |
| 8688 |
}); |
| 8689 |
} |
| 8690 |
|
| 8691 |
// node_modules/@base-ui/react/esm/dialog/backdrop/DialogBackdrop.js |
| 8692 |
var React44 = __toESM(require_react(), 1); |
| 8693 |
|
| 8694 |
// node_modules/@base-ui/react/esm/utils/popupStateMapping.js |
| 8695 |
var CommonPopupDataAttributes = (function(CommonPopupDataAttributes2) { |
| 8696 |
CommonPopupDataAttributes2["open"] = "data-open"; |
| 8697 |
CommonPopupDataAttributes2["closed"] = "data-closed"; |
| 8698 |
CommonPopupDataAttributes2[CommonPopupDataAttributes2["startingStyle"] = TransitionStatusDataAttributes.startingStyle] = "startingStyle"; |
| 8699 |
CommonPopupDataAttributes2[CommonPopupDataAttributes2["endingStyle"] = TransitionStatusDataAttributes.endingStyle] = "endingStyle"; |
| 8700 |
CommonPopupDataAttributes2["anchorHidden"] = "data-anchor-hidden"; |
| 8701 |
CommonPopupDataAttributes2["side"] = "data-side"; |
| 8702 |
CommonPopupDataAttributes2["align"] = "data-align"; |
| 8703 |
return CommonPopupDataAttributes2; |
| 8704 |
})({}); |
| 8705 |
var CommonTriggerDataAttributes = /* @__PURE__ */ (function(CommonTriggerDataAttributes2) { |
| 8706 |
CommonTriggerDataAttributes2["popupOpen"] = "data-popup-open"; |
| 8707 |
CommonTriggerDataAttributes2["pressed"] = "data-pressed"; |
| 8708 |
return CommonTriggerDataAttributes2; |
| 8709 |
})({}); |
| 8710 |
var TRIGGER_HOOK = { |
| 8711 |
[CommonTriggerDataAttributes.popupOpen]: "" |
| 8712 |
}; |
| 8713 |
var PRESSABLE_TRIGGER_HOOK = { |
| 8714 |
[CommonTriggerDataAttributes.popupOpen]: "", |
| 8715 |
[CommonTriggerDataAttributes.pressed]: "" |
| 8716 |
}; |
| 8717 |
var POPUP_OPEN_HOOK = { |
| 8718 |
[CommonPopupDataAttributes.open]: "" |
| 8719 |
}; |
| 8720 |
var POPUP_CLOSED_HOOK = { |
| 8721 |
[CommonPopupDataAttributes.closed]: "" |
| 8722 |
}; |
| 8723 |
var ANCHOR_HIDDEN_HOOK = { |
| 8724 |
[CommonPopupDataAttributes.anchorHidden]: "" |
| 8725 |
}; |
| 8726 |
var triggerOpenStateMapping = { |
| 8727 |
open(value) { |
| 8728 |
if (value) { |
| 8729 |
return TRIGGER_HOOK; |
| 8730 |
} |
| 8731 |
return null; |
| 8732 |
} |
| 8733 |
}; |
| 8734 |
var popupStateMapping = { |
| 8735 |
open(value) { |
| 8736 |
if (value) { |
| 8737 |
return POPUP_OPEN_HOOK; |
| 8738 |
} |
| 8739 |
return POPUP_CLOSED_HOOK; |
| 8740 |
}, |
| 8741 |
anchorHidden(value) { |
| 8742 |
if (value) { |
| 8743 |
return ANCHOR_HIDDEN_HOOK; |
| 8744 |
} |
| 8745 |
return null; |
| 8746 |
} |
| 8747 |
}; |
| 8748 |
|
| 8749 |
// node_modules/@base-ui/react/esm/dialog/backdrop/DialogBackdrop.js |
| 8750 |
var stateAttributesMapping = { |
| 8751 |
...popupStateMapping, |
| 8752 |
...transitionStatusMapping |
| 8753 |
}; |
| 8754 |
var DialogBackdrop = /* @__PURE__ */ React44.forwardRef(function DialogBackdrop2(componentProps, forwardedRef) { |
| 8755 |
const { |
| 8756 |
render: render4, |
| 8757 |
className, |
| 8758 |
style, |
| 8759 |
forceRender = false, |
| 8760 |
...elementProps |
| 8761 |
} = componentProps; |
| 8762 |
const { |
| 8763 |
store |
| 8764 |
} = useDialogRootContext(); |
| 8765 |
const open = store.useState("open"); |
| 8766 |
const nested = store.useState("nested"); |
| 8767 |
const mounted = store.useState("mounted"); |
| 8768 |
const transitionStatus = store.useState("transitionStatus"); |
| 8769 |
const state = { |
| 8770 |
open, |
| 8771 |
transitionStatus |
| 8772 |
}; |
| 8773 |
return useRenderElement("div", componentProps, { |
| 8774 |
state, |
| 8775 |
ref: [store.context.backdropRef, forwardedRef], |
| 8776 |
stateAttributesMapping, |
| 8777 |
props: [{ |
| 8778 |
role: "presentation", |
| 8779 |
hidden: !mounted, |
| 8780 |
style: { |
| 8781 |
userSelect: "none", |
| 8782 |
WebkitUserSelect: "none" |
| 8783 |
} |
| 8784 |
}, elementProps], |
| 8785 |
enabled: forceRender || !nested |
| 8786 |
}); |
| 8787 |
}); |
| 8788 |
if (true) DialogBackdrop.displayName = "DialogBackdrop"; |
| 8789 |
|
| 8790 |
// node_modules/@base-ui/react/esm/dialog/close/DialogClose.js |
| 8791 |
var React45 = __toESM(require_react(), 1); |
| 8792 |
var DialogClose = /* @__PURE__ */ React45.forwardRef(function DialogClose2(componentProps, forwardedRef) { |
| 8793 |
const { |
| 8794 |
render: render4, |
| 8795 |
className, |
| 8796 |
disabled: disabled2 = false, |
| 8797 |
nativeButton = true, |
| 8798 |
style, |
| 8799 |
...elementProps |
| 8800 |
} = componentProps; |
| 8801 |
const { |
| 8802 |
store |
| 8803 |
} = useDialogRootContext(); |
| 8804 |
const open = store.useState("open"); |
| 8805 |
function handleClick(event) { |
| 8806 |
if (open) { |
| 8807 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.closePress, event.nativeEvent)); |
| 8808 |
} |
| 8809 |
} |
| 8810 |
const { |
| 8811 |
getButtonProps, |
| 8812 |
buttonRef |
| 8813 |
} = useButton({ |
| 8814 |
disabled: disabled2, |
| 8815 |
native: nativeButton |
| 8816 |
}); |
| 8817 |
const state = { |
| 8818 |
disabled: disabled2 |
| 8819 |
}; |
| 8820 |
return useRenderElement("button", componentProps, { |
| 8821 |
state, |
| 8822 |
ref: [forwardedRef, buttonRef], |
| 8823 |
props: [{ |
| 8824 |
onClick: handleClick |
| 8825 |
}, elementProps, getButtonProps] |
| 8826 |
}); |
| 8827 |
}); |
| 8828 |
if (true) DialogClose.displayName = "DialogClose"; |
| 8829 |
|
| 8830 |
// node_modules/@base-ui/react/esm/dialog/description/DialogDescription.js |
| 8831 |
var React46 = __toESM(require_react(), 1); |
| 8832 |
var DialogDescription = /* @__PURE__ */ React46.forwardRef(function DialogDescription2(componentProps, forwardedRef) { |
| 8833 |
const { |
| 8834 |
render: render4, |
| 8835 |
className, |
| 8836 |
style, |
| 8837 |
id: idProp, |
| 8838 |
...elementProps |
| 8839 |
} = componentProps; |
| 8840 |
const { |
| 8841 |
store |
| 8842 |
} = useDialogRootContext(); |
| 8843 |
const id = useBaseUiId(idProp); |
| 8844 |
store.useSyncedValueWithCleanup("descriptionElementId", id); |
| 8845 |
return useRenderElement("p", componentProps, { |
| 8846 |
ref: forwardedRef, |
| 8847 |
props: [{ |
| 8848 |
id |
| 8849 |
}, elementProps] |
| 8850 |
}); |
| 8851 |
}); |
| 8852 |
if (true) DialogDescription.displayName = "DialogDescription"; |
| 8853 |
|
| 8854 |
// node_modules/@base-ui/react/esm/dialog/popup/DialogPopup.js |
| 8855 |
var React48 = __toESM(require_react(), 1); |
| 8856 |
|
| 8857 |
// node_modules/@base-ui/react/esm/dialog/popup/DialogPopupCssVars.js |
| 8858 |
var DialogPopupCssVars = /* @__PURE__ */ (function(DialogPopupCssVars2) { |
| 8859 |
DialogPopupCssVars2["nestedDialogs"] = "--nested-dialogs"; |
| 8860 |
return DialogPopupCssVars2; |
| 8861 |
})({}); |
| 8862 |
|
| 8863 |
// node_modules/@base-ui/react/esm/dialog/popup/DialogPopupDataAttributes.js |
| 8864 |
var DialogPopupDataAttributes = (function(DialogPopupDataAttributes2) { |
| 8865 |
DialogPopupDataAttributes2[DialogPopupDataAttributes2["open"] = CommonPopupDataAttributes.open] = "open"; |
| 8866 |
DialogPopupDataAttributes2[DialogPopupDataAttributes2["closed"] = CommonPopupDataAttributes.closed] = "closed"; |
| 8867 |
DialogPopupDataAttributes2[DialogPopupDataAttributes2["startingStyle"] = CommonPopupDataAttributes.startingStyle] = "startingStyle"; |
| 8868 |
DialogPopupDataAttributes2[DialogPopupDataAttributes2["endingStyle"] = CommonPopupDataAttributes.endingStyle] = "endingStyle"; |
| 8869 |
DialogPopupDataAttributes2["nested"] = "data-nested"; |
| 8870 |
DialogPopupDataAttributes2["nestedDialogOpen"] = "data-nested-dialog-open"; |
| 8871 |
return DialogPopupDataAttributes2; |
| 8872 |
})({}); |
| 8873 |
|
| 8874 |
// node_modules/@base-ui/react/esm/dialog/portal/DialogPortalContext.js |
| 8875 |
var React47 = __toESM(require_react(), 1); |
| 8876 |
var DialogPortalContext = /* @__PURE__ */ React47.createContext(void 0); |
| 8877 |
if (true) DialogPortalContext.displayName = "DialogPortalContext"; |
| 8878 |
function useDialogPortalContext() { |
| 8879 |
const value = React47.useContext(DialogPortalContext); |
| 8880 |
if (value === void 0) { |
| 8881 |
throw new Error(true ? "Base UI: <Dialog.Portal> is missing." : formatErrorMessage_default(26)); |
| 8882 |
} |
| 8883 |
return value; |
| 8884 |
} |
| 8885 |
|
| 8886 |
// node_modules/@base-ui/react/esm/dialog/popup/DialogPopup.js |
| 8887 |
var import_jsx_runtime8 = __toESM(require_jsx_runtime(), 1); |
| 8888 |
var stateAttributesMapping2 = { |
| 8889 |
...popupStateMapping, |
| 8890 |
...transitionStatusMapping, |
| 8891 |
nestedDialogOpen(value) { |
| 8892 |
return value ? { |
| 8893 |
[DialogPopupDataAttributes.nestedDialogOpen]: "" |
| 8894 |
} : null; |
| 8895 |
} |
| 8896 |
}; |
| 8897 |
var DialogPopup = /* @__PURE__ */ React48.forwardRef(function DialogPopup2(componentProps, forwardedRef) { |
| 8898 |
const { |
| 8899 |
className, |
| 8900 |
finalFocus, |
| 8901 |
initialFocus, |
| 8902 |
render: render4, |
| 8903 |
style, |
| 8904 |
...elementProps |
| 8905 |
} = componentProps; |
| 8906 |
const { |
| 8907 |
store |
| 8908 |
} = useDialogRootContext(); |
| 8909 |
const descriptionElementId = store.useState("descriptionElementId"); |
| 8910 |
const disablePointerDismissal = store.useState("disablePointerDismissal"); |
| 8911 |
const floatingRootContext = store.useState("floatingRootContext"); |
| 8912 |
const rootPopupProps = store.useState("popupProps"); |
| 8913 |
const modal = store.useState("modal"); |
| 8914 |
const mounted = store.useState("mounted"); |
| 8915 |
const nested = store.useState("nested"); |
| 8916 |
const nestedOpenDialogCount = store.useState("nestedOpenDialogCount"); |
| 8917 |
const open = store.useState("open"); |
| 8918 |
const openMethod = store.useState("openMethod"); |
| 8919 |
const titleElementId = store.useState("titleElementId"); |
| 8920 |
const transitionStatus = store.useState("transitionStatus"); |
| 8921 |
const role = store.useState("role"); |
| 8922 |
useDialogPortalContext(); |
| 8923 |
useOpenChangeComplete({ |
| 8924 |
open, |
| 8925 |
ref: store.context.popupRef, |
| 8926 |
onComplete() { |
| 8927 |
if (open) { |
| 8928 |
store.context.onOpenChangeComplete?.(true); |
| 8929 |
} |
| 8930 |
} |
| 8931 |
}); |
| 8932 |
function defaultInitialFocus(interactionType) { |
| 8933 |
if (interactionType === "touch") { |
| 8934 |
return store.context.popupRef.current; |
| 8935 |
} |
| 8936 |
return true; |
| 8937 |
} |
| 8938 |
const resolvedInitialFocus = initialFocus === void 0 ? defaultInitialFocus : initialFocus; |
| 8939 |
const nestedDialogOpen = nestedOpenDialogCount > 0; |
| 8940 |
const state = { |
| 8941 |
open, |
| 8942 |
nested, |
| 8943 |
transitionStatus, |
| 8944 |
nestedDialogOpen |
| 8945 |
}; |
| 8946 |
const element = useRenderElement("div", componentProps, { |
| 8947 |
state, |
| 8948 |
props: [rootPopupProps, { |
| 8949 |
"aria-labelledby": titleElementId ?? void 0, |
| 8950 |
"aria-describedby": descriptionElementId ?? void 0, |
| 8951 |
role, |
| 8952 |
tabIndex: -1, |
| 8953 |
hidden: !mounted, |
| 8954 |
onKeyDown(event) { |
| 8955 |
if (COMPOSITE_KEYS.has(event.key)) { |
| 8956 |
event.stopPropagation(); |
| 8957 |
} |
| 8958 |
}, |
| 8959 |
style: { |
| 8960 |
[DialogPopupCssVars.nestedDialogs]: nestedOpenDialogCount |
| 8961 |
} |
| 8962 |
}, elementProps], |
| 8963 |
ref: [forwardedRef, store.context.popupRef, store.useStateSetter("popupElement")], |
| 8964 |
stateAttributesMapping: stateAttributesMapping2 |
| 8965 |
}); |
| 8966 |
return /* @__PURE__ */ (0, import_jsx_runtime8.jsx)(FloatingFocusManager, { |
| 8967 |
context: floatingRootContext, |
| 8968 |
openInteractionType: openMethod, |
| 8969 |
disabled: !mounted, |
| 8970 |
closeOnFocusOut: !disablePointerDismissal, |
| 8971 |
initialFocus: resolvedInitialFocus, |
| 8972 |
returnFocus: finalFocus, |
| 8973 |
modal: modal !== false, |
| 8974 |
restoreFocus: "popup", |
| 8975 |
children: element |
| 8976 |
}); |
| 8977 |
}); |
| 8978 |
if (true) DialogPopup.displayName = "DialogPopup"; |
| 8979 |
|
| 8980 |
// node_modules/@base-ui/react/esm/dialog/portal/DialogPortal.js |
| 8981 |
var React50 = __toESM(require_react(), 1); |
| 8982 |
|
| 8983 |
// node_modules/@base-ui/utils/esm/inertValue.js |
| 8984 |
function inertValue(value) { |
| 8985 |
if (isReactVersionAtLeast(19)) { |
| 8986 |
return value; |
| 8987 |
} |
| 8988 |
return value ? "true" : void 0; |
| 8989 |
} |
| 8990 |
|
| 8991 |
// node_modules/@base-ui/react/esm/utils/InternalBackdrop.js |
| 8992 |
var React49 = __toESM(require_react(), 1); |
| 8993 |
var import_jsx_runtime9 = __toESM(require_jsx_runtime(), 1); |
| 8994 |
var InternalBackdrop = /* @__PURE__ */ React49.forwardRef(function InternalBackdrop2(props, ref) { |
| 8995 |
const { |
| 8996 |
cutout, |
| 8997 |
...otherProps |
| 8998 |
} = props; |
| 8999 |
let clipPath; |
| 9000 |
if (cutout) { |
| 9001 |
const rect = cutout.getBoundingClientRect(); |
| 9002 |
clipPath = `polygon(0% 0%,100% 0%,100% 100%,0% 100%,0% 0%,${rect.left}px ${rect.top}px,${rect.left}px ${rect.bottom}px,${rect.right}px ${rect.bottom}px,${rect.right}px ${rect.top}px,${rect.left}px ${rect.top}px)`; |
| 9003 |
} |
| 9004 |
return /* @__PURE__ */ (0, import_jsx_runtime9.jsx)("div", { |
| 9005 |
ref, |
| 9006 |
role: "presentation", |
| 9007 |
"data-base-ui-inert": "", |
| 9008 |
...otherProps, |
| 9009 |
style: { |
| 9010 |
position: "fixed", |
| 9011 |
inset: 0, |
| 9012 |
userSelect: "none", |
| 9013 |
WebkitUserSelect: "none", |
| 9014 |
clipPath |
| 9015 |
} |
| 9016 |
}); |
| 9017 |
}); |
| 9018 |
if (true) InternalBackdrop.displayName = "InternalBackdrop"; |
| 9019 |
|
| 9020 |
// node_modules/@base-ui/react/esm/dialog/portal/DialogPortal.js |
| 9021 |
var import_jsx_runtime10 = __toESM(require_jsx_runtime(), 1); |
| 9022 |
var DialogPortal = /* @__PURE__ */ React50.forwardRef(function DialogPortal2(props, forwardedRef) { |
| 9023 |
const { |
| 9024 |
keepMounted = false, |
| 9025 |
...portalProps |
| 9026 |
} = props; |
| 9027 |
const { |
| 9028 |
store |
| 9029 |
} = useDialogRootContext(); |
| 9030 |
const mounted = store.useState("mounted"); |
| 9031 |
const modal = store.useState("modal"); |
| 9032 |
const open = store.useState("open"); |
| 9033 |
const shouldRender = mounted || keepMounted; |
| 9034 |
if (!shouldRender) { |
| 9035 |
return null; |
| 9036 |
} |
| 9037 |
return /* @__PURE__ */ (0, import_jsx_runtime10.jsx)(DialogPortalContext.Provider, { |
| 9038 |
value: keepMounted, |
| 9039 |
children: /* @__PURE__ */ (0, import_jsx_runtime10.jsxs)(FloatingPortal, { |
| 9040 |
ref: forwardedRef, |
| 9041 |
...portalProps, |
| 9042 |
children: [mounted && modal === true && /* @__PURE__ */ (0, import_jsx_runtime10.jsx)(InternalBackdrop, { |
| 9043 |
ref: store.context.internalBackdropRef, |
| 9044 |
inert: inertValue(!open) |
| 9045 |
}), props.children] |
| 9046 |
}) |
| 9047 |
}); |
| 9048 |
}); |
| 9049 |
if (true) DialogPortal.displayName = "DialogPortal"; |
| 9050 |
|
| 9051 |
// node_modules/@base-ui/react/esm/dialog/title/DialogTitle.js |
| 9052 |
var React51 = __toESM(require_react(), 1); |
| 9053 |
var DialogTitle = /* @__PURE__ */ React51.forwardRef(function DialogTitle2(componentProps, forwardedRef) { |
| 9054 |
const { |
| 9055 |
render: render4, |
| 9056 |
className, |
| 9057 |
style, |
| 9058 |
id: idProp, |
| 9059 |
...elementProps |
| 9060 |
} = componentProps; |
| 9061 |
const { |
| 9062 |
store |
| 9063 |
} = useDialogRootContext(); |
| 9064 |
const id = useBaseUiId(idProp); |
| 9065 |
store.useSyncedValueWithCleanup("titleElementId", id); |
| 9066 |
return useRenderElement("h2", componentProps, { |
| 9067 |
ref: forwardedRef, |
| 9068 |
props: [{ |
| 9069 |
id |
| 9070 |
}, elementProps] |
| 9071 |
}); |
| 9072 |
}); |
| 9073 |
if (true) DialogTitle.displayName = "DialogTitle"; |
| 9074 |
|
| 9075 |
// node_modules/@base-ui/react/esm/dialog/trigger/DialogTrigger.js |
| 9076 |
var React52 = __toESM(require_react(), 1); |
| 9077 |
var DialogTrigger = /* @__PURE__ */ React52.forwardRef(function DialogTrigger2(componentProps, forwardedRef) { |
| 9078 |
const { |
| 9079 |
render: render4, |
| 9080 |
className, |
| 9081 |
disabled: disabled2 = false, |
| 9082 |
nativeButton = true, |
| 9083 |
id: idProp, |
| 9084 |
payload, |
| 9085 |
handle, |
| 9086 |
style, |
| 9087 |
...elementProps |
| 9088 |
} = componentProps; |
| 9089 |
const dialogRootContext = useDialogRootContext(true); |
| 9090 |
const store = handle?.store ?? dialogRootContext?.store; |
| 9091 |
if (!store) { |
| 9092 |
throw new Error(true ? "Base UI: <Dialog.Trigger> must be used within <Dialog.Root> or provided with a handle." : formatErrorMessage_default(79)); |
| 9093 |
} |
| 9094 |
const thisTriggerId = useBaseUiId(idProp); |
| 9095 |
const floatingContext = store.useState("floatingRootContext"); |
| 9096 |
const isOpenedByThisTrigger = store.useState("isOpenedByTrigger", thisTriggerId); |
| 9097 |
const triggerElementRef = React52.useRef(null); |
| 9098 |
const { |
| 9099 |
registerTrigger, |
| 9100 |
isMountedByThisTrigger |
| 9101 |
} = useTriggerDataForwarding(thisTriggerId, triggerElementRef, store, { |
| 9102 |
payload |
| 9103 |
}); |
| 9104 |
const { |
| 9105 |
getButtonProps, |
| 9106 |
buttonRef |
| 9107 |
} = useButton({ |
| 9108 |
disabled: disabled2, |
| 9109 |
native: nativeButton |
| 9110 |
}); |
| 9111 |
const click = useClick(floatingContext, { |
| 9112 |
enabled: floatingContext != null |
| 9113 |
}); |
| 9114 |
const localInteractionProps = useInteractions([click]); |
| 9115 |
const state = { |
| 9116 |
disabled: disabled2, |
| 9117 |
open: isOpenedByThisTrigger |
| 9118 |
}; |
| 9119 |
const rootTriggerProps = store.useState("triggerProps", isMountedByThisTrigger); |
| 9120 |
return useRenderElement("button", componentProps, { |
| 9121 |
state, |
| 9122 |
ref: [buttonRef, forwardedRef, registerTrigger, triggerElementRef], |
| 9123 |
props: [localInteractionProps.getReferenceProps(), rootTriggerProps, { |
| 9124 |
[CLICK_TRIGGER_IDENTIFIER]: "", |
| 9125 |
id: thisTriggerId |
| 9126 |
}, elementProps, getButtonProps], |
| 9127 |
stateAttributesMapping: triggerOpenStateMapping |
| 9128 |
}); |
| 9129 |
}); |
| 9130 |
if (true) DialogTrigger.displayName = "DialogTrigger"; |
| 9131 |
|
| 9132 |
// node_modules/@base-ui/react/esm/dialog/viewport/DialogViewport.js |
| 9133 |
var React53 = __toESM(require_react(), 1); |
| 9134 |
|
| 9135 |
// node_modules/@base-ui/react/esm/dialog/viewport/DialogViewportDataAttributes.js |
| 9136 |
var DialogViewportDataAttributes = (function(DialogViewportDataAttributes2) { |
| 9137 |
DialogViewportDataAttributes2[DialogViewportDataAttributes2["open"] = CommonPopupDataAttributes.open] = "open"; |
| 9138 |
DialogViewportDataAttributes2[DialogViewportDataAttributes2["closed"] = CommonPopupDataAttributes.closed] = "closed"; |
| 9139 |
DialogViewportDataAttributes2[DialogViewportDataAttributes2["startingStyle"] = CommonPopupDataAttributes.startingStyle] = "startingStyle"; |
| 9140 |
DialogViewportDataAttributes2[DialogViewportDataAttributes2["endingStyle"] = CommonPopupDataAttributes.endingStyle] = "endingStyle"; |
| 9141 |
DialogViewportDataAttributes2["nested"] = "data-nested"; |
| 9142 |
DialogViewportDataAttributes2["nestedDialogOpen"] = "data-nested-dialog-open"; |
| 9143 |
return DialogViewportDataAttributes2; |
| 9144 |
})({}); |
| 9145 |
|
| 9146 |
// node_modules/@base-ui/react/esm/dialog/viewport/DialogViewport.js |
| 9147 |
var stateAttributesMapping3 = { |
| 9148 |
...popupStateMapping, |
| 9149 |
...transitionStatusMapping, |
| 9150 |
nested(value) { |
| 9151 |
return value ? { |
| 9152 |
[DialogViewportDataAttributes.nested]: "" |
| 9153 |
} : null; |
| 9154 |
}, |
| 9155 |
nestedDialogOpen(value) { |
| 9156 |
return value ? { |
| 9157 |
[DialogViewportDataAttributes.nestedDialogOpen]: "" |
| 9158 |
} : null; |
| 9159 |
} |
| 9160 |
}; |
| 9161 |
var DialogViewport = /* @__PURE__ */ React53.forwardRef(function DialogViewport2(componentProps, forwardedRef) { |
| 9162 |
const { |
| 9163 |
className, |
| 9164 |
render: render4, |
| 9165 |
children, |
| 9166 |
style, |
| 9167 |
...elementProps |
| 9168 |
} = componentProps; |
| 9169 |
const keepMounted = useDialogPortalContext(); |
| 9170 |
const { |
| 9171 |
store |
| 9172 |
} = useDialogRootContext(); |
| 9173 |
const open = store.useState("open"); |
| 9174 |
const nested = store.useState("nested"); |
| 9175 |
const transitionStatus = store.useState("transitionStatus"); |
| 9176 |
const nestedOpenDialogCount = store.useState("nestedOpenDialogCount"); |
| 9177 |
const mounted = store.useState("mounted"); |
| 9178 |
const nestedDialogOpen = nestedOpenDialogCount > 0; |
| 9179 |
const state = { |
| 9180 |
open, |
| 9181 |
nested, |
| 9182 |
transitionStatus, |
| 9183 |
nestedDialogOpen |
| 9184 |
}; |
| 9185 |
const shouldRender = keepMounted || mounted; |
| 9186 |
return useRenderElement("div", componentProps, { |
| 9187 |
enabled: shouldRender, |
| 9188 |
state, |
| 9189 |
ref: [forwardedRef, store.useStateSetter("viewportElement")], |
| 9190 |
stateAttributesMapping: stateAttributesMapping3, |
| 9191 |
props: [{ |
| 9192 |
role: "presentation", |
| 9193 |
hidden: !mounted, |
| 9194 |
style: { |
| 9195 |
pointerEvents: !open ? "none" : void 0 |
| 9196 |
}, |
| 9197 |
children |
| 9198 |
}, elementProps] |
| 9199 |
}); |
| 9200 |
}); |
| 9201 |
if (true) DialogViewport.displayName = "DialogViewport"; |
| 9202 |
|
| 9203 |
// node_modules/@base-ui/react/esm/dialog/store/DialogHandle.js |
| 9204 |
var DialogHandle = class { |
| 9205 |
/** |
| 9206 |
* Internal store holding the dialog state. |
| 9207 |
* @internal |
| 9208 |
*/ |
| 9209 |
constructor(store) { |
| 9210 |
this.store = store ?? new DialogStore(); |
| 9211 |
} |
| 9212 |
/** |
| 9213 |
* Opens the dialog and associates it with the trigger with the given id. |
| 9214 |
* The trigger, if provided, must be a Dialog.Trigger component with this handle passed as a prop. |
| 9215 |
* |
| 9216 |
* This method should only be called in an event handler or an effect (not during rendering). |
| 9217 |
* |
| 9218 |
* @param triggerId ID of the trigger to associate with the dialog. If null, the dialog will open without a trigger association. |
| 9219 |
*/ |
| 9220 |
open(triggerId) { |
| 9221 |
const triggerElement = triggerId ? this.store.context.triggerElements.getById(triggerId) : void 0; |
| 9222 |
if (true) { |
| 9223 |
if (triggerId && !triggerElement) { |
| 9224 |
console.warn(`Base UI: DialogHandle.open: No trigger found with id "${triggerId}". The dialog will open, but the trigger will not be associated with the dialog.`); |
| 9225 |
} |
| 9226 |
} |
| 9227 |
this.store.setOpen(true, createChangeEventDetails(reason_parts_exports.imperativeAction, void 0, triggerElement)); |
| 9228 |
} |
| 9229 |
/** |
| 9230 |
* Opens the dialog and sets the payload. |
| 9231 |
* Does not associate the dialog with any trigger. |
| 9232 |
* |
| 9233 |
* @param payload Payload to set when opening the dialog. |
| 9234 |
*/ |
| 9235 |
openWithPayload(payload) { |
| 9236 |
this.store.set("payload", payload); |
| 9237 |
this.store.setOpen(true, createChangeEventDetails(reason_parts_exports.imperativeAction, void 0, void 0)); |
| 9238 |
} |
| 9239 |
/** |
| 9240 |
* Closes the dialog. |
| 9241 |
*/ |
| 9242 |
close() { |
| 9243 |
this.store.setOpen(false, createChangeEventDetails(reason_parts_exports.imperativeAction, void 0, void 0)); |
| 9244 |
} |
| 9245 |
/** |
| 9246 |
* Indicates whether the dialog is currently open. |
| 9247 |
*/ |
| 9248 |
get isOpen() { |
| 9249 |
return this.store.state.open; |
| 9250 |
} |
| 9251 |
}; |
| 9252 |
function createDialogHandle() { |
| 9253 |
return new DialogHandle(); |
| 9254 |
} |
| 9255 |
|
| 9256 |
// node_modules/@base-ui/react/esm/alert-dialog/handle.js |
| 9257 |
function createAlertDialogHandle() { |
| 9258 |
return new DialogHandle(new DialogStore({ |
| 9259 |
modal: true, |
| 9260 |
disablePointerDismissal: true, |
| 9261 |
role: "alertdialog" |
| 9262 |
})); |
| 9263 |
} |
| 9264 |
|
| 9265 |
// node_modules/@base-ui/react/esm/utils/useAnchorPositioning.js |
| 9266 |
var React54 = __toESM(require_react(), 1); |
| 9267 |
|
| 9268 |
// node_modules/@base-ui/react/esm/floating-ui-react/middleware/arrow.js |
| 9269 |
var baseArrow = (options) => ({ |
| 9270 |
name: "arrow", |
| 9271 |
options, |
| 9272 |
async fn(state) { |
| 9273 |
const { |
| 9274 |
x: x2, |
| 9275 |
y: y2, |
| 9276 |
placement, |
| 9277 |
rects, |
| 9278 |
platform: platform3, |
| 9279 |
elements, |
| 9280 |
middlewareData |
| 9281 |
} = state; |
| 9282 |
const { |
| 9283 |
element, |
| 9284 |
padding = 0, |
| 9285 |
offsetParent = "real" |
| 9286 |
} = evaluate(options, state) || {}; |
| 9287 |
if (element == null) { |
| 9288 |
return {}; |
| 9289 |
} |
| 9290 |
const paddingObject = getPaddingObject(padding); |
| 9291 |
const coords = { |
| 9292 |
x: x2, |
| 9293 |
y: y2 |
| 9294 |
}; |
| 9295 |
const axis = getAlignmentAxis(placement); |
| 9296 |
const length = getAxisLength(axis); |
| 9297 |
const arrowDimensions = await platform3.getDimensions(element); |
| 9298 |
const isYAxis = axis === "y"; |
| 9299 |
const minProp = isYAxis ? "top" : "left"; |
| 9300 |
const maxProp = isYAxis ? "bottom" : "right"; |
| 9301 |
const clientProp = isYAxis ? "clientHeight" : "clientWidth"; |
| 9302 |
const endDiff = rects.reference[length] + rects.reference[axis] - coords[axis] - rects.floating[length]; |
| 9303 |
const startDiff = coords[axis] - rects.reference[axis]; |
| 9304 |
const arrowOffsetParent = offsetParent === "real" ? await platform3.getOffsetParent?.(element) : elements.floating; |
| 9305 |
let clientSize = elements.floating[clientProp] || rects.floating[length]; |
| 9306 |
if (!clientSize || !await platform3.isElement?.(arrowOffsetParent)) { |
| 9307 |
clientSize = elements.floating[clientProp] || rects.floating[length]; |
| 9308 |
} |
| 9309 |
const centerToReference = endDiff / 2 - startDiff / 2; |
| 9310 |
const largestPossiblePadding = clientSize / 2 - arrowDimensions[length] / 2 - 1; |
| 9311 |
const minPadding = Math.min(paddingObject[minProp], largestPossiblePadding); |
| 9312 |
const maxPadding = Math.min(paddingObject[maxProp], largestPossiblePadding); |
| 9313 |
const min2 = minPadding; |
| 9314 |
const max2 = clientSize - arrowDimensions[length] - maxPadding; |
| 9315 |
const center = clientSize / 2 - arrowDimensions[length] / 2 + centerToReference; |
| 9316 |
const offset4 = clamp(min2, center, max2); |
| 9317 |
const shouldAddOffset = !middlewareData.arrow && getAlignment(placement) != null && center !== offset4 && rects.reference[length] / 2 - (center < min2 ? minPadding : maxPadding) - arrowDimensions[length] / 2 < 0; |
| 9318 |
const alignmentOffset = shouldAddOffset ? center < min2 ? center - min2 : center - max2 : 0; |
| 9319 |
return { |
| 9320 |
[axis]: coords[axis] + alignmentOffset, |
| 9321 |
data: { |
| 9322 |
[axis]: offset4, |
| 9323 |
centerOffset: center - offset4 - alignmentOffset, |
| 9324 |
...shouldAddOffset && { |
| 9325 |
alignmentOffset |
| 9326 |
} |
| 9327 |
}, |
| 9328 |
reset: shouldAddOffset |
| 9329 |
}; |
| 9330 |
} |
| 9331 |
}); |
| 9332 |
var arrow4 = (options, deps) => ({ |
| 9333 |
...baseArrow(options), |
| 9334 |
options: [options, deps] |
| 9335 |
}); |
| 9336 |
|
| 9337 |
// node_modules/@base-ui/react/esm/utils/hideMiddleware.js |
| 9338 |
var hide4 = { |
| 9339 |
name: "hide", |
| 9340 |
async fn(state) { |
| 9341 |
const { |
| 9342 |
width, |
| 9343 |
height, |
| 9344 |
x: x2, |
| 9345 |
y: y2 |
| 9346 |
} = state.rects.reference; |
| 9347 |
const anchorHidden = width === 0 && height === 0 && x2 === 0 && y2 === 0; |
| 9348 |
const nativeHideResult = await hide3().fn(state); |
| 9349 |
return { |
| 9350 |
data: { |
| 9351 |
referenceHidden: nativeHideResult.data?.referenceHidden || anchorHidden |
| 9352 |
} |
| 9353 |
}; |
| 9354 |
} |
| 9355 |
}; |
| 9356 |
|
| 9357 |
// node_modules/@base-ui/react/esm/utils/adaptiveOriginMiddleware.js |
| 9358 |
var DEFAULT_SIDES = { |
| 9359 |
sideX: "left", |
| 9360 |
sideY: "top" |
| 9361 |
}; |
| 9362 |
var adaptiveOrigin = { |
| 9363 |
name: "adaptiveOrigin", |
| 9364 |
async fn(state) { |
| 9365 |
const { |
| 9366 |
x: rawX, |
| 9367 |
y: rawY, |
| 9368 |
rects: { |
| 9369 |
floating: floatRect |
| 9370 |
}, |
| 9371 |
elements: { |
| 9372 |
floating |
| 9373 |
}, |
| 9374 |
platform: platform3, |
| 9375 |
strategy, |
| 9376 |
placement |
| 9377 |
} = state; |
| 9378 |
const win = getWindow(floating); |
| 9379 |
const styles = win.getComputedStyle(floating); |
| 9380 |
const hasTransition = styles.transitionDuration !== "0s" && styles.transitionDuration !== ""; |
| 9381 |
if (!hasTransition) { |
| 9382 |
return { |
| 9383 |
x: rawX, |
| 9384 |
y: rawY, |
| 9385 |
data: DEFAULT_SIDES |
| 9386 |
}; |
| 9387 |
} |
| 9388 |
const offsetParent = await platform3.getOffsetParent?.(floating); |
| 9389 |
let offsetDimensions = { |
| 9390 |
width: 0, |
| 9391 |
height: 0 |
| 9392 |
}; |
| 9393 |
if (strategy === "fixed" && win?.visualViewport) { |
| 9394 |
offsetDimensions = { |
| 9395 |
width: win.visualViewport.width, |
| 9396 |
height: win.visualViewport.height |
| 9397 |
}; |
| 9398 |
} else if (offsetParent === win) { |
| 9399 |
const doc = ownerDocument(floating); |
| 9400 |
offsetDimensions = { |
| 9401 |
width: doc.documentElement.clientWidth, |
| 9402 |
height: doc.documentElement.clientHeight |
| 9403 |
}; |
| 9404 |
} else if (await platform3.isElement?.(offsetParent)) { |
| 9405 |
offsetDimensions = await platform3.getDimensions(offsetParent); |
| 9406 |
} |
| 9407 |
const currentSide = getSide(placement); |
| 9408 |
let x2 = rawX; |
| 9409 |
let y2 = rawY; |
| 9410 |
if (currentSide === "left") { |
| 9411 |
x2 = offsetDimensions.width - (rawX + floatRect.width); |
| 9412 |
} |
| 9413 |
if (currentSide === "top") { |
| 9414 |
y2 = offsetDimensions.height - (rawY + floatRect.height); |
| 9415 |
} |
| 9416 |
const sideX = currentSide === "left" ? "right" : DEFAULT_SIDES.sideX; |
| 9417 |
const sideY = currentSide === "top" ? "bottom" : DEFAULT_SIDES.sideY; |
| 9418 |
return { |
| 9419 |
x: x2, |
| 9420 |
y: y2, |
| 9421 |
data: { |
| 9422 |
sideX, |
| 9423 |
sideY |
| 9424 |
} |
| 9425 |
}; |
| 9426 |
} |
| 9427 |
}; |
| 9428 |
|
| 9429 |
// node_modules/@base-ui/react/esm/utils/useAnchorPositioning.js |
| 9430 |
function getLogicalSide(sideParam, renderedSide, isRtl) { |
| 9431 |
const isLogicalSideParam = sideParam === "inline-start" || sideParam === "inline-end"; |
| 9432 |
const logicalRight = isRtl ? "inline-start" : "inline-end"; |
| 9433 |
const logicalLeft = isRtl ? "inline-end" : "inline-start"; |
| 9434 |
return { |
| 9435 |
top: "top", |
| 9436 |
right: isLogicalSideParam ? logicalRight : "right", |
| 9437 |
bottom: "bottom", |
| 9438 |
left: isLogicalSideParam ? logicalLeft : "left" |
| 9439 |
}[renderedSide]; |
| 9440 |
} |
| 9441 |
function getOffsetData(state, sideParam, isRtl) { |
| 9442 |
const { |
| 9443 |
rects, |
| 9444 |
placement |
| 9445 |
} = state; |
| 9446 |
const data = { |
| 9447 |
side: getLogicalSide(sideParam, getSide(placement), isRtl), |
| 9448 |
align: getAlignment(placement) || "center", |
| 9449 |
anchor: { |
| 9450 |
width: rects.reference.width, |
| 9451 |
height: rects.reference.height |
| 9452 |
}, |
| 9453 |
positioner: { |
| 9454 |
width: rects.floating.width, |
| 9455 |
height: rects.floating.height |
| 9456 |
} |
| 9457 |
}; |
| 9458 |
return data; |
| 9459 |
} |
| 9460 |
function useAnchorPositioning(params) { |
| 9461 |
const { |
| 9462 |
// Public parameters |
| 9463 |
anchor, |
| 9464 |
positionMethod = "absolute", |
| 9465 |
side: sideParam = "bottom", |
| 9466 |
sideOffset = 0, |
| 9467 |
align = "center", |
| 9468 |
alignOffset = 0, |
| 9469 |
collisionBoundary, |
| 9470 |
collisionPadding: collisionPaddingParam = 5, |
| 9471 |
sticky = false, |
| 9472 |
arrowPadding = 5, |
| 9473 |
disableAnchorTracking = false, |
| 9474 |
// Private parameters |
| 9475 |
keepMounted = false, |
| 9476 |
floatingRootContext, |
| 9477 |
mounted, |
| 9478 |
collisionAvoidance, |
| 9479 |
shiftCrossAxis = false, |
| 9480 |
nodeId, |
| 9481 |
adaptiveOrigin: adaptiveOrigin2, |
| 9482 |
lazyFlip = false, |
| 9483 |
externalTree |
| 9484 |
} = params; |
| 9485 |
const [mountSide, setMountSide] = React54.useState(null); |
| 9486 |
if (!mounted && mountSide !== null) { |
| 9487 |
setMountSide(null); |
| 9488 |
} |
| 9489 |
const collisionAvoidanceSide = collisionAvoidance.side || "flip"; |
| 9490 |
const collisionAvoidanceAlign = collisionAvoidance.align || "flip"; |
| 9491 |
const collisionAvoidanceFallbackAxisSide = collisionAvoidance.fallbackAxisSide || "end"; |
| 9492 |
const anchorFn = typeof anchor === "function" ? anchor : void 0; |
| 9493 |
const anchorFnCallback = useStableCallback(anchorFn); |
| 9494 |
const anchorDep = anchorFn ? anchorFnCallback : anchor; |
| 9495 |
const anchorValueRef = useValueAsRef(anchor); |
| 9496 |
const mountedRef = useValueAsRef(mounted); |
| 9497 |
const direction = useDirection(); |
| 9498 |
const isRtl = direction === "rtl"; |
| 9499 |
const side = mountSide || { |
| 9500 |
top: "top", |
| 9501 |
right: "right", |
| 9502 |
bottom: "bottom", |
| 9503 |
left: "left", |
| 9504 |
"inline-end": isRtl ? "left" : "right", |
| 9505 |
"inline-start": isRtl ? "right" : "left" |
| 9506 |
}[sideParam]; |
| 9507 |
const placement = align === "center" ? side : `${side}-${align}`; |
| 9508 |
let collisionPadding = collisionPaddingParam; |
| 9509 |
const bias = 1; |
| 9510 |
const biasTop = sideParam === "bottom" ? bias : 0; |
| 9511 |
const biasBottom = sideParam === "top" ? bias : 0; |
| 9512 |
const biasLeft = sideParam === "right" ? bias : 0; |
| 9513 |
const biasRight = sideParam === "left" ? bias : 0; |
| 9514 |
if (typeof collisionPadding === "number") { |
| 9515 |
collisionPadding = { |
| 9516 |
top: collisionPadding + biasTop, |
| 9517 |
right: collisionPadding + biasRight, |
| 9518 |
bottom: collisionPadding + biasBottom, |
| 9519 |
left: collisionPadding + biasLeft |
| 9520 |
}; |
| 9521 |
} else if (collisionPadding) { |
| 9522 |
collisionPadding = { |
| 9523 |
top: (collisionPadding.top || 0) + biasTop, |
| 9524 |
right: (collisionPadding.right || 0) + biasRight, |
| 9525 |
bottom: (collisionPadding.bottom || 0) + biasBottom, |
| 9526 |
left: (collisionPadding.left || 0) + biasLeft |
| 9527 |
}; |
| 9528 |
} |
| 9529 |
const commonCollisionProps = { |
| 9530 |
boundary: collisionBoundary === "clipping-ancestors" ? "clippingAncestors" : collisionBoundary, |
| 9531 |
padding: collisionPadding |
| 9532 |
}; |
| 9533 |
const arrowRef = React54.useRef(null); |
| 9534 |
const sideOffsetRef = useValueAsRef(sideOffset); |
| 9535 |
const alignOffsetRef = useValueAsRef(alignOffset); |
| 9536 |
const sideOffsetDep = typeof sideOffset !== "function" ? sideOffset : 0; |
| 9537 |
const alignOffsetDep = typeof alignOffset !== "function" ? alignOffset : 0; |
| 9538 |
const middleware = [offset3((state) => { |
| 9539 |
const data = getOffsetData(state, sideParam, isRtl); |
| 9540 |
const sideAxis = typeof sideOffsetRef.current === "function" ? sideOffsetRef.current(data) : sideOffsetRef.current; |
| 9541 |
const alignAxis = typeof alignOffsetRef.current === "function" ? alignOffsetRef.current(data) : alignOffsetRef.current; |
| 9542 |
return { |
| 9543 |
mainAxis: sideAxis, |
| 9544 |
crossAxis: alignAxis, |
| 9545 |
alignmentAxis: alignAxis |
| 9546 |
}; |
| 9547 |
}, [sideOffsetDep, alignOffsetDep, isRtl, sideParam])]; |
| 9548 |
const shiftDisabled = collisionAvoidanceAlign === "none" && collisionAvoidanceSide !== "shift"; |
| 9549 |
const crossAxisShiftEnabled = !shiftDisabled && (sticky || shiftCrossAxis || collisionAvoidanceSide === "shift"); |
| 9550 |
const flipMiddleware = collisionAvoidanceSide === "none" ? null : flip3({ |
| 9551 |
...commonCollisionProps, |
| 9552 |
// Ensure the popup flips if it's been limited by its --available-height and it resizes. |
| 9553 |
// Since the size() padding is smaller than the flip() padding, flip() will take precedence. |
| 9554 |
padding: { |
| 9555 |
top: collisionPadding.top + bias, |
| 9556 |
right: collisionPadding.right + bias, |
| 9557 |
bottom: collisionPadding.bottom + bias, |
| 9558 |
left: collisionPadding.left + bias |
| 9559 |
}, |
| 9560 |
mainAxis: !shiftCrossAxis && collisionAvoidanceSide === "flip", |
| 9561 |
crossAxis: collisionAvoidanceAlign === "flip" ? "alignment" : false, |
| 9562 |
fallbackAxisSideDirection: collisionAvoidanceFallbackAxisSide |
| 9563 |
}); |
| 9564 |
const shiftMiddleware = shiftDisabled ? null : shift3((data) => { |
| 9565 |
const html = ownerDocument(data.elements.floating).documentElement; |
| 9566 |
return { |
| 9567 |
...commonCollisionProps, |
| 9568 |
// Use the Layout Viewport to avoid shifting around when pinch-zooming |
| 9569 |
// for context menus. |
| 9570 |
rootBoundary: shiftCrossAxis ? { |
| 9571 |
x: 0, |
| 9572 |
y: 0, |
| 9573 |
width: html.clientWidth, |
| 9574 |
height: html.clientHeight |
| 9575 |
} : void 0, |
| 9576 |
mainAxis: collisionAvoidanceAlign !== "none", |
| 9577 |
crossAxis: crossAxisShiftEnabled, |
| 9578 |
limiter: sticky || shiftCrossAxis ? void 0 : limitShift3((limitData) => { |
| 9579 |
if (!arrowRef.current) { |
| 9580 |
return {}; |
| 9581 |
} |
| 9582 |
const { |
| 9583 |
width, |
| 9584 |
height |
| 9585 |
} = arrowRef.current.getBoundingClientRect(); |
| 9586 |
const sideAxis = getSideAxis(getSide(limitData.placement)); |
| 9587 |
const arrowSize = sideAxis === "y" ? width : height; |
| 9588 |
const offsetAmount = sideAxis === "y" ? collisionPadding.left + collisionPadding.right : collisionPadding.top + collisionPadding.bottom; |
| 9589 |
return { |
| 9590 |
offset: arrowSize / 2 + offsetAmount / 2 |
| 9591 |
}; |
| 9592 |
}) |
| 9593 |
}; |
| 9594 |
}, [commonCollisionProps, sticky, shiftCrossAxis, collisionPadding, collisionAvoidanceAlign]); |
| 9595 |
if (collisionAvoidanceSide === "shift" || collisionAvoidanceAlign === "shift" || align === "center") { |
| 9596 |
middleware.push(shiftMiddleware, flipMiddleware); |
| 9597 |
} else { |
| 9598 |
middleware.push(flipMiddleware, shiftMiddleware); |
| 9599 |
} |
| 9600 |
middleware.push(size3({ |
| 9601 |
...commonCollisionProps, |
| 9602 |
apply({ |
| 9603 |
elements: { |
| 9604 |
floating |
| 9605 |
}, |
| 9606 |
availableWidth, |
| 9607 |
availableHeight, |
| 9608 |
rects |
| 9609 |
}) { |
| 9610 |
if (!mountedRef.current) { |
| 9611 |
return; |
| 9612 |
} |
| 9613 |
const floatingStyle = floating.style; |
| 9614 |
floatingStyle.setProperty("--available-width", `${availableWidth}px`); |
| 9615 |
floatingStyle.setProperty("--available-height", `${availableHeight}px`); |
| 9616 |
const dpr = getWindow(floating).devicePixelRatio || 1; |
| 9617 |
const { |
| 9618 |
x: x3, |
| 9619 |
y: y3, |
| 9620 |
width, |
| 9621 |
height |
| 9622 |
} = rects.reference; |
| 9623 |
const anchorWidth = (Math.round((x3 + width) * dpr) - Math.round(x3 * dpr)) / dpr; |
| 9624 |
const anchorHeight = (Math.round((y3 + height) * dpr) - Math.round(y3 * dpr)) / dpr; |
| 9625 |
floatingStyle.setProperty("--anchor-width", `${anchorWidth}px`); |
| 9626 |
floatingStyle.setProperty("--anchor-height", `${anchorHeight}px`); |
| 9627 |
} |
| 9628 |
}), arrow4(() => ({ |
| 9629 |
// `transform-origin` calculations rely on an element existing. If the arrow hasn't been set, |
| 9630 |
// we'll create a fake element. |
| 9631 |
element: arrowRef.current || ownerDocument(arrowRef.current).createElement("div"), |
| 9632 |
padding: arrowPadding, |
| 9633 |
offsetParent: "floating" |
| 9634 |
}), [arrowPadding]), { |
| 9635 |
name: "transformOrigin", |
| 9636 |
fn(state) { |
| 9637 |
const { |
| 9638 |
elements: elements2, |
| 9639 |
middlewareData: middlewareData2, |
| 9640 |
placement: renderedPlacement2, |
| 9641 |
rects, |
| 9642 |
y: y3 |
| 9643 |
} = state; |
| 9644 |
const currentRenderedSide = getSide(renderedPlacement2); |
| 9645 |
const currentRenderedAxis = getSideAxis(currentRenderedSide); |
| 9646 |
const arrowEl = arrowRef.current; |
| 9647 |
const arrowX = middlewareData2.arrow?.x || 0; |
| 9648 |
const arrowY = middlewareData2.arrow?.y || 0; |
| 9649 |
const arrowWidth = arrowEl?.clientWidth || 0; |
| 9650 |
const arrowHeight = arrowEl?.clientHeight || 0; |
| 9651 |
const transformX = arrowX + arrowWidth / 2; |
| 9652 |
const transformY = arrowY + arrowHeight / 2; |
| 9653 |
const shiftY = Math.abs(middlewareData2.shift?.y || 0); |
| 9654 |
const halfAnchorHeight = rects.reference.height / 2; |
| 9655 |
const sideOffsetValue = typeof sideOffset === "function" ? sideOffset(getOffsetData(state, sideParam, isRtl)) : sideOffset; |
| 9656 |
const isOverlappingAnchor = shiftY > sideOffsetValue; |
| 9657 |
const adjacentTransformOrigin = { |
| 9658 |
top: `${transformX}px calc(100% + ${sideOffsetValue}px)`, |
| 9659 |
bottom: `${transformX}px ${-sideOffsetValue}px`, |
| 9660 |
left: `calc(100% + ${sideOffsetValue}px) ${transformY}px`, |
| 9661 |
right: `${-sideOffsetValue}px ${transformY}px` |
| 9662 |
}[currentRenderedSide]; |
| 9663 |
const overlapTransformOrigin = `${transformX}px ${rects.reference.y + halfAnchorHeight - y3}px`; |
| 9664 |
elements2.floating.style.setProperty("--transform-origin", crossAxisShiftEnabled && currentRenderedAxis === "y" && isOverlappingAnchor ? overlapTransformOrigin : adjacentTransformOrigin); |
| 9665 |
return {}; |
| 9666 |
} |
| 9667 |
}, hide4, adaptiveOrigin2); |
| 9668 |
useIsoLayoutEffect(() => { |
| 9669 |
if (!mounted && floatingRootContext) { |
| 9670 |
floatingRootContext.update({ |
| 9671 |
referenceElement: null, |
| 9672 |
floatingElement: null, |
| 9673 |
domReferenceElement: null, |
| 9674 |
positionReference: null |
| 9675 |
}); |
| 9676 |
} |
| 9677 |
}, [mounted, floatingRootContext]); |
| 9678 |
const autoUpdateOptions = React54.useMemo(() => ({ |
| 9679 |
elementResize: !disableAnchorTracking && typeof ResizeObserver !== "undefined", |
| 9680 |
layoutShift: !disableAnchorTracking && typeof IntersectionObserver !== "undefined" |
| 9681 |
}), [disableAnchorTracking]); |
| 9682 |
const { |
| 9683 |
refs, |
| 9684 |
elements, |
| 9685 |
x: x2, |
| 9686 |
y: y2, |
| 9687 |
middlewareData, |
| 9688 |
update: update2, |
| 9689 |
placement: renderedPlacement, |
| 9690 |
context, |
| 9691 |
isPositioned, |
| 9692 |
floatingStyles: originalFloatingStyles |
| 9693 |
} = useFloating2({ |
| 9694 |
rootContext: floatingRootContext, |
| 9695 |
open: keepMounted ? mounted : void 0, |
| 9696 |
placement, |
| 9697 |
middleware, |
| 9698 |
strategy: positionMethod, |
| 9699 |
whileElementsMounted: keepMounted ? void 0 : (...args) => autoUpdate(...args, autoUpdateOptions), |
| 9700 |
nodeId, |
| 9701 |
externalTree |
| 9702 |
}); |
| 9703 |
const { |
| 9704 |
sideX, |
| 9705 |
sideY |
| 9706 |
} = middlewareData.adaptiveOrigin || DEFAULT_SIDES; |
| 9707 |
const resolvedPosition = isPositioned ? positionMethod : "fixed"; |
| 9708 |
const floatingStyles = React54.useMemo(() => { |
| 9709 |
const base = adaptiveOrigin2 ? { |
| 9710 |
position: resolvedPosition, |
| 9711 |
[sideX]: x2, |
| 9712 |
[sideY]: y2 |
| 9713 |
} : { |
| 9714 |
position: resolvedPosition, |
| 9715 |
...originalFloatingStyles |
| 9716 |
}; |
| 9717 |
if (!isPositioned) { |
| 9718 |
base.opacity = 0; |
| 9719 |
} |
| 9720 |
return base; |
| 9721 |
}, [adaptiveOrigin2, resolvedPosition, sideX, x2, sideY, y2, originalFloatingStyles, isPositioned]); |
| 9722 |
const registeredPositionReferenceRef = React54.useRef(null); |
| 9723 |
useIsoLayoutEffect(() => { |
| 9724 |
if (!mounted) { |
| 9725 |
return; |
| 9726 |
} |
| 9727 |
const anchorValue = anchorValueRef.current; |
| 9728 |
const resolvedAnchor = typeof anchorValue === "function" ? anchorValue() : anchorValue; |
| 9729 |
const unwrappedElement = (isRef(resolvedAnchor) ? resolvedAnchor.current : resolvedAnchor) || null; |
| 9730 |
const finalAnchor = unwrappedElement || null; |
| 9731 |
if (finalAnchor !== registeredPositionReferenceRef.current) { |
| 9732 |
refs.setPositionReference(finalAnchor); |
| 9733 |
registeredPositionReferenceRef.current = finalAnchor; |
| 9734 |
} |
| 9735 |
}, [mounted, refs, anchorDep, anchorValueRef]); |
| 9736 |
React54.useEffect(() => { |
| 9737 |
if (!mounted) { |
| 9738 |
return; |
| 9739 |
} |
| 9740 |
const anchorValue = anchorValueRef.current; |
| 9741 |
if (typeof anchorValue === "function") { |
| 9742 |
return; |
| 9743 |
} |
| 9744 |
if (isRef(anchorValue) && anchorValue.current !== registeredPositionReferenceRef.current) { |
| 9745 |
refs.setPositionReference(anchorValue.current); |
| 9746 |
registeredPositionReferenceRef.current = anchorValue.current; |
| 9747 |
} |
| 9748 |
}, [mounted, refs, anchorDep, anchorValueRef]); |
| 9749 |
React54.useEffect(() => { |
| 9750 |
if (keepMounted && mounted && elements.domReference && elements.floating) { |
| 9751 |
return autoUpdate(elements.domReference, elements.floating, update2, autoUpdateOptions); |
| 9752 |
} |
| 9753 |
return void 0; |
| 9754 |
}, [keepMounted, mounted, elements, update2, autoUpdateOptions]); |
| 9755 |
const renderedSide = getSide(renderedPlacement); |
| 9756 |
const logicalRenderedSide = getLogicalSide(sideParam, renderedSide, isRtl); |
| 9757 |
const renderedAlign = getAlignment(renderedPlacement) || "center"; |
| 9758 |
const anchorHidden = Boolean(middlewareData.hide?.referenceHidden); |
| 9759 |
useIsoLayoutEffect(() => { |
| 9760 |
if (lazyFlip && mounted && isPositioned) { |
| 9761 |
setMountSide(renderedSide); |
| 9762 |
} |
| 9763 |
}, [lazyFlip, mounted, isPositioned, renderedSide]); |
| 9764 |
const arrowStyles = React54.useMemo(() => ({ |
| 9765 |
position: "absolute", |
| 9766 |
top: middlewareData.arrow?.y, |
| 9767 |
left: middlewareData.arrow?.x |
| 9768 |
}), [middlewareData.arrow]); |
| 9769 |
const arrowUncentered = middlewareData.arrow?.centerOffset !== 0; |
| 9770 |
return React54.useMemo(() => ({ |
| 9771 |
positionerStyles: floatingStyles, |
| 9772 |
arrowStyles, |
| 9773 |
arrowRef, |
| 9774 |
arrowUncentered, |
| 9775 |
side: logicalRenderedSide, |
| 9776 |
align: renderedAlign, |
| 9777 |
physicalSide: renderedSide, |
| 9778 |
anchorHidden, |
| 9779 |
refs, |
| 9780 |
context, |
| 9781 |
isPositioned, |
| 9782 |
update: update2 |
| 9783 |
}), [floatingStyles, arrowStyles, arrowRef, arrowUncentered, logicalRenderedSide, renderedAlign, renderedSide, anchorHidden, refs, context, isPositioned, update2]); |
| 9784 |
} |
| 9785 |
function isRef(param) { |
| 9786 |
return param != null && "current" in param; |
| 9787 |
} |
| 9788 |
|
| 9789 |
// node_modules/@base-ui/react/esm/utils/getDisabledMountTransitionStyles.js |
| 9790 |
function getDisabledMountTransitionStyles(transitionStatus) { |
| 9791 |
return transitionStatus === "starting" ? DISABLED_TRANSITIONS_STYLE : EMPTY_OBJECT; |
| 9792 |
} |
| 9793 |
|
| 9794 |
// node_modules/@base-ui/react/esm/utils/usePositioner.js |
| 9795 |
function usePositioner(componentProps, state, { |
| 9796 |
styles, |
| 9797 |
transitionStatus, |
| 9798 |
props, |
| 9799 |
refs, |
| 9800 |
hidden, |
| 9801 |
inert = false |
| 9802 |
}) { |
| 9803 |
const style = { |
| 9804 |
...styles |
| 9805 |
}; |
| 9806 |
if (inert) { |
| 9807 |
style.pointerEvents = "none"; |
| 9808 |
} |
| 9809 |
return useRenderElement("div", componentProps, { |
| 9810 |
state, |
| 9811 |
ref: refs, |
| 9812 |
props: [{ |
| 9813 |
role: "presentation", |
| 9814 |
hidden, |
| 9815 |
style |
| 9816 |
}, getDisabledMountTransitionStyles(transitionStatus), props], |
| 9817 |
stateAttributesMapping: popupStateMapping |
| 9818 |
}); |
| 9819 |
} |
| 9820 |
|
| 9821 |
// node_modules/@base-ui/react/esm/button/Button.js |
| 9822 |
var React55 = __toESM(require_react(), 1); |
| 9823 |
var Button = /* @__PURE__ */ React55.forwardRef(function Button2(componentProps, forwardedRef) { |
| 9824 |
const { |
| 9825 |
render: render4, |
| 9826 |
className, |
| 9827 |
disabled: disabled2 = false, |
| 9828 |
focusableWhenDisabled = false, |
| 9829 |
nativeButton = true, |
| 9830 |
style, |
| 9831 |
...elementProps |
| 9832 |
} = componentProps; |
| 9833 |
const { |
| 9834 |
getButtonProps, |
| 9835 |
buttonRef |
| 9836 |
} = useButton({ |
| 9837 |
disabled: disabled2, |
| 9838 |
focusableWhenDisabled, |
| 9839 |
native: nativeButton |
| 9840 |
}); |
| 9841 |
const state = { |
| 9842 |
disabled: disabled2 |
| 9843 |
}; |
| 9844 |
return useRenderElement("button", componentProps, { |
| 9845 |
state, |
| 9846 |
ref: [forwardedRef, buttonRef], |
| 9847 |
props: [elementProps, getButtonProps] |
| 9848 |
}); |
| 9849 |
}); |
| 9850 |
if (true) Button.displayName = "Button"; |
| 9851 |
|
| 9852 |
// node_modules/@base-ui/react/esm/utils/usePopupViewport.js |
| 9853 |
var React58 = __toESM(require_react(), 1); |
| 9854 |
var ReactDOM5 = __toESM(require_react_dom(), 1); |
| 9855 |
|
| 9856 |
// node_modules/@base-ui/utils/esm/usePreviousValue.js |
| 9857 |
var React56 = __toESM(require_react(), 1); |
| 9858 |
function usePreviousValue(value) { |
| 9859 |
const [state, setState] = React56.useState({ |
| 9860 |
current: value, |
| 9861 |
previous: null |
| 9862 |
}); |
| 9863 |
if (value !== state.current) { |
| 9864 |
setState({ |
| 9865 |
current: value, |
| 9866 |
previous: state.current |
| 9867 |
}); |
| 9868 |
} |
| 9869 |
return state.previous; |
| 9870 |
} |
| 9871 |
|
| 9872 |
// node_modules/@base-ui/react/esm/utils/usePopupAutoResize.js |
| 9873 |
var React57 = __toESM(require_react(), 1); |
| 9874 |
|
| 9875 |
// node_modules/@base-ui/react/esm/utils/getCssDimensions.js |
| 9876 |
function getCssDimensions2(element) { |
| 9877 |
const css = getComputedStyle2(element); |
| 9878 |
let width = parseFloat(css.width) || 0; |
| 9879 |
let height = parseFloat(css.height) || 0; |
| 9880 |
const hasOffset = isHTMLElement(element); |
| 9881 |
const offsetWidth = hasOffset ? element.offsetWidth : width; |
| 9882 |
const offsetHeight = hasOffset ? element.offsetHeight : height; |
| 9883 |
const shouldFallback = round(width) !== offsetWidth || round(height) !== offsetHeight; |
| 9884 |
if (shouldFallback) { |
| 9885 |
width = offsetWidth; |
| 9886 |
height = offsetHeight; |
| 9887 |
} |
| 9888 |
return { |
| 9889 |
width, |
| 9890 |
height |
| 9891 |
}; |
| 9892 |
} |
| 9893 |
|
| 9894 |
// node_modules/@base-ui/react/esm/utils/usePopupAutoResize.js |
| 9895 |
var DEFAULT_ENABLED = () => true; |
| 9896 |
function usePopupAutoResize(parameters) { |
| 9897 |
const { |
| 9898 |
popupElement, |
| 9899 |
positionerElement, |
| 9900 |
content, |
| 9901 |
mounted, |
| 9902 |
enabled = DEFAULT_ENABLED, |
| 9903 |
onMeasureLayout: onMeasureLayoutParam, |
| 9904 |
onMeasureLayoutComplete: onMeasureLayoutCompleteParam, |
| 9905 |
side, |
| 9906 |
direction |
| 9907 |
} = parameters; |
| 9908 |
const runOnceAnimationsFinish = useAnimationsFinished(popupElement, true, false); |
| 9909 |
const animationFrame = useAnimationFrame(); |
| 9910 |
const committedDimensionsRef = React57.useRef(null); |
| 9911 |
const liveDimensionsRef = React57.useRef(null); |
| 9912 |
const isInitialRenderRef = React57.useRef(true); |
| 9913 |
const restoreAnchoringStylesRef = React57.useRef(NOOP); |
| 9914 |
const onMeasureLayout = useStableCallback(onMeasureLayoutParam); |
| 9915 |
const onMeasureLayoutComplete = useStableCallback(onMeasureLayoutCompleteParam); |
| 9916 |
const anchoringStyles = React57.useMemo(() => { |
| 9917 |
let isOriginSide = side === "top"; |
| 9918 |
let isPhysicalLeft = side === "left"; |
| 9919 |
if (direction === "rtl") { |
| 9920 |
isOriginSide = isOriginSide || side === "inline-end"; |
| 9921 |
isPhysicalLeft = isPhysicalLeft || side === "inline-end"; |
| 9922 |
} else { |
| 9923 |
isOriginSide = isOriginSide || side === "inline-start"; |
| 9924 |
isPhysicalLeft = isPhysicalLeft || side === "inline-start"; |
| 9925 |
} |
| 9926 |
return isOriginSide ? { |
| 9927 |
position: "absolute", |
| 9928 |
[side === "top" ? "bottom" : "top"]: "0", |
| 9929 |
[isPhysicalLeft ? "right" : "left"]: "0" |
| 9930 |
} : EMPTY_OBJECT; |
| 9931 |
}, [side, direction]); |
| 9932 |
useIsoLayoutEffect(() => { |
| 9933 |
if (!mounted || !enabled() || typeof ResizeObserver !== "function") { |
| 9934 |
restoreAnchoringStylesRef.current = NOOP; |
| 9935 |
isInitialRenderRef.current = true; |
| 9936 |
committedDimensionsRef.current = null; |
| 9937 |
liveDimensionsRef.current = null; |
| 9938 |
return void 0; |
| 9939 |
} |
| 9940 |
if (!popupElement || !positionerElement) { |
| 9941 |
return void 0; |
| 9942 |
} |
| 9943 |
restoreAnchoringStylesRef.current = applyElementStyles(popupElement, anchoringStyles); |
| 9944 |
const observer = new ResizeObserver((entries) => { |
| 9945 |
const entry = entries[0]; |
| 9946 |
if (entry) { |
| 9947 |
liveDimensionsRef.current = { |
| 9948 |
width: Math.ceil(entry.borderBoxSize[0].inlineSize), |
| 9949 |
height: Math.ceil(entry.borderBoxSize[0].blockSize) |
| 9950 |
}; |
| 9951 |
} |
| 9952 |
}); |
| 9953 |
observer.observe(popupElement); |
| 9954 |
setPopupCssSize(popupElement, "auto"); |
| 9955 |
const restorePopupPosition = overrideElementStyle(popupElement, "position", "static"); |
| 9956 |
const restorePopupTransform = overrideElementStyle(popupElement, "transform", "none"); |
| 9957 |
const restorePopupScale = overrideElementStyle(popupElement, "scale", "1"); |
| 9958 |
const restorePositionerAvailableSize = applyElementStyles(positionerElement, { |
| 9959 |
"--available-width": "max-content", |
| 9960 |
"--available-height": "max-content" |
| 9961 |
}); |
| 9962 |
function restoreMeasurementOverrides() { |
| 9963 |
restorePopupPosition(); |
| 9964 |
restorePopupTransform(); |
| 9965 |
restorePositionerAvailableSize(); |
| 9966 |
} |
| 9967 |
function restoreMeasurementOverridesIncludingScale() { |
| 9968 |
restoreMeasurementOverrides(); |
| 9969 |
restorePopupScale(); |
| 9970 |
} |
| 9971 |
onMeasureLayout?.(); |
| 9972 |
if (isInitialRenderRef.current || committedDimensionsRef.current === null) { |
| 9973 |
setPositionerCssSize(positionerElement, "max-content"); |
| 9974 |
const dimensions = getCssDimensions2(popupElement); |
| 9975 |
committedDimensionsRef.current = dimensions; |
| 9976 |
setPositionerCssSize(positionerElement, dimensions); |
| 9977 |
restoreMeasurementOverridesIncludingScale(); |
| 9978 |
onMeasureLayoutComplete?.(null, dimensions); |
| 9979 |
isInitialRenderRef.current = false; |
| 9980 |
return () => { |
| 9981 |
observer.disconnect(); |
| 9982 |
restoreAnchoringStylesRef.current(); |
| 9983 |
restoreAnchoringStylesRef.current = NOOP; |
| 9984 |
}; |
| 9985 |
} |
| 9986 |
setPopupCssSize(popupElement, "auto"); |
| 9987 |
setPositionerCssSize(positionerElement, "max-content"); |
| 9988 |
const previousDimensions = committedDimensionsRef.current ?? liveDimensionsRef.current; |
| 9989 |
const newDimensions = getCssDimensions2(popupElement); |
| 9990 |
committedDimensionsRef.current = newDimensions; |
| 9991 |
if (!previousDimensions) { |
| 9992 |
setPositionerCssSize(positionerElement, newDimensions); |
| 9993 |
restoreMeasurementOverridesIncludingScale(); |
| 9994 |
onMeasureLayoutComplete?.(null, newDimensions); |
| 9995 |
return () => { |
| 9996 |
observer.disconnect(); |
| 9997 |
animationFrame.cancel(); |
| 9998 |
restoreAnchoringStylesRef.current(); |
| 9999 |
restoreAnchoringStylesRef.current = NOOP; |
| 10000 |
}; |
| 10001 |
} |
| 10002 |
setPopupCssSize(popupElement, previousDimensions); |
| 10003 |
restoreMeasurementOverridesIncludingScale(); |
| 10004 |
onMeasureLayoutComplete?.(previousDimensions, newDimensions); |
| 10005 |
setPositionerCssSize(positionerElement, newDimensions); |
| 10006 |
const abortController = new AbortController(); |
| 10007 |
animationFrame.request(() => { |
| 10008 |
setPopupCssSize(popupElement, newDimensions); |
| 10009 |
runOnceAnimationsFinish(() => { |
| 10010 |
popupElement.style.setProperty("--popup-width", "auto"); |
| 10011 |
popupElement.style.setProperty("--popup-height", "auto"); |
| 10012 |
}, abortController.signal); |
| 10013 |
}); |
| 10014 |
return () => { |
| 10015 |
observer.disconnect(); |
| 10016 |
abortController.abort(); |
| 10017 |
animationFrame.cancel(); |
| 10018 |
restoreAnchoringStylesRef.current(); |
| 10019 |
restoreAnchoringStylesRef.current = NOOP; |
| 10020 |
}; |
| 10021 |
}, [content, popupElement, positionerElement, runOnceAnimationsFinish, animationFrame, enabled, mounted, onMeasureLayout, onMeasureLayoutComplete, anchoringStyles]); |
| 10022 |
} |
| 10023 |
function overrideElementStyle(element, property, value) { |
| 10024 |
const originalValue = element.style.getPropertyValue(property); |
| 10025 |
element.style.setProperty(property, value); |
| 10026 |
return () => { |
| 10027 |
element.style.setProperty(property, originalValue); |
| 10028 |
}; |
| 10029 |
} |
| 10030 |
function applyElementStyles(element, styles) { |
| 10031 |
const restorers = []; |
| 10032 |
for (const [key2, value] of Object.entries(styles)) { |
| 10033 |
restorers.push(overrideElementStyle(element, key2, value)); |
| 10034 |
} |
| 10035 |
return restorers.length ? () => { |
| 10036 |
restorers.forEach((restore) => restore()); |
| 10037 |
} : NOOP; |
| 10038 |
} |
| 10039 |
function setPopupCssSize(popupElement, size4) { |
| 10040 |
const width = size4 === "auto" ? "auto" : `${size4.width}px`; |
| 10041 |
const height = size4 === "auto" ? "auto" : `${size4.height}px`; |
| 10042 |
popupElement.style.setProperty("--popup-width", width); |
| 10043 |
popupElement.style.setProperty("--popup-height", height); |
| 10044 |
} |
| 10045 |
function setPositionerCssSize(positionerElement, size4) { |
| 10046 |
const width = size4 === "max-content" ? "max-content" : `${size4.width}px`; |
| 10047 |
const height = size4 === "max-content" ? "max-content" : `${size4.height}px`; |
| 10048 |
positionerElement.style.setProperty("--positioner-width", width); |
| 10049 |
positionerElement.style.setProperty("--positioner-height", height); |
| 10050 |
} |
| 10051 |
|
| 10052 |
// node_modules/@base-ui/react/esm/utils/usePopupViewport.js |
| 10053 |
var import_jsx_runtime11 = __toESM(require_jsx_runtime(), 1); |
| 10054 |
function usePopupViewport(parameters) { |
| 10055 |
const { |
| 10056 |
store, |
| 10057 |
side, |
| 10058 |
cssVars, |
| 10059 |
children |
| 10060 |
} = parameters; |
| 10061 |
const direction = useDirection(); |
| 10062 |
const activeTrigger = store.useState("activeTriggerElement"); |
| 10063 |
const activeTriggerId = store.useState("activeTriggerId"); |
| 10064 |
const open = store.useState("open"); |
| 10065 |
const payload = store.useState("payload"); |
| 10066 |
const mounted = store.useState("mounted"); |
| 10067 |
const popupElement = store.useState("popupElement"); |
| 10068 |
const positionerElement = store.useState("positionerElement"); |
| 10069 |
const previousActiveTrigger = usePreviousValue(open ? activeTrigger : null); |
| 10070 |
const currentContentKey = usePopupContentKey(activeTriggerId, payload); |
| 10071 |
const capturedNodeRef = React58.useRef(null); |
| 10072 |
const [previousContentNode, setPreviousContentNode] = React58.useState(null); |
| 10073 |
const [newTriggerOffset, setNewTriggerOffset] = React58.useState(null); |
| 10074 |
const currentContainerRef = React58.useRef(null); |
| 10075 |
const previousContainerRef = React58.useRef(null); |
| 10076 |
const onAnimationsFinished = useAnimationsFinished(currentContainerRef, true, false); |
| 10077 |
const cleanupFrame = useAnimationFrame(); |
| 10078 |
const [previousContentDimensions, setPreviousContentDimensions] = React58.useState(null); |
| 10079 |
const [showStartingStyleAttribute, setShowStartingStyleAttribute] = React58.useState(false); |
| 10080 |
useIsoLayoutEffect(() => { |
| 10081 |
store.set("hasViewport", true); |
| 10082 |
return () => { |
| 10083 |
store.set("hasViewport", false); |
| 10084 |
}; |
| 10085 |
}, [store]); |
| 10086 |
const handleMeasureLayout = useStableCallback(() => { |
| 10087 |
currentContainerRef.current?.style.setProperty("animation", "none"); |
| 10088 |
currentContainerRef.current?.style.setProperty("transition", "none"); |
| 10089 |
previousContainerRef.current?.style.setProperty("display", "none"); |
| 10090 |
}); |
| 10091 |
const handleMeasureLayoutComplete = useStableCallback((previousDimensions) => { |
| 10092 |
currentContainerRef.current?.style.removeProperty("animation"); |
| 10093 |
currentContainerRef.current?.style.removeProperty("transition"); |
| 10094 |
previousContainerRef.current?.style.removeProperty("display"); |
| 10095 |
if (previousDimensions) { |
| 10096 |
setPreviousContentDimensions(previousDimensions); |
| 10097 |
} |
| 10098 |
}); |
| 10099 |
const lastHandledTriggerRef = React58.useRef(null); |
| 10100 |
useIsoLayoutEffect(() => { |
| 10101 |
if (activeTrigger && previousActiveTrigger && activeTrigger !== previousActiveTrigger && lastHandledTriggerRef.current !== activeTrigger && capturedNodeRef.current) { |
| 10102 |
setPreviousContentNode(capturedNodeRef.current); |
| 10103 |
setShowStartingStyleAttribute(true); |
| 10104 |
const offset4 = calculateRelativePosition(previousActiveTrigger, activeTrigger); |
| 10105 |
setNewTriggerOffset(offset4); |
| 10106 |
cleanupFrame.request(() => { |
| 10107 |
ReactDOM5.flushSync(() => { |
| 10108 |
setShowStartingStyleAttribute(false); |
| 10109 |
}); |
| 10110 |
onAnimationsFinished(() => { |
| 10111 |
setPreviousContentNode(null); |
| 10112 |
setPreviousContentDimensions(null); |
| 10113 |
capturedNodeRef.current = null; |
| 10114 |
}); |
| 10115 |
}); |
| 10116 |
lastHandledTriggerRef.current = activeTrigger; |
| 10117 |
} |
| 10118 |
}, [activeTrigger, previousActiveTrigger, previousContentNode, onAnimationsFinished, cleanupFrame]); |
| 10119 |
useIsoLayoutEffect(() => { |
| 10120 |
const source = currentContainerRef.current; |
| 10121 |
if (!source) { |
| 10122 |
return; |
| 10123 |
} |
| 10124 |
const wrapper = ownerDocument(source).createElement("div"); |
| 10125 |
for (const child of Array.from(source.childNodes)) { |
| 10126 |
wrapper.appendChild(child.cloneNode(true)); |
| 10127 |
} |
| 10128 |
capturedNodeRef.current = wrapper; |
| 10129 |
}); |
| 10130 |
const isTransitioning = previousContentNode != null; |
| 10131 |
let childrenToRender; |
| 10132 |
if (!isTransitioning) { |
| 10133 |
childrenToRender = /* @__PURE__ */ (0, import_jsx_runtime11.jsx)("div", { |
| 10134 |
"data-current": true, |
| 10135 |
ref: currentContainerRef, |
| 10136 |
children |
| 10137 |
}, currentContentKey); |
| 10138 |
} else { |
| 10139 |
childrenToRender = /* @__PURE__ */ (0, import_jsx_runtime11.jsxs)(React58.Fragment, { |
| 10140 |
children: [/* @__PURE__ */ (0, import_jsx_runtime11.jsx)("div", { |
| 10141 |
"data-previous": true, |
| 10142 |
inert: inertValue(true), |
| 10143 |
ref: previousContainerRef, |
| 10144 |
style: { |
| 10145 |
...previousContentDimensions ? { |
| 10146 |
[cssVars.popupWidth]: `${previousContentDimensions.width}px`, |
| 10147 |
[cssVars.popupHeight]: `${previousContentDimensions.height}px` |
| 10148 |
} : null, |
| 10149 |
position: "absolute" |
| 10150 |
}, |
| 10151 |
"data-ending-style": showStartingStyleAttribute ? void 0 : "" |
| 10152 |
}, "previous"), /* @__PURE__ */ (0, import_jsx_runtime11.jsx)("div", { |
| 10153 |
"data-current": true, |
| 10154 |
ref: currentContainerRef, |
| 10155 |
"data-starting-style": showStartingStyleAttribute ? "" : void 0, |
| 10156 |
children |
| 10157 |
}, currentContentKey)] |
| 10158 |
}); |
| 10159 |
} |
| 10160 |
useIsoLayoutEffect(() => { |
| 10161 |
const container = previousContainerRef.current; |
| 10162 |
if (!container || !previousContentNode) { |
| 10163 |
return; |
| 10164 |
} |
| 10165 |
container.replaceChildren(...Array.from(previousContentNode.childNodes)); |
| 10166 |
}, [previousContentNode]); |
| 10167 |
usePopupAutoResize({ |
| 10168 |
popupElement, |
| 10169 |
positionerElement, |
| 10170 |
mounted, |
| 10171 |
content: payload, |
| 10172 |
onMeasureLayout: handleMeasureLayout, |
| 10173 |
onMeasureLayoutComplete: handleMeasureLayoutComplete, |
| 10174 |
side, |
| 10175 |
direction |
| 10176 |
}); |
| 10177 |
const state = { |
| 10178 |
activationDirection: getActivationDirection(newTriggerOffset), |
| 10179 |
transitioning: isTransitioning |
| 10180 |
}; |
| 10181 |
return { |
| 10182 |
children: childrenToRender, |
| 10183 |
state |
| 10184 |
}; |
| 10185 |
} |
| 10186 |
function getActivationDirection(offset4) { |
| 10187 |
if (!offset4) { |
| 10188 |
return void 0; |
| 10189 |
} |
| 10190 |
return `${getValueWithTolerance(offset4.horizontal, 5, "right", "left")} ${getValueWithTolerance(offset4.vertical, 5, "down", "up")}`; |
| 10191 |
} |
| 10192 |
function getValueWithTolerance(value, tolerance, positiveLabel, negativeLabel) { |
| 10193 |
if (value > tolerance) { |
| 10194 |
return positiveLabel; |
| 10195 |
} |
| 10196 |
if (value < -tolerance) { |
| 10197 |
return negativeLabel; |
| 10198 |
} |
| 10199 |
return ""; |
| 10200 |
} |
| 10201 |
function calculateRelativePosition(from, to) { |
| 10202 |
const fromRect = from.getBoundingClientRect(); |
| 10203 |
const toRect = to.getBoundingClientRect(); |
| 10204 |
const fromCenter = { |
| 10205 |
x: fromRect.left + fromRect.width / 2, |
| 10206 |
y: fromRect.top + fromRect.height / 2 |
| 10207 |
}; |
| 10208 |
const toCenter = { |
| 10209 |
x: toRect.left + toRect.width / 2, |
| 10210 |
y: toRect.top + toRect.height / 2 |
| 10211 |
}; |
| 10212 |
return { |
| 10213 |
horizontal: toCenter.x - fromCenter.x, |
| 10214 |
vertical: toCenter.y - fromCenter.y |
| 10215 |
}; |
| 10216 |
} |
| 10217 |
function usePopupContentKey(activeTriggerId, payload) { |
| 10218 |
const [contentKey, setContentKey] = React58.useState(0); |
| 10219 |
const previousActiveTriggerIdRef = React58.useRef(activeTriggerId); |
| 10220 |
const previousPayloadRef = React58.useRef(payload); |
| 10221 |
const pendingPayloadUpdateRef = React58.useRef(false); |
| 10222 |
useIsoLayoutEffect(() => { |
| 10223 |
const previousActiveTriggerId = previousActiveTriggerIdRef.current; |
| 10224 |
const previousPayload = previousPayloadRef.current; |
| 10225 |
const triggerIdChanged = activeTriggerId !== previousActiveTriggerId; |
| 10226 |
const payloadChanged = payload !== previousPayload; |
| 10227 |
if (triggerIdChanged) { |
| 10228 |
setContentKey((value) => value + 1); |
| 10229 |
pendingPayloadUpdateRef.current = !payloadChanged; |
| 10230 |
} else if (pendingPayloadUpdateRef.current && payloadChanged) { |
| 10231 |
setContentKey((value) => value + 1); |
| 10232 |
pendingPayloadUpdateRef.current = false; |
| 10233 |
} |
| 10234 |
previousActiveTriggerIdRef.current = activeTriggerId; |
| 10235 |
previousPayloadRef.current = payload; |
| 10236 |
}, [activeTriggerId, payload]); |
| 10237 |
return `${activeTriggerId ?? "current"}-${contentKey}`; |
| 10238 |
} |
| 10239 |
|
| 10240 |
// node_modules/@base-ui/react/esm/dialog/index.parts.js |
| 10241 |
var index_parts_exports2 = {}; |
| 10242 |
__export(index_parts_exports2, { |
| 10243 |
Backdrop: () => DialogBackdrop, |
| 10244 |
Close: () => DialogClose, |
| 10245 |
Description: () => DialogDescription, |
| 10246 |
Handle: () => DialogHandle, |
| 10247 |
Popup: () => DialogPopup, |
| 10248 |
Portal: () => DialogPortal, |
| 10249 |
Root: () => DialogRoot, |
| 10250 |
Title: () => DialogTitle, |
| 10251 |
Trigger: () => DialogTrigger, |
| 10252 |
Viewport: () => DialogViewport, |
| 10253 |
createHandle: () => createDialogHandle |
| 10254 |
}); |
| 10255 |
|
| 10256 |
// node_modules/@base-ui/react/esm/utils/FloatingPortalLite.js |
| 10257 |
var React59 = __toESM(require_react(), 1); |
| 10258 |
var ReactDOM6 = __toESM(require_react_dom(), 1); |
| 10259 |
var import_jsx_runtime12 = __toESM(require_jsx_runtime(), 1); |
| 10260 |
var FloatingPortalLite = /* @__PURE__ */ React59.forwardRef(function FloatingPortalLite2(componentProps, forwardedRef) { |
| 10261 |
const { |
| 10262 |
children, |
| 10263 |
container, |
| 10264 |
className, |
| 10265 |
render: render4, |
| 10266 |
style, |
| 10267 |
...elementProps |
| 10268 |
} = componentProps; |
| 10269 |
const { |
| 10270 |
portalNode, |
| 10271 |
portalSubtree |
| 10272 |
} = useFloatingPortalNode({ |
| 10273 |
container, |
| 10274 |
ref: forwardedRef, |
| 10275 |
componentProps, |
| 10276 |
elementProps |
| 10277 |
}); |
| 10278 |
if (!portalSubtree && !portalNode) { |
| 10279 |
return null; |
| 10280 |
} |
| 10281 |
return /* @__PURE__ */ (0, import_jsx_runtime12.jsxs)(React59.Fragment, { |
| 10282 |
children: [portalSubtree, portalNode && /* @__PURE__ */ ReactDOM6.createPortal(children, portalNode)] |
| 10283 |
}); |
| 10284 |
}); |
| 10285 |
if (true) FloatingPortalLite.displayName = "FloatingPortalLite"; |
| 10286 |
|
| 10287 |
// node_modules/@base-ui/react/esm/tooltip/index.parts.js |
| 10288 |
var index_parts_exports3 = {}; |
| 10289 |
__export(index_parts_exports3, { |
| 10290 |
Arrow: () => TooltipArrow, |
| 10291 |
Handle: () => TooltipHandle, |
| 10292 |
Popup: () => TooltipPopup, |
| 10293 |
Portal: () => TooltipPortal, |
| 10294 |
Positioner: () => TooltipPositioner, |
| 10295 |
Provider: () => TooltipProvider, |
| 10296 |
Root: () => TooltipRoot, |
| 10297 |
Trigger: () => TooltipTrigger, |
| 10298 |
Viewport: () => TooltipViewport, |
| 10299 |
createHandle: () => createTooltipHandle |
| 10300 |
}); |
| 10301 |
|
| 10302 |
// node_modules/@base-ui/react/esm/tooltip/root/TooltipRoot.js |
| 10303 |
var React62 = __toESM(require_react(), 1); |
| 10304 |
|
| 10305 |
// node_modules/@base-ui/react/esm/tooltip/root/TooltipRootContext.js |
| 10306 |
var React60 = __toESM(require_react(), 1); |
| 10307 |
var TooltipRootContext = /* @__PURE__ */ React60.createContext(void 0); |
| 10308 |
if (true) TooltipRootContext.displayName = "TooltipRootContext"; |
| 10309 |
function useTooltipRootContext(optional) { |
| 10310 |
const context = React60.useContext(TooltipRootContext); |
| 10311 |
if (context === void 0 && !optional) { |
| 10312 |
throw new Error(true ? "Base UI: TooltipRootContext is missing. Tooltip parts must be placed within <Tooltip.Root>." : formatErrorMessage_default(72)); |
| 10313 |
} |
| 10314 |
return context; |
| 10315 |
} |
| 10316 |
|
| 10317 |
// node_modules/@base-ui/react/esm/tooltip/store/TooltipStore.js |
| 10318 |
var React61 = __toESM(require_react(), 1); |
| 10319 |
var ReactDOM7 = __toESM(require_react_dom(), 1); |
| 10320 |
var selectors3 = { |
| 10321 |
...popupStoreSelectors, |
| 10322 |
disabled: createSelector((state) => state.disabled), |
| 10323 |
instantType: createSelector((state) => state.instantType), |
| 10324 |
isInstantPhase: createSelector((state) => state.isInstantPhase), |
| 10325 |
trackCursorAxis: createSelector((state) => state.trackCursorAxis), |
| 10326 |
disableHoverablePopup: createSelector((state) => state.disableHoverablePopup), |
| 10327 |
lastOpenChangeReason: createSelector((state) => state.openChangeReason), |
| 10328 |
closeOnClick: createSelector((state) => state.closeOnClick), |
| 10329 |
closeDelay: createSelector((state) => state.closeDelay), |
| 10330 |
hasViewport: createSelector((state) => state.hasViewport) |
| 10331 |
}; |
| 10332 |
var TooltipStore = class _TooltipStore extends ReactStore { |
| 10333 |
constructor(initialState) { |
| 10334 |
super({ |
| 10335 |
...createInitialState2(), |
| 10336 |
...initialState |
| 10337 |
}, { |
| 10338 |
popupRef: /* @__PURE__ */ React61.createRef(), |
| 10339 |
onOpenChange: void 0, |
| 10340 |
onOpenChangeComplete: void 0, |
| 10341 |
triggerElements: new PopupTriggerMap() |
| 10342 |
}, selectors3); |
| 10343 |
} |
| 10344 |
setOpen = (nextOpen, eventDetails) => { |
| 10345 |
const reason = eventDetails.reason; |
| 10346 |
const isHover = reason === reason_parts_exports.triggerHover; |
| 10347 |
const isFocusOpen = nextOpen && reason === reason_parts_exports.triggerFocus; |
| 10348 |
const isDismissClose = !nextOpen && (reason === reason_parts_exports.triggerPress || reason === reason_parts_exports.escapeKey); |
| 10349 |
eventDetails.preventUnmountOnClose = () => { |
| 10350 |
this.set("preventUnmountingOnClose", true); |
| 10351 |
}; |
| 10352 |
this.context.onOpenChange?.(nextOpen, eventDetails); |
| 10353 |
if (eventDetails.isCanceled) { |
| 10354 |
return; |
| 10355 |
} |
| 10356 |
this.state.floatingRootContext.dispatchOpenChange(nextOpen, eventDetails); |
| 10357 |
const changeState = () => { |
| 10358 |
const updatedState = { |
| 10359 |
open: nextOpen, |
| 10360 |
openChangeReason: reason |
| 10361 |
}; |
| 10362 |
if (isFocusOpen) { |
| 10363 |
updatedState.instantType = "focus"; |
| 10364 |
} else if (isDismissClose) { |
| 10365 |
updatedState.instantType = "dismiss"; |
| 10366 |
} else if (reason === reason_parts_exports.triggerHover) { |
| 10367 |
updatedState.instantType = void 0; |
| 10368 |
} |
| 10369 |
const newTriggerId = eventDetails.trigger?.id ?? null; |
| 10370 |
if (newTriggerId || nextOpen) { |
| 10371 |
updatedState.activeTriggerId = newTriggerId; |
| 10372 |
updatedState.activeTriggerElement = eventDetails.trigger ?? null; |
| 10373 |
} |
| 10374 |
this.update(updatedState); |
| 10375 |
}; |
| 10376 |
if (isHover) { |
| 10377 |
ReactDOM7.flushSync(changeState); |
| 10378 |
} else { |
| 10379 |
changeState(); |
| 10380 |
} |
| 10381 |
}; |
| 10382 |
static useStore(externalStore, initialState) { |
| 10383 |
const internalStore = useRefWithInit(() => { |
| 10384 |
return new _TooltipStore(initialState); |
| 10385 |
}).current; |
| 10386 |
const store = externalStore ?? internalStore; |
| 10387 |
const floatingRootContext = useSyncedFloatingRootContext({ |
| 10388 |
popupStore: store, |
| 10389 |
onOpenChange: store.setOpen |
| 10390 |
}); |
| 10391 |
store.state.floatingRootContext = floatingRootContext; |
| 10392 |
return store; |
| 10393 |
} |
| 10394 |
}; |
| 10395 |
function createInitialState2() { |
| 10396 |
return { |
| 10397 |
...createInitialPopupStoreState(), |
| 10398 |
disabled: false, |
| 10399 |
instantType: void 0, |
| 10400 |
isInstantPhase: false, |
| 10401 |
trackCursorAxis: "none", |
| 10402 |
disableHoverablePopup: false, |
| 10403 |
openChangeReason: null, |
| 10404 |
closeOnClick: true, |
| 10405 |
closeDelay: 0, |
| 10406 |
hasViewport: false |
| 10407 |
}; |
| 10408 |
} |
| 10409 |
|
| 10410 |
// node_modules/@base-ui/react/esm/tooltip/root/TooltipRoot.js |
| 10411 |
var import_jsx_runtime13 = __toESM(require_jsx_runtime(), 1); |
| 10412 |
var TooltipRoot = fastComponent(function TooltipRoot2(props) { |
| 10413 |
const { |
| 10414 |
disabled: disabled2 = false, |
| 10415 |
defaultOpen = false, |
| 10416 |
open: openProp, |
| 10417 |
disableHoverablePopup = false, |
| 10418 |
trackCursorAxis = "none", |
| 10419 |
actionsRef, |
| 10420 |
onOpenChange, |
| 10421 |
onOpenChangeComplete, |
| 10422 |
handle, |
| 10423 |
triggerId: triggerIdProp, |
| 10424 |
defaultTriggerId: defaultTriggerIdProp = null, |
| 10425 |
children |
| 10426 |
} = props; |
| 10427 |
const store = TooltipStore.useStore(handle?.store, { |
| 10428 |
open: defaultOpen, |
| 10429 |
openProp, |
| 10430 |
activeTriggerId: defaultTriggerIdProp, |
| 10431 |
triggerIdProp |
| 10432 |
}); |
| 10433 |
useOnFirstRender(() => { |
| 10434 |
if (openProp === void 0 && store.state.open === false && defaultOpen === true) { |
| 10435 |
store.update({ |
| 10436 |
open: true, |
| 10437 |
activeTriggerId: defaultTriggerIdProp |
| 10438 |
}); |
| 10439 |
} |
| 10440 |
}); |
| 10441 |
store.useControlledProp("openProp", openProp); |
| 10442 |
store.useControlledProp("triggerIdProp", triggerIdProp); |
| 10443 |
store.useContextCallback("onOpenChange", onOpenChange); |
| 10444 |
store.useContextCallback("onOpenChangeComplete", onOpenChangeComplete); |
| 10445 |
const openState = store.useState("open"); |
| 10446 |
const open = !disabled2 && openState; |
| 10447 |
const activeTriggerId = store.useState("activeTriggerId"); |
| 10448 |
const payload = store.useState("payload"); |
| 10449 |
store.useSyncedValues({ |
| 10450 |
trackCursorAxis, |
| 10451 |
disableHoverablePopup |
| 10452 |
}); |
| 10453 |
useIsoLayoutEffect(() => { |
| 10454 |
if (openState && disabled2) { |
| 10455 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.disabled)); |
| 10456 |
} |
| 10457 |
}, [openState, disabled2, store]); |
| 10458 |
store.useSyncedValue("disabled", disabled2); |
| 10459 |
useImplicitActiveTrigger(store); |
| 10460 |
const { |
| 10461 |
forceUnmount, |
| 10462 |
transitionStatus |
| 10463 |
} = useOpenStateTransitions(open, store); |
| 10464 |
const floatingRootContext = store.select("floatingRootContext"); |
| 10465 |
const isInstantPhase = store.useState("isInstantPhase"); |
| 10466 |
const instantType = store.useState("instantType"); |
| 10467 |
const lastOpenChangeReason = store.useState("lastOpenChangeReason"); |
| 10468 |
const previousInstantTypeRef = React62.useRef(null); |
| 10469 |
useIsoLayoutEffect(() => { |
| 10470 |
if (transitionStatus === "ending" && lastOpenChangeReason === reason_parts_exports.none || transitionStatus !== "ending" && isInstantPhase) { |
| 10471 |
if (instantType !== "delay") { |
| 10472 |
previousInstantTypeRef.current = instantType; |
| 10473 |
} |
| 10474 |
store.set("instantType", "delay"); |
| 10475 |
} else if (previousInstantTypeRef.current !== null) { |
| 10476 |
store.set("instantType", previousInstantTypeRef.current); |
| 10477 |
previousInstantTypeRef.current = null; |
| 10478 |
} |
| 10479 |
}, [transitionStatus, isInstantPhase, lastOpenChangeReason, instantType, store]); |
| 10480 |
useIsoLayoutEffect(() => { |
| 10481 |
if (open) { |
| 10482 |
if (activeTriggerId == null) { |
| 10483 |
store.set("payload", void 0); |
| 10484 |
} |
| 10485 |
} |
| 10486 |
}, [store, activeTriggerId, open]); |
| 10487 |
const handleImperativeClose = React62.useCallback(() => { |
| 10488 |
store.setOpen(false, createChangeEventDetails(reason_parts_exports.imperativeAction)); |
| 10489 |
}, [store]); |
| 10490 |
React62.useImperativeHandle(actionsRef, () => ({ |
| 10491 |
unmount: forceUnmount, |
| 10492 |
close: handleImperativeClose |
| 10493 |
}), [forceUnmount, handleImperativeClose]); |
| 10494 |
const dismiss = useDismiss(floatingRootContext, { |
| 10495 |
enabled: !disabled2, |
| 10496 |
referencePress: () => store.select("closeOnClick") |
| 10497 |
}); |
| 10498 |
const clientPoint = useClientPoint(floatingRootContext, { |
| 10499 |
enabled: !disabled2 && trackCursorAxis !== "none", |
| 10500 |
axis: trackCursorAxis === "none" ? void 0 : trackCursorAxis |
| 10501 |
}); |
| 10502 |
const { |
| 10503 |
getReferenceProps, |
| 10504 |
getFloatingProps, |
| 10505 |
getTriggerProps |
| 10506 |
} = useInteractions([dismiss, clientPoint]); |
| 10507 |
const activeTriggerProps = React62.useMemo(() => getReferenceProps(), [getReferenceProps]); |
| 10508 |
const inactiveTriggerProps = React62.useMemo(() => getTriggerProps(), [getTriggerProps]); |
| 10509 |
const popupProps = React62.useMemo(() => getFloatingProps(), [getFloatingProps]); |
| 10510 |
store.useSyncedValues({ |
| 10511 |
activeTriggerProps, |
| 10512 |
inactiveTriggerProps, |
| 10513 |
popupProps |
| 10514 |
}); |
| 10515 |
return /* @__PURE__ */ (0, import_jsx_runtime13.jsx)(TooltipRootContext.Provider, { |
| 10516 |
value: store, |
| 10517 |
children: typeof children === "function" ? children({ |
| 10518 |
payload |
| 10519 |
}) : children |
| 10520 |
}); |
| 10521 |
}); |
| 10522 |
if (true) TooltipRoot.displayName = "TooltipRoot"; |
| 10523 |
|
| 10524 |
// node_modules/@base-ui/react/esm/tooltip/trigger/TooltipTrigger.js |
| 10525 |
var React64 = __toESM(require_react(), 1); |
| 10526 |
|
| 10527 |
// node_modules/@base-ui/react/esm/tooltip/provider/TooltipProviderContext.js |
| 10528 |
var React63 = __toESM(require_react(), 1); |
| 10529 |
var TooltipProviderContext = /* @__PURE__ */ React63.createContext(void 0); |
| 10530 |
if (true) TooltipProviderContext.displayName = "TooltipProviderContext"; |
| 10531 |
function useTooltipProviderContext() { |
| 10532 |
return React63.useContext(TooltipProviderContext); |
| 10533 |
} |
| 10534 |
|
| 10535 |
// node_modules/@base-ui/react/esm/tooltip/trigger/TooltipTriggerDataAttributes.js |
| 10536 |
var TooltipTriggerDataAttributes = (function(TooltipTriggerDataAttributes2) { |
| 10537 |
TooltipTriggerDataAttributes2[TooltipTriggerDataAttributes2["popupOpen"] = CommonTriggerDataAttributes.popupOpen] = "popupOpen"; |
| 10538 |
TooltipTriggerDataAttributes2["triggerDisabled"] = "data-trigger-disabled"; |
| 10539 |
return TooltipTriggerDataAttributes2; |
| 10540 |
})({}); |
| 10541 |
|
| 10542 |
// node_modules/@base-ui/react/esm/tooltip/utils/constants.js |
| 10543 |
var OPEN_DELAY = 600; |
| 10544 |
|
| 10545 |
// node_modules/@base-ui/react/esm/tooltip/trigger/TooltipTrigger.js |
| 10546 |
var TooltipTrigger = fastComponentRef(function TooltipTrigger2(componentProps, forwardedRef) { |
| 10547 |
const { |
| 10548 |
className, |
| 10549 |
render: render4, |
| 10550 |
handle, |
| 10551 |
payload, |
| 10552 |
disabled: disabledProp, |
| 10553 |
delay, |
| 10554 |
closeOnClick = true, |
| 10555 |
closeDelay, |
| 10556 |
id: idProp, |
| 10557 |
style, |
| 10558 |
...elementProps |
| 10559 |
} = componentProps; |
| 10560 |
const rootContext = useTooltipRootContext(true); |
| 10561 |
const store = handle?.store ?? rootContext; |
| 10562 |
if (!store) { |
| 10563 |
throw new Error(true ? "Base UI: <Tooltip.Trigger> must be either used within a <Tooltip.Root> component or provided with a handle." : formatErrorMessage_default(82)); |
| 10564 |
} |
| 10565 |
const thisTriggerId = useBaseUiId(idProp); |
| 10566 |
const isTriggerActive = store.useState("isTriggerActive", thisTriggerId); |
| 10567 |
const isOpenedByThisTrigger = store.useState("isOpenedByTrigger", thisTriggerId); |
| 10568 |
const floatingRootContext = store.useState("floatingRootContext"); |
| 10569 |
const triggerElementRef = React64.useRef(null); |
| 10570 |
const delayWithDefault = delay ?? OPEN_DELAY; |
| 10571 |
const closeDelayWithDefault = closeDelay ?? 0; |
| 10572 |
const { |
| 10573 |
registerTrigger, |
| 10574 |
isMountedByThisTrigger |
| 10575 |
} = useTriggerDataForwarding(thisTriggerId, triggerElementRef, store, { |
| 10576 |
payload, |
| 10577 |
closeOnClick, |
| 10578 |
closeDelay: closeDelayWithDefault |
| 10579 |
}); |
| 10580 |
const providerContext = useTooltipProviderContext(); |
| 10581 |
const { |
| 10582 |
delayRef, |
| 10583 |
isInstantPhase, |
| 10584 |
hasProvider |
| 10585 |
} = useDelayGroup(floatingRootContext, { |
| 10586 |
open: isOpenedByThisTrigger |
| 10587 |
}); |
| 10588 |
store.useSyncedValue("isInstantPhase", isInstantPhase); |
| 10589 |
const rootDisabled = store.useState("disabled"); |
| 10590 |
const disabled2 = disabledProp ?? rootDisabled; |
| 10591 |
const trackCursorAxis = store.useState("trackCursorAxis"); |
| 10592 |
const disableHoverablePopup = store.useState("disableHoverablePopup"); |
| 10593 |
const hoverProps = useHoverReferenceInteraction(floatingRootContext, { |
| 10594 |
enabled: !disabled2, |
| 10595 |
mouseOnly: true, |
| 10596 |
move: false, |
| 10597 |
handleClose: !disableHoverablePopup && trackCursorAxis !== "both" ? safePolygon() : null, |
| 10598 |
restMs() { |
| 10599 |
const providerDelay = providerContext?.delay; |
| 10600 |
const groupOpenValue = typeof delayRef.current === "object" ? delayRef.current.open : void 0; |
| 10601 |
let computedRestMs = delayWithDefault; |
| 10602 |
if (hasProvider) { |
| 10603 |
if (groupOpenValue !== 0) { |
| 10604 |
computedRestMs = delay ?? providerDelay ?? delayWithDefault; |
| 10605 |
} else { |
| 10606 |
computedRestMs = 0; |
| 10607 |
} |
| 10608 |
} |
| 10609 |
return computedRestMs; |
| 10610 |
}, |
| 10611 |
delay() { |
| 10612 |
const closeValue = typeof delayRef.current === "object" ? delayRef.current.close : void 0; |
| 10613 |
let computedCloseDelay = closeDelayWithDefault; |
| 10614 |
if (closeDelay == null && hasProvider) { |
| 10615 |
computedCloseDelay = closeValue; |
| 10616 |
} |
| 10617 |
return { |
| 10618 |
close: computedCloseDelay |
| 10619 |
}; |
| 10620 |
}, |
| 10621 |
triggerElementRef, |
| 10622 |
isActiveTrigger: isTriggerActive, |
| 10623 |
isClosing: () => store.select("transitionStatus") === "ending" |
| 10624 |
}); |
| 10625 |
const focusProps = useFocus(floatingRootContext, { |
| 10626 |
enabled: !disabled2 |
| 10627 |
}).reference; |
| 10628 |
const state = { |
| 10629 |
open: isOpenedByThisTrigger |
| 10630 |
}; |
| 10631 |
const rootTriggerProps = store.useState("triggerProps", isMountedByThisTrigger); |
| 10632 |
const element = useRenderElement("button", componentProps, { |
| 10633 |
state, |
| 10634 |
ref: [forwardedRef, registerTrigger, triggerElementRef], |
| 10635 |
props: [hoverProps, focusProps, rootTriggerProps, { |
| 10636 |
onPointerDown() { |
| 10637 |
store.set("closeOnClick", closeOnClick); |
| 10638 |
}, |
| 10639 |
id: thisTriggerId, |
| 10640 |
[TooltipTriggerDataAttributes.triggerDisabled]: disabled2 ? "" : void 0 |
| 10641 |
}, elementProps], |
| 10642 |
stateAttributesMapping: triggerOpenStateMapping |
| 10643 |
}); |
| 10644 |
return element; |
| 10645 |
}); |
| 10646 |
if (true) TooltipTrigger.displayName = "TooltipTrigger"; |
| 10647 |
|
| 10648 |
// node_modules/@base-ui/react/esm/tooltip/portal/TooltipPortal.js |
| 10649 |
var React66 = __toESM(require_react(), 1); |
| 10650 |
|
| 10651 |
// node_modules/@base-ui/react/esm/tooltip/portal/TooltipPortalContext.js |
| 10652 |
var React65 = __toESM(require_react(), 1); |
| 10653 |
var TooltipPortalContext = /* @__PURE__ */ React65.createContext(void 0); |
| 10654 |
if (true) TooltipPortalContext.displayName = "TooltipPortalContext"; |
| 10655 |
function useTooltipPortalContext() { |
| 10656 |
const value = React65.useContext(TooltipPortalContext); |
| 10657 |
if (value === void 0) { |
| 10658 |
throw new Error(true ? "Base UI: <Tooltip.Portal> is missing." : formatErrorMessage_default(70)); |
| 10659 |
} |
| 10660 |
return value; |
| 10661 |
} |
| 10662 |
|
| 10663 |
// node_modules/@base-ui/react/esm/tooltip/portal/TooltipPortal.js |
| 10664 |
var import_jsx_runtime14 = __toESM(require_jsx_runtime(), 1); |
| 10665 |
var TooltipPortal = /* @__PURE__ */ React66.forwardRef(function TooltipPortal2(props, forwardedRef) { |
| 10666 |
const { |
| 10667 |
keepMounted = false, |
| 10668 |
...portalProps |
| 10669 |
} = props; |
| 10670 |
const store = useTooltipRootContext(); |
| 10671 |
const mounted = store.useState("mounted"); |
| 10672 |
const shouldRender = mounted || keepMounted; |
| 10673 |
if (!shouldRender) { |
| 10674 |
return null; |
| 10675 |
} |
| 10676 |
return /* @__PURE__ */ (0, import_jsx_runtime14.jsx)(TooltipPortalContext.Provider, { |
| 10677 |
value: keepMounted, |
| 10678 |
children: /* @__PURE__ */ (0, import_jsx_runtime14.jsx)(FloatingPortalLite, { |
| 10679 |
ref: forwardedRef, |
| 10680 |
...portalProps |
| 10681 |
}) |
| 10682 |
}); |
| 10683 |
}); |
| 10684 |
if (true) TooltipPortal.displayName = "TooltipPortal"; |
| 10685 |
|
| 10686 |
// node_modules/@base-ui/react/esm/tooltip/positioner/TooltipPositioner.js |
| 10687 |
var React68 = __toESM(require_react(), 1); |
| 10688 |
|
| 10689 |
// node_modules/@base-ui/react/esm/tooltip/positioner/TooltipPositionerContext.js |
| 10690 |
var React67 = __toESM(require_react(), 1); |
| 10691 |
var TooltipPositionerContext = /* @__PURE__ */ React67.createContext(void 0); |
| 10692 |
if (true) TooltipPositionerContext.displayName = "TooltipPositionerContext"; |
| 10693 |
function useTooltipPositionerContext() { |
| 10694 |
const context = React67.useContext(TooltipPositionerContext); |
| 10695 |
if (context === void 0) { |
| 10696 |
throw new Error(true ? "Base UI: TooltipPositionerContext is missing. TooltipPositioner parts must be placed within <Tooltip.Positioner>." : formatErrorMessage_default(71)); |
| 10697 |
} |
| 10698 |
return context; |
| 10699 |
} |
| 10700 |
|
| 10701 |
// node_modules/@base-ui/react/esm/tooltip/positioner/TooltipPositioner.js |
| 10702 |
var import_jsx_runtime15 = __toESM(require_jsx_runtime(), 1); |
| 10703 |
var TooltipPositioner = /* @__PURE__ */ React68.forwardRef(function TooltipPositioner2(componentProps, forwardedRef) { |
| 10704 |
const { |
| 10705 |
render: render4, |
| 10706 |
className, |
| 10707 |
anchor, |
| 10708 |
positionMethod = "absolute", |
| 10709 |
side = "top", |
| 10710 |
align = "center", |
| 10711 |
sideOffset = 0, |
| 10712 |
alignOffset = 0, |
| 10713 |
collisionBoundary = "clipping-ancestors", |
| 10714 |
collisionPadding = 5, |
| 10715 |
arrowPadding = 5, |
| 10716 |
sticky = false, |
| 10717 |
disableAnchorTracking = false, |
| 10718 |
collisionAvoidance = POPUP_COLLISION_AVOIDANCE, |
| 10719 |
style, |
| 10720 |
...elementProps |
| 10721 |
} = componentProps; |
| 10722 |
const store = useTooltipRootContext(); |
| 10723 |
const keepMounted = useTooltipPortalContext(); |
| 10724 |
const open = store.useState("open"); |
| 10725 |
const mounted = store.useState("mounted"); |
| 10726 |
const trackCursorAxis = store.useState("trackCursorAxis"); |
| 10727 |
const disableHoverablePopup = store.useState("disableHoverablePopup"); |
| 10728 |
const floatingRootContext = store.useState("floatingRootContext"); |
| 10729 |
const instantType = store.useState("instantType"); |
| 10730 |
const transitionStatus = store.useState("transitionStatus"); |
| 10731 |
const hasViewport = store.useState("hasViewport"); |
| 10732 |
const positioning = useAnchorPositioning({ |
| 10733 |
anchor, |
| 10734 |
positionMethod, |
| 10735 |
floatingRootContext, |
| 10736 |
mounted, |
| 10737 |
side, |
| 10738 |
sideOffset, |
| 10739 |
align, |
| 10740 |
alignOffset, |
| 10741 |
collisionBoundary, |
| 10742 |
collisionPadding, |
| 10743 |
sticky, |
| 10744 |
arrowPadding, |
| 10745 |
disableAnchorTracking, |
| 10746 |
keepMounted, |
| 10747 |
collisionAvoidance, |
| 10748 |
adaptiveOrigin: hasViewport ? adaptiveOrigin : void 0 |
| 10749 |
}); |
| 10750 |
const state = React68.useMemo(() => ({ |
| 10751 |
open, |
| 10752 |
side: positioning.side, |
| 10753 |
align: positioning.align, |
| 10754 |
anchorHidden: positioning.anchorHidden, |
| 10755 |
instant: trackCursorAxis !== "none" ? "tracking-cursor" : instantType |
| 10756 |
}), [open, positioning.side, positioning.align, positioning.anchorHidden, trackCursorAxis, instantType]); |
| 10757 |
const element = usePositioner(componentProps, state, { |
| 10758 |
styles: positioning.positionerStyles, |
| 10759 |
transitionStatus, |
| 10760 |
props: elementProps, |
| 10761 |
refs: [forwardedRef, store.useStateSetter("positionerElement")], |
| 10762 |
hidden: !mounted, |
| 10763 |
inert: !open || trackCursorAxis === "both" || disableHoverablePopup |
| 10764 |
}); |
| 10765 |
return /* @__PURE__ */ (0, import_jsx_runtime15.jsx)(TooltipPositionerContext.Provider, { |
| 10766 |
value: positioning, |
| 10767 |
children: element |
| 10768 |
}); |
| 10769 |
}); |
| 10770 |
if (true) TooltipPositioner.displayName = "TooltipPositioner"; |
| 10771 |
|
| 10772 |
// node_modules/@base-ui/react/esm/tooltip/popup/TooltipPopup.js |
| 10773 |
var React69 = __toESM(require_react(), 1); |
| 10774 |
var stateAttributesMapping4 = { |
| 10775 |
...popupStateMapping, |
| 10776 |
...transitionStatusMapping |
| 10777 |
}; |
| 10778 |
var TooltipPopup = /* @__PURE__ */ React69.forwardRef(function TooltipPopup2(componentProps, forwardedRef) { |
| 10779 |
const { |
| 10780 |
className, |
| 10781 |
render: render4, |
| 10782 |
style, |
| 10783 |
...elementProps |
| 10784 |
} = componentProps; |
| 10785 |
const store = useTooltipRootContext(); |
| 10786 |
const { |
| 10787 |
side, |
| 10788 |
align |
| 10789 |
} = useTooltipPositionerContext(); |
| 10790 |
const open = store.useState("open"); |
| 10791 |
const instantType = store.useState("instantType"); |
| 10792 |
const transitionStatus = store.useState("transitionStatus"); |
| 10793 |
const popupProps = store.useState("popupProps"); |
| 10794 |
const floatingContext = store.useState("floatingRootContext"); |
| 10795 |
useOpenChangeComplete({ |
| 10796 |
open, |
| 10797 |
ref: store.context.popupRef, |
| 10798 |
onComplete() { |
| 10799 |
if (open) { |
| 10800 |
store.context.onOpenChangeComplete?.(true); |
| 10801 |
} |
| 10802 |
} |
| 10803 |
}); |
| 10804 |
const disabled2 = store.useState("disabled"); |
| 10805 |
const closeDelay = store.useState("closeDelay"); |
| 10806 |
useHoverFloatingInteraction(floatingContext, { |
| 10807 |
enabled: !disabled2, |
| 10808 |
closeDelay |
| 10809 |
}); |
| 10810 |
const state = { |
| 10811 |
open, |
| 10812 |
side, |
| 10813 |
align, |
| 10814 |
instant: instantType, |
| 10815 |
transitionStatus |
| 10816 |
}; |
| 10817 |
const element = useRenderElement("div", componentProps, { |
| 10818 |
state, |
| 10819 |
ref: [forwardedRef, store.context.popupRef, store.useStateSetter("popupElement")], |
| 10820 |
props: [popupProps, getDisabledMountTransitionStyles(transitionStatus), elementProps], |
| 10821 |
stateAttributesMapping: stateAttributesMapping4 |
| 10822 |
}); |
| 10823 |
return element; |
| 10824 |
}); |
| 10825 |
if (true) TooltipPopup.displayName = "TooltipPopup"; |
| 10826 |
|
| 10827 |
// node_modules/@base-ui/react/esm/tooltip/arrow/TooltipArrow.js |
| 10828 |
var React70 = __toESM(require_react(), 1); |
| 10829 |
var TooltipArrow = /* @__PURE__ */ React70.forwardRef(function TooltipArrow2(componentProps, forwardedRef) { |
| 10830 |
const { |
| 10831 |
className, |
| 10832 |
render: render4, |
| 10833 |
style, |
| 10834 |
...elementProps |
| 10835 |
} = componentProps; |
| 10836 |
const store = useTooltipRootContext(); |
| 10837 |
const open = store.useState("open"); |
| 10838 |
const instantType = store.useState("instantType"); |
| 10839 |
const { |
| 10840 |
arrowRef, |
| 10841 |
side, |
| 10842 |
align, |
| 10843 |
arrowUncentered, |
| 10844 |
arrowStyles |
| 10845 |
} = useTooltipPositionerContext(); |
| 10846 |
const state = { |
| 10847 |
open, |
| 10848 |
side, |
| 10849 |
align, |
| 10850 |
uncentered: arrowUncentered, |
| 10851 |
instant: instantType |
| 10852 |
}; |
| 10853 |
const element = useRenderElement("div", componentProps, { |
| 10854 |
state, |
| 10855 |
ref: [forwardedRef, arrowRef], |
| 10856 |
props: [{ |
| 10857 |
style: arrowStyles, |
| 10858 |
"aria-hidden": true |
| 10859 |
}, elementProps], |
| 10860 |
stateAttributesMapping: popupStateMapping |
| 10861 |
}); |
| 10862 |
return element; |
| 10863 |
}); |
| 10864 |
if (true) TooltipArrow.displayName = "TooltipArrow"; |
| 10865 |
|
| 10866 |
// node_modules/@base-ui/react/esm/tooltip/provider/TooltipProvider.js |
| 10867 |
var React71 = __toESM(require_react(), 1); |
| 10868 |
var import_jsx_runtime16 = __toESM(require_jsx_runtime(), 1); |
| 10869 |
var TooltipProvider = function TooltipProvider2(props) { |
| 10870 |
const { |
| 10871 |
delay, |
| 10872 |
closeDelay, |
| 10873 |
timeout = 400 |
| 10874 |
} = props; |
| 10875 |
const contextValue = React71.useMemo(() => ({ |
| 10876 |
delay, |
| 10877 |
closeDelay |
| 10878 |
}), [delay, closeDelay]); |
| 10879 |
const delayValue = React71.useMemo(() => ({ |
| 10880 |
open: delay, |
| 10881 |
close: closeDelay |
| 10882 |
}), [delay, closeDelay]); |
| 10883 |
return /* @__PURE__ */ (0, import_jsx_runtime16.jsx)(TooltipProviderContext.Provider, { |
| 10884 |
value: contextValue, |
| 10885 |
children: /* @__PURE__ */ (0, import_jsx_runtime16.jsx)(FloatingDelayGroup, { |
| 10886 |
delay: delayValue, |
| 10887 |
timeoutMs: timeout, |
| 10888 |
children: props.children |
| 10889 |
}) |
| 10890 |
}); |
| 10891 |
}; |
| 10892 |
if (true) TooltipProvider.displayName = "TooltipProvider"; |
| 10893 |
|
| 10894 |
// node_modules/@base-ui/react/esm/tooltip/viewport/TooltipViewport.js |
| 10895 |
var React72 = __toESM(require_react(), 1); |
| 10896 |
|
| 10897 |
// node_modules/@base-ui/react/esm/tooltip/viewport/TooltipViewportCssVars.js |
| 10898 |
var TooltipViewportCssVars = /* @__PURE__ */ (function(TooltipViewportCssVars2) { |
| 10899 |
TooltipViewportCssVars2["popupWidth"] = "--popup-width"; |
| 10900 |
TooltipViewportCssVars2["popupHeight"] = "--popup-height"; |
| 10901 |
return TooltipViewportCssVars2; |
| 10902 |
})({}); |
| 10903 |
|
| 10904 |
// node_modules/@base-ui/react/esm/tooltip/viewport/TooltipViewport.js |
| 10905 |
var stateAttributesMapping5 = { |
| 10906 |
activationDirection: (value) => value ? { |
| 10907 |
"data-activation-direction": value |
| 10908 |
} : null |
| 10909 |
}; |
| 10910 |
var TooltipViewport = /* @__PURE__ */ React72.forwardRef(function TooltipViewport2(componentProps, forwardedRef) { |
| 10911 |
const { |
| 10912 |
render: render4, |
| 10913 |
className, |
| 10914 |
style, |
| 10915 |
children, |
| 10916 |
...elementProps |
| 10917 |
} = componentProps; |
| 10918 |
const store = useTooltipRootContext(); |
| 10919 |
const positioner = useTooltipPositionerContext(); |
| 10920 |
const instantType = store.useState("instantType"); |
| 10921 |
const { |
| 10922 |
children: childrenToRender, |
| 10923 |
state: viewportState |
| 10924 |
} = usePopupViewport({ |
| 10925 |
store, |
| 10926 |
side: positioner.side, |
| 10927 |
cssVars: TooltipViewportCssVars, |
| 10928 |
children |
| 10929 |
}); |
| 10930 |
const state = { |
| 10931 |
activationDirection: viewportState.activationDirection, |
| 10932 |
transitioning: viewportState.transitioning, |
| 10933 |
instant: instantType |
| 10934 |
}; |
| 10935 |
return useRenderElement("div", componentProps, { |
| 10936 |
state, |
| 10937 |
ref: forwardedRef, |
| 10938 |
props: [elementProps, { |
| 10939 |
children: childrenToRender |
| 10940 |
}], |
| 10941 |
stateAttributesMapping: stateAttributesMapping5 |
| 10942 |
}); |
| 10943 |
}); |
| 10944 |
if (true) TooltipViewport.displayName = "TooltipViewport"; |
| 10945 |
|
| 10946 |
// node_modules/@base-ui/react/esm/tooltip/store/TooltipHandle.js |
| 10947 |
var TooltipHandle = class { |
| 10948 |
/** |
| 10949 |
* Internal store holding the tooltip state. |
| 10950 |
* @internal |
| 10951 |
*/ |
| 10952 |
constructor() { |
| 10953 |
this.store = new TooltipStore(); |
| 10954 |
} |
| 10955 |
/** |
| 10956 |
* Opens the tooltip and associates it with the trigger with the given ID. |
| 10957 |
* The trigger must be a Tooltip.Trigger component with this handle passed as a prop. |
| 10958 |
* |
| 10959 |
* This method should only be called in an event handler or an effect (not during rendering). |
| 10960 |
* |
| 10961 |
* @param triggerId ID of the trigger to associate with the tooltip. |
| 10962 |
*/ |
| 10963 |
open(triggerId) { |
| 10964 |
const triggerElement = triggerId ? this.store.context.triggerElements.getById(triggerId) : void 0; |
| 10965 |
if (triggerId && !triggerElement) { |
| 10966 |
throw new Error(true ? `Base UI: TooltipHandle.open: No trigger found with id "${triggerId}".` : formatErrorMessage_default(81, triggerId)); |
| 10967 |
} |
| 10968 |
this.store.setOpen(true, createChangeEventDetails(reason_parts_exports.imperativeAction, void 0, triggerElement)); |
| 10969 |
} |
| 10970 |
/** |
| 10971 |
* Closes the tooltip. |
| 10972 |
*/ |
| 10973 |
close() { |
| 10974 |
this.store.setOpen(false, createChangeEventDetails(reason_parts_exports.imperativeAction, void 0, void 0)); |
| 10975 |
} |
| 10976 |
/** |
| 10977 |
* Indicates whether the tooltip is currently open. |
| 10978 |
*/ |
| 10979 |
get isOpen() { |
| 10980 |
return this.store.state.open; |
| 10981 |
} |
| 10982 |
}; |
| 10983 |
function createTooltipHandle() { |
| 10984 |
return new TooltipHandle(); |
| 10985 |
} |
| 10986 |
|
| 10987 |
// node_modules/@base-ui/react/esm/use-render/useRender.js |
| 10988 |
function useRender(params) { |
| 10989 |
return useRenderElement(params.defaultTagName ?? "div", params, params); |
| 10990 |
} |
| 10991 |
|
| 10992 |
// packages/ui/build-module/text/text.mjs |
| 10993 |
var import_element11 = __toESM(require_element(), 1); |
| 10994 |
var STYLE_HASH_ATTRIBUTE = "data-wp-hash"; |
| 10995 |
function getRuntime() { |
| 10996 |
const globalScope = globalThis; |
| 10997 |
if (globalScope.__wpStyleRuntime) { |
| 10998 |
return globalScope.__wpStyleRuntime; |
| 10999 |
} |
| 11000 |
globalScope.__wpStyleRuntime = { |
| 11001 |
documents: /* @__PURE__ */ new Map(), |
| 11002 |
styles: /* @__PURE__ */ new Map(), |
| 11003 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11004 |
}; |
| 11005 |
if (typeof document !== "undefined") { |
| 11006 |
registerDocument(document); |
| 11007 |
} |
| 11008 |
return globalScope.__wpStyleRuntime; |
| 11009 |
} |
| 11010 |
function documentContainsStyleHash(targetDocument, hash) { |
| 11011 |
if (!targetDocument.head) { |
| 11012 |
return false; |
| 11013 |
} |
| 11014 |
for (const style of targetDocument.head.querySelectorAll( |
| 11015 |
`style[${STYLE_HASH_ATTRIBUTE}]` |
| 11016 |
)) { |
| 11017 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE) === hash) { |
| 11018 |
return true; |
| 11019 |
} |
| 11020 |
} |
| 11021 |
return false; |
| 11022 |
} |
| 11023 |
function injectStyle(targetDocument, hash, css) { |
| 11024 |
if (!targetDocument.head) { |
| 11025 |
return; |
| 11026 |
} |
| 11027 |
const runtime = getRuntime(); |
| 11028 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11029 |
if (!injectedStyles) { |
| 11030 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11031 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11032 |
} |
| 11033 |
if (injectedStyles.has(hash)) { |
| 11034 |
return; |
| 11035 |
} |
| 11036 |
if (documentContainsStyleHash(targetDocument, hash)) { |
| 11037 |
injectedStyles.add(hash); |
| 11038 |
return; |
| 11039 |
} |
| 11040 |
const style = targetDocument.createElement("style"); |
| 11041 |
style.setAttribute(STYLE_HASH_ATTRIBUTE, hash); |
| 11042 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11043 |
targetDocument.head.appendChild(style); |
| 11044 |
injectedStyles.add(hash); |
| 11045 |
} |
| 11046 |
function registerDocument(targetDocument) { |
| 11047 |
const runtime = getRuntime(); |
| 11048 |
runtime.documents.set( |
| 11049 |
targetDocument, |
| 11050 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11051 |
); |
| 11052 |
for (const [hash, css] of runtime.styles) { |
| 11053 |
injectStyle(targetDocument, hash, css); |
| 11054 |
} |
| 11055 |
return () => { |
| 11056 |
const count = runtime.documents.get(targetDocument); |
| 11057 |
if (count === void 0) { |
| 11058 |
return; |
| 11059 |
} |
| 11060 |
if (count <= 1) { |
| 11061 |
runtime.documents.delete(targetDocument); |
| 11062 |
return; |
| 11063 |
} |
| 11064 |
runtime.documents.set(targetDocument, count - 1); |
| 11065 |
}; |
| 11066 |
} |
| 11067 |
function registerStyle(hash, css) { |
| 11068 |
const runtime = getRuntime(); |
| 11069 |
runtime.styles.set(hash, css); |
| 11070 |
for (const targetDocument of runtime.documents.keys()) { |
| 11071 |
injectStyle(targetDocument, hash, css); |
| 11072 |
} |
| 11073 |
} |
| 11074 |
if (typeof process === "undefined" || true) { |
| 11075 |
registerStyle("0c8601dd83", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._83ed8a8da5dd50ea__text{margin:0}._14437cfb77831647__heading-2xl{--_gcd-heading-font-size:var(--wpds-typography-font-size-2xl,32px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-medium,499);--_gcd-p-font-size:var(--wpds-typography-font-size-2xl,32px);--_gcd-p-line-height:var(--wpds-typography-line-height-2xl,40px);font-size:var(--wpds-typography-font-size-2xl,32px);line-height:var(--wpds-typography-line-height-2xl,40px)}._14437cfb77831647__heading-2xl,._3c78b7fa9b4072dd__heading-xl{font-family:var(--wpds-typography-font-family-heading,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-weight:var(--wpds-typography-font-weight-medium,499)}._3c78b7fa9b4072dd__heading-xl{--_gcd-heading-font-size:var(--wpds-typography-font-size-xl,20px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-medium,499);--_gcd-p-font-size:var(--wpds-typography-font-size-xl,20px);--_gcd-p-line-height:var(--wpds-typography-line-height-md,24px);font-size:var(--wpds-typography-font-size-xl,20px);line-height:var(--wpds-typography-line-height-md,24px)}.aa58f227716bcde2__heading-lg{--_gcd-heading-font-size:var(--wpds-typography-font-size-lg,15px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-medium,499);--_gcd-p-font-size:var(--wpds-typography-font-size-lg,15px);--_gcd-p-line-height:var(--wpds-typography-line-height-sm,20px);font-size:var(--wpds-typography-font-size-lg,15px)}.aa58f227716bcde2__heading-lg,.fc4da56d8dfe52c4__heading-md{font-family:var(--wpds-typography-font-family-heading,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-weight:var(--wpds-typography-font-weight-medium,499);line-height:var(--wpds-typography-line-height-sm,20px)}.fc4da56d8dfe52c4__heading-md{--_gcd-heading-font-size:var(--wpds-typography-font-size-md,13px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-medium,499);--_gcd-p-font-size:var(--wpds-typography-font-size-md,13px);--_gcd-p-line-height:var(--wpds-typography-line-height-sm,20px);font-size:var(--wpds-typography-font-size-md,13px)}.a9b78c7c82e8dff7__heading-sm{--_gcd-heading-font-size:var(--wpds-typography-font-size-xs,11px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-medium,499);--_gcd-p-font-size:var(--wpds-typography-font-size-xs,11px);--_gcd-p-line-height:var(--wpds-typography-line-height-xs,16px);font-family:var(--wpds-typography-font-family-heading,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-xs,11px);font-weight:var(--wpds-typography-font-weight-medium,499);line-height:var(--wpds-typography-line-height-xs,16px);text-transform:uppercase}._305ff559e52180d5__body-xl{--_gcd-heading-font-size:var(--wpds-typography-font-size-xl,20px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-regular,400);--_gcd-p-font-size:var(--wpds-typography-font-size-xl,20px);--_gcd-p-line-height:var(--wpds-typography-line-height-xl,32px);font-size:var(--wpds-typography-font-size-xl,20px);line-height:var(--wpds-typography-line-height-xl,32px)}._305ff559e52180d5__body-xl,.ca1aa3fc2029e958__body-lg{font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-weight:var(--wpds-typography-font-weight-regular,400)}.ca1aa3fc2029e958__body-lg{--_gcd-heading-font-size:var(--wpds-typography-font-size-lg,15px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-regular,400);--_gcd-p-font-size:var(--wpds-typography-font-size-lg,15px);--_gcd-p-line-height:var(--wpds-typography-line-height-md,24px);font-size:var(--wpds-typography-font-size-lg,15px);line-height:var(--wpds-typography-line-height-md,24px)}._131101940be12424__body-md{--_gcd-heading-font-size:var(--wpds-typography-font-size-md,13px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-regular,400);--_gcd-p-font-size:var(--wpds-typography-font-size-md,13px);--_gcd-p-line-height:var(--wpds-typography-line-height-sm,20px);font-size:var(--wpds-typography-font-size-md,13px);line-height:var(--wpds-typography-line-height-sm,20px)}._0e8d87a42c1f75fa__body-sm,._131101940be12424__body-md{font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-weight:var(--wpds-typography-font-weight-regular,400)}._0e8d87a42c1f75fa__body-sm{--_gcd-heading-font-size:var(--wpds-typography-font-size-sm,12px);--_gcd-heading-font-weight:var(--wpds-typography-font-weight-regular,400);--_gcd-p-font-size:var(--wpds-typography-font-size-sm,12px);--_gcd-p-line-height:var(--wpds-typography-line-height-xs,16px);font-size:var(--wpds-typography-font-size-sm,12px);line-height:var(--wpds-typography-line-height-xs,16px)}}'); |
| 11076 |
} |
| 11077 |
var style_default = { "text": "_83ed8a8da5dd50ea__text", "heading-2xl": "_14437cfb77831647__heading-2xl", "heading-xl": "_3c78b7fa9b4072dd__heading-xl", "heading-lg": "aa58f227716bcde2__heading-lg", "heading-md": "fc4da56d8dfe52c4__heading-md", "heading-sm": "a9b78c7c82e8dff7__heading-sm", "body-xl": "_305ff559e52180d5__body-xl", "body-lg": "ca1aa3fc2029e958__body-lg", "body-md": "_131101940be12424__body-md", "body-sm": "_0e8d87a42c1f75fa__body-sm" }; |
| 11078 |
if (typeof process === "undefined" || true) { |
| 11079 |
registerStyle("1fb29d3a3c", "._6defc79820e382c6__button{box-sizing:var(--_gcd-button-box-sizing,border-box);font-family:var(--_gcd-button-font-family,inherit);font-size:var(--_gcd-button-font-size,inherit);font-weight:var(--_gcd-button-font-weight,inherit)}.d2cff2e5dea83bd1__input{box-sizing:var(--_gcd-input-box-sizing,border-box);font-family:var(--_gcd-input-font-family,inherit);font-size:var(--_gcd-input-font-size,inherit);font-weight:var(--_gcd-input-font-weight,inherit);margin:var(--_gcd-input-margin,0);&:is(textarea,[type=text],[type=password],[type=color],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){background-color:var(--_gcd-input-background-color,#0000);border:var(--_gcd-input-border,none);border-radius:var(--_gcd-input-border-radius,0);box-shadow:var(--_gcd-input-box-shadow,0 0 0 #0000);color:var(--_gcd-input-color,var(--wpds-color-fg-interactive-neutral,#1e1e1e));&:focus{border-color:var(--_gcd-input-border-color-focus,var(--wp-admin-theme-color));box-shadow:var(--_gcd-input-box-shadow-focus,none);outline:var(--_gcd-input-outline-focus,none)}&:disabled{background:var(--_gcd-input-background-disabled,#0000);border-color:var(--_gcd-input-border-color-disabled,#0000);box-shadow:var(--_gcd-input-box-shadow-disabled,none);color:var(--_gcd-input-color-disabled,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}&::placeholder{color:var(--_gcd-input-placeholder-color,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}}&:is(textarea,[type=text],[type=password],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){line-height:var(--_gcd-input-line-height,inherit);min-height:var(--_gcd-input-min-height,auto);padding:var(--_gcd-input-padding,0)}}._547d86373d02e108__textarea{box-sizing:var(--_gcd-textarea-box-sizing,border-box);overflow:var(--_gcd-textarea-overflow,auto);resize:var(--_gcd-textarea-resize,block)}._8c15fd0ed9f28ba4__div{outline:var(--_gcd-div-outline,0 solid #0000)}p._43cec3e1eec1066d__p{font-size:var(--_gcd-p-font-size,13px);line-height:var(--_gcd-p-line-height,1.5);margin:var(--_gcd-p-margin,0)}:is(h1,h2,h3,h4,h5,h6).e97669c6d9a38497__heading{color:var(--_gcd-heading-color,var(--wpds-color-fg-content-neutral,#1e1e1e));font-size:var(--_gcd-heading-font-size,inherit);font-weight:var(--_gcd-heading-font-weight,var(--wpds-typography-font-weight-medium,499));margin:var(--_gcd-heading-margin,0)}._2c0831b0499dbd6e__a,._2c0831b0499dbd6e__a:is(:hover,:focus,:active){border-radius:var(--_gcd-a-border-radius,0);box-shadow:var(--_gcd-a-box-shadow,none);color:var(--_gcd-a-color,inherit);outline:var(--_gcd-a-outline,0 solid #0000);transition:var(--_gcd-a-transition,none)}"); |
| 11080 |
} |
| 11081 |
var global_css_defense_default = { "button": "_6defc79820e382c6__button", "input": "d2cff2e5dea83bd1__input", "textarea": "_547d86373d02e108__textarea", "div": "_8c15fd0ed9f28ba4__div", "p": "_43cec3e1eec1066d__p", "heading": "e97669c6d9a38497__heading", "a": "_2c0831b0499dbd6e__a" }; |
| 11082 |
var Text = (0, import_element11.forwardRef)(function Text2({ variant = "body-md", render: render4, className, ...props }, ref) { |
| 11083 |
const element = useRender({ |
| 11084 |
render: render4, |
| 11085 |
defaultTagName: "span", |
| 11086 |
ref, |
| 11087 |
props: mergeProps(props, { |
| 11088 |
className: clsx_default( |
| 11089 |
style_default.text, |
| 11090 |
global_css_defense_default.heading, |
| 11091 |
global_css_defense_default.p, |
| 11092 |
style_default[variant], |
| 11093 |
className |
| 11094 |
) |
| 11095 |
}) |
| 11096 |
}); |
| 11097 |
return element; |
| 11098 |
}); |
| 11099 |
|
| 11100 |
// packages/ui/build-module/button/button.mjs |
| 11101 |
var import_element12 = __toESM(require_element(), 1); |
| 11102 |
var import_i18n = __toESM(require_i18n(), 1); |
| 11103 |
var import_jsx_runtime17 = __toESM(require_jsx_runtime(), 1); |
| 11104 |
import { speak } from "@wordpress/a11y"; |
| 11105 |
var STYLE_HASH_ATTRIBUTE2 = "data-wp-hash"; |
| 11106 |
function getRuntime2() { |
| 11107 |
const globalScope = globalThis; |
| 11108 |
if (globalScope.__wpStyleRuntime) { |
| 11109 |
return globalScope.__wpStyleRuntime; |
| 11110 |
} |
| 11111 |
globalScope.__wpStyleRuntime = { |
| 11112 |
documents: /* @__PURE__ */ new Map(), |
| 11113 |
styles: /* @__PURE__ */ new Map(), |
| 11114 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11115 |
}; |
| 11116 |
if (typeof document !== "undefined") { |
| 11117 |
registerDocument2(document); |
| 11118 |
} |
| 11119 |
return globalScope.__wpStyleRuntime; |
| 11120 |
} |
| 11121 |
function documentContainsStyleHash2(targetDocument, hash) { |
| 11122 |
if (!targetDocument.head) { |
| 11123 |
return false; |
| 11124 |
} |
| 11125 |
for (const style of targetDocument.head.querySelectorAll( |
| 11126 |
`style[${STYLE_HASH_ATTRIBUTE2}]` |
| 11127 |
)) { |
| 11128 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE2) === hash) { |
| 11129 |
return true; |
| 11130 |
} |
| 11131 |
} |
| 11132 |
return false; |
| 11133 |
} |
| 11134 |
function injectStyle2(targetDocument, hash, css) { |
| 11135 |
if (!targetDocument.head) { |
| 11136 |
return; |
| 11137 |
} |
| 11138 |
const runtime = getRuntime2(); |
| 11139 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11140 |
if (!injectedStyles) { |
| 11141 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11142 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11143 |
} |
| 11144 |
if (injectedStyles.has(hash)) { |
| 11145 |
return; |
| 11146 |
} |
| 11147 |
if (documentContainsStyleHash2(targetDocument, hash)) { |
| 11148 |
injectedStyles.add(hash); |
| 11149 |
return; |
| 11150 |
} |
| 11151 |
const style = targetDocument.createElement("style"); |
| 11152 |
style.setAttribute(STYLE_HASH_ATTRIBUTE2, hash); |
| 11153 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11154 |
targetDocument.head.appendChild(style); |
| 11155 |
injectedStyles.add(hash); |
| 11156 |
} |
| 11157 |
function registerDocument2(targetDocument) { |
| 11158 |
const runtime = getRuntime2(); |
| 11159 |
runtime.documents.set( |
| 11160 |
targetDocument, |
| 11161 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11162 |
); |
| 11163 |
for (const [hash, css] of runtime.styles) { |
| 11164 |
injectStyle2(targetDocument, hash, css); |
| 11165 |
} |
| 11166 |
return () => { |
| 11167 |
const count = runtime.documents.get(targetDocument); |
| 11168 |
if (count === void 0) { |
| 11169 |
return; |
| 11170 |
} |
| 11171 |
if (count <= 1) { |
| 11172 |
runtime.documents.delete(targetDocument); |
| 11173 |
return; |
| 11174 |
} |
| 11175 |
runtime.documents.set(targetDocument, count - 1); |
| 11176 |
}; |
| 11177 |
} |
| 11178 |
function registerStyle2(hash, css) { |
| 11179 |
const runtime = getRuntime2(); |
| 11180 |
runtime.styles.set(hash, css); |
| 11181 |
for (const targetDocument of runtime.documents.keys()) { |
| 11182 |
injectStyle2(targetDocument, hash, css); |
| 11183 |
} |
| 11184 |
} |
| 11185 |
if (typeof process === "undefined" || true) { |
| 11186 |
registerStyle2("26d90ece4e", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._97b0fc33c028be1a__button,.abbb272e2ce49bd6__is-unstyled{appearance:none;padding:0}._97b0fc33c028be1a__button{--wp-ui-button-font-weight:499;--wp-ui-button-background-color:var(--wpds-color-bg-interactive-brand-strong,var(--wp-admin-theme-color,#3858e9));--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-brand-strong-active,color-mix(in oklch,var(--wp-admin-theme-color,#3858e9) 93%,#000));--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-strong-disabled,#e6e6e6);--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-brand-strong,#fff);--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-brand-strong-active,#fff);--wp-ui-button-foreground-color-disabled:var(--wpds-color-fg-interactive-neutral-strong-disabled,#8d8d8d);--wp-ui-button-padding-inline:var(--wpds-dimension-padding-md,12px);--wp-ui-button-height:40px;--wp-ui-button-aspect-ratio:auto;--wp-ui-button-font-size:var(--wpds-typography-font-size-md,13px);--wp-ui-button-min-width:calc(4ch + var(--wp-ui-button-padding-inline)*2);--wp-ui-button-border-color:var(--wp-ui-button-background-color);--wp-ui-button-border-color-active:var(--wp-ui-button-background-color-active);--wp-ui-button-border-color-disabled:var(--wp-ui-button-background-color-disabled);--_gcd-button-font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);--_gcd-button-font-size:var(--wp-ui-button-font-size);--_gcd-button-font-weight:var(--wp-ui-button-font-weight);align-items:center;aspect-ratio:var(--wp-ui-button-aspect-ratio);background-clip:padding-box;background-color:var(--wp-ui-button-background-color);border-color:var(--wp-ui-button-border-color);border-radius:var(--wpds-border-radius-sm,2px);border-style:solid;border-width:1px;color:var(--wp-ui-button-foreground-color);cursor:var(--wpds-cursor-control,pointer);display:inline-flex;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wp-ui-button-font-size);font-weight:var(--wp-ui-button-font-weight);gap:var(--wpds-dimension-gap-sm,8px);height:var(--wp-ui-button-height);justify-content:center;line-height:var(--wpds-typography-line-height-sm,20px);min-width:var(--wp-ui-button-min-width);padding-inline:var(--wp-ui-button-padding-inline);position:relative;text-decoration:none;@media not (prefers-reduced-motion){transition:color .1s ease-out;*{transition:opacity .1s ease-out}}&[href]{cursor:pointer}[href]{color:inherit;text-decoration:inherit}&:not([data-disabled]):is(:hover,:active,:focus){background-color:var(--wp-ui-button-background-color-active);border-color:var(--wp-ui-button-border-color-active);color:var(--wp-ui-button-foreground-color-active)}&[data-disabled]:not(._914b42f315c0e580__is-loading){background-color:var(--wp-ui-button-background-color-disabled);border-color:var(--wp-ui-button-border-color-disabled);color:var(--wp-ui-button-foreground-color-disabled);@media (forced-colors:active){border-bottom-color:GrayText;border-left-color:GrayText;border-right-color:GrayText;border-top-color:GrayText;color:GrayText}}&:before{aspect-ratio:1;border:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid;border-block-end-color:#0000;border-block-start-color:var(--wp-ui-button-foreground-color);border-inline-end-color:var(--wp-ui-button-foreground-color);border-inline-start-color:#0000;border-radius:50%;box-sizing:border-box;content:"";display:block;height:var(--wp-ui-button-font-size);inset-inline-start:50%;opacity:0;pointer-events:none;position:absolute;top:50%;transform:translate(-50%,-50%);@media not (prefers-reduced-motion){transition:opacity .1s ease-out}}}._908205475f9f2a92__is-small{--wp-ui-button-padding-inline:var(--wpds-dimension-padding-sm,8px);--wp-ui-button-height:24px}.dd460c965226cc77__is-brand{&._62d5a778b7b258ee__is-outline,&.ad0619a3217c6a5b__is-minimal{--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-brand,var(--wp-admin-theme-color,#3858e9));--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-brand-active,var(--wp-admin-theme-color,#3858e9));--wp-ui-button-foreground-color-disabled:var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d)}&._62d5a778b7b258ee__is-outline{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-brand-weak,#0000);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-brand-weak-active,color-mix(in oklch,var(--wp-admin-theme-color,#3858e9) 12%,#fff));--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-weak-disabled,#0000);--wp-ui-button-border-color:var(--wpds-color-stroke-interactive-brand,var(--wp-admin-theme-color,#3858e9));--wp-ui-button-border-color-active:var(--wpds-color-stroke-interactive-brand-active,color-mix(in oklch,var(--wp-admin-theme-color,#3858e9) 85%,#000));--wp-ui-button-border-color-disabled:var(--wpds-color-stroke-interactive-neutral-disabled,#dbdbdb)}&.ad0619a3217c6a5b__is-minimal{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-brand-weak,#0000);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-brand-weak-active,color-mix(in oklch,var(--wp-admin-theme-color,#3858e9) 12%,#fff));--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-weak-disabled,#0000)}}.e722a8f96726aa99__is-neutral{&.b50b3358c5fb4d0b__is-solid{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-neutral-strong,#2d2d2d);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-neutral-strong-active,#1e1e1e);--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-strong-disabled,#e6e6e6);--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-neutral-strong,#f0f0f0);--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-neutral-strong-active,#f0f0f0);--wp-ui-button-foreground-color-disabled:var(--wpds-color-fg-interactive-neutral-strong-disabled,#8d8d8d)}&._62d5a778b7b258ee__is-outline,&.ad0619a3217c6a5b__is-minimal{--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-neutral,#1e1e1e);--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-neutral-active,#1e1e1e);--wp-ui-button-foreground-color-disabled:var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d)}&._62d5a778b7b258ee__is-outline{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-neutral-weak,#0000);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-neutral-weak-active,#ededed);--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-weak-disabled,#0000);--wp-ui-button-border-color:var(--wpds-color-stroke-interactive-neutral,#8d8d8d);--wp-ui-button-border-color-active:var(--wpds-color-stroke-interactive-neutral-active,#6e6e6e);--wp-ui-button-border-color-disabled:var(--wpds-color-stroke-interactive-neutral-disabled,#dbdbdb)}&.ad0619a3217c6a5b__is-minimal{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-neutral-weak,#0000);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-neutral-weak-active,#ededed);--wp-ui-button-background-color-disabled:var(--wpds-color-bg-interactive-neutral-weak-disabled,#0000)}}.abbb272e2ce49bd6__is-unstyled{background:none;border:none;min-width:unset}.cf59cf1b69629838__is-compact{--wp-ui-button-height:32px}._914b42f315c0e580__is-loading{color:#0000;&:not([data-disabled]):is(:hover,:active,:focus){color:#0000}*{opacity:0}&:before{opacity:1;transition-delay:.05s;@media not (prefers-reduced-motion){animation:_5a1d53da6f830c8d__loading-animation 1s linear infinite}}}[aria-pressed=true].ad0619a3217c6a5b__is-minimal.e722a8f96726aa99__is-neutral{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-neutral-strong,#2d2d2d);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-neutral-strong,#2d2d2d);--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-neutral-strong,#f0f0f0);--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-neutral-strong,#f0f0f0)}}@keyframes _5a1d53da6f830c8d__loading-animation{0%{transform:translate(-50%,-50%) rotate(0deg)}to{transform:translate(-50%,-50%) rotate(1turn)}}'); |
| 11187 |
} |
| 11188 |
var style_default2 = { "button": "_97b0fc33c028be1a__button", "is-unstyled": "abbb272e2ce49bd6__is-unstyled", "is-loading": "_914b42f315c0e580__is-loading", "is-small": "_908205475f9f2a92__is-small", "is-brand": "dd460c965226cc77__is-brand", "is-outline": "_62d5a778b7b258ee__is-outline", "is-minimal": "ad0619a3217c6a5b__is-minimal", "is-neutral": "e722a8f96726aa99__is-neutral", "is-solid": "b50b3358c5fb4d0b__is-solid", "is-compact": "cf59cf1b69629838__is-compact", "loading-animation": "_5a1d53da6f830c8d__loading-animation" }; |
| 11189 |
if (typeof process === "undefined" || true) { |
| 11190 |
registerStyle2("e3ae230cea", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._336cd3e4e743482f__box-sizing{box-sizing:border-box;*,:after,:before{box-sizing:inherit}}}"); |
| 11191 |
} |
| 11192 |
var resets_default = { "box-sizing": "_336cd3e4e743482f__box-sizing" }; |
| 11193 |
if (typeof process === "undefined" || true) { |
| 11194 |
registerStyle2("2a5ab8f3a7", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._08e8a2e44959f892__outset-ring--focus,._970d04df7376df67__outset-ring--focus-within-except-active,.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible,.cd83dfc2126a0846__outset-ring--focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active,.ecadb9e080e2dfa5__outset-ring--focus-parent-visible{@media not (prefers-reduced-motion){--_gcd-a-transition:outline 0.1s ease-out;transition:outline .1s ease-out}outline:0 solid #0000;outline-offset:1px}._08e8a2e44959f892__outset-ring--focus:focus,._970d04df7376df67__outset-ring--focus-within-except-active:focus-within:not(:has(:active)),.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible:focus-within:has(:focus-visible),.cd83dfc2126a0846__outset-ring--focus-within:focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible:focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active:focus:not(:active),:focus-visible .ecadb9e080e2dfa5__outset-ring--focus-parent-visible{--_gcd-a-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));--_gcd-div-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9))}}"); |
| 11195 |
} |
| 11196 |
var focus_default = { "outset-ring--focus": "_08e8a2e44959f892__outset-ring--focus", "outset-ring--focus-except-active": "e25b2bdd7aa21721__outset-ring--focus-except-active", "outset-ring--focus-visible": "d0541bc9dd9dc7b6__outset-ring--focus-visible", "outset-ring--focus-within": "cd83dfc2126a0846__outset-ring--focus-within", "outset-ring--focus-within-except-active": "_970d04df7376df67__outset-ring--focus-within-except-active", "outset-ring--focus-within-visible": "c5cb3ee4bddaa8e4__outset-ring--focus-within-visible", "outset-ring--focus-parent-visible": "ecadb9e080e2dfa5__outset-ring--focus-parent-visible" }; |
| 11197 |
if (typeof process === "undefined" || true) { |
| 11198 |
registerStyle2("1fb29d3a3c", "._6defc79820e382c6__button{box-sizing:var(--_gcd-button-box-sizing,border-box);font-family:var(--_gcd-button-font-family,inherit);font-size:var(--_gcd-button-font-size,inherit);font-weight:var(--_gcd-button-font-weight,inherit)}.d2cff2e5dea83bd1__input{box-sizing:var(--_gcd-input-box-sizing,border-box);font-family:var(--_gcd-input-font-family,inherit);font-size:var(--_gcd-input-font-size,inherit);font-weight:var(--_gcd-input-font-weight,inherit);margin:var(--_gcd-input-margin,0);&:is(textarea,[type=text],[type=password],[type=color],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){background-color:var(--_gcd-input-background-color,#0000);border:var(--_gcd-input-border,none);border-radius:var(--_gcd-input-border-radius,0);box-shadow:var(--_gcd-input-box-shadow,0 0 0 #0000);color:var(--_gcd-input-color,var(--wpds-color-fg-interactive-neutral,#1e1e1e));&:focus{border-color:var(--_gcd-input-border-color-focus,var(--wp-admin-theme-color));box-shadow:var(--_gcd-input-box-shadow-focus,none);outline:var(--_gcd-input-outline-focus,none)}&:disabled{background:var(--_gcd-input-background-disabled,#0000);border-color:var(--_gcd-input-border-color-disabled,#0000);box-shadow:var(--_gcd-input-box-shadow-disabled,none);color:var(--_gcd-input-color-disabled,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}&::placeholder{color:var(--_gcd-input-placeholder-color,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}}&:is(textarea,[type=text],[type=password],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){line-height:var(--_gcd-input-line-height,inherit);min-height:var(--_gcd-input-min-height,auto);padding:var(--_gcd-input-padding,0)}}._547d86373d02e108__textarea{box-sizing:var(--_gcd-textarea-box-sizing,border-box);overflow:var(--_gcd-textarea-overflow,auto);resize:var(--_gcd-textarea-resize,block)}._8c15fd0ed9f28ba4__div{outline:var(--_gcd-div-outline,0 solid #0000)}p._43cec3e1eec1066d__p{font-size:var(--_gcd-p-font-size,13px);line-height:var(--_gcd-p-line-height,1.5);margin:var(--_gcd-p-margin,0)}:is(h1,h2,h3,h4,h5,h6).e97669c6d9a38497__heading{color:var(--_gcd-heading-color,var(--wpds-color-fg-content-neutral,#1e1e1e));font-size:var(--_gcd-heading-font-size,inherit);font-weight:var(--_gcd-heading-font-weight,var(--wpds-typography-font-weight-medium,499));margin:var(--_gcd-heading-margin,0)}._2c0831b0499dbd6e__a,._2c0831b0499dbd6e__a:is(:hover,:focus,:active){border-radius:var(--_gcd-a-border-radius,0);box-shadow:var(--_gcd-a-box-shadow,none);color:var(--_gcd-a-color,inherit);outline:var(--_gcd-a-outline,0 solid #0000);transition:var(--_gcd-a-transition,none)}"); |
| 11199 |
} |
| 11200 |
var global_css_defense_default2 = { "button": "_6defc79820e382c6__button", "input": "d2cff2e5dea83bd1__input", "textarea": "_547d86373d02e108__textarea", "div": "_8c15fd0ed9f28ba4__div", "p": "_43cec3e1eec1066d__p", "heading": "e97669c6d9a38497__heading", "a": "_2c0831b0499dbd6e__a" }; |
| 11201 |
var Button3 = (0, import_element12.forwardRef)( |
| 11202 |
function Button22({ |
| 11203 |
tone = "brand", |
| 11204 |
variant = "solid", |
| 11205 |
size: size4 = "default", |
| 11206 |
className, |
| 11207 |
focusableWhenDisabled = true, |
| 11208 |
disabled: disabled2, |
| 11209 |
loading, |
| 11210 |
loadingAnnouncement = (0, import_i18n.__)("Loading"), |
| 11211 |
children, |
| 11212 |
...props |
| 11213 |
}, ref) { |
| 11214 |
const mergedClassName = clsx_default( |
| 11215 |
global_css_defense_default2.button, |
| 11216 |
resets_default["box-sizing"], |
| 11217 |
focus_default["outset-ring--focus-except-active"], |
| 11218 |
variant !== "unstyled" && style_default2.button, |
| 11219 |
style_default2[`is-${tone}`], |
| 11220 |
style_default2[`is-${variant}`], |
| 11221 |
style_default2[`is-${size4}`], |
| 11222 |
loading && style_default2["is-loading"], |
| 11223 |
className |
| 11224 |
); |
| 11225 |
(0, import_element12.useEffect)(() => { |
| 11226 |
if (loading && loadingAnnouncement) { |
| 11227 |
speak(loadingAnnouncement); |
| 11228 |
} |
| 11229 |
}, [loading, loadingAnnouncement]); |
| 11230 |
return /* @__PURE__ */ (0, import_jsx_runtime17.jsx)( |
| 11231 |
Button, |
| 11232 |
{ |
| 11233 |
ref, |
| 11234 |
className: mergedClassName, |
| 11235 |
focusableWhenDisabled, |
| 11236 |
disabled: disabled2 ?? loading, |
| 11237 |
...props, |
| 11238 |
children |
| 11239 |
} |
| 11240 |
); |
| 11241 |
} |
| 11242 |
); |
| 11243 |
|
| 11244 |
// packages/ui/build-module/button/icon.mjs |
| 11245 |
var import_element14 = __toESM(require_element(), 1); |
| 11246 |
|
| 11247 |
// packages/ui/build-module/icon/icon.mjs |
| 11248 |
var import_element13 = __toESM(require_element(), 1); |
| 11249 |
var import_primitives = __toESM(require_primitives(), 1); |
| 11250 |
var import_jsx_runtime18 = __toESM(require_jsx_runtime(), 1); |
| 11251 |
var Icon = (0, import_element13.forwardRef)(function Icon2({ icon, size: size4 = 24, ...restProps }, ref) { |
| 11252 |
return /* @__PURE__ */ (0, import_jsx_runtime18.jsx)( |
| 11253 |
import_primitives.SVG, |
| 11254 |
{ |
| 11255 |
ref, |
| 11256 |
fill: "currentColor", |
| 11257 |
...icon.props, |
| 11258 |
...restProps, |
| 11259 |
width: size4, |
| 11260 |
height: size4 |
| 11261 |
} |
| 11262 |
); |
| 11263 |
}); |
| 11264 |
|
| 11265 |
// packages/ui/build-module/button/icon.mjs |
| 11266 |
var import_jsx_runtime19 = __toESM(require_jsx_runtime(), 1); |
| 11267 |
var ButtonIcon = (0, import_element14.forwardRef)( |
| 11268 |
function ButtonIcon2({ icon, ...props }, ref) { |
| 11269 |
return /* @__PURE__ */ (0, import_jsx_runtime19.jsx)( |
| 11270 |
Icon, |
| 11271 |
{ |
| 11272 |
ref, |
| 11273 |
icon, |
| 11274 |
viewBox: "4 4 16 16", |
| 11275 |
size: 16, |
| 11276 |
...props |
| 11277 |
} |
| 11278 |
); |
| 11279 |
} |
| 11280 |
); |
| 11281 |
|
| 11282 |
// packages/ui/build-module/button/index.mjs |
| 11283 |
ButtonIcon.displayName = "Button.Icon"; |
| 11284 |
var Button4 = Object.assign(Button3, { |
| 11285 |
/** |
| 11286 |
* An icon component specifically designed to work well when rendered inside |
| 11287 |
* a `Button` component. |
| 11288 |
*/ |
| 11289 |
Icon: ButtonIcon |
| 11290 |
}); |
| 11291 |
|
| 11292 |
// packages/ui/build-module/card/index.mjs |
| 11293 |
var card_exports = {}; |
| 11294 |
__export(card_exports, { |
| 11295 |
Content: () => Content, |
| 11296 |
FullBleed: () => FullBleed, |
| 11297 |
Header: () => Header, |
| 11298 |
Root: () => Root, |
| 11299 |
Title: () => Title |
| 11300 |
}); |
| 11301 |
|
| 11302 |
// packages/ui/build-module/card/root.mjs |
| 11303 |
var import_element15 = __toESM(require_element(), 1); |
| 11304 |
var STYLE_HASH_ATTRIBUTE3 = "data-wp-hash"; |
| 11305 |
function getRuntime3() { |
| 11306 |
const globalScope = globalThis; |
| 11307 |
if (globalScope.__wpStyleRuntime) { |
| 11308 |
return globalScope.__wpStyleRuntime; |
| 11309 |
} |
| 11310 |
globalScope.__wpStyleRuntime = { |
| 11311 |
documents: /* @__PURE__ */ new Map(), |
| 11312 |
styles: /* @__PURE__ */ new Map(), |
| 11313 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11314 |
}; |
| 11315 |
if (typeof document !== "undefined") { |
| 11316 |
registerDocument3(document); |
| 11317 |
} |
| 11318 |
return globalScope.__wpStyleRuntime; |
| 11319 |
} |
| 11320 |
function documentContainsStyleHash3(targetDocument, hash) { |
| 11321 |
if (!targetDocument.head) { |
| 11322 |
return false; |
| 11323 |
} |
| 11324 |
for (const style of targetDocument.head.querySelectorAll( |
| 11325 |
`style[${STYLE_HASH_ATTRIBUTE3}]` |
| 11326 |
)) { |
| 11327 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE3) === hash) { |
| 11328 |
return true; |
| 11329 |
} |
| 11330 |
} |
| 11331 |
return false; |
| 11332 |
} |
| 11333 |
function injectStyle3(targetDocument, hash, css) { |
| 11334 |
if (!targetDocument.head) { |
| 11335 |
return; |
| 11336 |
} |
| 11337 |
const runtime = getRuntime3(); |
| 11338 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11339 |
if (!injectedStyles) { |
| 11340 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11341 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11342 |
} |
| 11343 |
if (injectedStyles.has(hash)) { |
| 11344 |
return; |
| 11345 |
} |
| 11346 |
if (documentContainsStyleHash3(targetDocument, hash)) { |
| 11347 |
injectedStyles.add(hash); |
| 11348 |
return; |
| 11349 |
} |
| 11350 |
const style = targetDocument.createElement("style"); |
| 11351 |
style.setAttribute(STYLE_HASH_ATTRIBUTE3, hash); |
| 11352 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11353 |
targetDocument.head.appendChild(style); |
| 11354 |
injectedStyles.add(hash); |
| 11355 |
} |
| 11356 |
function registerDocument3(targetDocument) { |
| 11357 |
const runtime = getRuntime3(); |
| 11358 |
runtime.documents.set( |
| 11359 |
targetDocument, |
| 11360 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11361 |
); |
| 11362 |
for (const [hash, css] of runtime.styles) { |
| 11363 |
injectStyle3(targetDocument, hash, css); |
| 11364 |
} |
| 11365 |
return () => { |
| 11366 |
const count = runtime.documents.get(targetDocument); |
| 11367 |
if (count === void 0) { |
| 11368 |
return; |
| 11369 |
} |
| 11370 |
if (count <= 1) { |
| 11371 |
runtime.documents.delete(targetDocument); |
| 11372 |
return; |
| 11373 |
} |
| 11374 |
runtime.documents.set(targetDocument, count - 1); |
| 11375 |
}; |
| 11376 |
} |
| 11377 |
function registerStyle3(hash, css) { |
| 11378 |
const runtime = getRuntime3(); |
| 11379 |
runtime.styles.set(hash, css); |
| 11380 |
for (const targetDocument of runtime.documents.keys()) { |
| 11381 |
injectStyle3(targetDocument, hash, css); |
| 11382 |
} |
| 11383 |
} |
| 11384 |
if (typeof process === "undefined" || true) { |
| 11385 |
registerStyle3("e3ae230cea", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._336cd3e4e743482f__box-sizing{box-sizing:border-box;*,:after,:before{box-sizing:inherit}}}"); |
| 11386 |
} |
| 11387 |
var resets_default2 = { "box-sizing": "_336cd3e4e743482f__box-sizing" }; |
| 11388 |
if (typeof process === "undefined" || true) { |
| 11389 |
registerStyle3("14f5e9ddeb", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._02872bf298eadc43__root{--wp-ui-card-padding:var(--wpds-dimension-padding-2xl,24px);--wp-ui-card-header-content-gap:var(--wpds-dimension-gap-xl,24px);--wp-ui-card-header-content-margin:calc(var(--wp-ui-card-header-content-gap) - var(--wp-ui-card-padding));background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:var(--wpds-border-radius-lg,8px);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;overflow:clip}._5dffdaf2a6e669ac__content,.bbccc92e6ba5662d__header{padding:var(--wp-ui-card-padding);&:not(:first-child):not(:last-child){padding-block-end:0}}.bbccc92e6ba5662d__header+._5dffdaf2a6e669ac__content{margin-block-start:var(--wp-ui-card-header-content-margin);padding-block-start:0}.c1fa192587e1b4a6__fullbleed{margin-inline:calc(var(--wp-ui-card-padding)*-1);width:calc(100% + var(--wp-ui-card-padding)*2)}}"); |
| 11390 |
} |
| 11391 |
var style_default3 = { "root": "_02872bf298eadc43__root", "header": "bbccc92e6ba5662d__header", "content": "_5dffdaf2a6e669ac__content", "fullbleed": "c1fa192587e1b4a6__fullbleed" }; |
| 11392 |
var Root = (0, import_element15.forwardRef)(function Card({ render: render4, ...restProps }, ref) { |
| 11393 |
const mergedClassName = clsx_default(style_default3.root, resets_default2["box-sizing"]); |
| 11394 |
const element = useRender({ |
| 11395 |
defaultTagName: "div", |
| 11396 |
render: render4, |
| 11397 |
ref, |
| 11398 |
props: mergeProps({ className: mergedClassName }, restProps) |
| 11399 |
}); |
| 11400 |
return element; |
| 11401 |
}); |
| 11402 |
|
| 11403 |
// packages/ui/build-module/card/header.mjs |
| 11404 |
var import_element16 = __toESM(require_element(), 1); |
| 11405 |
var STYLE_HASH_ATTRIBUTE4 = "data-wp-hash"; |
| 11406 |
function getRuntime4() { |
| 11407 |
const globalScope = globalThis; |
| 11408 |
if (globalScope.__wpStyleRuntime) { |
| 11409 |
return globalScope.__wpStyleRuntime; |
| 11410 |
} |
| 11411 |
globalScope.__wpStyleRuntime = { |
| 11412 |
documents: /* @__PURE__ */ new Map(), |
| 11413 |
styles: /* @__PURE__ */ new Map(), |
| 11414 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11415 |
}; |
| 11416 |
if (typeof document !== "undefined") { |
| 11417 |
registerDocument4(document); |
| 11418 |
} |
| 11419 |
return globalScope.__wpStyleRuntime; |
| 11420 |
} |
| 11421 |
function documentContainsStyleHash4(targetDocument, hash) { |
| 11422 |
if (!targetDocument.head) { |
| 11423 |
return false; |
| 11424 |
} |
| 11425 |
for (const style of targetDocument.head.querySelectorAll( |
| 11426 |
`style[${STYLE_HASH_ATTRIBUTE4}]` |
| 11427 |
)) { |
| 11428 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE4) === hash) { |
| 11429 |
return true; |
| 11430 |
} |
| 11431 |
} |
| 11432 |
return false; |
| 11433 |
} |
| 11434 |
function injectStyle4(targetDocument, hash, css) { |
| 11435 |
if (!targetDocument.head) { |
| 11436 |
return; |
| 11437 |
} |
| 11438 |
const runtime = getRuntime4(); |
| 11439 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11440 |
if (!injectedStyles) { |
| 11441 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11442 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11443 |
} |
| 11444 |
if (injectedStyles.has(hash)) { |
| 11445 |
return; |
| 11446 |
} |
| 11447 |
if (documentContainsStyleHash4(targetDocument, hash)) { |
| 11448 |
injectedStyles.add(hash); |
| 11449 |
return; |
| 11450 |
} |
| 11451 |
const style = targetDocument.createElement("style"); |
| 11452 |
style.setAttribute(STYLE_HASH_ATTRIBUTE4, hash); |
| 11453 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11454 |
targetDocument.head.appendChild(style); |
| 11455 |
injectedStyles.add(hash); |
| 11456 |
} |
| 11457 |
function registerDocument4(targetDocument) { |
| 11458 |
const runtime = getRuntime4(); |
| 11459 |
runtime.documents.set( |
| 11460 |
targetDocument, |
| 11461 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11462 |
); |
| 11463 |
for (const [hash, css] of runtime.styles) { |
| 11464 |
injectStyle4(targetDocument, hash, css); |
| 11465 |
} |
| 11466 |
return () => { |
| 11467 |
const count = runtime.documents.get(targetDocument); |
| 11468 |
if (count === void 0) { |
| 11469 |
return; |
| 11470 |
} |
| 11471 |
if (count <= 1) { |
| 11472 |
runtime.documents.delete(targetDocument); |
| 11473 |
return; |
| 11474 |
} |
| 11475 |
runtime.documents.set(targetDocument, count - 1); |
| 11476 |
}; |
| 11477 |
} |
| 11478 |
function registerStyle4(hash, css) { |
| 11479 |
const runtime = getRuntime4(); |
| 11480 |
runtime.styles.set(hash, css); |
| 11481 |
for (const targetDocument of runtime.documents.keys()) { |
| 11482 |
injectStyle4(targetDocument, hash, css); |
| 11483 |
} |
| 11484 |
} |
| 11485 |
if (typeof process === "undefined" || true) { |
| 11486 |
registerStyle4("14f5e9ddeb", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._02872bf298eadc43__root{--wp-ui-card-padding:var(--wpds-dimension-padding-2xl,24px);--wp-ui-card-header-content-gap:var(--wpds-dimension-gap-xl,24px);--wp-ui-card-header-content-margin:calc(var(--wp-ui-card-header-content-gap) - var(--wp-ui-card-padding));background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:var(--wpds-border-radius-lg,8px);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;overflow:clip}._5dffdaf2a6e669ac__content,.bbccc92e6ba5662d__header{padding:var(--wp-ui-card-padding);&:not(:first-child):not(:last-child){padding-block-end:0}}.bbccc92e6ba5662d__header+._5dffdaf2a6e669ac__content{margin-block-start:var(--wp-ui-card-header-content-margin);padding-block-start:0}.c1fa192587e1b4a6__fullbleed{margin-inline:calc(var(--wp-ui-card-padding)*-1);width:calc(100% + var(--wp-ui-card-padding)*2)}}"); |
| 11487 |
} |
| 11488 |
var style_default4 = { "root": "_02872bf298eadc43__root", "header": "bbccc92e6ba5662d__header", "content": "_5dffdaf2a6e669ac__content", "fullbleed": "c1fa192587e1b4a6__fullbleed" }; |
| 11489 |
var Header = (0, import_element16.forwardRef)( |
| 11490 |
function CardHeader({ render: render4, ...props }, ref) { |
| 11491 |
const element = useRender({ |
| 11492 |
defaultTagName: "div", |
| 11493 |
render: render4, |
| 11494 |
ref, |
| 11495 |
props: mergeProps({ className: style_default4.header }, props) |
| 11496 |
}); |
| 11497 |
return element; |
| 11498 |
} |
| 11499 |
); |
| 11500 |
|
| 11501 |
// packages/ui/build-module/card/content.mjs |
| 11502 |
var import_element17 = __toESM(require_element(), 1); |
| 11503 |
var STYLE_HASH_ATTRIBUTE5 = "data-wp-hash"; |
| 11504 |
function getRuntime5() { |
| 11505 |
const globalScope = globalThis; |
| 11506 |
if (globalScope.__wpStyleRuntime) { |
| 11507 |
return globalScope.__wpStyleRuntime; |
| 11508 |
} |
| 11509 |
globalScope.__wpStyleRuntime = { |
| 11510 |
documents: /* @__PURE__ */ new Map(), |
| 11511 |
styles: /* @__PURE__ */ new Map(), |
| 11512 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11513 |
}; |
| 11514 |
if (typeof document !== "undefined") { |
| 11515 |
registerDocument5(document); |
| 11516 |
} |
| 11517 |
return globalScope.__wpStyleRuntime; |
| 11518 |
} |
| 11519 |
function documentContainsStyleHash5(targetDocument, hash) { |
| 11520 |
if (!targetDocument.head) { |
| 11521 |
return false; |
| 11522 |
} |
| 11523 |
for (const style of targetDocument.head.querySelectorAll( |
| 11524 |
`style[${STYLE_HASH_ATTRIBUTE5}]` |
| 11525 |
)) { |
| 11526 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE5) === hash) { |
| 11527 |
return true; |
| 11528 |
} |
| 11529 |
} |
| 11530 |
return false; |
| 11531 |
} |
| 11532 |
function injectStyle5(targetDocument, hash, css) { |
| 11533 |
if (!targetDocument.head) { |
| 11534 |
return; |
| 11535 |
} |
| 11536 |
const runtime = getRuntime5(); |
| 11537 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11538 |
if (!injectedStyles) { |
| 11539 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11540 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11541 |
} |
| 11542 |
if (injectedStyles.has(hash)) { |
| 11543 |
return; |
| 11544 |
} |
| 11545 |
if (documentContainsStyleHash5(targetDocument, hash)) { |
| 11546 |
injectedStyles.add(hash); |
| 11547 |
return; |
| 11548 |
} |
| 11549 |
const style = targetDocument.createElement("style"); |
| 11550 |
style.setAttribute(STYLE_HASH_ATTRIBUTE5, hash); |
| 11551 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11552 |
targetDocument.head.appendChild(style); |
| 11553 |
injectedStyles.add(hash); |
| 11554 |
} |
| 11555 |
function registerDocument5(targetDocument) { |
| 11556 |
const runtime = getRuntime5(); |
| 11557 |
runtime.documents.set( |
| 11558 |
targetDocument, |
| 11559 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11560 |
); |
| 11561 |
for (const [hash, css] of runtime.styles) { |
| 11562 |
injectStyle5(targetDocument, hash, css); |
| 11563 |
} |
| 11564 |
return () => { |
| 11565 |
const count = runtime.documents.get(targetDocument); |
| 11566 |
if (count === void 0) { |
| 11567 |
return; |
| 11568 |
} |
| 11569 |
if (count <= 1) { |
| 11570 |
runtime.documents.delete(targetDocument); |
| 11571 |
return; |
| 11572 |
} |
| 11573 |
runtime.documents.set(targetDocument, count - 1); |
| 11574 |
}; |
| 11575 |
} |
| 11576 |
function registerStyle5(hash, css) { |
| 11577 |
const runtime = getRuntime5(); |
| 11578 |
runtime.styles.set(hash, css); |
| 11579 |
for (const targetDocument of runtime.documents.keys()) { |
| 11580 |
injectStyle5(targetDocument, hash, css); |
| 11581 |
} |
| 11582 |
} |
| 11583 |
if (typeof process === "undefined" || true) { |
| 11584 |
registerStyle5("14f5e9ddeb", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._02872bf298eadc43__root{--wp-ui-card-padding:var(--wpds-dimension-padding-2xl,24px);--wp-ui-card-header-content-gap:var(--wpds-dimension-gap-xl,24px);--wp-ui-card-header-content-margin:calc(var(--wp-ui-card-header-content-gap) - var(--wp-ui-card-padding));background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:var(--wpds-border-radius-lg,8px);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;overflow:clip}._5dffdaf2a6e669ac__content,.bbccc92e6ba5662d__header{padding:var(--wp-ui-card-padding);&:not(:first-child):not(:last-child){padding-block-end:0}}.bbccc92e6ba5662d__header+._5dffdaf2a6e669ac__content{margin-block-start:var(--wp-ui-card-header-content-margin);padding-block-start:0}.c1fa192587e1b4a6__fullbleed{margin-inline:calc(var(--wp-ui-card-padding)*-1);width:calc(100% + var(--wp-ui-card-padding)*2)}}"); |
| 11585 |
} |
| 11586 |
var style_default5 = { "root": "_02872bf298eadc43__root", "header": "bbccc92e6ba5662d__header", "content": "_5dffdaf2a6e669ac__content", "fullbleed": "c1fa192587e1b4a6__fullbleed" }; |
| 11587 |
var Content = (0, import_element17.forwardRef)( |
| 11588 |
function CardContent({ render: render4, ...props }, ref) { |
| 11589 |
const element = useRender({ |
| 11590 |
defaultTagName: "div", |
| 11591 |
render: render4, |
| 11592 |
ref, |
| 11593 |
props: mergeProps({ className: style_default5.content }, props) |
| 11594 |
}); |
| 11595 |
return element; |
| 11596 |
} |
| 11597 |
); |
| 11598 |
|
| 11599 |
// packages/ui/build-module/card/full-bleed.mjs |
| 11600 |
var import_element18 = __toESM(require_element(), 1); |
| 11601 |
var STYLE_HASH_ATTRIBUTE6 = "data-wp-hash"; |
| 11602 |
function getRuntime6() { |
| 11603 |
const globalScope = globalThis; |
| 11604 |
if (globalScope.__wpStyleRuntime) { |
| 11605 |
return globalScope.__wpStyleRuntime; |
| 11606 |
} |
| 11607 |
globalScope.__wpStyleRuntime = { |
| 11608 |
documents: /* @__PURE__ */ new Map(), |
| 11609 |
styles: /* @__PURE__ */ new Map(), |
| 11610 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 11611 |
}; |
| 11612 |
if (typeof document !== "undefined") { |
| 11613 |
registerDocument6(document); |
| 11614 |
} |
| 11615 |
return globalScope.__wpStyleRuntime; |
| 11616 |
} |
| 11617 |
function documentContainsStyleHash6(targetDocument, hash) { |
| 11618 |
if (!targetDocument.head) { |
| 11619 |
return false; |
| 11620 |
} |
| 11621 |
for (const style of targetDocument.head.querySelectorAll( |
| 11622 |
`style[${STYLE_HASH_ATTRIBUTE6}]` |
| 11623 |
)) { |
| 11624 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE6) === hash) { |
| 11625 |
return true; |
| 11626 |
} |
| 11627 |
} |
| 11628 |
return false; |
| 11629 |
} |
| 11630 |
function injectStyle6(targetDocument, hash, css) { |
| 11631 |
if (!targetDocument.head) { |
| 11632 |
return; |
| 11633 |
} |
| 11634 |
const runtime = getRuntime6(); |
| 11635 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 11636 |
if (!injectedStyles) { |
| 11637 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 11638 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 11639 |
} |
| 11640 |
if (injectedStyles.has(hash)) { |
| 11641 |
return; |
| 11642 |
} |
| 11643 |
if (documentContainsStyleHash6(targetDocument, hash)) { |
| 11644 |
injectedStyles.add(hash); |
| 11645 |
return; |
| 11646 |
} |
| 11647 |
const style = targetDocument.createElement("style"); |
| 11648 |
style.setAttribute(STYLE_HASH_ATTRIBUTE6, hash); |
| 11649 |
style.appendChild(targetDocument.createTextNode(css)); |
| 11650 |
targetDocument.head.appendChild(style); |
| 11651 |
injectedStyles.add(hash); |
| 11652 |
} |
| 11653 |
function registerDocument6(targetDocument) { |
| 11654 |
const runtime = getRuntime6(); |
| 11655 |
runtime.documents.set( |
| 11656 |
targetDocument, |
| 11657 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 11658 |
); |
| 11659 |
for (const [hash, css] of runtime.styles) { |
| 11660 |
injectStyle6(targetDocument, hash, css); |
| 11661 |
} |
| 11662 |
return () => { |
| 11663 |
const count = runtime.documents.get(targetDocument); |
| 11664 |
if (count === void 0) { |
| 11665 |
return; |
| 11666 |
} |
| 11667 |
if (count <= 1) { |
| 11668 |
runtime.documents.delete(targetDocument); |
| 11669 |
return; |
| 11670 |
} |
| 11671 |
runtime.documents.set(targetDocument, count - 1); |
| 11672 |
}; |
| 11673 |
} |
| 11674 |
function registerStyle6(hash, css) { |
| 11675 |
const runtime = getRuntime6(); |
| 11676 |
runtime.styles.set(hash, css); |
| 11677 |
for (const targetDocument of runtime.documents.keys()) { |
| 11678 |
injectStyle6(targetDocument, hash, css); |
| 11679 |
} |
| 11680 |
} |
| 11681 |
if (typeof process === "undefined" || true) { |
| 11682 |
registerStyle6("14f5e9ddeb", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._02872bf298eadc43__root{--wp-ui-card-padding:var(--wpds-dimension-padding-2xl,24px);--wp-ui-card-header-content-gap:var(--wpds-dimension-gap-xl,24px);--wp-ui-card-header-content-margin:calc(var(--wp-ui-card-header-content-gap) - var(--wp-ui-card-padding));background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:var(--wpds-border-radius-lg,8px);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;overflow:clip}._5dffdaf2a6e669ac__content,.bbccc92e6ba5662d__header{padding:var(--wp-ui-card-padding);&:not(:first-child):not(:last-child){padding-block-end:0}}.bbccc92e6ba5662d__header+._5dffdaf2a6e669ac__content{margin-block-start:var(--wp-ui-card-header-content-margin);padding-block-start:0}.c1fa192587e1b4a6__fullbleed{margin-inline:calc(var(--wp-ui-card-padding)*-1);width:calc(100% + var(--wp-ui-card-padding)*2)}}"); |
| 11683 |
} |
| 11684 |
var style_default6 = { "root": "_02872bf298eadc43__root", "header": "bbccc92e6ba5662d__header", "content": "_5dffdaf2a6e669ac__content", "fullbleed": "c1fa192587e1b4a6__fullbleed" }; |
| 11685 |
var FullBleed = (0, import_element18.forwardRef)( |
| 11686 |
function CardFullBleed({ render: render4, ...props }, ref) { |
| 11687 |
const element = useRender({ |
| 11688 |
defaultTagName: "div", |
| 11689 |
render: render4, |
| 11690 |
ref, |
| 11691 |
props: mergeProps( |
| 11692 |
{ className: style_default6.fullbleed }, |
| 11693 |
props |
| 11694 |
) |
| 11695 |
}); |
| 11696 |
return element; |
| 11697 |
} |
| 11698 |
); |
| 11699 |
|
| 11700 |
// packages/ui/build-module/card/title.mjs |
| 11701 |
var import_element19 = __toESM(require_element(), 1); |
| 11702 |
var import_jsx_runtime20 = __toESM(require_jsx_runtime(), 1); |
| 11703 |
var DEFAULT_TAG = /* @__PURE__ */ (0, import_jsx_runtime20.jsx)("div", {}); |
| 11704 |
var Title = (0, import_element19.forwardRef)( |
| 11705 |
function CardTitle({ render: render4 = DEFAULT_TAG, children, ...props }, ref) { |
| 11706 |
return /* @__PURE__ */ (0, import_jsx_runtime20.jsx)( |
| 11707 |
Text, |
| 11708 |
{ |
| 11709 |
ref, |
| 11710 |
variant: "heading-lg", |
| 11711 |
render: render4, |
| 11712 |
...props, |
| 11713 |
children |
| 11714 |
} |
| 11715 |
); |
| 11716 |
} |
| 11717 |
); |
| 11718 |
|
| 11719 |
// packages/icons/build-module/library/arrow-down.mjs |
| 11720 |
var import_primitives2 = __toESM(require_primitives(), 1); |
| 11721 |
var import_jsx_runtime21 = __toESM(require_jsx_runtime(), 1); |
| 11722 |
var arrow_down_default = /* @__PURE__ */ (0, import_jsx_runtime21.jsx)(import_primitives2.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime21.jsx)(import_primitives2.Path, { d: "m16.5 13.5-3.7 3.7V4h-1.5v13.2l-3.8-3.7-1 1 5.5 5.6 5.5-5.6z" }) }); |
| 11723 |
|
| 11724 |
// packages/icons/build-module/library/arrow-left.mjs |
| 11725 |
var import_primitives3 = __toESM(require_primitives(), 1); |
| 11726 |
var import_jsx_runtime22 = __toESM(require_jsx_runtime(), 1); |
| 11727 |
var arrow_left_default = /* @__PURE__ */ (0, import_jsx_runtime22.jsx)(import_primitives3.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime22.jsx)(import_primitives3.Path, { d: "M20 11.2H6.8l3.7-3.7-1-1L3.9 12l5.6 5.5 1-1-3.7-3.7H20z" }) }); |
| 11728 |
|
| 11729 |
// packages/icons/build-module/library/arrow-right.mjs |
| 11730 |
var import_primitives4 = __toESM(require_primitives(), 1); |
| 11731 |
var import_jsx_runtime23 = __toESM(require_jsx_runtime(), 1); |
| 11732 |
var arrow_right_default = /* @__PURE__ */ (0, import_jsx_runtime23.jsx)(import_primitives4.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime23.jsx)(import_primitives4.Path, { d: "m14.5 6.5-1 1 3.7 3.7H4v1.6h13.2l-3.7 3.7 1 1 5.6-5.5z" }) }); |
| 11733 |
|
| 11734 |
// packages/icons/build-module/library/arrow-up.mjs |
| 11735 |
var import_primitives5 = __toESM(require_primitives(), 1); |
| 11736 |
var import_jsx_runtime24 = __toESM(require_jsx_runtime(), 1); |
| 11737 |
var arrow_up_default = /* @__PURE__ */ (0, import_jsx_runtime24.jsx)(import_primitives5.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime24.jsx)(import_primitives5.Path, { d: "M12 3.9 6.5 9.5l1 1 3.8-3.7V20h1.5V6.8l3.7 3.7 1-1z" }) }); |
| 11738 |
|
| 11739 |
// packages/icons/build-module/library/block-table.mjs |
| 11740 |
var import_primitives6 = __toESM(require_primitives(), 1); |
| 11741 |
var import_jsx_runtime25 = __toESM(require_jsx_runtime(), 1); |
| 11742 |
var block_table_default = /* @__PURE__ */ (0, import_jsx_runtime25.jsx)(import_primitives6.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime25.jsx)(import_primitives6.Path, { d: "M19 3H5c-1.1 0-2 .9-2 2v14c0 1.1.9 2 2 2h14c1.1 0 2-.9 2-2V5c0-1.1-.9-2-2-2zM5 4.5h14c.3 0 .5.2.5.5v3.5h-15V5c0-.3.2-.5.5-.5zm8 5.5h6.5v3.5H13V10zm-1.5 3.5h-7V10h7v3.5zm-7 5.5v-4h7v4.5H5c-.3 0-.5-.2-.5-.5zm14.5.5h-6V15h6.5v4c0 .3-.2.5-.5.5z" }) }); |
| 11743 |
|
| 11744 |
// packages/icons/build-module/library/category.mjs |
| 11745 |
var import_primitives7 = __toESM(require_primitives(), 1); |
| 11746 |
var import_jsx_runtime26 = __toESM(require_jsx_runtime(), 1); |
| 11747 |
var category_default = /* @__PURE__ */ (0, import_jsx_runtime26.jsx)(import_primitives7.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime26.jsx)(import_primitives7.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M6 5.5h3a.5.5 0 01.5.5v3a.5.5 0 01-.5.5H6a.5.5 0 01-.5-.5V6a.5.5 0 01.5-.5zM4 6a2 2 0 012-2h3a2 2 0 012 2v3a2 2 0 01-2 2H6a2 2 0 01-2-2V6zm11-.5h3a.5.5 0 01.5.5v3a.5.5 0 01-.5.5h-3a.5.5 0 01-.5-.5V6a.5.5 0 01.5-.5zM13 6a2 2 0 012-2h3a2 2 0 012 2v3a2 2 0 01-2 2h-3a2 2 0 01-2-2V6zm5 8.5h-3a.5.5 0 00-.5.5v3a.5.5 0 00.5.5h3a.5.5 0 00.5-.5v-3a.5.5 0 00-.5-.5zM15 13a2 2 0 00-2 2v3a2 2 0 002 2h3a2 2 0 002-2v-3a2 2 0 00-2-2h-3zm-9 1.5h3a.5.5 0 01.5.5v3a.5.5 0 01-.5.5H6a.5.5 0 01-.5-.5v-3a.5.5 0 01.5-.5zM4 15a2 2 0 012-2h3a2 2 0 012 2v3a2 2 0 01-2 2H6a2 2 0 01-2-2v-3z" }) }); |
| 11748 |
|
| 11749 |
// packages/icons/build-module/library/caution.mjs |
| 11750 |
var import_primitives8 = __toESM(require_primitives(), 1); |
| 11751 |
var import_jsx_runtime27 = __toESM(require_jsx_runtime(), 1); |
| 11752 |
var caution_default = /* @__PURE__ */ (0, import_jsx_runtime27.jsx)(import_primitives8.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime27.jsx)(import_primitives8.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M5.5 12a6.5 6.5 0 1 0 13 0 6.5 6.5 0 0 0-13 0ZM12 4a8 8 0 1 0 0 16 8 8 0 0 0 0-16Zm-.75 12v-1.5h1.5V16h-1.5Zm0-8v5h1.5V8h-1.5Z" }) }); |
| 11753 |
|
| 11754 |
// packages/icons/build-module/library/check.mjs |
| 11755 |
var import_primitives9 = __toESM(require_primitives(), 1); |
| 11756 |
var import_jsx_runtime28 = __toESM(require_jsx_runtime(), 1); |
| 11757 |
var check_default = /* @__PURE__ */ (0, import_jsx_runtime28.jsx)(import_primitives9.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime28.jsx)(import_primitives9.Path, { d: "M16.5 7.5 10 13.9l-2.5-2.4-1 1 3.5 3.6 7.5-7.6z" }) }); |
| 11758 |
|
| 11759 |
// packages/icons/build-module/library/close-small.mjs |
| 11760 |
var import_primitives10 = __toESM(require_primitives(), 1); |
| 11761 |
var import_jsx_runtime29 = __toESM(require_jsx_runtime(), 1); |
| 11762 |
var close_small_default = /* @__PURE__ */ (0, import_jsx_runtime29.jsx)(import_primitives10.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime29.jsx)(import_primitives10.Path, { d: "M12 13.06l3.712 3.713 1.061-1.06L13.061 12l3.712-3.712-1.06-1.06L12 10.938 8.288 7.227l-1.061 1.06L10.939 12l-3.712 3.712 1.06 1.061L12 13.061z" }) }); |
| 11763 |
|
| 11764 |
// packages/icons/build-module/library/close.mjs |
| 11765 |
var import_primitives11 = __toESM(require_primitives(), 1); |
| 11766 |
var import_jsx_runtime30 = __toESM(require_jsx_runtime(), 1); |
| 11767 |
var close_default = /* @__PURE__ */ (0, import_jsx_runtime30.jsx)(import_primitives11.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime30.jsx)(import_primitives11.Path, { d: "m13.06 12 6.47-6.47-1.06-1.06L12 10.94 5.53 4.47 4.47 5.53 10.94 12l-6.47 6.47 1.06 1.06L12 13.06l6.47 6.47 1.06-1.06L13.06 12Z" }) }); |
| 11768 |
|
| 11769 |
// packages/icons/build-module/library/cog.mjs |
| 11770 |
var import_primitives12 = __toESM(require_primitives(), 1); |
| 11771 |
var import_jsx_runtime31 = __toESM(require_jsx_runtime(), 1); |
| 11772 |
var cog_default = /* @__PURE__ */ (0, import_jsx_runtime31.jsx)(import_primitives12.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime31.jsx)(import_primitives12.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M10.289 4.836A1 1 0 0111.275 4h1.306a1 1 0 01.987.836l.244 1.466c.787.26 1.503.679 2.108 1.218l1.393-.522a1 1 0 011.216.437l.653 1.13a1 1 0 01-.23 1.273l-1.148.944a6.025 6.025 0 010 2.435l1.149.946a1 1 0 01.23 1.272l-.653 1.13a1 1 0 01-1.216.437l-1.394-.522c-.605.54-1.32.958-2.108 1.218l-.244 1.466a1 1 0 01-.987.836h-1.306a1 1 0 01-.986-.836l-.244-1.466a5.995 5.995 0 01-2.108-1.218l-1.394.522a1 1 0 01-1.217-.436l-.653-1.131a1 1 0 01.23-1.272l1.149-.946a6.026 6.026 0 010-2.435l-1.148-.944a1 1 0 01-.23-1.272l.653-1.131a1 1 0 011.217-.437l1.393.522a5.994 5.994 0 012.108-1.218l.244-1.466zM14.929 12a3 3 0 11-6 0 3 3 0 016 0z" }) }); |
| 11773 |
|
| 11774 |
// packages/icons/build-module/library/envelope.mjs |
| 11775 |
var import_primitives13 = __toESM(require_primitives(), 1); |
| 11776 |
var import_jsx_runtime32 = __toESM(require_jsx_runtime(), 1); |
| 11777 |
var envelope_default = /* @__PURE__ */ (0, import_jsx_runtime32.jsx)(import_primitives13.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime32.jsx)(import_primitives13.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M3 7c0-1.1.9-2 2-2h14a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V7Zm2-.5h14c.3 0 .5.2.5.5v1L12 13.5 4.5 7.9V7c0-.3.2-.5.5-.5Zm-.5 3.3V17c0 .3.2.5.5.5h14c.3 0 .5-.2.5-.5V9.8L12 15.4 4.5 9.8Z" }) }); |
| 11778 |
|
| 11779 |
// packages/icons/build-module/library/error.mjs |
| 11780 |
var import_primitives14 = __toESM(require_primitives(), 1); |
| 11781 |
var import_jsx_runtime33 = __toESM(require_jsx_runtime(), 1); |
| 11782 |
var error_default = /* @__PURE__ */ (0, import_jsx_runtime33.jsx)(import_primitives14.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime33.jsx)(import_primitives14.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M12.218 5.377a.25.25 0 0 0-.436 0l-7.29 12.96a.25.25 0 0 0 .218.373h14.58a.25.25 0 0 0 .218-.372l-7.29-12.96Zm-1.743-.735c.669-1.19 2.381-1.19 3.05 0l7.29 12.96a1.75 1.75 0 0 1-1.525 2.608H4.71a1.75 1.75 0 0 1-1.525-2.608l7.29-12.96ZM12.75 17.46h-1.5v-1.5h1.5v1.5Zm-1.5-3h1.5v-5h-1.5v5Z" }) }); |
| 11783 |
|
| 11784 |
// packages/icons/build-module/library/format-list-bullets-rtl.mjs |
| 11785 |
var import_primitives15 = __toESM(require_primitives(), 1); |
| 11786 |
var import_jsx_runtime34 = __toESM(require_jsx_runtime(), 1); |
| 11787 |
var format_list_bullets_rtl_default = /* @__PURE__ */ (0, import_jsx_runtime34.jsx)(import_primitives15.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime34.jsx)(import_primitives15.Path, { d: "M4 8.8h8.9V7.2H4v1.6zm0 7h8.9v-1.5H4v1.5zM18 13c-1.1 0-2 .9-2 2s.9 2 2 2 2-.9 2-2-.9-2-2-2zm0-3c1.1 0 2-.9 2-2s-.9-2-2-2-2 .9-2 2 .9 2 2 2z" }) }); |
| 11788 |
|
| 11789 |
// packages/icons/build-module/library/format-list-bullets.mjs |
| 11790 |
var import_primitives16 = __toESM(require_primitives(), 1); |
| 11791 |
var import_jsx_runtime35 = __toESM(require_jsx_runtime(), 1); |
| 11792 |
var format_list_bullets_default = /* @__PURE__ */ (0, import_jsx_runtime35.jsx)(import_primitives16.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime35.jsx)(import_primitives16.Path, { d: "M11.1 15.8H20v-1.5h-8.9v1.5zm0-8.6v1.5H20V7.2h-8.9zM6 13c-1.1 0-2 .9-2 2s.9 2 2 2 2-.9 2-2-.9-2-2-2zm0-7c-1.1 0-2 .9-2 2s.9 2 2 2 2-.9 2-2-.9-2-2-2z" }) }); |
| 11793 |
|
| 11794 |
// packages/icons/build-module/library/funnel.mjs |
| 11795 |
var import_primitives17 = __toESM(require_primitives(), 1); |
| 11796 |
var import_jsx_runtime36 = __toESM(require_jsx_runtime(), 1); |
| 11797 |
var funnel_default = /* @__PURE__ */ (0, import_jsx_runtime36.jsx)(import_primitives17.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime36.jsx)(import_primitives17.Path, { d: "M10 17.5H14V16H10V17.5ZM6 6V7.5H18V6H6ZM8 12.5H16V11H8V12.5Z" }) }); |
| 11798 |
|
| 11799 |
// packages/icons/build-module/library/home.mjs |
| 11800 |
var import_primitives18 = __toESM(require_primitives(), 1); |
| 11801 |
var import_jsx_runtime37 = __toESM(require_jsx_runtime(), 1); |
| 11802 |
var home_default = /* @__PURE__ */ (0, import_jsx_runtime37.jsx)(import_primitives18.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime37.jsx)(import_primitives18.Path, { d: "M12 4L4 7.9V20h16V7.9L12 4zm6.5 14.5H14V13h-4v5.5H5.5V8.8L12 5.7l6.5 3.1v9.7z" }) }); |
| 11803 |
|
| 11804 |
// packages/icons/build-module/library/info.mjs |
| 11805 |
var import_primitives19 = __toESM(require_primitives(), 1); |
| 11806 |
var import_jsx_runtime38 = __toESM(require_jsx_runtime(), 1); |
| 11807 |
var info_default = /* @__PURE__ */ (0, import_jsx_runtime38.jsx)(import_primitives19.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime38.jsx)(import_primitives19.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M5.5 12a6.5 6.5 0 1 0 13 0 6.5 6.5 0 0 0-13 0ZM12 4a8 8 0 1 0 0 16 8 8 0 0 0 0-16Zm.75 4v1.5h-1.5V8h1.5Zm0 8v-5h-1.5v5h1.5Z" }) }); |
| 11808 |
|
| 11809 |
// packages/icons/build-module/library/link.mjs |
| 11810 |
var import_primitives20 = __toESM(require_primitives(), 1); |
| 11811 |
var import_jsx_runtime39 = __toESM(require_jsx_runtime(), 1); |
| 11812 |
var link_default = /* @__PURE__ */ (0, import_jsx_runtime39.jsx)(import_primitives20.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime39.jsx)(import_primitives20.Path, { d: "M10 17.389H8.444A5.194 5.194 0 1 1 8.444 7H10v1.5H8.444a3.694 3.694 0 0 0 0 7.389H10v1.5ZM14 7h1.556a5.194 5.194 0 0 1 0 10.39H14v-1.5h1.556a3.694 3.694 0 0 0 0-7.39H14V7Zm-4.5 6h5v-1.5h-5V13Z" }) }); |
| 11813 |
|
| 11814 |
// packages/icons/build-module/library/mobile.mjs |
| 11815 |
var import_primitives21 = __toESM(require_primitives(), 1); |
| 11816 |
var import_jsx_runtime40 = __toESM(require_jsx_runtime(), 1); |
| 11817 |
var mobile_default = /* @__PURE__ */ (0, import_jsx_runtime40.jsx)(import_primitives21.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime40.jsx)(import_primitives21.Path, { d: "M15 4H9c-1.1 0-2 .9-2 2v12c0 1.1.9 2 2 2h6c1.1 0 2-.9 2-2V6c0-1.1-.9-2-2-2zm.5 14c0 .3-.2.5-.5.5H9c-.3 0-.5-.2-.5-.5V6c0-.3.2-.5.5-.5h6c.3 0 .5.2.5.5v12zm-4.5-.5h2V16h-2v1.5z" }) }); |
| 11818 |
|
| 11819 |
// packages/icons/build-module/library/more-vertical.mjs |
| 11820 |
var import_primitives22 = __toESM(require_primitives(), 1); |
| 11821 |
var import_jsx_runtime41 = __toESM(require_jsx_runtime(), 1); |
| 11822 |
var more_vertical_default = /* @__PURE__ */ (0, import_jsx_runtime41.jsx)(import_primitives22.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime41.jsx)(import_primitives22.Path, { d: "M13 19h-2v-2h2v2zm0-6h-2v-2h2v2zm0-6h-2V5h2v2z" }) }); |
| 11823 |
|
| 11824 |
// packages/icons/build-module/library/next.mjs |
| 11825 |
var import_primitives23 = __toESM(require_primitives(), 1); |
| 11826 |
var import_jsx_runtime42 = __toESM(require_jsx_runtime(), 1); |
| 11827 |
var next_default = /* @__PURE__ */ (0, import_jsx_runtime42.jsx)(import_primitives23.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime42.jsx)(import_primitives23.Path, { d: "M6.6 6L5.4 7l4.5 5-4.5 5 1.1 1 5.5-6-5.4-6zm6 0l-1.1 1 4.5 5-4.5 5 1.1 1 5.5-6-5.5-6z" }) }); |
| 11828 |
|
| 11829 |
// packages/icons/build-module/library/previous.mjs |
| 11830 |
var import_primitives24 = __toESM(require_primitives(), 1); |
| 11831 |
var import_jsx_runtime43 = __toESM(require_jsx_runtime(), 1); |
| 11832 |
var previous_default = /* @__PURE__ */ (0, import_jsx_runtime43.jsx)(import_primitives24.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime43.jsx)(import_primitives24.Path, { d: "M11.6 7l-1.1-1L5 12l5.5 6 1.1-1L7 12l4.6-5zm6 0l-1.1-1-5.5 6 5.5 6 1.1-1-4.6-5 4.6-5z" }) }); |
| 11833 |
|
| 11834 |
// packages/icons/build-module/library/published.mjs |
| 11835 |
var import_primitives25 = __toESM(require_primitives(), 1); |
| 11836 |
var import_jsx_runtime44 = __toESM(require_jsx_runtime(), 1); |
| 11837 |
var published_default = /* @__PURE__ */ (0, import_jsx_runtime44.jsx)(import_primitives25.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime44.jsx)(import_primitives25.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M12 18.5a6.5 6.5 0 1 1 0-13 6.5 6.5 0 0 1 0 13ZM4 12a8 8 0 1 1 16 0 8 8 0 0 1-16 0Zm11.53-1.47-1.06-1.06L11 12.94l-1.47-1.47-1.06 1.06L11 15.06l4.53-4.53Z" }) }); |
| 11838 |
|
| 11839 |
// packages/icons/build-module/library/scheduled.mjs |
| 11840 |
var import_primitives26 = __toESM(require_primitives(), 1); |
| 11841 |
var import_jsx_runtime45 = __toESM(require_jsx_runtime(), 1); |
| 11842 |
var scheduled_default = /* @__PURE__ */ (0, import_jsx_runtime45.jsx)(import_primitives26.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime45.jsx)(import_primitives26.Path, { fillRule: "evenodd", clipRule: "evenodd", d: "M12 18.5a6.5 6.5 0 1 1 0-13 6.5 6.5 0 0 1 0 13ZM4 12a8 8 0 1 1 16 0 8 8 0 0 1-16 0Zm9 1V8h-1.5v3.5h-2V13H13Z" }) }); |
| 11843 |
|
| 11844 |
// packages/icons/build-module/library/search.mjs |
| 11845 |
var import_primitives27 = __toESM(require_primitives(), 1); |
| 11846 |
var import_jsx_runtime46 = __toESM(require_jsx_runtime(), 1); |
| 11847 |
var search_default = /* @__PURE__ */ (0, import_jsx_runtime46.jsx)(import_primitives27.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime46.jsx)(import_primitives27.Path, { d: "M13 5c-3.3 0-6 2.7-6 6 0 1.4.5 2.7 1.3 3.7l-3.8 3.8 1.1 1.1 3.8-3.8c1 .8 2.3 1.3 3.7 1.3 3.3 0 6-2.7 6-6S16.3 5 13 5zm0 10.5c-2.5 0-4.5-2-4.5-4.5s2-4.5 4.5-4.5 4.5 2 4.5 4.5-2 4.5-4.5 4.5z" }) }); |
| 11848 |
|
| 11849 |
// packages/icons/build-module/library/seen.mjs |
| 11850 |
var import_primitives28 = __toESM(require_primitives(), 1); |
| 11851 |
var import_jsx_runtime47 = __toESM(require_jsx_runtime(), 1); |
| 11852 |
var seen_default = /* @__PURE__ */ (0, import_jsx_runtime47.jsx)(import_primitives28.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime47.jsx)(import_primitives28.Path, { d: "M3.99961 13C4.67043 13.3354 4.6703 13.3357 4.67017 13.3359L4.67298 13.3305C4.67621 13.3242 4.68184 13.3135 4.68988 13.2985C4.70595 13.2686 4.7316 13.2218 4.76695 13.1608C4.8377 13.0385 4.94692 12.8592 5.09541 12.6419C5.39312 12.2062 5.84436 11.624 6.45435 11.0431C7.67308 9.88241 9.49719 8.75 11.9996 8.75C14.502 8.75 16.3261 9.88241 17.5449 11.0431C18.1549 11.624 18.6061 12.2062 18.9038 12.6419C19.0523 12.8592 19.1615 13.0385 19.2323 13.1608C19.2676 13.2218 19.2933 13.2686 19.3093 13.2985C19.3174 13.3135 19.323 13.3242 19.3262 13.3305L19.3291 13.3359C19.3289 13.3357 19.3288 13.3354 19.9996 13C20.6704 12.6646 20.6703 12.6643 20.6701 12.664L20.6697 12.6632L20.6688 12.6614L20.6662 12.6563L20.6583 12.6408C20.6517 12.6282 20.6427 12.6108 20.631 12.5892C20.6078 12.5459 20.5744 12.4852 20.5306 12.4096C20.4432 12.2584 20.3141 12.0471 20.1423 11.7956C19.7994 11.2938 19.2819 10.626 18.5794 9.9569C17.1731 8.61759 14.9972 7.25 11.9996 7.25C9.00203 7.25 6.82614 8.61759 5.41987 9.9569C4.71736 10.626 4.19984 11.2938 3.85694 11.7956C3.68511 12.0471 3.55605 12.2584 3.4686 12.4096C3.42484 12.4852 3.39142 12.5459 3.36818 12.5892C3.35656 12.6108 3.34748 12.6282 3.34092 12.6408L3.33297 12.6563L3.33041 12.6614L3.32948 12.6632L3.32911 12.664C3.32894 12.6643 3.32879 12.6646 3.99961 13ZM11.9996 16C13.9326 16 15.4996 14.433 15.4996 12.5C15.4996 10.567 13.9326 9 11.9996 9C10.0666 9 8.49961 10.567 8.49961 12.5C8.49961 14.433 10.0666 16 11.9996 16Z" }) }); |
| 11853 |
|
| 11854 |
// packages/icons/build-module/library/unseen.mjs |
| 11855 |
var import_primitives29 = __toESM(require_primitives(), 1); |
| 11856 |
var import_jsx_runtime48 = __toESM(require_jsx_runtime(), 1); |
| 11857 |
var unseen_default = /* @__PURE__ */ (0, import_jsx_runtime48.jsx)(import_primitives29.SVG, { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 24 24", children: /* @__PURE__ */ (0, import_jsx_runtime48.jsx)(import_primitives29.Path, { d: "M20.7 12.7s0-.1-.1-.2c0-.2-.2-.4-.4-.6-.3-.5-.9-1.2-1.6-1.8-.7-.6-1.5-1.3-2.6-1.8l-.6 1.4c.9.4 1.6 1 2.1 1.5.6.6 1.1 1.2 1.4 1.6.1.2.3.4.3.5v.1l.7-.3.7-.3Zm-5.2-9.3-1.8 4c-.5-.1-1.1-.2-1.7-.2-3 0-5.2 1.4-6.6 2.7-.7.7-1.2 1.3-1.6 1.8-.2.3-.3.5-.4.6 0 0 0 .1-.1.2s0 0 .7.3l.7.3V13c0-.1.2-.3.3-.5.3-.4.7-1 1.4-1.6 1.2-1.2 3-2.3 5.5-2.3H13v.3c-.4 0-.8-.1-1.1-.1-1.9 0-3.5 1.6-3.5 3.5s.6 2.3 1.6 2.9l-2 4.4.9.4 7.6-16.2-.9-.4Zm-3 12.6c1.7-.2 3-1.7 3-3.5s-.2-1.4-.6-1.9L12.4 16Z" }) }); |
| 11858 |
|
| 11859 |
// packages/ui/build-module/alert-dialog/index.mjs |
| 11860 |
var alert_dialog_exports = {}; |
| 11861 |
__export(alert_dialog_exports, { |
| 11862 |
Popup: () => Popup, |
| 11863 |
Portal: () => Portal, |
| 11864 |
Root: () => Root2, |
| 11865 |
Trigger: () => Trigger |
| 11866 |
}); |
| 11867 |
|
| 11868 |
// packages/ui/build-module/alert-dialog/root.mjs |
| 11869 |
var import_element21 = __toESM(require_element(), 1); |
| 11870 |
import { speak as speak2 } from "@wordpress/a11y"; |
| 11871 |
|
| 11872 |
// packages/ui/build-module/alert-dialog/context.mjs |
| 11873 |
var import_element20 = __toESM(require_element(), 1); |
| 11874 |
var noop4 = async () => { |
| 11875 |
}; |
| 11876 |
var AlertDialogContext = (0, import_element20.createContext)({ |
| 11877 |
phase: "idle", |
| 11878 |
showSpinner: false, |
| 11879 |
errorMessage: void 0, |
| 11880 |
confirm: noop4 |
| 11881 |
}); |
| 11882 |
|
| 11883 |
// packages/ui/build-module/alert-dialog/root.mjs |
| 11884 |
var import_jsx_runtime49 = __toESM(require_jsx_runtime(), 1); |
| 11885 |
function isThenable(value) { |
| 11886 |
return value !== null && value !== void 0 && typeof value.then === "function"; |
| 11887 |
} |
| 11888 |
function Root2({ |
| 11889 |
children, |
| 11890 |
open: openProp, |
| 11891 |
onOpenChange, |
| 11892 |
defaultOpen, |
| 11893 |
onConfirm |
| 11894 |
}) { |
| 11895 |
const [internalOpen, setInternalOpen] = (0, import_element21.useState)(defaultOpen ?? false); |
| 11896 |
const [phase, setPhase] = (0, import_element21.useState)("idle"); |
| 11897 |
const [showSpinner, setShowSpinner] = (0, import_element21.useState)(false); |
| 11898 |
const [errorMessage, setErrorMessage] = (0, import_element21.useState)(); |
| 11899 |
const actionsRef = (0, import_element21.useRef)(null); |
| 11900 |
const onConfirmRef = (0, import_element21.useRef)(onConfirm); |
| 11901 |
onConfirmRef.current = onConfirm; |
| 11902 |
const phaseRef = (0, import_element21.useRef)(phase); |
| 11903 |
phaseRef.current = phase; |
| 11904 |
const confirmIdRef = (0, import_element21.useRef)(0); |
| 11905 |
const effectiveOpen = openProp ?? internalOpen; |
| 11906 |
(0, import_element21.useEffect)(() => { |
| 11907 |
if (effectiveOpen && phase === "closing") { |
| 11908 |
phaseRef.current = "idle"; |
| 11909 |
setPhase("idle"); |
| 11910 |
setShowSpinner(false); |
| 11911 |
} |
| 11912 |
}, [effectiveOpen, phase]); |
| 11913 |
const handleOpenChange = (0, import_element21.useCallback)( |
| 11914 |
(nextOpen, eventDetails) => { |
| 11915 |
if (!nextOpen && phaseRef.current === "pending") { |
| 11916 |
return; |
| 11917 |
} |
| 11918 |
if (!nextOpen && phaseRef.current === "idle") { |
| 11919 |
phaseRef.current = "closing"; |
| 11920 |
setPhase("closing"); |
| 11921 |
} |
| 11922 |
setInternalOpen(nextOpen); |
| 11923 |
onOpenChange?.(nextOpen, eventDetails); |
| 11924 |
}, |
| 11925 |
[onOpenChange] |
| 11926 |
); |
| 11927 |
const confirm = (0, import_element21.useCallback)(async () => { |
| 11928 |
if (phaseRef.current !== "idle") { |
| 11929 |
return; |
| 11930 |
} |
| 11931 |
phaseRef.current = "pending"; |
| 11932 |
setPhase("pending"); |
| 11933 |
setErrorMessage(void 0); |
| 11934 |
const id = ++confirmIdRef.current; |
| 11935 |
try { |
| 11936 |
const rawResult = onConfirmRef.current?.(); |
| 11937 |
if (isThenable(rawResult)) { |
| 11938 |
setShowSpinner(true); |
| 11939 |
} |
| 11940 |
const result = await Promise.resolve(rawResult); |
| 11941 |
if (confirmIdRef.current !== id) { |
| 11942 |
return; |
| 11943 |
} |
| 11944 |
if (result?.error) { |
| 11945 |
phaseRef.current = "idle"; |
| 11946 |
setPhase("idle"); |
| 11947 |
setShowSpinner(false); |
| 11948 |
setErrorMessage(result.error); |
| 11949 |
speak2(result.error, "assertive"); |
| 11950 |
return; |
| 11951 |
} |
| 11952 |
const shouldClose = result?.close !== false; |
| 11953 |
if (shouldClose) { |
| 11954 |
phaseRef.current = "closing"; |
| 11955 |
setPhase("closing"); |
| 11956 |
actionsRef.current?.close(); |
| 11957 |
} else { |
| 11958 |
phaseRef.current = "idle"; |
| 11959 |
setPhase("idle"); |
| 11960 |
setShowSpinner(false); |
| 11961 |
} |
| 11962 |
} catch (error2) { |
| 11963 |
if (confirmIdRef.current !== id) { |
| 11964 |
return; |
| 11965 |
} |
| 11966 |
phaseRef.current = "idle"; |
| 11967 |
setPhase("idle"); |
| 11968 |
setShowSpinner(false); |
| 11969 |
console.error(error2); |
| 11970 |
} |
| 11971 |
}, []); |
| 11972 |
const handleOpenChangeComplete = (0, import_element21.useCallback)((open) => { |
| 11973 |
if (!open) { |
| 11974 |
confirmIdRef.current++; |
| 11975 |
phaseRef.current = "idle"; |
| 11976 |
setPhase("idle"); |
| 11977 |
setShowSpinner(false); |
| 11978 |
setErrorMessage(void 0); |
| 11979 |
} |
| 11980 |
}, []); |
| 11981 |
const contextValue = (0, import_element21.useMemo)( |
| 11982 |
() => ({ |
| 11983 |
phase, |
| 11984 |
showSpinner, |
| 11985 |
errorMessage, |
| 11986 |
confirm |
| 11987 |
}), |
| 11988 |
[phase, showSpinner, errorMessage, confirm] |
| 11989 |
); |
| 11990 |
return /* @__PURE__ */ (0, import_jsx_runtime49.jsx)( |
| 11991 |
index_parts_exports.Root, |
| 11992 |
{ |
| 11993 |
open: effectiveOpen, |
| 11994 |
defaultOpen, |
| 11995 |
onOpenChange: handleOpenChange, |
| 11996 |
onOpenChangeComplete: handleOpenChangeComplete, |
| 11997 |
actionsRef, |
| 11998 |
children: /* @__PURE__ */ (0, import_jsx_runtime49.jsx)(AlertDialogContext.Provider, { value: contextValue, children }) |
| 11999 |
} |
| 12000 |
); |
| 12001 |
} |
| 12002 |
|
| 12003 |
// packages/ui/build-module/alert-dialog/trigger.mjs |
| 12004 |
var import_element22 = __toESM(require_element(), 1); |
| 12005 |
var import_jsx_runtime50 = __toESM(require_jsx_runtime(), 1); |
| 12006 |
var Trigger = (0, import_element22.forwardRef)( |
| 12007 |
function AlertDialogTrigger(props, ref) { |
| 12008 |
return /* @__PURE__ */ (0, import_jsx_runtime50.jsx)(index_parts_exports.Trigger, { ref, ...props }); |
| 12009 |
} |
| 12010 |
); |
| 12011 |
|
| 12012 |
// packages/ui/build-module/alert-dialog/popup.mjs |
| 12013 |
var import_element28 = __toESM(require_element(), 1); |
| 12014 |
var import_compose = __toESM(require_compose(), 1); |
| 12015 |
var import_i18n2 = __toESM(require_i18n(), 1); |
| 12016 |
var import_theme = __toESM(require_theme(), 1); |
| 12017 |
|
| 12018 |
// packages/ui/build-module/utils/render-slot-with-children.mjs |
| 12019 |
var import_element23 = __toESM(require_element(), 1); |
| 12020 |
function renderSlotWithChildren(slot, defaultSlot, children) { |
| 12021 |
return (0, import_element23.cloneElement)(slot ?? defaultSlot, { children }); |
| 12022 |
} |
| 12023 |
|
| 12024 |
// packages/ui/build-module/utils/use-deprioritized-initial-focus.mjs |
| 12025 |
var import_element24 = __toESM(require_element(), 1); |
| 12026 |
|
| 12027 |
// node_modules/tabbable/dist/index.esm.js |
| 12028 |
var candidateSelectors = ["input:not([inert]):not([inert] *)", "select:not([inert]):not([inert] *)", "textarea:not([inert]):not([inert] *)", "a[href]:not([inert]):not([inert] *)", "button:not([inert]):not([inert] *)", "[tabindex]:not(slot):not([inert]):not([inert] *)", "audio[controls]:not([inert]):not([inert] *)", "video[controls]:not([inert]):not([inert] *)", '[contenteditable]:not([contenteditable="false"]):not([inert]):not([inert] *)', "details>summary:first-of-type:not([inert]):not([inert] *)", "details:not([inert]):not([inert] *)"]; |
| 12029 |
var candidateSelector = /* @__PURE__ */ candidateSelectors.join(","); |
| 12030 |
var NoElement = typeof Element === "undefined"; |
| 12031 |
var matches = NoElement ? function() { |
| 12032 |
} : Element.prototype.matches || Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector; |
| 12033 |
var getRootNode = !NoElement && Element.prototype.getRootNode ? function(element) { |
| 12034 |
var _element$getRootNode; |
| 12035 |
return element === null || element === void 0 ? void 0 : (_element$getRootNode = element.getRootNode) === null || _element$getRootNode === void 0 ? void 0 : _element$getRootNode.call(element); |
| 12036 |
} : function(element) { |
| 12037 |
return element === null || element === void 0 ? void 0 : element.ownerDocument; |
| 12038 |
}; |
| 12039 |
var _isInert = function isInert(node, lookUp) { |
| 12040 |
var _node$getAttribute; |
| 12041 |
if (lookUp === void 0) { |
| 12042 |
lookUp = true; |
| 12043 |
} |
| 12044 |
var inertAtt = node === null || node === void 0 ? void 0 : (_node$getAttribute = node.getAttribute) === null || _node$getAttribute === void 0 ? void 0 : _node$getAttribute.call(node, "inert"); |
| 12045 |
var inert = inertAtt === "" || inertAtt === "true"; |
| 12046 |
var result = inert || lookUp && node && // closest does not exist on shadow roots, so we fall back to a manual |
| 12047 |
// lookup upward, in case it is not defined. |
| 12048 |
(typeof node.closest === "function" ? node.closest("[inert]") : _isInert(node.parentNode)); |
| 12049 |
return result; |
| 12050 |
}; |
| 12051 |
var isContentEditable = function isContentEditable2(node) { |
| 12052 |
var _node$getAttribute2; |
| 12053 |
var attValue = node === null || node === void 0 ? void 0 : (_node$getAttribute2 = node.getAttribute) === null || _node$getAttribute2 === void 0 ? void 0 : _node$getAttribute2.call(node, "contenteditable"); |
| 12054 |
return attValue === "" || attValue === "true"; |
| 12055 |
}; |
| 12056 |
var getCandidates = function getCandidates2(el, includeContainer, filter) { |
| 12057 |
if (_isInert(el)) { |
| 12058 |
return []; |
| 12059 |
} |
| 12060 |
var candidates = Array.prototype.slice.apply(el.querySelectorAll(candidateSelector)); |
| 12061 |
if (includeContainer && matches.call(el, candidateSelector)) { |
| 12062 |
candidates.unshift(el); |
| 12063 |
} |
| 12064 |
candidates = candidates.filter(filter); |
| 12065 |
return candidates; |
| 12066 |
}; |
| 12067 |
var _getCandidatesIteratively = function getCandidatesIteratively(elements, includeContainer, options) { |
| 12068 |
var candidates = []; |
| 12069 |
var elementsToCheck = Array.from(elements); |
| 12070 |
while (elementsToCheck.length) { |
| 12071 |
var element = elementsToCheck.shift(); |
| 12072 |
if (_isInert(element, false)) { |
| 12073 |
continue; |
| 12074 |
} |
| 12075 |
if (element.tagName === "SLOT") { |
| 12076 |
var assigned = element.assignedElements(); |
| 12077 |
var content = assigned.length ? assigned : element.children; |
| 12078 |
var nestedCandidates = _getCandidatesIteratively(content, true, options); |
| 12079 |
if (options.flatten) { |
| 12080 |
candidates.push.apply(candidates, nestedCandidates); |
| 12081 |
} else { |
| 12082 |
candidates.push({ |
| 12083 |
scopeParent: element, |
| 12084 |
candidates: nestedCandidates |
| 12085 |
}); |
| 12086 |
} |
| 12087 |
} else { |
| 12088 |
var validCandidate = matches.call(element, candidateSelector); |
| 12089 |
if (validCandidate && options.filter(element) && (includeContainer || !elements.includes(element))) { |
| 12090 |
candidates.push(element); |
| 12091 |
} |
| 12092 |
var shadowRoot = element.shadowRoot || // check for an undisclosed shadow |
| 12093 |
typeof options.getShadowRoot === "function" && options.getShadowRoot(element); |
| 12094 |
var validShadowRoot = !_isInert(shadowRoot, false) && (!options.shadowRootFilter || options.shadowRootFilter(element)); |
| 12095 |
if (shadowRoot && validShadowRoot) { |
| 12096 |
var _nestedCandidates = _getCandidatesIteratively(shadowRoot === true ? element.children : shadowRoot.children, true, options); |
| 12097 |
if (options.flatten) { |
| 12098 |
candidates.push.apply(candidates, _nestedCandidates); |
| 12099 |
} else { |
| 12100 |
candidates.push({ |
| 12101 |
scopeParent: element, |
| 12102 |
candidates: _nestedCandidates |
| 12103 |
}); |
| 12104 |
} |
| 12105 |
} else { |
| 12106 |
elementsToCheck.unshift.apply(elementsToCheck, element.children); |
| 12107 |
} |
| 12108 |
} |
| 12109 |
} |
| 12110 |
return candidates; |
| 12111 |
}; |
| 12112 |
var hasTabIndex = function hasTabIndex2(node) { |
| 12113 |
return !isNaN(parseInt(node.getAttribute("tabindex"), 10)); |
| 12114 |
}; |
| 12115 |
var getTabIndex2 = function getTabIndex3(node) { |
| 12116 |
if (!node) { |
| 12117 |
throw new Error("No node provided"); |
| 12118 |
} |
| 12119 |
if (node.tabIndex < 0) { |
| 12120 |
if ((/^(AUDIO|VIDEO|DETAILS)$/.test(node.tagName) || isContentEditable(node)) && !hasTabIndex(node)) { |
| 12121 |
return 0; |
| 12122 |
} |
| 12123 |
} |
| 12124 |
return node.tabIndex; |
| 12125 |
}; |
| 12126 |
var getSortOrderTabIndex = function getSortOrderTabIndex2(node, isScope) { |
| 12127 |
var tabIndex = getTabIndex2(node); |
| 12128 |
if (tabIndex < 0 && isScope && !hasTabIndex(node)) { |
| 12129 |
return 0; |
| 12130 |
} |
| 12131 |
return tabIndex; |
| 12132 |
}; |
| 12133 |
var sortOrderedTabbables = function sortOrderedTabbables2(a2, b2) { |
| 12134 |
return a2.tabIndex === b2.tabIndex ? a2.documentOrder - b2.documentOrder : a2.tabIndex - b2.tabIndex; |
| 12135 |
}; |
| 12136 |
var isInput = function isInput2(node) { |
| 12137 |
return node.tagName === "INPUT"; |
| 12138 |
}; |
| 12139 |
var isHiddenInput = function isHiddenInput2(node) { |
| 12140 |
return isInput(node) && node.type === "hidden"; |
| 12141 |
}; |
| 12142 |
var isDetailsWithSummary = function isDetailsWithSummary2(node) { |
| 12143 |
var r3 = node.tagName === "DETAILS" && Array.prototype.slice.apply(node.children).some(function(child) { |
| 12144 |
return child.tagName === "SUMMARY"; |
| 12145 |
}); |
| 12146 |
return r3; |
| 12147 |
}; |
| 12148 |
var getCheckedRadio = function getCheckedRadio2(nodes, form) { |
| 12149 |
for (var i2 = 0; i2 < nodes.length; i2++) { |
| 12150 |
if (nodes[i2].checked && nodes[i2].form === form) { |
| 12151 |
return nodes[i2]; |
| 12152 |
} |
| 12153 |
} |
| 12154 |
}; |
| 12155 |
var isTabbableRadio2 = function isTabbableRadio3(node) { |
| 12156 |
if (!node.name) { |
| 12157 |
return true; |
| 12158 |
} |
| 12159 |
var radioScope = node.form || getRootNode(node); |
| 12160 |
var queryRadios = function queryRadios2(name) { |
| 12161 |
return radioScope.querySelectorAll('input[type="radio"][name="' + name + '"]'); |
| 12162 |
}; |
| 12163 |
var radioSet; |
| 12164 |
if (typeof window !== "undefined" && typeof window.CSS !== "undefined" && typeof window.CSS.escape === "function") { |
| 12165 |
radioSet = queryRadios(window.CSS.escape(node.name)); |
| 12166 |
} else { |
| 12167 |
try { |
| 12168 |
radioSet = queryRadios(node.name); |
| 12169 |
} catch (err) { |
| 12170 |
console.error("Looks like you have a radio button with a name attribute containing invalid CSS selector characters and need the CSS.escape polyfill: %s", err.message); |
| 12171 |
return false; |
| 12172 |
} |
| 12173 |
} |
| 12174 |
var checked = getCheckedRadio(radioSet, node.form); |
| 12175 |
return !checked || checked === node; |
| 12176 |
}; |
| 12177 |
var isRadio = function isRadio2(node) { |
| 12178 |
return isInput(node) && node.type === "radio"; |
| 12179 |
}; |
| 12180 |
var isNonTabbableRadio = function isNonTabbableRadio2(node) { |
| 12181 |
return isRadio(node) && !isTabbableRadio2(node); |
| 12182 |
}; |
| 12183 |
var isNodeAttached = function isNodeAttached2(node) { |
| 12184 |
var _nodeRoot; |
| 12185 |
var nodeRoot = node && getRootNode(node); |
| 12186 |
var nodeRootHost = (_nodeRoot = nodeRoot) === null || _nodeRoot === void 0 ? void 0 : _nodeRoot.host; |
| 12187 |
var attached = false; |
| 12188 |
if (nodeRoot && nodeRoot !== node) { |
| 12189 |
var _nodeRootHost, _nodeRootHost$ownerDo, _node$ownerDocument; |
| 12190 |
attached = !!((_nodeRootHost = nodeRootHost) !== null && _nodeRootHost !== void 0 && (_nodeRootHost$ownerDo = _nodeRootHost.ownerDocument) !== null && _nodeRootHost$ownerDo !== void 0 && _nodeRootHost$ownerDo.contains(nodeRootHost) || node !== null && node !== void 0 && (_node$ownerDocument = node.ownerDocument) !== null && _node$ownerDocument !== void 0 && _node$ownerDocument.contains(node)); |
| 12191 |
while (!attached && nodeRootHost) { |
| 12192 |
var _nodeRoot2, _nodeRootHost2, _nodeRootHost2$ownerD; |
| 12193 |
nodeRoot = getRootNode(nodeRootHost); |
| 12194 |
nodeRootHost = (_nodeRoot2 = nodeRoot) === null || _nodeRoot2 === void 0 ? void 0 : _nodeRoot2.host; |
| 12195 |
attached = !!((_nodeRootHost2 = nodeRootHost) !== null && _nodeRootHost2 !== void 0 && (_nodeRootHost2$ownerD = _nodeRootHost2.ownerDocument) !== null && _nodeRootHost2$ownerD !== void 0 && _nodeRootHost2$ownerD.contains(nodeRootHost)); |
| 12196 |
} |
| 12197 |
} |
| 12198 |
return attached; |
| 12199 |
}; |
| 12200 |
var isZeroArea = function isZeroArea2(node) { |
| 12201 |
var _node$getBoundingClie = node.getBoundingClientRect(), width = _node$getBoundingClie.width, height = _node$getBoundingClie.height; |
| 12202 |
return width === 0 && height === 0; |
| 12203 |
}; |
| 12204 |
var isHidden = function isHidden2(node, _ref) { |
| 12205 |
var displayCheck = _ref.displayCheck, getShadowRoot = _ref.getShadowRoot; |
| 12206 |
if (displayCheck === "full-native") { |
| 12207 |
if ("checkVisibility" in node) { |
| 12208 |
var visible = node.checkVisibility({ |
| 12209 |
// Checking opacity might be desirable for some use cases, but natively, |
| 12210 |
// opacity zero elements _are_ focusable and tabbable. |
| 12211 |
checkOpacity: false, |
| 12212 |
opacityProperty: false, |
| 12213 |
contentVisibilityAuto: true, |
| 12214 |
visibilityProperty: true, |
| 12215 |
// This is an alias for `visibilityProperty`. Contemporary browsers |
| 12216 |
// support both. However, this alias has wider browser support (Chrome |
| 12217 |
// >= 105 and Firefox >= 106, vs. Chrome >= 121 and Firefox >= 122), so |
| 12218 |
// we include it anyway. |
| 12219 |
checkVisibilityCSS: true |
| 12220 |
}); |
| 12221 |
return !visible; |
| 12222 |
} |
| 12223 |
} |
| 12224 |
if (getComputedStyle(node).visibility === "hidden") { |
| 12225 |
return true; |
| 12226 |
} |
| 12227 |
var isDirectSummary = matches.call(node, "details>summary:first-of-type"); |
| 12228 |
var nodeUnderDetails = isDirectSummary ? node.parentElement : node; |
| 12229 |
if (matches.call(nodeUnderDetails, "details:not([open]) *")) { |
| 12230 |
return true; |
| 12231 |
} |
| 12232 |
if (!displayCheck || displayCheck === "full" || // full-native can run this branch when it falls through in case |
| 12233 |
// Element#checkVisibility is unsupported |
| 12234 |
displayCheck === "full-native" || displayCheck === "legacy-full") { |
| 12235 |
if (typeof getShadowRoot === "function") { |
| 12236 |
var originalNode = node; |
| 12237 |
while (node) { |
| 12238 |
var parentElement = node.parentElement; |
| 12239 |
var rootNode = getRootNode(node); |
| 12240 |
if (parentElement && !parentElement.shadowRoot && getShadowRoot(parentElement) === true) { |
| 12241 |
return isZeroArea(node); |
| 12242 |
} else if (node.assignedSlot) { |
| 12243 |
node = node.assignedSlot; |
| 12244 |
} else if (!parentElement && rootNode !== node.ownerDocument) { |
| 12245 |
node = rootNode.host; |
| 12246 |
} else { |
| 12247 |
node = parentElement; |
| 12248 |
} |
| 12249 |
} |
| 12250 |
node = originalNode; |
| 12251 |
} |
| 12252 |
if (isNodeAttached(node)) { |
| 12253 |
return !node.getClientRects().length; |
| 12254 |
} |
| 12255 |
if (displayCheck !== "legacy-full") { |
| 12256 |
return true; |
| 12257 |
} |
| 12258 |
} else if (displayCheck === "non-zero-area") { |
| 12259 |
return isZeroArea(node); |
| 12260 |
} |
| 12261 |
return false; |
| 12262 |
}; |
| 12263 |
var isDisabledFromFieldset = function isDisabledFromFieldset2(node) { |
| 12264 |
if (/^(INPUT|BUTTON|SELECT|TEXTAREA)$/.test(node.tagName)) { |
| 12265 |
var parentNode = node.parentElement; |
| 12266 |
while (parentNode) { |
| 12267 |
if (parentNode.tagName === "FIELDSET" && parentNode.disabled) { |
| 12268 |
for (var i2 = 0; i2 < parentNode.children.length; i2++) { |
| 12269 |
var child = parentNode.children.item(i2); |
| 12270 |
if (child.tagName === "LEGEND") { |
| 12271 |
return matches.call(parentNode, "fieldset[disabled] *") ? true : !child.contains(node); |
| 12272 |
} |
| 12273 |
} |
| 12274 |
return true; |
| 12275 |
} |
| 12276 |
parentNode = parentNode.parentElement; |
| 12277 |
} |
| 12278 |
} |
| 12279 |
return false; |
| 12280 |
}; |
| 12281 |
var isNodeMatchingSelectorFocusable = function isNodeMatchingSelectorFocusable2(options, node) { |
| 12282 |
if (node.disabled || isHiddenInput(node) || isHidden(node, options) || // For a details element with a summary, the summary element gets the focus |
| 12283 |
isDetailsWithSummary(node) || isDisabledFromFieldset(node)) { |
| 12284 |
return false; |
| 12285 |
} |
| 12286 |
return true; |
| 12287 |
}; |
| 12288 |
var isNodeMatchingSelectorTabbable = function isNodeMatchingSelectorTabbable2(options, node) { |
| 12289 |
if (isNonTabbableRadio(node) || getTabIndex2(node) < 0 || !isNodeMatchingSelectorFocusable(options, node)) { |
| 12290 |
return false; |
| 12291 |
} |
| 12292 |
return true; |
| 12293 |
}; |
| 12294 |
var isShadowRootTabbable = function isShadowRootTabbable2(shadowHostNode) { |
| 12295 |
var tabIndex = parseInt(shadowHostNode.getAttribute("tabindex"), 10); |
| 12296 |
if (isNaN(tabIndex) || tabIndex >= 0) { |
| 12297 |
return true; |
| 12298 |
} |
| 12299 |
return false; |
| 12300 |
}; |
| 12301 |
var _sortByOrder = function sortByOrder(candidates) { |
| 12302 |
var regularTabbables = []; |
| 12303 |
var orderedTabbables = []; |
| 12304 |
candidates.forEach(function(item, i2) { |
| 12305 |
var isScope = !!item.scopeParent; |
| 12306 |
var element = isScope ? item.scopeParent : item; |
| 12307 |
var candidateTabindex = getSortOrderTabIndex(element, isScope); |
| 12308 |
var elements = isScope ? _sortByOrder(item.candidates) : element; |
| 12309 |
if (candidateTabindex === 0) { |
| 12310 |
isScope ? regularTabbables.push.apply(regularTabbables, elements) : regularTabbables.push(element); |
| 12311 |
} else { |
| 12312 |
orderedTabbables.push({ |
| 12313 |
documentOrder: i2, |
| 12314 |
tabIndex: candidateTabindex, |
| 12315 |
item, |
| 12316 |
isScope, |
| 12317 |
content: elements |
| 12318 |
}); |
| 12319 |
} |
| 12320 |
}); |
| 12321 |
return orderedTabbables.sort(sortOrderedTabbables).reduce(function(acc, sortable) { |
| 12322 |
sortable.isScope ? acc.push.apply(acc, sortable.content) : acc.push(sortable.content); |
| 12323 |
return acc; |
| 12324 |
}, []).concat(regularTabbables); |
| 12325 |
}; |
| 12326 |
var tabbable2 = function tabbable3(container, options) { |
| 12327 |
options = options || {}; |
| 12328 |
var candidates; |
| 12329 |
if (options.getShadowRoot) { |
| 12330 |
candidates = _getCandidatesIteratively([container], options.includeContainer, { |
| 12331 |
filter: isNodeMatchingSelectorTabbable.bind(null, options), |
| 12332 |
flatten: false, |
| 12333 |
getShadowRoot: options.getShadowRoot, |
| 12334 |
shadowRootFilter: isShadowRootTabbable |
| 12335 |
}); |
| 12336 |
} else { |
| 12337 |
candidates = getCandidates(container, options.includeContainer, isNodeMatchingSelectorTabbable.bind(null, options)); |
| 12338 |
} |
| 12339 |
return _sortByOrder(candidates); |
| 12340 |
}; |
| 12341 |
|
| 12342 |
// packages/ui/build-module/utils/use-deprioritized-initial-focus.mjs |
| 12343 |
var getTabbableOptions = () => ({ |
| 12344 |
getShadowRoot: true, |
| 12345 |
displayCheck: typeof ResizeObserver === "function" && ResizeObserver.toString().includes("[native code]") ? "full" : "none" |
| 12346 |
}); |
| 12347 |
function useDeprioritizedInitialFocus({ |
| 12348 |
initialFocus, |
| 12349 |
deprioritizedAttributes |
| 12350 |
}) { |
| 12351 |
const popupRef = (0, import_element24.useRef)(null); |
| 12352 |
let resolvedInitialFocus = initialFocus; |
| 12353 |
if (initialFocus === void 0 || initialFocus === true) { |
| 12354 |
resolvedInitialFocus = (interactionType) => { |
| 12355 |
if (interactionType === "touch") { |
| 12356 |
return popupRef.current ?? true; |
| 12357 |
} |
| 12358 |
const popup = popupRef.current; |
| 12359 |
if (!popup) { |
| 12360 |
return true; |
| 12361 |
} |
| 12362 |
const tabbables = tabbable2(popup, getTabbableOptions()); |
| 12363 |
for (const el of tabbables) { |
| 12364 |
if (el instanceof HTMLElement && !deprioritizedAttributes.some( |
| 12365 |
(attr2) => el.hasAttribute(attr2) |
| 12366 |
)) { |
| 12367 |
return el; |
| 12368 |
} |
| 12369 |
} |
| 12370 |
return true; |
| 12371 |
}; |
| 12372 |
} |
| 12373 |
return { resolvedInitialFocus, popupRef }; |
| 12374 |
} |
| 12375 |
|
| 12376 |
// packages/ui/build-module/utils/use-overlay-scroll-state-attributes.mjs |
| 12377 |
var import_element25 = __toESM(require_element(), 1); |
| 12378 |
var SCROLL_CONTAINER_ATTR = "data-wp-ui-overlay-scroll-container"; |
| 12379 |
var SCROLLED_FROM_TOP_ATTR = "data-wp-ui-overlay-scrolled-from-top"; |
| 12380 |
var SCROLLED_FROM_BOTTOM_ATTR = "data-wp-ui-overlay-scrolled-from-bottom"; |
| 12381 |
var SCROLL_TABBABLE_FLAG_ATTR = "data-wp-ui-overlay-scroll-tabbable"; |
| 12382 |
var SCROLL_END_EPSILON = 1; |
| 12383 |
function reconcileTabbableFlag(el) { |
| 12384 |
if (el.hasAttribute(SCROLL_TABBABLE_FLAG_ATTR) && el.getAttribute("tabindex") !== "0") { |
| 12385 |
el.removeAttribute(SCROLL_TABBABLE_FLAG_ATTR); |
| 12386 |
} |
| 12387 |
} |
| 12388 |
function updateScrollAttributes(el) { |
| 12389 |
const { scrollTop, clientHeight, scrollHeight } = el; |
| 12390 |
const overflows = scrollHeight - clientHeight > SCROLL_END_EPSILON; |
| 12391 |
el.toggleAttribute(SCROLLED_FROM_TOP_ATTR, scrollTop > 0); |
| 12392 |
el.toggleAttribute( |
| 12393 |
SCROLLED_FROM_BOTTOM_ATTR, |
| 12394 |
scrollTop + clientHeight < scrollHeight - SCROLL_END_EPSILON |
| 12395 |
); |
| 12396 |
reconcileTabbableFlag(el); |
| 12397 |
if (overflows) { |
| 12398 |
if (!el.hasAttribute(SCROLL_TABBABLE_FLAG_ATTR) && el.getAttribute("tabindex") === null) { |
| 12399 |
el.setAttribute("tabindex", "0"); |
| 12400 |
el.setAttribute(SCROLL_TABBABLE_FLAG_ATTR, ""); |
| 12401 |
} |
| 12402 |
} else if (el.hasAttribute(SCROLL_TABBABLE_FLAG_ATTR)) { |
| 12403 |
el.removeAttribute("tabindex"); |
| 12404 |
el.removeAttribute(SCROLL_TABBABLE_FLAG_ATTR); |
| 12405 |
} |
| 12406 |
} |
| 12407 |
var HOOK_OWNED_ATTRS = [ |
| 12408 |
SCROLL_CONTAINER_ATTR, |
| 12409 |
SCROLLED_FROM_TOP_ATTR, |
| 12410 |
SCROLLED_FROM_BOTTOM_ATTR |
| 12411 |
]; |
| 12412 |
function cleanupScrollAttributes(el) { |
| 12413 |
for (const attr2 of HOOK_OWNED_ATTRS) { |
| 12414 |
el.removeAttribute(attr2); |
| 12415 |
} |
| 12416 |
reconcileTabbableFlag(el); |
| 12417 |
if (el.hasAttribute(SCROLL_TABBABLE_FLAG_ATTR)) { |
| 12418 |
el.removeAttribute("tabindex"); |
| 12419 |
el.removeAttribute(SCROLL_TABBABLE_FLAG_ATTR); |
| 12420 |
} |
| 12421 |
} |
| 12422 |
function useOverlayScrollStateAttributes(onScroll) { |
| 12423 |
const [node, setNode] = (0, import_element25.useState)(null); |
| 12424 |
const ref = (0, import_element25.useCallback)((el) => { |
| 12425 |
setNode(el); |
| 12426 |
}, []); |
| 12427 |
(0, import_element25.useLayoutEffect)(() => { |
| 12428 |
if (!node) { |
| 12429 |
return; |
| 12430 |
} |
| 12431 |
node.setAttribute(SCROLL_CONTAINER_ATTR, ""); |
| 12432 |
updateScrollAttributes(node); |
| 12433 |
if (typeof ResizeObserver === "undefined") { |
| 12434 |
return () => { |
| 12435 |
cleanupScrollAttributes(node); |
| 12436 |
}; |
| 12437 |
} |
| 12438 |
const resizeObserver = new ResizeObserver(() => { |
| 12439 |
updateScrollAttributes(node); |
| 12440 |
}); |
| 12441 |
resizeObserver.observe(node); |
| 12442 |
for (const child of Array.from(node.children)) { |
| 12443 |
resizeObserver.observe(child); |
| 12444 |
} |
| 12445 |
let mutationObserver; |
| 12446 |
if (typeof MutationObserver !== "undefined") { |
| 12447 |
mutationObserver = new MutationObserver((records) => { |
| 12448 |
for (const record of records) { |
| 12449 |
if (record.target === node) { |
| 12450 |
for (const added of Array.from(record.addedNodes)) { |
| 12451 |
if (added instanceof Element) { |
| 12452 |
resizeObserver.observe(added); |
| 12453 |
} |
| 12454 |
} |
| 12455 |
for (const removed of Array.from( |
| 12456 |
record.removedNodes |
| 12457 |
)) { |
| 12458 |
if (removed instanceof Element) { |
| 12459 |
resizeObserver.unobserve(removed); |
| 12460 |
} |
| 12461 |
} |
| 12462 |
} |
| 12463 |
} |
| 12464 |
updateScrollAttributes(node); |
| 12465 |
}); |
| 12466 |
mutationObserver.observe(node, { |
| 12467 |
childList: true |
| 12468 |
}); |
| 12469 |
} |
| 12470 |
return () => { |
| 12471 |
resizeObserver.disconnect(); |
| 12472 |
mutationObserver?.disconnect(); |
| 12473 |
cleanupScrollAttributes(node); |
| 12474 |
}; |
| 12475 |
}, [node]); |
| 12476 |
const handleScroll = (0, import_element25.useCallback)( |
| 12477 |
(event) => { |
| 12478 |
updateScrollAttributes(event.currentTarget); |
| 12479 |
onScroll?.(event); |
| 12480 |
}, |
| 12481 |
[onScroll] |
| 12482 |
); |
| 12483 |
return { ref, onScroll: handleScroll }; |
| 12484 |
} |
| 12485 |
|
| 12486 |
// packages/ui/build-module/lock-unlock.mjs |
| 12487 |
var import_private_apis = __toESM(require_private_apis(), 1); |
| 12488 |
var { lock, unlock } = (0, import_private_apis.__dangerousOptInToUnstableAPIsOnlyForCoreModules)( |
| 12489 |
"I acknowledge private features are not for use in themes or plugins and doing so will break in the next version of WordPress.", |
| 12490 |
"@wordpress/ui" |
| 12491 |
); |
| 12492 |
|
| 12493 |
// packages/ui/build-module/stack/stack.mjs |
| 12494 |
var import_element26 = __toESM(require_element(), 1); |
| 12495 |
var STYLE_HASH_ATTRIBUTE7 = "data-wp-hash"; |
| 12496 |
function getRuntime7() { |
| 12497 |
const globalScope = globalThis; |
| 12498 |
if (globalScope.__wpStyleRuntime) { |
| 12499 |
return globalScope.__wpStyleRuntime; |
| 12500 |
} |
| 12501 |
globalScope.__wpStyleRuntime = { |
| 12502 |
documents: /* @__PURE__ */ new Map(), |
| 12503 |
styles: /* @__PURE__ */ new Map(), |
| 12504 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 12505 |
}; |
| 12506 |
if (typeof document !== "undefined") { |
| 12507 |
registerDocument7(document); |
| 12508 |
} |
| 12509 |
return globalScope.__wpStyleRuntime; |
| 12510 |
} |
| 12511 |
function documentContainsStyleHash7(targetDocument, hash) { |
| 12512 |
if (!targetDocument.head) { |
| 12513 |
return false; |
| 12514 |
} |
| 12515 |
for (const style of targetDocument.head.querySelectorAll( |
| 12516 |
`style[${STYLE_HASH_ATTRIBUTE7}]` |
| 12517 |
)) { |
| 12518 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE7) === hash) { |
| 12519 |
return true; |
| 12520 |
} |
| 12521 |
} |
| 12522 |
return false; |
| 12523 |
} |
| 12524 |
function injectStyle7(targetDocument, hash, css) { |
| 12525 |
if (!targetDocument.head) { |
| 12526 |
return; |
| 12527 |
} |
| 12528 |
const runtime = getRuntime7(); |
| 12529 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 12530 |
if (!injectedStyles) { |
| 12531 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 12532 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 12533 |
} |
| 12534 |
if (injectedStyles.has(hash)) { |
| 12535 |
return; |
| 12536 |
} |
| 12537 |
if (documentContainsStyleHash7(targetDocument, hash)) { |
| 12538 |
injectedStyles.add(hash); |
| 12539 |
return; |
| 12540 |
} |
| 12541 |
const style = targetDocument.createElement("style"); |
| 12542 |
style.setAttribute(STYLE_HASH_ATTRIBUTE7, hash); |
| 12543 |
style.appendChild(targetDocument.createTextNode(css)); |
| 12544 |
targetDocument.head.appendChild(style); |
| 12545 |
injectedStyles.add(hash); |
| 12546 |
} |
| 12547 |
function registerDocument7(targetDocument) { |
| 12548 |
const runtime = getRuntime7(); |
| 12549 |
runtime.documents.set( |
| 12550 |
targetDocument, |
| 12551 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 12552 |
); |
| 12553 |
for (const [hash, css] of runtime.styles) { |
| 12554 |
injectStyle7(targetDocument, hash, css); |
| 12555 |
} |
| 12556 |
return () => { |
| 12557 |
const count = runtime.documents.get(targetDocument); |
| 12558 |
if (count === void 0) { |
| 12559 |
return; |
| 12560 |
} |
| 12561 |
if (count <= 1) { |
| 12562 |
runtime.documents.delete(targetDocument); |
| 12563 |
return; |
| 12564 |
} |
| 12565 |
runtime.documents.set(targetDocument, count - 1); |
| 12566 |
}; |
| 12567 |
} |
| 12568 |
function registerStyle7(hash, css) { |
| 12569 |
const runtime = getRuntime7(); |
| 12570 |
runtime.styles.set(hash, css); |
| 12571 |
for (const targetDocument of runtime.documents.keys()) { |
| 12572 |
injectStyle7(targetDocument, hash, css); |
| 12573 |
} |
| 12574 |
} |
| 12575 |
if (typeof process === "undefined" || true) { |
| 12576 |
registerStyle7("b51ff41489", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._19ce0419607e1896__stack{display:flex}}"); |
| 12577 |
} |
| 12578 |
var style_default7 = { "stack": "_19ce0419607e1896__stack" }; |
| 12579 |
var gapTokens = { |
| 12580 |
xs: "var(--wpds-dimension-gap-xs, 4px)", |
| 12581 |
sm: "var(--wpds-dimension-gap-sm, 8px)", |
| 12582 |
md: "var(--wpds-dimension-gap-md, 12px)", |
| 12583 |
lg: "var(--wpds-dimension-gap-lg, 16px)", |
| 12584 |
xl: "var(--wpds-dimension-gap-xl, 24px)", |
| 12585 |
"2xl": "var(--wpds-dimension-gap-2xl, 32px)", |
| 12586 |
"3xl": "var(--wpds-dimension-gap-3xl, 40px)" |
| 12587 |
}; |
| 12588 |
var Stack = (0, import_element26.forwardRef)(function Stack2({ direction, gap, align, justify, wrap, render: render4, ...props }, ref) { |
| 12589 |
const style = { |
| 12590 |
gap: gap && gapTokens[gap], |
| 12591 |
alignItems: align, |
| 12592 |
justifyContent: justify, |
| 12593 |
flexDirection: direction, |
| 12594 |
flexWrap: wrap |
| 12595 |
}; |
| 12596 |
const element = useRender({ |
| 12597 |
render: render4, |
| 12598 |
ref, |
| 12599 |
props: mergeProps(props, { style, className: style_default7.stack }) |
| 12600 |
}); |
| 12601 |
return element; |
| 12602 |
}); |
| 12603 |
|
| 12604 |
// packages/ui/build-module/alert-dialog/portal.mjs |
| 12605 |
var import_element27 = __toESM(require_element(), 1); |
| 12606 |
var import_jsx_runtime51 = __toESM(require_jsx_runtime(), 1); |
| 12607 |
var Portal = (0, import_element27.forwardRef)( |
| 12608 |
function AlertDialogPortal(props, ref) { |
| 12609 |
return /* @__PURE__ */ (0, import_jsx_runtime51.jsx)(index_parts_exports.Portal, { ref, ...props }); |
| 12610 |
} |
| 12611 |
); |
| 12612 |
|
| 12613 |
// packages/ui/build-module/alert-dialog/popup.mjs |
| 12614 |
var import_jsx_runtime52 = __toESM(require_jsx_runtime(), 1); |
| 12615 |
var STYLE_HASH_ATTRIBUTE8 = "data-wp-hash"; |
| 12616 |
function getRuntime8() { |
| 12617 |
const globalScope = globalThis; |
| 12618 |
if (globalScope.__wpStyleRuntime) { |
| 12619 |
return globalScope.__wpStyleRuntime; |
| 12620 |
} |
| 12621 |
globalScope.__wpStyleRuntime = { |
| 12622 |
documents: /* @__PURE__ */ new Map(), |
| 12623 |
styles: /* @__PURE__ */ new Map(), |
| 12624 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 12625 |
}; |
| 12626 |
if (typeof document !== "undefined") { |
| 12627 |
registerDocument8(document); |
| 12628 |
} |
| 12629 |
return globalScope.__wpStyleRuntime; |
| 12630 |
} |
| 12631 |
function documentContainsStyleHash8(targetDocument, hash) { |
| 12632 |
if (!targetDocument.head) { |
| 12633 |
return false; |
| 12634 |
} |
| 12635 |
for (const style of targetDocument.head.querySelectorAll( |
| 12636 |
`style[${STYLE_HASH_ATTRIBUTE8}]` |
| 12637 |
)) { |
| 12638 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE8) === hash) { |
| 12639 |
return true; |
| 12640 |
} |
| 12641 |
} |
| 12642 |
return false; |
| 12643 |
} |
| 12644 |
function injectStyle8(targetDocument, hash, css) { |
| 12645 |
if (!targetDocument.head) { |
| 12646 |
return; |
| 12647 |
} |
| 12648 |
const runtime = getRuntime8(); |
| 12649 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 12650 |
if (!injectedStyles) { |
| 12651 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 12652 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 12653 |
} |
| 12654 |
if (injectedStyles.has(hash)) { |
| 12655 |
return; |
| 12656 |
} |
| 12657 |
if (documentContainsStyleHash8(targetDocument, hash)) { |
| 12658 |
injectedStyles.add(hash); |
| 12659 |
return; |
| 12660 |
} |
| 12661 |
const style = targetDocument.createElement("style"); |
| 12662 |
style.setAttribute(STYLE_HASH_ATTRIBUTE8, hash); |
| 12663 |
style.appendChild(targetDocument.createTextNode(css)); |
| 12664 |
targetDocument.head.appendChild(style); |
| 12665 |
injectedStyles.add(hash); |
| 12666 |
} |
| 12667 |
function registerDocument8(targetDocument) { |
| 12668 |
const runtime = getRuntime8(); |
| 12669 |
runtime.documents.set( |
| 12670 |
targetDocument, |
| 12671 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 12672 |
); |
| 12673 |
for (const [hash, css] of runtime.styles) { |
| 12674 |
injectStyle8(targetDocument, hash, css); |
| 12675 |
} |
| 12676 |
return () => { |
| 12677 |
const count = runtime.documents.get(targetDocument); |
| 12678 |
if (count === void 0) { |
| 12679 |
return; |
| 12680 |
} |
| 12681 |
if (count <= 1) { |
| 12682 |
runtime.documents.delete(targetDocument); |
| 12683 |
return; |
| 12684 |
} |
| 12685 |
runtime.documents.set(targetDocument, count - 1); |
| 12686 |
}; |
| 12687 |
} |
| 12688 |
function registerStyle8(hash, css) { |
| 12689 |
const runtime = getRuntime8(); |
| 12690 |
runtime.styles.set(hash, css); |
| 12691 |
for (const targetDocument of runtime.documents.keys()) { |
| 12692 |
injectStyle8(targetDocument, hash, css); |
| 12693 |
} |
| 12694 |
} |
| 12695 |
if (typeof process === "undefined" || true) { |
| 12696 |
registerStyle8("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 12697 |
} |
| 12698 |
var style_default8 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 12699 |
if (typeof process === "undefined" || true) { |
| 12700 |
registerStyle8("2a5ab8f3a7", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._08e8a2e44959f892__outset-ring--focus,._970d04df7376df67__outset-ring--focus-within-except-active,.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible,.cd83dfc2126a0846__outset-ring--focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active,.ecadb9e080e2dfa5__outset-ring--focus-parent-visible{@media not (prefers-reduced-motion){--_gcd-a-transition:outline 0.1s ease-out;transition:outline .1s ease-out}outline:0 solid #0000;outline-offset:1px}._08e8a2e44959f892__outset-ring--focus:focus,._970d04df7376df67__outset-ring--focus-within-except-active:focus-within:not(:has(:active)),.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible:focus-within:has(:focus-visible),.cd83dfc2126a0846__outset-ring--focus-within:focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible:focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active:focus:not(:active),:focus-visible .ecadb9e080e2dfa5__outset-ring--focus-parent-visible{--_gcd-a-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));--_gcd-div-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9))}}"); |
| 12701 |
} |
| 12702 |
var focus_default2 = { "outset-ring--focus": "_08e8a2e44959f892__outset-ring--focus", "outset-ring--focus-except-active": "e25b2bdd7aa21721__outset-ring--focus-except-active", "outset-ring--focus-visible": "d0541bc9dd9dc7b6__outset-ring--focus-visible", "outset-ring--focus-within": "cd83dfc2126a0846__outset-ring--focus-within", "outset-ring--focus-within-except-active": "_970d04df7376df67__outset-ring--focus-within-except-active", "outset-ring--focus-within-visible": "c5cb3ee4bddaa8e4__outset-ring--focus-within-visible", "outset-ring--focus-parent-visible": "ecadb9e080e2dfa5__outset-ring--focus-parent-visible" }; |
| 12703 |
if (typeof process === "undefined" || true) { |
| 12704 |
registerStyle8("538652eb41", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}"); |
| 12705 |
} |
| 12706 |
var overlay_chrome_default = { "header": "f1c50237c4787636__header", "footer": "_579f95efdec92a66__footer", "title": "_5371cc08aad82574__title", "content": "_766d9011d37ce2d9__content" }; |
| 12707 |
if (typeof process === "undefined" || true) { |
| 12708 |
registerStyle8("ea48258a83", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.dbff6618234a2a93__error-message{align-self:flex-end;color:var(--wpds-color-fg-content-error,#470000)}._66cf5fe0c6a030bd__footer-column{align-items:stretch;flex-direction:column;gap:var(--wpds-dimension-gap-md,12px);justify-content:flex-start}}@layer wp-ui-compositions{._2ddc2fc9155a1dad__irreversible-action{--wp-ui-button-background-color:var(--wpds-color-bg-interactive-error-strong,#cc1818);--wp-ui-button-background-color-active:var(--wpds-color-bg-interactive-error-strong-active,#b90000);--wp-ui-button-foreground-color:var(--wpds-color-fg-interactive-error-strong,#f2efef);--wp-ui-button-foreground-color-active:var(--wpds-color-fg-interactive-error-strong-active,#f2efef)}}"); |
| 12709 |
} |
| 12710 |
var style_default22 = { "error-message": "dbff6618234a2a93__error-message", "footer-column": "_66cf5fe0c6a030bd__footer-column", "irreversible-action": "_2ddc2fc9155a1dad__irreversible-action" }; |
| 12711 |
var ThemeProvider = unlock(import_theme.privateApis).ThemeProvider; |
| 12712 |
var Popup = (0, import_element28.forwardRef)( |
| 12713 |
function AlertDialogPopup({ |
| 12714 |
className, |
| 12715 |
portal, |
| 12716 |
intent = "default", |
| 12717 |
title, |
| 12718 |
description, |
| 12719 |
children, |
| 12720 |
confirmButtonText = (0, import_i18n2.__)("OK"), |
| 12721 |
cancelButtonText = (0, import_i18n2.__)("Cancel"), |
| 12722 |
stickyHeader = true, |
| 12723 |
stickyFooter = true, |
| 12724 |
initialFocus, |
| 12725 |
finalFocus, |
| 12726 |
...props |
| 12727 |
}, ref) { |
| 12728 |
const { phase, showSpinner, errorMessage, confirm } = (0, import_element28.useContext)(AlertDialogContext); |
| 12729 |
const { ref: scrollStateRef, onScroll } = useOverlayScrollStateAttributes(); |
| 12730 |
const { resolvedInitialFocus, popupRef } = useDeprioritizedInitialFocus( |
| 12731 |
{ |
| 12732 |
initialFocus, |
| 12733 |
deprioritizedAttributes: [SCROLL_CONTAINER_ATTR] |
| 12734 |
} |
| 12735 |
); |
| 12736 |
const mergedRef = (0, import_compose.useMergeRefs)([ref, popupRef]); |
| 12737 |
const confirmClassName = intent === "irreversible" ? style_default22["irreversible-action"] : void 0; |
| 12738 |
const buttonsDisabled = phase !== "idle" || void 0; |
| 12739 |
const headerElement = /* @__PURE__ */ (0, import_jsx_runtime52.jsx)("div", { className: overlay_chrome_default.header, children: /* @__PURE__ */ (0, import_jsx_runtime52.jsx)( |
| 12740 |
Text, |
| 12741 |
{ |
| 12742 |
variant: "heading-xl", |
| 12743 |
render: /* @__PURE__ */ (0, import_jsx_runtime52.jsx)(index_parts_exports.Title, {}), |
| 12744 |
className: overlay_chrome_default.title, |
| 12745 |
children: title |
| 12746 |
} |
| 12747 |
) }); |
| 12748 |
const footerElement = /* @__PURE__ */ (0, import_jsx_runtime52.jsxs)( |
| 12749 |
"div", |
| 12750 |
{ |
| 12751 |
className: clsx_default( |
| 12752 |
overlay_chrome_default.footer, |
| 12753 |
style_default22["footer-column"] |
| 12754 |
), |
| 12755 |
children: [ |
| 12756 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsxs)( |
| 12757 |
Stack, |
| 12758 |
{ |
| 12759 |
direction: "row", |
| 12760 |
gap: "sm", |
| 12761 |
justify: "flex-end", |
| 12762 |
align: "center", |
| 12763 |
children: [ |
| 12764 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsx)( |
| 12765 |
index_parts_exports.Close, |
| 12766 |
{ |
| 12767 |
render: /* @__PURE__ */ (0, import_jsx_runtime52.jsx)(Button4, { variant: "minimal" }), |
| 12768 |
disabled: buttonsDisabled, |
| 12769 |
children: cancelButtonText |
| 12770 |
} |
| 12771 |
), |
| 12772 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsx)( |
| 12773 |
Button4, |
| 12774 |
{ |
| 12775 |
className: confirmClassName, |
| 12776 |
onClick: confirm, |
| 12777 |
loading: showSpinner || void 0, |
| 12778 |
disabled: buttonsDisabled, |
| 12779 |
children: confirmButtonText |
| 12780 |
} |
| 12781 |
) |
| 12782 |
] |
| 12783 |
} |
| 12784 |
), |
| 12785 |
errorMessage && /* @__PURE__ */ (0, import_jsx_runtime52.jsx)( |
| 12786 |
Text, |
| 12787 |
{ |
| 12788 |
variant: "body-sm", |
| 12789 |
className: style_default22["error-message"], |
| 12790 |
children: errorMessage |
| 12791 |
} |
| 12792 |
) |
| 12793 |
] |
| 12794 |
} |
| 12795 |
); |
| 12796 |
const portalChildren = /* @__PURE__ */ (0, import_jsx_runtime52.jsxs)(import_jsx_runtime52.Fragment, { children: [ |
| 12797 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsx)(index_parts_exports.Backdrop, { className: style_default8.backdrop }), |
| 12798 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsx)(ThemeProvider, { children: /* @__PURE__ */ (0, import_jsx_runtime52.jsxs)( |
| 12799 |
index_parts_exports.Popup, |
| 12800 |
{ |
| 12801 |
ref: mergedRef, |
| 12802 |
className: clsx_default( |
| 12803 |
style_default8.popup, |
| 12804 |
className, |
| 12805 |
style_default8["is-medium"] |
| 12806 |
), |
| 12807 |
initialFocus: resolvedInitialFocus, |
| 12808 |
finalFocus, |
| 12809 |
...props, |
| 12810 |
"data-wp-ui-overlay-modal": "", |
| 12811 |
children: [ |
| 12812 |
stickyHeader && headerElement, |
| 12813 |
/* @__PURE__ */ (0, import_jsx_runtime52.jsxs)( |
| 12814 |
"div", |
| 12815 |
{ |
| 12816 |
ref: scrollStateRef, |
| 12817 |
className: clsx_default( |
| 12818 |
overlay_chrome_default.content, |
| 12819 |
focus_default2["outset-ring--focus-visible"] |
| 12820 |
), |
| 12821 |
onScroll, |
| 12822 |
children: [ |
| 12823 |
!stickyHeader && headerElement, |
| 12824 |
description && /* @__PURE__ */ (0, import_jsx_runtime52.jsx)( |
| 12825 |
Text, |
| 12826 |
{ |
| 12827 |
variant: "body-md", |
| 12828 |
render: /* @__PURE__ */ (0, import_jsx_runtime52.jsx)(index_parts_exports.Description, {}), |
| 12829 |
children: description |
| 12830 |
} |
| 12831 |
), |
| 12832 |
children, |
| 12833 |
!stickyFooter && footerElement |
| 12834 |
] |
| 12835 |
} |
| 12836 |
), |
| 12837 |
stickyFooter && footerElement |
| 12838 |
] |
| 12839 |
} |
| 12840 |
) }) |
| 12841 |
] }); |
| 12842 |
return renderSlotWithChildren(portal, /* @__PURE__ */ (0, import_jsx_runtime52.jsx)(Portal, {}), portalChildren); |
| 12843 |
} |
| 12844 |
); |
| 12845 |
|
| 12846 |
// packages/ui/build-module/dialog/index.mjs |
| 12847 |
var dialog_exports = {}; |
| 12848 |
__export(dialog_exports, { |
| 12849 |
Action: () => Action, |
| 12850 |
CloseIcon: () => CloseIcon, |
| 12851 |
Content: () => Content2, |
| 12852 |
Description: () => Description, |
| 12853 |
Footer: () => Footer, |
| 12854 |
Header: () => Header2, |
| 12855 |
Popup: () => Popup3, |
| 12856 |
Portal: () => Portal3, |
| 12857 |
Root: () => Root4, |
| 12858 |
Title: () => Title2, |
| 12859 |
Trigger: () => Trigger3 |
| 12860 |
}); |
| 12861 |
|
| 12862 |
// packages/ui/build-module/dialog/action.mjs |
| 12863 |
var import_element29 = __toESM(require_element(), 1); |
| 12864 |
var import_jsx_runtime53 = __toESM(require_jsx_runtime(), 1); |
| 12865 |
var Action = (0, import_element29.forwardRef)( |
| 12866 |
function DialogAction({ render: render4, disabled: disabled2, loading, ...props }, ref) { |
| 12867 |
const resolvedDisabled = disabled2 ?? loading; |
| 12868 |
return /* @__PURE__ */ (0, import_jsx_runtime53.jsx)( |
| 12869 |
index_parts_exports2.Close, |
| 12870 |
{ |
| 12871 |
ref, |
| 12872 |
render: /* @__PURE__ */ (0, import_jsx_runtime53.jsx)(Button4, { render: render4, loading }), |
| 12873 |
disabled: resolvedDisabled, |
| 12874 |
...props |
| 12875 |
} |
| 12876 |
); |
| 12877 |
} |
| 12878 |
); |
| 12879 |
|
| 12880 |
// packages/ui/build-module/dialog/close-icon.mjs |
| 12881 |
var import_element35 = __toESM(require_element(), 1); |
| 12882 |
var import_i18n3 = __toESM(require_i18n(), 1); |
| 12883 |
|
| 12884 |
// packages/ui/build-module/icon-button/icon-button.mjs |
| 12885 |
var import_element34 = __toESM(require_element(), 1); |
| 12886 |
|
| 12887 |
// packages/ui/build-module/tooltip/popup.mjs |
| 12888 |
var import_element32 = __toESM(require_element(), 1); |
| 12889 |
var import_theme2 = __toESM(require_theme(), 1); |
| 12890 |
|
| 12891 |
// packages/ui/build-module/tooltip/portal.mjs |
| 12892 |
var import_element30 = __toESM(require_element(), 1); |
| 12893 |
var import_jsx_runtime54 = __toESM(require_jsx_runtime(), 1); |
| 12894 |
var Portal2 = (0, import_element30.forwardRef)( |
| 12895 |
function TooltipPortal3(props, ref) { |
| 12896 |
return /* @__PURE__ */ (0, import_jsx_runtime54.jsx)(index_parts_exports3.Portal, { ref, ...props }); |
| 12897 |
} |
| 12898 |
); |
| 12899 |
|
| 12900 |
// packages/ui/build-module/tooltip/positioner.mjs |
| 12901 |
var import_element31 = __toESM(require_element(), 1); |
| 12902 |
var import_jsx_runtime55 = __toESM(require_jsx_runtime(), 1); |
| 12903 |
var STYLE_HASH_ATTRIBUTE9 = "data-wp-hash"; |
| 12904 |
function getRuntime9() { |
| 12905 |
const globalScope = globalThis; |
| 12906 |
if (globalScope.__wpStyleRuntime) { |
| 12907 |
return globalScope.__wpStyleRuntime; |
| 12908 |
} |
| 12909 |
globalScope.__wpStyleRuntime = { |
| 12910 |
documents: /* @__PURE__ */ new Map(), |
| 12911 |
styles: /* @__PURE__ */ new Map(), |
| 12912 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 12913 |
}; |
| 12914 |
if (typeof document !== "undefined") { |
| 12915 |
registerDocument9(document); |
| 12916 |
} |
| 12917 |
return globalScope.__wpStyleRuntime; |
| 12918 |
} |
| 12919 |
function documentContainsStyleHash9(targetDocument, hash) { |
| 12920 |
if (!targetDocument.head) { |
| 12921 |
return false; |
| 12922 |
} |
| 12923 |
for (const style of targetDocument.head.querySelectorAll( |
| 12924 |
`style[${STYLE_HASH_ATTRIBUTE9}]` |
| 12925 |
)) { |
| 12926 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE9) === hash) { |
| 12927 |
return true; |
| 12928 |
} |
| 12929 |
} |
| 12930 |
return false; |
| 12931 |
} |
| 12932 |
function injectStyle9(targetDocument, hash, css) { |
| 12933 |
if (!targetDocument.head) { |
| 12934 |
return; |
| 12935 |
} |
| 12936 |
const runtime = getRuntime9(); |
| 12937 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 12938 |
if (!injectedStyles) { |
| 12939 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 12940 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 12941 |
} |
| 12942 |
if (injectedStyles.has(hash)) { |
| 12943 |
return; |
| 12944 |
} |
| 12945 |
if (documentContainsStyleHash9(targetDocument, hash)) { |
| 12946 |
injectedStyles.add(hash); |
| 12947 |
return; |
| 12948 |
} |
| 12949 |
const style = targetDocument.createElement("style"); |
| 12950 |
style.setAttribute(STYLE_HASH_ATTRIBUTE9, hash); |
| 12951 |
style.appendChild(targetDocument.createTextNode(css)); |
| 12952 |
targetDocument.head.appendChild(style); |
| 12953 |
injectedStyles.add(hash); |
| 12954 |
} |
| 12955 |
function registerDocument9(targetDocument) { |
| 12956 |
const runtime = getRuntime9(); |
| 12957 |
runtime.documents.set( |
| 12958 |
targetDocument, |
| 12959 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 12960 |
); |
| 12961 |
for (const [hash, css] of runtime.styles) { |
| 12962 |
injectStyle9(targetDocument, hash, css); |
| 12963 |
} |
| 12964 |
return () => { |
| 12965 |
const count = runtime.documents.get(targetDocument); |
| 12966 |
if (count === void 0) { |
| 12967 |
return; |
| 12968 |
} |
| 12969 |
if (count <= 1) { |
| 12970 |
runtime.documents.delete(targetDocument); |
| 12971 |
return; |
| 12972 |
} |
| 12973 |
runtime.documents.set(targetDocument, count - 1); |
| 12974 |
}; |
| 12975 |
} |
| 12976 |
function registerStyle9(hash, css) { |
| 12977 |
const runtime = getRuntime9(); |
| 12978 |
runtime.styles.set(hash, css); |
| 12979 |
for (const targetDocument of runtime.documents.keys()) { |
| 12980 |
injectStyle9(targetDocument, hash, css); |
| 12981 |
} |
| 12982 |
} |
| 12983 |
if (typeof process === "undefined" || true) { |
| 12984 |
registerStyle9("e3ae230cea", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._336cd3e4e743482f__box-sizing{box-sizing:border-box;*,:after,:before{box-sizing:inherit}}}"); |
| 12985 |
} |
| 12986 |
var resets_default3 = { "box-sizing": "_336cd3e4e743482f__box-sizing" }; |
| 12987 |
if (typeof process === "undefined" || true) { |
| 12988 |
registerStyle9("8293efbb49", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._480b748dd3510e64__positioner{z-index:var(--wp-ui-tooltip-z-index,initial)}._50096b232db7709d__popup{background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border-radius:var(--wpds-border-radius-sm,2px);box-shadow:var(--wpds-elevation-sm,0 1px 2px 0 #0000000d,0 2px 3px 0 #0000000a,0 6px 6px 0 #00000008,0 8px 8px 0 #00000005);color:var(--wpds-color-fg-content-neutral,#1e1e1e);font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-sm,12px);line-height:1.4;padding:var(--wpds-dimension-padding-xs,4px) var(--wpds-dimension-padding-sm,8px);@media (forced-colors:active){border-bottom-color:CanvasText;border-bottom-style:solid;border-bottom-width:1px;border-left-color:CanvasText;border-left-style:solid;border-left-width:1px;border-right-color:CanvasText;border-right-style:solid;border-right-width:1px;border-top-color:CanvasText;border-top-style:solid;border-top-width:1px}}}'); |
| 12989 |
} |
| 12990 |
var style_default9 = { "positioner": "_480b748dd3510e64__positioner", "popup": "_50096b232db7709d__popup" }; |
| 12991 |
var Positioner = (0, import_element31.forwardRef)( |
| 12992 |
function TooltipPositioner3({ align = "center", className, side = "top", sideOffset = 4, ...props }, ref) { |
| 12993 |
return /* @__PURE__ */ (0, import_jsx_runtime55.jsx)( |
| 12994 |
index_parts_exports3.Positioner, |
| 12995 |
{ |
| 12996 |
ref, |
| 12997 |
align, |
| 12998 |
side, |
| 12999 |
sideOffset, |
| 13000 |
...props, |
| 13001 |
className: clsx_default( |
| 13002 |
resets_default3["box-sizing"], |
| 13003 |
style_default9.positioner, |
| 13004 |
className |
| 13005 |
) |
| 13006 |
} |
| 13007 |
); |
| 13008 |
} |
| 13009 |
); |
| 13010 |
|
| 13011 |
// packages/ui/build-module/tooltip/popup.mjs |
| 13012 |
var import_jsx_runtime56 = __toESM(require_jsx_runtime(), 1); |
| 13013 |
var STYLE_HASH_ATTRIBUTE10 = "data-wp-hash"; |
| 13014 |
function getRuntime10() { |
| 13015 |
const globalScope = globalThis; |
| 13016 |
if (globalScope.__wpStyleRuntime) { |
| 13017 |
return globalScope.__wpStyleRuntime; |
| 13018 |
} |
| 13019 |
globalScope.__wpStyleRuntime = { |
| 13020 |
documents: /* @__PURE__ */ new Map(), |
| 13021 |
styles: /* @__PURE__ */ new Map(), |
| 13022 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13023 |
}; |
| 13024 |
if (typeof document !== "undefined") { |
| 13025 |
registerDocument10(document); |
| 13026 |
} |
| 13027 |
return globalScope.__wpStyleRuntime; |
| 13028 |
} |
| 13029 |
function documentContainsStyleHash10(targetDocument, hash) { |
| 13030 |
if (!targetDocument.head) { |
| 13031 |
return false; |
| 13032 |
} |
| 13033 |
for (const style of targetDocument.head.querySelectorAll( |
| 13034 |
`style[${STYLE_HASH_ATTRIBUTE10}]` |
| 13035 |
)) { |
| 13036 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE10) === hash) { |
| 13037 |
return true; |
| 13038 |
} |
| 13039 |
} |
| 13040 |
return false; |
| 13041 |
} |
| 13042 |
function injectStyle10(targetDocument, hash, css) { |
| 13043 |
if (!targetDocument.head) { |
| 13044 |
return; |
| 13045 |
} |
| 13046 |
const runtime = getRuntime10(); |
| 13047 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13048 |
if (!injectedStyles) { |
| 13049 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13050 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13051 |
} |
| 13052 |
if (injectedStyles.has(hash)) { |
| 13053 |
return; |
| 13054 |
} |
| 13055 |
if (documentContainsStyleHash10(targetDocument, hash)) { |
| 13056 |
injectedStyles.add(hash); |
| 13057 |
return; |
| 13058 |
} |
| 13059 |
const style = targetDocument.createElement("style"); |
| 13060 |
style.setAttribute(STYLE_HASH_ATTRIBUTE10, hash); |
| 13061 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13062 |
targetDocument.head.appendChild(style); |
| 13063 |
injectedStyles.add(hash); |
| 13064 |
} |
| 13065 |
function registerDocument10(targetDocument) { |
| 13066 |
const runtime = getRuntime10(); |
| 13067 |
runtime.documents.set( |
| 13068 |
targetDocument, |
| 13069 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13070 |
); |
| 13071 |
for (const [hash, css] of runtime.styles) { |
| 13072 |
injectStyle10(targetDocument, hash, css); |
| 13073 |
} |
| 13074 |
return () => { |
| 13075 |
const count = runtime.documents.get(targetDocument); |
| 13076 |
if (count === void 0) { |
| 13077 |
return; |
| 13078 |
} |
| 13079 |
if (count <= 1) { |
| 13080 |
runtime.documents.delete(targetDocument); |
| 13081 |
return; |
| 13082 |
} |
| 13083 |
runtime.documents.set(targetDocument, count - 1); |
| 13084 |
}; |
| 13085 |
} |
| 13086 |
function registerStyle10(hash, css) { |
| 13087 |
const runtime = getRuntime10(); |
| 13088 |
runtime.styles.set(hash, css); |
| 13089 |
for (const targetDocument of runtime.documents.keys()) { |
| 13090 |
injectStyle10(targetDocument, hash, css); |
| 13091 |
} |
| 13092 |
} |
| 13093 |
if (typeof process === "undefined" || true) { |
| 13094 |
registerStyle10("8293efbb49", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._480b748dd3510e64__positioner{z-index:var(--wp-ui-tooltip-z-index,initial)}._50096b232db7709d__popup{background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border-radius:var(--wpds-border-radius-sm,2px);box-shadow:var(--wpds-elevation-sm,0 1px 2px 0 #0000000d,0 2px 3px 0 #0000000a,0 6px 6px 0 #00000008,0 8px 8px 0 #00000005);color:var(--wpds-color-fg-content-neutral,#1e1e1e);font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-sm,12px);line-height:1.4;padding:var(--wpds-dimension-padding-xs,4px) var(--wpds-dimension-padding-sm,8px);@media (forced-colors:active){border-bottom-color:CanvasText;border-bottom-style:solid;border-bottom-width:1px;border-left-color:CanvasText;border-left-style:solid;border-left-width:1px;border-right-color:CanvasText;border-right-style:solid;border-right-width:1px;border-top-color:CanvasText;border-top-style:solid;border-top-width:1px}}}'); |
| 13095 |
} |
| 13096 |
var style_default10 = { "positioner": "_480b748dd3510e64__positioner", "popup": "_50096b232db7709d__popup" }; |
| 13097 |
var ThemeProvider2 = unlock(import_theme2.privateApis).ThemeProvider; |
| 13098 |
var Popup2 = (0, import_element32.forwardRef)(function TooltipPopup3({ portal, positioner, children, className, ...props }, ref) { |
| 13099 |
const popupContent = ( |
| 13100 |
/* This should ideally use whatever dark color makes sense, |
| 13101 |
* and not be hardcoded to #1e1e1e. The solutions would be to: |
| 13102 |
* - review the design of the tooltip, in case we want to stop |
| 13103 |
* hardcoding it to a dark background |
| 13104 |
* - create new semantic tokens as needed (aliasing either the |
| 13105 |
* "inverted bg" or "perma-dark bg" private tokens) and have |
| 13106 |
* Tooltip.Popup use them; |
| 13107 |
* - remove the hardcoded `bg` setting from the `ThemeProvider` |
| 13108 |
* below |
| 13109 |
*/ |
| 13110 |
/* @__PURE__ */ (0, import_jsx_runtime56.jsx)(ThemeProvider2, { color: { bg: "#1e1e1e" }, children: /* @__PURE__ */ (0, import_jsx_runtime56.jsx)( |
| 13111 |
index_parts_exports3.Popup, |
| 13112 |
{ |
| 13113 |
ref, |
| 13114 |
className: clsx_default(style_default10.popup, className), |
| 13115 |
...props, |
| 13116 |
children |
| 13117 |
} |
| 13118 |
) }) |
| 13119 |
); |
| 13120 |
const positionedPopup = renderSlotWithChildren( |
| 13121 |
positioner, |
| 13122 |
/* @__PURE__ */ (0, import_jsx_runtime56.jsx)(Positioner, {}), |
| 13123 |
popupContent |
| 13124 |
); |
| 13125 |
return renderSlotWithChildren(portal, /* @__PURE__ */ (0, import_jsx_runtime56.jsx)(Portal2, {}), positionedPopup); |
| 13126 |
}); |
| 13127 |
|
| 13128 |
// packages/ui/build-module/tooltip/trigger.mjs |
| 13129 |
var import_element33 = __toESM(require_element(), 1); |
| 13130 |
var import_jsx_runtime57 = __toESM(require_jsx_runtime(), 1); |
| 13131 |
var Trigger2 = (0, import_element33.forwardRef)( |
| 13132 |
function TooltipTrigger3(props, ref) { |
| 13133 |
return /* @__PURE__ */ (0, import_jsx_runtime57.jsx)(index_parts_exports3.Trigger, { ref, ...props }); |
| 13134 |
} |
| 13135 |
); |
| 13136 |
|
| 13137 |
// packages/ui/build-module/tooltip/root.mjs |
| 13138 |
var import_jsx_runtime58 = __toESM(require_jsx_runtime(), 1); |
| 13139 |
function Root3(props) { |
| 13140 |
return /* @__PURE__ */ (0, import_jsx_runtime58.jsx)(index_parts_exports3.Root, { ...props }); |
| 13141 |
} |
| 13142 |
|
| 13143 |
// packages/ui/build-module/tooltip/provider.mjs |
| 13144 |
var import_jsx_runtime59 = __toESM(require_jsx_runtime(), 1); |
| 13145 |
function Provider({ ...props }) { |
| 13146 |
return /* @__PURE__ */ (0, import_jsx_runtime59.jsx)(index_parts_exports3.Provider, { ...props }); |
| 13147 |
} |
| 13148 |
|
| 13149 |
// packages/ui/build-module/icon-button/icon-button.mjs |
| 13150 |
var import_jsx_runtime60 = __toESM(require_jsx_runtime(), 1); |
| 13151 |
var STYLE_HASH_ATTRIBUTE11 = "data-wp-hash"; |
| 13152 |
function getRuntime11() { |
| 13153 |
const globalScope = globalThis; |
| 13154 |
if (globalScope.__wpStyleRuntime) { |
| 13155 |
return globalScope.__wpStyleRuntime; |
| 13156 |
} |
| 13157 |
globalScope.__wpStyleRuntime = { |
| 13158 |
documents: /* @__PURE__ */ new Map(), |
| 13159 |
styles: /* @__PURE__ */ new Map(), |
| 13160 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13161 |
}; |
| 13162 |
if (typeof document !== "undefined") { |
| 13163 |
registerDocument11(document); |
| 13164 |
} |
| 13165 |
return globalScope.__wpStyleRuntime; |
| 13166 |
} |
| 13167 |
function documentContainsStyleHash11(targetDocument, hash) { |
| 13168 |
if (!targetDocument.head) { |
| 13169 |
return false; |
| 13170 |
} |
| 13171 |
for (const style of targetDocument.head.querySelectorAll( |
| 13172 |
`style[${STYLE_HASH_ATTRIBUTE11}]` |
| 13173 |
)) { |
| 13174 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE11) === hash) { |
| 13175 |
return true; |
| 13176 |
} |
| 13177 |
} |
| 13178 |
return false; |
| 13179 |
} |
| 13180 |
function injectStyle11(targetDocument, hash, css) { |
| 13181 |
if (!targetDocument.head) { |
| 13182 |
return; |
| 13183 |
} |
| 13184 |
const runtime = getRuntime11(); |
| 13185 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13186 |
if (!injectedStyles) { |
| 13187 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13188 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13189 |
} |
| 13190 |
if (injectedStyles.has(hash)) { |
| 13191 |
return; |
| 13192 |
} |
| 13193 |
if (documentContainsStyleHash11(targetDocument, hash)) { |
| 13194 |
injectedStyles.add(hash); |
| 13195 |
return; |
| 13196 |
} |
| 13197 |
const style = targetDocument.createElement("style"); |
| 13198 |
style.setAttribute(STYLE_HASH_ATTRIBUTE11, hash); |
| 13199 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13200 |
targetDocument.head.appendChild(style); |
| 13201 |
injectedStyles.add(hash); |
| 13202 |
} |
| 13203 |
function registerDocument11(targetDocument) { |
| 13204 |
const runtime = getRuntime11(); |
| 13205 |
runtime.documents.set( |
| 13206 |
targetDocument, |
| 13207 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13208 |
); |
| 13209 |
for (const [hash, css] of runtime.styles) { |
| 13210 |
injectStyle11(targetDocument, hash, css); |
| 13211 |
} |
| 13212 |
return () => { |
| 13213 |
const count = runtime.documents.get(targetDocument); |
| 13214 |
if (count === void 0) { |
| 13215 |
return; |
| 13216 |
} |
| 13217 |
if (count <= 1) { |
| 13218 |
runtime.documents.delete(targetDocument); |
| 13219 |
return; |
| 13220 |
} |
| 13221 |
runtime.documents.set(targetDocument, count - 1); |
| 13222 |
}; |
| 13223 |
} |
| 13224 |
function registerStyle11(hash, css) { |
| 13225 |
const runtime = getRuntime11(); |
| 13226 |
runtime.styles.set(hash, css); |
| 13227 |
for (const targetDocument of runtime.documents.keys()) { |
| 13228 |
injectStyle11(targetDocument, hash, css); |
| 13229 |
} |
| 13230 |
} |
| 13231 |
if (typeof process === "undefined" || true) { |
| 13232 |
registerStyle11("358a2a646a", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-compositions{._28cfdc260e755391__icon-button{--wp-ui-button-aspect-ratio:1;--wp-ui-button-padding-inline:0;--wp-ui-button-min-width:unset}.f1c70d719989a85a__icon{margin:-1px}}"); |
| 13233 |
} |
| 13234 |
var style_default11 = { "icon-button": "_28cfdc260e755391__icon-button", "icon": "f1c70d719989a85a__icon" }; |
| 13235 |
var IconButton = (0, import_element34.forwardRef)( |
| 13236 |
function IconButton2({ |
| 13237 |
label, |
| 13238 |
className, |
| 13239 |
// Prevent accidental forwarding of `children` |
| 13240 |
children: _children, |
| 13241 |
disabled: disabled2, |
| 13242 |
focusableWhenDisabled, |
| 13243 |
icon, |
| 13244 |
size: size4, |
| 13245 |
shortcut, |
| 13246 |
positioner, |
| 13247 |
...restProps |
| 13248 |
}, ref) { |
| 13249 |
const classes = clsx_default(style_default11["icon-button"], className); |
| 13250 |
return /* @__PURE__ */ (0, import_jsx_runtime60.jsx)(Provider, { delay: 0, children: /* @__PURE__ */ (0, import_jsx_runtime60.jsxs)(Root3, { children: [ |
| 13251 |
/* @__PURE__ */ (0, import_jsx_runtime60.jsx)( |
| 13252 |
Trigger2, |
| 13253 |
{ |
| 13254 |
ref, |
| 13255 |
disabled: disabled2 && !focusableWhenDisabled, |
| 13256 |
render: /* @__PURE__ */ (0, import_jsx_runtime60.jsx)( |
| 13257 |
Button4, |
| 13258 |
{ |
| 13259 |
...restProps, |
| 13260 |
size: size4, |
| 13261 |
"aria-label": label, |
| 13262 |
"aria-keyshortcuts": shortcut?.ariaKeyShortcut, |
| 13263 |
disabled: disabled2, |
| 13264 |
focusableWhenDisabled |
| 13265 |
} |
| 13266 |
), |
| 13267 |
className: classes, |
| 13268 |
children: /* @__PURE__ */ (0, import_jsx_runtime60.jsx)( |
| 13269 |
Icon, |
| 13270 |
{ |
| 13271 |
icon, |
| 13272 |
size: 24, |
| 13273 |
className: style_default11.icon |
| 13274 |
} |
| 13275 |
) |
| 13276 |
} |
| 13277 |
), |
| 13278 |
/* @__PURE__ */ (0, import_jsx_runtime60.jsxs)(Popup2, { positioner, children: [ |
| 13279 |
label, |
| 13280 |
shortcut && /* @__PURE__ */ (0, import_jsx_runtime60.jsxs)(import_jsx_runtime60.Fragment, { children: [ |
| 13281 |
" ", |
| 13282 |
/* @__PURE__ */ (0, import_jsx_runtime60.jsx)("span", { "aria-hidden": "true", children: shortcut.displayShortcut }) |
| 13283 |
] }) |
| 13284 |
] }) |
| 13285 |
] }) }); |
| 13286 |
} |
| 13287 |
); |
| 13288 |
|
| 13289 |
// packages/ui/build-module/dialog/close-icon.mjs |
| 13290 |
var import_jsx_runtime61 = __toESM(require_jsx_runtime(), 1); |
| 13291 |
var CloseIcon = (0, import_element35.forwardRef)( |
| 13292 |
function DialogCloseIcon({ icon, label, ...props }, ref) { |
| 13293 |
return /* @__PURE__ */ (0, import_jsx_runtime61.jsx)( |
| 13294 |
index_parts_exports2.Close, |
| 13295 |
{ |
| 13296 |
ref, |
| 13297 |
render: /* @__PURE__ */ (0, import_jsx_runtime61.jsx)( |
| 13298 |
IconButton, |
| 13299 |
{ |
| 13300 |
variant: "minimal", |
| 13301 |
size: "compact", |
| 13302 |
tone: "neutral", |
| 13303 |
...props, |
| 13304 |
icon: icon ?? close_default, |
| 13305 |
label: label ?? (0, import_i18n3.__)("Close"), |
| 13306 |
"data-wp-ui-dialog-close-icon": "" |
| 13307 |
} |
| 13308 |
) |
| 13309 |
} |
| 13310 |
); |
| 13311 |
} |
| 13312 |
); |
| 13313 |
|
| 13314 |
// packages/ui/build-module/dialog/content.mjs |
| 13315 |
var import_element36 = __toESM(require_element(), 1); |
| 13316 |
var import_compose2 = __toESM(require_compose(), 1); |
| 13317 |
var STYLE_HASH_ATTRIBUTE12 = "data-wp-hash"; |
| 13318 |
function getRuntime12() { |
| 13319 |
const globalScope = globalThis; |
| 13320 |
if (globalScope.__wpStyleRuntime) { |
| 13321 |
return globalScope.__wpStyleRuntime; |
| 13322 |
} |
| 13323 |
globalScope.__wpStyleRuntime = { |
| 13324 |
documents: /* @__PURE__ */ new Map(), |
| 13325 |
styles: /* @__PURE__ */ new Map(), |
| 13326 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13327 |
}; |
| 13328 |
if (typeof document !== "undefined") { |
| 13329 |
registerDocument12(document); |
| 13330 |
} |
| 13331 |
return globalScope.__wpStyleRuntime; |
| 13332 |
} |
| 13333 |
function documentContainsStyleHash12(targetDocument, hash) { |
| 13334 |
if (!targetDocument.head) { |
| 13335 |
return false; |
| 13336 |
} |
| 13337 |
for (const style of targetDocument.head.querySelectorAll( |
| 13338 |
`style[${STYLE_HASH_ATTRIBUTE12}]` |
| 13339 |
)) { |
| 13340 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE12) === hash) { |
| 13341 |
return true; |
| 13342 |
} |
| 13343 |
} |
| 13344 |
return false; |
| 13345 |
} |
| 13346 |
function injectStyle12(targetDocument, hash, css) { |
| 13347 |
if (!targetDocument.head) { |
| 13348 |
return; |
| 13349 |
} |
| 13350 |
const runtime = getRuntime12(); |
| 13351 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13352 |
if (!injectedStyles) { |
| 13353 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13354 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13355 |
} |
| 13356 |
if (injectedStyles.has(hash)) { |
| 13357 |
return; |
| 13358 |
} |
| 13359 |
if (documentContainsStyleHash12(targetDocument, hash)) { |
| 13360 |
injectedStyles.add(hash); |
| 13361 |
return; |
| 13362 |
} |
| 13363 |
const style = targetDocument.createElement("style"); |
| 13364 |
style.setAttribute(STYLE_HASH_ATTRIBUTE12, hash); |
| 13365 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13366 |
targetDocument.head.appendChild(style); |
| 13367 |
injectedStyles.add(hash); |
| 13368 |
} |
| 13369 |
function registerDocument12(targetDocument) { |
| 13370 |
const runtime = getRuntime12(); |
| 13371 |
runtime.documents.set( |
| 13372 |
targetDocument, |
| 13373 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13374 |
); |
| 13375 |
for (const [hash, css] of runtime.styles) { |
| 13376 |
injectStyle12(targetDocument, hash, css); |
| 13377 |
} |
| 13378 |
return () => { |
| 13379 |
const count = runtime.documents.get(targetDocument); |
| 13380 |
if (count === void 0) { |
| 13381 |
return; |
| 13382 |
} |
| 13383 |
if (count <= 1) { |
| 13384 |
runtime.documents.delete(targetDocument); |
| 13385 |
return; |
| 13386 |
} |
| 13387 |
runtime.documents.set(targetDocument, count - 1); |
| 13388 |
}; |
| 13389 |
} |
| 13390 |
function registerStyle12(hash, css) { |
| 13391 |
const runtime = getRuntime12(); |
| 13392 |
runtime.styles.set(hash, css); |
| 13393 |
for (const targetDocument of runtime.documents.keys()) { |
| 13394 |
injectStyle12(targetDocument, hash, css); |
| 13395 |
} |
| 13396 |
} |
| 13397 |
if (typeof process === "undefined" || true) { |
| 13398 |
registerStyle12("2a5ab8f3a7", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._08e8a2e44959f892__outset-ring--focus,._970d04df7376df67__outset-ring--focus-within-except-active,.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible,.cd83dfc2126a0846__outset-ring--focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active,.ecadb9e080e2dfa5__outset-ring--focus-parent-visible{@media not (prefers-reduced-motion){--_gcd-a-transition:outline 0.1s ease-out;transition:outline .1s ease-out}outline:0 solid #0000;outline-offset:1px}._08e8a2e44959f892__outset-ring--focus:focus,._970d04df7376df67__outset-ring--focus-within-except-active:focus-within:not(:has(:active)),.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible:focus-within:has(:focus-visible),.cd83dfc2126a0846__outset-ring--focus-within:focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible:focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active:focus:not(:active),:focus-visible .ecadb9e080e2dfa5__outset-ring--focus-parent-visible{--_gcd-a-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));--_gcd-div-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9))}}"); |
| 13399 |
} |
| 13400 |
var focus_default3 = { "outset-ring--focus": "_08e8a2e44959f892__outset-ring--focus", "outset-ring--focus-except-active": "e25b2bdd7aa21721__outset-ring--focus-except-active", "outset-ring--focus-visible": "d0541bc9dd9dc7b6__outset-ring--focus-visible", "outset-ring--focus-within": "cd83dfc2126a0846__outset-ring--focus-within", "outset-ring--focus-within-except-active": "_970d04df7376df67__outset-ring--focus-within-except-active", "outset-ring--focus-within-visible": "c5cb3ee4bddaa8e4__outset-ring--focus-within-visible", "outset-ring--focus-parent-visible": "ecadb9e080e2dfa5__outset-ring--focus-parent-visible" }; |
| 13401 |
if (typeof process === "undefined" || true) { |
| 13402 |
registerStyle12("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 13403 |
} |
| 13404 |
var style_default12 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 13405 |
var Content2 = (0, import_element36.forwardRef)( |
| 13406 |
function DialogContent({ className, render: render4, onScroll, ...props }, ref) { |
| 13407 |
const { ref: scrollStateRef, onScroll: scrollStateOnScroll } = useOverlayScrollStateAttributes(onScroll); |
| 13408 |
const mergedRef = (0, import_compose2.useMergeRefs)([ref, scrollStateRef]); |
| 13409 |
const element = useRender({ |
| 13410 |
defaultTagName: "div", |
| 13411 |
render: render4, |
| 13412 |
ref: mergedRef, |
| 13413 |
props: mergeProps(props, { |
| 13414 |
className: clsx_default( |
| 13415 |
style_default12.content, |
| 13416 |
focus_default3["outset-ring--focus-visible"], |
| 13417 |
className |
| 13418 |
), |
| 13419 |
onScroll: scrollStateOnScroll |
| 13420 |
}) |
| 13421 |
}); |
| 13422 |
return element; |
| 13423 |
} |
| 13424 |
); |
| 13425 |
|
| 13426 |
// packages/ui/build-module/dialog/description.mjs |
| 13427 |
var import_element37 = __toESM(require_element(), 1); |
| 13428 |
var import_jsx_runtime62 = __toESM(require_jsx_runtime(), 1); |
| 13429 |
var STYLE_HASH_ATTRIBUTE13 = "data-wp-hash"; |
| 13430 |
function getRuntime13() { |
| 13431 |
const globalScope = globalThis; |
| 13432 |
if (globalScope.__wpStyleRuntime) { |
| 13433 |
return globalScope.__wpStyleRuntime; |
| 13434 |
} |
| 13435 |
globalScope.__wpStyleRuntime = { |
| 13436 |
documents: /* @__PURE__ */ new Map(), |
| 13437 |
styles: /* @__PURE__ */ new Map(), |
| 13438 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13439 |
}; |
| 13440 |
if (typeof document !== "undefined") { |
| 13441 |
registerDocument13(document); |
| 13442 |
} |
| 13443 |
return globalScope.__wpStyleRuntime; |
| 13444 |
} |
| 13445 |
function documentContainsStyleHash13(targetDocument, hash) { |
| 13446 |
if (!targetDocument.head) { |
| 13447 |
return false; |
| 13448 |
} |
| 13449 |
for (const style of targetDocument.head.querySelectorAll( |
| 13450 |
`style[${STYLE_HASH_ATTRIBUTE13}]` |
| 13451 |
)) { |
| 13452 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE13) === hash) { |
| 13453 |
return true; |
| 13454 |
} |
| 13455 |
} |
| 13456 |
return false; |
| 13457 |
} |
| 13458 |
function injectStyle13(targetDocument, hash, css) { |
| 13459 |
if (!targetDocument.head) { |
| 13460 |
return; |
| 13461 |
} |
| 13462 |
const runtime = getRuntime13(); |
| 13463 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13464 |
if (!injectedStyles) { |
| 13465 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13466 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13467 |
} |
| 13468 |
if (injectedStyles.has(hash)) { |
| 13469 |
return; |
| 13470 |
} |
| 13471 |
if (documentContainsStyleHash13(targetDocument, hash)) { |
| 13472 |
injectedStyles.add(hash); |
| 13473 |
return; |
| 13474 |
} |
| 13475 |
const style = targetDocument.createElement("style"); |
| 13476 |
style.setAttribute(STYLE_HASH_ATTRIBUTE13, hash); |
| 13477 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13478 |
targetDocument.head.appendChild(style); |
| 13479 |
injectedStyles.add(hash); |
| 13480 |
} |
| 13481 |
function registerDocument13(targetDocument) { |
| 13482 |
const runtime = getRuntime13(); |
| 13483 |
runtime.documents.set( |
| 13484 |
targetDocument, |
| 13485 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13486 |
); |
| 13487 |
for (const [hash, css] of runtime.styles) { |
| 13488 |
injectStyle13(targetDocument, hash, css); |
| 13489 |
} |
| 13490 |
return () => { |
| 13491 |
const count = runtime.documents.get(targetDocument); |
| 13492 |
if (count === void 0) { |
| 13493 |
return; |
| 13494 |
} |
| 13495 |
if (count <= 1) { |
| 13496 |
runtime.documents.delete(targetDocument); |
| 13497 |
return; |
| 13498 |
} |
| 13499 |
runtime.documents.set(targetDocument, count - 1); |
| 13500 |
}; |
| 13501 |
} |
| 13502 |
function registerStyle13(hash, css) { |
| 13503 |
const runtime = getRuntime13(); |
| 13504 |
runtime.styles.set(hash, css); |
| 13505 |
for (const targetDocument of runtime.documents.keys()) { |
| 13506 |
injectStyle13(targetDocument, hash, css); |
| 13507 |
} |
| 13508 |
} |
| 13509 |
if (typeof process === "undefined" || true) { |
| 13510 |
registerStyle13("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 13511 |
} |
| 13512 |
var style_default13 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 13513 |
var Description = (0, import_element37.forwardRef)( |
| 13514 |
function DialogDescription3({ children, ...props }, ref) { |
| 13515 |
return /* @__PURE__ */ (0, import_jsx_runtime62.jsx)( |
| 13516 |
Text, |
| 13517 |
{ |
| 13518 |
ref, |
| 13519 |
variant: "body-md", |
| 13520 |
render: /* @__PURE__ */ (0, import_jsx_runtime62.jsx)(index_parts_exports2.Description, { ...props }), |
| 13521 |
className: style_default13.description, |
| 13522 |
children |
| 13523 |
} |
| 13524 |
); |
| 13525 |
} |
| 13526 |
); |
| 13527 |
|
| 13528 |
// packages/ui/build-module/dialog/footer.mjs |
| 13529 |
var import_element38 = __toESM(require_element(), 1); |
| 13530 |
var STYLE_HASH_ATTRIBUTE14 = "data-wp-hash"; |
| 13531 |
function getRuntime14() { |
| 13532 |
const globalScope = globalThis; |
| 13533 |
if (globalScope.__wpStyleRuntime) { |
| 13534 |
return globalScope.__wpStyleRuntime; |
| 13535 |
} |
| 13536 |
globalScope.__wpStyleRuntime = { |
| 13537 |
documents: /* @__PURE__ */ new Map(), |
| 13538 |
styles: /* @__PURE__ */ new Map(), |
| 13539 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13540 |
}; |
| 13541 |
if (typeof document !== "undefined") { |
| 13542 |
registerDocument14(document); |
| 13543 |
} |
| 13544 |
return globalScope.__wpStyleRuntime; |
| 13545 |
} |
| 13546 |
function documentContainsStyleHash14(targetDocument, hash) { |
| 13547 |
if (!targetDocument.head) { |
| 13548 |
return false; |
| 13549 |
} |
| 13550 |
for (const style of targetDocument.head.querySelectorAll( |
| 13551 |
`style[${STYLE_HASH_ATTRIBUTE14}]` |
| 13552 |
)) { |
| 13553 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE14) === hash) { |
| 13554 |
return true; |
| 13555 |
} |
| 13556 |
} |
| 13557 |
return false; |
| 13558 |
} |
| 13559 |
function injectStyle14(targetDocument, hash, css) { |
| 13560 |
if (!targetDocument.head) { |
| 13561 |
return; |
| 13562 |
} |
| 13563 |
const runtime = getRuntime14(); |
| 13564 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13565 |
if (!injectedStyles) { |
| 13566 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13567 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13568 |
} |
| 13569 |
if (injectedStyles.has(hash)) { |
| 13570 |
return; |
| 13571 |
} |
| 13572 |
if (documentContainsStyleHash14(targetDocument, hash)) { |
| 13573 |
injectedStyles.add(hash); |
| 13574 |
return; |
| 13575 |
} |
| 13576 |
const style = targetDocument.createElement("style"); |
| 13577 |
style.setAttribute(STYLE_HASH_ATTRIBUTE14, hash); |
| 13578 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13579 |
targetDocument.head.appendChild(style); |
| 13580 |
injectedStyles.add(hash); |
| 13581 |
} |
| 13582 |
function registerDocument14(targetDocument) { |
| 13583 |
const runtime = getRuntime14(); |
| 13584 |
runtime.documents.set( |
| 13585 |
targetDocument, |
| 13586 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13587 |
); |
| 13588 |
for (const [hash, css] of runtime.styles) { |
| 13589 |
injectStyle14(targetDocument, hash, css); |
| 13590 |
} |
| 13591 |
return () => { |
| 13592 |
const count = runtime.documents.get(targetDocument); |
| 13593 |
if (count === void 0) { |
| 13594 |
return; |
| 13595 |
} |
| 13596 |
if (count <= 1) { |
| 13597 |
runtime.documents.delete(targetDocument); |
| 13598 |
return; |
| 13599 |
} |
| 13600 |
runtime.documents.set(targetDocument, count - 1); |
| 13601 |
}; |
| 13602 |
} |
| 13603 |
function registerStyle14(hash, css) { |
| 13604 |
const runtime = getRuntime14(); |
| 13605 |
runtime.styles.set(hash, css); |
| 13606 |
for (const targetDocument of runtime.documents.keys()) { |
| 13607 |
injectStyle14(targetDocument, hash, css); |
| 13608 |
} |
| 13609 |
} |
| 13610 |
if (typeof process === "undefined" || true) { |
| 13611 |
registerStyle14("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 13612 |
} |
| 13613 |
var style_default14 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 13614 |
var Footer = (0, import_element38.forwardRef)(function DialogFooter({ className, render: render4, ...props }, ref) { |
| 13615 |
const element = useRender({ |
| 13616 |
defaultTagName: "footer", |
| 13617 |
render: render4, |
| 13618 |
ref, |
| 13619 |
props: mergeProps(props, { |
| 13620 |
className: clsx_default(style_default14.footer, className) |
| 13621 |
}) |
| 13622 |
}); |
| 13623 |
return element; |
| 13624 |
}); |
| 13625 |
|
| 13626 |
// packages/ui/build-module/dialog/header.mjs |
| 13627 |
var import_element39 = __toESM(require_element(), 1); |
| 13628 |
var STYLE_HASH_ATTRIBUTE15 = "data-wp-hash"; |
| 13629 |
function getRuntime15() { |
| 13630 |
const globalScope = globalThis; |
| 13631 |
if (globalScope.__wpStyleRuntime) { |
| 13632 |
return globalScope.__wpStyleRuntime; |
| 13633 |
} |
| 13634 |
globalScope.__wpStyleRuntime = { |
| 13635 |
documents: /* @__PURE__ */ new Map(), |
| 13636 |
styles: /* @__PURE__ */ new Map(), |
| 13637 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13638 |
}; |
| 13639 |
if (typeof document !== "undefined") { |
| 13640 |
registerDocument15(document); |
| 13641 |
} |
| 13642 |
return globalScope.__wpStyleRuntime; |
| 13643 |
} |
| 13644 |
function documentContainsStyleHash15(targetDocument, hash) { |
| 13645 |
if (!targetDocument.head) { |
| 13646 |
return false; |
| 13647 |
} |
| 13648 |
for (const style of targetDocument.head.querySelectorAll( |
| 13649 |
`style[${STYLE_HASH_ATTRIBUTE15}]` |
| 13650 |
)) { |
| 13651 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE15) === hash) { |
| 13652 |
return true; |
| 13653 |
} |
| 13654 |
} |
| 13655 |
return false; |
| 13656 |
} |
| 13657 |
function injectStyle15(targetDocument, hash, css) { |
| 13658 |
if (!targetDocument.head) { |
| 13659 |
return; |
| 13660 |
} |
| 13661 |
const runtime = getRuntime15(); |
| 13662 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13663 |
if (!injectedStyles) { |
| 13664 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13665 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13666 |
} |
| 13667 |
if (injectedStyles.has(hash)) { |
| 13668 |
return; |
| 13669 |
} |
| 13670 |
if (documentContainsStyleHash15(targetDocument, hash)) { |
| 13671 |
injectedStyles.add(hash); |
| 13672 |
return; |
| 13673 |
} |
| 13674 |
const style = targetDocument.createElement("style"); |
| 13675 |
style.setAttribute(STYLE_HASH_ATTRIBUTE15, hash); |
| 13676 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13677 |
targetDocument.head.appendChild(style); |
| 13678 |
injectedStyles.add(hash); |
| 13679 |
} |
| 13680 |
function registerDocument15(targetDocument) { |
| 13681 |
const runtime = getRuntime15(); |
| 13682 |
runtime.documents.set( |
| 13683 |
targetDocument, |
| 13684 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13685 |
); |
| 13686 |
for (const [hash, css] of runtime.styles) { |
| 13687 |
injectStyle15(targetDocument, hash, css); |
| 13688 |
} |
| 13689 |
return () => { |
| 13690 |
const count = runtime.documents.get(targetDocument); |
| 13691 |
if (count === void 0) { |
| 13692 |
return; |
| 13693 |
} |
| 13694 |
if (count <= 1) { |
| 13695 |
runtime.documents.delete(targetDocument); |
| 13696 |
return; |
| 13697 |
} |
| 13698 |
runtime.documents.set(targetDocument, count - 1); |
| 13699 |
}; |
| 13700 |
} |
| 13701 |
function registerStyle15(hash, css) { |
| 13702 |
const runtime = getRuntime15(); |
| 13703 |
runtime.styles.set(hash, css); |
| 13704 |
for (const targetDocument of runtime.documents.keys()) { |
| 13705 |
injectStyle15(targetDocument, hash, css); |
| 13706 |
} |
| 13707 |
} |
| 13708 |
if (typeof process === "undefined" || true) { |
| 13709 |
registerStyle15("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 13710 |
} |
| 13711 |
var style_default15 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 13712 |
var Header2 = (0, import_element39.forwardRef)(function DialogHeader({ className, render: render4, ...props }, ref) { |
| 13713 |
const element = useRender({ |
| 13714 |
defaultTagName: "header", |
| 13715 |
render: render4, |
| 13716 |
ref, |
| 13717 |
props: mergeProps(props, { |
| 13718 |
className: clsx_default(style_default15.header, className) |
| 13719 |
}) |
| 13720 |
}); |
| 13721 |
return element; |
| 13722 |
}); |
| 13723 |
|
| 13724 |
// packages/ui/build-module/dialog/popup.mjs |
| 13725 |
var import_element44 = __toESM(require_element(), 1); |
| 13726 |
var import_compose3 = __toESM(require_compose(), 1); |
| 13727 |
var import_theme3 = __toESM(require_theme(), 1); |
| 13728 |
|
| 13729 |
// packages/ui/build-module/utils/create-overlay-modal-context.mjs |
| 13730 |
var import_element40 = __toESM(require_element(), 1); |
| 13731 |
var import_jsx_runtime63 = __toESM(require_jsx_runtime(), 1); |
| 13732 |
function createOverlayModalContext(initialValue) { |
| 13733 |
const OverlayModalContext = (0, import_element40.createContext)(initialValue); |
| 13734 |
function OverlayModalProvider({ |
| 13735 |
modal, |
| 13736 |
children |
| 13737 |
}) { |
| 13738 |
return /* @__PURE__ */ (0, import_jsx_runtime63.jsx)(OverlayModalContext.Provider, { value: modal, children }); |
| 13739 |
} |
| 13740 |
function useOverlayModal() { |
| 13741 |
return (0, import_element40.useContext)(OverlayModalContext); |
| 13742 |
} |
| 13743 |
return { |
| 13744 |
Provider: OverlayModalProvider, |
| 13745 |
useModal: useOverlayModal |
| 13746 |
}; |
| 13747 |
} |
| 13748 |
|
| 13749 |
// packages/ui/build-module/utils/create-overlay-title-validation.mjs |
| 13750 |
var import_element42 = __toESM(require_element(), 1); |
| 13751 |
|
| 13752 |
// packages/ui/build-module/utils/use-schedule-validation.mjs |
| 13753 |
var import_element41 = __toESM(require_element(), 1); |
| 13754 |
function useScheduleValidation(validate) { |
| 13755 |
const validateRef = (0, import_element41.useRef)(validate); |
| 13756 |
validateRef.current = validate; |
| 13757 |
const timerRef = (0, import_element41.useRef)(null); |
| 13758 |
const unmountedRef = (0, import_element41.useRef)(false); |
| 13759 |
const scheduleValidation = (0, import_element41.useCallback)(() => { |
| 13760 |
if (unmountedRef.current) { |
| 13761 |
return; |
| 13762 |
} |
| 13763 |
if (timerRef.current) { |
| 13764 |
clearTimeout(timerRef.current); |
| 13765 |
} |
| 13766 |
timerRef.current = setTimeout(() => { |
| 13767 |
validateRef.current(); |
| 13768 |
timerRef.current = null; |
| 13769 |
}, 0); |
| 13770 |
}, []); |
| 13771 |
(0, import_element41.useEffect)(() => { |
| 13772 |
unmountedRef.current = false; |
| 13773 |
return () => { |
| 13774 |
unmountedRef.current = true; |
| 13775 |
if (timerRef.current) { |
| 13776 |
clearTimeout(timerRef.current); |
| 13777 |
} |
| 13778 |
}; |
| 13779 |
}, []); |
| 13780 |
return scheduleValidation; |
| 13781 |
} |
| 13782 |
|
| 13783 |
// packages/ui/build-module/utils/create-overlay-title-validation.mjs |
| 13784 |
var import_jsx_runtime64 = __toESM(require_jsx_runtime(), 1); |
| 13785 |
var VALIDATION_ENABLED = true; |
| 13786 |
function createOverlayTitleValidation(componentName) { |
| 13787 |
const componentNameLowerCase = componentName.toLowerCase(); |
| 13788 |
const OverlayValidationContext = VALIDATION_ENABLED ? (0, import_element42.createContext)(null) : null; |
| 13789 |
function useValidationContextDev() { |
| 13790 |
return (0, import_element42.useContext)(OverlayValidationContext); |
| 13791 |
} |
| 13792 |
function useValidationContextProd() { |
| 13793 |
return null; |
| 13794 |
} |
| 13795 |
const useValidationContext = VALIDATION_ENABLED ? useValidationContextDev : useValidationContextProd; |
| 13796 |
function ValidationProviderDev({ |
| 13797 |
children |
| 13798 |
}) { |
| 13799 |
const titleElementRef = (0, import_element42.useRef)(null); |
| 13800 |
const scheduleValidation = useScheduleValidation(() => { |
| 13801 |
const titleElement = titleElementRef.current; |
| 13802 |
if (!titleElement) { |
| 13803 |
throw new Error( |
| 13804 |
`${componentName}: Missing <${componentName}.Title>. For accessibility, every ${componentNameLowerCase} requires a title. If needed, the title can be visually hidden but must not be omitted.` |
| 13805 |
); |
| 13806 |
} |
| 13807 |
const textContent = titleElement.textContent?.trim(); |
| 13808 |
if (!textContent) { |
| 13809 |
throw new Error( |
| 13810 |
`${componentName}: <${componentName}.Title> cannot be empty. Provide meaningful text content for the ${componentNameLowerCase} title.` |
| 13811 |
); |
| 13812 |
} |
| 13813 |
}); |
| 13814 |
const registerTitle = (0, import_element42.useCallback)( |
| 13815 |
(element) => { |
| 13816 |
titleElementRef.current = element; |
| 13817 |
scheduleValidation(); |
| 13818 |
return () => { |
| 13819 |
titleElementRef.current = null; |
| 13820 |
scheduleValidation(); |
| 13821 |
}; |
| 13822 |
}, |
| 13823 |
[scheduleValidation] |
| 13824 |
); |
| 13825 |
const contextValue = (0, import_element42.useMemo)( |
| 13826 |
() => ({ registerTitle }), |
| 13827 |
[registerTitle] |
| 13828 |
); |
| 13829 |
(0, import_element42.useEffect)(() => { |
| 13830 |
scheduleValidation(); |
| 13831 |
}, [scheduleValidation]); |
| 13832 |
return /* @__PURE__ */ (0, import_jsx_runtime64.jsx)(OverlayValidationContext.Provider, { value: contextValue, children }); |
| 13833 |
} |
| 13834 |
function ValidationProviderProd({ |
| 13835 |
children |
| 13836 |
}) { |
| 13837 |
return /* @__PURE__ */ (0, import_jsx_runtime64.jsx)(import_jsx_runtime64.Fragment, { children }); |
| 13838 |
} |
| 13839 |
const ValidationProvider = VALIDATION_ENABLED ? ValidationProviderDev : ValidationProviderProd; |
| 13840 |
return { |
| 13841 |
ValidationProvider, |
| 13842 |
useValidationContext |
| 13843 |
}; |
| 13844 |
} |
| 13845 |
|
| 13846 |
// packages/ui/build-module/dialog/context.mjs |
| 13847 |
var dialogModal = createOverlayModalContext(true); |
| 13848 |
var DialogModalProvider = dialogModal.Provider; |
| 13849 |
var useDialogModal = dialogModal.useModal; |
| 13850 |
var dialogTitleValidation = createOverlayTitleValidation("Dialog"); |
| 13851 |
var useDialogValidationContext = dialogTitleValidation.useValidationContext; |
| 13852 |
var DialogValidationProvider = dialogTitleValidation.ValidationProvider; |
| 13853 |
|
| 13854 |
// packages/ui/build-module/dialog/portal.mjs |
| 13855 |
var import_element43 = __toESM(require_element(), 1); |
| 13856 |
var import_jsx_runtime65 = __toESM(require_jsx_runtime(), 1); |
| 13857 |
var Portal3 = (0, import_element43.forwardRef)( |
| 13858 |
function DialogPortal3(props, ref) { |
| 13859 |
return /* @__PURE__ */ (0, import_jsx_runtime65.jsx)(index_parts_exports2.Portal, { ref, ...props }); |
| 13860 |
} |
| 13861 |
); |
| 13862 |
|
| 13863 |
// packages/ui/build-module/dialog/popup.mjs |
| 13864 |
var import_jsx_runtime66 = __toESM(require_jsx_runtime(), 1); |
| 13865 |
var STYLE_HASH_ATTRIBUTE16 = "data-wp-hash"; |
| 13866 |
function getRuntime16() { |
| 13867 |
const globalScope = globalThis; |
| 13868 |
if (globalScope.__wpStyleRuntime) { |
| 13869 |
return globalScope.__wpStyleRuntime; |
| 13870 |
} |
| 13871 |
globalScope.__wpStyleRuntime = { |
| 13872 |
documents: /* @__PURE__ */ new Map(), |
| 13873 |
styles: /* @__PURE__ */ new Map(), |
| 13874 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 13875 |
}; |
| 13876 |
if (typeof document !== "undefined") { |
| 13877 |
registerDocument16(document); |
| 13878 |
} |
| 13879 |
return globalScope.__wpStyleRuntime; |
| 13880 |
} |
| 13881 |
function documentContainsStyleHash16(targetDocument, hash) { |
| 13882 |
if (!targetDocument.head) { |
| 13883 |
return false; |
| 13884 |
} |
| 13885 |
for (const style of targetDocument.head.querySelectorAll( |
| 13886 |
`style[${STYLE_HASH_ATTRIBUTE16}]` |
| 13887 |
)) { |
| 13888 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE16) === hash) { |
| 13889 |
return true; |
| 13890 |
} |
| 13891 |
} |
| 13892 |
return false; |
| 13893 |
} |
| 13894 |
function injectStyle16(targetDocument, hash, css) { |
| 13895 |
if (!targetDocument.head) { |
| 13896 |
return; |
| 13897 |
} |
| 13898 |
const runtime = getRuntime16(); |
| 13899 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 13900 |
if (!injectedStyles) { |
| 13901 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 13902 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 13903 |
} |
| 13904 |
if (injectedStyles.has(hash)) { |
| 13905 |
return; |
| 13906 |
} |
| 13907 |
if (documentContainsStyleHash16(targetDocument, hash)) { |
| 13908 |
injectedStyles.add(hash); |
| 13909 |
return; |
| 13910 |
} |
| 13911 |
const style = targetDocument.createElement("style"); |
| 13912 |
style.setAttribute(STYLE_HASH_ATTRIBUTE16, hash); |
| 13913 |
style.appendChild(targetDocument.createTextNode(css)); |
| 13914 |
targetDocument.head.appendChild(style); |
| 13915 |
injectedStyles.add(hash); |
| 13916 |
} |
| 13917 |
function registerDocument16(targetDocument) { |
| 13918 |
const runtime = getRuntime16(); |
| 13919 |
runtime.documents.set( |
| 13920 |
targetDocument, |
| 13921 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 13922 |
); |
| 13923 |
for (const [hash, css] of runtime.styles) { |
| 13924 |
injectStyle16(targetDocument, hash, css); |
| 13925 |
} |
| 13926 |
return () => { |
| 13927 |
const count = runtime.documents.get(targetDocument); |
| 13928 |
if (count === void 0) { |
| 13929 |
return; |
| 13930 |
} |
| 13931 |
if (count <= 1) { |
| 13932 |
runtime.documents.delete(targetDocument); |
| 13933 |
return; |
| 13934 |
} |
| 13935 |
runtime.documents.set(targetDocument, count - 1); |
| 13936 |
}; |
| 13937 |
} |
| 13938 |
function registerStyle16(hash, css) { |
| 13939 |
const runtime = getRuntime16(); |
| 13940 |
runtime.styles.set(hash, css); |
| 13941 |
for (const targetDocument of runtime.documents.keys()) { |
| 13942 |
injectStyle16(targetDocument, hash, css); |
| 13943 |
} |
| 13944 |
} |
| 13945 |
if (typeof process === "undefined" || true) { |
| 13946 |
registerStyle16("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 13947 |
} |
| 13948 |
var style_default16 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 13949 |
var ThemeProvider3 = unlock(import_theme3.privateApis).ThemeProvider; |
| 13950 |
var CLOSE_ICON_ATTR = "data-wp-ui-dialog-close-icon"; |
| 13951 |
var Popup3 = (0, import_element44.forwardRef)(function DialogPopup3({ |
| 13952 |
className, |
| 13953 |
portal, |
| 13954 |
children, |
| 13955 |
size: size4 = "medium", |
| 13956 |
initialFocus, |
| 13957 |
finalFocus, |
| 13958 |
...props |
| 13959 |
}, ref) { |
| 13960 |
const { resolvedInitialFocus, popupRef } = useDeprioritizedInitialFocus({ |
| 13961 |
initialFocus, |
| 13962 |
deprioritizedAttributes: [CLOSE_ICON_ATTR, SCROLL_CONTAINER_ATTR] |
| 13963 |
}); |
| 13964 |
const mergedRef = (0, import_compose3.useMergeRefs)([ref, popupRef]); |
| 13965 |
const modal = useDialogModal(); |
| 13966 |
const portalChildren = /* @__PURE__ */ (0, import_jsx_runtime66.jsxs)(import_jsx_runtime66.Fragment, { children: [ |
| 13967 |
modal === true && /* @__PURE__ */ (0, import_jsx_runtime66.jsx)( |
| 13968 |
index_parts_exports2.Backdrop, |
| 13969 |
{ |
| 13970 |
className: style_default16.backdrop, |
| 13971 |
"data-testid": "dialog-backdrop" |
| 13972 |
} |
| 13973 |
), |
| 13974 |
/* @__PURE__ */ (0, import_jsx_runtime66.jsx)(ThemeProvider3, { children: /* @__PURE__ */ (0, import_jsx_runtime66.jsx)( |
| 13975 |
index_parts_exports2.Popup, |
| 13976 |
{ |
| 13977 |
ref: mergedRef, |
| 13978 |
className: clsx_default( |
| 13979 |
style_default16.popup, |
| 13980 |
className, |
| 13981 |
style_default16[`is-${size4}`] |
| 13982 |
), |
| 13983 |
initialFocus: resolvedInitialFocus, |
| 13984 |
finalFocus, |
| 13985 |
...props, |
| 13986 |
"data-wp-ui-overlay-modal": modal === true ? "" : void 0, |
| 13987 |
children: /* @__PURE__ */ (0, import_jsx_runtime66.jsx)(DialogValidationProvider, { children }) |
| 13988 |
} |
| 13989 |
) }) |
| 13990 |
] }); |
| 13991 |
return renderSlotWithChildren(portal, /* @__PURE__ */ (0, import_jsx_runtime66.jsx)(Portal3, {}), portalChildren); |
| 13992 |
}); |
| 13993 |
|
| 13994 |
// packages/ui/build-module/dialog/root.mjs |
| 13995 |
var import_jsx_runtime67 = __toESM(require_jsx_runtime(), 1); |
| 13996 |
function Root4({ modal = true, children, ...props }) { |
| 13997 |
return /* @__PURE__ */ (0, import_jsx_runtime67.jsx)(index_parts_exports2.Root, { modal, ...props, children: /* @__PURE__ */ (0, import_jsx_runtime67.jsx)(DialogModalProvider, { modal, children }) }); |
| 13998 |
} |
| 13999 |
|
| 14000 |
// packages/ui/build-module/dialog/title.mjs |
| 14001 |
var import_compose4 = __toESM(require_compose(), 1); |
| 14002 |
var import_element45 = __toESM(require_element(), 1); |
| 14003 |
var import_jsx_runtime68 = __toESM(require_jsx_runtime(), 1); |
| 14004 |
var STYLE_HASH_ATTRIBUTE17 = "data-wp-hash"; |
| 14005 |
function getRuntime17() { |
| 14006 |
const globalScope = globalThis; |
| 14007 |
if (globalScope.__wpStyleRuntime) { |
| 14008 |
return globalScope.__wpStyleRuntime; |
| 14009 |
} |
| 14010 |
globalScope.__wpStyleRuntime = { |
| 14011 |
documents: /* @__PURE__ */ new Map(), |
| 14012 |
styles: /* @__PURE__ */ new Map(), |
| 14013 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14014 |
}; |
| 14015 |
if (typeof document !== "undefined") { |
| 14016 |
registerDocument17(document); |
| 14017 |
} |
| 14018 |
return globalScope.__wpStyleRuntime; |
| 14019 |
} |
| 14020 |
function documentContainsStyleHash17(targetDocument, hash) { |
| 14021 |
if (!targetDocument.head) { |
| 14022 |
return false; |
| 14023 |
} |
| 14024 |
for (const style of targetDocument.head.querySelectorAll( |
| 14025 |
`style[${STYLE_HASH_ATTRIBUTE17}]` |
| 14026 |
)) { |
| 14027 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE17) === hash) { |
| 14028 |
return true; |
| 14029 |
} |
| 14030 |
} |
| 14031 |
return false; |
| 14032 |
} |
| 14033 |
function injectStyle17(targetDocument, hash, css) { |
| 14034 |
if (!targetDocument.head) { |
| 14035 |
return; |
| 14036 |
} |
| 14037 |
const runtime = getRuntime17(); |
| 14038 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14039 |
if (!injectedStyles) { |
| 14040 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14041 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14042 |
} |
| 14043 |
if (injectedStyles.has(hash)) { |
| 14044 |
return; |
| 14045 |
} |
| 14046 |
if (documentContainsStyleHash17(targetDocument, hash)) { |
| 14047 |
injectedStyles.add(hash); |
| 14048 |
return; |
| 14049 |
} |
| 14050 |
const style = targetDocument.createElement("style"); |
| 14051 |
style.setAttribute(STYLE_HASH_ATTRIBUTE17, hash); |
| 14052 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14053 |
targetDocument.head.appendChild(style); |
| 14054 |
injectedStyles.add(hash); |
| 14055 |
} |
| 14056 |
function registerDocument17(targetDocument) { |
| 14057 |
const runtime = getRuntime17(); |
| 14058 |
runtime.documents.set( |
| 14059 |
targetDocument, |
| 14060 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14061 |
); |
| 14062 |
for (const [hash, css] of runtime.styles) { |
| 14063 |
injectStyle17(targetDocument, hash, css); |
| 14064 |
} |
| 14065 |
return () => { |
| 14066 |
const count = runtime.documents.get(targetDocument); |
| 14067 |
if (count === void 0) { |
| 14068 |
return; |
| 14069 |
} |
| 14070 |
if (count <= 1) { |
| 14071 |
runtime.documents.delete(targetDocument); |
| 14072 |
return; |
| 14073 |
} |
| 14074 |
runtime.documents.set(targetDocument, count - 1); |
| 14075 |
}; |
| 14076 |
} |
| 14077 |
function registerStyle17(hash, css) { |
| 14078 |
const runtime = getRuntime17(); |
| 14079 |
runtime.styles.set(hash, css); |
| 14080 |
for (const targetDocument of runtime.documents.keys()) { |
| 14081 |
injectStyle17(targetDocument, hash, css); |
| 14082 |
} |
| 14083 |
} |
| 14084 |
if (typeof process === "undefined" || true) { |
| 14085 |
registerStyle17("a400076f01", '@layer wp-ui-components{.f1c50237c4787636__header{min-height:32px;padding-block:var(--wpds-dimension-padding-2xl,24px) var(--wpds-dimension-gap-lg,16px)}._579f95efdec92a66__footer,.f1c50237c4787636__header{align-items:center;display:flex;gap:var(--wpds-dimension-gap-sm,8px);padding-inline:var(--wpds-dimension-padding-2xl,24px)}._579f95efdec92a66__footer{justify-content:flex-end;padding-block:var(--wpds-dimension-gap-lg,16px) var(--wpds-dimension-padding-2xl,24px)}._5371cc08aad82574__title{--_gcd-heading-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--_gcd-heading-margin:0 auto 0 0;color:var(--wpds-color-fg-content-neutral,#1e1e1e);margin-inline-end:auto;&:dir(rtl){--_gcd-heading-margin:0 0 0 auto}}._766d9011d37ce2d9__content{flex:1 1 auto;min-block-size:0;overflow-block:auto;overflow-inline:hidden;padding:var(--wpds-dimension-padding-2xl,24px);&:focus-visible{outline-offset:calc(var(--wpds-border-width-focus, var(--wp-admin-border-width-focus, 2px))*-1)}}.f1c50237c4787636__header:has(~._766d9011d37ce2d9__content){border-block-end:1px solid #0000;padding-block-end:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}.f1c50237c4787636__header~._766d9011d37ce2d9__content{padding-block-start:0}._766d9011d37ce2d9__content~._579f95efdec92a66__footer{border-block-start:1px solid #0000;padding-block-start:calc(var(--wpds-dimension-gap-lg, 16px) - 1px)}._766d9011d37ce2d9__content:has(~._579f95efdec92a66__footer){padding-block-end:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header{padding-inline:0}._766d9011d37ce2d9__content>.f1c50237c4787636__header:first-child,._766d9011d37ce2d9__content>[data-drawer-content]>.f1c50237c4787636__header:first-child{padding-block-start:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer{padding-inline:0}._766d9011d37ce2d9__content>._579f95efdec92a66__footer:last-child,._766d9011d37ce2d9__content>[data-drawer-content]>._579f95efdec92a66__footer:last-child{padding-block-end:0}.f1c50237c4787636__header:has(~[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-top]){border-block-end-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-scroll-container][data-wp-ui-overlay-scrolled-from-bottom]~._579f95efdec92a66__footer{border-block-start-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb)}[data-wp-ui-overlay-modal] [data-wp-ui-overlay-scroll-container]{overscroll-behavior:contain}}@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._074affe4c56b4f2f__backdrop{background-color:#00000059;inset:0;position:fixed;z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0}&[data-open]{opacity:1}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}._8acaa98861620d4d__popup{--viewport-inset:var(--wpds-dimension-padding-2xl,24px);background-color:var(--wpds-color-bg-surface-neutral-strong,#fff);border:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral,#dbdbdb);border-radius:var(--wpds-border-radius-lg,8px);box-shadow:var(--wpds-elevation-lg,0 5px 15px 0 #00000014,0 15px 27px 0 #00000012,0 30px 36px 0 #0000000a,0 50px 43px 0 #00000005);box-sizing:border-box;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);font-size:var(--wpds-typography-font-size-md,13px);left:50%;line-height:var(--wpds-typography-line-height-md,24px);max-height:calc(100dvh - var(--viewport-inset)*2);min-width:var(--wpds-dimension-surface-width-sm,320px);overflow:hidden;position:fixed;top:50%;transform:translate(-50%,-50%);width:calc(100vw - var(--viewport-inset)*2);z-index:var(--wp-ui-dialog-z-index,initial);&[data-ending-style],&[data-starting-style]{opacity:0;transform:translate(-50%,-50%) scale(.9)}@media not (prefers-reduced-motion){transition:opacity var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)),transform var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1))}@media (min-width:480px){min-width:var(--wpds-dimension-surface-width-md,400px)}&._7acfa67ebf092988__is-small{max-width:var(--wpds-dimension-surface-width-md,400px)}&._1eeeed880cb5769d__is-medium{max-width:var(--wpds-dimension-surface-width-lg,560px)}&._99f900b2267e22d0__is-large{max-width:var(--wpds-dimension-surface-width-2xl,960px)}&.b49f7ff9c06fe387__is-stretch{max-width:none}&.dcd4c2f5036cbf1a__is-full{height:100dvh}}._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup{border-color:#0000}@media (forced-colors:active){._074affe4c56b4f2f__backdrop~* ._8acaa98861620d4d__popup,._8acaa98861620d4d__popup{border-color:CanvasText}}._76fb3b28fcbd45fc__header [data-wp-ui-dialog-close-icon]{margin-inline-start:auto}.d9d6da914ef0a77c__description{margin-bottom:var(--wpds-dimension-gap-lg,16px)}}'); |
| 14086 |
} |
| 14087 |
var style_default17 = { "backdrop": "_074affe4c56b4f2f__backdrop", "popup": "_8acaa98861620d4d__popup", "is-small": "_7acfa67ebf092988__is-small", "is-medium": "_1eeeed880cb5769d__is-medium", "is-large": "_99f900b2267e22d0__is-large", "is-stretch": "b49f7ff9c06fe387__is-stretch", "is-full": "dcd4c2f5036cbf1a__is-full", "header": "_76fb3b28fcbd45fc__header f1c50237c4787636__header", "footer": "_00eeb4f220cddae3__footer _579f95efdec92a66__footer", "title": "f636832002af749e__title _5371cc08aad82574__title", "content": "_101038da9af7162f__content _766d9011d37ce2d9__content", "description": "d9d6da914ef0a77c__description" }; |
| 14088 |
var Title2 = (0, import_element45.forwardRef)( |
| 14089 |
function DialogTitle3({ children, ...props }, forwardedRef) { |
| 14090 |
const validationContext = useDialogValidationContext(); |
| 14091 |
const internalRef = (0, import_element45.useRef)(null); |
| 14092 |
const mergedRef = (0, import_compose4.useMergeRefs)([internalRef, forwardedRef]); |
| 14093 |
(0, import_element45.useEffect)(() => { |
| 14094 |
if (validationContext) { |
| 14095 |
return validationContext.registerTitle(internalRef.current); |
| 14096 |
} |
| 14097 |
return void 0; |
| 14098 |
}, [validationContext]); |
| 14099 |
return /* @__PURE__ */ (0, import_jsx_runtime68.jsx)( |
| 14100 |
Text, |
| 14101 |
{ |
| 14102 |
ref: mergedRef, |
| 14103 |
variant: "heading-xl", |
| 14104 |
render: /* @__PURE__ */ (0, import_jsx_runtime68.jsx)(index_parts_exports2.Title, { ...props }), |
| 14105 |
className: style_default17.title, |
| 14106 |
children |
| 14107 |
} |
| 14108 |
); |
| 14109 |
} |
| 14110 |
); |
| 14111 |
|
| 14112 |
// packages/ui/build-module/dialog/trigger.mjs |
| 14113 |
var import_element46 = __toESM(require_element(), 1); |
| 14114 |
var import_jsx_runtime69 = __toESM(require_jsx_runtime(), 1); |
| 14115 |
var Trigger3 = (0, import_element46.forwardRef)( |
| 14116 |
function DialogTrigger3(props, ref) { |
| 14117 |
return /* @__PURE__ */ (0, import_jsx_runtime69.jsx)(index_parts_exports2.Trigger, { ref, ...props }); |
| 14118 |
} |
| 14119 |
); |
| 14120 |
|
| 14121 |
// packages/ui/build-module/empty-state/index.mjs |
| 14122 |
var empty_state_exports = {}; |
| 14123 |
__export(empty_state_exports, { |
| 14124 |
Actions: () => Actions, |
| 14125 |
Description: () => Description2, |
| 14126 |
Icon: () => Icon3, |
| 14127 |
Root: () => Root5, |
| 14128 |
Title: () => Title3, |
| 14129 |
Visual: () => Visual |
| 14130 |
}); |
| 14131 |
|
| 14132 |
// packages/ui/build-module/empty-state/root.mjs |
| 14133 |
var import_element47 = __toESM(require_element(), 1); |
| 14134 |
var STYLE_HASH_ATTRIBUTE18 = "data-wp-hash"; |
| 14135 |
function getRuntime18() { |
| 14136 |
const globalScope = globalThis; |
| 14137 |
if (globalScope.__wpStyleRuntime) { |
| 14138 |
return globalScope.__wpStyleRuntime; |
| 14139 |
} |
| 14140 |
globalScope.__wpStyleRuntime = { |
| 14141 |
documents: /* @__PURE__ */ new Map(), |
| 14142 |
styles: /* @__PURE__ */ new Map(), |
| 14143 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14144 |
}; |
| 14145 |
if (typeof document !== "undefined") { |
| 14146 |
registerDocument18(document); |
| 14147 |
} |
| 14148 |
return globalScope.__wpStyleRuntime; |
| 14149 |
} |
| 14150 |
function documentContainsStyleHash18(targetDocument, hash) { |
| 14151 |
if (!targetDocument.head) { |
| 14152 |
return false; |
| 14153 |
} |
| 14154 |
for (const style of targetDocument.head.querySelectorAll( |
| 14155 |
`style[${STYLE_HASH_ATTRIBUTE18}]` |
| 14156 |
)) { |
| 14157 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE18) === hash) { |
| 14158 |
return true; |
| 14159 |
} |
| 14160 |
} |
| 14161 |
return false; |
| 14162 |
} |
| 14163 |
function injectStyle18(targetDocument, hash, css) { |
| 14164 |
if (!targetDocument.head) { |
| 14165 |
return; |
| 14166 |
} |
| 14167 |
const runtime = getRuntime18(); |
| 14168 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14169 |
if (!injectedStyles) { |
| 14170 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14171 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14172 |
} |
| 14173 |
if (injectedStyles.has(hash)) { |
| 14174 |
return; |
| 14175 |
} |
| 14176 |
if (documentContainsStyleHash18(targetDocument, hash)) { |
| 14177 |
injectedStyles.add(hash); |
| 14178 |
return; |
| 14179 |
} |
| 14180 |
const style = targetDocument.createElement("style"); |
| 14181 |
style.setAttribute(STYLE_HASH_ATTRIBUTE18, hash); |
| 14182 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14183 |
targetDocument.head.appendChild(style); |
| 14184 |
injectedStyles.add(hash); |
| 14185 |
} |
| 14186 |
function registerDocument18(targetDocument) { |
| 14187 |
const runtime = getRuntime18(); |
| 14188 |
runtime.documents.set( |
| 14189 |
targetDocument, |
| 14190 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14191 |
); |
| 14192 |
for (const [hash, css] of runtime.styles) { |
| 14193 |
injectStyle18(targetDocument, hash, css); |
| 14194 |
} |
| 14195 |
return () => { |
| 14196 |
const count = runtime.documents.get(targetDocument); |
| 14197 |
if (count === void 0) { |
| 14198 |
return; |
| 14199 |
} |
| 14200 |
if (count <= 1) { |
| 14201 |
runtime.documents.delete(targetDocument); |
| 14202 |
return; |
| 14203 |
} |
| 14204 |
runtime.documents.set(targetDocument, count - 1); |
| 14205 |
}; |
| 14206 |
} |
| 14207 |
function registerStyle18(hash, css) { |
| 14208 |
const runtime = getRuntime18(); |
| 14209 |
runtime.styles.set(hash, css); |
| 14210 |
for (const targetDocument of runtime.documents.keys()) { |
| 14211 |
injectStyle18(targetDocument, hash, css); |
| 14212 |
} |
| 14213 |
} |
| 14214 |
if (typeof process === "undefined" || true) { |
| 14215 |
registerStyle18("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14216 |
} |
| 14217 |
var style_default18 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14218 |
var Root5 = (0, import_element47.forwardRef)( |
| 14219 |
function EmptyStateRoot({ render: render4, ...props }, ref) { |
| 14220 |
const className = clsx_default(style_default18.root); |
| 14221 |
const element = useRender({ |
| 14222 |
defaultTagName: "div", |
| 14223 |
render: render4, |
| 14224 |
ref, |
| 14225 |
props: mergeProps({ className }, props) |
| 14226 |
}); |
| 14227 |
return element; |
| 14228 |
} |
| 14229 |
); |
| 14230 |
|
| 14231 |
// packages/ui/build-module/empty-state/visual.mjs |
| 14232 |
var import_element48 = __toESM(require_element(), 1); |
| 14233 |
var STYLE_HASH_ATTRIBUTE19 = "data-wp-hash"; |
| 14234 |
function getRuntime19() { |
| 14235 |
const globalScope = globalThis; |
| 14236 |
if (globalScope.__wpStyleRuntime) { |
| 14237 |
return globalScope.__wpStyleRuntime; |
| 14238 |
} |
| 14239 |
globalScope.__wpStyleRuntime = { |
| 14240 |
documents: /* @__PURE__ */ new Map(), |
| 14241 |
styles: /* @__PURE__ */ new Map(), |
| 14242 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14243 |
}; |
| 14244 |
if (typeof document !== "undefined") { |
| 14245 |
registerDocument19(document); |
| 14246 |
} |
| 14247 |
return globalScope.__wpStyleRuntime; |
| 14248 |
} |
| 14249 |
function documentContainsStyleHash19(targetDocument, hash) { |
| 14250 |
if (!targetDocument.head) { |
| 14251 |
return false; |
| 14252 |
} |
| 14253 |
for (const style of targetDocument.head.querySelectorAll( |
| 14254 |
`style[${STYLE_HASH_ATTRIBUTE19}]` |
| 14255 |
)) { |
| 14256 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE19) === hash) { |
| 14257 |
return true; |
| 14258 |
} |
| 14259 |
} |
| 14260 |
return false; |
| 14261 |
} |
| 14262 |
function injectStyle19(targetDocument, hash, css) { |
| 14263 |
if (!targetDocument.head) { |
| 14264 |
return; |
| 14265 |
} |
| 14266 |
const runtime = getRuntime19(); |
| 14267 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14268 |
if (!injectedStyles) { |
| 14269 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14270 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14271 |
} |
| 14272 |
if (injectedStyles.has(hash)) { |
| 14273 |
return; |
| 14274 |
} |
| 14275 |
if (documentContainsStyleHash19(targetDocument, hash)) { |
| 14276 |
injectedStyles.add(hash); |
| 14277 |
return; |
| 14278 |
} |
| 14279 |
const style = targetDocument.createElement("style"); |
| 14280 |
style.setAttribute(STYLE_HASH_ATTRIBUTE19, hash); |
| 14281 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14282 |
targetDocument.head.appendChild(style); |
| 14283 |
injectedStyles.add(hash); |
| 14284 |
} |
| 14285 |
function registerDocument19(targetDocument) { |
| 14286 |
const runtime = getRuntime19(); |
| 14287 |
runtime.documents.set( |
| 14288 |
targetDocument, |
| 14289 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14290 |
); |
| 14291 |
for (const [hash, css] of runtime.styles) { |
| 14292 |
injectStyle19(targetDocument, hash, css); |
| 14293 |
} |
| 14294 |
return () => { |
| 14295 |
const count = runtime.documents.get(targetDocument); |
| 14296 |
if (count === void 0) { |
| 14297 |
return; |
| 14298 |
} |
| 14299 |
if (count <= 1) { |
| 14300 |
runtime.documents.delete(targetDocument); |
| 14301 |
return; |
| 14302 |
} |
| 14303 |
runtime.documents.set(targetDocument, count - 1); |
| 14304 |
}; |
| 14305 |
} |
| 14306 |
function registerStyle19(hash, css) { |
| 14307 |
const runtime = getRuntime19(); |
| 14308 |
runtime.styles.set(hash, css); |
| 14309 |
for (const targetDocument of runtime.documents.keys()) { |
| 14310 |
injectStyle19(targetDocument, hash, css); |
| 14311 |
} |
| 14312 |
} |
| 14313 |
if (typeof process === "undefined" || true) { |
| 14314 |
registerStyle19("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14315 |
} |
| 14316 |
var style_default19 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14317 |
var Visual = (0, import_element48.forwardRef)( |
| 14318 |
function EmptyStateVisual({ render: render4, ...props }, ref) { |
| 14319 |
const className = clsx_default(style_default19.visual); |
| 14320 |
const element = useRender({ |
| 14321 |
defaultTagName: "div", |
| 14322 |
render: render4, |
| 14323 |
ref, |
| 14324 |
props: mergeProps({ className }, props) |
| 14325 |
}); |
| 14326 |
return element; |
| 14327 |
} |
| 14328 |
); |
| 14329 |
|
| 14330 |
// packages/ui/build-module/empty-state/icon.mjs |
| 14331 |
var import_element49 = __toESM(require_element(), 1); |
| 14332 |
var import_jsx_runtime70 = __toESM(require_jsx_runtime(), 1); |
| 14333 |
var STYLE_HASH_ATTRIBUTE20 = "data-wp-hash"; |
| 14334 |
function getRuntime20() { |
| 14335 |
const globalScope = globalThis; |
| 14336 |
if (globalScope.__wpStyleRuntime) { |
| 14337 |
return globalScope.__wpStyleRuntime; |
| 14338 |
} |
| 14339 |
globalScope.__wpStyleRuntime = { |
| 14340 |
documents: /* @__PURE__ */ new Map(), |
| 14341 |
styles: /* @__PURE__ */ new Map(), |
| 14342 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14343 |
}; |
| 14344 |
if (typeof document !== "undefined") { |
| 14345 |
registerDocument20(document); |
| 14346 |
} |
| 14347 |
return globalScope.__wpStyleRuntime; |
| 14348 |
} |
| 14349 |
function documentContainsStyleHash20(targetDocument, hash) { |
| 14350 |
if (!targetDocument.head) { |
| 14351 |
return false; |
| 14352 |
} |
| 14353 |
for (const style of targetDocument.head.querySelectorAll( |
| 14354 |
`style[${STYLE_HASH_ATTRIBUTE20}]` |
| 14355 |
)) { |
| 14356 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE20) === hash) { |
| 14357 |
return true; |
| 14358 |
} |
| 14359 |
} |
| 14360 |
return false; |
| 14361 |
} |
| 14362 |
function injectStyle20(targetDocument, hash, css) { |
| 14363 |
if (!targetDocument.head) { |
| 14364 |
return; |
| 14365 |
} |
| 14366 |
const runtime = getRuntime20(); |
| 14367 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14368 |
if (!injectedStyles) { |
| 14369 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14370 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14371 |
} |
| 14372 |
if (injectedStyles.has(hash)) { |
| 14373 |
return; |
| 14374 |
} |
| 14375 |
if (documentContainsStyleHash20(targetDocument, hash)) { |
| 14376 |
injectedStyles.add(hash); |
| 14377 |
return; |
| 14378 |
} |
| 14379 |
const style = targetDocument.createElement("style"); |
| 14380 |
style.setAttribute(STYLE_HASH_ATTRIBUTE20, hash); |
| 14381 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14382 |
targetDocument.head.appendChild(style); |
| 14383 |
injectedStyles.add(hash); |
| 14384 |
} |
| 14385 |
function registerDocument20(targetDocument) { |
| 14386 |
const runtime = getRuntime20(); |
| 14387 |
runtime.documents.set( |
| 14388 |
targetDocument, |
| 14389 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14390 |
); |
| 14391 |
for (const [hash, css] of runtime.styles) { |
| 14392 |
injectStyle20(targetDocument, hash, css); |
| 14393 |
} |
| 14394 |
return () => { |
| 14395 |
const count = runtime.documents.get(targetDocument); |
| 14396 |
if (count === void 0) { |
| 14397 |
return; |
| 14398 |
} |
| 14399 |
if (count <= 1) { |
| 14400 |
runtime.documents.delete(targetDocument); |
| 14401 |
return; |
| 14402 |
} |
| 14403 |
runtime.documents.set(targetDocument, count - 1); |
| 14404 |
}; |
| 14405 |
} |
| 14406 |
function registerStyle20(hash, css) { |
| 14407 |
const runtime = getRuntime20(); |
| 14408 |
runtime.styles.set(hash, css); |
| 14409 |
for (const targetDocument of runtime.documents.keys()) { |
| 14410 |
injectStyle20(targetDocument, hash, css); |
| 14411 |
} |
| 14412 |
} |
| 14413 |
if (typeof process === "undefined" || true) { |
| 14414 |
registerStyle20("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14415 |
} |
| 14416 |
var style_default20 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14417 |
var Icon3 = (0, import_element49.forwardRef)( |
| 14418 |
function EmptyStateIcon({ icon, className, ...restProps }, ref) { |
| 14419 |
return /* @__PURE__ */ (0, import_jsx_runtime70.jsx)( |
| 14420 |
Visual, |
| 14421 |
{ |
| 14422 |
ref, |
| 14423 |
className: clsx_default(style_default20.icon, className), |
| 14424 |
...restProps, |
| 14425 |
children: /* @__PURE__ */ (0, import_jsx_runtime70.jsx)(Icon, { icon }) |
| 14426 |
} |
| 14427 |
); |
| 14428 |
} |
| 14429 |
); |
| 14430 |
|
| 14431 |
// packages/ui/build-module/empty-state/title.mjs |
| 14432 |
var import_element50 = __toESM(require_element(), 1); |
| 14433 |
var import_jsx_runtime71 = __toESM(require_jsx_runtime(), 1); |
| 14434 |
var STYLE_HASH_ATTRIBUTE21 = "data-wp-hash"; |
| 14435 |
function getRuntime21() { |
| 14436 |
const globalScope = globalThis; |
| 14437 |
if (globalScope.__wpStyleRuntime) { |
| 14438 |
return globalScope.__wpStyleRuntime; |
| 14439 |
} |
| 14440 |
globalScope.__wpStyleRuntime = { |
| 14441 |
documents: /* @__PURE__ */ new Map(), |
| 14442 |
styles: /* @__PURE__ */ new Map(), |
| 14443 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14444 |
}; |
| 14445 |
if (typeof document !== "undefined") { |
| 14446 |
registerDocument21(document); |
| 14447 |
} |
| 14448 |
return globalScope.__wpStyleRuntime; |
| 14449 |
} |
| 14450 |
function documentContainsStyleHash21(targetDocument, hash) { |
| 14451 |
if (!targetDocument.head) { |
| 14452 |
return false; |
| 14453 |
} |
| 14454 |
for (const style of targetDocument.head.querySelectorAll( |
| 14455 |
`style[${STYLE_HASH_ATTRIBUTE21}]` |
| 14456 |
)) { |
| 14457 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE21) === hash) { |
| 14458 |
return true; |
| 14459 |
} |
| 14460 |
} |
| 14461 |
return false; |
| 14462 |
} |
| 14463 |
function injectStyle21(targetDocument, hash, css) { |
| 14464 |
if (!targetDocument.head) { |
| 14465 |
return; |
| 14466 |
} |
| 14467 |
const runtime = getRuntime21(); |
| 14468 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14469 |
if (!injectedStyles) { |
| 14470 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14471 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14472 |
} |
| 14473 |
if (injectedStyles.has(hash)) { |
| 14474 |
return; |
| 14475 |
} |
| 14476 |
if (documentContainsStyleHash21(targetDocument, hash)) { |
| 14477 |
injectedStyles.add(hash); |
| 14478 |
return; |
| 14479 |
} |
| 14480 |
const style = targetDocument.createElement("style"); |
| 14481 |
style.setAttribute(STYLE_HASH_ATTRIBUTE21, hash); |
| 14482 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14483 |
targetDocument.head.appendChild(style); |
| 14484 |
injectedStyles.add(hash); |
| 14485 |
} |
| 14486 |
function registerDocument21(targetDocument) { |
| 14487 |
const runtime = getRuntime21(); |
| 14488 |
runtime.documents.set( |
| 14489 |
targetDocument, |
| 14490 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14491 |
); |
| 14492 |
for (const [hash, css] of runtime.styles) { |
| 14493 |
injectStyle21(targetDocument, hash, css); |
| 14494 |
} |
| 14495 |
return () => { |
| 14496 |
const count = runtime.documents.get(targetDocument); |
| 14497 |
if (count === void 0) { |
| 14498 |
return; |
| 14499 |
} |
| 14500 |
if (count <= 1) { |
| 14501 |
runtime.documents.delete(targetDocument); |
| 14502 |
return; |
| 14503 |
} |
| 14504 |
runtime.documents.set(targetDocument, count - 1); |
| 14505 |
}; |
| 14506 |
} |
| 14507 |
function registerStyle21(hash, css) { |
| 14508 |
const runtime = getRuntime21(); |
| 14509 |
runtime.styles.set(hash, css); |
| 14510 |
for (const targetDocument of runtime.documents.keys()) { |
| 14511 |
injectStyle21(targetDocument, hash, css); |
| 14512 |
} |
| 14513 |
} |
| 14514 |
if (typeof process === "undefined" || true) { |
| 14515 |
registerStyle21("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14516 |
} |
| 14517 |
var style_default21 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14518 |
var DEFAULT_TAG2 = /* @__PURE__ */ (0, import_jsx_runtime71.jsx)("h2", {}); |
| 14519 |
var Title3 = (0, import_element50.forwardRef)( |
| 14520 |
function EmptyStateTitle({ render: render4 = DEFAULT_TAG2, className, children, ...props }, ref) { |
| 14521 |
return /* @__PURE__ */ (0, import_jsx_runtime71.jsx)( |
| 14522 |
Text, |
| 14523 |
{ |
| 14524 |
ref, |
| 14525 |
variant: "heading-lg", |
| 14526 |
render: render4, |
| 14527 |
className: clsx_default(style_default21.title, className), |
| 14528 |
...props, |
| 14529 |
children |
| 14530 |
} |
| 14531 |
); |
| 14532 |
} |
| 14533 |
); |
| 14534 |
|
| 14535 |
// packages/ui/build-module/empty-state/description.mjs |
| 14536 |
var import_element51 = __toESM(require_element(), 1); |
| 14537 |
var import_jsx_runtime72 = __toESM(require_jsx_runtime(), 1); |
| 14538 |
var STYLE_HASH_ATTRIBUTE22 = "data-wp-hash"; |
| 14539 |
function getRuntime22() { |
| 14540 |
const globalScope = globalThis; |
| 14541 |
if (globalScope.__wpStyleRuntime) { |
| 14542 |
return globalScope.__wpStyleRuntime; |
| 14543 |
} |
| 14544 |
globalScope.__wpStyleRuntime = { |
| 14545 |
documents: /* @__PURE__ */ new Map(), |
| 14546 |
styles: /* @__PURE__ */ new Map(), |
| 14547 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14548 |
}; |
| 14549 |
if (typeof document !== "undefined") { |
| 14550 |
registerDocument22(document); |
| 14551 |
} |
| 14552 |
return globalScope.__wpStyleRuntime; |
| 14553 |
} |
| 14554 |
function documentContainsStyleHash22(targetDocument, hash) { |
| 14555 |
if (!targetDocument.head) { |
| 14556 |
return false; |
| 14557 |
} |
| 14558 |
for (const style of targetDocument.head.querySelectorAll( |
| 14559 |
`style[${STYLE_HASH_ATTRIBUTE22}]` |
| 14560 |
)) { |
| 14561 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE22) === hash) { |
| 14562 |
return true; |
| 14563 |
} |
| 14564 |
} |
| 14565 |
return false; |
| 14566 |
} |
| 14567 |
function injectStyle22(targetDocument, hash, css) { |
| 14568 |
if (!targetDocument.head) { |
| 14569 |
return; |
| 14570 |
} |
| 14571 |
const runtime = getRuntime22(); |
| 14572 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14573 |
if (!injectedStyles) { |
| 14574 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14575 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14576 |
} |
| 14577 |
if (injectedStyles.has(hash)) { |
| 14578 |
return; |
| 14579 |
} |
| 14580 |
if (documentContainsStyleHash22(targetDocument, hash)) { |
| 14581 |
injectedStyles.add(hash); |
| 14582 |
return; |
| 14583 |
} |
| 14584 |
const style = targetDocument.createElement("style"); |
| 14585 |
style.setAttribute(STYLE_HASH_ATTRIBUTE22, hash); |
| 14586 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14587 |
targetDocument.head.appendChild(style); |
| 14588 |
injectedStyles.add(hash); |
| 14589 |
} |
| 14590 |
function registerDocument22(targetDocument) { |
| 14591 |
const runtime = getRuntime22(); |
| 14592 |
runtime.documents.set( |
| 14593 |
targetDocument, |
| 14594 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14595 |
); |
| 14596 |
for (const [hash, css] of runtime.styles) { |
| 14597 |
injectStyle22(targetDocument, hash, css); |
| 14598 |
} |
| 14599 |
return () => { |
| 14600 |
const count = runtime.documents.get(targetDocument); |
| 14601 |
if (count === void 0) { |
| 14602 |
return; |
| 14603 |
} |
| 14604 |
if (count <= 1) { |
| 14605 |
runtime.documents.delete(targetDocument); |
| 14606 |
return; |
| 14607 |
} |
| 14608 |
runtime.documents.set(targetDocument, count - 1); |
| 14609 |
}; |
| 14610 |
} |
| 14611 |
function registerStyle22(hash, css) { |
| 14612 |
const runtime = getRuntime22(); |
| 14613 |
runtime.styles.set(hash, css); |
| 14614 |
for (const targetDocument of runtime.documents.keys()) { |
| 14615 |
injectStyle22(targetDocument, hash, css); |
| 14616 |
} |
| 14617 |
} |
| 14618 |
if (typeof process === "undefined" || true) { |
| 14619 |
registerStyle22("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14620 |
} |
| 14621 |
var style_default23 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14622 |
var DEFAULT_TAG3 = /* @__PURE__ */ (0, import_jsx_runtime72.jsx)("p", {}); |
| 14623 |
var Description2 = (0, import_element51.forwardRef)(function EmptyStateDescription({ render: render4 = DEFAULT_TAG3, className, children, ...props }, ref) { |
| 14624 |
return /* @__PURE__ */ (0, import_jsx_runtime72.jsx)( |
| 14625 |
Text, |
| 14626 |
{ |
| 14627 |
ref, |
| 14628 |
variant: "body-md", |
| 14629 |
render: render4, |
| 14630 |
className: clsx_default(style_default23.description, className), |
| 14631 |
...props, |
| 14632 |
children |
| 14633 |
} |
| 14634 |
); |
| 14635 |
}); |
| 14636 |
|
| 14637 |
// packages/ui/build-module/empty-state/actions.mjs |
| 14638 |
var import_element52 = __toESM(require_element(), 1); |
| 14639 |
var STYLE_HASH_ATTRIBUTE23 = "data-wp-hash"; |
| 14640 |
function getRuntime23() { |
| 14641 |
const globalScope = globalThis; |
| 14642 |
if (globalScope.__wpStyleRuntime) { |
| 14643 |
return globalScope.__wpStyleRuntime; |
| 14644 |
} |
| 14645 |
globalScope.__wpStyleRuntime = { |
| 14646 |
documents: /* @__PURE__ */ new Map(), |
| 14647 |
styles: /* @__PURE__ */ new Map(), |
| 14648 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14649 |
}; |
| 14650 |
if (typeof document !== "undefined") { |
| 14651 |
registerDocument23(document); |
| 14652 |
} |
| 14653 |
return globalScope.__wpStyleRuntime; |
| 14654 |
} |
| 14655 |
function documentContainsStyleHash23(targetDocument, hash) { |
| 14656 |
if (!targetDocument.head) { |
| 14657 |
return false; |
| 14658 |
} |
| 14659 |
for (const style of targetDocument.head.querySelectorAll( |
| 14660 |
`style[${STYLE_HASH_ATTRIBUTE23}]` |
| 14661 |
)) { |
| 14662 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE23) === hash) { |
| 14663 |
return true; |
| 14664 |
} |
| 14665 |
} |
| 14666 |
return false; |
| 14667 |
} |
| 14668 |
function injectStyle23(targetDocument, hash, css) { |
| 14669 |
if (!targetDocument.head) { |
| 14670 |
return; |
| 14671 |
} |
| 14672 |
const runtime = getRuntime23(); |
| 14673 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14674 |
if (!injectedStyles) { |
| 14675 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14676 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14677 |
} |
| 14678 |
if (injectedStyles.has(hash)) { |
| 14679 |
return; |
| 14680 |
} |
| 14681 |
if (documentContainsStyleHash23(targetDocument, hash)) { |
| 14682 |
injectedStyles.add(hash); |
| 14683 |
return; |
| 14684 |
} |
| 14685 |
const style = targetDocument.createElement("style"); |
| 14686 |
style.setAttribute(STYLE_HASH_ATTRIBUTE23, hash); |
| 14687 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14688 |
targetDocument.head.appendChild(style); |
| 14689 |
injectedStyles.add(hash); |
| 14690 |
} |
| 14691 |
function registerDocument23(targetDocument) { |
| 14692 |
const runtime = getRuntime23(); |
| 14693 |
runtime.documents.set( |
| 14694 |
targetDocument, |
| 14695 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14696 |
); |
| 14697 |
for (const [hash, css] of runtime.styles) { |
| 14698 |
injectStyle23(targetDocument, hash, css); |
| 14699 |
} |
| 14700 |
return () => { |
| 14701 |
const count = runtime.documents.get(targetDocument); |
| 14702 |
if (count === void 0) { |
| 14703 |
return; |
| 14704 |
} |
| 14705 |
if (count <= 1) { |
| 14706 |
runtime.documents.delete(targetDocument); |
| 14707 |
return; |
| 14708 |
} |
| 14709 |
runtime.documents.set(targetDocument, count - 1); |
| 14710 |
}; |
| 14711 |
} |
| 14712 |
function registerStyle23(hash, css) { |
| 14713 |
const runtime = getRuntime23(); |
| 14714 |
runtime.styles.set(hash, css); |
| 14715 |
for (const targetDocument of runtime.documents.keys()) { |
| 14716 |
injectStyle23(targetDocument, hash, css); |
| 14717 |
} |
| 14718 |
} |
| 14719 |
if (typeof process === "undefined" || true) { |
| 14720 |
registerStyle23("6d6361d221", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.a23e08e65c8e62e5__root{text-wrap:balance;align-items:center;color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-direction:column;font-family:var(--wpds-typography-font-family-body,-apple-system,system-ui,"Segoe UI","Roboto","Oxygen-Sans","Ubuntu","Cantarell","Helvetica Neue",sans-serif);gap:var(--wpds-dimension-gap-xs,4px);max-width:var(--wpds-dimension-surface-width-sm,320px);text-align:center}._01303b3680eaa216__visual{align-items:center;color:var(--wpds-color-fg-content-neutral-weak,#707070);display:flex;justify-content:center;line-height:1;margin-block-end:var(--wpds-dimension-gap-xs,4px)}._58c8e351db225608__icon{background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);border:1px solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);border-radius:50%;padding:var(--wpds-dimension-padding-xs,4px)}.b8b96f70820333a1__title{margin:0}._70f1dd22bad55b18__description{color:var(--wpds-color-fg-content-neutral-weak,#707070);margin:0}._89ac025fd8e2bc52__actions{align-items:center;display:flex;flex-direction:column;gap:var(--wpds-dimension-gap-xs,4px);margin-block-start:var(--wpds-dimension-gap-md,12px);@media (min-width:480px){flex-direction:row;justify-content:center}}}'); |
| 14721 |
} |
| 14722 |
var style_default24 = { "root": "a23e08e65c8e62e5__root", "visual": "_01303b3680eaa216__visual", "icon": "_58c8e351db225608__icon", "title": "b8b96f70820333a1__title", "description": "_70f1dd22bad55b18__description", "actions": "_89ac025fd8e2bc52__actions" }; |
| 14723 |
var Actions = (0, import_element52.forwardRef)( |
| 14724 |
function EmptyStateActions({ render: render4, ...props }, ref) { |
| 14725 |
const className = clsx_default(style_default24.actions); |
| 14726 |
const element = useRender({ |
| 14727 |
defaultTagName: "div", |
| 14728 |
render: render4, |
| 14729 |
ref, |
| 14730 |
props: mergeProps({ className }, props) |
| 14731 |
}); |
| 14732 |
return element; |
| 14733 |
} |
| 14734 |
); |
| 14735 |
|
| 14736 |
// packages/ui/build-module/visually-hidden/visually-hidden.mjs |
| 14737 |
var import_element53 = __toESM(require_element(), 1); |
| 14738 |
var STYLE_HASH_ATTRIBUTE24 = "data-wp-hash"; |
| 14739 |
function getRuntime24() { |
| 14740 |
const globalScope = globalThis; |
| 14741 |
if (globalScope.__wpStyleRuntime) { |
| 14742 |
return globalScope.__wpStyleRuntime; |
| 14743 |
} |
| 14744 |
globalScope.__wpStyleRuntime = { |
| 14745 |
documents: /* @__PURE__ */ new Map(), |
| 14746 |
styles: /* @__PURE__ */ new Map(), |
| 14747 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14748 |
}; |
| 14749 |
if (typeof document !== "undefined") { |
| 14750 |
registerDocument24(document); |
| 14751 |
} |
| 14752 |
return globalScope.__wpStyleRuntime; |
| 14753 |
} |
| 14754 |
function documentContainsStyleHash24(targetDocument, hash) { |
| 14755 |
if (!targetDocument.head) { |
| 14756 |
return false; |
| 14757 |
} |
| 14758 |
for (const style of targetDocument.head.querySelectorAll( |
| 14759 |
`style[${STYLE_HASH_ATTRIBUTE24}]` |
| 14760 |
)) { |
| 14761 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE24) === hash) { |
| 14762 |
return true; |
| 14763 |
} |
| 14764 |
} |
| 14765 |
return false; |
| 14766 |
} |
| 14767 |
function injectStyle24(targetDocument, hash, css) { |
| 14768 |
if (!targetDocument.head) { |
| 14769 |
return; |
| 14770 |
} |
| 14771 |
const runtime = getRuntime24(); |
| 14772 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14773 |
if (!injectedStyles) { |
| 14774 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14775 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14776 |
} |
| 14777 |
if (injectedStyles.has(hash)) { |
| 14778 |
return; |
| 14779 |
} |
| 14780 |
if (documentContainsStyleHash24(targetDocument, hash)) { |
| 14781 |
injectedStyles.add(hash); |
| 14782 |
return; |
| 14783 |
} |
| 14784 |
const style = targetDocument.createElement("style"); |
| 14785 |
style.setAttribute(STYLE_HASH_ATTRIBUTE24, hash); |
| 14786 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14787 |
targetDocument.head.appendChild(style); |
| 14788 |
injectedStyles.add(hash); |
| 14789 |
} |
| 14790 |
function registerDocument24(targetDocument) { |
| 14791 |
const runtime = getRuntime24(); |
| 14792 |
runtime.documents.set( |
| 14793 |
targetDocument, |
| 14794 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14795 |
); |
| 14796 |
for (const [hash, css] of runtime.styles) { |
| 14797 |
injectStyle24(targetDocument, hash, css); |
| 14798 |
} |
| 14799 |
return () => { |
| 14800 |
const count = runtime.documents.get(targetDocument); |
| 14801 |
if (count === void 0) { |
| 14802 |
return; |
| 14803 |
} |
| 14804 |
if (count <= 1) { |
| 14805 |
runtime.documents.delete(targetDocument); |
| 14806 |
return; |
| 14807 |
} |
| 14808 |
runtime.documents.set(targetDocument, count - 1); |
| 14809 |
}; |
| 14810 |
} |
| 14811 |
function registerStyle24(hash, css) { |
| 14812 |
const runtime = getRuntime24(); |
| 14813 |
runtime.styles.set(hash, css); |
| 14814 |
for (const targetDocument of runtime.documents.keys()) { |
| 14815 |
injectStyle24(targetDocument, hash, css); |
| 14816 |
} |
| 14817 |
} |
| 14818 |
if (typeof process === "undefined" || true) { |
| 14819 |
registerStyle24("c46e8cb841", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.f37b9e2e191ebd66__visually-hidden{word-wrap:normal;border:0;clip-path:inset(50%);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px;word-break:normal}}"); |
| 14820 |
} |
| 14821 |
var style_default25 = { "visually-hidden": "f37b9e2e191ebd66__visually-hidden" }; |
| 14822 |
var VisuallyHidden = (0, import_element53.forwardRef)( |
| 14823 |
function VisuallyHidden2({ render: render4, ...restProps }, ref) { |
| 14824 |
const element = useRender({ |
| 14825 |
render: render4, |
| 14826 |
ref, |
| 14827 |
props: mergeProps( |
| 14828 |
{ className: style_default25["visually-hidden"] }, |
| 14829 |
restProps, |
| 14830 |
{ |
| 14831 |
// @ts-expect-error Arbitrary data-* attributes aren't indexable on the typed div props. Kept hardcoded so consumers can't change or remove it. |
| 14832 |
"data-visually-hidden": "" |
| 14833 |
} |
| 14834 |
) |
| 14835 |
}); |
| 14836 |
return element; |
| 14837 |
} |
| 14838 |
); |
| 14839 |
|
| 14840 |
// packages/ui/build-module/link/link.mjs |
| 14841 |
var import_element54 = __toESM(require_element(), 1); |
| 14842 |
var import_i18n4 = __toESM(require_i18n(), 1); |
| 14843 |
var import_jsx_runtime73 = __toESM(require_jsx_runtime(), 1); |
| 14844 |
var STYLE_HASH_ATTRIBUTE25 = "data-wp-hash"; |
| 14845 |
function getRuntime25() { |
| 14846 |
const globalScope = globalThis; |
| 14847 |
if (globalScope.__wpStyleRuntime) { |
| 14848 |
return globalScope.__wpStyleRuntime; |
| 14849 |
} |
| 14850 |
globalScope.__wpStyleRuntime = { |
| 14851 |
documents: /* @__PURE__ */ new Map(), |
| 14852 |
styles: /* @__PURE__ */ new Map(), |
| 14853 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 14854 |
}; |
| 14855 |
if (typeof document !== "undefined") { |
| 14856 |
registerDocument25(document); |
| 14857 |
} |
| 14858 |
return globalScope.__wpStyleRuntime; |
| 14859 |
} |
| 14860 |
function documentContainsStyleHash25(targetDocument, hash) { |
| 14861 |
if (!targetDocument.head) { |
| 14862 |
return false; |
| 14863 |
} |
| 14864 |
for (const style of targetDocument.head.querySelectorAll( |
| 14865 |
`style[${STYLE_HASH_ATTRIBUTE25}]` |
| 14866 |
)) { |
| 14867 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE25) === hash) { |
| 14868 |
return true; |
| 14869 |
} |
| 14870 |
} |
| 14871 |
return false; |
| 14872 |
} |
| 14873 |
function injectStyle25(targetDocument, hash, css) { |
| 14874 |
if (!targetDocument.head) { |
| 14875 |
return; |
| 14876 |
} |
| 14877 |
const runtime = getRuntime25(); |
| 14878 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 14879 |
if (!injectedStyles) { |
| 14880 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 14881 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 14882 |
} |
| 14883 |
if (injectedStyles.has(hash)) { |
| 14884 |
return; |
| 14885 |
} |
| 14886 |
if (documentContainsStyleHash25(targetDocument, hash)) { |
| 14887 |
injectedStyles.add(hash); |
| 14888 |
return; |
| 14889 |
} |
| 14890 |
const style = targetDocument.createElement("style"); |
| 14891 |
style.setAttribute(STYLE_HASH_ATTRIBUTE25, hash); |
| 14892 |
style.appendChild(targetDocument.createTextNode(css)); |
| 14893 |
targetDocument.head.appendChild(style); |
| 14894 |
injectedStyles.add(hash); |
| 14895 |
} |
| 14896 |
function registerDocument25(targetDocument) { |
| 14897 |
const runtime = getRuntime25(); |
| 14898 |
runtime.documents.set( |
| 14899 |
targetDocument, |
| 14900 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 14901 |
); |
| 14902 |
for (const [hash, css] of runtime.styles) { |
| 14903 |
injectStyle25(targetDocument, hash, css); |
| 14904 |
} |
| 14905 |
return () => { |
| 14906 |
const count = runtime.documents.get(targetDocument); |
| 14907 |
if (count === void 0) { |
| 14908 |
return; |
| 14909 |
} |
| 14910 |
if (count <= 1) { |
| 14911 |
runtime.documents.delete(targetDocument); |
| 14912 |
return; |
| 14913 |
} |
| 14914 |
runtime.documents.set(targetDocument, count - 1); |
| 14915 |
}; |
| 14916 |
} |
| 14917 |
function registerStyle25(hash, css) { |
| 14918 |
const runtime = getRuntime25(); |
| 14919 |
runtime.styles.set(hash, css); |
| 14920 |
for (const targetDocument of runtime.documents.keys()) { |
| 14921 |
injectStyle25(targetDocument, hash, css); |
| 14922 |
} |
| 14923 |
} |
| 14924 |
if (typeof process === "undefined" || true) { |
| 14925 |
registerStyle25("e3ae230cea", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._336cd3e4e743482f__box-sizing{box-sizing:border-box;*,:after,:before{box-sizing:inherit}}}"); |
| 14926 |
} |
| 14927 |
var resets_default4 = { "box-sizing": "_336cd3e4e743482f__box-sizing" }; |
| 14928 |
if (typeof process === "undefined" || true) { |
| 14929 |
registerStyle25("2a5ab8f3a7", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._08e8a2e44959f892__outset-ring--focus,._970d04df7376df67__outset-ring--focus-within-except-active,.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible,.cd83dfc2126a0846__outset-ring--focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active,.ecadb9e080e2dfa5__outset-ring--focus-parent-visible{@media not (prefers-reduced-motion){--_gcd-a-transition:outline 0.1s ease-out;transition:outline .1s ease-out}outline:0 solid #0000;outline-offset:1px}._08e8a2e44959f892__outset-ring--focus:focus,._970d04df7376df67__outset-ring--focus-within-except-active:focus-within:not(:has(:active)),.c5cb3ee4bddaa8e4__outset-ring--focus-within-visible:focus-within:has(:focus-visible),.cd83dfc2126a0846__outset-ring--focus-within:focus-within,.d0541bc9dd9dc7b6__outset-ring--focus-visible:focus-visible,.e25b2bdd7aa21721__outset-ring--focus-except-active:focus:not(:active),:focus-visible .ecadb9e080e2dfa5__outset-ring--focus-parent-visible{--_gcd-a-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));--_gcd-div-outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9))}}"); |
| 14930 |
} |
| 14931 |
var focus_default4 = { "outset-ring--focus": "_08e8a2e44959f892__outset-ring--focus", "outset-ring--focus-except-active": "e25b2bdd7aa21721__outset-ring--focus-except-active", "outset-ring--focus-visible": "d0541bc9dd9dc7b6__outset-ring--focus-visible", "outset-ring--focus-within": "cd83dfc2126a0846__outset-ring--focus-within", "outset-ring--focus-within-except-active": "_970d04df7376df67__outset-ring--focus-within-except-active", "outset-ring--focus-within-visible": "c5cb3ee4bddaa8e4__outset-ring--focus-within-visible", "outset-ring--focus-parent-visible": "ecadb9e080e2dfa5__outset-ring--focus-parent-visible" }; |
| 14932 |
if (typeof process === "undefined" || true) { |
| 14933 |
registerStyle25("90a23568f8", '@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{.d4250949359b05ce__link{text-decoration-thickness:from-font;text-underline-offset:.2em}.c6055659b8e2cd2c__is-brand,.c6055659b8e2cd2c__is-brand:visited{--_gcd-a-color:var(--wpds-color-fg-interactive-brand,var(--wp-admin-theme-color,#3858e9));color:var(--wpds-color-fg-interactive-brand,var(--wp-admin-theme-color,#3858e9))}.c6055659b8e2cd2c__is-brand:active,.c6055659b8e2cd2c__is-brand:hover{--_gcd-a-color:var(--wpds-color-fg-interactive-brand-active,var(--wp-admin-theme-color,#3858e9));color:var(--wpds-color-fg-interactive-brand-active,var(--wp-admin-theme-color,#3858e9))}._92e0dfcaeee15b88__is-neutral,._92e0dfcaeee15b88__is-neutral:visited{--_gcd-a-color:var(--wpds-color-fg-interactive-neutral,#1e1e1e);color:var(--wpds-color-fg-interactive-neutral,#1e1e1e);text-decoration-color:var(--wpds-color-stroke-interactive-neutral,#8d8d8d)}._92e0dfcaeee15b88__is-neutral:active,._92e0dfcaeee15b88__is-neutral:hover{--_gcd-a-color:var(--wpds-color-fg-interactive-neutral-active,#1e1e1e);color:var(--wpds-color-fg-interactive-neutral-active,#1e1e1e)}.cf122a9bf1035d42__is-unstyled{--_gcd-a-color:inherit;color:inherit;text-decoration:none}._0cb411afac4c86c7__link-icon{display:inline-block;font-weight:var(--wpds-typography-font-weight-regular,400);line-height:1;margin-inline-start:var(--wpds-dimension-padding-xs,4px);text-decoration:none}._0cb411afac4c86c7__link-icon:after{content:"\\2197"}._0cb411afac4c86c7__link-icon:dir(rtl):after{content:"\\2196"}}'); |
| 14934 |
} |
| 14935 |
var style_default26 = { "link": "d4250949359b05ce__link", "is-brand": "c6055659b8e2cd2c__is-brand", "is-neutral": "_92e0dfcaeee15b88__is-neutral", "is-unstyled": "cf122a9bf1035d42__is-unstyled", "link-icon": "_0cb411afac4c86c7__link-icon" }; |
| 14936 |
if (typeof process === "undefined" || true) { |
| 14937 |
registerStyle25("1fb29d3a3c", "._6defc79820e382c6__button{box-sizing:var(--_gcd-button-box-sizing,border-box);font-family:var(--_gcd-button-font-family,inherit);font-size:var(--_gcd-button-font-size,inherit);font-weight:var(--_gcd-button-font-weight,inherit)}.d2cff2e5dea83bd1__input{box-sizing:var(--_gcd-input-box-sizing,border-box);font-family:var(--_gcd-input-font-family,inherit);font-size:var(--_gcd-input-font-size,inherit);font-weight:var(--_gcd-input-font-weight,inherit);margin:var(--_gcd-input-margin,0);&:is(textarea,[type=text],[type=password],[type=color],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){background-color:var(--_gcd-input-background-color,#0000);border:var(--_gcd-input-border,none);border-radius:var(--_gcd-input-border-radius,0);box-shadow:var(--_gcd-input-box-shadow,0 0 0 #0000);color:var(--_gcd-input-color,var(--wpds-color-fg-interactive-neutral,#1e1e1e));&:focus{border-color:var(--_gcd-input-border-color-focus,var(--wp-admin-theme-color));box-shadow:var(--_gcd-input-box-shadow-focus,none);outline:var(--_gcd-input-outline-focus,none)}&:disabled{background:var(--_gcd-input-background-disabled,#0000);border-color:var(--_gcd-input-border-color-disabled,#0000);box-shadow:var(--_gcd-input-box-shadow-disabled,none);color:var(--_gcd-input-color-disabled,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}&::placeholder{color:var(--_gcd-input-placeholder-color,var(--wpds-color-fg-interactive-neutral-disabled,#8d8d8d))}}&:is(textarea,[type=text],[type=password],[type=date],[type=datetime],[type=datetime-local],[type=email],[type=month],[type=number],[type=search],[type=tel],[type=time],[type=url],[type=week]){line-height:var(--_gcd-input-line-height,inherit);min-height:var(--_gcd-input-min-height,auto);padding:var(--_gcd-input-padding,0)}}._547d86373d02e108__textarea{box-sizing:var(--_gcd-textarea-box-sizing,border-box);overflow:var(--_gcd-textarea-overflow,auto);resize:var(--_gcd-textarea-resize,block)}._8c15fd0ed9f28ba4__div{outline:var(--_gcd-div-outline,0 solid #0000)}p._43cec3e1eec1066d__p{font-size:var(--_gcd-p-font-size,13px);line-height:var(--_gcd-p-line-height,1.5);margin:var(--_gcd-p-margin,0)}:is(h1,h2,h3,h4,h5,h6).e97669c6d9a38497__heading{color:var(--_gcd-heading-color,var(--wpds-color-fg-content-neutral,#1e1e1e));font-size:var(--_gcd-heading-font-size,inherit);font-weight:var(--_gcd-heading-font-weight,var(--wpds-typography-font-weight-medium,499));margin:var(--_gcd-heading-margin,0)}._2c0831b0499dbd6e__a,._2c0831b0499dbd6e__a:is(:hover,:focus,:active){border-radius:var(--_gcd-a-border-radius,0);box-shadow:var(--_gcd-a-box-shadow,none);color:var(--_gcd-a-color,inherit);outline:var(--_gcd-a-outline,0 solid #0000);transition:var(--_gcd-a-transition,none)}"); |
| 14938 |
} |
| 14939 |
var global_css_defense_default3 = { "button": "_6defc79820e382c6__button", "input": "d2cff2e5dea83bd1__input", "textarea": "_547d86373d02e108__textarea", "div": "_8c15fd0ed9f28ba4__div", "p": "_43cec3e1eec1066d__p", "heading": "e97669c6d9a38497__heading", "a": "_2c0831b0499dbd6e__a" }; |
| 14940 |
var Link = (0, import_element54.forwardRef)(function Link2({ |
| 14941 |
children, |
| 14942 |
variant = "default", |
| 14943 |
tone = "brand", |
| 14944 |
openInNewTab = false, |
| 14945 |
render: render4, |
| 14946 |
className, |
| 14947 |
...props |
| 14948 |
}, ref) { |
| 14949 |
const element = useRender({ |
| 14950 |
render: render4, |
| 14951 |
defaultTagName: "a", |
| 14952 |
ref, |
| 14953 |
props: mergeProps(props, { |
| 14954 |
className: clsx_default( |
| 14955 |
global_css_defense_default3.a, |
| 14956 |
resets_default4["box-sizing"], |
| 14957 |
focus_default4["outset-ring--focus"], |
| 14958 |
variant !== "unstyled" && style_default26.link, |
| 14959 |
variant !== "unstyled" && style_default26[`is-${tone}`], |
| 14960 |
variant === "unstyled" && style_default26["is-unstyled"], |
| 14961 |
className |
| 14962 |
), |
| 14963 |
target: openInNewTab ? "_blank" : void 0, |
| 14964 |
children: /* @__PURE__ */ (0, import_jsx_runtime73.jsxs)(import_jsx_runtime73.Fragment, { children: [ |
| 14965 |
children, |
| 14966 |
openInNewTab && /* @__PURE__ */ (0, import_jsx_runtime73.jsx)( |
| 14967 |
"span", |
| 14968 |
{ |
| 14969 |
className: style_default26["link-icon"], |
| 14970 |
role: "img", |
| 14971 |
"aria-label": ( |
| 14972 |
/* translators: accessibility text appended to link text */ |
| 14973 |
(0, import_i18n4.__)("(opens in a new tab)") |
| 14974 |
) |
| 14975 |
} |
| 14976 |
) |
| 14977 |
] }) |
| 14978 |
}) |
| 14979 |
}); |
| 14980 |
return element; |
| 14981 |
}); |
| 14982 |
|
| 14983 |
// packages/ui/build-module/notice/index.mjs |
| 14984 |
var notice_exports = {}; |
| 14985 |
__export(notice_exports, { |
| 14986 |
ActionButton: () => ActionButton, |
| 14987 |
ActionLink: () => ActionLink, |
| 14988 |
Actions: () => Actions2, |
| 14989 |
CloseIcon: () => CloseIcon2, |
| 14990 |
Description: () => Description3, |
| 14991 |
Root: () => Root6, |
| 14992 |
Title: () => Title4 |
| 14993 |
}); |
| 14994 |
|
| 14995 |
// packages/ui/build-module/notice/root.mjs |
| 14996 |
var import_element55 = __toESM(require_element(), 1); |
| 14997 |
import { speak as speak3 } from "@wordpress/a11y"; |
| 14998 |
var import_jsx_runtime74 = __toESM(require_jsx_runtime(), 1); |
| 14999 |
var STYLE_HASH_ATTRIBUTE26 = "data-wp-hash"; |
| 15000 |
function getRuntime26() { |
| 15001 |
const globalScope = globalThis; |
| 15002 |
if (globalScope.__wpStyleRuntime) { |
| 15003 |
return globalScope.__wpStyleRuntime; |
| 15004 |
} |
| 15005 |
globalScope.__wpStyleRuntime = { |
| 15006 |
documents: /* @__PURE__ */ new Map(), |
| 15007 |
styles: /* @__PURE__ */ new Map(), |
| 15008 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15009 |
}; |
| 15010 |
if (typeof document !== "undefined") { |
| 15011 |
registerDocument26(document); |
| 15012 |
} |
| 15013 |
return globalScope.__wpStyleRuntime; |
| 15014 |
} |
| 15015 |
function documentContainsStyleHash26(targetDocument, hash) { |
| 15016 |
if (!targetDocument.head) { |
| 15017 |
return false; |
| 15018 |
} |
| 15019 |
for (const style of targetDocument.head.querySelectorAll( |
| 15020 |
`style[${STYLE_HASH_ATTRIBUTE26}]` |
| 15021 |
)) { |
| 15022 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE26) === hash) { |
| 15023 |
return true; |
| 15024 |
} |
| 15025 |
} |
| 15026 |
return false; |
| 15027 |
} |
| 15028 |
function injectStyle26(targetDocument, hash, css) { |
| 15029 |
if (!targetDocument.head) { |
| 15030 |
return; |
| 15031 |
} |
| 15032 |
const runtime = getRuntime26(); |
| 15033 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15034 |
if (!injectedStyles) { |
| 15035 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15036 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15037 |
} |
| 15038 |
if (injectedStyles.has(hash)) { |
| 15039 |
return; |
| 15040 |
} |
| 15041 |
if (documentContainsStyleHash26(targetDocument, hash)) { |
| 15042 |
injectedStyles.add(hash); |
| 15043 |
return; |
| 15044 |
} |
| 15045 |
const style = targetDocument.createElement("style"); |
| 15046 |
style.setAttribute(STYLE_HASH_ATTRIBUTE26, hash); |
| 15047 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15048 |
targetDocument.head.appendChild(style); |
| 15049 |
injectedStyles.add(hash); |
| 15050 |
} |
| 15051 |
function registerDocument26(targetDocument) { |
| 15052 |
const runtime = getRuntime26(); |
| 15053 |
runtime.documents.set( |
| 15054 |
targetDocument, |
| 15055 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15056 |
); |
| 15057 |
for (const [hash, css] of runtime.styles) { |
| 15058 |
injectStyle26(targetDocument, hash, css); |
| 15059 |
} |
| 15060 |
return () => { |
| 15061 |
const count = runtime.documents.get(targetDocument); |
| 15062 |
if (count === void 0) { |
| 15063 |
return; |
| 15064 |
} |
| 15065 |
if (count <= 1) { |
| 15066 |
runtime.documents.delete(targetDocument); |
| 15067 |
return; |
| 15068 |
} |
| 15069 |
runtime.documents.set(targetDocument, count - 1); |
| 15070 |
}; |
| 15071 |
} |
| 15072 |
function registerStyle26(hash, css) { |
| 15073 |
const runtime = getRuntime26(); |
| 15074 |
runtime.styles.set(hash, css); |
| 15075 |
for (const targetDocument of runtime.documents.keys()) { |
| 15076 |
injectStyle26(targetDocument, hash, css); |
| 15077 |
} |
| 15078 |
} |
| 15079 |
if (typeof process === "undefined" || true) { |
| 15080 |
registerStyle26("e3ae230cea", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-utilities{._336cd3e4e743482f__box-sizing{box-sizing:border-box;*,:after,:before{box-sizing:inherit}}}"); |
| 15081 |
} |
| 15082 |
var resets_default5 = { "box-sizing": "_336cd3e4e743482f__box-sizing" }; |
| 15083 |
if (typeof process === "undefined" || true) { |
| 15084 |
registerStyle26("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15085 |
} |
| 15086 |
var style_default27 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15087 |
var icons = { |
| 15088 |
neutral: null, |
| 15089 |
info: info_default, |
| 15090 |
warning: caution_default, |
| 15091 |
success: published_default, |
| 15092 |
error: error_default |
| 15093 |
}; |
| 15094 |
function getDefaultPoliteness(intent) { |
| 15095 |
return intent === "error" ? "assertive" : "polite"; |
| 15096 |
} |
| 15097 |
function safeRenderToString(message2) { |
| 15098 |
if (!message2) { |
| 15099 |
return void 0; |
| 15100 |
} |
| 15101 |
if (typeof message2 === "string") { |
| 15102 |
return message2; |
| 15103 |
} |
| 15104 |
try { |
| 15105 |
return (0, import_element55.renderToString)(message2); |
| 15106 |
} catch { |
| 15107 |
return void 0; |
| 15108 |
} |
| 15109 |
} |
| 15110 |
function useSpokenMessage(message2, politeness) { |
| 15111 |
const spokenMessage = safeRenderToString(message2); |
| 15112 |
(0, import_element55.useEffect)(() => { |
| 15113 |
if (spokenMessage) { |
| 15114 |
speak3(spokenMessage, politeness); |
| 15115 |
} |
| 15116 |
}, [spokenMessage, politeness]); |
| 15117 |
} |
| 15118 |
var Root6 = (0, import_element55.forwardRef)(function Notice({ |
| 15119 |
intent = "neutral", |
| 15120 |
children, |
| 15121 |
icon, |
| 15122 |
spokenMessage = children, |
| 15123 |
politeness = getDefaultPoliteness(intent), |
| 15124 |
render: render4, |
| 15125 |
...restProps |
| 15126 |
}, ref) { |
| 15127 |
useSpokenMessage(spokenMessage, politeness); |
| 15128 |
const iconElement = icon === null ? null : icon ?? icons[intent]; |
| 15129 |
const mergedClassName = clsx_default( |
| 15130 |
style_default27.notice, |
| 15131 |
style_default27[`is-${intent}`], |
| 15132 |
resets_default5["box-sizing"] |
| 15133 |
); |
| 15134 |
const element = useRender({ |
| 15135 |
defaultTagName: "div", |
| 15136 |
render: render4, |
| 15137 |
ref, |
| 15138 |
props: mergeProps( |
| 15139 |
{ |
| 15140 |
className: mergedClassName, |
| 15141 |
children: /* @__PURE__ */ (0, import_jsx_runtime74.jsxs)(import_jsx_runtime74.Fragment, { children: [ |
| 15142 |
children, |
| 15143 |
iconElement && /* @__PURE__ */ (0, import_jsx_runtime74.jsx)( |
| 15144 |
Icon, |
| 15145 |
{ |
| 15146 |
className: style_default27.icon, |
| 15147 |
icon: iconElement |
| 15148 |
} |
| 15149 |
) |
| 15150 |
] }) |
| 15151 |
}, |
| 15152 |
restProps |
| 15153 |
) |
| 15154 |
}); |
| 15155 |
return element; |
| 15156 |
}); |
| 15157 |
|
| 15158 |
// packages/ui/build-module/notice/title.mjs |
| 15159 |
var import_element56 = __toESM(require_element(), 1); |
| 15160 |
var import_jsx_runtime75 = __toESM(require_jsx_runtime(), 1); |
| 15161 |
var STYLE_HASH_ATTRIBUTE27 = "data-wp-hash"; |
| 15162 |
function getRuntime27() { |
| 15163 |
const globalScope = globalThis; |
| 15164 |
if (globalScope.__wpStyleRuntime) { |
| 15165 |
return globalScope.__wpStyleRuntime; |
| 15166 |
} |
| 15167 |
globalScope.__wpStyleRuntime = { |
| 15168 |
documents: /* @__PURE__ */ new Map(), |
| 15169 |
styles: /* @__PURE__ */ new Map(), |
| 15170 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15171 |
}; |
| 15172 |
if (typeof document !== "undefined") { |
| 15173 |
registerDocument27(document); |
| 15174 |
} |
| 15175 |
return globalScope.__wpStyleRuntime; |
| 15176 |
} |
| 15177 |
function documentContainsStyleHash27(targetDocument, hash) { |
| 15178 |
if (!targetDocument.head) { |
| 15179 |
return false; |
| 15180 |
} |
| 15181 |
for (const style of targetDocument.head.querySelectorAll( |
| 15182 |
`style[${STYLE_HASH_ATTRIBUTE27}]` |
| 15183 |
)) { |
| 15184 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE27) === hash) { |
| 15185 |
return true; |
| 15186 |
} |
| 15187 |
} |
| 15188 |
return false; |
| 15189 |
} |
| 15190 |
function injectStyle27(targetDocument, hash, css) { |
| 15191 |
if (!targetDocument.head) { |
| 15192 |
return; |
| 15193 |
} |
| 15194 |
const runtime = getRuntime27(); |
| 15195 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15196 |
if (!injectedStyles) { |
| 15197 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15198 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15199 |
} |
| 15200 |
if (injectedStyles.has(hash)) { |
| 15201 |
return; |
| 15202 |
} |
| 15203 |
if (documentContainsStyleHash27(targetDocument, hash)) { |
| 15204 |
injectedStyles.add(hash); |
| 15205 |
return; |
| 15206 |
} |
| 15207 |
const style = targetDocument.createElement("style"); |
| 15208 |
style.setAttribute(STYLE_HASH_ATTRIBUTE27, hash); |
| 15209 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15210 |
targetDocument.head.appendChild(style); |
| 15211 |
injectedStyles.add(hash); |
| 15212 |
} |
| 15213 |
function registerDocument27(targetDocument) { |
| 15214 |
const runtime = getRuntime27(); |
| 15215 |
runtime.documents.set( |
| 15216 |
targetDocument, |
| 15217 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15218 |
); |
| 15219 |
for (const [hash, css] of runtime.styles) { |
| 15220 |
injectStyle27(targetDocument, hash, css); |
| 15221 |
} |
| 15222 |
return () => { |
| 15223 |
const count = runtime.documents.get(targetDocument); |
| 15224 |
if (count === void 0) { |
| 15225 |
return; |
| 15226 |
} |
| 15227 |
if (count <= 1) { |
| 15228 |
runtime.documents.delete(targetDocument); |
| 15229 |
return; |
| 15230 |
} |
| 15231 |
runtime.documents.set(targetDocument, count - 1); |
| 15232 |
}; |
| 15233 |
} |
| 15234 |
function registerStyle27(hash, css) { |
| 15235 |
const runtime = getRuntime27(); |
| 15236 |
runtime.styles.set(hash, css); |
| 15237 |
for (const targetDocument of runtime.documents.keys()) { |
| 15238 |
injectStyle27(targetDocument, hash, css); |
| 15239 |
} |
| 15240 |
} |
| 15241 |
if (typeof process === "undefined" || true) { |
| 15242 |
registerStyle27("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15243 |
} |
| 15244 |
var style_default28 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15245 |
var Title4 = (0, import_element56.forwardRef)( |
| 15246 |
function NoticeTitle({ className, ...props }, ref) { |
| 15247 |
return /* @__PURE__ */ (0, import_jsx_runtime75.jsx)( |
| 15248 |
Text, |
| 15249 |
{ |
| 15250 |
ref, |
| 15251 |
variant: "heading-md", |
| 15252 |
className: clsx_default(style_default28.title, className), |
| 15253 |
...props |
| 15254 |
} |
| 15255 |
); |
| 15256 |
} |
| 15257 |
); |
| 15258 |
|
| 15259 |
// packages/ui/build-module/notice/description.mjs |
| 15260 |
var import_element57 = __toESM(require_element(), 1); |
| 15261 |
var import_jsx_runtime76 = __toESM(require_jsx_runtime(), 1); |
| 15262 |
var STYLE_HASH_ATTRIBUTE28 = "data-wp-hash"; |
| 15263 |
function getRuntime28() { |
| 15264 |
const globalScope = globalThis; |
| 15265 |
if (globalScope.__wpStyleRuntime) { |
| 15266 |
return globalScope.__wpStyleRuntime; |
| 15267 |
} |
| 15268 |
globalScope.__wpStyleRuntime = { |
| 15269 |
documents: /* @__PURE__ */ new Map(), |
| 15270 |
styles: /* @__PURE__ */ new Map(), |
| 15271 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15272 |
}; |
| 15273 |
if (typeof document !== "undefined") { |
| 15274 |
registerDocument28(document); |
| 15275 |
} |
| 15276 |
return globalScope.__wpStyleRuntime; |
| 15277 |
} |
| 15278 |
function documentContainsStyleHash28(targetDocument, hash) { |
| 15279 |
if (!targetDocument.head) { |
| 15280 |
return false; |
| 15281 |
} |
| 15282 |
for (const style of targetDocument.head.querySelectorAll( |
| 15283 |
`style[${STYLE_HASH_ATTRIBUTE28}]` |
| 15284 |
)) { |
| 15285 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE28) === hash) { |
| 15286 |
return true; |
| 15287 |
} |
| 15288 |
} |
| 15289 |
return false; |
| 15290 |
} |
| 15291 |
function injectStyle28(targetDocument, hash, css) { |
| 15292 |
if (!targetDocument.head) { |
| 15293 |
return; |
| 15294 |
} |
| 15295 |
const runtime = getRuntime28(); |
| 15296 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15297 |
if (!injectedStyles) { |
| 15298 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15299 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15300 |
} |
| 15301 |
if (injectedStyles.has(hash)) { |
| 15302 |
return; |
| 15303 |
} |
| 15304 |
if (documentContainsStyleHash28(targetDocument, hash)) { |
| 15305 |
injectedStyles.add(hash); |
| 15306 |
return; |
| 15307 |
} |
| 15308 |
const style = targetDocument.createElement("style"); |
| 15309 |
style.setAttribute(STYLE_HASH_ATTRIBUTE28, hash); |
| 15310 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15311 |
targetDocument.head.appendChild(style); |
| 15312 |
injectedStyles.add(hash); |
| 15313 |
} |
| 15314 |
function registerDocument28(targetDocument) { |
| 15315 |
const runtime = getRuntime28(); |
| 15316 |
runtime.documents.set( |
| 15317 |
targetDocument, |
| 15318 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15319 |
); |
| 15320 |
for (const [hash, css] of runtime.styles) { |
| 15321 |
injectStyle28(targetDocument, hash, css); |
| 15322 |
} |
| 15323 |
return () => { |
| 15324 |
const count = runtime.documents.get(targetDocument); |
| 15325 |
if (count === void 0) { |
| 15326 |
return; |
| 15327 |
} |
| 15328 |
if (count <= 1) { |
| 15329 |
runtime.documents.delete(targetDocument); |
| 15330 |
return; |
| 15331 |
} |
| 15332 |
runtime.documents.set(targetDocument, count - 1); |
| 15333 |
}; |
| 15334 |
} |
| 15335 |
function registerStyle28(hash, css) { |
| 15336 |
const runtime = getRuntime28(); |
| 15337 |
runtime.styles.set(hash, css); |
| 15338 |
for (const targetDocument of runtime.documents.keys()) { |
| 15339 |
injectStyle28(targetDocument, hash, css); |
| 15340 |
} |
| 15341 |
} |
| 15342 |
if (typeof process === "undefined" || true) { |
| 15343 |
registerStyle28("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15344 |
} |
| 15345 |
var style_default29 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15346 |
var Description3 = (0, import_element57.forwardRef)( |
| 15347 |
function NoticeDescription({ className, ...props }, ref) { |
| 15348 |
return /* @__PURE__ */ (0, import_jsx_runtime76.jsx)( |
| 15349 |
Text, |
| 15350 |
{ |
| 15351 |
ref, |
| 15352 |
variant: "body-md", |
| 15353 |
className: clsx_default(style_default29.description, className), |
| 15354 |
...props |
| 15355 |
} |
| 15356 |
); |
| 15357 |
} |
| 15358 |
); |
| 15359 |
|
| 15360 |
// packages/ui/build-module/notice/actions.mjs |
| 15361 |
var import_element58 = __toESM(require_element(), 1); |
| 15362 |
var STYLE_HASH_ATTRIBUTE29 = "data-wp-hash"; |
| 15363 |
function getRuntime29() { |
| 15364 |
const globalScope = globalThis; |
| 15365 |
if (globalScope.__wpStyleRuntime) { |
| 15366 |
return globalScope.__wpStyleRuntime; |
| 15367 |
} |
| 15368 |
globalScope.__wpStyleRuntime = { |
| 15369 |
documents: /* @__PURE__ */ new Map(), |
| 15370 |
styles: /* @__PURE__ */ new Map(), |
| 15371 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15372 |
}; |
| 15373 |
if (typeof document !== "undefined") { |
| 15374 |
registerDocument29(document); |
| 15375 |
} |
| 15376 |
return globalScope.__wpStyleRuntime; |
| 15377 |
} |
| 15378 |
function documentContainsStyleHash29(targetDocument, hash) { |
| 15379 |
if (!targetDocument.head) { |
| 15380 |
return false; |
| 15381 |
} |
| 15382 |
for (const style of targetDocument.head.querySelectorAll( |
| 15383 |
`style[${STYLE_HASH_ATTRIBUTE29}]` |
| 15384 |
)) { |
| 15385 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE29) === hash) { |
| 15386 |
return true; |
| 15387 |
} |
| 15388 |
} |
| 15389 |
return false; |
| 15390 |
} |
| 15391 |
function injectStyle29(targetDocument, hash, css) { |
| 15392 |
if (!targetDocument.head) { |
| 15393 |
return; |
| 15394 |
} |
| 15395 |
const runtime = getRuntime29(); |
| 15396 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15397 |
if (!injectedStyles) { |
| 15398 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15399 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15400 |
} |
| 15401 |
if (injectedStyles.has(hash)) { |
| 15402 |
return; |
| 15403 |
} |
| 15404 |
if (documentContainsStyleHash29(targetDocument, hash)) { |
| 15405 |
injectedStyles.add(hash); |
| 15406 |
return; |
| 15407 |
} |
| 15408 |
const style = targetDocument.createElement("style"); |
| 15409 |
style.setAttribute(STYLE_HASH_ATTRIBUTE29, hash); |
| 15410 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15411 |
targetDocument.head.appendChild(style); |
| 15412 |
injectedStyles.add(hash); |
| 15413 |
} |
| 15414 |
function registerDocument29(targetDocument) { |
| 15415 |
const runtime = getRuntime29(); |
| 15416 |
runtime.documents.set( |
| 15417 |
targetDocument, |
| 15418 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15419 |
); |
| 15420 |
for (const [hash, css] of runtime.styles) { |
| 15421 |
injectStyle29(targetDocument, hash, css); |
| 15422 |
} |
| 15423 |
return () => { |
| 15424 |
const count = runtime.documents.get(targetDocument); |
| 15425 |
if (count === void 0) { |
| 15426 |
return; |
| 15427 |
} |
| 15428 |
if (count <= 1) { |
| 15429 |
runtime.documents.delete(targetDocument); |
| 15430 |
return; |
| 15431 |
} |
| 15432 |
runtime.documents.set(targetDocument, count - 1); |
| 15433 |
}; |
| 15434 |
} |
| 15435 |
function registerStyle29(hash, css) { |
| 15436 |
const runtime = getRuntime29(); |
| 15437 |
runtime.styles.set(hash, css); |
| 15438 |
for (const targetDocument of runtime.documents.keys()) { |
| 15439 |
injectStyle29(targetDocument, hash, css); |
| 15440 |
} |
| 15441 |
} |
| 15442 |
if (typeof process === "undefined" || true) { |
| 15443 |
registerStyle29("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15444 |
} |
| 15445 |
var style_default30 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15446 |
var Actions2 = (0, import_element58.forwardRef)( |
| 15447 |
function NoticeActions({ render: render4, ...props }, ref) { |
| 15448 |
const element = useRender({ |
| 15449 |
defaultTagName: "div", |
| 15450 |
render: render4, |
| 15451 |
ref, |
| 15452 |
props: mergeProps( |
| 15453 |
{ |
| 15454 |
className: style_default30.actions |
| 15455 |
}, |
| 15456 |
props |
| 15457 |
) |
| 15458 |
}); |
| 15459 |
return element; |
| 15460 |
} |
| 15461 |
); |
| 15462 |
|
| 15463 |
// packages/ui/build-module/notice/close-icon.mjs |
| 15464 |
var import_element59 = __toESM(require_element(), 1); |
| 15465 |
var import_i18n5 = __toESM(require_i18n(), 1); |
| 15466 |
var import_jsx_runtime77 = __toESM(require_jsx_runtime(), 1); |
| 15467 |
var STYLE_HASH_ATTRIBUTE30 = "data-wp-hash"; |
| 15468 |
function getRuntime30() { |
| 15469 |
const globalScope = globalThis; |
| 15470 |
if (globalScope.__wpStyleRuntime) { |
| 15471 |
return globalScope.__wpStyleRuntime; |
| 15472 |
} |
| 15473 |
globalScope.__wpStyleRuntime = { |
| 15474 |
documents: /* @__PURE__ */ new Map(), |
| 15475 |
styles: /* @__PURE__ */ new Map(), |
| 15476 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15477 |
}; |
| 15478 |
if (typeof document !== "undefined") { |
| 15479 |
registerDocument30(document); |
| 15480 |
} |
| 15481 |
return globalScope.__wpStyleRuntime; |
| 15482 |
} |
| 15483 |
function documentContainsStyleHash30(targetDocument, hash) { |
| 15484 |
if (!targetDocument.head) { |
| 15485 |
return false; |
| 15486 |
} |
| 15487 |
for (const style of targetDocument.head.querySelectorAll( |
| 15488 |
`style[${STYLE_HASH_ATTRIBUTE30}]` |
| 15489 |
)) { |
| 15490 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE30) === hash) { |
| 15491 |
return true; |
| 15492 |
} |
| 15493 |
} |
| 15494 |
return false; |
| 15495 |
} |
| 15496 |
function injectStyle30(targetDocument, hash, css) { |
| 15497 |
if (!targetDocument.head) { |
| 15498 |
return; |
| 15499 |
} |
| 15500 |
const runtime = getRuntime30(); |
| 15501 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15502 |
if (!injectedStyles) { |
| 15503 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15504 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15505 |
} |
| 15506 |
if (injectedStyles.has(hash)) { |
| 15507 |
return; |
| 15508 |
} |
| 15509 |
if (documentContainsStyleHash30(targetDocument, hash)) { |
| 15510 |
injectedStyles.add(hash); |
| 15511 |
return; |
| 15512 |
} |
| 15513 |
const style = targetDocument.createElement("style"); |
| 15514 |
style.setAttribute(STYLE_HASH_ATTRIBUTE30, hash); |
| 15515 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15516 |
targetDocument.head.appendChild(style); |
| 15517 |
injectedStyles.add(hash); |
| 15518 |
} |
| 15519 |
function registerDocument30(targetDocument) { |
| 15520 |
const runtime = getRuntime30(); |
| 15521 |
runtime.documents.set( |
| 15522 |
targetDocument, |
| 15523 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15524 |
); |
| 15525 |
for (const [hash, css] of runtime.styles) { |
| 15526 |
injectStyle30(targetDocument, hash, css); |
| 15527 |
} |
| 15528 |
return () => { |
| 15529 |
const count = runtime.documents.get(targetDocument); |
| 15530 |
if (count === void 0) { |
| 15531 |
return; |
| 15532 |
} |
| 15533 |
if (count <= 1) { |
| 15534 |
runtime.documents.delete(targetDocument); |
| 15535 |
return; |
| 15536 |
} |
| 15537 |
runtime.documents.set(targetDocument, count - 1); |
| 15538 |
}; |
| 15539 |
} |
| 15540 |
function registerStyle30(hash, css) { |
| 15541 |
const runtime = getRuntime30(); |
| 15542 |
runtime.styles.set(hash, css); |
| 15543 |
for (const targetDocument of runtime.documents.keys()) { |
| 15544 |
injectStyle30(targetDocument, hash, css); |
| 15545 |
} |
| 15546 |
} |
| 15547 |
if (typeof process === "undefined" || true) { |
| 15548 |
registerStyle30("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15549 |
} |
| 15550 |
var style_default31 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15551 |
var CloseIcon2 = (0, import_element59.forwardRef)( |
| 15552 |
function NoticeCloseIcon({ className, icon = close_small_default, label = (0, import_i18n5.__)("Dismiss"), ...props }, ref) { |
| 15553 |
return /* @__PURE__ */ (0, import_jsx_runtime77.jsx)( |
| 15554 |
IconButton, |
| 15555 |
{ |
| 15556 |
...props, |
| 15557 |
ref, |
| 15558 |
className: clsx_default(style_default31["close-icon"], className), |
| 15559 |
variant: "minimal", |
| 15560 |
size: "small", |
| 15561 |
tone: "neutral", |
| 15562 |
icon, |
| 15563 |
label |
| 15564 |
} |
| 15565 |
); |
| 15566 |
} |
| 15567 |
); |
| 15568 |
|
| 15569 |
// packages/ui/build-module/notice/action-button.mjs |
| 15570 |
var import_element60 = __toESM(require_element(), 1); |
| 15571 |
var import_jsx_runtime78 = __toESM(require_jsx_runtime(), 1); |
| 15572 |
var STYLE_HASH_ATTRIBUTE31 = "data-wp-hash"; |
| 15573 |
function getRuntime31() { |
| 15574 |
const globalScope = globalThis; |
| 15575 |
if (globalScope.__wpStyleRuntime) { |
| 15576 |
return globalScope.__wpStyleRuntime; |
| 15577 |
} |
| 15578 |
globalScope.__wpStyleRuntime = { |
| 15579 |
documents: /* @__PURE__ */ new Map(), |
| 15580 |
styles: /* @__PURE__ */ new Map(), |
| 15581 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15582 |
}; |
| 15583 |
if (typeof document !== "undefined") { |
| 15584 |
registerDocument31(document); |
| 15585 |
} |
| 15586 |
return globalScope.__wpStyleRuntime; |
| 15587 |
} |
| 15588 |
function documentContainsStyleHash31(targetDocument, hash) { |
| 15589 |
if (!targetDocument.head) { |
| 15590 |
return false; |
| 15591 |
} |
| 15592 |
for (const style of targetDocument.head.querySelectorAll( |
| 15593 |
`style[${STYLE_HASH_ATTRIBUTE31}]` |
| 15594 |
)) { |
| 15595 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE31) === hash) { |
| 15596 |
return true; |
| 15597 |
} |
| 15598 |
} |
| 15599 |
return false; |
| 15600 |
} |
| 15601 |
function injectStyle31(targetDocument, hash, css) { |
| 15602 |
if (!targetDocument.head) { |
| 15603 |
return; |
| 15604 |
} |
| 15605 |
const runtime = getRuntime31(); |
| 15606 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15607 |
if (!injectedStyles) { |
| 15608 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15609 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15610 |
} |
| 15611 |
if (injectedStyles.has(hash)) { |
| 15612 |
return; |
| 15613 |
} |
| 15614 |
if (documentContainsStyleHash31(targetDocument, hash)) { |
| 15615 |
injectedStyles.add(hash); |
| 15616 |
return; |
| 15617 |
} |
| 15618 |
const style = targetDocument.createElement("style"); |
| 15619 |
style.setAttribute(STYLE_HASH_ATTRIBUTE31, hash); |
| 15620 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15621 |
targetDocument.head.appendChild(style); |
| 15622 |
injectedStyles.add(hash); |
| 15623 |
} |
| 15624 |
function registerDocument31(targetDocument) { |
| 15625 |
const runtime = getRuntime31(); |
| 15626 |
runtime.documents.set( |
| 15627 |
targetDocument, |
| 15628 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15629 |
); |
| 15630 |
for (const [hash, css] of runtime.styles) { |
| 15631 |
injectStyle31(targetDocument, hash, css); |
| 15632 |
} |
| 15633 |
return () => { |
| 15634 |
const count = runtime.documents.get(targetDocument); |
| 15635 |
if (count === void 0) { |
| 15636 |
return; |
| 15637 |
} |
| 15638 |
if (count <= 1) { |
| 15639 |
runtime.documents.delete(targetDocument); |
| 15640 |
return; |
| 15641 |
} |
| 15642 |
runtime.documents.set(targetDocument, count - 1); |
| 15643 |
}; |
| 15644 |
} |
| 15645 |
function registerStyle31(hash, css) { |
| 15646 |
const runtime = getRuntime31(); |
| 15647 |
runtime.styles.set(hash, css); |
| 15648 |
for (const targetDocument of runtime.documents.keys()) { |
| 15649 |
injectStyle31(targetDocument, hash, css); |
| 15650 |
} |
| 15651 |
} |
| 15652 |
if (typeof process === "undefined" || true) { |
| 15653 |
registerStyle31("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15654 |
} |
| 15655 |
var style_default32 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15656 |
var ActionButton = (0, import_element60.forwardRef)( |
| 15657 |
function NoticeActionButton({ className, loading, loadingAnnouncement, variant, ...props }, ref) { |
| 15658 |
const loadingProps = loading !== void 0 ? { loading, loadingAnnouncement: loadingAnnouncement ?? "" } : {}; |
| 15659 |
return /* @__PURE__ */ (0, import_jsx_runtime78.jsx)( |
| 15660 |
Button4, |
| 15661 |
{ |
| 15662 |
...props, |
| 15663 |
...loadingProps, |
| 15664 |
ref, |
| 15665 |
size: "compact", |
| 15666 |
tone: "neutral", |
| 15667 |
variant, |
| 15668 |
className: clsx_default( |
| 15669 |
style_default32["action-button"], |
| 15670 |
style_default32[`is-action-button-${variant}`], |
| 15671 |
className |
| 15672 |
) |
| 15673 |
} |
| 15674 |
); |
| 15675 |
} |
| 15676 |
); |
| 15677 |
|
| 15678 |
// packages/ui/build-module/notice/action-link.mjs |
| 15679 |
var import_element61 = __toESM(require_element(), 1); |
| 15680 |
var import_jsx_runtime79 = __toESM(require_jsx_runtime(), 1); |
| 15681 |
var STYLE_HASH_ATTRIBUTE32 = "data-wp-hash"; |
| 15682 |
function getRuntime32() { |
| 15683 |
const globalScope = globalThis; |
| 15684 |
if (globalScope.__wpStyleRuntime) { |
| 15685 |
return globalScope.__wpStyleRuntime; |
| 15686 |
} |
| 15687 |
globalScope.__wpStyleRuntime = { |
| 15688 |
documents: /* @__PURE__ */ new Map(), |
| 15689 |
styles: /* @__PURE__ */ new Map(), |
| 15690 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15691 |
}; |
| 15692 |
if (typeof document !== "undefined") { |
| 15693 |
registerDocument32(document); |
| 15694 |
} |
| 15695 |
return globalScope.__wpStyleRuntime; |
| 15696 |
} |
| 15697 |
function documentContainsStyleHash32(targetDocument, hash) { |
| 15698 |
if (!targetDocument.head) { |
| 15699 |
return false; |
| 15700 |
} |
| 15701 |
for (const style of targetDocument.head.querySelectorAll( |
| 15702 |
`style[${STYLE_HASH_ATTRIBUTE32}]` |
| 15703 |
)) { |
| 15704 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE32) === hash) { |
| 15705 |
return true; |
| 15706 |
} |
| 15707 |
} |
| 15708 |
return false; |
| 15709 |
} |
| 15710 |
function injectStyle32(targetDocument, hash, css) { |
| 15711 |
if (!targetDocument.head) { |
| 15712 |
return; |
| 15713 |
} |
| 15714 |
const runtime = getRuntime32(); |
| 15715 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15716 |
if (!injectedStyles) { |
| 15717 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15718 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15719 |
} |
| 15720 |
if (injectedStyles.has(hash)) { |
| 15721 |
return; |
| 15722 |
} |
| 15723 |
if (documentContainsStyleHash32(targetDocument, hash)) { |
| 15724 |
injectedStyles.add(hash); |
| 15725 |
return; |
| 15726 |
} |
| 15727 |
const style = targetDocument.createElement("style"); |
| 15728 |
style.setAttribute(STYLE_HASH_ATTRIBUTE32, hash); |
| 15729 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15730 |
targetDocument.head.appendChild(style); |
| 15731 |
injectedStyles.add(hash); |
| 15732 |
} |
| 15733 |
function registerDocument32(targetDocument) { |
| 15734 |
const runtime = getRuntime32(); |
| 15735 |
runtime.documents.set( |
| 15736 |
targetDocument, |
| 15737 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15738 |
); |
| 15739 |
for (const [hash, css] of runtime.styles) { |
| 15740 |
injectStyle32(targetDocument, hash, css); |
| 15741 |
} |
| 15742 |
return () => { |
| 15743 |
const count = runtime.documents.get(targetDocument); |
| 15744 |
if (count === void 0) { |
| 15745 |
return; |
| 15746 |
} |
| 15747 |
if (count <= 1) { |
| 15748 |
runtime.documents.delete(targetDocument); |
| 15749 |
return; |
| 15750 |
} |
| 15751 |
runtime.documents.set(targetDocument, count - 1); |
| 15752 |
}; |
| 15753 |
} |
| 15754 |
function registerStyle32(hash, css) { |
| 15755 |
const runtime = getRuntime32(); |
| 15756 |
runtime.styles.set(hash, css); |
| 15757 |
for (const targetDocument of runtime.documents.keys()) { |
| 15758 |
injectStyle32(targetDocument, hash, css); |
| 15759 |
} |
| 15760 |
} |
| 15761 |
if (typeof process === "undefined" || true) { |
| 15762 |
registerStyle32("60dd1d4d42", "@layer wp-ui-utilities, wp-ui-components, wp-ui-compositions, wp-ui-overrides;@layer wp-ui-components{._4145abab73d17514__notice{--icon-height:24px;--text-vertical-padding:calc((var(--icon-height) - var(--wpds-typography-line-height-sm, 20px))/2);--wp-ui-notice-background-color:var(--wpds-color-bg-surface-neutral-weak,#f4f4f4);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-neutral,#dbdbdb);--wp-ui-notice-text-color:var(--wpds-color-fg-content-neutral,#1e1e1e);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-neutral,#1e1e1e);align-items:start;background-color:var(--wp-ui-notice-background-color);border:1px solid var(--wp-ui-notice-border-color);border-radius:var(--wpds-border-radius-lg,8px);container-type:inline-size;display:grid;grid-template-columns:auto 1fr auto;padding:var(--wpds-dimension-padding-md,12px)}.d0a25570cb528528__icon{color:var(--wp-ui-notice-decorative-icon-color);grid-column:1;grid-row:1;margin-inline-end:var(--wpds-dimension-gap-xs,4px)}._1904b570a89bb815__description,.b5397fb9d05389e3__title{color:var(--wp-ui-notice-text-color);grid-column:2;padding-block:var(--text-vertical-padding)}._1904b570a89bb815__description{text-wrap:pretty}._0a1270dcdd79c031__actions{display:flex;flex-wrap:wrap;gap:var(--wpds-dimension-gap-md,12px);grid-column:2}._4145abab73d17514__notice:has(._1904b570a89bb815__description) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions{margin-block-start:var(--wpds-dimension-gap-sm,8px)}._983740ab855c4e09__action-button{flex-shrink:0}.d329e7416d368d31__action-link{flex-shrink:0;&:not(:first-child){margin-inline-start:var(--wpds-dimension-gap-xs,4px)}&:not(:last-child){margin-inline-end:var(--wpds-dimension-gap-xs,4px)}}._487e6a5c1375f7dc__close-icon{grid-column:3;grid-row:1;margin-inline-start:var(--wpds-dimension-gap-xs,4px)}._531c140826094795__is-info{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-info-weak,#f3f9ff);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-info,#9fbcdc);--wp-ui-notice-text-color:var(--wpds-color-fg-content-info,#001b4f);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-info-weak,#006bd7)}.ae2e1004697cce95__is-warning{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-warning-weak,#fff7e1);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-warning,#d0b481);--wp-ui-notice-text-color:var(--wpds-color-fg-content-warning,#2e1900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-warning-weak,#926300)}._2e614a76af494837__is-success{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-success-weak,#ebffed);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-success,#8ac894);--wp-ui-notice-text-color:var(--wpds-color-fg-content-success,#002900);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-success-weak,#008030)}.af00331ae17a0065__is-error{--wp-ui-notice-background-color:var(--wpds-color-bg-surface-error-weak,#fff6f5);--wp-ui-notice-border-color:var(--wpds-color-stroke-surface-error,#daa39b);--wp-ui-notice-text-color:var(--wpds-color-fg-content-error,#470000);--wp-ui-notice-decorative-icon-color:var(--wpds-color-fg-content-error-weak,#cc1818)}@container (max-width: 320px){._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._0a1270dcdd79c031__actions,._4145abab73d17514__notice:has(.b5397fb9d05389e3__title) ._1904b570a89bb815__description{grid-column:1/3}}}@layer wp-ui-compositions{.d329e7416d368d31__action-link{margin-block:auto}._487e6a5c1375f7dc__close-icon,._983740ab855c4e09__action-button:is(._8ddb8fb33fbf3d38__is-action-button-outline,._77bbde495a8a0af3__is-action-button-minimal){--wp-ui-button-background-color-active:color-mix(in srgb,#0000 50%,var(--wpds-color-bg-interactive-neutral-weak-active,#ededed))}}"); |
| 15763 |
} |
| 15764 |
var style_default33 = { "notice": "_4145abab73d17514__notice", "icon": "d0a25570cb528528__icon", "title": "b5397fb9d05389e3__title", "description": "_1904b570a89bb815__description", "actions": "_0a1270dcdd79c031__actions", "action-button": "_983740ab855c4e09__action-button", "action-link": "d329e7416d368d31__action-link", "close-icon": "_487e6a5c1375f7dc__close-icon", "is-info": "_531c140826094795__is-info", "is-warning": "ae2e1004697cce95__is-warning", "is-success": "_2e614a76af494837__is-success", "is-error": "af00331ae17a0065__is-error", "is-action-button-outline": "_8ddb8fb33fbf3d38__is-action-button-outline", "is-action-button-minimal": "_77bbde495a8a0af3__is-action-button-minimal" }; |
| 15765 |
var ActionLink = (0, import_element61.forwardRef)( |
| 15766 |
function NoticeActionLink({ className, render: render4, ...props }, ref) { |
| 15767 |
return /* @__PURE__ */ (0, import_jsx_runtime79.jsx)( |
| 15768 |
Text, |
| 15769 |
{ |
| 15770 |
ref, |
| 15771 |
className: clsx_default(style_default33["action-link"], className), |
| 15772 |
...props, |
| 15773 |
variant: "body-md", |
| 15774 |
render: /* @__PURE__ */ (0, import_jsx_runtime79.jsx)(Link, { tone: "neutral", variant: "default", render: render4 }) |
| 15775 |
} |
| 15776 |
); |
| 15777 |
} |
| 15778 |
); |
| 15779 |
|
| 15780 |
// packages/admin-ui/build-module/navigable-region/index.mjs |
| 15781 |
var import_element62 = __toESM(require_element(), 1); |
| 15782 |
var import_jsx_runtime80 = __toESM(require_jsx_runtime(), 1); |
| 15783 |
var NavigableRegion = (0, import_element62.forwardRef)( |
| 15784 |
({ children, className, ariaLabel, as: Tag = "div", ...props }, ref) => { |
| 15785 |
return /* @__PURE__ */ (0, import_jsx_runtime80.jsx)( |
| 15786 |
Tag, |
| 15787 |
{ |
| 15788 |
ref, |
| 15789 |
className: clsx_default("admin-ui-navigable-region", className), |
| 15790 |
"aria-label": ariaLabel, |
| 15791 |
role: "region", |
| 15792 |
tabIndex: "-1", |
| 15793 |
...props, |
| 15794 |
children |
| 15795 |
} |
| 15796 |
); |
| 15797 |
} |
| 15798 |
); |
| 15799 |
NavigableRegion.displayName = "NavigableRegion"; |
| 15800 |
var navigable_region_default = NavigableRegion; |
| 15801 |
|
| 15802 |
// packages/admin-ui/build-module/page/sidebar-toggle-slot.mjs |
| 15803 |
var import_components = __toESM(require_components(), 1); |
| 15804 |
var { Fill: SidebarToggleFill, Slot: SidebarToggleSlot } = (0, import_components.createSlotFill)("SidebarToggle"); |
| 15805 |
|
| 15806 |
// packages/admin-ui/build-module/page/header.mjs |
| 15807 |
var import_jsx_runtime81 = __toESM(require_jsx_runtime(), 1); |
| 15808 |
var STYLE_HASH_ATTRIBUTE33 = "data-wp-hash"; |
| 15809 |
function getRuntime33() { |
| 15810 |
const globalScope = globalThis; |
| 15811 |
if (globalScope.__wpStyleRuntime) { |
| 15812 |
return globalScope.__wpStyleRuntime; |
| 15813 |
} |
| 15814 |
globalScope.__wpStyleRuntime = { |
| 15815 |
documents: /* @__PURE__ */ new Map(), |
| 15816 |
styles: /* @__PURE__ */ new Map(), |
| 15817 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15818 |
}; |
| 15819 |
if (typeof document !== "undefined") { |
| 15820 |
registerDocument33(document); |
| 15821 |
} |
| 15822 |
return globalScope.__wpStyleRuntime; |
| 15823 |
} |
| 15824 |
function documentContainsStyleHash33(targetDocument, hash) { |
| 15825 |
if (!targetDocument.head) { |
| 15826 |
return false; |
| 15827 |
} |
| 15828 |
for (const style of targetDocument.head.querySelectorAll( |
| 15829 |
`style[${STYLE_HASH_ATTRIBUTE33}]` |
| 15830 |
)) { |
| 15831 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE33) === hash) { |
| 15832 |
return true; |
| 15833 |
} |
| 15834 |
} |
| 15835 |
return false; |
| 15836 |
} |
| 15837 |
function injectStyle33(targetDocument, hash, css) { |
| 15838 |
if (!targetDocument.head) { |
| 15839 |
return; |
| 15840 |
} |
| 15841 |
const runtime = getRuntime33(); |
| 15842 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 15843 |
if (!injectedStyles) { |
| 15844 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 15845 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 15846 |
} |
| 15847 |
if (injectedStyles.has(hash)) { |
| 15848 |
return; |
| 15849 |
} |
| 15850 |
if (documentContainsStyleHash33(targetDocument, hash)) { |
| 15851 |
injectedStyles.add(hash); |
| 15852 |
return; |
| 15853 |
} |
| 15854 |
const style = targetDocument.createElement("style"); |
| 15855 |
style.setAttribute(STYLE_HASH_ATTRIBUTE33, hash); |
| 15856 |
style.appendChild(targetDocument.createTextNode(css)); |
| 15857 |
targetDocument.head.appendChild(style); |
| 15858 |
injectedStyles.add(hash); |
| 15859 |
} |
| 15860 |
function registerDocument33(targetDocument) { |
| 15861 |
const runtime = getRuntime33(); |
| 15862 |
runtime.documents.set( |
| 15863 |
targetDocument, |
| 15864 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 15865 |
); |
| 15866 |
for (const [hash, css] of runtime.styles) { |
| 15867 |
injectStyle33(targetDocument, hash, css); |
| 15868 |
} |
| 15869 |
return () => { |
| 15870 |
const count = runtime.documents.get(targetDocument); |
| 15871 |
if (count === void 0) { |
| 15872 |
return; |
| 15873 |
} |
| 15874 |
if (count <= 1) { |
| 15875 |
runtime.documents.delete(targetDocument); |
| 15876 |
return; |
| 15877 |
} |
| 15878 |
runtime.documents.set(targetDocument, count - 1); |
| 15879 |
}; |
| 15880 |
} |
| 15881 |
function registerStyle33(hash, css) { |
| 15882 |
const runtime = getRuntime33(); |
| 15883 |
runtime.styles.set(hash, css); |
| 15884 |
for (const targetDocument of runtime.documents.keys()) { |
| 15885 |
injectStyle33(targetDocument, hash, css); |
| 15886 |
} |
| 15887 |
} |
| 15888 |
if (typeof process === "undefined" || true) { |
| 15889 |
registerStyle33("aa9c241ccc", "._956b6df0898efed0__page{text-wrap:pretty;background-color:var(--wpds-color-bg-surface-neutral,#fcfcfc);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-flow:column;height:100%;position:relative;z-index:1}._0625b55e82a0d93d__header{background:var(--wpds-color-bg-surface-neutral-strong,#fff);border-block-end:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);inset-block-start:0;padding:var(--wpds-dimension-padding-lg,16px) var(--wpds-dimension-padding-2xl,24px);position:sticky;z-index:1}.a43c44d5ae28b2e8__header-content{min-height:calc(var(--wpds-dimension-base, 4px)*8)}.b7cb5b9daf3a3b25__header-actions{flex-shrink:0}._8113be94e7caf73c__header-title{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}._9a776c7f70996f61__header-visual{display:grid;flex-shrink:0;grid-template-columns:1fr;grid-template-rows:1fr;height:calc(var(--wpds-dimension-base, 4px)*6);width:calc(var(--wpds-dimension-base, 4px)*6);>*{grid-column:1/-1;grid-row:1/-1;max-height:100%;max-width:100%}}.d5e0920cd15d35bc__sidebar-toggle-slot:empty{display:none}._60fea2f6bf5319cd__header-subtitle{color:var(--wpds-color-fg-content-neutral-weak,#707070);padding-block-end:var(--wpds-dimension-padding-xs,4px)}.be5e57d029ec4036__content{display:flex;flex-direction:column;flex-grow:1;overflow:auto;&._128806d0b26e3a50__has-padding{padding:var(--wpds-dimension-padding-lg,16px) var(--wpds-dimension-padding-2xl,24px)}}"); |
| 15890 |
} |
| 15891 |
var style_default34 = { "page": "_956b6df0898efed0__page", "header": "_0625b55e82a0d93d__header", "header-content": "a43c44d5ae28b2e8__header-content", "header-actions": "b7cb5b9daf3a3b25__header-actions", "header-title": "_8113be94e7caf73c__header-title", "header-visual": "_9a776c7f70996f61__header-visual", "sidebar-toggle-slot": "d5e0920cd15d35bc__sidebar-toggle-slot", "header-subtitle": "_60fea2f6bf5319cd__header-subtitle", "content": "be5e57d029ec4036__content", "has-padding": "_128806d0b26e3a50__has-padding" }; |
| 15892 |
function Header3({ |
| 15893 |
headingLevel = 1, |
| 15894 |
breadcrumbs, |
| 15895 |
badges, |
| 15896 |
visual, |
| 15897 |
title, |
| 15898 |
subTitle, |
| 15899 |
actions, |
| 15900 |
showSidebarToggle = true |
| 15901 |
}) { |
| 15902 |
const HeadingTag = `h${headingLevel}`; |
| 15903 |
return /* @__PURE__ */ (0, import_jsx_runtime81.jsxs)(Stack, { direction: "column", className: style_default34.header, children: [ |
| 15904 |
/* @__PURE__ */ (0, import_jsx_runtime81.jsxs)( |
| 15905 |
Stack, |
| 15906 |
{ |
| 15907 |
className: style_default34["header-content"], |
| 15908 |
direction: "row", |
| 15909 |
gap: "sm", |
| 15910 |
justify: "space-between", |
| 15911 |
children: [ |
| 15912 |
/* @__PURE__ */ (0, import_jsx_runtime81.jsxs)(Stack, { direction: "row", gap: "sm", align: "center", justify: "start", children: [ |
| 15913 |
showSidebarToggle && /* @__PURE__ */ (0, import_jsx_runtime81.jsx)( |
| 15914 |
SidebarToggleSlot, |
| 15915 |
{ |
| 15916 |
bubblesVirtually: true, |
| 15917 |
className: style_default34["sidebar-toggle-slot"] |
| 15918 |
} |
| 15919 |
), |
| 15920 |
visual && /* @__PURE__ */ (0, import_jsx_runtime81.jsx)( |
| 15921 |
"div", |
| 15922 |
{ |
| 15923 |
className: style_default34["header-visual"], |
| 15924 |
"aria-hidden": "true", |
| 15925 |
children: visual |
| 15926 |
} |
| 15927 |
), |
| 15928 |
title && /* @__PURE__ */ (0, import_jsx_runtime81.jsx)( |
| 15929 |
Text, |
| 15930 |
{ |
| 15931 |
className: style_default34["header-title"], |
| 15932 |
render: /* @__PURE__ */ (0, import_jsx_runtime81.jsx)(HeadingTag, {}), |
| 15933 |
variant: "heading-lg", |
| 15934 |
children: title |
| 15935 |
} |
| 15936 |
), |
| 15937 |
breadcrumbs, |
| 15938 |
badges |
| 15939 |
] }), |
| 15940 |
actions && /* @__PURE__ */ (0, import_jsx_runtime81.jsx)( |
| 15941 |
Stack, |
| 15942 |
{ |
| 15943 |
align: "center", |
| 15944 |
className: style_default34["header-actions"], |
| 15945 |
direction: "row", |
| 15946 |
gap: "sm", |
| 15947 |
children: actions |
| 15948 |
} |
| 15949 |
) |
| 15950 |
] |
| 15951 |
} |
| 15952 |
), |
| 15953 |
subTitle && /* @__PURE__ */ (0, import_jsx_runtime81.jsx)( |
| 15954 |
Text, |
| 15955 |
{ |
| 15956 |
render: /* @__PURE__ */ (0, import_jsx_runtime81.jsx)("p", {}), |
| 15957 |
variant: "body-md", |
| 15958 |
className: style_default34["header-subtitle"], |
| 15959 |
children: subTitle |
| 15960 |
} |
| 15961 |
) |
| 15962 |
] }); |
| 15963 |
} |
| 15964 |
|
| 15965 |
// packages/admin-ui/build-module/page/index.mjs |
| 15966 |
var import_jsx_runtime82 = __toESM(require_jsx_runtime(), 1); |
| 15967 |
var STYLE_HASH_ATTRIBUTE34 = "data-wp-hash"; |
| 15968 |
function getRuntime34() { |
| 15969 |
const globalScope = globalThis; |
| 15970 |
if (globalScope.__wpStyleRuntime) { |
| 15971 |
return globalScope.__wpStyleRuntime; |
| 15972 |
} |
| 15973 |
globalScope.__wpStyleRuntime = { |
| 15974 |
documents: /* @__PURE__ */ new Map(), |
| 15975 |
styles: /* @__PURE__ */ new Map(), |
| 15976 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 15977 |
}; |
| 15978 |
if (typeof document !== "undefined") { |
| 15979 |
registerDocument34(document); |
| 15980 |
} |
| 15981 |
return globalScope.__wpStyleRuntime; |
| 15982 |
} |
| 15983 |
function documentContainsStyleHash34(targetDocument, hash) { |
| 15984 |
if (!targetDocument.head) { |
| 15985 |
return false; |
| 15986 |
} |
| 15987 |
for (const style of targetDocument.head.querySelectorAll( |
| 15988 |
`style[${STYLE_HASH_ATTRIBUTE34}]` |
| 15989 |
)) { |
| 15990 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE34) === hash) { |
| 15991 |
return true; |
| 15992 |
} |
| 15993 |
} |
| 15994 |
return false; |
| 15995 |
} |
| 15996 |
function injectStyle34(targetDocument, hash, css) { |
| 15997 |
if (!targetDocument.head) { |
| 15998 |
return; |
| 15999 |
} |
| 16000 |
const runtime = getRuntime34(); |
| 16001 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 16002 |
if (!injectedStyles) { |
| 16003 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 16004 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 16005 |
} |
| 16006 |
if (injectedStyles.has(hash)) { |
| 16007 |
return; |
| 16008 |
} |
| 16009 |
if (documentContainsStyleHash34(targetDocument, hash)) { |
| 16010 |
injectedStyles.add(hash); |
| 16011 |
return; |
| 16012 |
} |
| 16013 |
const style = targetDocument.createElement("style"); |
| 16014 |
style.setAttribute(STYLE_HASH_ATTRIBUTE34, hash); |
| 16015 |
style.appendChild(targetDocument.createTextNode(css)); |
| 16016 |
targetDocument.head.appendChild(style); |
| 16017 |
injectedStyles.add(hash); |
| 16018 |
} |
| 16019 |
function registerDocument34(targetDocument) { |
| 16020 |
const runtime = getRuntime34(); |
| 16021 |
runtime.documents.set( |
| 16022 |
targetDocument, |
| 16023 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 16024 |
); |
| 16025 |
for (const [hash, css] of runtime.styles) { |
| 16026 |
injectStyle34(targetDocument, hash, css); |
| 16027 |
} |
| 16028 |
return () => { |
| 16029 |
const count = runtime.documents.get(targetDocument); |
| 16030 |
if (count === void 0) { |
| 16031 |
return; |
| 16032 |
} |
| 16033 |
if (count <= 1) { |
| 16034 |
runtime.documents.delete(targetDocument); |
| 16035 |
return; |
| 16036 |
} |
| 16037 |
runtime.documents.set(targetDocument, count - 1); |
| 16038 |
}; |
| 16039 |
} |
| 16040 |
function registerStyle34(hash, css) { |
| 16041 |
const runtime = getRuntime34(); |
| 16042 |
runtime.styles.set(hash, css); |
| 16043 |
for (const targetDocument of runtime.documents.keys()) { |
| 16044 |
injectStyle34(targetDocument, hash, css); |
| 16045 |
} |
| 16046 |
} |
| 16047 |
if (typeof process === "undefined" || true) { |
| 16048 |
registerStyle34("aa9c241ccc", "._956b6df0898efed0__page{text-wrap:pretty;background-color:var(--wpds-color-bg-surface-neutral,#fcfcfc);color:var(--wpds-color-fg-content-neutral,#1e1e1e);display:flex;flex-flow:column;height:100%;position:relative;z-index:1}._0625b55e82a0d93d__header{background:var(--wpds-color-bg-surface-neutral-strong,#fff);border-block-end:var(--wpds-border-width-xs,1px) solid var(--wpds-color-stroke-surface-neutral-weak,#e4e4e4);inset-block-start:0;padding:var(--wpds-dimension-padding-lg,16px) var(--wpds-dimension-padding-2xl,24px);position:sticky;z-index:1}.a43c44d5ae28b2e8__header-content{min-height:calc(var(--wpds-dimension-base, 4px)*8)}.b7cb5b9daf3a3b25__header-actions{flex-shrink:0}._8113be94e7caf73c__header-title{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}._9a776c7f70996f61__header-visual{display:grid;flex-shrink:0;grid-template-columns:1fr;grid-template-rows:1fr;height:calc(var(--wpds-dimension-base, 4px)*6);width:calc(var(--wpds-dimension-base, 4px)*6);>*{grid-column:1/-1;grid-row:1/-1;max-height:100%;max-width:100%}}.d5e0920cd15d35bc__sidebar-toggle-slot:empty{display:none}._60fea2f6bf5319cd__header-subtitle{color:var(--wpds-color-fg-content-neutral-weak,#707070);padding-block-end:var(--wpds-dimension-padding-xs,4px)}.be5e57d029ec4036__content{display:flex;flex-direction:column;flex-grow:1;overflow:auto;&._128806d0b26e3a50__has-padding{padding:var(--wpds-dimension-padding-lg,16px) var(--wpds-dimension-padding-2xl,24px)}}"); |
| 16049 |
} |
| 16050 |
var style_default35 = { "page": "_956b6df0898efed0__page", "header": "_0625b55e82a0d93d__header", "header-content": "a43c44d5ae28b2e8__header-content", "header-actions": "b7cb5b9daf3a3b25__header-actions", "header-title": "_8113be94e7caf73c__header-title", "header-visual": "_9a776c7f70996f61__header-visual", "sidebar-toggle-slot": "d5e0920cd15d35bc__sidebar-toggle-slot", "header-subtitle": "_60fea2f6bf5319cd__header-subtitle", "content": "be5e57d029ec4036__content", "has-padding": "_128806d0b26e3a50__has-padding" }; |
| 16051 |
function Page({ |
| 16052 |
headingLevel, |
| 16053 |
breadcrumbs, |
| 16054 |
badges, |
| 16055 |
visual, |
| 16056 |
title, |
| 16057 |
subTitle, |
| 16058 |
children, |
| 16059 |
className, |
| 16060 |
actions, |
| 16061 |
ariaLabel, |
| 16062 |
hasPadding = false, |
| 16063 |
showSidebarToggle = true |
| 16064 |
}) { |
| 16065 |
const classes = clsx_default(style_default35.page, className); |
| 16066 |
const effectiveAriaLabel = ariaLabel ?? (typeof title === "string" ? title : ""); |
| 16067 |
return /* @__PURE__ */ (0, import_jsx_runtime82.jsxs)(navigable_region_default, { className: classes, ariaLabel: effectiveAriaLabel, children: [ |
| 16068 |
(title || breadcrumbs || badges || actions || visual) && /* @__PURE__ */ (0, import_jsx_runtime82.jsx)( |
| 16069 |
Header3, |
| 16070 |
{ |
| 16071 |
headingLevel, |
| 16072 |
breadcrumbs, |
| 16073 |
badges, |
| 16074 |
visual, |
| 16075 |
title, |
| 16076 |
subTitle, |
| 16077 |
actions, |
| 16078 |
showSidebarToggle |
| 16079 |
} |
| 16080 |
), |
| 16081 |
hasPadding ? /* @__PURE__ */ (0, import_jsx_runtime82.jsx)( |
| 16082 |
"div", |
| 16083 |
{ |
| 16084 |
className: clsx_default( |
| 16085 |
style_default35.content, |
| 16086 |
style_default35["has-padding"] |
| 16087 |
), |
| 16088 |
children |
| 16089 |
} |
| 16090 |
) : children |
| 16091 |
] }); |
| 16092 |
} |
| 16093 |
Page.SidebarToggleFill = SidebarToggleFill; |
| 16094 |
var page_default = Page; |
| 16095 |
|
| 16096 |
// routes/dashboard/stage.tsx |
| 16097 |
var import_data8 = __toESM(require_data()); |
| 16098 |
var import_element132 = __toESM(require_element()); |
| 16099 |
var import_i18n55 = __toESM(require_i18n()); |
| 16100 |
var import_notices = __toESM(require_notices()); |
| 16101 |
|
| 16102 |
// routes/dashboard/hooks/use-dashboard-layout/use-dashboard-layout.ts |
| 16103 |
var import_api_fetch = __toESM(require_api_fetch()); |
| 16104 |
var import_data = __toESM(require_data()); |
| 16105 |
var import_preferences = __toESM(require_preferences()); |
| 16106 |
var SCOPE = "core/dashboard"; |
| 16107 |
var KEY = "dashboardLayout"; |
| 16108 |
function useDashboardLayout(dashboardName) { |
| 16109 |
const layout = (0, import_data.useSelect)( |
| 16110 |
(select) => select(import_preferences.store).get(SCOPE, KEY) ?? [], |
| 16111 |
[] |
| 16112 |
); |
| 16113 |
const { set: set3 } = (0, import_data.useDispatch)(import_preferences.store); |
| 16114 |
function setLayout(newLayout) { |
| 16115 |
void set3(SCOPE, KEY, newLayout); |
| 16116 |
} |
| 16117 |
async function resetLayout() { |
| 16118 |
const fresh = await (0, import_api_fetch.default)({ |
| 16119 |
path: `/wp/v2/dashboards/${dashboardName}/default-layout` |
| 16120 |
}); |
| 16121 |
void set3(SCOPE, KEY, fresh); |
| 16122 |
} |
| 16123 |
return [layout, setLayout, resetLayout]; |
| 16124 |
} |
| 16125 |
|
| 16126 |
// routes/dashboard/widget-dashboard/context/dashboard-context.tsx |
| 16127 |
var import_es6 = __toESM(require_es6()); |
| 16128 |
var import_element63 = __toESM(require_element()); |
| 16129 |
var import_jsx_runtime83 = __toESM(require_jsx_runtime()); |
| 16130 |
var DEFAULT_GRID = { |
| 16131 |
minColumnWidth: 350, |
| 16132 |
rowHeight: 200, |
| 16133 |
spacing: 4 |
| 16134 |
}; |
| 16135 |
var DEFAULT_RESOLVE_WIDGET_MODULE = (moduleId) => import( |
| 16136 |
/* webpackIgnore: true */ |
| 16137 |
moduleId |
| 16138 |
); |
| 16139 |
function canonicalize(layout) { |
| 16140 |
const indexed = layout.map((widget, index2) => ({ |
| 16141 |
widget, |
| 16142 |
order: widget.placement?.order ?? index2 |
| 16143 |
})); |
| 16144 |
indexed.sort((a2, b2) => a2.order - b2.order); |
| 16145 |
return indexed.map(({ widget }) => { |
| 16146 |
if (!widget.placement) { |
| 16147 |
return widget; |
| 16148 |
} |
| 16149 |
const { order: _stripped, ...placement } = widget.placement; |
| 16150 |
return { ...widget, placement }; |
| 16151 |
}); |
| 16152 |
} |
| 16153 |
var Context = (0, import_element63.createContext)(null); |
| 16154 |
function useDashboardInternalContext() { |
| 16155 |
const ctx8 = (0, import_element63.useContext)(Context); |
| 16156 |
if (!ctx8) { |
| 16157 |
throw new Error( |
| 16158 |
"Dashboard compound used outside a WidgetDashboard subtree." |
| 16159 |
); |
| 16160 |
} |
| 16161 |
return ctx8; |
| 16162 |
} |
| 16163 |
function WidgetDashboardProvider({ |
| 16164 |
widgetTypes, |
| 16165 |
layout: committedLayout, |
| 16166 |
onLayoutChange, |
| 16167 |
onLayoutReset, |
| 16168 |
editMode = false, |
| 16169 |
onEditChange, |
| 16170 |
resolveWidgetModule = DEFAULT_RESOLVE_WIDGET_MODULE, |
| 16171 |
gridSettings = DEFAULT_GRID, |
| 16172 |
children |
| 16173 |
}) { |
| 16174 |
const [stagingLayout, setStagingLayout] = (0, import_element63.useState)(committedLayout); |
| 16175 |
(0, import_element63.useEffect)(() => { |
| 16176 |
setStagingLayout(committedLayout); |
| 16177 |
}, [committedLayout]); |
| 16178 |
const hasUncommittedChanges = (0, import_element63.useMemo)( |
| 16179 |
() => !(0, import_es6.default)( |
| 16180 |
canonicalize(committedLayout), |
| 16181 |
canonicalize(stagingLayout) |
| 16182 |
), |
| 16183 |
[committedLayout, stagingLayout] |
| 16184 |
); |
| 16185 |
const commitLayout = (0, import_element63.useCallback)(() => { |
| 16186 |
if (hasUncommittedChanges) { |
| 16187 |
onLayoutChange(canonicalize(stagingLayout)); |
| 16188 |
} |
| 16189 |
onEditChange?.(false); |
| 16190 |
}, [hasUncommittedChanges, onLayoutChange, stagingLayout, onEditChange]); |
| 16191 |
const cancelLayout = (0, import_element63.useCallback)(() => { |
| 16192 |
setStagingLayout(committedLayout); |
| 16193 |
onEditChange?.(false); |
| 16194 |
}, [committedLayout, onEditChange]); |
| 16195 |
(0, import_element63.useEffect)(() => { |
| 16196 |
if (stagingLayout.length === 0) { |
| 16197 |
onEditChange?.(true); |
| 16198 |
} |
| 16199 |
}, [stagingLayout.length === 0]); |
| 16200 |
const value = (0, import_element63.useMemo)( |
| 16201 |
() => ({ |
| 16202 |
widgetTypes, |
| 16203 |
layout: stagingLayout, |
| 16204 |
onLayoutChange: setStagingLayout, |
| 16205 |
onLayoutReset, |
| 16206 |
commitLayout, |
| 16207 |
cancelLayout, |
| 16208 |
hasUncommittedChanges, |
| 16209 |
editMode, |
| 16210 |
onEditChange, |
| 16211 |
resolveWidgetModule, |
| 16212 |
gridSettings |
| 16213 |
}), |
| 16214 |
[ |
| 16215 |
widgetTypes, |
| 16216 |
stagingLayout, |
| 16217 |
onLayoutReset, |
| 16218 |
commitLayout, |
| 16219 |
cancelLayout, |
| 16220 |
hasUncommittedChanges, |
| 16221 |
editMode, |
| 16222 |
onEditChange, |
| 16223 |
resolveWidgetModule, |
| 16224 |
gridSettings |
| 16225 |
] |
| 16226 |
); |
| 16227 |
return /* @__PURE__ */ (0, import_jsx_runtime83.jsx)(Context.Provider, { value, children }); |
| 16228 |
} |
| 16229 |
|
| 16230 |
// routes/dashboard/widget-dashboard/context/ui-context.tsx |
| 16231 |
var import_element64 = __toESM(require_element()); |
| 16232 |
var import_jsx_runtime84 = __toESM(require_jsx_runtime()); |
| 16233 |
var Context2 = (0, import_element64.createContext)(null); |
| 16234 |
function useDashboardUIContext() { |
| 16235 |
const ctx8 = (0, import_element64.useContext)(Context2); |
| 16236 |
if (!ctx8) { |
| 16237 |
throw new Error( |
| 16238 |
"Dashboard compound used outside a WidgetDashboard subtree." |
| 16239 |
); |
| 16240 |
} |
| 16241 |
return ctx8; |
| 16242 |
} |
| 16243 |
function WidgetDashboardUIProvider({ children }) { |
| 16244 |
const [inserterOpen, setInserterOpen] = (0, import_element64.useState)(false); |
| 16245 |
const value = (0, import_element64.useMemo)( |
| 16246 |
() => ({ inserterOpen, setInserterOpen }), |
| 16247 |
[inserterOpen] |
| 16248 |
); |
| 16249 |
return /* @__PURE__ */ (0, import_jsx_runtime84.jsx)(Context2.Provider, { value, children }); |
| 16250 |
} |
| 16251 |
|
| 16252 |
// routes/dashboard/widget-dashboard/components/actions/actions.tsx |
| 16253 |
var import_element65 = __toESM(require_element()); |
| 16254 |
var import_i18n7 = __toESM(require_i18n()); |
| 16255 |
|
| 16256 |
// packages/style-runtime/src/index.ts |
| 16257 |
var STYLE_HASH_ATTRIBUTE35 = "data-wp-hash"; |
| 16258 |
function getRuntime35() { |
| 16259 |
const globalScope = globalThis; |
| 16260 |
if (globalScope.__wpStyleRuntime) { |
| 16261 |
return globalScope.__wpStyleRuntime; |
| 16262 |
} |
| 16263 |
globalScope.__wpStyleRuntime = { |
| 16264 |
documents: /* @__PURE__ */ new Map(), |
| 16265 |
styles: /* @__PURE__ */ new Map(), |
| 16266 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 16267 |
}; |
| 16268 |
if (typeof document !== "undefined") { |
| 16269 |
registerDocument35(document); |
| 16270 |
} |
| 16271 |
return globalScope.__wpStyleRuntime; |
| 16272 |
} |
| 16273 |
function documentContainsStyleHash35(targetDocument, hash) { |
| 16274 |
if (!targetDocument.head) { |
| 16275 |
return false; |
| 16276 |
} |
| 16277 |
for (const style of targetDocument.head.querySelectorAll( |
| 16278 |
`style[${STYLE_HASH_ATTRIBUTE35}]` |
| 16279 |
)) { |
| 16280 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE35) === hash) { |
| 16281 |
return true; |
| 16282 |
} |
| 16283 |
} |
| 16284 |
return false; |
| 16285 |
} |
| 16286 |
function injectStyle35(targetDocument, hash, css) { |
| 16287 |
if (!targetDocument.head) { |
| 16288 |
return; |
| 16289 |
} |
| 16290 |
const runtime = getRuntime35(); |
| 16291 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 16292 |
if (!injectedStyles) { |
| 16293 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 16294 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 16295 |
} |
| 16296 |
if (injectedStyles.has(hash)) { |
| 16297 |
return; |
| 16298 |
} |
| 16299 |
if (documentContainsStyleHash35(targetDocument, hash)) { |
| 16300 |
injectedStyles.add(hash); |
| 16301 |
return; |
| 16302 |
} |
| 16303 |
const style = targetDocument.createElement("style"); |
| 16304 |
style.setAttribute(STYLE_HASH_ATTRIBUTE35, hash); |
| 16305 |
style.appendChild(targetDocument.createTextNode(css)); |
| 16306 |
targetDocument.head.appendChild(style); |
| 16307 |
injectedStyles.add(hash); |
| 16308 |
} |
| 16309 |
function registerDocument35(targetDocument) { |
| 16310 |
const runtime = getRuntime35(); |
| 16311 |
runtime.documents.set( |
| 16312 |
targetDocument, |
| 16313 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 16314 |
); |
| 16315 |
for (const [hash, css] of runtime.styles) { |
| 16316 |
injectStyle35(targetDocument, hash, css); |
| 16317 |
} |
| 16318 |
return () => { |
| 16319 |
const count = runtime.documents.get(targetDocument); |
| 16320 |
if (count === void 0) { |
| 16321 |
return; |
| 16322 |
} |
| 16323 |
if (count <= 1) { |
| 16324 |
runtime.documents.delete(targetDocument); |
| 16325 |
return; |
| 16326 |
} |
| 16327 |
runtime.documents.set(targetDocument, count - 1); |
| 16328 |
}; |
| 16329 |
} |
| 16330 |
function registerStyle35(hash, css) { |
| 16331 |
const runtime = getRuntime35(); |
| 16332 |
runtime.styles.set(hash, css); |
| 16333 |
for (const targetDocument of runtime.documents.keys()) { |
| 16334 |
injectStyle35(targetDocument, hash, css); |
| 16335 |
} |
| 16336 |
} |
| 16337 |
|
| 16338 |
// routes/dashboard/widget-dashboard/components/actions/actions.module.css |
| 16339 |
if (typeof process === "undefined" || true) { |
| 16340 |
registerStyle35("616d83d5a3", ".a6e8ada13acc9f11__editActionsExit,.aa9a2b8bca16d3d4__editActionsEnter{display:inline-flex;gap:var(--wp--preset--spacing--20);transform-origin:right center}@media not (prefers-reduced-motion){.a6e8ada13acc9f11__editActionsExit,.aa9a2b8bca16d3d4__editActionsEnter{will-change:opacity,transform}.aa9a2b8bca16d3d4__editActionsEnter{animation:_6ad9417d3c8378ea__actions-slide-in var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-expressive,cubic-bezier(.25,0,0,1)) forwards}.a6e8ada13acc9f11__editActionsExit{animation:ca863286783f6f27__actions-fold-out var(--wpds-motion-duration-sm,.1s) var(--wpds-motion-easing-balanced,cubic-bezier(.4,0,.2,1)) forwards}@keyframes _6ad9417d3c8378ea__actions-slide-in{0%{opacity:0;transform:translateX(12px) scaleX(.92)}to{opacity:1;transform:translateX(0) scaleX(1)}}@keyframes ca863286783f6f27__actions-fold-out{0%{opacity:1;transform:translateX(0) scaleX(1)}to{opacity:0;transform:translateX(12px) scaleX(.92)}}}"); |
| 16341 |
} |
| 16342 |
var actions_default = { "editActionsEnter": "aa9a2b8bca16d3d4__editActionsEnter", "editActionsExit": "a6e8ada13acc9f11__editActionsExit", "actions-slide-in": "_6ad9417d3c8378ea__actions-slide-in", "actions-fold-out": "ca863286783f6f27__actions-fold-out" }; |
| 16343 |
|
| 16344 |
// routes/dashboard/widget-dashboard/components/more-actions-dropdown/more-actions-dropdown.tsx |
| 16345 |
var import_components2 = __toESM(require_components()); |
| 16346 |
var import_i18n6 = __toESM(require_i18n()); |
| 16347 |
|
| 16348 |
// routes/dashboard/lock-unlock.ts |
| 16349 |
var import_private_apis2 = __toESM(require_private_apis()); |
| 16350 |
var { lock: lock2, unlock: unlock2 } = (0, import_private_apis2.__dangerousOptInToUnstableAPIsOnlyForCoreModules)( |
| 16351 |
"I acknowledge private features are not for use in themes or plugins and doing so will break in the next version of WordPress.", |
| 16352 |
"@wordpress/routes" |
| 16353 |
); |
| 16354 |
|
| 16355 |
// routes/dashboard/widget-dashboard/components/more-actions-dropdown/more-actions-dropdown.tsx |
| 16356 |
var import_jsx_runtime85 = __toESM(require_jsx_runtime()); |
| 16357 |
var { Menu } = unlock2(import_components2.privateApis); |
| 16358 |
function MoreActionsDropdown({ |
| 16359 |
items |
| 16360 |
}) { |
| 16361 |
if (items.length === 0) { |
| 16362 |
return null; |
| 16363 |
} |
| 16364 |
return /* @__PURE__ */ (0, import_jsx_runtime85.jsxs)(Menu, { children: [ |
| 16365 |
/* @__PURE__ */ (0, import_jsx_runtime85.jsx)( |
| 16366 |
Menu.TriggerButton, |
| 16367 |
{ |
| 16368 |
render: /* @__PURE__ */ (0, import_jsx_runtime85.jsx)( |
| 16369 |
IconButton, |
| 16370 |
{ |
| 16371 |
icon: more_vertical_default, |
| 16372 |
label: (0, import_i18n6.__)("More options"), |
| 16373 |
variant: "minimal", |
| 16374 |
tone: "brand", |
| 16375 |
size: "compact" |
| 16376 |
} |
| 16377 |
) |
| 16378 |
} |
| 16379 |
), |
| 16380 |
/* @__PURE__ */ (0, import_jsx_runtime85.jsx)(Menu.Popover, { children: /* @__PURE__ */ (0, import_jsx_runtime85.jsx)(Menu.Group, { children: items.map((item, index2) => /* @__PURE__ */ (0, import_jsx_runtime85.jsx)( |
| 16381 |
Menu.Item, |
| 16382 |
{ |
| 16383 |
disabled: item.disabled, |
| 16384 |
onClick: item.onClick, |
| 16385 |
render: /* @__PURE__ */ (0, import_jsx_runtime85.jsx)(Button4, { variant: "minimal", tone: "neutral" }), |
| 16386 |
children: item.label |
| 16387 |
}, |
| 16388 |
index2 |
| 16389 |
)) }) }) |
| 16390 |
] }); |
| 16391 |
} |
| 16392 |
|
| 16393 |
// routes/dashboard/widget-dashboard/components/actions/actions.tsx |
| 16394 |
var import_jsx_runtime86 = __toESM(require_jsx_runtime()); |
| 16395 |
function Actions3() { |
| 16396 |
const { |
| 16397 |
editMode, |
| 16398 |
onEditChange, |
| 16399 |
onLayoutReset, |
| 16400 |
commitLayout, |
| 16401 |
cancelLayout, |
| 16402 |
hasUncommittedChanges |
| 16403 |
} = useDashboardInternalContext(); |
| 16404 |
const [isEditActionsMounted, setIsEditActionsMounted] = (0, import_element65.useState)(editMode); |
| 16405 |
const [isExitingEditActions, setIsExitingEditActions] = (0, import_element65.useState)(false); |
| 16406 |
(0, import_element65.useEffect)(() => { |
| 16407 |
if (editMode) { |
| 16408 |
setIsEditActionsMounted(true); |
| 16409 |
setIsExitingEditActions(false); |
| 16410 |
return; |
| 16411 |
} |
| 16412 |
if (!isEditActionsMounted) { |
| 16413 |
return; |
| 16414 |
} |
| 16415 |
setIsExitingEditActions(true); |
| 16416 |
const exitTimeout = setTimeout(() => { |
| 16417 |
setIsEditActionsMounted(false); |
| 16418 |
setIsExitingEditActions(false); |
| 16419 |
}, 220); |
| 16420 |
return () => clearTimeout(exitTimeout); |
| 16421 |
}, [editMode, isEditActionsMounted]); |
| 16422 |
const { setInserterOpen } = useDashboardUIContext(); |
| 16423 |
const [isResetDialogOpen, setIsResetDialogOpen] = (0, import_element65.useState)(false); |
| 16424 |
const handleEditMode = (0, import_element65.useCallback)(() => { |
| 16425 |
onEditChange?.(!editMode); |
| 16426 |
}, [editMode, onEditChange]); |
| 16427 |
const insert = (0, import_element65.useCallback)(() => { |
| 16428 |
setInserterOpen(true); |
| 16429 |
}, [setInserterOpen]); |
| 16430 |
const cancel = (0, import_element65.useCallback)(() => { |
| 16431 |
cancelLayout(); |
| 16432 |
}, [cancelLayout]); |
| 16433 |
const done = (0, import_element65.useCallback)(() => { |
| 16434 |
commitLayout(); |
| 16435 |
}, [commitLayout]); |
| 16436 |
const moreActionsItems = [ |
| 16437 |
{ |
| 16438 |
label: (0, import_i18n7.__)("Reset to default"), |
| 16439 |
onClick: () => setIsResetDialogOpen(true), |
| 16440 |
disabled: !onLayoutReset |
| 16441 |
} |
| 16442 |
]; |
| 16443 |
if (!onEditChange) { |
| 16444 |
return null; |
| 16445 |
} |
| 16446 |
return /* @__PURE__ */ (0, import_jsx_runtime86.jsxs)(Stack, { direction: "row", gap: "sm", children: [ |
| 16447 |
isEditActionsMounted ? /* @__PURE__ */ (0, import_jsx_runtime86.jsxs)( |
| 16448 |
Stack, |
| 16449 |
{ |
| 16450 |
direction: "row", |
| 16451 |
gap: "sm", |
| 16452 |
className: isExitingEditActions ? actions_default.editActionsExit : actions_default.editActionsEnter, |
| 16453 |
children: [ |
| 16454 |
/* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16455 |
Button4, |
| 16456 |
{ |
| 16457 |
variant: "minimal", |
| 16458 |
tone: "brand", |
| 16459 |
size: "compact", |
| 16460 |
onClick: insert, |
| 16461 |
children: (0, import_i18n7.__)("Add widgets") |
| 16462 |
} |
| 16463 |
), |
| 16464 |
/* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16465 |
Button4, |
| 16466 |
{ |
| 16467 |
variant: "minimal", |
| 16468 |
tone: "brand", |
| 16469 |
size: "compact", |
| 16470 |
onClick: cancel, |
| 16471 |
children: (0, import_i18n7.__)("Cancel") |
| 16472 |
} |
| 16473 |
), |
| 16474 |
/* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16475 |
Button4, |
| 16476 |
{ |
| 16477 |
variant: "solid", |
| 16478 |
tone: "brand", |
| 16479 |
size: "compact", |
| 16480 |
onClick: done, |
| 16481 |
disabled: !hasUncommittedChanges, |
| 16482 |
children: (0, import_i18n7.__)("Done") |
| 16483 |
} |
| 16484 |
) |
| 16485 |
] |
| 16486 |
} |
| 16487 |
) : /* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16488 |
Button4, |
| 16489 |
{ |
| 16490 |
variant: "outline", |
| 16491 |
tone: "brand", |
| 16492 |
size: "compact", |
| 16493 |
onClick: handleEditMode, |
| 16494 |
children: (0, import_i18n7.__)("Customize") |
| 16495 |
} |
| 16496 |
), |
| 16497 |
/* @__PURE__ */ (0, import_jsx_runtime86.jsx)(MoreActionsDropdown, { items: moreActionsItems }), |
| 16498 |
/* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16499 |
alert_dialog_exports.Root, |
| 16500 |
{ |
| 16501 |
open: isResetDialogOpen, |
| 16502 |
onOpenChange: setIsResetDialogOpen, |
| 16503 |
onConfirm: async () => { |
| 16504 |
await onLayoutReset?.(); |
| 16505 |
onEditChange?.(false); |
| 16506 |
setIsResetDialogOpen(false); |
| 16507 |
}, |
| 16508 |
children: /* @__PURE__ */ (0, import_jsx_runtime86.jsx)( |
| 16509 |
alert_dialog_exports.Popup, |
| 16510 |
{ |
| 16511 |
intent: "irreversible", |
| 16512 |
title: (0, import_i18n7.__)("Reset dashboard to default?"), |
| 16513 |
description: (0, import_i18n7.__)( |
| 16514 |
"All customizations will be permanently lost." |
| 16515 |
), |
| 16516 |
confirmButtonText: (0, import_i18n7.__)("Reset") |
| 16517 |
} |
| 16518 |
) |
| 16519 |
} |
| 16520 |
) |
| 16521 |
] }); |
| 16522 |
} |
| 16523 |
|
| 16524 |
// routes/dashboard/widget-dashboard/components/inserter/inserter.tsx |
| 16525 |
var import_element124 = __toESM(require_element()); |
| 16526 |
var import_i18n51 = __toESM(require_i18n()); |
| 16527 |
|
| 16528 |
// routes/dashboard/widget-dashboard/utils/create-dashboard-widget/create-dashboard-widget.ts |
| 16529 |
var DEFAULT_PLACEMENT = { |
| 16530 |
width: 1, |
| 16531 |
height: 2, |
| 16532 |
order: 0 |
| 16533 |
}; |
| 16534 |
function createDashboardWidget(widgetType, initialAttributes) { |
| 16535 |
return { |
| 16536 |
uuid: crypto.randomUUID(), |
| 16537 |
type: widgetType.name, |
| 16538 |
attributes: initialAttributes ?? widgetType.example?.attributes, |
| 16539 |
placement: DEFAULT_PLACEMENT |
| 16540 |
}; |
| 16541 |
} |
| 16542 |
|
| 16543 |
// packages/dataviews/build-module/components/dataviews-context/index.mjs |
| 16544 |
var import_element66 = __toESM(require_element(), 1); |
| 16545 |
|
| 16546 |
// packages/dataviews/build-module/constants.mjs |
| 16547 |
var import_i18n8 = __toESM(require_i18n(), 1); |
| 16548 |
var OPERATOR_IS_ANY = "isAny"; |
| 16549 |
var OPERATOR_IS_NONE = "isNone"; |
| 16550 |
var OPERATOR_IS_ALL = "isAll"; |
| 16551 |
var OPERATOR_IS_NOT_ALL = "isNotAll"; |
| 16552 |
var OPERATOR_BETWEEN = "between"; |
| 16553 |
var OPERATOR_IN_THE_PAST = "inThePast"; |
| 16554 |
var OPERATOR_OVER = "over"; |
| 16555 |
var OPERATOR_IS = "is"; |
| 16556 |
var OPERATOR_IS_NOT = "isNot"; |
| 16557 |
var OPERATOR_LESS_THAN = "lessThan"; |
| 16558 |
var OPERATOR_GREATER_THAN = "greaterThan"; |
| 16559 |
var OPERATOR_LESS_THAN_OR_EQUAL = "lessThanOrEqual"; |
| 16560 |
var OPERATOR_GREATER_THAN_OR_EQUAL = "greaterThanOrEqual"; |
| 16561 |
var OPERATOR_BEFORE = "before"; |
| 16562 |
var OPERATOR_AFTER = "after"; |
| 16563 |
var OPERATOR_BEFORE_INC = "beforeInc"; |
| 16564 |
var OPERATOR_AFTER_INC = "afterInc"; |
| 16565 |
var OPERATOR_CONTAINS = "contains"; |
| 16566 |
var OPERATOR_NOT_CONTAINS = "notContains"; |
| 16567 |
var OPERATOR_STARTS_WITH = "startsWith"; |
| 16568 |
var OPERATOR_ON = "on"; |
| 16569 |
var OPERATOR_NOT_ON = "notOn"; |
| 16570 |
var SORTING_DIRECTIONS = ["asc", "desc"]; |
| 16571 |
var sortArrows = { asc: "\u2191", desc: "\u2193" }; |
| 16572 |
var sortValues = { asc: "ascending", desc: "descending" }; |
| 16573 |
var sortLabels = { |
| 16574 |
asc: (0, import_i18n8.__)("Sort ascending"), |
| 16575 |
desc: (0, import_i18n8.__)("Sort descending") |
| 16576 |
}; |
| 16577 |
var sortIcons = { |
| 16578 |
asc: arrow_up_default, |
| 16579 |
desc: arrow_down_default |
| 16580 |
}; |
| 16581 |
var LAYOUT_TABLE = "table"; |
| 16582 |
var LAYOUT_GRID = "grid"; |
| 16583 |
var LAYOUT_LIST = "list"; |
| 16584 |
var LAYOUT_ACTIVITY = "activity"; |
| 16585 |
var LAYOUT_PICKER_GRID = "pickerGrid"; |
| 16586 |
var LAYOUT_PICKER_TABLE = "pickerTable"; |
| 16587 |
|
| 16588 |
// packages/dataviews/build-module/components/dataviews-context/index.mjs |
| 16589 |
var DataViewsContext = (0, import_element66.createContext)({ |
| 16590 |
view: { type: LAYOUT_TABLE }, |
| 16591 |
onChangeView: () => { |
| 16592 |
}, |
| 16593 |
fields: [], |
| 16594 |
data: [], |
| 16595 |
paginationInfo: { |
| 16596 |
totalItems: 0, |
| 16597 |
totalPages: 0 |
| 16598 |
}, |
| 16599 |
selection: [], |
| 16600 |
onChangeSelection: () => { |
| 16601 |
}, |
| 16602 |
setOpenedFilter: () => { |
| 16603 |
}, |
| 16604 |
openedFilter: null, |
| 16605 |
getItemId: (item) => item.id, |
| 16606 |
isItemClickable: () => true, |
| 16607 |
renderItemLink: void 0, |
| 16608 |
containerWidth: 0, |
| 16609 |
containerRef: (0, import_element66.createRef)(), |
| 16610 |
resizeObserverRef: () => { |
| 16611 |
}, |
| 16612 |
defaultLayouts: { list: {}, grid: {}, table: {} }, |
| 16613 |
filters: [], |
| 16614 |
isShowingFilter: false, |
| 16615 |
setIsShowingFilter: () => { |
| 16616 |
}, |
| 16617 |
hasInitiallyLoaded: false, |
| 16618 |
config: { |
| 16619 |
perPageSizes: [] |
| 16620 |
}, |
| 16621 |
intersectionObserver: null |
| 16622 |
}); |
| 16623 |
DataViewsContext.displayName = "DataViewsContext"; |
| 16624 |
var dataviews_context_default = DataViewsContext; |
| 16625 |
|
| 16626 |
// packages/dataviews/build-module/components/dataviews-layouts/index.mjs |
| 16627 |
var import_i18n28 = __toESM(require_i18n(), 1); |
| 16628 |
|
| 16629 |
// packages/dataviews/build-module/components/dataviews-layouts/table/index.mjs |
| 16630 |
var import_i18n16 = __toESM(require_i18n(), 1); |
| 16631 |
var import_components8 = __toESM(require_components(), 1); |
| 16632 |
var import_element74 = __toESM(require_element(), 1); |
| 16633 |
var import_keycodes = __toESM(require_keycodes(), 1); |
| 16634 |
|
| 16635 |
// packages/dataviews/build-module/components/dataviews-selection-checkbox/index.mjs |
| 16636 |
var import_components3 = __toESM(require_components(), 1); |
| 16637 |
var import_i18n9 = __toESM(require_i18n(), 1); |
| 16638 |
var import_jsx_runtime87 = __toESM(require_jsx_runtime(), 1); |
| 16639 |
function DataViewsSelectionCheckbox({ |
| 16640 |
selection, |
| 16641 |
onChangeSelection, |
| 16642 |
item, |
| 16643 |
getItemId: getItemId2, |
| 16644 |
titleField, |
| 16645 |
disabled: disabled2, |
| 16646 |
...extraProps |
| 16647 |
}) { |
| 16648 |
const id = getItemId2(item); |
| 16649 |
const isInSelectionArray = selection.includes(id); |
| 16650 |
const checked = !disabled2 && isInSelectionArray; |
| 16651 |
const selectionLabel = titleField?.getValue?.({ item }) || (0, import_i18n9.__)("(no title)"); |
| 16652 |
return /* @__PURE__ */ (0, import_jsx_runtime87.jsx)( |
| 16653 |
import_components3.CheckboxControl, |
| 16654 |
{ |
| 16655 |
className: "dataviews-selection-checkbox", |
| 16656 |
"aria-label": selectionLabel, |
| 16657 |
"aria-disabled": disabled2, |
| 16658 |
checked, |
| 16659 |
onChange: () => { |
| 16660 |
if (disabled2) { |
| 16661 |
return; |
| 16662 |
} |
| 16663 |
onChangeSelection( |
| 16664 |
isInSelectionArray ? selection.filter((itemId) => id !== itemId) : [...selection, id] |
| 16665 |
); |
| 16666 |
}, |
| 16667 |
...extraProps |
| 16668 |
} |
| 16669 |
); |
| 16670 |
} |
| 16671 |
|
| 16672 |
// packages/dataviews/build-module/components/dataviews-item-actions/index.mjs |
| 16673 |
var import_components4 = __toESM(require_components(), 1); |
| 16674 |
var import_i18n10 = __toESM(require_i18n(), 1); |
| 16675 |
var import_element67 = __toESM(require_element(), 1); |
| 16676 |
var import_data2 = __toESM(require_data(), 1); |
| 16677 |
var import_compose5 = __toESM(require_compose(), 1); |
| 16678 |
|
| 16679 |
// packages/dataviews/build-module/lock-unlock.mjs |
| 16680 |
var import_private_apis3 = __toESM(require_private_apis(), 1); |
| 16681 |
var { lock: lock3, unlock: unlock3 } = (0, import_private_apis3.__dangerousOptInToUnstableAPIsOnlyForCoreModules)( |
| 16682 |
"I acknowledge private features are not for use in themes or plugins and doing so will break in the next version of WordPress.", |
| 16683 |
"@wordpress/dataviews" |
| 16684 |
); |
| 16685 |
|
| 16686 |
// packages/dataviews/build-module/components/dataviews-item-actions/index.mjs |
| 16687 |
var import_jsx_runtime88 = __toESM(require_jsx_runtime(), 1); |
| 16688 |
var { Menu: Menu2, kebabCase } = unlock3(import_components4.privateApis); |
| 16689 |
function ButtonTrigger({ |
| 16690 |
action, |
| 16691 |
onClick, |
| 16692 |
items, |
| 16693 |
variant |
| 16694 |
}) { |
| 16695 |
const label = typeof action.label === "string" ? action.label : action.label(items); |
| 16696 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16697 |
import_components4.Button, |
| 16698 |
{ |
| 16699 |
disabled: !!action.disabled, |
| 16700 |
accessibleWhenDisabled: true, |
| 16701 |
size: "compact", |
| 16702 |
variant, |
| 16703 |
onClick, |
| 16704 |
children: label |
| 16705 |
} |
| 16706 |
); |
| 16707 |
} |
| 16708 |
function MenuItemTrigger({ |
| 16709 |
action, |
| 16710 |
onClick, |
| 16711 |
items |
| 16712 |
}) { |
| 16713 |
const label = typeof action.label === "string" ? action.label : action.label(items); |
| 16714 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsx)(Menu2.Item, { disabled: action.disabled, onClick, children: /* @__PURE__ */ (0, import_jsx_runtime88.jsx)(Menu2.ItemLabel, { children: label }) }); |
| 16715 |
} |
| 16716 |
function ActionModal({ |
| 16717 |
action, |
| 16718 |
items, |
| 16719 |
closeModal |
| 16720 |
}) { |
| 16721 |
const label = typeof action.label === "string" ? action.label : action.label(items); |
| 16722 |
const modalHeader = typeof action.modalHeader === "function" ? action.modalHeader(items) : action.modalHeader; |
| 16723 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16724 |
import_components4.Modal, |
| 16725 |
{ |
| 16726 |
title: modalHeader || label, |
| 16727 |
__experimentalHideHeader: !!action.hideModalHeader, |
| 16728 |
onRequestClose: closeModal, |
| 16729 |
focusOnMount: action.modalFocusOnMount ?? true, |
| 16730 |
size: action.modalSize || "medium", |
| 16731 |
overlayClassName: `dataviews-action-modal dataviews-action-modal__${kebabCase( |
| 16732 |
action.id |
| 16733 |
)}`, |
| 16734 |
children: /* @__PURE__ */ (0, import_jsx_runtime88.jsx)(action.RenderModal, { items, closeModal }) |
| 16735 |
} |
| 16736 |
); |
| 16737 |
} |
| 16738 |
function ActionsMenuGroup({ |
| 16739 |
actions, |
| 16740 |
item, |
| 16741 |
registry, |
| 16742 |
setActiveModalAction |
| 16743 |
}) { |
| 16744 |
const { primaryActions, regularActions } = (0, import_element67.useMemo)(() => { |
| 16745 |
return actions.reduce( |
| 16746 |
(acc, action) => { |
| 16747 |
(action.isPrimary ? acc.primaryActions : acc.regularActions).push(action); |
| 16748 |
return acc; |
| 16749 |
}, |
| 16750 |
{ |
| 16751 |
primaryActions: [], |
| 16752 |
regularActions: [] |
| 16753 |
} |
| 16754 |
); |
| 16755 |
}, [actions]); |
| 16756 |
const renderActionGroup = (actionList) => actionList.map((action) => /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16757 |
MenuItemTrigger, |
| 16758 |
{ |
| 16759 |
action, |
| 16760 |
onClick: () => { |
| 16761 |
if ("RenderModal" in action) { |
| 16762 |
setActiveModalAction(action); |
| 16763 |
return; |
| 16764 |
} |
| 16765 |
action.callback([item], { registry }); |
| 16766 |
}, |
| 16767 |
items: [item] |
| 16768 |
}, |
| 16769 |
action.id |
| 16770 |
)); |
| 16771 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsxs)(Menu2.Group, { children: [ |
| 16772 |
renderActionGroup(primaryActions), |
| 16773 |
renderActionGroup(regularActions) |
| 16774 |
] }); |
| 16775 |
} |
| 16776 |
function ItemActions({ |
| 16777 |
item, |
| 16778 |
actions, |
| 16779 |
isCompact |
| 16780 |
}) { |
| 16781 |
const registry = (0, import_data2.useRegistry)(); |
| 16782 |
const { primaryActions, eligibleActions } = (0, import_element67.useMemo)(() => { |
| 16783 |
const _eligibleActions = actions.filter( |
| 16784 |
(action) => !action.isEligible || action.isEligible(item) |
| 16785 |
); |
| 16786 |
const _primaryActions = _eligibleActions.filter( |
| 16787 |
(action) => action.isPrimary |
| 16788 |
); |
| 16789 |
return { |
| 16790 |
primaryActions: _primaryActions, |
| 16791 |
eligibleActions: _eligibleActions |
| 16792 |
}; |
| 16793 |
}, [actions, item]); |
| 16794 |
const isMobileViewport = (0, import_compose5.useViewportMatch)("medium", "<"); |
| 16795 |
if (isCompact) { |
| 16796 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16797 |
CompactItemActions, |
| 16798 |
{ |
| 16799 |
item, |
| 16800 |
actions: eligibleActions, |
| 16801 |
isSmall: true, |
| 16802 |
registry |
| 16803 |
} |
| 16804 |
); |
| 16805 |
} |
| 16806 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsxs)( |
| 16807 |
Stack, |
| 16808 |
{ |
| 16809 |
direction: "row", |
| 16810 |
justify: "flex-end", |
| 16811 |
className: "dataviews-item-actions", |
| 16812 |
style: { |
| 16813 |
flexShrink: 0, |
| 16814 |
width: "auto" |
| 16815 |
}, |
| 16816 |
children: [ |
| 16817 |
/* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16818 |
PrimaryActions, |
| 16819 |
{ |
| 16820 |
item, |
| 16821 |
actions: primaryActions, |
| 16822 |
registry |
| 16823 |
} |
| 16824 |
), |
| 16825 |
(primaryActions.length < eligibleActions.length || // Since we hide primary actions on mobile, we need to show the menu |
| 16826 |
// there if there are any actions at all. |
| 16827 |
isMobileViewport) && /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16828 |
CompactItemActions, |
| 16829 |
{ |
| 16830 |
item, |
| 16831 |
actions: eligibleActions, |
| 16832 |
registry |
| 16833 |
} |
| 16834 |
) |
| 16835 |
] |
| 16836 |
} |
| 16837 |
); |
| 16838 |
} |
| 16839 |
function CompactItemActions({ |
| 16840 |
item, |
| 16841 |
actions, |
| 16842 |
isSmall, |
| 16843 |
registry |
| 16844 |
}) { |
| 16845 |
const [activeModalAction, setActiveModalAction] = (0, import_element67.useState)( |
| 16846 |
null |
| 16847 |
); |
| 16848 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsxs)(import_jsx_runtime88.Fragment, { children: [ |
| 16849 |
/* @__PURE__ */ (0, import_jsx_runtime88.jsxs)(Menu2, { placement: "bottom-end", children: [ |
| 16850 |
/* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16851 |
Menu2.TriggerButton, |
| 16852 |
{ |
| 16853 |
render: /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16854 |
import_components4.Button, |
| 16855 |
{ |
| 16856 |
size: isSmall ? "small" : "compact", |
| 16857 |
icon: more_vertical_default, |
| 16858 |
label: (0, import_i18n10.__)("Actions"), |
| 16859 |
accessibleWhenDisabled: true, |
| 16860 |
disabled: !actions.length, |
| 16861 |
className: "dataviews-all-actions-button" |
| 16862 |
} |
| 16863 |
) |
| 16864 |
} |
| 16865 |
), |
| 16866 |
/* @__PURE__ */ (0, import_jsx_runtime88.jsx)(Menu2.Popover, { children: /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16867 |
ActionsMenuGroup, |
| 16868 |
{ |
| 16869 |
actions, |
| 16870 |
item, |
| 16871 |
registry, |
| 16872 |
setActiveModalAction |
| 16873 |
} |
| 16874 |
) }) |
| 16875 |
] }), |
| 16876 |
!!activeModalAction && /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16877 |
ActionModal, |
| 16878 |
{ |
| 16879 |
action: activeModalAction, |
| 16880 |
items: [item], |
| 16881 |
closeModal: () => setActiveModalAction(null) |
| 16882 |
} |
| 16883 |
) |
| 16884 |
] }); |
| 16885 |
} |
| 16886 |
function PrimaryActions({ |
| 16887 |
item, |
| 16888 |
actions, |
| 16889 |
registry, |
| 16890 |
buttonVariant |
| 16891 |
}) { |
| 16892 |
const [activeModalAction, setActiveModalAction] = (0, import_element67.useState)(null); |
| 16893 |
const isMobileViewport = (0, import_compose5.useViewportMatch)("medium", "<"); |
| 16894 |
if (isMobileViewport) { |
| 16895 |
return null; |
| 16896 |
} |
| 16897 |
if (!Array.isArray(actions) || actions.length === 0) { |
| 16898 |
return null; |
| 16899 |
} |
| 16900 |
return /* @__PURE__ */ (0, import_jsx_runtime88.jsxs)(import_jsx_runtime88.Fragment, { children: [ |
| 16901 |
actions.map((action) => /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16902 |
ButtonTrigger, |
| 16903 |
{ |
| 16904 |
action, |
| 16905 |
onClick: () => { |
| 16906 |
if ("RenderModal" in action) { |
| 16907 |
setActiveModalAction(action); |
| 16908 |
return; |
| 16909 |
} |
| 16910 |
action.callback([item], { registry }); |
| 16911 |
}, |
| 16912 |
items: [item], |
| 16913 |
variant: buttonVariant |
| 16914 |
}, |
| 16915 |
action.id |
| 16916 |
)), |
| 16917 |
!!activeModalAction && /* @__PURE__ */ (0, import_jsx_runtime88.jsx)( |
| 16918 |
ActionModal, |
| 16919 |
{ |
| 16920 |
action: activeModalAction, |
| 16921 |
items: [item], |
| 16922 |
closeModal: () => setActiveModalAction(null) |
| 16923 |
} |
| 16924 |
) |
| 16925 |
] }); |
| 16926 |
} |
| 16927 |
|
| 16928 |
// packages/dataviews/build-module/components/dataviews-bulk-actions/index.mjs |
| 16929 |
var import_components5 = __toESM(require_components(), 1); |
| 16930 |
var import_i18n12 = __toESM(require_i18n(), 1); |
| 16931 |
var import_element68 = __toESM(require_element(), 1); |
| 16932 |
var import_data3 = __toESM(require_data(), 1); |
| 16933 |
var import_compose6 = __toESM(require_compose(), 1); |
| 16934 |
|
| 16935 |
// packages/dataviews/build-module/utils/get-footer-message.mjs |
| 16936 |
var import_i18n11 = __toESM(require_i18n(), 1); |
| 16937 |
function getFooterMessage(selectionCount, itemsCount, totalItems, onlyTotalCount = false) { |
| 16938 |
if (selectionCount > 0) { |
| 16939 |
return (0, import_i18n11.sprintf)( |
| 16940 |
/* translators: %d: number of items. */ |
| 16941 |
(0, import_i18n11._n)("%d Item selected", "%d Items selected", selectionCount), |
| 16942 |
selectionCount |
| 16943 |
); |
| 16944 |
} |
| 16945 |
if (onlyTotalCount || totalItems <= itemsCount) { |
| 16946 |
return (0, import_i18n11.sprintf)( |
| 16947 |
/* translators: %d: number of items. */ |
| 16948 |
(0, import_i18n11._n)("%d Item", "%d Items", totalItems), |
| 16949 |
totalItems |
| 16950 |
); |
| 16951 |
} |
| 16952 |
return (0, import_i18n11.sprintf)( |
| 16953 |
/* translators: %1$d: number of items. %2$d: total number of items. */ |
| 16954 |
(0, import_i18n11._n)("%1$d of %2$d Item", "%1$d of %2$d Items", totalItems), |
| 16955 |
itemsCount, |
| 16956 |
totalItems |
| 16957 |
); |
| 16958 |
} |
| 16959 |
|
| 16960 |
// packages/dataviews/build-module/components/dataviews-bulk-actions/index.mjs |
| 16961 |
var import_jsx_runtime89 = __toESM(require_jsx_runtime(), 1); |
| 16962 |
function useHasAPossibleBulkAction(actions, item) { |
| 16963 |
return (0, import_element68.useMemo)(() => { |
| 16964 |
return actions.some((action) => { |
| 16965 |
return action.supportsBulk && (!action.isEligible || action.isEligible(item)); |
| 16966 |
}); |
| 16967 |
}, [actions, item]); |
| 16968 |
} |
| 16969 |
function useSomeItemHasAPossibleBulkAction(actions, data) { |
| 16970 |
return (0, import_element68.useMemo)(() => { |
| 16971 |
return data.some((item) => { |
| 16972 |
return actions.some((action) => { |
| 16973 |
return action.supportsBulk && (!action.isEligible || action.isEligible(item)); |
| 16974 |
}); |
| 16975 |
}); |
| 16976 |
}, [actions, data]); |
| 16977 |
} |
| 16978 |
function BulkSelectionCheckbox({ |
| 16979 |
selection, |
| 16980 |
onChangeSelection, |
| 16981 |
data, |
| 16982 |
actions, |
| 16983 |
getItemId: getItemId2, |
| 16984 |
disableSelectAll = false |
| 16985 |
}) { |
| 16986 |
const selectableItems = (0, import_element68.useMemo)(() => { |
| 16987 |
return data.filter((item) => { |
| 16988 |
return actions.some( |
| 16989 |
(action) => action.supportsBulk && (!action.isEligible || action.isEligible(item)) |
| 16990 |
); |
| 16991 |
}); |
| 16992 |
}, [data, actions]); |
| 16993 |
const selectedItems = data.filter( |
| 16994 |
(item) => selection.includes(getItemId2(item)) && selectableItems.includes(item) |
| 16995 |
); |
| 16996 |
const hasSelection = selection.length > 0; |
| 16997 |
const areAllSelected = selectedItems.length === selectableItems.length; |
| 16998 |
if (disableSelectAll) { |
| 16999 |
return /* @__PURE__ */ (0, import_jsx_runtime89.jsx)( |
| 17000 |
import_components5.CheckboxControl, |
| 17001 |
{ |
| 17002 |
className: "dataviews-view-table-selection-checkbox", |
| 17003 |
checked: hasSelection, |
| 17004 |
disabled: !hasSelection, |
| 17005 |
onChange: () => { |
| 17006 |
onChangeSelection([]); |
| 17007 |
}, |
| 17008 |
"aria-label": (0, import_i18n12.__)("Deselect all") |
| 17009 |
} |
| 17010 |
); |
| 17011 |
} |
| 17012 |
return /* @__PURE__ */ (0, import_jsx_runtime89.jsx)( |
| 17013 |
import_components5.CheckboxControl, |
| 17014 |
{ |
| 17015 |
className: "dataviews-view-table-selection-checkbox", |
| 17016 |
checked: areAllSelected, |
| 17017 |
indeterminate: !areAllSelected && !!selectedItems.length, |
| 17018 |
onChange: () => { |
| 17019 |
if (areAllSelected) { |
| 17020 |
onChangeSelection([]); |
| 17021 |
} else { |
| 17022 |
onChangeSelection( |
| 17023 |
selectableItems.map((item) => getItemId2(item)) |
| 17024 |
); |
| 17025 |
} |
| 17026 |
}, |
| 17027 |
"aria-label": areAllSelected ? (0, import_i18n12.__)("Deselect all") : (0, import_i18n12.__)("Select all") |
| 17028 |
} |
| 17029 |
); |
| 17030 |
} |
| 17031 |
|
| 17032 |
// packages/dataviews/build-module/components/dataviews-layouts/table/column-header-menu.mjs |
| 17033 |
var import_i18n13 = __toESM(require_i18n(), 1); |
| 17034 |
var import_components6 = __toESM(require_components(), 1); |
| 17035 |
var import_element69 = __toESM(require_element(), 1); |
| 17036 |
|
| 17037 |
// packages/dataviews/build-module/utils/get-hideable-fields.mjs |
| 17038 |
function getHideableFields(view, fields2) { |
| 17039 |
const togglableFields = [ |
| 17040 |
view?.titleField, |
| 17041 |
view?.mediaField, |
| 17042 |
view?.descriptionField |
| 17043 |
].filter(Boolean); |
| 17044 |
return fields2.filter( |
| 17045 |
(f2) => !togglableFields.includes(f2.id) && f2.type !== "media" && f2.enableHiding !== false |
| 17046 |
); |
| 17047 |
} |
| 17048 |
|
| 17049 |
// packages/dataviews/build-module/components/dataviews-layouts/table/column-header-menu.mjs |
| 17050 |
var import_jsx_runtime90 = __toESM(require_jsx_runtime(), 1); |
| 17051 |
var { Menu: Menu3 } = unlock3(import_components6.privateApis); |
| 17052 |
function WithMenuSeparators({ children }) { |
| 17053 |
return import_element69.Children.toArray(children).filter(Boolean).map((child, i2) => /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(import_element69.Fragment, { children: [ |
| 17054 |
i2 > 0 && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Separator, {}), |
| 17055 |
child |
| 17056 |
] }, i2)); |
| 17057 |
} |
| 17058 |
var _HeaderMenu = (0, import_element69.forwardRef)(function HeaderMenu({ |
| 17059 |
fieldId, |
| 17060 |
view, |
| 17061 |
fields: fields2, |
| 17062 |
onChangeView, |
| 17063 |
onHide, |
| 17064 |
setOpenedFilter, |
| 17065 |
canMove = true, |
| 17066 |
canInsertLeft = true, |
| 17067 |
canInsertRight = true |
| 17068 |
}, ref) { |
| 17069 |
const visibleFieldIds = view.fields ?? []; |
| 17070 |
const index2 = visibleFieldIds?.indexOf(fieldId); |
| 17071 |
const isSorted = view.sort?.field === fieldId; |
| 17072 |
let isHidable = false; |
| 17073 |
let isSortable = false; |
| 17074 |
let canAddFilter = false; |
| 17075 |
let operators = []; |
| 17076 |
const field = fields2.find((f2) => f2.id === fieldId); |
| 17077 |
const { setIsShowingFilter } = (0, import_element69.useContext)(dataviews_context_default); |
| 17078 |
if (!field) { |
| 17079 |
return null; |
| 17080 |
} |
| 17081 |
isHidable = field.enableHiding !== false; |
| 17082 |
isSortable = field.enableSorting !== false; |
| 17083 |
const header = field.header; |
| 17084 |
operators = !!field.filterBy && field.filterBy?.operators || []; |
| 17085 |
canAddFilter = !view.filters?.some((_filter) => fieldId === _filter.field) && !!(field.hasElements || field.Edit) && field.filterBy !== false && !field.filterBy?.isPrimary; |
| 17086 |
if (!isSortable && !canMove && !isHidable && !canAddFilter) { |
| 17087 |
return header; |
| 17088 |
} |
| 17089 |
const hiddenFields = getHideableFields(view, fields2).filter( |
| 17090 |
(f2) => !visibleFieldIds.includes(f2.id) |
| 17091 |
); |
| 17092 |
const canInsert = (canInsertLeft || canInsertRight) && !!hiddenFields.length; |
| 17093 |
const isRtl = (0, import_i18n13.isRTL)(); |
| 17094 |
return /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(Menu3, { children: [ |
| 17095 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsxs)( |
| 17096 |
Menu3.TriggerButton, |
| 17097 |
{ |
| 17098 |
render: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17099 |
import_components6.Button, |
| 17100 |
{ |
| 17101 |
size: "compact", |
| 17102 |
className: "dataviews-view-table-header-button", |
| 17103 |
ref, |
| 17104 |
variant: "tertiary" |
| 17105 |
} |
| 17106 |
), |
| 17107 |
children: [ |
| 17108 |
header, |
| 17109 |
view.sort && isSorted && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)("span", { "aria-hidden": "true", children: sortArrows[view.sort.direction] }) |
| 17110 |
] |
| 17111 |
} |
| 17112 |
), |
| 17113 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Popover, { style: { minWidth: "240px" }, children: /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(WithMenuSeparators, { children: [ |
| 17114 |
isSortable && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Group, { children: SORTING_DIRECTIONS.map( |
| 17115 |
(direction) => { |
| 17116 |
const isChecked = view.sort && isSorted && view.sort.direction === direction; |
| 17117 |
const value = `${fieldId}-${direction}`; |
| 17118 |
return /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17119 |
Menu3.RadioItem, |
| 17120 |
{ |
| 17121 |
name: "view-table-sorting", |
| 17122 |
value, |
| 17123 |
checked: isChecked, |
| 17124 |
onChange: () => { |
| 17125 |
onChangeView({ |
| 17126 |
...view, |
| 17127 |
sort: { |
| 17128 |
field: fieldId, |
| 17129 |
direction |
| 17130 |
}, |
| 17131 |
showLevels: false |
| 17132 |
}); |
| 17133 |
}, |
| 17134 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: sortLabels[direction] }) |
| 17135 |
}, |
| 17136 |
value |
| 17137 |
); |
| 17138 |
} |
| 17139 |
) }), |
| 17140 |
canAddFilter && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Group, { children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17141 |
Menu3.Item, |
| 17142 |
{ |
| 17143 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(import_components6.Icon, { icon: funnel_default }), |
| 17144 |
onClick: () => { |
| 17145 |
setOpenedFilter(fieldId); |
| 17146 |
setIsShowingFilter(true); |
| 17147 |
onChangeView({ |
| 17148 |
...view, |
| 17149 |
page: 1, |
| 17150 |
filters: [ |
| 17151 |
...view.filters || [], |
| 17152 |
{ |
| 17153 |
field: fieldId, |
| 17154 |
value: void 0, |
| 17155 |
operator: operators[0] |
| 17156 |
} |
| 17157 |
] |
| 17158 |
}); |
| 17159 |
}, |
| 17160 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Add filter") }) |
| 17161 |
} |
| 17162 |
) }), |
| 17163 |
(canMove || isHidable || canInsert) && field && /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(Menu3.Group, { children: [ |
| 17164 |
canMove && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17165 |
Menu3.Item, |
| 17166 |
{ |
| 17167 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(import_components6.Icon, { icon: arrow_left_default }), |
| 17168 |
disabled: isRtl ? index2 >= visibleFieldIds.length - 1 : index2 < 1, |
| 17169 |
onClick: () => { |
| 17170 |
const targetIndex = isRtl ? index2 + 1 : index2 - 1; |
| 17171 |
const newFields = [ |
| 17172 |
...visibleFieldIds |
| 17173 |
]; |
| 17174 |
newFields.splice(index2, 1); |
| 17175 |
newFields.splice( |
| 17176 |
targetIndex, |
| 17177 |
0, |
| 17178 |
fieldId |
| 17179 |
); |
| 17180 |
onChangeView({ |
| 17181 |
...view, |
| 17182 |
fields: newFields |
| 17183 |
}); |
| 17184 |
}, |
| 17185 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Move left") }) |
| 17186 |
} |
| 17187 |
), |
| 17188 |
canMove && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17189 |
Menu3.Item, |
| 17190 |
{ |
| 17191 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(import_components6.Icon, { icon: arrow_right_default }), |
| 17192 |
disabled: isRtl ? index2 < 1 : index2 >= visibleFieldIds.length - 1, |
| 17193 |
onClick: () => { |
| 17194 |
const targetIndex = isRtl ? index2 - 1 : index2 + 1; |
| 17195 |
const newFields = [ |
| 17196 |
...visibleFieldIds |
| 17197 |
]; |
| 17198 |
newFields.splice(index2, 1); |
| 17199 |
newFields.splice( |
| 17200 |
targetIndex, |
| 17201 |
0, |
| 17202 |
fieldId |
| 17203 |
); |
| 17204 |
onChangeView({ |
| 17205 |
...view, |
| 17206 |
fields: newFields |
| 17207 |
}); |
| 17208 |
}, |
| 17209 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Move right") }) |
| 17210 |
} |
| 17211 |
), |
| 17212 |
canInsertLeft && !!hiddenFields.length && /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(Menu3, { children: [ |
| 17213 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.SubmenuTriggerItem, { children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Insert left") }) }), |
| 17214 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Popover, { children: hiddenFields.map((hiddenField) => { |
| 17215 |
const insertIndex = isRtl ? index2 + 1 : index2; |
| 17216 |
return /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17217 |
Menu3.Item, |
| 17218 |
{ |
| 17219 |
onClick: () => { |
| 17220 |
onChangeView({ |
| 17221 |
...view, |
| 17222 |
fields: [ |
| 17223 |
...visibleFieldIds.slice( |
| 17224 |
0, |
| 17225 |
insertIndex |
| 17226 |
), |
| 17227 |
hiddenField.id, |
| 17228 |
...visibleFieldIds.slice( |
| 17229 |
insertIndex |
| 17230 |
) |
| 17231 |
] |
| 17232 |
}); |
| 17233 |
}, |
| 17234 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: hiddenField.label }) |
| 17235 |
}, |
| 17236 |
hiddenField.id |
| 17237 |
); |
| 17238 |
}) }) |
| 17239 |
] }), |
| 17240 |
canInsertRight && !!hiddenFields.length && /* @__PURE__ */ (0, import_jsx_runtime90.jsxs)(Menu3, { children: [ |
| 17241 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.SubmenuTriggerItem, { children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Insert right") }) }), |
| 17242 |
/* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.Popover, { children: hiddenFields.map((hiddenField) => { |
| 17243 |
const insertIndex = isRtl ? index2 : index2 + 1; |
| 17244 |
return /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17245 |
Menu3.Item, |
| 17246 |
{ |
| 17247 |
onClick: () => { |
| 17248 |
onChangeView({ |
| 17249 |
...view, |
| 17250 |
fields: [ |
| 17251 |
...visibleFieldIds.slice( |
| 17252 |
0, |
| 17253 |
insertIndex |
| 17254 |
), |
| 17255 |
hiddenField.id, |
| 17256 |
...visibleFieldIds.slice( |
| 17257 |
insertIndex |
| 17258 |
) |
| 17259 |
] |
| 17260 |
}); |
| 17261 |
}, |
| 17262 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: hiddenField.label }) |
| 17263 |
}, |
| 17264 |
hiddenField.id |
| 17265 |
); |
| 17266 |
}) }) |
| 17267 |
] }), |
| 17268 |
isHidable && field && /* @__PURE__ */ (0, import_jsx_runtime90.jsx)( |
| 17269 |
Menu3.Item, |
| 17270 |
{ |
| 17271 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(import_components6.Icon, { icon: unseen_default }), |
| 17272 |
onClick: () => { |
| 17273 |
onHide(field); |
| 17274 |
onChangeView({ |
| 17275 |
...view, |
| 17276 |
fields: visibleFieldIds.filter( |
| 17277 |
(id) => id !== fieldId |
| 17278 |
) |
| 17279 |
}); |
| 17280 |
}, |
| 17281 |
children: /* @__PURE__ */ (0, import_jsx_runtime90.jsx)(Menu3.ItemLabel, { children: (0, import_i18n13.__)("Hide column") }) |
| 17282 |
} |
| 17283 |
) |
| 17284 |
] }) |
| 17285 |
] }) }) |
| 17286 |
] }); |
| 17287 |
}); |
| 17288 |
var ColumnHeaderMenu = _HeaderMenu; |
| 17289 |
var column_header_menu_default = ColumnHeaderMenu; |
| 17290 |
|
| 17291 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/item-click-wrapper.mjs |
| 17292 |
var import_element70 = __toESM(require_element(), 1); |
| 17293 |
var import_jsx_runtime91 = __toESM(require_jsx_runtime(), 1); |
| 17294 |
function getClickableItemProps({ |
| 17295 |
item, |
| 17296 |
isItemClickable: isItemClickable2, |
| 17297 |
onClickItem, |
| 17298 |
className |
| 17299 |
}) { |
| 17300 |
if (!isItemClickable2(item) || !onClickItem) { |
| 17301 |
return { className }; |
| 17302 |
} |
| 17303 |
return { |
| 17304 |
className: className ? `${className} ${className}--clickable` : void 0, |
| 17305 |
role: "button", |
| 17306 |
tabIndex: 0, |
| 17307 |
onClick: (event) => { |
| 17308 |
event.stopPropagation(); |
| 17309 |
onClickItem(item); |
| 17310 |
}, |
| 17311 |
onKeyDown: (event) => { |
| 17312 |
if (event.key === "Enter" || event.key === "" || event.key === " ") { |
| 17313 |
event.stopPropagation(); |
| 17314 |
onClickItem(item); |
| 17315 |
} |
| 17316 |
} |
| 17317 |
}; |
| 17318 |
} |
| 17319 |
function ItemClickWrapper({ |
| 17320 |
item, |
| 17321 |
isItemClickable: isItemClickable2, |
| 17322 |
onClickItem, |
| 17323 |
renderItemLink, |
| 17324 |
className, |
| 17325 |
children, |
| 17326 |
...extraProps |
| 17327 |
}) { |
| 17328 |
if (!isItemClickable2(item)) { |
| 17329 |
return /* @__PURE__ */ (0, import_jsx_runtime91.jsx)("div", { className, ...extraProps, children }); |
| 17330 |
} |
| 17331 |
if (renderItemLink) { |
| 17332 |
const renderedElement = renderItemLink({ |
| 17333 |
item, |
| 17334 |
className: `${className} ${className}--clickable`, |
| 17335 |
...extraProps, |
| 17336 |
children |
| 17337 |
}); |
| 17338 |
return (0, import_element70.cloneElement)(renderedElement, { |
| 17339 |
onClick: (event) => { |
| 17340 |
event.stopPropagation(); |
| 17341 |
if (renderedElement.props.onClick) { |
| 17342 |
renderedElement.props.onClick(event); |
| 17343 |
} |
| 17344 |
}, |
| 17345 |
onKeyDown: (event) => { |
| 17346 |
if (event.key === "Enter" || event.key === "" || event.key === " ") { |
| 17347 |
event.stopPropagation(); |
| 17348 |
if (renderedElement.props.onKeyDown) { |
| 17349 |
renderedElement.props.onKeyDown(event); |
| 17350 |
} |
| 17351 |
} |
| 17352 |
} |
| 17353 |
}); |
| 17354 |
} |
| 17355 |
const clickProps = getClickableItemProps({ |
| 17356 |
item, |
| 17357 |
isItemClickable: isItemClickable2, |
| 17358 |
onClickItem, |
| 17359 |
className |
| 17360 |
}); |
| 17361 |
return /* @__PURE__ */ (0, import_jsx_runtime91.jsx)("div", { ...clickProps, ...extraProps, children }); |
| 17362 |
} |
| 17363 |
|
| 17364 |
// packages/dataviews/build-module/components/dataviews-layouts/table/column-primary.mjs |
| 17365 |
var import_jsx_runtime92 = __toESM(require_jsx_runtime(), 1); |
| 17366 |
function ColumnPrimary({ |
| 17367 |
item, |
| 17368 |
level, |
| 17369 |
titleField, |
| 17370 |
mediaField, |
| 17371 |
descriptionField, |
| 17372 |
onClickItem, |
| 17373 |
renderItemLink, |
| 17374 |
isItemClickable: isItemClickable2 |
| 17375 |
}) { |
| 17376 |
return /* @__PURE__ */ (0, import_jsx_runtime92.jsxs)(Stack, { direction: "row", gap: "md", align: "flex-start", justify: "flex-start", children: [ |
| 17377 |
mediaField && /* @__PURE__ */ (0, import_jsx_runtime92.jsx)( |
| 17378 |
ItemClickWrapper, |
| 17379 |
{ |
| 17380 |
item, |
| 17381 |
isItemClickable: isItemClickable2, |
| 17382 |
onClickItem, |
| 17383 |
renderItemLink, |
| 17384 |
className: "dataviews-view-table__cell-content-wrapper dataviews-column-primary__media", |
| 17385 |
"aria-label": isItemClickable2(item) && (!!onClickItem || !!renderItemLink) && !!titleField ? titleField.getValue?.({ item }) : void 0, |
| 17386 |
children: /* @__PURE__ */ (0, import_jsx_runtime92.jsx)( |
| 17387 |
mediaField.render, |
| 17388 |
{ |
| 17389 |
item, |
| 17390 |
field: mediaField, |
| 17391 |
config: { sizes: "32px" } |
| 17392 |
} |
| 17393 |
) |
| 17394 |
} |
| 17395 |
), |
| 17396 |
/* @__PURE__ */ (0, import_jsx_runtime92.jsxs)( |
| 17397 |
Stack, |
| 17398 |
{ |
| 17399 |
direction: "column", |
| 17400 |
align: "flex-start", |
| 17401 |
className: "dataviews-view-table__primary-column-content", |
| 17402 |
children: [ |
| 17403 |
titleField && /* @__PURE__ */ (0, import_jsx_runtime92.jsxs)( |
| 17404 |
ItemClickWrapper, |
| 17405 |
{ |
| 17406 |
item, |
| 17407 |
isItemClickable: isItemClickable2, |
| 17408 |
onClickItem, |
| 17409 |
renderItemLink, |
| 17410 |
className: "dataviews-view-table__cell-content-wrapper dataviews-title-field", |
| 17411 |
children: [ |
| 17412 |
level !== void 0 && level > 0 && /* @__PURE__ */ (0, import_jsx_runtime92.jsxs)("span", { className: "dataviews-view-table__level", children: [ |
| 17413 |
Array(level).fill("\u2014").join(" "), |
| 17414 |
"\xA0" |
| 17415 |
] }), |
| 17416 |
/* @__PURE__ */ (0, import_jsx_runtime92.jsx)(titleField.render, { item, field: titleField }) |
| 17417 |
] |
| 17418 |
} |
| 17419 |
), |
| 17420 |
descriptionField && /* @__PURE__ */ (0, import_jsx_runtime92.jsx)( |
| 17421 |
descriptionField.render, |
| 17422 |
{ |
| 17423 |
item, |
| 17424 |
field: descriptionField |
| 17425 |
} |
| 17426 |
) |
| 17427 |
] |
| 17428 |
} |
| 17429 |
) |
| 17430 |
] }); |
| 17431 |
} |
| 17432 |
var column_primary_default = ColumnPrimary; |
| 17433 |
|
| 17434 |
// packages/dataviews/build-module/components/dataviews-layouts/table/use-scroll-state.mjs |
| 17435 |
var import_element71 = __toESM(require_element(), 1); |
| 17436 |
var import_i18n14 = __toESM(require_i18n(), 1); |
| 17437 |
var isScrolledToEnd = (element) => { |
| 17438 |
if ((0, import_i18n14.isRTL)()) { |
| 17439 |
const scrollLeft = Math.abs(element.scrollLeft); |
| 17440 |
return scrollLeft <= 1; |
| 17441 |
} |
| 17442 |
return element.scrollLeft + element.clientWidth >= element.scrollWidth - 1; |
| 17443 |
}; |
| 17444 |
function useScrollState({ |
| 17445 |
scrollContainerRef, |
| 17446 |
enabledHorizontal = false |
| 17447 |
}) { |
| 17448 |
const [isHorizontalScrollEnd, setIsHorizontalScrollEnd] = (0, import_element71.useState)(false); |
| 17449 |
const [isVerticallyScrolled, setIsVerticallyScrolled] = (0, import_element71.useState)(false); |
| 17450 |
const handleScroll = (0, import_element71.useCallback)(() => { |
| 17451 |
const scrollContainer = scrollContainerRef.current; |
| 17452 |
if (!scrollContainer) { |
| 17453 |
return; |
| 17454 |
} |
| 17455 |
if (enabledHorizontal) { |
| 17456 |
setIsHorizontalScrollEnd(isScrolledToEnd(scrollContainer)); |
| 17457 |
} |
| 17458 |
setIsVerticallyScrolled(scrollContainer.scrollTop > 0); |
| 17459 |
}, [scrollContainerRef, enabledHorizontal]); |
| 17460 |
(0, import_element71.useEffect)(() => { |
| 17461 |
if (typeof window === "undefined" || !scrollContainerRef.current) { |
| 17462 |
return () => { |
| 17463 |
}; |
| 17464 |
} |
| 17465 |
const scrollContainer = scrollContainerRef.current; |
| 17466 |
handleScroll(); |
| 17467 |
scrollContainer.addEventListener("scroll", handleScroll); |
| 17468 |
window.addEventListener("resize", handleScroll); |
| 17469 |
return () => { |
| 17470 |
scrollContainer.removeEventListener("scroll", handleScroll); |
| 17471 |
window.removeEventListener("resize", handleScroll); |
| 17472 |
}; |
| 17473 |
}, [scrollContainerRef, enabledHorizontal, handleScroll]); |
| 17474 |
return { isHorizontalScrollEnd, isVerticallyScrolled }; |
| 17475 |
} |
| 17476 |
|
| 17477 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/get-data-by-group.mjs |
| 17478 |
function getDataByGroup(data, groupByField) { |
| 17479 |
return data.reduce((groups, item) => { |
| 17480 |
const groupName = groupByField.getValue({ item }); |
| 17481 |
if (!groups.has(groupName)) { |
| 17482 |
groups.set(groupName, []); |
| 17483 |
} |
| 17484 |
groups.get(groupName)?.push(item); |
| 17485 |
return groups; |
| 17486 |
}, /* @__PURE__ */ new Map()); |
| 17487 |
} |
| 17488 |
|
| 17489 |
// packages/dataviews/build-module/components/dataviews-view-config/properties-section.mjs |
| 17490 |
var import_components7 = __toESM(require_components(), 1); |
| 17491 |
var import_i18n15 = __toESM(require_i18n(), 1); |
| 17492 |
var import_element72 = __toESM(require_element(), 1); |
| 17493 |
var import_jsx_runtime93 = __toESM(require_jsx_runtime(), 1); |
| 17494 |
function FieldItem({ |
| 17495 |
field, |
| 17496 |
isVisible: isVisible2, |
| 17497 |
onToggleVisibility |
| 17498 |
}) { |
| 17499 |
return /* @__PURE__ */ (0, import_jsx_runtime93.jsx)(import_components7.__experimentalItem, { onClick: field.enableHiding ? onToggleVisibility : void 0, children: /* @__PURE__ */ (0, import_jsx_runtime93.jsxs)(Stack, { direction: "row", gap: "sm", justify: "flex-start", align: "center", children: [ |
| 17500 |
/* @__PURE__ */ (0, import_jsx_runtime93.jsx)("div", { style: { height: 24, width: 24 }, children: isVisible2 && /* @__PURE__ */ (0, import_jsx_runtime93.jsx)(import_components7.Icon, { icon: check_default }) }), |
| 17501 |
/* @__PURE__ */ (0, import_jsx_runtime93.jsx)("span", { className: "dataviews-view-config__label", children: field.label }) |
| 17502 |
] }) }); |
| 17503 |
} |
| 17504 |
function isDefined(item) { |
| 17505 |
return !!item; |
| 17506 |
} |
| 17507 |
function PropertiesSection({ |
| 17508 |
showLabel = true |
| 17509 |
}) { |
| 17510 |
const { view, fields: fields2, onChangeView } = (0, import_element72.useContext)(dataviews_context_default); |
| 17511 |
const regularFields = getHideableFields(view, fields2); |
| 17512 |
if (!regularFields?.length) { |
| 17513 |
return null; |
| 17514 |
} |
| 17515 |
const titleField = fields2.find((f2) => f2.id === view.titleField); |
| 17516 |
const previewField = fields2.find((f2) => f2.id === view.mediaField); |
| 17517 |
const descriptionField = fields2.find( |
| 17518 |
(f2) => f2.id === view.descriptionField |
| 17519 |
); |
| 17520 |
const lockedFields = [ |
| 17521 |
{ |
| 17522 |
field: titleField, |
| 17523 |
isVisibleFlag: "showTitle" |
| 17524 |
}, |
| 17525 |
{ |
| 17526 |
field: previewField, |
| 17527 |
isVisibleFlag: "showMedia" |
| 17528 |
}, |
| 17529 |
{ |
| 17530 |
field: descriptionField, |
| 17531 |
isVisibleFlag: "showDescription" |
| 17532 |
} |
| 17533 |
].filter(({ field }) => isDefined(field)); |
| 17534 |
const visibleFieldIds = view.fields ?? []; |
| 17535 |
const visibleRegularFieldsCount = regularFields.filter( |
| 17536 |
(f2) => visibleFieldIds.includes(f2.id) |
| 17537 |
).length; |
| 17538 |
const visibleLockedFields = lockedFields.filter( |
| 17539 |
({ isVisibleFlag }) => ( |
| 17540 |
// @ts-expect-error |
| 17541 |
view[isVisibleFlag] ?? true |
| 17542 |
) |
| 17543 |
); |
| 17544 |
const totalVisibleFields = visibleLockedFields.length + visibleRegularFieldsCount; |
| 17545 |
const isSingleVisibleLockedField = totalVisibleFields === 1 && visibleLockedFields.length === 1; |
| 17546 |
return /* @__PURE__ */ (0, import_jsx_runtime93.jsxs)(Stack, { direction: "column", className: "dataviews-field-control", children: [ |
| 17547 |
showLabel && /* @__PURE__ */ (0, import_jsx_runtime93.jsx)(import_components7.BaseControl.VisualLabel, { children: (0, import_i18n15.__)("Properties") }), |
| 17548 |
/* @__PURE__ */ (0, import_jsx_runtime93.jsx)( |
| 17549 |
Stack, |
| 17550 |
{ |
| 17551 |
direction: "column", |
| 17552 |
className: "dataviews-view-config__properties", |
| 17553 |
children: /* @__PURE__ */ (0, import_jsx_runtime93.jsxs)(import_components7.__experimentalItemGroup, { isBordered: true, isSeparated: true, size: "medium", children: [ |
| 17554 |
lockedFields.map(({ field, isVisibleFlag }) => { |
| 17555 |
const isVisible2 = view[isVisibleFlag] ?? true; |
| 17556 |
const fieldToRender = isSingleVisibleLockedField && isVisible2 ? { ...field, enableHiding: false } : field; |
| 17557 |
return /* @__PURE__ */ (0, import_jsx_runtime93.jsx)( |
| 17558 |
FieldItem, |
| 17559 |
{ |
| 17560 |
field: fieldToRender, |
| 17561 |
isVisible: isVisible2, |
| 17562 |
onToggleVisibility: () => { |
| 17563 |
onChangeView({ |
| 17564 |
...view, |
| 17565 |
[isVisibleFlag]: !isVisible2 |
| 17566 |
}); |
| 17567 |
} |
| 17568 |
}, |
| 17569 |
field.id |
| 17570 |
); |
| 17571 |
}), |
| 17572 |
regularFields.map((field) => { |
| 17573 |
const isVisible2 = visibleFieldIds.includes(field.id); |
| 17574 |
const fieldToRender = totalVisibleFields === 1 && isVisible2 ? { ...field, enableHiding: false } : field; |
| 17575 |
return /* @__PURE__ */ (0, import_jsx_runtime93.jsx)( |
| 17576 |
FieldItem, |
| 17577 |
{ |
| 17578 |
field: fieldToRender, |
| 17579 |
isVisible: isVisible2, |
| 17580 |
onToggleVisibility: () => { |
| 17581 |
onChangeView({ |
| 17582 |
...view, |
| 17583 |
fields: isVisible2 ? visibleFieldIds.filter( |
| 17584 |
(fieldId) => fieldId !== field.id |
| 17585 |
) : [...visibleFieldIds, field.id] |
| 17586 |
}); |
| 17587 |
} |
| 17588 |
}, |
| 17589 |
field.id |
| 17590 |
); |
| 17591 |
}) |
| 17592 |
] }) |
| 17593 |
} |
| 17594 |
) |
| 17595 |
] }); |
| 17596 |
} |
| 17597 |
|
| 17598 |
// packages/dataviews/build-module/hooks/use-delayed-loading.mjs |
| 17599 |
var import_element73 = __toESM(require_element(), 1); |
| 17600 |
function useDelayedLoading(isLoading, options = { delay: 400 }) { |
| 17601 |
const [showLoader, setShowLoader] = (0, import_element73.useState)(false); |
| 17602 |
(0, import_element73.useEffect)(() => { |
| 17603 |
if (!isLoading) { |
| 17604 |
return; |
| 17605 |
} |
| 17606 |
const timeout = setTimeout(() => { |
| 17607 |
setShowLoader(true); |
| 17608 |
}, options.delay); |
| 17609 |
return () => { |
| 17610 |
clearTimeout(timeout); |
| 17611 |
setShowLoader(false); |
| 17612 |
}; |
| 17613 |
}, [isLoading, options.delay]); |
| 17614 |
return showLoader; |
| 17615 |
} |
| 17616 |
|
| 17617 |
// packages/dataviews/build-module/components/dataviews-layouts/table/index.mjs |
| 17618 |
var import_jsx_runtime94 = __toESM(require_jsx_runtime(), 1); |
| 17619 |
function getEffectiveAlign(explicitAlign, fieldType) { |
| 17620 |
if (explicitAlign) { |
| 17621 |
return explicitAlign; |
| 17622 |
} |
| 17623 |
if (fieldType === "integer" || fieldType === "number") { |
| 17624 |
return "end"; |
| 17625 |
} |
| 17626 |
return void 0; |
| 17627 |
} |
| 17628 |
function TableColumnField({ |
| 17629 |
item, |
| 17630 |
fields: fields2, |
| 17631 |
column, |
| 17632 |
align |
| 17633 |
}) { |
| 17634 |
const field = fields2.find((f2) => f2.id === column); |
| 17635 |
if (!field) { |
| 17636 |
return null; |
| 17637 |
} |
| 17638 |
const className = clsx_default("dataviews-view-table__cell-content-wrapper", { |
| 17639 |
"dataviews-view-table__cell-align-end": align === "end", |
| 17640 |
"dataviews-view-table__cell-align-center": align === "center" |
| 17641 |
}); |
| 17642 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("div", { className, children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)(field.render, { item, field }) }); |
| 17643 |
} |
| 17644 |
function TableRow({ |
| 17645 |
hasBulkActions, |
| 17646 |
item, |
| 17647 |
level, |
| 17648 |
actions, |
| 17649 |
fields: fields2, |
| 17650 |
id, |
| 17651 |
view, |
| 17652 |
titleField, |
| 17653 |
mediaField, |
| 17654 |
descriptionField, |
| 17655 |
selection, |
| 17656 |
getItemId: getItemId2, |
| 17657 |
isItemClickable: isItemClickable2, |
| 17658 |
onClickItem, |
| 17659 |
renderItemLink, |
| 17660 |
onChangeSelection, |
| 17661 |
isActionsColumnSticky, |
| 17662 |
posinset |
| 17663 |
}) { |
| 17664 |
const { paginationInfo } = (0, import_element74.useContext)(dataviews_context_default); |
| 17665 |
const hasPossibleBulkAction = useHasAPossibleBulkAction(actions, item); |
| 17666 |
const isSelected2 = hasPossibleBulkAction && selection.includes(id); |
| 17667 |
const { |
| 17668 |
showTitle = true, |
| 17669 |
showMedia = true, |
| 17670 |
showDescription = true, |
| 17671 |
infiniteScrollEnabled |
| 17672 |
} = view; |
| 17673 |
const isTouchDeviceRef = (0, import_element74.useRef)(false); |
| 17674 |
const columns = view.fields ?? []; |
| 17675 |
const hasPrimaryColumn = titleField && showTitle || mediaField && showMedia || descriptionField && showDescription; |
| 17676 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsxs)( |
| 17677 |
"tr", |
| 17678 |
{ |
| 17679 |
className: clsx_default("dataviews-view-table__row", { |
| 17680 |
"is-selected": hasPossibleBulkAction && isSelected2, |
| 17681 |
"has-bulk-actions": hasPossibleBulkAction |
| 17682 |
}), |
| 17683 |
onTouchStart: () => { |
| 17684 |
isTouchDeviceRef.current = true; |
| 17685 |
}, |
| 17686 |
"aria-setsize": infiniteScrollEnabled ? paginationInfo.totalItems : void 0, |
| 17687 |
"aria-posinset": posinset, |
| 17688 |
role: infiniteScrollEnabled ? "article" : void 0, |
| 17689 |
onMouseDown: (event) => { |
| 17690 |
const isMetaClick = (0, import_keycodes.isAppleOS)() ? event.metaKey : event.ctrlKey; |
| 17691 |
if (event.button === 0 && isMetaClick && window.navigator.userAgent.toLowerCase().includes("firefox")) { |
| 17692 |
event?.preventDefault(); |
| 17693 |
} |
| 17694 |
}, |
| 17695 |
onClick: (event) => { |
| 17696 |
if (!hasPossibleBulkAction) { |
| 17697 |
return; |
| 17698 |
} |
| 17699 |
const isModifierKeyPressed = (0, import_keycodes.isAppleOS)() ? event.metaKey : event.ctrlKey; |
| 17700 |
if (isModifierKeyPressed && !isTouchDeviceRef.current && document.getSelection()?.type !== "Range") { |
| 17701 |
onChangeSelection( |
| 17702 |
selection.includes(id) ? selection.filter((itemId) => id !== itemId) : [...selection, id] |
| 17703 |
); |
| 17704 |
} |
| 17705 |
}, |
| 17706 |
children: [ |
| 17707 |
hasBulkActions && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("td", { className: "dataviews-view-table__checkbox-column", children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("div", { className: "dataviews-view-table__cell-content-wrapper", children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17708 |
DataViewsSelectionCheckbox, |
| 17709 |
{ |
| 17710 |
item, |
| 17711 |
selection, |
| 17712 |
onChangeSelection, |
| 17713 |
getItemId: getItemId2, |
| 17714 |
titleField, |
| 17715 |
disabled: !hasPossibleBulkAction |
| 17716 |
} |
| 17717 |
) }) }), |
| 17718 |
hasPrimaryColumn && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("td", { children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17719 |
column_primary_default, |
| 17720 |
{ |
| 17721 |
item, |
| 17722 |
level, |
| 17723 |
titleField: showTitle ? titleField : void 0, |
| 17724 |
mediaField: showMedia ? mediaField : void 0, |
| 17725 |
descriptionField: showDescription ? descriptionField : void 0, |
| 17726 |
isItemClickable: isItemClickable2, |
| 17727 |
onClickItem, |
| 17728 |
renderItemLink |
| 17729 |
} |
| 17730 |
) }), |
| 17731 |
columns.map((column) => { |
| 17732 |
const { width, maxWidth, minWidth, align } = view.layout?.styles?.[column] ?? {}; |
| 17733 |
const field = fields2.find((f2) => f2.id === column); |
| 17734 |
const effectiveAlign = getEffectiveAlign(align, field?.type); |
| 17735 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17736 |
"td", |
| 17737 |
{ |
| 17738 |
style: { |
| 17739 |
width, |
| 17740 |
maxWidth, |
| 17741 |
minWidth |
| 17742 |
}, |
| 17743 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17744 |
TableColumnField, |
| 17745 |
{ |
| 17746 |
fields: fields2, |
| 17747 |
item, |
| 17748 |
column, |
| 17749 |
align: effectiveAlign |
| 17750 |
} |
| 17751 |
) |
| 17752 |
}, |
| 17753 |
column |
| 17754 |
); |
| 17755 |
}), |
| 17756 |
!!actions?.length && // Disable reason: we are not making the element interactive, |
| 17757 |
// but preventing any click events from bubbling up to the |
| 17758 |
// table row. This allows us to add a click handler to the row |
| 17759 |
// itself (to toggle row selection) without erroneously |
| 17760 |
// intercepting click events from ItemActions. |
| 17761 |
/* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17762 |
"td", |
| 17763 |
{ |
| 17764 |
className: clsx_default("dataviews-view-table__actions-column", { |
| 17765 |
"dataviews-view-table__actions-column--sticky": true, |
| 17766 |
"dataviews-view-table__actions-column--stuck": isActionsColumnSticky |
| 17767 |
}), |
| 17768 |
onClick: (e2) => e2.stopPropagation(), |
| 17769 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)(ItemActions, { item, actions }) |
| 17770 |
} |
| 17771 |
) |
| 17772 |
] |
| 17773 |
} |
| 17774 |
); |
| 17775 |
} |
| 17776 |
function ViewTable({ |
| 17777 |
actions, |
| 17778 |
data, |
| 17779 |
fields: fields2, |
| 17780 |
getItemId: getItemId2, |
| 17781 |
getItemLevel, |
| 17782 |
isLoading = false, |
| 17783 |
onChangeView, |
| 17784 |
onChangeSelection, |
| 17785 |
selection, |
| 17786 |
setOpenedFilter, |
| 17787 |
onClickItem, |
| 17788 |
isItemClickable: isItemClickable2, |
| 17789 |
renderItemLink, |
| 17790 |
view, |
| 17791 |
className, |
| 17792 |
empty |
| 17793 |
}) { |
| 17794 |
const { containerRef } = (0, import_element74.useContext)(dataviews_context_default); |
| 17795 |
const isDelayedLoading = useDelayedLoading(isLoading); |
| 17796 |
const headerMenuRefs = (0, import_element74.useRef)(/* @__PURE__ */ new Map()); |
| 17797 |
const headerMenuToFocusRef = (0, import_element74.useRef)(void 0); |
| 17798 |
const [nextHeaderMenuToFocus, setNextHeaderMenuToFocus] = (0, import_element74.useState)(); |
| 17799 |
const [contextMenuAnchor, setContextMenuAnchor] = (0, import_element74.useState)(null); |
| 17800 |
(0, import_element74.useEffect)(() => { |
| 17801 |
if (headerMenuToFocusRef.current) { |
| 17802 |
headerMenuToFocusRef.current.focus(); |
| 17803 |
headerMenuToFocusRef.current = void 0; |
| 17804 |
} |
| 17805 |
}); |
| 17806 |
const tableNoticeId = (0, import_element74.useId)(); |
| 17807 |
const { isHorizontalScrollEnd, isVerticallyScrolled } = useScrollState({ |
| 17808 |
scrollContainerRef: containerRef, |
| 17809 |
enabledHorizontal: !!actions?.length |
| 17810 |
}); |
| 17811 |
const hasBulkActions = useSomeItemHasAPossibleBulkAction(actions, data); |
| 17812 |
if (nextHeaderMenuToFocus) { |
| 17813 |
headerMenuToFocusRef.current = nextHeaderMenuToFocus; |
| 17814 |
setNextHeaderMenuToFocus(void 0); |
| 17815 |
return; |
| 17816 |
} |
| 17817 |
const onHide = (field) => { |
| 17818 |
const hidden = headerMenuRefs.current.get(field.id); |
| 17819 |
const fallback = hidden ? headerMenuRefs.current.get(hidden.fallback) : void 0; |
| 17820 |
setNextHeaderMenuToFocus(fallback?.node); |
| 17821 |
}; |
| 17822 |
const handleHeaderContextMenu = (event) => { |
| 17823 |
event.preventDefault(); |
| 17824 |
event.stopPropagation(); |
| 17825 |
const virtualAnchor = { |
| 17826 |
getBoundingClientRect: () => ({ |
| 17827 |
x: event.clientX, |
| 17828 |
y: event.clientY, |
| 17829 |
top: event.clientY, |
| 17830 |
left: event.clientX, |
| 17831 |
right: event.clientX, |
| 17832 |
bottom: event.clientY, |
| 17833 |
width: 0, |
| 17834 |
height: 0, |
| 17835 |
toJSON: () => ({}) |
| 17836 |
}) |
| 17837 |
}; |
| 17838 |
window.requestAnimationFrame(() => { |
| 17839 |
setContextMenuAnchor(virtualAnchor); |
| 17840 |
}); |
| 17841 |
}; |
| 17842 |
const hasData = !!data?.length; |
| 17843 |
const titleField = fields2.find((field) => field.id === view.titleField); |
| 17844 |
const mediaField = fields2.find((field) => field.id === view.mediaField); |
| 17845 |
const descriptionField = fields2.find( |
| 17846 |
(field) => field.id === view.descriptionField |
| 17847 |
); |
| 17848 |
const groupField = view.groupBy?.field ? fields2.find((f2) => f2.id === view.groupBy?.field) : null; |
| 17849 |
const dataByGroup = groupField ? getDataByGroup(data, groupField) : null; |
| 17850 |
const { showTitle = true, showMedia = true, showDescription = true } = view; |
| 17851 |
const hasPrimaryColumn = titleField && showTitle || mediaField && showMedia || descriptionField && showDescription; |
| 17852 |
const columns = view.fields ?? []; |
| 17853 |
const headerMenuRef = (column, index2) => (node) => { |
| 17854 |
if (node) { |
| 17855 |
headerMenuRefs.current.set(column, { |
| 17856 |
node, |
| 17857 |
fallback: columns[index2 > 0 ? index2 - 1 : 1] |
| 17858 |
}); |
| 17859 |
} else { |
| 17860 |
headerMenuRefs.current.delete(column); |
| 17861 |
} |
| 17862 |
}; |
| 17863 |
const isInfiniteScroll = view.infiniteScrollEnabled && !dataByGroup; |
| 17864 |
const isRtl = (0, import_i18n16.isRTL)(); |
| 17865 |
if (!hasData) { |
| 17866 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17867 |
"div", |
| 17868 |
{ |
| 17869 |
className: clsx_default("dataviews-no-results", { |
| 17870 |
"is-refreshing": isDelayedLoading |
| 17871 |
}), |
| 17872 |
id: tableNoticeId, |
| 17873 |
children: empty |
| 17874 |
} |
| 17875 |
); |
| 17876 |
} |
| 17877 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsxs)(import_jsx_runtime94.Fragment, { children: [ |
| 17878 |
/* @__PURE__ */ (0, import_jsx_runtime94.jsxs)( |
| 17879 |
"table", |
| 17880 |
{ |
| 17881 |
className: clsx_default("dataviews-view-table", className, { |
| 17882 |
[`has-${view.layout?.density}-density`]: view.layout?.density && ["compact", "comfortable"].includes( |
| 17883 |
view.layout.density |
| 17884 |
), |
| 17885 |
"has-bulk-actions": hasBulkActions, |
| 17886 |
"is-refreshing": !isInfiniteScroll && isDelayedLoading |
| 17887 |
}), |
| 17888 |
"aria-busy": isLoading, |
| 17889 |
"aria-describedby": tableNoticeId, |
| 17890 |
role: isInfiniteScroll ? "feed" : void 0, |
| 17891 |
inert: !isInfiniteScroll && isLoading ? "true" : void 0, |
| 17892 |
children: [ |
| 17893 |
/* @__PURE__ */ (0, import_jsx_runtime94.jsxs)("colgroup", { children: [ |
| 17894 |
hasBulkActions && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("col", { className: "dataviews-view-table__col-checkbox" }), |
| 17895 |
hasPrimaryColumn && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("col", { className: "dataviews-view-table__col-first-data" }), |
| 17896 |
columns.map((column, index2) => /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17897 |
"col", |
| 17898 |
{ |
| 17899 |
className: clsx_default( |
| 17900 |
`dataviews-view-table__col-${column}`, |
| 17901 |
{ |
| 17902 |
"dataviews-view-table__col-expand": !hasPrimaryColumn && index2 === columns.length - 1 |
| 17903 |
} |
| 17904 |
) |
| 17905 |
}, |
| 17906 |
`col-${column}` |
| 17907 |
)), |
| 17908 |
!!actions?.length && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("col", { className: "dataviews-view-table__col-actions" }) |
| 17909 |
] }), |
| 17910 |
contextMenuAnchor && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17911 |
import_components8.Popover, |
| 17912 |
{ |
| 17913 |
anchor: contextMenuAnchor, |
| 17914 |
onClose: () => setContextMenuAnchor(null), |
| 17915 |
placement: "bottom-start", |
| 17916 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)(PropertiesSection, { showLabel: false }) |
| 17917 |
} |
| 17918 |
), |
| 17919 |
/* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17920 |
"thead", |
| 17921 |
{ |
| 17922 |
className: clsx_default({ |
| 17923 |
"dataviews-view-table__thead--stuck": isVerticallyScrolled |
| 17924 |
}), |
| 17925 |
onContextMenu: handleHeaderContextMenu, |
| 17926 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsxs)("tr", { className: "dataviews-view-table__row", children: [ |
| 17927 |
hasBulkActions && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17928 |
"th", |
| 17929 |
{ |
| 17930 |
className: "dataviews-view-table__checkbox-column", |
| 17931 |
scope: "col", |
| 17932 |
onContextMenu: handleHeaderContextMenu, |
| 17933 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17934 |
BulkSelectionCheckbox, |
| 17935 |
{ |
| 17936 |
selection, |
| 17937 |
onChangeSelection, |
| 17938 |
data, |
| 17939 |
actions, |
| 17940 |
getItemId: getItemId2 |
| 17941 |
} |
| 17942 |
) |
| 17943 |
} |
| 17944 |
), |
| 17945 |
hasPrimaryColumn && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("th", { scope: "col", children: titleField && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17946 |
column_header_menu_default, |
| 17947 |
{ |
| 17948 |
ref: headerMenuRef( |
| 17949 |
titleField.id, |
| 17950 |
0 |
| 17951 |
), |
| 17952 |
fieldId: titleField.id, |
| 17953 |
view, |
| 17954 |
fields: fields2, |
| 17955 |
onChangeView, |
| 17956 |
onHide, |
| 17957 |
setOpenedFilter, |
| 17958 |
canMove: false, |
| 17959 |
canInsertLeft: isRtl ? view.layout?.enableMoving ?? true : false, |
| 17960 |
canInsertRight: isRtl ? false : view.layout?.enableMoving ?? true |
| 17961 |
} |
| 17962 |
) }), |
| 17963 |
columns.map((column, index2) => { |
| 17964 |
const { width, maxWidth, minWidth, align } = view.layout?.styles?.[column] ?? {}; |
| 17965 |
const field = fields2.find( |
| 17966 |
(f2) => f2.id === column |
| 17967 |
); |
| 17968 |
const effectiveAlign = getEffectiveAlign( |
| 17969 |
align, |
| 17970 |
field?.type |
| 17971 |
); |
| 17972 |
const canInsertOrMove = view.layout?.enableMoving ?? true; |
| 17973 |
return /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17974 |
"th", |
| 17975 |
{ |
| 17976 |
style: { |
| 17977 |
width, |
| 17978 |
maxWidth, |
| 17979 |
minWidth, |
| 17980 |
textAlign: effectiveAlign |
| 17981 |
}, |
| 17982 |
"aria-sort": view.sort?.direction && view.sort?.field === column ? sortValues[view.sort.direction] : void 0, |
| 17983 |
scope: "col", |
| 17984 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 17985 |
column_header_menu_default, |
| 17986 |
{ |
| 17987 |
ref: headerMenuRef(column, index2), |
| 17988 |
fieldId: column, |
| 17989 |
view, |
| 17990 |
fields: fields2, |
| 17991 |
onChangeView, |
| 17992 |
onHide, |
| 17993 |
setOpenedFilter, |
| 17994 |
canMove: canInsertOrMove, |
| 17995 |
canInsertLeft: canInsertOrMove, |
| 17996 |
canInsertRight: canInsertOrMove |
| 17997 |
} |
| 17998 |
) |
| 17999 |
}, |
| 18000 |
column |
| 18001 |
); |
| 18002 |
}), |
| 18003 |
!!actions?.length && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 18004 |
"th", |
| 18005 |
{ |
| 18006 |
className: clsx_default( |
| 18007 |
"dataviews-view-table__actions-column", |
| 18008 |
{ |
| 18009 |
"dataviews-view-table__actions-column--sticky": true, |
| 18010 |
"dataviews-view-table__actions-column--stuck": !isHorizontalScrollEnd |
| 18011 |
} |
| 18012 |
), |
| 18013 |
children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("span", { className: "dataviews-view-table-header", children: (0, import_i18n16.__)("Actions") }) |
| 18014 |
} |
| 18015 |
) |
| 18016 |
] }) |
| 18017 |
} |
| 18018 |
), |
| 18019 |
hasData && groupField && dataByGroup ? Array.from(dataByGroup.entries()).map( |
| 18020 |
([groupName, groupItems]) => /* @__PURE__ */ (0, import_jsx_runtime94.jsxs)("tbody", { children: [ |
| 18021 |
/* @__PURE__ */ (0, import_jsx_runtime94.jsx)("tr", { className: "dataviews-view-table__group-header-row", children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 18022 |
"td", |
| 18023 |
{ |
| 18024 |
colSpan: columns.length + (hasPrimaryColumn ? 1 : 0) + (hasBulkActions ? 1 : 0) + (actions?.length ? 1 : 0), |
| 18025 |
className: "dataviews-view-table__group-header-cell", |
| 18026 |
children: view.groupBy?.showLabel === false ? groupName : (0, import_i18n16.sprintf)( |
| 18027 |
// translators: 1: The label of the field e.g. "Date". 2: The value of the field, e.g.: "May 2022". |
| 18028 |
(0, import_i18n16.__)("%1$s: %2$s"), |
| 18029 |
groupField.label, |
| 18030 |
groupName |
| 18031 |
) |
| 18032 |
} |
| 18033 |
) }), |
| 18034 |
groupItems.map((item, index2) => /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 18035 |
TableRow, |
| 18036 |
{ |
| 18037 |
item, |
| 18038 |
level: view.showLevels && typeof getItemLevel === "function" ? getItemLevel(item) : void 0, |
| 18039 |
hasBulkActions, |
| 18040 |
actions, |
| 18041 |
fields: fields2, |
| 18042 |
id: getItemId2(item) || index2.toString(), |
| 18043 |
view, |
| 18044 |
titleField, |
| 18045 |
mediaField, |
| 18046 |
descriptionField, |
| 18047 |
selection, |
| 18048 |
getItemId: getItemId2, |
| 18049 |
onChangeSelection, |
| 18050 |
onClickItem, |
| 18051 |
renderItemLink, |
| 18052 |
isItemClickable: isItemClickable2, |
| 18053 |
isActionsColumnSticky: !isHorizontalScrollEnd |
| 18054 |
}, |
| 18055 |
getItemId2(item) |
| 18056 |
)) |
| 18057 |
] }, `group-${groupName}`) |
| 18058 |
) : /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("tbody", { children: hasData && data.map((item, index2) => /* @__PURE__ */ (0, import_jsx_runtime94.jsx)( |
| 18059 |
TableRow, |
| 18060 |
{ |
| 18061 |
item, |
| 18062 |
level: view.showLevels && typeof getItemLevel === "function" ? getItemLevel(item) : void 0, |
| 18063 |
hasBulkActions, |
| 18064 |
actions, |
| 18065 |
fields: fields2, |
| 18066 |
id: getItemId2(item) || index2.toString(), |
| 18067 |
view, |
| 18068 |
titleField, |
| 18069 |
mediaField, |
| 18070 |
descriptionField, |
| 18071 |
selection, |
| 18072 |
getItemId: getItemId2, |
| 18073 |
onChangeSelection, |
| 18074 |
onClickItem, |
| 18075 |
renderItemLink, |
| 18076 |
isItemClickable: isItemClickable2, |
| 18077 |
isActionsColumnSticky: !isHorizontalScrollEnd, |
| 18078 |
posinset: isInfiniteScroll ? index2 + 1 : void 0 |
| 18079 |
}, |
| 18080 |
getItemId2(item) |
| 18081 |
)) }) |
| 18082 |
] |
| 18083 |
} |
| 18084 |
), |
| 18085 |
isInfiniteScroll && isLoading && /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("div", { className: "dataviews-loading", id: tableNoticeId, children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime94.jsx)(import_components8.Spinner, {}) }) }) |
| 18086 |
] }); |
| 18087 |
} |
| 18088 |
var table_default = ViewTable; |
| 18089 |
|
| 18090 |
// packages/dataviews/build-module/components/dataviews-layouts/grid/index.mjs |
| 18091 |
var import_components11 = __toESM(require_components(), 1); |
| 18092 |
var import_i18n19 = __toESM(require_i18n(), 1); |
| 18093 |
|
| 18094 |
// packages/dataviews/build-module/components/dataviews-layouts/grid/composite-grid.mjs |
| 18095 |
var import_components10 = __toESM(require_components(), 1); |
| 18096 |
var import_i18n18 = __toESM(require_i18n(), 1); |
| 18097 |
var import_compose7 = __toESM(require_compose(), 1); |
| 18098 |
var import_keycodes2 = __toESM(require_keycodes(), 1); |
| 18099 |
var import_element78 = __toESM(require_element(), 1); |
| 18100 |
|
| 18101 |
// packages/dataviews/build-module/components/dataviews-layouts/grid/preview-size-picker.mjs |
| 18102 |
var import_components9 = __toESM(require_components(), 1); |
| 18103 |
var import_i18n17 = __toESM(require_i18n(), 1); |
| 18104 |
var import_element75 = __toESM(require_element(), 1); |
| 18105 |
var import_jsx_runtime95 = __toESM(require_jsx_runtime(), 1); |
| 18106 |
var imageSizes = [ |
| 18107 |
{ |
| 18108 |
value: 120, |
| 18109 |
breakpoint: 1 |
| 18110 |
}, |
| 18111 |
{ |
| 18112 |
value: 170, |
| 18113 |
breakpoint: 1 |
| 18114 |
}, |
| 18115 |
{ |
| 18116 |
value: 230, |
| 18117 |
breakpoint: 1 |
| 18118 |
}, |
| 18119 |
{ |
| 18120 |
value: 290, |
| 18121 |
breakpoint: 1112 |
| 18122 |
// at minimum image width, 4 images display at this container size |
| 18123 |
}, |
| 18124 |
{ |
| 18125 |
value: 350, |
| 18126 |
breakpoint: 1636 |
| 18127 |
// at minimum image width, 6 images display at this container size |
| 18128 |
}, |
| 18129 |
{ |
| 18130 |
value: 430, |
| 18131 |
breakpoint: 588 |
| 18132 |
// at minimum image width, 2 images display at this container size |
| 18133 |
} |
| 18134 |
]; |
| 18135 |
var DEFAULT_PREVIEW_SIZE = imageSizes[2].value; |
| 18136 |
function useGridColumns() { |
| 18137 |
const context = (0, import_element75.useContext)(dataviews_context_default); |
| 18138 |
const view = context.view; |
| 18139 |
return (0, import_element75.useMemo)(() => { |
| 18140 |
const containerWidth = context.containerWidth; |
| 18141 |
const gap = 32; |
| 18142 |
const previewSize = view.layout?.previewSize ?? DEFAULT_PREVIEW_SIZE; |
| 18143 |
const columns = Math.floor( |
| 18144 |
(containerWidth + gap) / (previewSize + gap) |
| 18145 |
); |
| 18146 |
return Math.max(1, columns); |
| 18147 |
}, [context.containerWidth, view.layout?.previewSize]); |
| 18148 |
} |
| 18149 |
|
| 18150 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/grid-items.mjs |
| 18151 |
var import_element76 = __toESM(require_element(), 1); |
| 18152 |
var import_jsx_runtime96 = __toESM(require_jsx_runtime(), 1); |
| 18153 |
var GridItems = (0, import_element76.forwardRef)(({ className, previewSize, ...props }, ref) => { |
| 18154 |
return /* @__PURE__ */ (0, import_jsx_runtime96.jsx)( |
| 18155 |
"div", |
| 18156 |
{ |
| 18157 |
ref, |
| 18158 |
className: clsx_default("dataviews-view-grid-items", className), |
| 18159 |
style: { |
| 18160 |
gridTemplateColumns: previewSize && `repeat(auto-fill, minmax(${previewSize}px, 1fr))` |
| 18161 |
}, |
| 18162 |
...props |
| 18163 |
} |
| 18164 |
); |
| 18165 |
}); |
| 18166 |
|
| 18167 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/use-infinite-scroll.mjs |
| 18168 |
var import_element77 = __toESM(require_element(), 1); |
| 18169 |
function useIntersectionObserver(elementRef, posinset) { |
| 18170 |
const { intersectionObserver } = (0, import_element77.useContext)(dataviews_context_default); |
| 18171 |
(0, import_element77.useEffect)(() => { |
| 18172 |
const element = elementRef.current; |
| 18173 |
if (!element || posinset === void 0 || !intersectionObserver) { |
| 18174 |
return; |
| 18175 |
} |
| 18176 |
intersectionObserver.observe(element); |
| 18177 |
return () => { |
| 18178 |
intersectionObserver.unobserve(element); |
| 18179 |
}; |
| 18180 |
}, [elementRef, intersectionObserver, posinset]); |
| 18181 |
} |
| 18182 |
function usePlaceholdersNeeded(data, isInfiniteScroll, gridColumns) { |
| 18183 |
const hasData = !!data?.length; |
| 18184 |
const firstItemPosition = hasData && isInfiniteScroll ? data[0].position : void 0; |
| 18185 |
return firstItemPosition && gridColumns ? (firstItemPosition - 1) % gridColumns : 0; |
| 18186 |
} |
| 18187 |
|
| 18188 |
// packages/dataviews/build-module/components/dataviews-layouts/grid/composite-grid.mjs |
| 18189 |
var import_jsx_runtime97 = __toESM(require_jsx_runtime(), 1); |
| 18190 |
var { Badge: WCBadge } = unlock3(import_components10.privateApis); |
| 18191 |
function chunk(array, size4) { |
| 18192 |
const chunks = []; |
| 18193 |
for (let i2 = 0, j2 = array.length; i2 < j2; i2 += size4) { |
| 18194 |
chunks.push(array.slice(i2, i2 + size4)); |
| 18195 |
} |
| 18196 |
return chunks; |
| 18197 |
} |
| 18198 |
var GridItem = (0, import_element78.forwardRef)( |
| 18199 |
function GridItem2({ |
| 18200 |
view, |
| 18201 |
selection, |
| 18202 |
onChangeSelection, |
| 18203 |
onClickItem, |
| 18204 |
isItemClickable: isItemClickable2, |
| 18205 |
renderItemLink, |
| 18206 |
getItemId: getItemId2, |
| 18207 |
item, |
| 18208 |
actions, |
| 18209 |
mediaField, |
| 18210 |
titleField, |
| 18211 |
descriptionField, |
| 18212 |
regularFields, |
| 18213 |
badgeFields, |
| 18214 |
hasBulkActions, |
| 18215 |
config, |
| 18216 |
posinset, |
| 18217 |
setsize, |
| 18218 |
...props |
| 18219 |
}, forwardedRef) { |
| 18220 |
const { |
| 18221 |
showTitle = true, |
| 18222 |
showMedia = true, |
| 18223 |
showDescription = true |
| 18224 |
} = view; |
| 18225 |
const hasBulkAction = useHasAPossibleBulkAction(actions, item); |
| 18226 |
const id = getItemId2(item); |
| 18227 |
const elementRef = (0, import_element78.useRef)(null); |
| 18228 |
const setRefs = (0, import_element78.useCallback)( |
| 18229 |
(node) => { |
| 18230 |
elementRef.current = node; |
| 18231 |
if (typeof forwardedRef === "function") { |
| 18232 |
forwardedRef(node); |
| 18233 |
} else if (forwardedRef) { |
| 18234 |
forwardedRef.current = node; |
| 18235 |
} |
| 18236 |
}, |
| 18237 |
[forwardedRef] |
| 18238 |
); |
| 18239 |
useIntersectionObserver(elementRef, posinset); |
| 18240 |
const instanceId = (0, import_compose7.useInstanceId)(GridItem2); |
| 18241 |
const isSelected2 = selection.includes(id); |
| 18242 |
const mediaPlaceholder = /* @__PURE__ */ (0, import_jsx_runtime97.jsx)("span", { className: "dataviews-view-grid__media-placeholder" }); |
| 18243 |
const rendersMediaField = showMedia && mediaField?.render; |
| 18244 |
const renderedMediaField = rendersMediaField ? /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18245 |
mediaField.render, |
| 18246 |
{ |
| 18247 |
item, |
| 18248 |
field: mediaField, |
| 18249 |
config |
| 18250 |
} |
| 18251 |
) : mediaPlaceholder; |
| 18252 |
const renderedTitleField = showTitle && titleField?.render ? /* @__PURE__ */ (0, import_jsx_runtime97.jsx)(titleField.render, { item, field: titleField }) : null; |
| 18253 |
let mediaA11yProps; |
| 18254 |
let titleA11yProps; |
| 18255 |
if (isItemClickable2(item) && onClickItem) { |
| 18256 |
if (renderedTitleField) { |
| 18257 |
mediaA11yProps = { |
| 18258 |
"aria-labelledby": `dataviews-view-grid__title-field-${instanceId}` |
| 18259 |
}; |
| 18260 |
titleA11yProps = { |
| 18261 |
id: `dataviews-view-grid__title-field-${instanceId}` |
| 18262 |
}; |
| 18263 |
} else { |
| 18264 |
mediaA11yProps = { |
| 18265 |
"aria-label": (0, import_i18n18.__)("Navigate to item") |
| 18266 |
}; |
| 18267 |
} |
| 18268 |
} |
| 18269 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsxs)( |
| 18270 |
Stack, |
| 18271 |
{ |
| 18272 |
direction: "column", |
| 18273 |
...props, |
| 18274 |
ref: setRefs, |
| 18275 |
"aria-setsize": setsize, |
| 18276 |
"aria-posinset": posinset, |
| 18277 |
className: clsx_default( |
| 18278 |
props.className, |
| 18279 |
"dataviews-view-grid__row__gridcell", |
| 18280 |
"dataviews-view-grid__card", |
| 18281 |
{ |
| 18282 |
"is-selected": hasBulkAction && isSelected2 |
| 18283 |
} |
| 18284 |
), |
| 18285 |
onClickCapture: (event) => { |
| 18286 |
props.onClickCapture?.(event); |
| 18287 |
if ((0, import_keycodes2.isAppleOS)() ? event.metaKey : event.ctrlKey) { |
| 18288 |
event.stopPropagation(); |
| 18289 |
event.preventDefault(); |
| 18290 |
if (!hasBulkAction) { |
| 18291 |
return; |
| 18292 |
} |
| 18293 |
onChangeSelection( |
| 18294 |
isSelected2 ? selection.filter( |
| 18295 |
(itemId) => id !== itemId |
| 18296 |
) : [...selection, id] |
| 18297 |
); |
| 18298 |
} |
| 18299 |
}, |
| 18300 |
children: [ |
| 18301 |
/* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18302 |
ItemClickWrapper, |
| 18303 |
{ |
| 18304 |
item, |
| 18305 |
isItemClickable: isItemClickable2, |
| 18306 |
onClickItem, |
| 18307 |
renderItemLink, |
| 18308 |
className: clsx_default("dataviews-view-grid__media", { |
| 18309 |
"dataviews-view-grid__media--placeholder": !rendersMediaField |
| 18310 |
}), |
| 18311 |
...mediaA11yProps, |
| 18312 |
children: renderedMediaField |
| 18313 |
} |
| 18314 |
), |
| 18315 |
hasBulkActions && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18316 |
DataViewsSelectionCheckbox, |
| 18317 |
{ |
| 18318 |
item, |
| 18319 |
selection, |
| 18320 |
onChangeSelection, |
| 18321 |
getItemId: getItemId2, |
| 18322 |
titleField, |
| 18323 |
disabled: !hasBulkAction |
| 18324 |
} |
| 18325 |
), |
| 18326 |
!!actions?.length && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)("div", { className: "dataviews-view-grid__media-actions", children: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18327 |
ItemActions, |
| 18328 |
{ |
| 18329 |
item, |
| 18330 |
actions, |
| 18331 |
isCompact: true |
| 18332 |
} |
| 18333 |
) }), |
| 18334 |
showTitle && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)("div", { className: "dataviews-view-grid__title", children: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18335 |
ItemClickWrapper, |
| 18336 |
{ |
| 18337 |
item, |
| 18338 |
isItemClickable: isItemClickable2, |
| 18339 |
onClickItem, |
| 18340 |
renderItemLink, |
| 18341 |
className: "dataviews-view-grid__title-field dataviews-title-field", |
| 18342 |
...titleA11yProps, |
| 18343 |
title: titleField?.getValueFormatted({ |
| 18344 |
item, |
| 18345 |
field: titleField |
| 18346 |
}) || void 0, |
| 18347 |
children: renderedTitleField |
| 18348 |
} |
| 18349 |
) }), |
| 18350 |
/* @__PURE__ */ (0, import_jsx_runtime97.jsxs)(Stack, { direction: "column", gap: "xs", children: [ |
| 18351 |
showDescription && descriptionField?.render && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18352 |
descriptionField.render, |
| 18353 |
{ |
| 18354 |
item, |
| 18355 |
field: descriptionField |
| 18356 |
} |
| 18357 |
), |
| 18358 |
!!badgeFields?.length && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18359 |
Stack, |
| 18360 |
{ |
| 18361 |
direction: "row", |
| 18362 |
className: "dataviews-view-grid__badge-fields", |
| 18363 |
gap: "sm", |
| 18364 |
wrap: "wrap", |
| 18365 |
align: "top", |
| 18366 |
justify: "flex-start", |
| 18367 |
children: badgeFields.map((field) => { |
| 18368 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18369 |
WCBadge, |
| 18370 |
{ |
| 18371 |
className: "dataviews-view-grid__field-value", |
| 18372 |
children: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18373 |
field.render, |
| 18374 |
{ |
| 18375 |
item, |
| 18376 |
field |
| 18377 |
} |
| 18378 |
) |
| 18379 |
}, |
| 18380 |
field.id |
| 18381 |
); |
| 18382 |
}) |
| 18383 |
} |
| 18384 |
), |
| 18385 |
!!regularFields?.length && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18386 |
Stack, |
| 18387 |
{ |
| 18388 |
direction: "column", |
| 18389 |
className: "dataviews-view-grid__fields", |
| 18390 |
gap: "xs", |
| 18391 |
children: regularFields.map((field) => { |
| 18392 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18393 |
import_components10.Flex, |
| 18394 |
{ |
| 18395 |
className: "dataviews-view-grid__field", |
| 18396 |
gap: 1, |
| 18397 |
justify: "flex-start", |
| 18398 |
expanded: true, |
| 18399 |
style: { height: "auto" }, |
| 18400 |
direction: "row", |
| 18401 |
children: /* @__PURE__ */ (0, import_jsx_runtime97.jsxs)(import_jsx_runtime97.Fragment, { children: [ |
| 18402 |
/* @__PURE__ */ (0, import_jsx_runtime97.jsx)(import_components10.Tooltip, { text: field.label, children: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)(import_components10.FlexItem, { className: "dataviews-view-grid__field-name", children: field.header }) }), |
| 18403 |
/* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18404 |
import_components10.FlexItem, |
| 18405 |
{ |
| 18406 |
className: "dataviews-view-grid__field-value", |
| 18407 |
style: { maxHeight: "none" }, |
| 18408 |
children: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18409 |
field.render, |
| 18410 |
{ |
| 18411 |
item, |
| 18412 |
field |
| 18413 |
} |
| 18414 |
) |
| 18415 |
} |
| 18416 |
) |
| 18417 |
] }) |
| 18418 |
}, |
| 18419 |
field.id |
| 18420 |
); |
| 18421 |
}) |
| 18422 |
} |
| 18423 |
) |
| 18424 |
] }) |
| 18425 |
] |
| 18426 |
} |
| 18427 |
); |
| 18428 |
} |
| 18429 |
); |
| 18430 |
function CompositeGrid({ |
| 18431 |
data, |
| 18432 |
isInfiniteScroll, |
| 18433 |
className, |
| 18434 |
inert, |
| 18435 |
isLoading, |
| 18436 |
view, |
| 18437 |
fields: fields2, |
| 18438 |
selection, |
| 18439 |
onChangeSelection, |
| 18440 |
onClickItem, |
| 18441 |
isItemClickable: isItemClickable2, |
| 18442 |
renderItemLink, |
| 18443 |
getItemId: getItemId2, |
| 18444 |
actions |
| 18445 |
}) { |
| 18446 |
const { paginationInfo, resizeObserverRef } = (0, import_element78.useContext)(dataviews_context_default); |
| 18447 |
const gridColumns = useGridColumns(); |
| 18448 |
const hasBulkActions = useSomeItemHasAPossibleBulkAction(actions, data); |
| 18449 |
const titleField = fields2.find( |
| 18450 |
(field) => field.id === view?.titleField |
| 18451 |
); |
| 18452 |
const mediaField = fields2.find( |
| 18453 |
(field) => field.id === view?.mediaField |
| 18454 |
); |
| 18455 |
const descriptionField = fields2.find( |
| 18456 |
(field) => field.id === view?.descriptionField |
| 18457 |
); |
| 18458 |
const otherFields = view.fields ?? []; |
| 18459 |
const { regularFields, badgeFields } = otherFields.reduce( |
| 18460 |
(accumulator, fieldId) => { |
| 18461 |
const field = fields2.find((f2) => f2.id === fieldId); |
| 18462 |
if (!field) { |
| 18463 |
return accumulator; |
| 18464 |
} |
| 18465 |
const key2 = view.layout?.badgeFields?.includes(fieldId) ? "badgeFields" : "regularFields"; |
| 18466 |
accumulator[key2].push(field); |
| 18467 |
return accumulator; |
| 18468 |
}, |
| 18469 |
{ regularFields: [], badgeFields: [] } |
| 18470 |
); |
| 18471 |
const size4 = "900px"; |
| 18472 |
const totalRows = Math.ceil(data.length / gridColumns); |
| 18473 |
const placeholdersNeeded = usePlaceholdersNeeded( |
| 18474 |
data, |
| 18475 |
isInfiniteScroll, |
| 18476 |
gridColumns |
| 18477 |
); |
| 18478 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsxs)(import_jsx_runtime97.Fragment, { |
| 18479 |
// Render infinite scroll layout (no rows, feed semantics) |
| 18480 |
children: [ |
| 18481 |
isInfiniteScroll && /* @__PURE__ */ (0, import_jsx_runtime97.jsxs)( |
| 18482 |
import_components10.Composite, |
| 18483 |
{ |
| 18484 |
render: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18485 |
GridItems, |
| 18486 |
{ |
| 18487 |
className: clsx_default( |
| 18488 |
"dataviews-view-grid-infinite-scroll", |
| 18489 |
className, |
| 18490 |
{ |
| 18491 |
[`has-${view.layout?.density}-density`]: view.layout?.density && [ |
| 18492 |
"compact", |
| 18493 |
"comfortable" |
| 18494 |
].includes(view.layout.density) |
| 18495 |
} |
| 18496 |
), |
| 18497 |
previewSize: view.layout?.previewSize, |
| 18498 |
"aria-busy": isLoading, |
| 18499 |
ref: resizeObserverRef |
| 18500 |
} |
| 18501 |
), |
| 18502 |
role: "feed", |
| 18503 |
focusWrap: true, |
| 18504 |
inert, |
| 18505 |
children: [ |
| 18506 |
Array.from({ length: placeholdersNeeded }).map( |
| 18507 |
(_, index2) => /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18508 |
import_components10.Composite.Item, |
| 18509 |
{ |
| 18510 |
render: (props) => /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18511 |
Stack, |
| 18512 |
{ |
| 18513 |
...props, |
| 18514 |
direction: "column", |
| 18515 |
role: "article", |
| 18516 |
className: "dataviews-view-grid__row__gridcell dataviews-view-grid__card dataviews-view-grid__placeholder" |
| 18517 |
} |
| 18518 |
), |
| 18519 |
"aria-hidden": true, |
| 18520 |
tabIndex: -1 |
| 18521 |
}, |
| 18522 |
`placeholder-${index2}` |
| 18523 |
) |
| 18524 |
), |
| 18525 |
data.map((item) => { |
| 18526 |
const itemId = getItemId2(item); |
| 18527 |
const stablePosition = item.position; |
| 18528 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18529 |
import_components10.Composite.Item, |
| 18530 |
{ |
| 18531 |
render: (props) => /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18532 |
GridItem, |
| 18533 |
{ |
| 18534 |
...props, |
| 18535 |
id: itemId, |
| 18536 |
role: "article", |
| 18537 |
view, |
| 18538 |
selection, |
| 18539 |
onChangeSelection, |
| 18540 |
onClickItem, |
| 18541 |
isItemClickable: isItemClickable2, |
| 18542 |
renderItemLink, |
| 18543 |
getItemId: getItemId2, |
| 18544 |
item, |
| 18545 |
actions, |
| 18546 |
mediaField, |
| 18547 |
titleField, |
| 18548 |
descriptionField, |
| 18549 |
regularFields, |
| 18550 |
badgeFields, |
| 18551 |
hasBulkActions, |
| 18552 |
posinset: stablePosition, |
| 18553 |
setsize: paginationInfo.totalItems, |
| 18554 |
config: { |
| 18555 |
sizes: size4 |
| 18556 |
} |
| 18557 |
} |
| 18558 |
) |
| 18559 |
}, |
| 18560 |
itemId |
| 18561 |
); |
| 18562 |
}) |
| 18563 |
] |
| 18564 |
} |
| 18565 |
), |
| 18566 |
// Render standard grid layout (with rows, grid semantics) |
| 18567 |
!isInfiniteScroll && /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18568 |
import_components10.Composite, |
| 18569 |
{ |
| 18570 |
role: "grid", |
| 18571 |
className: clsx_default("dataviews-view-grid", className, { |
| 18572 |
[`has-${view.layout?.density}-density`]: view.layout?.density && ["compact", "comfortable"].includes( |
| 18573 |
view.layout.density |
| 18574 |
) |
| 18575 |
}), |
| 18576 |
focusWrap: true, |
| 18577 |
"aria-busy": isLoading, |
| 18578 |
"aria-rowcount": totalRows, |
| 18579 |
ref: resizeObserverRef, |
| 18580 |
inert, |
| 18581 |
children: chunk(data, gridColumns).map((row, i2) => /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18582 |
import_components10.Composite.Row, |
| 18583 |
{ |
| 18584 |
render: /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18585 |
"div", |
| 18586 |
{ |
| 18587 |
role: "row", |
| 18588 |
"aria-rowindex": i2 + 1, |
| 18589 |
"aria-label": (0, import_i18n18.sprintf)( |
| 18590 |
/* translators: %d: The row number in the grid */ |
| 18591 |
(0, import_i18n18.__)("Row %d"), |
| 18592 |
i2 + 1 |
| 18593 |
), |
| 18594 |
className: "dataviews-view-grid__row", |
| 18595 |
style: { |
| 18596 |
gridTemplateColumns: `repeat( ${gridColumns}, minmax(0, 1fr) )` |
| 18597 |
} |
| 18598 |
} |
| 18599 |
), |
| 18600 |
children: row.map((item) => { |
| 18601 |
const itemId = getItemId2(item); |
| 18602 |
return /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18603 |
import_components10.Composite.Item, |
| 18604 |
{ |
| 18605 |
render: (props) => /* @__PURE__ */ (0, import_jsx_runtime97.jsx)( |
| 18606 |
GridItem, |
| 18607 |
{ |
| 18608 |
...props, |
| 18609 |
id: itemId, |
| 18610 |
role: "gridcell", |
| 18611 |
view, |
| 18612 |
selection, |
| 18613 |
onChangeSelection, |
| 18614 |
onClickItem, |
| 18615 |
isItemClickable: isItemClickable2, |
| 18616 |
renderItemLink, |
| 18617 |
getItemId: getItemId2, |
| 18618 |
item, |
| 18619 |
actions, |
| 18620 |
mediaField, |
| 18621 |
titleField, |
| 18622 |
descriptionField, |
| 18623 |
regularFields, |
| 18624 |
badgeFields, |
| 18625 |
hasBulkActions, |
| 18626 |
config: { |
| 18627 |
sizes: size4 |
| 18628 |
} |
| 18629 |
} |
| 18630 |
) |
| 18631 |
}, |
| 18632 |
itemId |
| 18633 |
); |
| 18634 |
}) |
| 18635 |
}, |
| 18636 |
i2 |
| 18637 |
)) |
| 18638 |
} |
| 18639 |
) |
| 18640 |
] |
| 18641 |
}); |
| 18642 |
} |
| 18643 |
|
| 18644 |
// packages/dataviews/build-module/components/dataviews-layouts/grid/index.mjs |
| 18645 |
var import_jsx_runtime98 = __toESM(require_jsx_runtime(), 1); |
| 18646 |
function ViewGrid({ |
| 18647 |
actions, |
| 18648 |
data, |
| 18649 |
fields: fields2, |
| 18650 |
getItemId: getItemId2, |
| 18651 |
isLoading, |
| 18652 |
onChangeSelection, |
| 18653 |
onClickItem, |
| 18654 |
isItemClickable: isItemClickable2, |
| 18655 |
renderItemLink, |
| 18656 |
selection, |
| 18657 |
view, |
| 18658 |
className, |
| 18659 |
empty |
| 18660 |
}) { |
| 18661 |
const isDelayedLoading = useDelayedLoading(!!isLoading); |
| 18662 |
const hasData = !!data?.length; |
| 18663 |
const groupField = view.groupBy?.field ? fields2.find((f2) => f2.id === view.groupBy?.field) : null; |
| 18664 |
const dataByGroup = groupField ? getDataByGroup(data, groupField) : null; |
| 18665 |
const isInfiniteScroll = view.infiniteScrollEnabled && !dataByGroup; |
| 18666 |
if (!hasData) { |
| 18667 |
return /* @__PURE__ */ (0, import_jsx_runtime98.jsx)( |
| 18668 |
"div", |
| 18669 |
{ |
| 18670 |
className: clsx_default("dataviews-no-results", { |
| 18671 |
"is-refreshing": isDelayedLoading |
| 18672 |
}), |
| 18673 |
children: empty |
| 18674 |
} |
| 18675 |
); |
| 18676 |
} |
| 18677 |
const gridProps = { |
| 18678 |
className: clsx_default(className, { |
| 18679 |
"is-refreshing": !isInfiniteScroll && isDelayedLoading |
| 18680 |
}), |
| 18681 |
inert: !isInfiniteScroll && !!isLoading ? "true" : void 0, |
| 18682 |
isLoading, |
| 18683 |
view, |
| 18684 |
fields: fields2, |
| 18685 |
selection, |
| 18686 |
onChangeSelection, |
| 18687 |
onClickItem, |
| 18688 |
isItemClickable: isItemClickable2, |
| 18689 |
renderItemLink, |
| 18690 |
getItemId: getItemId2, |
| 18691 |
actions |
| 18692 |
}; |
| 18693 |
return /* @__PURE__ */ (0, import_jsx_runtime98.jsxs)(import_jsx_runtime98.Fragment, { |
| 18694 |
// Render multiple groups. |
| 18695 |
children: [ |
| 18696 |
hasData && groupField && dataByGroup && /* @__PURE__ */ (0, import_jsx_runtime98.jsx)(Stack, { direction: "column", gap: "lg", children: Array.from(dataByGroup.entries()).map( |
| 18697 |
([groupName, groupItems]) => /* @__PURE__ */ (0, import_jsx_runtime98.jsxs)( |
| 18698 |
Stack, |
| 18699 |
{ |
| 18700 |
direction: "column", |
| 18701 |
gap: "sm", |
| 18702 |
children: [ |
| 18703 |
/* @__PURE__ */ (0, import_jsx_runtime98.jsx)("h3", { className: "dataviews-view-grid__group-header", children: view.groupBy?.showLabel === false ? groupName : (0, import_i18n19.sprintf)( |
| 18704 |
// translators: 1: The label of the field e.g. "Date". 2: The value of the field, e.g.: "May 2022". |
| 18705 |
(0, import_i18n19.__)("%1$s: %2$s"), |
| 18706 |
groupField.label, |
| 18707 |
groupName |
| 18708 |
) }), |
| 18709 |
/* @__PURE__ */ (0, import_jsx_runtime98.jsx)( |
| 18710 |
CompositeGrid, |
| 18711 |
{ |
| 18712 |
...gridProps, |
| 18713 |
data: groupItems, |
| 18714 |
isInfiniteScroll: false |
| 18715 |
} |
| 18716 |
) |
| 18717 |
] |
| 18718 |
}, |
| 18719 |
groupName |
| 18720 |
) |
| 18721 |
) }), |
| 18722 |
// Render a single grid with all data. |
| 18723 |
!dataByGroup && /* @__PURE__ */ (0, import_jsx_runtime98.jsx)( |
| 18724 |
CompositeGrid, |
| 18725 |
{ |
| 18726 |
...gridProps, |
| 18727 |
data, |
| 18728 |
isInfiniteScroll: !!isInfiniteScroll |
| 18729 |
} |
| 18730 |
), |
| 18731 |
isInfiniteScroll && isLoading && /* @__PURE__ */ (0, import_jsx_runtime98.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime98.jsx)(import_components11.Spinner, {}) }) |
| 18732 |
] |
| 18733 |
}); |
| 18734 |
} |
| 18735 |
var grid_default = ViewGrid; |
| 18736 |
|
| 18737 |
// packages/dataviews/build-module/components/dataviews-layouts/list/index.mjs |
| 18738 |
var import_compose8 = __toESM(require_compose(), 1); |
| 18739 |
var import_components12 = __toESM(require_components(), 1); |
| 18740 |
var import_element79 = __toESM(require_element(), 1); |
| 18741 |
var import_i18n20 = __toESM(require_i18n(), 1); |
| 18742 |
var import_data4 = __toESM(require_data(), 1); |
| 18743 |
var import_jsx_runtime99 = __toESM(require_jsx_runtime(), 1); |
| 18744 |
var { Menu: Menu4 } = unlock3(import_components12.privateApis); |
| 18745 |
function generateItemWrapperCompositeId(idPrefix) { |
| 18746 |
return `${idPrefix}-item-wrapper`; |
| 18747 |
} |
| 18748 |
function generatePrimaryActionCompositeId(idPrefix, primaryActionId) { |
| 18749 |
return `${idPrefix}-primary-action-${primaryActionId}`; |
| 18750 |
} |
| 18751 |
function generateDropdownTriggerCompositeId(idPrefix) { |
| 18752 |
return `${idPrefix}-dropdown`; |
| 18753 |
} |
| 18754 |
function PrimaryActionGridCell({ |
| 18755 |
idPrefix, |
| 18756 |
primaryAction, |
| 18757 |
item |
| 18758 |
}) { |
| 18759 |
const registry = (0, import_data4.useRegistry)(); |
| 18760 |
const [isModalOpen, setIsModalOpen] = (0, import_element79.useState)(false); |
| 18761 |
const compositeItemId = generatePrimaryActionCompositeId( |
| 18762 |
idPrefix, |
| 18763 |
primaryAction.id |
| 18764 |
); |
| 18765 |
const label = typeof primaryAction.label === "string" ? primaryAction.label : primaryAction.label([item]); |
| 18766 |
return "RenderModal" in primaryAction ? /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", { role: "gridcell", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18767 |
import_components12.Composite.Item, |
| 18768 |
{ |
| 18769 |
id: compositeItemId, |
| 18770 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18771 |
import_components12.Button, |
| 18772 |
{ |
| 18773 |
disabled: !!primaryAction.disabled, |
| 18774 |
accessibleWhenDisabled: true, |
| 18775 |
text: label, |
| 18776 |
size: "small", |
| 18777 |
onClick: () => setIsModalOpen(true) |
| 18778 |
} |
| 18779 |
), |
| 18780 |
children: isModalOpen && /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18781 |
ActionModal, |
| 18782 |
{ |
| 18783 |
action: primaryAction, |
| 18784 |
items: [item], |
| 18785 |
closeModal: () => setIsModalOpen(false) |
| 18786 |
} |
| 18787 |
) |
| 18788 |
} |
| 18789 |
) }, primaryAction.id) : /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", { role: "gridcell", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18790 |
import_components12.Composite.Item, |
| 18791 |
{ |
| 18792 |
id: compositeItemId, |
| 18793 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18794 |
import_components12.Button, |
| 18795 |
{ |
| 18796 |
disabled: !!primaryAction.disabled, |
| 18797 |
accessibleWhenDisabled: true, |
| 18798 |
size: "small", |
| 18799 |
onClick: () => { |
| 18800 |
primaryAction.callback([item], { registry }); |
| 18801 |
}, |
| 18802 |
children: label |
| 18803 |
} |
| 18804 |
) |
| 18805 |
} |
| 18806 |
) }, primaryAction.id); |
| 18807 |
} |
| 18808 |
function ListItem({ |
| 18809 |
view, |
| 18810 |
actions, |
| 18811 |
idPrefix, |
| 18812 |
isSelected: isSelected2, |
| 18813 |
item, |
| 18814 |
titleField, |
| 18815 |
mediaField, |
| 18816 |
descriptionField, |
| 18817 |
onSelect, |
| 18818 |
otherFields, |
| 18819 |
onDropdownTriggerKeyDown, |
| 18820 |
posinset |
| 18821 |
}) { |
| 18822 |
const { |
| 18823 |
showTitle = true, |
| 18824 |
showMedia = true, |
| 18825 |
showDescription = true, |
| 18826 |
infiniteScrollEnabled |
| 18827 |
} = view; |
| 18828 |
const itemRef = (0, import_element79.useRef)(null); |
| 18829 |
const labelId = `${idPrefix}-label`; |
| 18830 |
const descriptionId = `${idPrefix}-description`; |
| 18831 |
const registry = (0, import_data4.useRegistry)(); |
| 18832 |
const [isHovered, setIsHovered] = (0, import_element79.useState)(false); |
| 18833 |
const [activeModalAction, setActiveModalAction] = (0, import_element79.useState)( |
| 18834 |
null |
| 18835 |
); |
| 18836 |
const handleHover = ({ type }) => { |
| 18837 |
const isHover = type === "mouseenter"; |
| 18838 |
setIsHovered(isHover); |
| 18839 |
}; |
| 18840 |
const { paginationInfo } = (0, import_element79.useContext)(dataviews_context_default); |
| 18841 |
(0, import_element79.useEffect)(() => { |
| 18842 |
if (isSelected2) { |
| 18843 |
itemRef.current?.scrollIntoView({ |
| 18844 |
behavior: "auto", |
| 18845 |
block: "nearest", |
| 18846 |
inline: "nearest" |
| 18847 |
}); |
| 18848 |
} |
| 18849 |
}, [isSelected2]); |
| 18850 |
const { primaryAction, eligibleActions } = (0, import_element79.useMemo)(() => { |
| 18851 |
const _eligibleActions = actions.filter( |
| 18852 |
(action) => !action.isEligible || action.isEligible(item) |
| 18853 |
); |
| 18854 |
const _primaryActions = _eligibleActions.filter( |
| 18855 |
(action) => action.isPrimary |
| 18856 |
); |
| 18857 |
return { |
| 18858 |
primaryAction: _primaryActions[0], |
| 18859 |
eligibleActions: _eligibleActions |
| 18860 |
}; |
| 18861 |
}, [actions, item]); |
| 18862 |
const hasOnlyOnePrimaryAction = primaryAction && actions.length === 1; |
| 18863 |
const renderedMediaField = showMedia && mediaField?.render ? /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", { className: "dataviews-view-list__media-wrapper", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18864 |
mediaField.render, |
| 18865 |
{ |
| 18866 |
item, |
| 18867 |
field: mediaField, |
| 18868 |
config: { sizes: "52px" } |
| 18869 |
} |
| 18870 |
) }) : null; |
| 18871 |
const renderedTitleField = showTitle && titleField?.render ? /* @__PURE__ */ (0, import_jsx_runtime99.jsx)(titleField.render, { item, field: titleField }) : null; |
| 18872 |
const renderDescription = showDescription && descriptionField?.render; |
| 18873 |
const hasOnlyMediaAndTitle = !!renderedMediaField && !renderDescription && !otherFields.length; |
| 18874 |
const usedActions = eligibleActions?.length > 0 && /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 18875 |
Stack, |
| 18876 |
{ |
| 18877 |
direction: "row", |
| 18878 |
gap: "md", |
| 18879 |
className: "dataviews-view-list__item-actions", |
| 18880 |
children: [ |
| 18881 |
primaryAction && /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18882 |
PrimaryActionGridCell, |
| 18883 |
{ |
| 18884 |
idPrefix, |
| 18885 |
primaryAction, |
| 18886 |
item |
| 18887 |
} |
| 18888 |
), |
| 18889 |
!hasOnlyOnePrimaryAction && /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)("div", { role: "gridcell", children: [ |
| 18890 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsxs)(Menu4, { placement: "bottom-end", children: [ |
| 18891 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18892 |
Menu4.TriggerButton, |
| 18893 |
{ |
| 18894 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18895 |
import_components12.Composite.Item, |
| 18896 |
{ |
| 18897 |
id: generateDropdownTriggerCompositeId( |
| 18898 |
idPrefix |
| 18899 |
), |
| 18900 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18901 |
import_components12.Button, |
| 18902 |
{ |
| 18903 |
size: "small", |
| 18904 |
icon: more_vertical_default, |
| 18905 |
label: (0, import_i18n20.__)("Actions"), |
| 18906 |
accessibleWhenDisabled: true, |
| 18907 |
disabled: !actions.length, |
| 18908 |
onKeyDown: onDropdownTriggerKeyDown |
| 18909 |
} |
| 18910 |
) |
| 18911 |
} |
| 18912 |
) |
| 18913 |
} |
| 18914 |
), |
| 18915 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)(Menu4.Popover, { children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18916 |
ActionsMenuGroup, |
| 18917 |
{ |
| 18918 |
actions: eligibleActions, |
| 18919 |
item, |
| 18920 |
registry, |
| 18921 |
setActiveModalAction |
| 18922 |
} |
| 18923 |
) }) |
| 18924 |
] }), |
| 18925 |
!!activeModalAction && /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18926 |
ActionModal, |
| 18927 |
{ |
| 18928 |
action: activeModalAction, |
| 18929 |
items: [item], |
| 18930 |
closeModal: () => setActiveModalAction(null) |
| 18931 |
} |
| 18932 |
) |
| 18933 |
] }) |
| 18934 |
] |
| 18935 |
} |
| 18936 |
); |
| 18937 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18938 |
import_components12.Composite.Row, |
| 18939 |
{ |
| 18940 |
ref: itemRef, |
| 18941 |
render: ( |
| 18942 |
/* aria-posinset breaks Composite.Row if passed to it directly. */ |
| 18943 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18944 |
"div", |
| 18945 |
{ |
| 18946 |
"aria-posinset": posinset, |
| 18947 |
"aria-setsize": infiniteScrollEnabled ? paginationInfo.totalItems : void 0 |
| 18948 |
} |
| 18949 |
) |
| 18950 |
), |
| 18951 |
role: infiniteScrollEnabled ? "article" : "row", |
| 18952 |
className: clsx_default({ |
| 18953 |
"is-selected": isSelected2, |
| 18954 |
"is-hovered": isHovered |
| 18955 |
}), |
| 18956 |
onMouseEnter: handleHover, |
| 18957 |
onMouseLeave: handleHover, |
| 18958 |
children: /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 18959 |
Stack, |
| 18960 |
{ |
| 18961 |
direction: "row", |
| 18962 |
className: "dataviews-view-list__item-wrapper", |
| 18963 |
children: [ |
| 18964 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", { role: "gridcell", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18965 |
import_components12.Composite.Item, |
| 18966 |
{ |
| 18967 |
id: generateItemWrapperCompositeId(idPrefix), |
| 18968 |
"aria-pressed": isSelected2, |
| 18969 |
"aria-labelledby": labelId, |
| 18970 |
"aria-describedby": descriptionId, |
| 18971 |
className: "dataviews-view-list__item", |
| 18972 |
onClick: () => onSelect(item) |
| 18973 |
} |
| 18974 |
) }), |
| 18975 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 18976 |
Stack, |
| 18977 |
{ |
| 18978 |
direction: "row", |
| 18979 |
gap: "md", |
| 18980 |
justify: "start", |
| 18981 |
align: hasOnlyMediaAndTitle ? "center" : "flex-start", |
| 18982 |
style: { flex: 1, minWidth: 0 }, |
| 18983 |
children: [ |
| 18984 |
renderedMediaField, |
| 18985 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 18986 |
Stack, |
| 18987 |
{ |
| 18988 |
direction: "column", |
| 18989 |
gap: "xs", |
| 18990 |
className: "dataviews-view-list__field-wrapper", |
| 18991 |
children: [ |
| 18992 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsxs)(Stack, { direction: "row", align: "center", children: [ |
| 18993 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 18994 |
"div", |
| 18995 |
{ |
| 18996 |
className: "dataviews-title-field dataviews-view-list__title-field", |
| 18997 |
id: labelId, |
| 18998 |
children: renderedTitleField |
| 18999 |
} |
| 19000 |
), |
| 19001 |
usedActions |
| 19002 |
] }), |
| 19003 |
renderDescription && /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", { className: "dataviews-view-list__field", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19004 |
descriptionField.render, |
| 19005 |
{ |
| 19006 |
item, |
| 19007 |
field: descriptionField |
| 19008 |
} |
| 19009 |
) }), |
| 19010 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19011 |
"div", |
| 19012 |
{ |
| 19013 |
className: "dataviews-view-list__fields", |
| 19014 |
id: descriptionId, |
| 19015 |
children: otherFields.map((field) => /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 19016 |
"div", |
| 19017 |
{ |
| 19018 |
className: "dataviews-view-list__field", |
| 19019 |
children: [ |
| 19020 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19021 |
VisuallyHidden, |
| 19022 |
{ |
| 19023 |
className: "dataviews-view-list__field-label", |
| 19024 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("span", {}), |
| 19025 |
children: field.label |
| 19026 |
} |
| 19027 |
), |
| 19028 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)("span", { className: "dataviews-view-list__field-value", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19029 |
field.render, |
| 19030 |
{ |
| 19031 |
item, |
| 19032 |
field |
| 19033 |
} |
| 19034 |
) }) |
| 19035 |
] |
| 19036 |
}, |
| 19037 |
field.id |
| 19038 |
)) |
| 19039 |
} |
| 19040 |
) |
| 19041 |
] |
| 19042 |
} |
| 19043 |
) |
| 19044 |
] |
| 19045 |
} |
| 19046 |
) |
| 19047 |
] |
| 19048 |
} |
| 19049 |
) |
| 19050 |
} |
| 19051 |
); |
| 19052 |
} |
| 19053 |
function isDefined2(item) { |
| 19054 |
return !!item; |
| 19055 |
} |
| 19056 |
function ViewList(props) { |
| 19057 |
const { |
| 19058 |
actions, |
| 19059 |
data, |
| 19060 |
fields: fields2, |
| 19061 |
getItemId: getItemId2, |
| 19062 |
isLoading, |
| 19063 |
onChangeSelection, |
| 19064 |
selection, |
| 19065 |
view, |
| 19066 |
className, |
| 19067 |
empty |
| 19068 |
} = props; |
| 19069 |
const baseId = (0, import_compose8.useInstanceId)(ViewList, "view-list"); |
| 19070 |
const isDelayedLoading = useDelayedLoading(!!isLoading); |
| 19071 |
const selectedItem = data?.findLast( |
| 19072 |
(item) => selection.includes(getItemId2(item)) |
| 19073 |
); |
| 19074 |
const titleField = fields2.find((field) => field.id === view.titleField); |
| 19075 |
const mediaField = fields2.find((field) => field.id === view.mediaField); |
| 19076 |
const descriptionField = fields2.find( |
| 19077 |
(field) => field.id === view.descriptionField |
| 19078 |
); |
| 19079 |
const otherFields = (view?.fields ?? []).map((fieldId) => fields2.find((f2) => fieldId === f2.id)).filter(isDefined2); |
| 19080 |
const onSelect = (item) => onChangeSelection([getItemId2(item)]); |
| 19081 |
const generateCompositeItemIdPrefix = (0, import_element79.useCallback)( |
| 19082 |
(item) => `${baseId}-${getItemId2(item)}`, |
| 19083 |
[baseId, getItemId2] |
| 19084 |
); |
| 19085 |
const isActiveCompositeItem = (0, import_element79.useCallback)( |
| 19086 |
(item, idToCheck) => { |
| 19087 |
return idToCheck.startsWith( |
| 19088 |
generateCompositeItemIdPrefix(item) |
| 19089 |
); |
| 19090 |
}, |
| 19091 |
[generateCompositeItemIdPrefix] |
| 19092 |
); |
| 19093 |
const [activeCompositeId, setActiveCompositeId] = (0, import_element79.useState)(void 0); |
| 19094 |
const compositeRef = (0, import_element79.useRef)(null); |
| 19095 |
(0, import_element79.useEffect)(() => { |
| 19096 |
if (selectedItem) { |
| 19097 |
setActiveCompositeId( |
| 19098 |
generateItemWrapperCompositeId( |
| 19099 |
generateCompositeItemIdPrefix(selectedItem) |
| 19100 |
) |
| 19101 |
); |
| 19102 |
} |
| 19103 |
}, [selectedItem, generateCompositeItemIdPrefix]); |
| 19104 |
const activeItemIndex = data.findIndex( |
| 19105 |
(item) => isActiveCompositeItem(item, activeCompositeId ?? "") |
| 19106 |
); |
| 19107 |
const previousActiveItemIndex = (0, import_compose8.usePrevious)(activeItemIndex); |
| 19108 |
const isActiveIdInList = activeItemIndex !== -1; |
| 19109 |
const selectCompositeItem = (0, import_element79.useCallback)( |
| 19110 |
(targetIndex, generateCompositeId) => { |
| 19111 |
const clampedIndex = Math.min( |
| 19112 |
data.length - 1, |
| 19113 |
Math.max(0, targetIndex) |
| 19114 |
); |
| 19115 |
if (!data[clampedIndex]) { |
| 19116 |
return; |
| 19117 |
} |
| 19118 |
const itemIdPrefix = generateCompositeItemIdPrefix( |
| 19119 |
data[clampedIndex] |
| 19120 |
); |
| 19121 |
const targetCompositeItemId = generateCompositeId(itemIdPrefix); |
| 19122 |
setActiveCompositeId(targetCompositeItemId); |
| 19123 |
if (compositeRef.current?.contains( |
| 19124 |
compositeRef.current.ownerDocument.activeElement |
| 19125 |
)) { |
| 19126 |
document.getElementById(targetCompositeItemId)?.focus(); |
| 19127 |
} |
| 19128 |
}, |
| 19129 |
[data, generateCompositeItemIdPrefix] |
| 19130 |
); |
| 19131 |
(0, import_element79.useEffect)(() => { |
| 19132 |
const wasActiveIdInList = previousActiveItemIndex !== void 0 && previousActiveItemIndex !== -1; |
| 19133 |
if (!isActiveIdInList && wasActiveIdInList) { |
| 19134 |
selectCompositeItem( |
| 19135 |
previousActiveItemIndex, |
| 19136 |
generateItemWrapperCompositeId |
| 19137 |
); |
| 19138 |
} |
| 19139 |
}, [isActiveIdInList, selectCompositeItem, previousActiveItemIndex]); |
| 19140 |
const onDropdownTriggerKeyDown = (0, import_element79.useCallback)( |
| 19141 |
(event) => { |
| 19142 |
if (event.key === "ArrowDown") { |
| 19143 |
event.preventDefault(); |
| 19144 |
selectCompositeItem( |
| 19145 |
activeItemIndex + 1, |
| 19146 |
generateDropdownTriggerCompositeId |
| 19147 |
); |
| 19148 |
} |
| 19149 |
if (event.key === "ArrowUp") { |
| 19150 |
event.preventDefault(); |
| 19151 |
selectCompositeItem( |
| 19152 |
activeItemIndex - 1, |
| 19153 |
generateDropdownTriggerCompositeId |
| 19154 |
); |
| 19155 |
} |
| 19156 |
}, |
| 19157 |
[selectCompositeItem, activeItemIndex] |
| 19158 |
); |
| 19159 |
const hasData = !!data?.length; |
| 19160 |
const groupField = view.groupBy?.field ? fields2.find((field) => field.id === view.groupBy?.field) : null; |
| 19161 |
const dataByGroup = hasData && groupField ? getDataByGroup(data, groupField) : null; |
| 19162 |
const isInfiniteScroll = view.infiniteScrollEnabled && !dataByGroup; |
| 19163 |
if (!hasData) { |
| 19164 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19165 |
"div", |
| 19166 |
{ |
| 19167 |
className: clsx_default("dataviews-no-results", { |
| 19168 |
"is-refreshing": isDelayedLoading |
| 19169 |
}), |
| 19170 |
children: empty |
| 19171 |
} |
| 19172 |
); |
| 19173 |
} |
| 19174 |
if (hasData && groupField && dataByGroup) { |
| 19175 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19176 |
import_components12.Composite, |
| 19177 |
{ |
| 19178 |
ref: compositeRef, |
| 19179 |
id: `${baseId}`, |
| 19180 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", {}), |
| 19181 |
className: "dataviews-view-list__group", |
| 19182 |
role: "grid", |
| 19183 |
activeId: activeCompositeId, |
| 19184 |
setActiveId: setActiveCompositeId, |
| 19185 |
children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19186 |
Stack, |
| 19187 |
{ |
| 19188 |
direction: "column", |
| 19189 |
gap: "lg", |
| 19190 |
className: clsx_default("dataviews-view-list", className), |
| 19191 |
children: Array.from(dataByGroup.entries()).map( |
| 19192 |
([groupName, groupItems]) => /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)( |
| 19193 |
Stack, |
| 19194 |
{ |
| 19195 |
direction: "column", |
| 19196 |
gap: "sm", |
| 19197 |
children: [ |
| 19198 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)("h3", { className: "dataviews-view-list__group-header", children: view.groupBy?.showLabel === false ? groupName : (0, import_i18n20.sprintf)( |
| 19199 |
// translators: 1: The label of the field e.g. "Date". 2: The value of the field, e.g.: "May 2022". |
| 19200 |
(0, import_i18n20.__)("%1$s: %2$s"), |
| 19201 |
groupField.label, |
| 19202 |
groupName |
| 19203 |
) }), |
| 19204 |
groupItems.map((item) => { |
| 19205 |
const id = generateCompositeItemIdPrefix(item); |
| 19206 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19207 |
ListItem, |
| 19208 |
{ |
| 19209 |
view, |
| 19210 |
idPrefix: id, |
| 19211 |
actions, |
| 19212 |
item, |
| 19213 |
isSelected: item === selectedItem, |
| 19214 |
onSelect, |
| 19215 |
mediaField, |
| 19216 |
titleField, |
| 19217 |
descriptionField, |
| 19218 |
otherFields, |
| 19219 |
onDropdownTriggerKeyDown |
| 19220 |
}, |
| 19221 |
id |
| 19222 |
); |
| 19223 |
}) |
| 19224 |
] |
| 19225 |
}, |
| 19226 |
groupName |
| 19227 |
) |
| 19228 |
) |
| 19229 |
} |
| 19230 |
) |
| 19231 |
} |
| 19232 |
); |
| 19233 |
} |
| 19234 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsxs)(import_jsx_runtime99.Fragment, { children: [ |
| 19235 |
/* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19236 |
import_components12.Composite, |
| 19237 |
{ |
| 19238 |
ref: compositeRef, |
| 19239 |
id: baseId, |
| 19240 |
render: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("div", {}), |
| 19241 |
className: clsx_default("dataviews-view-list", className, { |
| 19242 |
[`has-${view.layout?.density}-density`]: view.layout?.density && ["compact", "comfortable"].includes( |
| 19243 |
view.layout.density |
| 19244 |
), |
| 19245 |
"is-refreshing": !isInfiniteScroll && isDelayedLoading |
| 19246 |
}), |
| 19247 |
role: view.infiniteScrollEnabled ? "feed" : "grid", |
| 19248 |
activeId: activeCompositeId, |
| 19249 |
setActiveId: setActiveCompositeId, |
| 19250 |
inert: !isInfiniteScroll && !!isLoading ? "true" : void 0, |
| 19251 |
children: data.map((item, index2) => { |
| 19252 |
const id = generateCompositeItemIdPrefix(item); |
| 19253 |
return /* @__PURE__ */ (0, import_jsx_runtime99.jsx)( |
| 19254 |
ListItem, |
| 19255 |
{ |
| 19256 |
view, |
| 19257 |
idPrefix: id, |
| 19258 |
actions, |
| 19259 |
item, |
| 19260 |
isSelected: item === selectedItem, |
| 19261 |
onSelect, |
| 19262 |
mediaField, |
| 19263 |
titleField, |
| 19264 |
descriptionField, |
| 19265 |
otherFields, |
| 19266 |
onDropdownTriggerKeyDown, |
| 19267 |
posinset: view.infiniteScrollEnabled ? index2 + 1 : void 0 |
| 19268 |
}, |
| 19269 |
id |
| 19270 |
); |
| 19271 |
}) |
| 19272 |
} |
| 19273 |
), |
| 19274 |
isInfiniteScroll && isLoading && /* @__PURE__ */ (0, import_jsx_runtime99.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime99.jsx)(import_components12.Spinner, {}) }) |
| 19275 |
] }); |
| 19276 |
} |
| 19277 |
|
| 19278 |
// packages/dataviews/build-module/components/dataviews-layouts/activity/index.mjs |
| 19279 |
var import_components13 = __toESM(require_components(), 1); |
| 19280 |
|
| 19281 |
// packages/dataviews/build-module/components/dataviews-layouts/activity/activity-group.mjs |
| 19282 |
var import_i18n21 = __toESM(require_i18n(), 1); |
| 19283 |
var import_element80 = __toESM(require_element(), 1); |
| 19284 |
var import_jsx_runtime100 = __toESM(require_jsx_runtime(), 1); |
| 19285 |
function ActivityGroup({ |
| 19286 |
groupName, |
| 19287 |
groupData, |
| 19288 |
groupField, |
| 19289 |
showLabel = true, |
| 19290 |
children |
| 19291 |
}) { |
| 19292 |
const groupHeader = showLabel ? (0, import_element80.createInterpolateElement)( |
| 19293 |
// translators: %s: The label of the field e.g. "Status". |
| 19294 |
(0, import_i18n21.sprintf)((0, import_i18n21.__)("%s: <groupName />"), groupField.label).trim(), |
| 19295 |
{ |
| 19296 |
groupName: /* @__PURE__ */ (0, import_jsx_runtime100.jsx)( |
| 19297 |
groupField.render, |
| 19298 |
{ |
| 19299 |
item: groupData[0], |
| 19300 |
field: groupField |
| 19301 |
} |
| 19302 |
) |
| 19303 |
} |
| 19304 |
) : /* @__PURE__ */ (0, import_jsx_runtime100.jsx)(groupField.render, { item: groupData[0], field: groupField }); |
| 19305 |
return /* @__PURE__ */ (0, import_jsx_runtime100.jsxs)( |
| 19306 |
Stack, |
| 19307 |
{ |
| 19308 |
direction: "column", |
| 19309 |
className: "dataviews-view-activity__group", |
| 19310 |
children: [ |
| 19311 |
/* @__PURE__ */ (0, import_jsx_runtime100.jsx)("h3", { className: "dataviews-view-activity__group-header", children: groupHeader }), |
| 19312 |
children |
| 19313 |
] |
| 19314 |
}, |
| 19315 |
groupName |
| 19316 |
); |
| 19317 |
} |
| 19318 |
|
| 19319 |
// packages/dataviews/build-module/components/dataviews-layouts/activity/activity-item.mjs |
| 19320 |
var import_element81 = __toESM(require_element(), 1); |
| 19321 |
var import_data5 = __toESM(require_data(), 1); |
| 19322 |
var import_compose9 = __toESM(require_compose(), 1); |
| 19323 |
var import_jsx_runtime101 = __toESM(require_jsx_runtime(), 1); |
| 19324 |
function ActivityItem(props) { |
| 19325 |
const { |
| 19326 |
view, |
| 19327 |
actions, |
| 19328 |
item, |
| 19329 |
titleField, |
| 19330 |
mediaField, |
| 19331 |
descriptionField, |
| 19332 |
otherFields, |
| 19333 |
posinset, |
| 19334 |
onClickItem, |
| 19335 |
renderItemLink, |
| 19336 |
isItemClickable: isItemClickable2 |
| 19337 |
} = props; |
| 19338 |
const { |
| 19339 |
showTitle = true, |
| 19340 |
showMedia = true, |
| 19341 |
showDescription = true, |
| 19342 |
infiniteScrollEnabled |
| 19343 |
} = view; |
| 19344 |
const itemRef = (0, import_element81.useRef)(null); |
| 19345 |
const registry = (0, import_data5.useRegistry)(); |
| 19346 |
const { paginationInfo } = (0, import_element81.useContext)(dataviews_context_default); |
| 19347 |
const { primaryActions, eligibleActions } = (0, import_element81.useMemo)(() => { |
| 19348 |
const _eligibleActions = actions.filter( |
| 19349 |
(action) => !action.isEligible || action.isEligible(item) |
| 19350 |
); |
| 19351 |
const _primaryActions = _eligibleActions.filter( |
| 19352 |
(action) => action.isPrimary |
| 19353 |
); |
| 19354 |
return { |
| 19355 |
primaryActions: _primaryActions, |
| 19356 |
eligibleActions: _eligibleActions |
| 19357 |
}; |
| 19358 |
}, [actions, item]); |
| 19359 |
const isMobileViewport = (0, import_compose9.useViewportMatch)("medium", "<"); |
| 19360 |
const density = view.layout?.density ?? "balanced"; |
| 19361 |
const mediaContent = showMedia && density !== "compact" && mediaField?.render ? /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19362 |
mediaField.render, |
| 19363 |
{ |
| 19364 |
item, |
| 19365 |
field: mediaField, |
| 19366 |
config: { |
| 19367 |
sizes: density === "comfortable" ? "32px" : "24px" |
| 19368 |
} |
| 19369 |
} |
| 19370 |
) : null; |
| 19371 |
const renderedMediaField = /* @__PURE__ */ (0, import_jsx_runtime101.jsx)("div", { className: "dataviews-view-activity__item-type-icon", children: mediaContent || /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19372 |
"span", |
| 19373 |
{ |
| 19374 |
className: "dataviews-view-activity__item-bullet", |
| 19375 |
"aria-hidden": "true" |
| 19376 |
} |
| 19377 |
) }); |
| 19378 |
const renderedTitleField = showTitle && titleField?.render ? /* @__PURE__ */ (0, import_jsx_runtime101.jsx)(titleField.render, { item, field: titleField }) : null; |
| 19379 |
const verticalGap = (0, import_element81.useMemo)(() => { |
| 19380 |
switch (density) { |
| 19381 |
case "comfortable": |
| 19382 |
return "md"; |
| 19383 |
default: |
| 19384 |
return "sm"; |
| 19385 |
} |
| 19386 |
}, [density]); |
| 19387 |
return /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19388 |
"div", |
| 19389 |
{ |
| 19390 |
ref: itemRef, |
| 19391 |
role: infiniteScrollEnabled ? "article" : void 0, |
| 19392 |
"aria-posinset": posinset, |
| 19393 |
"aria-setsize": infiniteScrollEnabled ? paginationInfo.totalItems : void 0, |
| 19394 |
className: clsx_default( |
| 19395 |
"dataviews-view-activity__item", |
| 19396 |
density === "compact" && "is-compact", |
| 19397 |
density === "balanced" && "is-balanced", |
| 19398 |
density === "comfortable" && "is-comfortable" |
| 19399 |
), |
| 19400 |
children: /* @__PURE__ */ (0, import_jsx_runtime101.jsxs)(Stack, { direction: "row", gap: "lg", justify: "start", align: "flex-start", children: [ |
| 19401 |
/* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19402 |
Stack, |
| 19403 |
{ |
| 19404 |
direction: "column", |
| 19405 |
gap: "xs", |
| 19406 |
align: "center", |
| 19407 |
className: "dataviews-view-activity__item-type", |
| 19408 |
children: renderedMediaField |
| 19409 |
} |
| 19410 |
), |
| 19411 |
/* @__PURE__ */ (0, import_jsx_runtime101.jsxs)( |
| 19412 |
Stack, |
| 19413 |
{ |
| 19414 |
direction: "column", |
| 19415 |
gap: verticalGap, |
| 19416 |
align: "flex-start", |
| 19417 |
className: "dataviews-view-activity__item-content", |
| 19418 |
children: [ |
| 19419 |
renderedTitleField && /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19420 |
ItemClickWrapper, |
| 19421 |
{ |
| 19422 |
item, |
| 19423 |
isItemClickable: isItemClickable2, |
| 19424 |
onClickItem, |
| 19425 |
renderItemLink, |
| 19426 |
className: "dataviews-view-activity__item-title", |
| 19427 |
children: renderedTitleField |
| 19428 |
} |
| 19429 |
), |
| 19430 |
showDescription && descriptionField && /* @__PURE__ */ (0, import_jsx_runtime101.jsx)("div", { className: "dataviews-view-activity__item-description", children: /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19431 |
descriptionField.render, |
| 19432 |
{ |
| 19433 |
item, |
| 19434 |
field: descriptionField |
| 19435 |
} |
| 19436 |
) }), |
| 19437 |
/* @__PURE__ */ (0, import_jsx_runtime101.jsx)("div", { className: "dataviews-view-activity__item-fields", children: otherFields.map((field) => /* @__PURE__ */ (0, import_jsx_runtime101.jsxs)( |
| 19438 |
"div", |
| 19439 |
{ |
| 19440 |
className: "dataviews-view-activity__item-field", |
| 19441 |
children: [ |
| 19442 |
/* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19443 |
VisuallyHidden, |
| 19444 |
{ |
| 19445 |
className: "dataviews-view-activity__item-field-label", |
| 19446 |
render: /* @__PURE__ */ (0, import_jsx_runtime101.jsx)("span", {}), |
| 19447 |
children: field.label |
| 19448 |
} |
| 19449 |
), |
| 19450 |
/* @__PURE__ */ (0, import_jsx_runtime101.jsx)("span", { className: "dataviews-view-activity__item-field-value", children: /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19451 |
field.render, |
| 19452 |
{ |
| 19453 |
item, |
| 19454 |
field |
| 19455 |
} |
| 19456 |
) }) |
| 19457 |
] |
| 19458 |
}, |
| 19459 |
field.id |
| 19460 |
)) }), |
| 19461 |
!!primaryActions?.length && /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19462 |
PrimaryActions, |
| 19463 |
{ |
| 19464 |
item, |
| 19465 |
actions: primaryActions, |
| 19466 |
registry, |
| 19467 |
buttonVariant: "secondary" |
| 19468 |
} |
| 19469 |
) |
| 19470 |
] |
| 19471 |
} |
| 19472 |
), |
| 19473 |
(primaryActions.length < eligibleActions.length || // Since we hide primary actions on mobile, we need to show the menu |
| 19474 |
// there if there are any actions at all. |
| 19475 |
isMobileViewport && // At the same time, only show the menu if there are actions to show. |
| 19476 |
eligibleActions.length > 0) && /* @__PURE__ */ (0, import_jsx_runtime101.jsx)("div", { className: "dataviews-view-activity__item-actions", children: /* @__PURE__ */ (0, import_jsx_runtime101.jsx)( |
| 19477 |
ItemActions, |
| 19478 |
{ |
| 19479 |
item, |
| 19480 |
actions: eligibleActions, |
| 19481 |
isCompact: true |
| 19482 |
} |
| 19483 |
) }) |
| 19484 |
] }) |
| 19485 |
} |
| 19486 |
); |
| 19487 |
} |
| 19488 |
var activity_item_default = ActivityItem; |
| 19489 |
|
| 19490 |
// packages/dataviews/build-module/components/dataviews-layouts/activity/activity-items.mjs |
| 19491 |
var import_react19 = __toESM(require_react(), 1); |
| 19492 |
function isDefined3(item) { |
| 19493 |
return !!item; |
| 19494 |
} |
| 19495 |
function ActivityItems(props) { |
| 19496 |
const { data, fields: fields2, getItemId: getItemId2, view } = props; |
| 19497 |
const titleField = fields2.find((field) => field.id === view.titleField); |
| 19498 |
const mediaField = fields2.find((field) => field.id === view.mediaField); |
| 19499 |
const descriptionField = fields2.find( |
| 19500 |
(field) => field.id === view.descriptionField |
| 19501 |
); |
| 19502 |
const otherFields = (view?.fields ?? []).map((fieldId) => fields2.find((f2) => fieldId === f2.id)).filter(isDefined3); |
| 19503 |
return data.map((item, index2) => { |
| 19504 |
return /* @__PURE__ */ (0, import_react19.createElement)( |
| 19505 |
activity_item_default, |
| 19506 |
{ |
| 19507 |
...props, |
| 19508 |
key: getItemId2(item), |
| 19509 |
item, |
| 19510 |
mediaField, |
| 19511 |
titleField, |
| 19512 |
descriptionField, |
| 19513 |
otherFields, |
| 19514 |
posinset: view.infiniteScrollEnabled ? index2 + 1 : void 0 |
| 19515 |
} |
| 19516 |
); |
| 19517 |
}); |
| 19518 |
} |
| 19519 |
|
| 19520 |
// packages/dataviews/build-module/components/dataviews-layouts/activity/index.mjs |
| 19521 |
var import_jsx_runtime102 = __toESM(require_jsx_runtime(), 1); |
| 19522 |
function ViewActivity(props) { |
| 19523 |
const { empty, data, fields: fields2, isLoading, view, className } = props; |
| 19524 |
const isDelayedLoading = useDelayedLoading(!!isLoading); |
| 19525 |
const hasData = !!data?.length; |
| 19526 |
const groupField = view.groupBy?.field ? fields2.find((field) => field.id === view.groupBy?.field) : null; |
| 19527 |
const dataByGroup = hasData && groupField ? getDataByGroup(data, groupField) : null; |
| 19528 |
const isInfiniteScroll = view.infiniteScrollEnabled && !dataByGroup; |
| 19529 |
if (!hasData) { |
| 19530 |
return /* @__PURE__ */ (0, import_jsx_runtime102.jsx)( |
| 19531 |
"div", |
| 19532 |
{ |
| 19533 |
className: clsx_default("dataviews-no-results", { |
| 19534 |
"is-refreshing": isDelayedLoading |
| 19535 |
}), |
| 19536 |
children: empty |
| 19537 |
} |
| 19538 |
); |
| 19539 |
} |
| 19540 |
const isInert2 = !isInfiniteScroll && !!isLoading; |
| 19541 |
const wrapperClassName = clsx_default("dataviews-view-activity", className, { |
| 19542 |
"is-refreshing": !isInfiniteScroll && isDelayedLoading |
| 19543 |
}); |
| 19544 |
const groupedEntries = dataByGroup ? Array.from(dataByGroup.entries()) : []; |
| 19545 |
if (hasData && groupField && dataByGroup) { |
| 19546 |
return /* @__PURE__ */ (0, import_jsx_runtime102.jsx)( |
| 19547 |
Stack, |
| 19548 |
{ |
| 19549 |
direction: "column", |
| 19550 |
gap: "sm", |
| 19551 |
className: wrapperClassName, |
| 19552 |
inert: isInert2 ? "true" : void 0, |
| 19553 |
children: groupedEntries.map( |
| 19554 |
([groupName, groupData]) => /* @__PURE__ */ (0, import_jsx_runtime102.jsx)( |
| 19555 |
ActivityGroup, |
| 19556 |
{ |
| 19557 |
groupName, |
| 19558 |
groupData, |
| 19559 |
groupField, |
| 19560 |
showLabel: view.groupBy?.showLabel !== false, |
| 19561 |
children: /* @__PURE__ */ (0, import_jsx_runtime102.jsx)( |
| 19562 |
ActivityItems, |
| 19563 |
{ |
| 19564 |
...props, |
| 19565 |
data: groupData |
| 19566 |
} |
| 19567 |
) |
| 19568 |
}, |
| 19569 |
groupName |
| 19570 |
) |
| 19571 |
) |
| 19572 |
} |
| 19573 |
); |
| 19574 |
} |
| 19575 |
return /* @__PURE__ */ (0, import_jsx_runtime102.jsxs)(import_jsx_runtime102.Fragment, { children: [ |
| 19576 |
/* @__PURE__ */ (0, import_jsx_runtime102.jsx)( |
| 19577 |
"div", |
| 19578 |
{ |
| 19579 |
className: wrapperClassName, |
| 19580 |
role: view.infiniteScrollEnabled ? "feed" : void 0, |
| 19581 |
inert: isInert2 ? "true" : void 0, |
| 19582 |
children: /* @__PURE__ */ (0, import_jsx_runtime102.jsx)(ActivityItems, { ...props }) |
| 19583 |
} |
| 19584 |
), |
| 19585 |
isInfiniteScroll && isLoading && /* @__PURE__ */ (0, import_jsx_runtime102.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime102.jsx)(import_components13.Spinner, {}) }) |
| 19586 |
] }); |
| 19587 |
} |
| 19588 |
|
| 19589 |
// packages/dataviews/build-module/components/dataviews-layouts/picker-grid/index.mjs |
| 19590 |
var import_components16 = __toESM(require_components(), 1); |
| 19591 |
var import_i18n24 = __toESM(require_i18n(), 1); |
| 19592 |
var import_compose10 = __toESM(require_compose(), 1); |
| 19593 |
var import_element84 = __toESM(require_element(), 1); |
| 19594 |
|
| 19595 |
// packages/dataviews/build-module/components/dataviews-picker-footer/index.mjs |
| 19596 |
var import_components15 = __toESM(require_components(), 1); |
| 19597 |
var import_data6 = __toESM(require_data(), 1); |
| 19598 |
var import_element83 = __toESM(require_element(), 1); |
| 19599 |
var import_i18n23 = __toESM(require_i18n(), 1); |
| 19600 |
|
| 19601 |
// packages/dataviews/build-module/components/dataviews-pagination/index.mjs |
| 19602 |
var import_components14 = __toESM(require_components(), 1); |
| 19603 |
var import_element82 = __toESM(require_element(), 1); |
| 19604 |
var import_i18n22 = __toESM(require_i18n(), 1); |
| 19605 |
var import_jsx_runtime103 = __toESM(require_jsx_runtime(), 1); |
| 19606 |
function DataViewsPagination() { |
| 19607 |
const { |
| 19608 |
view, |
| 19609 |
onChangeView, |
| 19610 |
paginationInfo: { totalItems = 0, totalPages } |
| 19611 |
} = (0, import_element82.useContext)(dataviews_context_default); |
| 19612 |
if (!totalItems || !totalPages || view.infiniteScrollEnabled) { |
| 19613 |
return null; |
| 19614 |
} |
| 19615 |
const currentPage = view.page ?? 1; |
| 19616 |
const pageSelectOptions = Array.from(Array(totalPages)).map( |
| 19617 |
(_, i2) => { |
| 19618 |
const page = i2 + 1; |
| 19619 |
return { |
| 19620 |
value: page.toString(), |
| 19621 |
label: page.toString(), |
| 19622 |
"aria-label": currentPage === page ? (0, import_i18n22.sprintf)( |
| 19623 |
// translators: 1: current page number. 2: total number of pages. |
| 19624 |
(0, import_i18n22.__)("Page %1$d of %2$d"), |
| 19625 |
currentPage, |
| 19626 |
totalPages |
| 19627 |
) : page.toString() |
| 19628 |
}; |
| 19629 |
} |
| 19630 |
); |
| 19631 |
return !!totalItems && totalPages !== 1 && /* @__PURE__ */ (0, import_jsx_runtime103.jsxs)( |
| 19632 |
Stack, |
| 19633 |
{ |
| 19634 |
direction: "row", |
| 19635 |
className: "dataviews-pagination", |
| 19636 |
justify: "end", |
| 19637 |
align: "center", |
| 19638 |
gap: "xl", |
| 19639 |
children: [ |
| 19640 |
/* @__PURE__ */ (0, import_jsx_runtime103.jsx)( |
| 19641 |
Stack, |
| 19642 |
{ |
| 19643 |
direction: "row", |
| 19644 |
justify: "flex-start", |
| 19645 |
align: "center", |
| 19646 |
gap: "xs", |
| 19647 |
className: "dataviews-pagination__page-select", |
| 19648 |
children: (0, import_element82.createInterpolateElement)( |
| 19649 |
(0, import_i18n22.sprintf)( |
| 19650 |
// translators: 1: Current page number, 2: Total number of pages. |
| 19651 |
(0, import_i18n22._x)( |
| 19652 |
"<div>Page</div>%1$s<div>of %2$d</div>", |
| 19653 |
"paging" |
| 19654 |
), |
| 19655 |
"<CurrentPage />", |
| 19656 |
totalPages |
| 19657 |
), |
| 19658 |
{ |
| 19659 |
div: /* @__PURE__ */ (0, import_jsx_runtime103.jsx)("div", { "aria-hidden": true }), |
| 19660 |
// @ts-expect-error — Tag injected via sprintf argument, not visible in format string. |
| 19661 |
CurrentPage: /* @__PURE__ */ (0, import_jsx_runtime103.jsx)( |
| 19662 |
import_components14.SelectControl, |
| 19663 |
{ |
| 19664 |
"aria-label": (0, import_i18n22.__)("Current page"), |
| 19665 |
value: currentPage.toString(), |
| 19666 |
options: pageSelectOptions, |
| 19667 |
onChange: (newValue) => { |
| 19668 |
onChangeView({ |
| 19669 |
...view, |
| 19670 |
page: +newValue |
| 19671 |
}); |
| 19672 |
}, |
| 19673 |
size: "small", |
| 19674 |
variant: "minimal" |
| 19675 |
} |
| 19676 |
) |
| 19677 |
} |
| 19678 |
) |
| 19679 |
} |
| 19680 |
), |
| 19681 |
/* @__PURE__ */ (0, import_jsx_runtime103.jsxs)(Stack, { direction: "row", gap: "xs", align: "center", children: [ |
| 19682 |
/* @__PURE__ */ (0, import_jsx_runtime103.jsx)( |
| 19683 |
import_components14.Button, |
| 19684 |
{ |
| 19685 |
onClick: () => onChangeView({ |
| 19686 |
...view, |
| 19687 |
page: currentPage - 1 |
| 19688 |
}), |
| 19689 |
disabled: currentPage === 1, |
| 19690 |
accessibleWhenDisabled: true, |
| 19691 |
label: (0, import_i18n22.__)("Previous page"), |
| 19692 |
icon: (0, import_i18n22.isRTL)() ? next_default : previous_default, |
| 19693 |
showTooltip: true, |
| 19694 |
size: "compact", |
| 19695 |
tooltipPosition: "top" |
| 19696 |
} |
| 19697 |
), |
| 19698 |
/* @__PURE__ */ (0, import_jsx_runtime103.jsx)( |
| 19699 |
import_components14.Button, |
| 19700 |
{ |
| 19701 |
onClick: () => onChangeView({ ...view, page: currentPage + 1 }), |
| 19702 |
disabled: currentPage >= totalPages, |
| 19703 |
accessibleWhenDisabled: true, |
| 19704 |
label: (0, import_i18n22.__)("Next page"), |
| 19705 |
icon: (0, import_i18n22.isRTL)() ? previous_default : next_default, |
| 19706 |
showTooltip: true, |
| 19707 |
size: "compact", |
| 19708 |
tooltipPosition: "top" |
| 19709 |
} |
| 19710 |
) |
| 19711 |
] }) |
| 19712 |
] |
| 19713 |
} |
| 19714 |
); |
| 19715 |
} |
| 19716 |
var dataviews_pagination_default = (0, import_element82.memo)(DataViewsPagination); |
| 19717 |
|
| 19718 |
// packages/dataviews/build-module/components/dataviews-picker-footer/index.mjs |
| 19719 |
var import_jsx_runtime104 = __toESM(require_jsx_runtime(), 1); |
| 19720 |
var EMPTY_ARRAY2 = []; |
| 19721 |
function useIsMultiselectPicker(actions) { |
| 19722 |
return (0, import_element83.useMemo)(() => { |
| 19723 |
return actions?.every((action) => action.supportsBulk); |
| 19724 |
}, [actions]); |
| 19725 |
} |
| 19726 |
function BulkSelectionCheckbox2({ |
| 19727 |
selection, |
| 19728 |
selectedItems, |
| 19729 |
onChangeSelection, |
| 19730 |
data, |
| 19731 |
getItemId: getItemId2, |
| 19732 |
disableSelectAll = false |
| 19733 |
}) { |
| 19734 |
const hasSelection = selection.length > 0; |
| 19735 |
const areAllSelected = selectedItems.length === data.length; |
| 19736 |
if (disableSelectAll) { |
| 19737 |
return /* @__PURE__ */ (0, import_jsx_runtime104.jsx)( |
| 19738 |
import_components15.CheckboxControl, |
| 19739 |
{ |
| 19740 |
className: "dataviews-view-table-selection-checkbox", |
| 19741 |
checked: hasSelection, |
| 19742 |
disabled: !hasSelection, |
| 19743 |
onChange: () => { |
| 19744 |
onChangeSelection([]); |
| 19745 |
}, |
| 19746 |
"aria-label": (0, import_i18n23.__)("Deselect all") |
| 19747 |
} |
| 19748 |
); |
| 19749 |
} |
| 19750 |
return /* @__PURE__ */ (0, import_jsx_runtime104.jsx)( |
| 19751 |
import_components15.CheckboxControl, |
| 19752 |
{ |
| 19753 |
className: "dataviews-view-table-selection-checkbox", |
| 19754 |
checked: areAllSelected, |
| 19755 |
indeterminate: !areAllSelected && !!selectedItems.length, |
| 19756 |
onChange: () => { |
| 19757 |
if (areAllSelected) { |
| 19758 |
onChangeSelection( |
| 19759 |
selection.filter( |
| 19760 |
(id) => !data.some( |
| 19761 |
(item) => id === getItemId2(item) |
| 19762 |
) |
| 19763 |
) |
| 19764 |
); |
| 19765 |
} else { |
| 19766 |
const selectionSet = /* @__PURE__ */ new Set([ |
| 19767 |
...selection, |
| 19768 |
...data.map((item) => getItemId2(item)) |
| 19769 |
]); |
| 19770 |
onChangeSelection(Array.from(selectionSet)); |
| 19771 |
} |
| 19772 |
}, |
| 19773 |
"aria-label": areAllSelected ? (0, import_i18n23.__)("Deselect all") : (0, import_i18n23.__)("Select all") |
| 19774 |
} |
| 19775 |
); |
| 19776 |
} |
| 19777 |
function ActionButtons({ |
| 19778 |
actions, |
| 19779 |
items, |
| 19780 |
selection |
| 19781 |
}) { |
| 19782 |
const registry = (0, import_data6.useRegistry)(); |
| 19783 |
const [actionInProgress, setActionInProgress] = (0, import_element83.useState)( |
| 19784 |
null |
| 19785 |
); |
| 19786 |
return /* @__PURE__ */ (0, import_jsx_runtime104.jsx)(Stack, { direction: "row", gap: "xs", children: actions.map((action) => { |
| 19787 |
if (!("callback" in action)) { |
| 19788 |
return null; |
| 19789 |
} |
| 19790 |
const { id, label, icon, isPrimary, callback } = action; |
| 19791 |
const _label = typeof label === "string" ? label : label(items); |
| 19792 |
const variant = isPrimary ? "primary" : "tertiary"; |
| 19793 |
const isInProgress = id === actionInProgress; |
| 19794 |
return /* @__PURE__ */ (0, import_jsx_runtime104.jsx)( |
| 19795 |
import_components15.Button, |
| 19796 |
{ |
| 19797 |
accessibleWhenDisabled: true, |
| 19798 |
icon, |
| 19799 |
disabled: isInProgress || !selection?.length, |
| 19800 |
isBusy: isInProgress, |
| 19801 |
onClick: async () => { |
| 19802 |
setActionInProgress(id); |
| 19803 |
await callback(items, { |
| 19804 |
registry |
| 19805 |
}); |
| 19806 |
setActionInProgress(null); |
| 19807 |
}, |
| 19808 |
size: "compact", |
| 19809 |
variant, |
| 19810 |
children: _label |
| 19811 |
}, |
| 19812 |
id |
| 19813 |
); |
| 19814 |
}) }); |
| 19815 |
} |
| 19816 |
function DataViewsPickerFooter() { |
| 19817 |
const { |
| 19818 |
data, |
| 19819 |
selection, |
| 19820 |
onChangeSelection, |
| 19821 |
getItemId: getItemId2, |
| 19822 |
actions = EMPTY_ARRAY2, |
| 19823 |
paginationInfo, |
| 19824 |
view |
| 19825 |
} = (0, import_element83.useContext)(dataviews_context_default); |
| 19826 |
const isMultiselect = useIsMultiselectPicker(actions); |
| 19827 |
const message2 = getFooterMessage( |
| 19828 |
selection.length, |
| 19829 |
data.length, |
| 19830 |
paginationInfo.totalItems, |
| 19831 |
!!view.infiniteScrollEnabled |
| 19832 |
); |
| 19833 |
const selectedItems = (0, import_element83.useMemo)( |
| 19834 |
() => data.filter((item) => selection.includes(getItemId2(item))), |
| 19835 |
[selection, getItemId2, data] |
| 19836 |
); |
| 19837 |
return /* @__PURE__ */ (0, import_jsx_runtime104.jsxs)( |
| 19838 |
Stack, |
| 19839 |
{ |
| 19840 |
direction: "row", |
| 19841 |
justify: "space-between", |
| 19842 |
align: "center", |
| 19843 |
className: "dataviews-footer", |
| 19844 |
gap: "sm", |
| 19845 |
children: [ |
| 19846 |
/* @__PURE__ */ (0, import_jsx_runtime104.jsxs)( |
| 19847 |
Stack, |
| 19848 |
{ |
| 19849 |
direction: "row", |
| 19850 |
className: "dataviews-picker-footer__bulk-selection", |
| 19851 |
gap: "md", |
| 19852 |
align: "center", |
| 19853 |
children: [ |
| 19854 |
isMultiselect && /* @__PURE__ */ (0, import_jsx_runtime104.jsx)( |
| 19855 |
BulkSelectionCheckbox2, |
| 19856 |
{ |
| 19857 |
selection, |
| 19858 |
selectedItems, |
| 19859 |
onChangeSelection, |
| 19860 |
data, |
| 19861 |
getItemId: getItemId2, |
| 19862 |
disableSelectAll: !!view.infiniteScrollEnabled |
| 19863 |
} |
| 19864 |
), |
| 19865 |
/* @__PURE__ */ (0, import_jsx_runtime104.jsx)("span", { className: "dataviews-bulk-actions-footer__item-count", children: message2 }) |
| 19866 |
] |
| 19867 |
} |
| 19868 |
), |
| 19869 |
/* @__PURE__ */ (0, import_jsx_runtime104.jsx)(dataviews_pagination_default, {}), |
| 19870 |
Boolean(actions?.length) && /* @__PURE__ */ (0, import_jsx_runtime104.jsx)("div", { className: "dataviews-picker-footer__actions", children: /* @__PURE__ */ (0, import_jsx_runtime104.jsx)( |
| 19871 |
ActionButtons, |
| 19872 |
{ |
| 19873 |
actions, |
| 19874 |
items: selectedItems, |
| 19875 |
selection |
| 19876 |
} |
| 19877 |
) }) |
| 19878 |
] |
| 19879 |
} |
| 19880 |
); |
| 19881 |
} |
| 19882 |
|
| 19883 |
// packages/dataviews/build-module/components/dataviews-layouts/picker-grid/index.mjs |
| 19884 |
var import_jsx_runtime105 = __toESM(require_jsx_runtime(), 1); |
| 19885 |
var { Badge: WCBadge2 } = unlock3(import_components16.privateApis); |
| 19886 |
function GridItem3({ |
| 19887 |
view, |
| 19888 |
multiselect, |
| 19889 |
selection, |
| 19890 |
onChangeSelection, |
| 19891 |
getItemId: getItemId2, |
| 19892 |
item, |
| 19893 |
mediaField, |
| 19894 |
titleField, |
| 19895 |
descriptionField, |
| 19896 |
regularFields, |
| 19897 |
badgeFields, |
| 19898 |
config, |
| 19899 |
posinset, |
| 19900 |
setsize |
| 19901 |
}) { |
| 19902 |
const { showTitle = true, showMedia = true, showDescription = true } = view; |
| 19903 |
const id = getItemId2(item); |
| 19904 |
const elementRef = (0, import_element84.useRef)(null); |
| 19905 |
const isSelected2 = selection.includes(id); |
| 19906 |
useIntersectionObserver(elementRef, posinset); |
| 19907 |
const renderedMediaField = mediaField?.render ? /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19908 |
mediaField.render, |
| 19909 |
{ |
| 19910 |
item, |
| 19911 |
field: mediaField, |
| 19912 |
config |
| 19913 |
} |
| 19914 |
) : null; |
| 19915 |
const renderedTitleField = showTitle && titleField?.render ? /* @__PURE__ */ (0, import_jsx_runtime105.jsx)(titleField.render, { item, field: titleField }) : null; |
| 19916 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsxs)( |
| 19917 |
import_components16.Composite.Item, |
| 19918 |
{ |
| 19919 |
ref: elementRef, |
| 19920 |
"aria-label": titleField ? titleField.getValue({ item }) || (0, import_i18n24.__)("(no title)") : void 0, |
| 19921 |
render: ({ children, ...props }) => /* @__PURE__ */ (0, import_jsx_runtime105.jsx)(Stack, { direction: "column", children, ...props }), |
| 19922 |
role: "option", |
| 19923 |
"aria-posinset": posinset, |
| 19924 |
"aria-setsize": setsize, |
| 19925 |
className: clsx_default("dataviews-view-picker-grid__card", { |
| 19926 |
"is-selected": isSelected2 |
| 19927 |
}), |
| 19928 |
"aria-selected": isSelected2, |
| 19929 |
onClick: () => { |
| 19930 |
if (isSelected2) { |
| 19931 |
onChangeSelection( |
| 19932 |
selection.filter((itemId) => id !== itemId) |
| 19933 |
); |
| 19934 |
} else { |
| 19935 |
const newSelection = multiselect ? [...selection, id] : [id]; |
| 19936 |
onChangeSelection(newSelection); |
| 19937 |
} |
| 19938 |
}, |
| 19939 |
children: [ |
| 19940 |
showMedia && renderedMediaField && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)("div", { className: "dataviews-view-picker-grid__media", children: renderedMediaField }), |
| 19941 |
showMedia && renderedMediaField && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19942 |
DataViewsSelectionCheckbox, |
| 19943 |
{ |
| 19944 |
item, |
| 19945 |
selection, |
| 19946 |
onChangeSelection, |
| 19947 |
getItemId: getItemId2, |
| 19948 |
titleField, |
| 19949 |
disabled: false, |
| 19950 |
"aria-hidden": true, |
| 19951 |
tabIndex: -1 |
| 19952 |
} |
| 19953 |
), |
| 19954 |
showTitle && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19955 |
Stack, |
| 19956 |
{ |
| 19957 |
direction: "row", |
| 19958 |
justify: "space-between", |
| 19959 |
className: "dataviews-view-picker-grid__title-actions", |
| 19960 |
children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)("div", { className: "dataviews-view-picker-grid__title-field dataviews-title-field", children: renderedTitleField }) |
| 19961 |
} |
| 19962 |
), |
| 19963 |
/* @__PURE__ */ (0, import_jsx_runtime105.jsxs)(Stack, { direction: "column", gap: "xs", children: [ |
| 19964 |
showDescription && descriptionField?.render && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19965 |
descriptionField.render, |
| 19966 |
{ |
| 19967 |
item, |
| 19968 |
field: descriptionField |
| 19969 |
} |
| 19970 |
), |
| 19971 |
!!badgeFields?.length && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19972 |
Stack, |
| 19973 |
{ |
| 19974 |
direction: "row", |
| 19975 |
className: "dataviews-view-picker-grid__badge-fields", |
| 19976 |
gap: "sm", |
| 19977 |
wrap: "wrap", |
| 19978 |
align: "top", |
| 19979 |
justify: "flex-start", |
| 19980 |
children: badgeFields.map((field) => { |
| 19981 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19982 |
WCBadge2, |
| 19983 |
{ |
| 19984 |
className: "dataviews-view-picker-grid__field-value", |
| 19985 |
children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19986 |
field.render, |
| 19987 |
{ |
| 19988 |
item, |
| 19989 |
field |
| 19990 |
} |
| 19991 |
) |
| 19992 |
}, |
| 19993 |
field.id |
| 19994 |
); |
| 19995 |
}) |
| 19996 |
} |
| 19997 |
), |
| 19998 |
!!regularFields?.length && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 19999 |
Stack, |
| 20000 |
{ |
| 20001 |
direction: "column", |
| 20002 |
className: "dataviews-view-picker-grid__fields", |
| 20003 |
gap: "xs", |
| 20004 |
children: regularFields.map((field) => { |
| 20005 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20006 |
import_components16.Flex, |
| 20007 |
{ |
| 20008 |
className: "dataviews-view-picker-grid__field", |
| 20009 |
gap: 1, |
| 20010 |
justify: "flex-start", |
| 20011 |
expanded: true, |
| 20012 |
style: { height: "auto" }, |
| 20013 |
direction: "row", |
| 20014 |
children: /* @__PURE__ */ (0, import_jsx_runtime105.jsxs)(import_jsx_runtime105.Fragment, { children: [ |
| 20015 |
/* @__PURE__ */ (0, import_jsx_runtime105.jsx)(import_components16.FlexItem, { className: "dataviews-view-picker-grid__field-name", children: field.header }), |
| 20016 |
/* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20017 |
import_components16.FlexItem, |
| 20018 |
{ |
| 20019 |
className: "dataviews-view-picker-grid__field-value", |
| 20020 |
style: { maxHeight: "none" }, |
| 20021 |
children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20022 |
field.render, |
| 20023 |
{ |
| 20024 |
item, |
| 20025 |
field |
| 20026 |
} |
| 20027 |
) |
| 20028 |
} |
| 20029 |
) |
| 20030 |
] }) |
| 20031 |
}, |
| 20032 |
field.id |
| 20033 |
); |
| 20034 |
}) |
| 20035 |
} |
| 20036 |
) |
| 20037 |
] }) |
| 20038 |
] |
| 20039 |
}, |
| 20040 |
id |
| 20041 |
); |
| 20042 |
} |
| 20043 |
function GridGroup({ |
| 20044 |
groupName, |
| 20045 |
groupField, |
| 20046 |
showLabel = true, |
| 20047 |
children |
| 20048 |
}) { |
| 20049 |
const headerId = (0, import_compose10.useInstanceId)( |
| 20050 |
GridGroup, |
| 20051 |
"dataviews-view-picker-grid-group__header" |
| 20052 |
); |
| 20053 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsxs)( |
| 20054 |
Stack, |
| 20055 |
{ |
| 20056 |
direction: "column", |
| 20057 |
gap: "sm", |
| 20058 |
role: "group", |
| 20059 |
"aria-labelledby": headerId, |
| 20060 |
children: [ |
| 20061 |
/* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20062 |
"h3", |
| 20063 |
{ |
| 20064 |
className: "dataviews-view-picker-grid-group__header", |
| 20065 |
id: headerId, |
| 20066 |
children: showLabel ? (0, import_i18n24.sprintf)( |
| 20067 |
// translators: 1: The label of the field e.g. "Date". 2: The value of the field, e.g.: "May 2022". |
| 20068 |
(0, import_i18n24.__)("%1$s: %2$s"), |
| 20069 |
groupField.label, |
| 20070 |
groupName |
| 20071 |
) : groupName |
| 20072 |
} |
| 20073 |
), |
| 20074 |
children |
| 20075 |
] |
| 20076 |
}, |
| 20077 |
groupName |
| 20078 |
); |
| 20079 |
} |
| 20080 |
function ViewPickerGrid({ |
| 20081 |
actions, |
| 20082 |
data, |
| 20083 |
fields: fields2, |
| 20084 |
getItemId: getItemId2, |
| 20085 |
isLoading, |
| 20086 |
onChangeSelection, |
| 20087 |
selection, |
| 20088 |
view, |
| 20089 |
className, |
| 20090 |
empty |
| 20091 |
}) { |
| 20092 |
const { resizeObserverRef, paginationInfo, itemListLabel } = (0, import_element84.useContext)(dataviews_context_default); |
| 20093 |
const titleField = fields2.find( |
| 20094 |
(field) => field.id === view?.titleField |
| 20095 |
); |
| 20096 |
const mediaField = fields2.find( |
| 20097 |
(field) => field.id === view?.mediaField |
| 20098 |
); |
| 20099 |
const descriptionField = fields2.find( |
| 20100 |
(field) => field.id === view?.descriptionField |
| 20101 |
); |
| 20102 |
const otherFields = view.fields ?? []; |
| 20103 |
const { regularFields, badgeFields } = otherFields.reduce( |
| 20104 |
(accumulator, fieldId) => { |
| 20105 |
const field = fields2.find((f2) => f2.id === fieldId); |
| 20106 |
if (!field) { |
| 20107 |
return accumulator; |
| 20108 |
} |
| 20109 |
const key2 = view.layout?.badgeFields?.includes(fieldId) ? "badgeFields" : "regularFields"; |
| 20110 |
accumulator[key2].push(field); |
| 20111 |
return accumulator; |
| 20112 |
}, |
| 20113 |
{ regularFields: [], badgeFields: [] } |
| 20114 |
); |
| 20115 |
const hasData = !!data?.length; |
| 20116 |
const usedPreviewSize = view.layout?.previewSize; |
| 20117 |
const isMultiselect = useIsMultiselectPicker(actions); |
| 20118 |
const size4 = "900px"; |
| 20119 |
const groupField = view.groupBy?.field ? fields2.find((f2) => f2.id === view.groupBy?.field) : null; |
| 20120 |
const dataByGroup = groupField ? getDataByGroup(data, groupField) : null; |
| 20121 |
const isInfiniteScroll = (view.infiniteScrollEnabled && !dataByGroup) ?? false; |
| 20122 |
const currentPage = view?.page ?? 1; |
| 20123 |
const perPage = view?.perPage ?? 0; |
| 20124 |
const setSize = isInfiniteScroll ? paginationInfo?.totalItems : void 0; |
| 20125 |
const gridColumns = useGridColumns(); |
| 20126 |
const placeholdersNeeded = usePlaceholdersNeeded( |
| 20127 |
data, |
| 20128 |
isInfiniteScroll, |
| 20129 |
gridColumns |
| 20130 |
); |
| 20131 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsxs)(import_jsx_runtime105.Fragment, { |
| 20132 |
// Render multiple groups. |
| 20133 |
children: [ |
| 20134 |
hasData && groupField && dataByGroup && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20135 |
import_components16.Composite, |
| 20136 |
{ |
| 20137 |
virtualFocus: true, |
| 20138 |
orientation: "horizontal", |
| 20139 |
role: "listbox", |
| 20140 |
"aria-multiselectable": isMultiselect, |
| 20141 |
className: clsx_default( |
| 20142 |
"dataviews-view-picker-grid", |
| 20143 |
className, |
| 20144 |
{ |
| 20145 |
[`has-${view.layout?.density}-density`]: view.layout?.density && ["compact", "comfortable"].includes( |
| 20146 |
view.layout.density |
| 20147 |
) |
| 20148 |
} |
| 20149 |
), |
| 20150 |
"aria-label": itemListLabel, |
| 20151 |
render: ({ children, ...props }) => /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20152 |
Stack, |
| 20153 |
{ |
| 20154 |
direction: "column", |
| 20155 |
gap: "lg", |
| 20156 |
children, |
| 20157 |
...props |
| 20158 |
} |
| 20159 |
), |
| 20160 |
children: Array.from(dataByGroup.entries()).map( |
| 20161 |
([groupName, groupItems]) => /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20162 |
GridGroup, |
| 20163 |
{ |
| 20164 |
groupName, |
| 20165 |
groupField, |
| 20166 |
showLabel: view.groupBy?.showLabel !== false, |
| 20167 |
children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20168 |
GridItems, |
| 20169 |
{ |
| 20170 |
previewSize: usedPreviewSize, |
| 20171 |
style: { |
| 20172 |
gridTemplateColumns: usedPreviewSize && `repeat(auto-fill, minmax(${usedPreviewSize}px, 1fr))` |
| 20173 |
}, |
| 20174 |
"aria-busy": isLoading, |
| 20175 |
ref: resizeObserverRef, |
| 20176 |
children: groupItems.map((item) => { |
| 20177 |
const posInSet = item.position ?? (currentPage - 1) * perPage + data.indexOf(item) + 1; |
| 20178 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20179 |
GridItem3, |
| 20180 |
{ |
| 20181 |
view, |
| 20182 |
multiselect: isMultiselect, |
| 20183 |
selection, |
| 20184 |
onChangeSelection, |
| 20185 |
getItemId: getItemId2, |
| 20186 |
item, |
| 20187 |
mediaField, |
| 20188 |
titleField, |
| 20189 |
descriptionField, |
| 20190 |
regularFields, |
| 20191 |
badgeFields, |
| 20192 |
config: { |
| 20193 |
sizes: size4 |
| 20194 |
}, |
| 20195 |
posinset: posInSet, |
| 20196 |
setsize: setSize |
| 20197 |
}, |
| 20198 |
getItemId2(item) |
| 20199 |
); |
| 20200 |
}) |
| 20201 |
} |
| 20202 |
) |
| 20203 |
}, |
| 20204 |
groupName |
| 20205 |
) |
| 20206 |
) |
| 20207 |
} |
| 20208 |
), |
| 20209 |
// Render a single grid with all data. |
| 20210 |
hasData && !dataByGroup && /* @__PURE__ */ (0, import_jsx_runtime105.jsxs)( |
| 20211 |
import_components16.Composite, |
| 20212 |
{ |
| 20213 |
render: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20214 |
GridItems, |
| 20215 |
{ |
| 20216 |
className: clsx_default( |
| 20217 |
"dataviews-view-picker-grid", |
| 20218 |
className, |
| 20219 |
{ |
| 20220 |
[`has-${view.layout?.density}-density`]: view.layout?.density && [ |
| 20221 |
"compact", |
| 20222 |
"comfortable" |
| 20223 |
].includes(view.layout.density) |
| 20224 |
} |
| 20225 |
), |
| 20226 |
previewSize: usedPreviewSize, |
| 20227 |
"aria-busy": isLoading, |
| 20228 |
ref: resizeObserverRef |
| 20229 |
} |
| 20230 |
), |
| 20231 |
virtualFocus: true, |
| 20232 |
orientation: "horizontal", |
| 20233 |
role: "listbox", |
| 20234 |
"aria-multiselectable": isMultiselect, |
| 20235 |
"aria-label": itemListLabel, |
| 20236 |
children: [ |
| 20237 |
Array.from({ length: placeholdersNeeded }).map( |
| 20238 |
(_, index2) => /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20239 |
import_components16.Composite.Item, |
| 20240 |
{ |
| 20241 |
render: ({ children, ...props }) => /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20242 |
Stack, |
| 20243 |
{ |
| 20244 |
direction: "column", |
| 20245 |
children, |
| 20246 |
...props |
| 20247 |
} |
| 20248 |
), |
| 20249 |
role: "option", |
| 20250 |
"aria-hidden": true, |
| 20251 |
tabIndex: -1, |
| 20252 |
className: "dataviews-view-picker-grid__card dataviews-view-picker-grid__placeholder" |
| 20253 |
}, |
| 20254 |
`placeholder-${index2}` |
| 20255 |
) |
| 20256 |
), |
| 20257 |
data.map((item) => { |
| 20258 |
const posinset = item.position; |
| 20259 |
return /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20260 |
GridItem3, |
| 20261 |
{ |
| 20262 |
view, |
| 20263 |
multiselect: isMultiselect, |
| 20264 |
selection, |
| 20265 |
onChangeSelection, |
| 20266 |
getItemId: getItemId2, |
| 20267 |
item, |
| 20268 |
mediaField, |
| 20269 |
titleField, |
| 20270 |
descriptionField, |
| 20271 |
regularFields, |
| 20272 |
badgeFields, |
| 20273 |
config: { |
| 20274 |
sizes: size4 |
| 20275 |
}, |
| 20276 |
posinset, |
| 20277 |
setsize: setSize |
| 20278 |
}, |
| 20279 |
getItemId2(item) |
| 20280 |
); |
| 20281 |
}) |
| 20282 |
] |
| 20283 |
} |
| 20284 |
), |
| 20285 |
// Render empty state. |
| 20286 |
!hasData && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)( |
| 20287 |
"div", |
| 20288 |
{ |
| 20289 |
className: clsx_default({ |
| 20290 |
"dataviews-loading": isLoading, |
| 20291 |
"dataviews-no-results": !isLoading |
| 20292 |
}), |
| 20293 |
children: isLoading ? /* @__PURE__ */ (0, import_jsx_runtime105.jsx)("p", { children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)(import_components16.Spinner, {}) }) : empty |
| 20294 |
} |
| 20295 |
), |
| 20296 |
hasData && isLoading && /* @__PURE__ */ (0, import_jsx_runtime105.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime105.jsx)(import_components16.Spinner, {}) }) |
| 20297 |
] |
| 20298 |
}); |
| 20299 |
} |
| 20300 |
var picker_grid_default = ViewPickerGrid; |
| 20301 |
|
| 20302 |
// packages/dataviews/build-module/components/dataviews-layouts/picker-table/index.mjs |
| 20303 |
var import_i18n25 = __toESM(require_i18n(), 1); |
| 20304 |
var import_components17 = __toESM(require_components(), 1); |
| 20305 |
var import_element85 = __toESM(require_element(), 1); |
| 20306 |
var import_jsx_runtime106 = __toESM(require_jsx_runtime(), 1); |
| 20307 |
function TableColumnField2({ |
| 20308 |
item, |
| 20309 |
fields: fields2, |
| 20310 |
column, |
| 20311 |
align |
| 20312 |
}) { |
| 20313 |
const field = fields2.find((f2) => f2.id === column); |
| 20314 |
if (!field) { |
| 20315 |
return null; |
| 20316 |
} |
| 20317 |
const className = clsx_default("dataviews-view-table__cell-content-wrapper", { |
| 20318 |
"dataviews-view-table__cell-align-end": align === "end", |
| 20319 |
"dataviews-view-table__cell-align-center": align === "center" |
| 20320 |
}); |
| 20321 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("div", { className, children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)(field.render, { item, field }) }); |
| 20322 |
} |
| 20323 |
function TableRow2({ |
| 20324 |
item, |
| 20325 |
fields: fields2, |
| 20326 |
id, |
| 20327 |
view, |
| 20328 |
titleField, |
| 20329 |
mediaField, |
| 20330 |
descriptionField, |
| 20331 |
selection, |
| 20332 |
getItemId: getItemId2, |
| 20333 |
onChangeSelection, |
| 20334 |
multiselect, |
| 20335 |
posinset |
| 20336 |
}) { |
| 20337 |
const { paginationInfo } = (0, import_element85.useContext)(dataviews_context_default); |
| 20338 |
const isSelected2 = selection.includes(id); |
| 20339 |
const [isHovered, setIsHovered] = (0, import_element85.useState)(false); |
| 20340 |
const elementRef = (0, import_element85.useRef)(null); |
| 20341 |
useIntersectionObserver(elementRef, posinset); |
| 20342 |
const { |
| 20343 |
showTitle = true, |
| 20344 |
showMedia = true, |
| 20345 |
showDescription = true, |
| 20346 |
infiniteScrollEnabled |
| 20347 |
} = view; |
| 20348 |
const handleMouseEnter = () => { |
| 20349 |
setIsHovered(true); |
| 20350 |
}; |
| 20351 |
const handleMouseLeave = () => { |
| 20352 |
setIsHovered(false); |
| 20353 |
}; |
| 20354 |
const columns = view.fields ?? []; |
| 20355 |
const hasPrimaryColumn = titleField && showTitle || mediaField && showMedia || descriptionField && showDescription; |
| 20356 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsxs)( |
| 20357 |
import_components17.Composite.Item, |
| 20358 |
{ |
| 20359 |
ref: elementRef, |
| 20360 |
render: ({ children, ...props }) => /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20361 |
"tr", |
| 20362 |
{ |
| 20363 |
className: clsx_default("dataviews-view-table__row", { |
| 20364 |
"is-selected": isSelected2, |
| 20365 |
"is-hovered": isHovered |
| 20366 |
}), |
| 20367 |
onMouseEnter: handleMouseEnter, |
| 20368 |
onMouseLeave: handleMouseLeave, |
| 20369 |
children, |
| 20370 |
...props |
| 20371 |
} |
| 20372 |
), |
| 20373 |
"aria-selected": isSelected2, |
| 20374 |
"aria-setsize": paginationInfo.totalItems || void 0, |
| 20375 |
"aria-posinset": posinset, |
| 20376 |
role: infiniteScrollEnabled ? "article" : "option", |
| 20377 |
onClick: () => { |
| 20378 |
if (isSelected2) { |
| 20379 |
onChangeSelection( |
| 20380 |
selection.filter((itemId) => id !== itemId) |
| 20381 |
); |
| 20382 |
} else { |
| 20383 |
const newSelection = multiselect ? [...selection, id] : [id]; |
| 20384 |
onChangeSelection(newSelection); |
| 20385 |
} |
| 20386 |
}, |
| 20387 |
children: [ |
| 20388 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20389 |
"td", |
| 20390 |
{ |
| 20391 |
className: "dataviews-view-table__checkbox-column", |
| 20392 |
role: "presentation", |
| 20393 |
children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("div", { className: "dataviews-view-table__cell-content-wrapper", children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20394 |
DataViewsSelectionCheckbox, |
| 20395 |
{ |
| 20396 |
item, |
| 20397 |
selection, |
| 20398 |
onChangeSelection, |
| 20399 |
getItemId: getItemId2, |
| 20400 |
titleField, |
| 20401 |
disabled: false, |
| 20402 |
"aria-hidden": true, |
| 20403 |
tabIndex: -1 |
| 20404 |
} |
| 20405 |
) }) |
| 20406 |
} |
| 20407 |
), |
| 20408 |
hasPrimaryColumn && /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20409 |
"td", |
| 20410 |
{ |
| 20411 |
role: "presentation", |
| 20412 |
children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20413 |
column_primary_default, |
| 20414 |
{ |
| 20415 |
item, |
| 20416 |
titleField: showTitle ? titleField : void 0, |
| 20417 |
mediaField: showMedia ? mediaField : void 0, |
| 20418 |
descriptionField: showDescription ? descriptionField : void 0, |
| 20419 |
isItemClickable: () => false |
| 20420 |
} |
| 20421 |
) |
| 20422 |
} |
| 20423 |
), |
| 20424 |
columns.map((column) => { |
| 20425 |
const { width, maxWidth, minWidth, align } = view.layout?.styles?.[column] ?? {}; |
| 20426 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20427 |
"td", |
| 20428 |
{ |
| 20429 |
style: { |
| 20430 |
width, |
| 20431 |
maxWidth, |
| 20432 |
minWidth |
| 20433 |
}, |
| 20434 |
role: "presentation", |
| 20435 |
children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20436 |
TableColumnField2, |
| 20437 |
{ |
| 20438 |
fields: fields2, |
| 20439 |
item, |
| 20440 |
column, |
| 20441 |
align |
| 20442 |
} |
| 20443 |
) |
| 20444 |
}, |
| 20445 |
column |
| 20446 |
); |
| 20447 |
}) |
| 20448 |
] |
| 20449 |
}, |
| 20450 |
id |
| 20451 |
); |
| 20452 |
} |
| 20453 |
function ViewPickerTable({ |
| 20454 |
actions, |
| 20455 |
data, |
| 20456 |
fields: fields2, |
| 20457 |
getItemId: getItemId2, |
| 20458 |
isLoading = false, |
| 20459 |
onChangeView, |
| 20460 |
onChangeSelection, |
| 20461 |
selection, |
| 20462 |
setOpenedFilter, |
| 20463 |
view, |
| 20464 |
className, |
| 20465 |
empty |
| 20466 |
}) { |
| 20467 |
const headerMenuRefs = (0, import_element85.useRef)(/* @__PURE__ */ new Map()); |
| 20468 |
const headerMenuToFocusRef = (0, import_element85.useRef)(void 0); |
| 20469 |
const [nextHeaderMenuToFocus, setNextHeaderMenuToFocus] = (0, import_element85.useState)(); |
| 20470 |
const isMultiselect = useIsMultiselectPicker(actions) ?? false; |
| 20471 |
(0, import_element85.useEffect)(() => { |
| 20472 |
if (headerMenuToFocusRef.current) { |
| 20473 |
headerMenuToFocusRef.current.focus(); |
| 20474 |
headerMenuToFocusRef.current = void 0; |
| 20475 |
} |
| 20476 |
}); |
| 20477 |
const groupField = view.groupBy?.field ? fields2.find((f2) => f2.id === view.groupBy?.field) : null; |
| 20478 |
const dataByGroup = groupField ? getDataByGroup(data, groupField) : null; |
| 20479 |
const isInfiniteScroll = view.infiniteScrollEnabled && !dataByGroup; |
| 20480 |
const tableNoticeId = (0, import_element85.useId)(); |
| 20481 |
if (nextHeaderMenuToFocus) { |
| 20482 |
headerMenuToFocusRef.current = nextHeaderMenuToFocus; |
| 20483 |
setNextHeaderMenuToFocus(void 0); |
| 20484 |
return; |
| 20485 |
} |
| 20486 |
const onHide = (field) => { |
| 20487 |
const hidden = headerMenuRefs.current.get(field.id); |
| 20488 |
const fallback = hidden ? headerMenuRefs.current.get(hidden.fallback) : void 0; |
| 20489 |
setNextHeaderMenuToFocus(fallback?.node); |
| 20490 |
}; |
| 20491 |
const hasData = !!data?.length; |
| 20492 |
const titleField = fields2.find((field) => field.id === view.titleField); |
| 20493 |
const mediaField = fields2.find((field) => field.id === view.mediaField); |
| 20494 |
const descriptionField = fields2.find( |
| 20495 |
(field) => field.id === view.descriptionField |
| 20496 |
); |
| 20497 |
const { showTitle = true, showMedia = true, showDescription = true } = view; |
| 20498 |
const hasPrimaryColumn = titleField && showTitle || mediaField && showMedia || descriptionField && showDescription; |
| 20499 |
const columns = view.fields ?? []; |
| 20500 |
const headerMenuRef = (column, index2) => (node) => { |
| 20501 |
if (node) { |
| 20502 |
headerMenuRefs.current.set(column, { |
| 20503 |
node, |
| 20504 |
fallback: columns[index2 > 0 ? index2 - 1 : 1] |
| 20505 |
}); |
| 20506 |
} else { |
| 20507 |
headerMenuRefs.current.delete(column); |
| 20508 |
} |
| 20509 |
}; |
| 20510 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsxs)(import_jsx_runtime106.Fragment, { children: [ |
| 20511 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsxs)( |
| 20512 |
"table", |
| 20513 |
{ |
| 20514 |
className: clsx_default( |
| 20515 |
"dataviews-view-table", |
| 20516 |
"dataviews-view-picker-table", |
| 20517 |
className, |
| 20518 |
{ |
| 20519 |
[`has-${view.layout?.density}-density`]: view.layout?.density && ["compact", "comfortable"].includes( |
| 20520 |
view.layout.density |
| 20521 |
) |
| 20522 |
} |
| 20523 |
), |
| 20524 |
"aria-busy": isLoading, |
| 20525 |
"aria-describedby": tableNoticeId, |
| 20526 |
role: isInfiniteScroll ? "feed" : "listbox", |
| 20527 |
children: [ |
| 20528 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsx)("thead", { role: "presentation", children: /* @__PURE__ */ (0, import_jsx_runtime106.jsxs)( |
| 20529 |
"tr", |
| 20530 |
{ |
| 20531 |
className: "dataviews-view-table__row", |
| 20532 |
role: "presentation", |
| 20533 |
children: [ |
| 20534 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsx)("th", { className: "dataviews-view-table__checkbox-column", children: isMultiselect && /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20535 |
BulkSelectionCheckbox, |
| 20536 |
{ |
| 20537 |
selection, |
| 20538 |
onChangeSelection, |
| 20539 |
data, |
| 20540 |
actions, |
| 20541 |
getItemId: getItemId2, |
| 20542 |
disableSelectAll: isInfiniteScroll |
| 20543 |
} |
| 20544 |
) }), |
| 20545 |
hasPrimaryColumn && /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("th", { children: titleField && /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20546 |
column_header_menu_default, |
| 20547 |
{ |
| 20548 |
ref: headerMenuRef( |
| 20549 |
titleField.id, |
| 20550 |
0 |
| 20551 |
), |
| 20552 |
fieldId: titleField.id, |
| 20553 |
view, |
| 20554 |
fields: fields2, |
| 20555 |
onChangeView, |
| 20556 |
onHide, |
| 20557 |
setOpenedFilter, |
| 20558 |
canMove: false |
| 20559 |
} |
| 20560 |
) }), |
| 20561 |
columns.map((column, index2) => { |
| 20562 |
const { width, maxWidth, minWidth, align } = view.layout?.styles?.[column] ?? {}; |
| 20563 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20564 |
"th", |
| 20565 |
{ |
| 20566 |
style: { |
| 20567 |
width, |
| 20568 |
maxWidth, |
| 20569 |
minWidth, |
| 20570 |
textAlign: align |
| 20571 |
}, |
| 20572 |
"aria-sort": view.sort?.direction && view.sort?.field === column ? sortValues[view.sort.direction] : void 0, |
| 20573 |
scope: "col", |
| 20574 |
children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20575 |
column_header_menu_default, |
| 20576 |
{ |
| 20577 |
ref: headerMenuRef(column, index2), |
| 20578 |
fieldId: column, |
| 20579 |
view, |
| 20580 |
fields: fields2, |
| 20581 |
onChangeView, |
| 20582 |
onHide, |
| 20583 |
setOpenedFilter, |
| 20584 |
canMove: view.layout?.enableMoving ?? true |
| 20585 |
} |
| 20586 |
) |
| 20587 |
}, |
| 20588 |
column |
| 20589 |
); |
| 20590 |
}) |
| 20591 |
] |
| 20592 |
} |
| 20593 |
) }), |
| 20594 |
hasData && groupField && dataByGroup ? Array.from(dataByGroup.entries()).map( |
| 20595 |
([groupName, groupItems]) => /* @__PURE__ */ (0, import_jsx_runtime106.jsxs)( |
| 20596 |
import_components17.Composite, |
| 20597 |
{ |
| 20598 |
virtualFocus: true, |
| 20599 |
orientation: "vertical", |
| 20600 |
render: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("tbody", { role: "group" }), |
| 20601 |
children: [ |
| 20602 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20603 |
"tr", |
| 20604 |
{ |
| 20605 |
className: "dataviews-view-table__group-header-row", |
| 20606 |
role: "presentation", |
| 20607 |
children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20608 |
"td", |
| 20609 |
{ |
| 20610 |
colSpan: columns.length + (hasPrimaryColumn ? 1 : 0) + 1, |
| 20611 |
className: "dataviews-view-table__group-header-cell", |
| 20612 |
role: "presentation", |
| 20613 |
children: view.groupBy?.showLabel === false ? groupName : (0, import_i18n25.sprintf)( |
| 20614 |
// translators: 1: The label of the field e.g. "Date". 2: The value of the field, e.g.: "May 2022". |
| 20615 |
(0, import_i18n25.__)("%1$s: %2$s"), |
| 20616 |
groupField.label, |
| 20617 |
groupName |
| 20618 |
) |
| 20619 |
} |
| 20620 |
) |
| 20621 |
} |
| 20622 |
), |
| 20623 |
groupItems.map((item, index2) => /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20624 |
TableRow2, |
| 20625 |
{ |
| 20626 |
item, |
| 20627 |
fields: fields2, |
| 20628 |
id: getItemId2(item) || index2.toString(), |
| 20629 |
view, |
| 20630 |
titleField, |
| 20631 |
mediaField, |
| 20632 |
descriptionField, |
| 20633 |
selection, |
| 20634 |
getItemId: getItemId2, |
| 20635 |
onChangeSelection, |
| 20636 |
multiselect: isMultiselect |
| 20637 |
}, |
| 20638 |
getItemId2(item) |
| 20639 |
)) |
| 20640 |
] |
| 20641 |
}, |
| 20642 |
`group-${groupName}` |
| 20643 |
) |
| 20644 |
) : /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20645 |
import_components17.Composite, |
| 20646 |
{ |
| 20647 |
render: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("tbody", { role: "presentation" }), |
| 20648 |
virtualFocus: true, |
| 20649 |
orientation: "vertical", |
| 20650 |
children: hasData && data.map((item, index2) => { |
| 20651 |
const itemId = getItemId2(item); |
| 20652 |
const posinset = item.position; |
| 20653 |
return /* @__PURE__ */ (0, import_jsx_runtime106.jsx)( |
| 20654 |
TableRow2, |
| 20655 |
{ |
| 20656 |
item, |
| 20657 |
fields: fields2, |
| 20658 |
id: itemId || index2.toString(), |
| 20659 |
view, |
| 20660 |
titleField, |
| 20661 |
mediaField, |
| 20662 |
descriptionField, |
| 20663 |
selection, |
| 20664 |
getItemId: getItemId2, |
| 20665 |
onChangeSelection, |
| 20666 |
multiselect: isMultiselect, |
| 20667 |
posinset |
| 20668 |
}, |
| 20669 |
itemId |
| 20670 |
); |
| 20671 |
}) |
| 20672 |
} |
| 20673 |
) |
| 20674 |
] |
| 20675 |
} |
| 20676 |
), |
| 20677 |
/* @__PURE__ */ (0, import_jsx_runtime106.jsxs)( |
| 20678 |
"div", |
| 20679 |
{ |
| 20680 |
className: clsx_default({ |
| 20681 |
"dataviews-loading": isLoading, |
| 20682 |
"dataviews-no-results": !hasData && !isLoading |
| 20683 |
}), |
| 20684 |
id: tableNoticeId, |
| 20685 |
children: [ |
| 20686 |
!hasData && (isLoading ? /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("p", { children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)(import_components17.Spinner, {}) }) : empty), |
| 20687 |
hasData && isLoading && /* @__PURE__ */ (0, import_jsx_runtime106.jsx)("p", { className: "dataviews-loading-more", children: /* @__PURE__ */ (0, import_jsx_runtime106.jsx)(import_components17.Spinner, {}) }) |
| 20688 |
] |
| 20689 |
} |
| 20690 |
) |
| 20691 |
] }); |
| 20692 |
} |
| 20693 |
var picker_table_default = ViewPickerTable; |
| 20694 |
|
| 20695 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/density-picker.mjs |
| 20696 |
var import_components18 = __toESM(require_components(), 1); |
| 20697 |
var import_i18n26 = __toESM(require_i18n(), 1); |
| 20698 |
var import_element86 = __toESM(require_element(), 1); |
| 20699 |
var import_jsx_runtime107 = __toESM(require_jsx_runtime(), 1); |
| 20700 |
function DensityPicker() { |
| 20701 |
const context = (0, import_element86.useContext)(dataviews_context_default); |
| 20702 |
const view = context.view; |
| 20703 |
return /* @__PURE__ */ (0, import_jsx_runtime107.jsxs)( |
| 20704 |
import_components18.__experimentalToggleGroupControl, |
| 20705 |
{ |
| 20706 |
size: "__unstable-large", |
| 20707 |
label: (0, import_i18n26.__)("Density"), |
| 20708 |
value: view.layout?.density || "balanced", |
| 20709 |
onChange: (value) => { |
| 20710 |
context.onChangeView({ |
| 20711 |
...view, |
| 20712 |
layout: { |
| 20713 |
...view.layout, |
| 20714 |
density: value |
| 20715 |
} |
| 20716 |
}); |
| 20717 |
}, |
| 20718 |
isBlock: true, |
| 20719 |
children: [ |
| 20720 |
/* @__PURE__ */ (0, import_jsx_runtime107.jsx)( |
| 20721 |
import_components18.__experimentalToggleGroupControlOption, |
| 20722 |
{ |
| 20723 |
value: "comfortable", |
| 20724 |
label: (0, import_i18n26._x)( |
| 20725 |
"Comfortable", |
| 20726 |
"Density option for DataView layout" |
| 20727 |
) |
| 20728 |
}, |
| 20729 |
"comfortable" |
| 20730 |
), |
| 20731 |
/* @__PURE__ */ (0, import_jsx_runtime107.jsx)( |
| 20732 |
import_components18.__experimentalToggleGroupControlOption, |
| 20733 |
{ |
| 20734 |
value: "balanced", |
| 20735 |
label: (0, import_i18n26._x)("Balanced", "Density option for DataView layout") |
| 20736 |
}, |
| 20737 |
"balanced" |
| 20738 |
), |
| 20739 |
/* @__PURE__ */ (0, import_jsx_runtime107.jsx)( |
| 20740 |
import_components18.__experimentalToggleGroupControlOption, |
| 20741 |
{ |
| 20742 |
value: "compact", |
| 20743 |
label: (0, import_i18n26._x)("Compact", "Density option for DataView layout") |
| 20744 |
}, |
| 20745 |
"compact" |
| 20746 |
) |
| 20747 |
] |
| 20748 |
} |
| 20749 |
); |
| 20750 |
} |
| 20751 |
|
| 20752 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/preview-size-picker.mjs |
| 20753 |
var import_components19 = __toESM(require_components(), 1); |
| 20754 |
var import_i18n27 = __toESM(require_i18n(), 1); |
| 20755 |
var import_element87 = __toESM(require_element(), 1); |
| 20756 |
var import_jsx_runtime108 = __toESM(require_jsx_runtime(), 1); |
| 20757 |
var imageSizes2 = [ |
| 20758 |
{ |
| 20759 |
value: 120, |
| 20760 |
breakpoint: 1 |
| 20761 |
}, |
| 20762 |
{ |
| 20763 |
value: 170, |
| 20764 |
breakpoint: 1 |
| 20765 |
}, |
| 20766 |
{ |
| 20767 |
value: 230, |
| 20768 |
breakpoint: 1 |
| 20769 |
}, |
| 20770 |
{ |
| 20771 |
value: 290, |
| 20772 |
breakpoint: 1112 |
| 20773 |
// at minimum image width, 4 images display at this container size |
| 20774 |
}, |
| 20775 |
{ |
| 20776 |
value: 350, |
| 20777 |
breakpoint: 1636 |
| 20778 |
// at minimum image width, 6 images display at this container size |
| 20779 |
}, |
| 20780 |
{ |
| 20781 |
value: 430, |
| 20782 |
breakpoint: 588 |
| 20783 |
// at minimum image width, 2 images display at this container size |
| 20784 |
} |
| 20785 |
]; |
| 20786 |
function PreviewSizePicker() { |
| 20787 |
const context = (0, import_element87.useContext)(dataviews_context_default); |
| 20788 |
const view = context.view; |
| 20789 |
const breakValues = imageSizes2.filter((size4) => { |
| 20790 |
return context.containerWidth >= size4.breakpoint; |
| 20791 |
}); |
| 20792 |
const layoutPreviewSize = view.layout?.previewSize ?? 230; |
| 20793 |
const previewSizeToUse = breakValues.map((size4, index2) => ({ ...size4, index: index2 })).filter((size4) => size4.value <= layoutPreviewSize).sort((a2, b2) => b2.value - a2.value)[0]?.index ?? 0; |
| 20794 |
const marks = breakValues.map((size4, index2) => { |
| 20795 |
return { |
| 20796 |
value: index2 |
| 20797 |
}; |
| 20798 |
}); |
| 20799 |
return /* @__PURE__ */ (0, import_jsx_runtime108.jsx)( |
| 20800 |
import_components19.RangeControl, |
| 20801 |
{ |
| 20802 |
__next40pxDefaultSize: true, |
| 20803 |
showTooltip: false, |
| 20804 |
label: (0, import_i18n27.__)("Preview size"), |
| 20805 |
value: previewSizeToUse, |
| 20806 |
min: 0, |
| 20807 |
max: breakValues.length - 1, |
| 20808 |
withInputField: false, |
| 20809 |
onChange: (value = 0) => { |
| 20810 |
context.onChangeView({ |
| 20811 |
...view, |
| 20812 |
layout: { |
| 20813 |
...view.layout, |
| 20814 |
previewSize: breakValues[value].value |
| 20815 |
} |
| 20816 |
}); |
| 20817 |
}, |
| 20818 |
step: 1, |
| 20819 |
marks |
| 20820 |
} |
| 20821 |
); |
| 20822 |
} |
| 20823 |
|
| 20824 |
// packages/dataviews/build-module/components/dataviews-layouts/utils/grid-config-options.mjs |
| 20825 |
var import_jsx_runtime109 = __toESM(require_jsx_runtime(), 1); |
| 20826 |
function GridConfigOptions() { |
| 20827 |
return /* @__PURE__ */ (0, import_jsx_runtime109.jsxs)(import_jsx_runtime109.Fragment, { children: [ |
| 20828 |
/* @__PURE__ */ (0, import_jsx_runtime109.jsx)(DensityPicker, {}), |
| 20829 |
/* @__PURE__ */ (0, import_jsx_runtime109.jsx)(PreviewSizePicker, {}) |
| 20830 |
] }); |
| 20831 |
} |
| 20832 |
|
| 20833 |
// packages/dataviews/build-module/components/dataviews-layouts/index.mjs |
| 20834 |
var VIEW_LAYOUTS = [ |
| 20835 |
{ |
| 20836 |
type: LAYOUT_TABLE, |
| 20837 |
label: (0, import_i18n28.__)("Table"), |
| 20838 |
component: table_default, |
| 20839 |
icon: block_table_default, |
| 20840 |
viewConfigOptions: DensityPicker |
| 20841 |
}, |
| 20842 |
{ |
| 20843 |
type: LAYOUT_GRID, |
| 20844 |
label: (0, import_i18n28.__)("Grid"), |
| 20845 |
component: grid_default, |
| 20846 |
icon: category_default, |
| 20847 |
viewConfigOptions: GridConfigOptions |
| 20848 |
}, |
| 20849 |
{ |
| 20850 |
type: LAYOUT_LIST, |
| 20851 |
label: (0, import_i18n28.__)("List"), |
| 20852 |
component: ViewList, |
| 20853 |
icon: (0, import_i18n28.isRTL)() ? format_list_bullets_rtl_default : format_list_bullets_default, |
| 20854 |
viewConfigOptions: DensityPicker |
| 20855 |
}, |
| 20856 |
{ |
| 20857 |
type: LAYOUT_ACTIVITY, |
| 20858 |
label: (0, import_i18n28.__)("Activity"), |
| 20859 |
component: ViewActivity, |
| 20860 |
icon: scheduled_default, |
| 20861 |
viewConfigOptions: DensityPicker |
| 20862 |
}, |
| 20863 |
{ |
| 20864 |
type: LAYOUT_PICKER_GRID, |
| 20865 |
label: (0, import_i18n28.__)("Grid"), |
| 20866 |
component: picker_grid_default, |
| 20867 |
icon: category_default, |
| 20868 |
viewConfigOptions: GridConfigOptions, |
| 20869 |
isPicker: true |
| 20870 |
}, |
| 20871 |
{ |
| 20872 |
type: LAYOUT_PICKER_TABLE, |
| 20873 |
label: (0, import_i18n28.__)("Table"), |
| 20874 |
component: picker_table_default, |
| 20875 |
icon: block_table_default, |
| 20876 |
viewConfigOptions: DensityPicker, |
| 20877 |
isPicker: true |
| 20878 |
} |
| 20879 |
]; |
| 20880 |
|
| 20881 |
// packages/dataviews/build-module/components/dataviews-filters/filters.mjs |
| 20882 |
var import_element95 = __toESM(require_element(), 1); |
| 20883 |
|
| 20884 |
// packages/dataviews/build-module/components/dataviews-filters/filter.mjs |
| 20885 |
var import_components22 = __toESM(require_components(), 1); |
| 20886 |
var import_i18n31 = __toESM(require_i18n(), 1); |
| 20887 |
var import_element92 = __toESM(require_element(), 1); |
| 20888 |
|
| 20889 |
// node_modules/@ariakit/core/esm/__chunks/XMCVU3LR.js |
| 20890 |
function noop5(..._) { |
| 20891 |
} |
| 20892 |
function applyState(argument, currentValue) { |
| 20893 |
if (isUpdater(argument)) { |
| 20894 |
const value = isLazyValue(currentValue) ? currentValue() : currentValue; |
| 20895 |
return argument(value); |
| 20896 |
} |
| 20897 |
return argument; |
| 20898 |
} |
| 20899 |
function isUpdater(argument) { |
| 20900 |
return typeof argument === "function"; |
| 20901 |
} |
| 20902 |
function isLazyValue(value) { |
| 20903 |
return typeof value === "function"; |
| 20904 |
} |
| 20905 |
function hasOwnProperty(object, prop) { |
| 20906 |
if (typeof Object.hasOwn === "function") { |
| 20907 |
return Object.hasOwn(object, prop); |
| 20908 |
} |
| 20909 |
return Object.prototype.hasOwnProperty.call(object, prop); |
| 20910 |
} |
| 20911 |
function chain(...fns) { |
| 20912 |
return (...args) => { |
| 20913 |
for (const fn of fns) { |
| 20914 |
if (typeof fn === "function") { |
| 20915 |
fn(...args); |
| 20916 |
} |
| 20917 |
} |
| 20918 |
}; |
| 20919 |
} |
| 20920 |
function normalizeString(str) { |
| 20921 |
return str.normalize("NFD").replace(/[\u0300-\u036f]/g, ""); |
| 20922 |
} |
| 20923 |
function omit(object, keys) { |
| 20924 |
const result = { ...object }; |
| 20925 |
for (const key2 of keys) { |
| 20926 |
if (hasOwnProperty(result, key2)) { |
| 20927 |
delete result[key2]; |
| 20928 |
} |
| 20929 |
} |
| 20930 |
return result; |
| 20931 |
} |
| 20932 |
function pick(object, paths) { |
| 20933 |
const result = {}; |
| 20934 |
for (const key2 of paths) { |
| 20935 |
if (hasOwnProperty(object, key2)) { |
| 20936 |
result[key2] = object[key2]; |
| 20937 |
} |
| 20938 |
} |
| 20939 |
return result; |
| 20940 |
} |
| 20941 |
function identity(value) { |
| 20942 |
return value; |
| 20943 |
} |
| 20944 |
function invariant(condition, message2) { |
| 20945 |
if (condition) return; |
| 20946 |
if (typeof message2 !== "string") throw new Error("Invariant failed"); |
| 20947 |
throw new Error(message2); |
| 20948 |
} |
| 20949 |
function getKeys(obj) { |
| 20950 |
return Object.keys(obj); |
| 20951 |
} |
| 20952 |
function isFalsyBooleanCallback(booleanOrCallback, ...args) { |
| 20953 |
const result = typeof booleanOrCallback === "function" ? booleanOrCallback(...args) : booleanOrCallback; |
| 20954 |
if (result == null) return false; |
| 20955 |
return !result; |
| 20956 |
} |
| 20957 |
function disabledFromProps(props) { |
| 20958 |
return props.disabled || props["aria-disabled"] === true || props["aria-disabled"] === "true"; |
| 20959 |
} |
| 20960 |
function removeUndefinedValues(obj) { |
| 20961 |
const result = {}; |
| 20962 |
for (const key2 in obj) { |
| 20963 |
if (obj[key2] !== void 0) { |
| 20964 |
result[key2] = obj[key2]; |
| 20965 |
} |
| 20966 |
} |
| 20967 |
return result; |
| 20968 |
} |
| 20969 |
function defaultValue(...values) { |
| 20970 |
for (const value of values) { |
| 20971 |
if (value !== void 0) return value; |
| 20972 |
} |
| 20973 |
return void 0; |
| 20974 |
} |
| 20975 |
|
| 20976 |
// node_modules/@ariakit/react-core/esm/__chunks/YXGXYGQX.js |
| 20977 |
var import_react20 = __toESM(require_react(), 1); |
| 20978 |
function setRef(ref, value) { |
| 20979 |
if (typeof ref === "function") { |
| 20980 |
ref(value); |
| 20981 |
} else if (ref) { |
| 20982 |
ref.current = value; |
| 20983 |
} |
| 20984 |
} |
| 20985 |
function isValidElementWithRef(element) { |
| 20986 |
if (!element) return false; |
| 20987 |
if (!(0, import_react20.isValidElement)(element)) return false; |
| 20988 |
if ("ref" in element.props) return true; |
| 20989 |
if ("ref" in element) return true; |
| 20990 |
return false; |
| 20991 |
} |
| 20992 |
function getRefProperty(element) { |
| 20993 |
if (!isValidElementWithRef(element)) return null; |
| 20994 |
const props = { ...element.props }; |
| 20995 |
return props.ref || element.ref; |
| 20996 |
} |
| 20997 |
function mergeProps3(base, overrides) { |
| 20998 |
const props = { ...base }; |
| 20999 |
for (const key2 in overrides) { |
| 21000 |
if (!hasOwnProperty(overrides, key2)) continue; |
| 21001 |
if (key2 === "className") { |
| 21002 |
const prop = "className"; |
| 21003 |
props[prop] = base[prop] ? `${base[prop]} ${overrides[prop]}` : overrides[prop]; |
| 21004 |
continue; |
| 21005 |
} |
| 21006 |
if (key2 === "style") { |
| 21007 |
const prop = "style"; |
| 21008 |
props[prop] = base[prop] ? { ...base[prop], ...overrides[prop] } : overrides[prop]; |
| 21009 |
continue; |
| 21010 |
} |
| 21011 |
const overrideValue = overrides[key2]; |
| 21012 |
if (typeof overrideValue === "function" && key2.startsWith("on")) { |
| 21013 |
const baseValue = base[key2]; |
| 21014 |
if (typeof baseValue === "function") { |
| 21015 |
props[key2] = (...args) => { |
| 21016 |
overrideValue(...args); |
| 21017 |
baseValue(...args); |
| 21018 |
}; |
| 21019 |
continue; |
| 21020 |
} |
| 21021 |
} |
| 21022 |
props[key2] = overrideValue; |
| 21023 |
} |
| 21024 |
return props; |
| 21025 |
} |
| 21026 |
|
| 21027 |
// node_modules/@ariakit/core/esm/__chunks/3DNM6L6E.js |
| 21028 |
var canUseDOM = checkIsBrowser(); |
| 21029 |
function checkIsBrowser() { |
| 21030 |
var _a; |
| 21031 |
return typeof window !== "undefined" && !!((_a = window.document) == null ? void 0 : _a.createElement); |
| 21032 |
} |
| 21033 |
function getDocument(node) { |
| 21034 |
if (!node) return document; |
| 21035 |
if ("self" in node) return node.document; |
| 21036 |
return node.ownerDocument || document; |
| 21037 |
} |
| 21038 |
function getActiveElement(node, activeDescendant = false) { |
| 21039 |
var _a; |
| 21040 |
const { activeElement: activeElement2 } = getDocument(node); |
| 21041 |
if (!(activeElement2 == null ? void 0 : activeElement2.nodeName)) { |
| 21042 |
return null; |
| 21043 |
} |
| 21044 |
if (isFrame(activeElement2) && ((_a = activeElement2.contentDocument) == null ? void 0 : _a.body)) { |
| 21045 |
return getActiveElement( |
| 21046 |
activeElement2.contentDocument.body, |
| 21047 |
activeDescendant |
| 21048 |
); |
| 21049 |
} |
| 21050 |
if (activeDescendant) { |
| 21051 |
const id = activeElement2.getAttribute("aria-activedescendant"); |
| 21052 |
if (id) { |
| 21053 |
const element = getDocument(activeElement2).getElementById(id); |
| 21054 |
if (element) { |
| 21055 |
return element; |
| 21056 |
} |
| 21057 |
} |
| 21058 |
} |
| 21059 |
return activeElement2; |
| 21060 |
} |
| 21061 |
function contains2(parent, child) { |
| 21062 |
return parent === child || parent.contains(child); |
| 21063 |
} |
| 21064 |
function isFrame(element) { |
| 21065 |
return element.tagName === "IFRAME"; |
| 21066 |
} |
| 21067 |
function isButton(element) { |
| 21068 |
const tagName = element.tagName.toLowerCase(); |
| 21069 |
if (tagName === "button") return true; |
| 21070 |
if (tagName === "input" && element.type) { |
| 21071 |
return buttonInputTypes.indexOf(element.type) !== -1; |
| 21072 |
} |
| 21073 |
return false; |
| 21074 |
} |
| 21075 |
var buttonInputTypes = [ |
| 21076 |
"button", |
| 21077 |
"color", |
| 21078 |
"file", |
| 21079 |
"image", |
| 21080 |
"reset", |
| 21081 |
"submit" |
| 21082 |
]; |
| 21083 |
function isVisible(element) { |
| 21084 |
if (typeof element.checkVisibility === "function") { |
| 21085 |
return element.checkVisibility(); |
| 21086 |
} |
| 21087 |
const htmlElement = element; |
| 21088 |
return htmlElement.offsetWidth > 0 || htmlElement.offsetHeight > 0 || element.getClientRects().length > 0; |
| 21089 |
} |
| 21090 |
function isTextField(element) { |
| 21091 |
try { |
| 21092 |
const isTextInput = element instanceof HTMLInputElement && element.selectionStart !== null; |
| 21093 |
const isTextArea = element.tagName === "TEXTAREA"; |
| 21094 |
return isTextInput || isTextArea || false; |
| 21095 |
} catch (_error) { |
| 21096 |
return false; |
| 21097 |
} |
| 21098 |
} |
| 21099 |
function isTextbox(element) { |
| 21100 |
return element.isContentEditable || isTextField(element); |
| 21101 |
} |
| 21102 |
function getTextboxValue(element) { |
| 21103 |
if (isTextField(element)) { |
| 21104 |
return element.value; |
| 21105 |
} |
| 21106 |
if (element.isContentEditable) { |
| 21107 |
const range = getDocument(element).createRange(); |
| 21108 |
range.selectNodeContents(element); |
| 21109 |
return range.toString(); |
| 21110 |
} |
| 21111 |
return ""; |
| 21112 |
} |
| 21113 |
function getTextboxSelection(element) { |
| 21114 |
let start = 0; |
| 21115 |
let end = 0; |
| 21116 |
if (isTextField(element)) { |
| 21117 |
start = element.selectionStart || 0; |
| 21118 |
end = element.selectionEnd || 0; |
| 21119 |
} else if (element.isContentEditable) { |
| 21120 |
const selection = getDocument(element).getSelection(); |
| 21121 |
if ((selection == null ? void 0 : selection.rangeCount) && selection.anchorNode && contains2(element, selection.anchorNode) && selection.focusNode && contains2(element, selection.focusNode)) { |
| 21122 |
const range = selection.getRangeAt(0); |
| 21123 |
const nextRange = range.cloneRange(); |
| 21124 |
nextRange.selectNodeContents(element); |
| 21125 |
nextRange.setEnd(range.startContainer, range.startOffset); |
| 21126 |
start = nextRange.toString().length; |
| 21127 |
nextRange.setEnd(range.endContainer, range.endOffset); |
| 21128 |
end = nextRange.toString().length; |
| 21129 |
} |
| 21130 |
} |
| 21131 |
return { start, end }; |
| 21132 |
} |
| 21133 |
function getPopupRole(element, fallback) { |
| 21134 |
const allowedPopupRoles = ["dialog", "menu", "listbox", "tree", "grid"]; |
| 21135 |
const role = element == null ? void 0 : element.getAttribute("role"); |
| 21136 |
if (role && allowedPopupRoles.indexOf(role) !== -1) { |
| 21137 |
return role; |
| 21138 |
} |
| 21139 |
return fallback; |
| 21140 |
} |
| 21141 |
function getScrollingElement(element) { |
| 21142 |
if (!element) return null; |
| 21143 |
const isScrollableOverflow = (overflow) => { |
| 21144 |
if (overflow === "auto") return true; |
| 21145 |
if (overflow === "scroll") return true; |
| 21146 |
return false; |
| 21147 |
}; |
| 21148 |
if (element.clientHeight && element.scrollHeight > element.clientHeight) { |
| 21149 |
const { overflowY } = getComputedStyle(element); |
| 21150 |
if (isScrollableOverflow(overflowY)) return element; |
| 21151 |
} else if (element.clientWidth && element.scrollWidth > element.clientWidth) { |
| 21152 |
const { overflowX } = getComputedStyle(element); |
| 21153 |
if (isScrollableOverflow(overflowX)) return element; |
| 21154 |
} |
| 21155 |
return getScrollingElement(element.parentElement) || document.scrollingElement || document.body; |
| 21156 |
} |
| 21157 |
function setSelectionRange(element, ...args) { |
| 21158 |
if (/text|search|password|tel|url/i.test(element.type)) { |
| 21159 |
element.setSelectionRange(...args); |
| 21160 |
} |
| 21161 |
} |
| 21162 |
function sortBasedOnDOMPosition(items, getElement) { |
| 21163 |
const pairs = items.map((item, index2) => [index2, item]); |
| 21164 |
let isOrderDifferent = false; |
| 21165 |
pairs.sort(([indexA, a2], [indexB, b2]) => { |
| 21166 |
const elementA = getElement(a2); |
| 21167 |
const elementB = getElement(b2); |
| 21168 |
if (elementA === elementB) return 0; |
| 21169 |
if (!elementA || !elementB) return 0; |
| 21170 |
if (isElementPreceding(elementA, elementB)) { |
| 21171 |
if (indexA > indexB) { |
| 21172 |
isOrderDifferent = true; |
| 21173 |
} |
| 21174 |
return -1; |
| 21175 |
} |
| 21176 |
if (indexA < indexB) { |
| 21177 |
isOrderDifferent = true; |
| 21178 |
} |
| 21179 |
return 1; |
| 21180 |
}); |
| 21181 |
if (isOrderDifferent) { |
| 21182 |
return pairs.map(([_, item]) => item); |
| 21183 |
} |
| 21184 |
return items; |
| 21185 |
} |
| 21186 |
function isElementPreceding(a2, b2) { |
| 21187 |
return Boolean( |
| 21188 |
b2.compareDocumentPosition(a2) & Node.DOCUMENT_POSITION_PRECEDING |
| 21189 |
); |
| 21190 |
} |
| 21191 |
|
| 21192 |
// node_modules/@ariakit/core/esm/__chunks/SNHYQNEZ.js |
| 21193 |
function isTouchDevice() { |
| 21194 |
return canUseDOM && !!navigator.maxTouchPoints; |
| 21195 |
} |
| 21196 |
function isApple() { |
| 21197 |
if (!canUseDOM) return false; |
| 21198 |
return /mac|iphone|ipad|ipod/i.test(navigator.platform); |
| 21199 |
} |
| 21200 |
function isSafari2() { |
| 21201 |
return canUseDOM && isApple() && /apple/i.test(navigator.vendor); |
| 21202 |
} |
| 21203 |
function isFirefox2() { |
| 21204 |
return canUseDOM && /firefox\//i.test(navigator.userAgent); |
| 21205 |
} |
| 21206 |
|
| 21207 |
// node_modules/@ariakit/core/esm/utils/events.js |
| 21208 |
function isPortalEvent(event) { |
| 21209 |
return Boolean( |
| 21210 |
event.currentTarget && !contains2(event.currentTarget, event.target) |
| 21211 |
); |
| 21212 |
} |
| 21213 |
function isSelfTarget(event) { |
| 21214 |
return event.target === event.currentTarget; |
| 21215 |
} |
| 21216 |
function isOpeningInNewTab(event) { |
| 21217 |
const element = event.currentTarget; |
| 21218 |
if (!element) return false; |
| 21219 |
const isAppleDevice = isApple(); |
| 21220 |
if (isAppleDevice && !event.metaKey) return false; |
| 21221 |
if (!isAppleDevice && !event.ctrlKey) return false; |
| 21222 |
const tagName = element.tagName.toLowerCase(); |
| 21223 |
if (tagName === "a") return true; |
| 21224 |
if (tagName === "button" && element.type === "submit") return true; |
| 21225 |
if (tagName === "input" && element.type === "submit") return true; |
| 21226 |
return false; |
| 21227 |
} |
| 21228 |
function isDownloading(event) { |
| 21229 |
const element = event.currentTarget; |
| 21230 |
if (!element) return false; |
| 21231 |
const tagName = element.tagName.toLowerCase(); |
| 21232 |
if (!event.altKey) return false; |
| 21233 |
if (tagName === "a") return true; |
| 21234 |
if (tagName === "button" && element.type === "submit") return true; |
| 21235 |
if (tagName === "input" && element.type === "submit") return true; |
| 21236 |
return false; |
| 21237 |
} |
| 21238 |
function fireBlurEvent(element, eventInit) { |
| 21239 |
const event = new FocusEvent("blur", eventInit); |
| 21240 |
const defaultAllowed = element.dispatchEvent(event); |
| 21241 |
const bubbleInit = { ...eventInit, bubbles: true }; |
| 21242 |
element.dispatchEvent(new FocusEvent("focusout", bubbleInit)); |
| 21243 |
return defaultAllowed; |
| 21244 |
} |
| 21245 |
function fireKeyboardEvent(element, type, eventInit) { |
| 21246 |
const event = new KeyboardEvent(type, eventInit); |
| 21247 |
return element.dispatchEvent(event); |
| 21248 |
} |
| 21249 |
function fireClickEvent(element, eventInit) { |
| 21250 |
const event = new MouseEvent("click", eventInit); |
| 21251 |
return element.dispatchEvent(event); |
| 21252 |
} |
| 21253 |
function isFocusEventOutside(event, container) { |
| 21254 |
const containerElement = container || event.currentTarget; |
| 21255 |
const relatedTarget = event.relatedTarget; |
| 21256 |
return !relatedTarget || !contains2(containerElement, relatedTarget); |
| 21257 |
} |
| 21258 |
function queueBeforeEvent(element, type, callback, timeout) { |
| 21259 |
const createTimer = (callback2) => { |
| 21260 |
if (timeout) { |
| 21261 |
const timerId2 = setTimeout(callback2, timeout); |
| 21262 |
return () => clearTimeout(timerId2); |
| 21263 |
} |
| 21264 |
const timerId = requestAnimationFrame(callback2); |
| 21265 |
return () => cancelAnimationFrame(timerId); |
| 21266 |
}; |
| 21267 |
const cancelTimer = createTimer(() => { |
| 21268 |
element.removeEventListener(type, callSync, true); |
| 21269 |
callback(); |
| 21270 |
}); |
| 21271 |
const callSync = () => { |
| 21272 |
cancelTimer(); |
| 21273 |
callback(); |
| 21274 |
}; |
| 21275 |
element.addEventListener(type, callSync, { once: true, capture: true }); |
| 21276 |
return cancelTimer; |
| 21277 |
} |
| 21278 |
function addGlobalEventListener(type, listener, options, scope = window) { |
| 21279 |
const children = []; |
| 21280 |
try { |
| 21281 |
scope.document.addEventListener(type, listener, options); |
| 21282 |
for (const frame of Array.from(scope.frames)) { |
| 21283 |
children.push(addGlobalEventListener(type, listener, options, frame)); |
| 21284 |
} |
| 21285 |
} catch (e2) { |
| 21286 |
} |
| 21287 |
const removeEventListener = () => { |
| 21288 |
try { |
| 21289 |
scope.document.removeEventListener(type, listener, options); |
| 21290 |
} catch (e2) { |
| 21291 |
} |
| 21292 |
for (const remove of children) { |
| 21293 |
remove(); |
| 21294 |
} |
| 21295 |
}; |
| 21296 |
return removeEventListener; |
| 21297 |
} |
| 21298 |
|
| 21299 |
// node_modules/@ariakit/react-core/esm/__chunks/KPHZR4MB.js |
| 21300 |
var React73 = __toESM(require_react(), 1); |
| 21301 |
var import_react21 = __toESM(require_react(), 1); |
| 21302 |
var _React = { ...React73 }; |
| 21303 |
var useReactId = _React.useId; |
| 21304 |
var useReactDeferredValue = _React.useDeferredValue; |
| 21305 |
var useReactInsertionEffect = _React.useInsertionEffect; |
| 21306 |
var useSafeLayoutEffect = canUseDOM ? import_react21.useLayoutEffect : import_react21.useEffect; |
| 21307 |
function useInitialValue(value) { |
| 21308 |
const [initialValue] = (0, import_react21.useState)(value); |
| 21309 |
return initialValue; |
| 21310 |
} |
| 21311 |
function useLiveRef(value) { |
| 21312 |
const ref = (0, import_react21.useRef)(value); |
| 21313 |
useSafeLayoutEffect(() => { |
| 21314 |
ref.current = value; |
| 21315 |
}); |
| 21316 |
return ref; |
| 21317 |
} |
| 21318 |
function useEvent(callback) { |
| 21319 |
const ref = (0, import_react21.useRef)(() => { |
| 21320 |
throw new Error("Cannot call an event handler while rendering."); |
| 21321 |
}); |
| 21322 |
if (useReactInsertionEffect) { |
| 21323 |
useReactInsertionEffect(() => { |
| 21324 |
ref.current = callback; |
| 21325 |
}); |
| 21326 |
} else { |
| 21327 |
ref.current = callback; |
| 21328 |
} |
| 21329 |
return (0, import_react21.useCallback)((...args) => { |
| 21330 |
var _a; |
| 21331 |
return (_a = ref.current) == null ? void 0 : _a.call(ref, ...args); |
| 21332 |
}, []); |
| 21333 |
} |
| 21334 |
function useTransactionState(callback) { |
| 21335 |
const [state, setState] = (0, import_react21.useState)(null); |
| 21336 |
useSafeLayoutEffect(() => { |
| 21337 |
if (state == null) return; |
| 21338 |
if (!callback) return; |
| 21339 |
let prevState = null; |
| 21340 |
callback((prev) => { |
| 21341 |
prevState = prev; |
| 21342 |
return state; |
| 21343 |
}); |
| 21344 |
return () => { |
| 21345 |
callback(prevState); |
| 21346 |
}; |
| 21347 |
}, [state, callback]); |
| 21348 |
return [state, setState]; |
| 21349 |
} |
| 21350 |
function useMergeRefs5(...refs) { |
| 21351 |
return (0, import_react21.useMemo)(() => { |
| 21352 |
if (!refs.some(Boolean)) return; |
| 21353 |
return (value) => { |
| 21354 |
for (const ref of refs) { |
| 21355 |
setRef(ref, value); |
| 21356 |
} |
| 21357 |
}; |
| 21358 |
}, refs); |
| 21359 |
} |
| 21360 |
function useId4(defaultId) { |
| 21361 |
if (useReactId) { |
| 21362 |
const reactId = useReactId(); |
| 21363 |
if (defaultId) return defaultId; |
| 21364 |
return reactId; |
| 21365 |
} |
| 21366 |
const [id, setId] = (0, import_react21.useState)(defaultId); |
| 21367 |
useSafeLayoutEffect(() => { |
| 21368 |
if (defaultId || id) return; |
| 21369 |
const random = Math.random().toString(36).slice(2, 8); |
| 21370 |
setId(`id-${random}`); |
| 21371 |
}, [defaultId, id]); |
| 21372 |
return defaultId || id; |
| 21373 |
} |
| 21374 |
function useTagName(refOrElement, type) { |
| 21375 |
const stringOrUndefined = (type2) => { |
| 21376 |
if (typeof type2 !== "string") return; |
| 21377 |
return type2; |
| 21378 |
}; |
| 21379 |
const [tagName, setTagName] = (0, import_react21.useState)(() => stringOrUndefined(type)); |
| 21380 |
useSafeLayoutEffect(() => { |
| 21381 |
const element = refOrElement && "current" in refOrElement ? refOrElement.current : refOrElement; |
| 21382 |
setTagName((element == null ? void 0 : element.tagName.toLowerCase()) || stringOrUndefined(type)); |
| 21383 |
}, [refOrElement, type]); |
| 21384 |
return tagName; |
| 21385 |
} |
| 21386 |
function useAttribute(refOrElement, attributeName, defaultValue3) { |
| 21387 |
const initialValue = useInitialValue(defaultValue3); |
| 21388 |
const [attribute, setAttribute] = (0, import_react21.useState)(initialValue); |
| 21389 |
(0, import_react21.useEffect)(() => { |
| 21390 |
const element = refOrElement && "current" in refOrElement ? refOrElement.current : refOrElement; |
| 21391 |
if (!element) return; |
| 21392 |
const callback = () => { |
| 21393 |
const value = element.getAttribute(attributeName); |
| 21394 |
setAttribute(value == null ? initialValue : value); |
| 21395 |
}; |
| 21396 |
const observer = new MutationObserver(callback); |
| 21397 |
observer.observe(element, { attributeFilter: [attributeName] }); |
| 21398 |
callback(); |
| 21399 |
return () => observer.disconnect(); |
| 21400 |
}, [refOrElement, attributeName, initialValue]); |
| 21401 |
return attribute; |
| 21402 |
} |
| 21403 |
function useUpdateEffect(effect, deps) { |
| 21404 |
const mounted = (0, import_react21.useRef)(false); |
| 21405 |
(0, import_react21.useEffect)(() => { |
| 21406 |
if (mounted.current) { |
| 21407 |
return effect(); |
| 21408 |
} |
| 21409 |
mounted.current = true; |
| 21410 |
}, deps); |
| 21411 |
(0, import_react21.useEffect)( |
| 21412 |
() => () => { |
| 21413 |
mounted.current = false; |
| 21414 |
}, |
| 21415 |
[] |
| 21416 |
); |
| 21417 |
} |
| 21418 |
function useUpdateLayoutEffect(effect, deps) { |
| 21419 |
const mounted = (0, import_react21.useRef)(false); |
| 21420 |
useSafeLayoutEffect(() => { |
| 21421 |
if (mounted.current) { |
| 21422 |
return effect(); |
| 21423 |
} |
| 21424 |
mounted.current = true; |
| 21425 |
}, deps); |
| 21426 |
useSafeLayoutEffect( |
| 21427 |
() => () => { |
| 21428 |
mounted.current = false; |
| 21429 |
}, |
| 21430 |
[] |
| 21431 |
); |
| 21432 |
} |
| 21433 |
function useForceUpdate() { |
| 21434 |
return (0, import_react21.useReducer)(() => [], []); |
| 21435 |
} |
| 21436 |
function useBooleanEvent(booleanOrCallback) { |
| 21437 |
return useEvent( |
| 21438 |
typeof booleanOrCallback === "function" ? booleanOrCallback : () => booleanOrCallback |
| 21439 |
); |
| 21440 |
} |
| 21441 |
function useWrapElement(props, callback, deps = []) { |
| 21442 |
const wrapElement = (0, import_react21.useCallback)( |
| 21443 |
(element) => { |
| 21444 |
if (props.wrapElement) { |
| 21445 |
element = props.wrapElement(element); |
| 21446 |
} |
| 21447 |
return callback(element); |
| 21448 |
}, |
| 21449 |
[...deps, props.wrapElement] |
| 21450 |
); |
| 21451 |
return { ...props, wrapElement }; |
| 21452 |
} |
| 21453 |
function useMetadataProps(props, key2, value) { |
| 21454 |
const parent = props.onLoadedMetadataCapture; |
| 21455 |
const onLoadedMetadataCapture = (0, import_react21.useMemo)(() => { |
| 21456 |
return Object.assign(() => { |
| 21457 |
}, { ...parent, [key2]: value }); |
| 21458 |
}, [parent, key2, value]); |
| 21459 |
return [parent == null ? void 0 : parent[key2], { onLoadedMetadataCapture }]; |
| 21460 |
} |
| 21461 |
var hasInstalledGlobalEventListeners = false; |
| 21462 |
function useIsMouseMoving() { |
| 21463 |
(0, import_react21.useEffect)(() => { |
| 21464 |
if (hasInstalledGlobalEventListeners) return; |
| 21465 |
addGlobalEventListener("mousemove", setMouseMoving, true); |
| 21466 |
addGlobalEventListener("mousedown", resetMouseMoving, true); |
| 21467 |
addGlobalEventListener("mouseup", resetMouseMoving, true); |
| 21468 |
addGlobalEventListener("keydown", resetMouseMoving, true); |
| 21469 |
addGlobalEventListener("scroll", resetMouseMoving, true); |
| 21470 |
hasInstalledGlobalEventListeners = true; |
| 21471 |
}, []); |
| 21472 |
const isMouseMoving = useEvent(() => mouseMoving); |
| 21473 |
return isMouseMoving; |
| 21474 |
} |
| 21475 |
var mouseMoving = false; |
| 21476 |
var previousScreenX = 0; |
| 21477 |
var previousScreenY = 0; |
| 21478 |
function hasMouseMovement(event) { |
| 21479 |
const movementX = event.movementX || event.screenX - previousScreenX; |
| 21480 |
const movementY = event.movementY || event.screenY - previousScreenY; |
| 21481 |
previousScreenX = event.screenX; |
| 21482 |
previousScreenY = event.screenY; |
| 21483 |
return movementX || movementY || false; |
| 21484 |
} |
| 21485 |
function setMouseMoving(event) { |
| 21486 |
if (!hasMouseMovement(event)) return; |
| 21487 |
mouseMoving = true; |
| 21488 |
} |
| 21489 |
function resetMouseMoving() { |
| 21490 |
mouseMoving = false; |
| 21491 |
} |
| 21492 |
|
| 21493 |
// node_modules/@ariakit/react-core/esm/__chunks/GWSL6KNJ.js |
| 21494 |
var React74 = __toESM(require_react(), 1); |
| 21495 |
var import_jsx_runtime110 = __toESM(require_jsx_runtime(), 1); |
| 21496 |
function forwardRef210(render4) { |
| 21497 |
const Role = React74.forwardRef( |
| 21498 |
// @ts-ignore Incompatible with React 19 types. Ignore for now. |
| 21499 |
(props, ref) => render4({ ...props, ref }) |
| 21500 |
); |
| 21501 |
Role.displayName = render4.displayName || render4.name; |
| 21502 |
return Role; |
| 21503 |
} |
| 21504 |
function memo22(Component2, propsAreEqual) { |
| 21505 |
return React74.memo(Component2, propsAreEqual); |
| 21506 |
} |
| 21507 |
function createElement3(Type, props) { |
| 21508 |
const { wrapElement, render: render4, ...rest } = props; |
| 21509 |
const mergedRef = useMergeRefs5(props.ref, getRefProperty(render4)); |
| 21510 |
let element; |
| 21511 |
if (React74.isValidElement(render4)) { |
| 21512 |
const renderProps = { |
| 21513 |
// @ts-ignore Incompatible with React 19 types. Ignore for now. |
| 21514 |
...render4.props, |
| 21515 |
ref: mergedRef |
| 21516 |
}; |
| 21517 |
element = React74.cloneElement(render4, mergeProps3(rest, renderProps)); |
| 21518 |
} else if (render4) { |
| 21519 |
element = render4(rest); |
| 21520 |
} else { |
| 21521 |
element = /* @__PURE__ */ (0, import_jsx_runtime110.jsx)(Type, { ...rest }); |
| 21522 |
} |
| 21523 |
if (wrapElement) { |
| 21524 |
return wrapElement(element); |
| 21525 |
} |
| 21526 |
return element; |
| 21527 |
} |
| 21528 |
function createHook(useProps) { |
| 21529 |
const useRole2 = (props = {}) => { |
| 21530 |
return useProps(props); |
| 21531 |
}; |
| 21532 |
useRole2.displayName = useProps.name; |
| 21533 |
return useRole2; |
| 21534 |
} |
| 21535 |
function createStoreContext(providers = [], scopedProviders = []) { |
| 21536 |
const context = React74.createContext(void 0); |
| 21537 |
const scopedContext = React74.createContext(void 0); |
| 21538 |
const useContext210 = () => React74.useContext(context); |
| 21539 |
const useScopedContext = (onlyScoped = false) => { |
| 21540 |
const scoped = React74.useContext(scopedContext); |
| 21541 |
const store = useContext210(); |
| 21542 |
if (onlyScoped) return scoped; |
| 21543 |
return scoped || store; |
| 21544 |
}; |
| 21545 |
const useProviderContext = () => { |
| 21546 |
const scoped = React74.useContext(scopedContext); |
| 21547 |
const store = useContext210(); |
| 21548 |
if (scoped && scoped === store) return; |
| 21549 |
return store; |
| 21550 |
}; |
| 21551 |
const ContextProvider = (props) => { |
| 21552 |
return providers.reduceRight( |
| 21553 |
(children, Provider2) => /* @__PURE__ */ (0, import_jsx_runtime110.jsx)(Provider2, { ...props, children }), |
| 21554 |
/* @__PURE__ */ (0, import_jsx_runtime110.jsx)(context.Provider, { ...props }) |
| 21555 |
); |
| 21556 |
}; |
| 21557 |
const ScopedContextProvider = (props) => { |
| 21558 |
return /* @__PURE__ */ (0, import_jsx_runtime110.jsx)(ContextProvider, { ...props, children: scopedProviders.reduceRight( |
| 21559 |
(children, Provider2) => /* @__PURE__ */ (0, import_jsx_runtime110.jsx)(Provider2, { ...props, children }), |
| 21560 |
/* @__PURE__ */ (0, import_jsx_runtime110.jsx)(scopedContext.Provider, { ...props }) |
| 21561 |
) }); |
| 21562 |
}; |
| 21563 |
return { |
| 21564 |
context, |
| 21565 |
scopedContext, |
| 21566 |
useContext: useContext210, |
| 21567 |
useScopedContext, |
| 21568 |
useProviderContext, |
| 21569 |
ContextProvider, |
| 21570 |
ScopedContextProvider |
| 21571 |
}; |
| 21572 |
} |
| 21573 |
|
| 21574 |
// node_modules/@ariakit/react-core/esm/__chunks/SMPCIMZM.js |
| 21575 |
var ctx = createStoreContext(); |
| 21576 |
var useCollectionContext = ctx.useContext; |
| 21577 |
var useCollectionScopedContext = ctx.useScopedContext; |
| 21578 |
var useCollectionProviderContext = ctx.useProviderContext; |
| 21579 |
var CollectionContextProvider = ctx.ContextProvider; |
| 21580 |
var CollectionScopedContextProvider = ctx.ScopedContextProvider; |
| 21581 |
|
| 21582 |
// node_modules/@ariakit/react-core/esm/__chunks/AVVXDJMZ.js |
| 21583 |
var import_react22 = __toESM(require_react(), 1); |
| 21584 |
var ctx2 = createStoreContext( |
| 21585 |
[CollectionContextProvider], |
| 21586 |
[CollectionScopedContextProvider] |
| 21587 |
); |
| 21588 |
var useCompositeContext = ctx2.useContext; |
| 21589 |
var useCompositeScopedContext = ctx2.useScopedContext; |
| 21590 |
var useCompositeProviderContext = ctx2.useProviderContext; |
| 21591 |
var CompositeContextProvider = ctx2.ContextProvider; |
| 21592 |
var CompositeScopedContextProvider = ctx2.ScopedContextProvider; |
| 21593 |
var CompositeItemContext = (0, import_react22.createContext)( |
| 21594 |
void 0 |
| 21595 |
); |
| 21596 |
var CompositeRowContext = (0, import_react22.createContext)( |
| 21597 |
void 0 |
| 21598 |
); |
| 21599 |
|
| 21600 |
// node_modules/@ariakit/react-core/esm/__chunks/5VQZOHHZ.js |
| 21601 |
function findFirstEnabledItem(items, excludeId) { |
| 21602 |
return items.find((item) => { |
| 21603 |
if (excludeId) { |
| 21604 |
return !item.disabled && item.id !== excludeId; |
| 21605 |
} |
| 21606 |
return !item.disabled; |
| 21607 |
}); |
| 21608 |
} |
| 21609 |
function getEnabledItem(store, id) { |
| 21610 |
if (!id) return null; |
| 21611 |
return store.item(id) || null; |
| 21612 |
} |
| 21613 |
function groupItemsByRows(items) { |
| 21614 |
const rows = []; |
| 21615 |
for (const item of items) { |
| 21616 |
const row = rows.find((currentRow) => { |
| 21617 |
var _a; |
| 21618 |
return ((_a = currentRow[0]) == null ? void 0 : _a.rowId) === item.rowId; |
| 21619 |
}); |
| 21620 |
if (row) { |
| 21621 |
row.push(item); |
| 21622 |
} else { |
| 21623 |
rows.push([item]); |
| 21624 |
} |
| 21625 |
} |
| 21626 |
return rows; |
| 21627 |
} |
| 21628 |
function selectTextField(element, collapseToEnd = false) { |
| 21629 |
if (isTextField(element)) { |
| 21630 |
element.setSelectionRange( |
| 21631 |
collapseToEnd ? element.value.length : 0, |
| 21632 |
element.value.length |
| 21633 |
); |
| 21634 |
} else if (element.isContentEditable) { |
| 21635 |
const selection = getDocument(element).getSelection(); |
| 21636 |
selection == null ? void 0 : selection.selectAllChildren(element); |
| 21637 |
if (collapseToEnd) { |
| 21638 |
selection == null ? void 0 : selection.collapseToEnd(); |
| 21639 |
} |
| 21640 |
} |
| 21641 |
} |
| 21642 |
var FOCUS_SILENTLY = /* @__PURE__ */ Symbol("FOCUS_SILENTLY"); |
| 21643 |
function focusSilently(element) { |
| 21644 |
element[FOCUS_SILENTLY] = true; |
| 21645 |
element.focus({ preventScroll: true }); |
| 21646 |
} |
| 21647 |
function silentlyFocused(element) { |
| 21648 |
const isSilentlyFocused = element[FOCUS_SILENTLY]; |
| 21649 |
delete element[FOCUS_SILENTLY]; |
| 21650 |
return isSilentlyFocused; |
| 21651 |
} |
| 21652 |
function isItem(store, element, exclude) { |
| 21653 |
if (!element) return false; |
| 21654 |
if (element === exclude) return false; |
| 21655 |
const item = store.item(element.id); |
| 21656 |
if (!item) return false; |
| 21657 |
if (exclude && item.element === exclude) return false; |
| 21658 |
return true; |
| 21659 |
} |
| 21660 |
|
| 21661 |
// node_modules/@ariakit/react-core/esm/__chunks/Z2O3VLAQ.js |
| 21662 |
var import_react23 = __toESM(require_react(), 1); |
| 21663 |
var TagName = "div"; |
| 21664 |
var useCollectionItem = createHook( |
| 21665 |
function useCollectionItem2({ |
| 21666 |
store, |
| 21667 |
shouldRegisterItem = true, |
| 21668 |
getItem = identity, |
| 21669 |
// @ts-expect-error This prop may come from a collection renderer. |
| 21670 |
element, |
| 21671 |
...props |
| 21672 |
}) { |
| 21673 |
const context = useCollectionContext(); |
| 21674 |
store = store || context; |
| 21675 |
const id = useId4(props.id); |
| 21676 |
const ref = (0, import_react23.useRef)(element); |
| 21677 |
(0, import_react23.useEffect)(() => { |
| 21678 |
const element2 = ref.current; |
| 21679 |
if (!id) return; |
| 21680 |
if (!element2) return; |
| 21681 |
if (!shouldRegisterItem) return; |
| 21682 |
const item = getItem({ id, element: element2 }); |
| 21683 |
return store == null ? void 0 : store.renderItem(item); |
| 21684 |
}, [id, shouldRegisterItem, getItem, store]); |
| 21685 |
props = { |
| 21686 |
...props, |
| 21687 |
ref: useMergeRefs5(ref, props.ref) |
| 21688 |
}; |
| 21689 |
return removeUndefinedValues(props); |
| 21690 |
} |
| 21691 |
); |
| 21692 |
var CollectionItem = forwardRef210(function CollectionItem2(props) { |
| 21693 |
const htmlProps = useCollectionItem(props); |
| 21694 |
return createElement3(TagName, htmlProps); |
| 21695 |
}); |
| 21696 |
|
| 21697 |
// node_modules/@ariakit/react-core/esm/__chunks/SWN3JYXT.js |
| 21698 |
var import_react24 = __toESM(require_react(), 1); |
| 21699 |
var FocusableContext = (0, import_react24.createContext)(true); |
| 21700 |
|
| 21701 |
// node_modules/@ariakit/core/esm/utils/focus.js |
| 21702 |
var selector = "input:not([type='hidden']):not([disabled]), select:not([disabled]), textarea:not([disabled]), a[href], button:not([disabled]), [tabindex], summary, iframe, object, embed, area[href], audio[controls], video[controls], [contenteditable]:not([contenteditable='false'])"; |
| 21703 |
function isFocusable(element) { |
| 21704 |
if (!element.matches(selector)) return false; |
| 21705 |
if (!isVisible(element)) return false; |
| 21706 |
if (element.closest("[inert]")) return false; |
| 21707 |
return true; |
| 21708 |
} |
| 21709 |
function getClosestFocusable(element) { |
| 21710 |
while (element && !isFocusable(element)) { |
| 21711 |
element = element.closest(selector); |
| 21712 |
} |
| 21713 |
return element || null; |
| 21714 |
} |
| 21715 |
function hasFocus(element) { |
| 21716 |
const activeElement2 = getActiveElement(element); |
| 21717 |
if (!activeElement2) return false; |
| 21718 |
if (activeElement2 === element) return true; |
| 21719 |
const activeDescendant = activeElement2.getAttribute("aria-activedescendant"); |
| 21720 |
if (!activeDescendant) return false; |
| 21721 |
return activeDescendant === element.id; |
| 21722 |
} |
| 21723 |
function hasFocusWithin(element) { |
| 21724 |
const activeElement2 = getActiveElement(element); |
| 21725 |
if (!activeElement2) return false; |
| 21726 |
if (contains2(element, activeElement2)) return true; |
| 21727 |
const activeDescendant = activeElement2.getAttribute("aria-activedescendant"); |
| 21728 |
if (!activeDescendant) return false; |
| 21729 |
if (!("id" in element)) return false; |
| 21730 |
if (activeDescendant === element.id) return true; |
| 21731 |
return !!element.querySelector(`#${CSS.escape(activeDescendant)}`); |
| 21732 |
} |
| 21733 |
function focusIfNeeded(element) { |
| 21734 |
if (!hasFocusWithin(element) && isFocusable(element)) { |
| 21735 |
element.focus(); |
| 21736 |
} |
| 21737 |
} |
| 21738 |
function focusIntoView(element, options) { |
| 21739 |
if (!("scrollIntoView" in element)) { |
| 21740 |
element.focus(); |
| 21741 |
} else { |
| 21742 |
element.focus({ preventScroll: true }); |
| 21743 |
element.scrollIntoView({ block: "nearest", inline: "nearest", ...options }); |
| 21744 |
} |
| 21745 |
} |
| 21746 |
|
| 21747 |
// node_modules/@ariakit/react-core/esm/__chunks/U6HHPQDW.js |
| 21748 |
var import_react25 = __toESM(require_react(), 1); |
| 21749 |
var TagName2 = "div"; |
| 21750 |
var isSafariBrowser = isSafari2(); |
| 21751 |
var alwaysFocusVisibleInputTypes = [ |
| 21752 |
"text", |
| 21753 |
"search", |
| 21754 |
"url", |
| 21755 |
"tel", |
| 21756 |
"email", |
| 21757 |
"password", |
| 21758 |
"number", |
| 21759 |
"date", |
| 21760 |
"month", |
| 21761 |
"week", |
| 21762 |
"time", |
| 21763 |
"datetime", |
| 21764 |
"datetime-local" |
| 21765 |
]; |
| 21766 |
var safariFocusAncestorSymbol = /* @__PURE__ */ Symbol("safariFocusAncestor"); |
| 21767 |
function markSafariFocusAncestor(element, value) { |
| 21768 |
if (!element) return; |
| 21769 |
element[safariFocusAncestorSymbol] = value; |
| 21770 |
} |
| 21771 |
function isAlwaysFocusVisible(element) { |
| 21772 |
const { tagName, readOnly, type } = element; |
| 21773 |
if (tagName === "TEXTAREA" && !readOnly) return true; |
| 21774 |
if (tagName === "SELECT" && !readOnly) return true; |
| 21775 |
if (tagName === "INPUT" && !readOnly) { |
| 21776 |
return alwaysFocusVisibleInputTypes.includes(type); |
| 21777 |
} |
| 21778 |
if (element.isContentEditable) return true; |
| 21779 |
const role = element.getAttribute("role"); |
| 21780 |
if (role === "combobox" && element.dataset.name) { |
| 21781 |
return true; |
| 21782 |
} |
| 21783 |
return false; |
| 21784 |
} |
| 21785 |
function getLabels(element) { |
| 21786 |
if ("labels" in element) { |
| 21787 |
return element.labels; |
| 21788 |
} |
| 21789 |
return null; |
| 21790 |
} |
| 21791 |
function isNativeCheckboxOrRadio(element) { |
| 21792 |
const tagName = element.tagName.toLowerCase(); |
| 21793 |
if (tagName === "input" && element.type) { |
| 21794 |
return element.type === "radio" || element.type === "checkbox"; |
| 21795 |
} |
| 21796 |
return false; |
| 21797 |
} |
| 21798 |
function isNativeTabbable(tagName) { |
| 21799 |
if (!tagName) return true; |
| 21800 |
return tagName === "button" || tagName === "summary" || tagName === "input" || tagName === "select" || tagName === "textarea" || tagName === "a"; |
| 21801 |
} |
| 21802 |
function supportsDisabledAttribute(tagName) { |
| 21803 |
if (!tagName) return true; |
| 21804 |
return tagName === "button" || tagName === "input" || tagName === "select" || tagName === "textarea"; |
| 21805 |
} |
| 21806 |
function getTabIndex4(focusable2, trulyDisabled, nativeTabbable, supportsDisabled, tabIndexProp) { |
| 21807 |
if (!focusable2) { |
| 21808 |
return tabIndexProp; |
| 21809 |
} |
| 21810 |
if (trulyDisabled) { |
| 21811 |
if (nativeTabbable && !supportsDisabled) { |
| 21812 |
return -1; |
| 21813 |
} |
| 21814 |
return; |
| 21815 |
} |
| 21816 |
if (nativeTabbable) { |
| 21817 |
return tabIndexProp; |
| 21818 |
} |
| 21819 |
return tabIndexProp || 0; |
| 21820 |
} |
| 21821 |
function useDisableEvent(onEvent, disabled2) { |
| 21822 |
return useEvent((event) => { |
| 21823 |
onEvent == null ? void 0 : onEvent(event); |
| 21824 |
if (event.defaultPrevented) return; |
| 21825 |
if (disabled2) { |
| 21826 |
event.stopPropagation(); |
| 21827 |
event.preventDefault(); |
| 21828 |
} |
| 21829 |
}); |
| 21830 |
} |
| 21831 |
var hasInstalledGlobalEventListeners2 = false; |
| 21832 |
var isKeyboardModality = true; |
| 21833 |
function onGlobalMouseDown(event) { |
| 21834 |
const target = event.target; |
| 21835 |
if (target && "hasAttribute" in target) { |
| 21836 |
if (!target.hasAttribute("data-focus-visible")) { |
| 21837 |
isKeyboardModality = false; |
| 21838 |
} |
| 21839 |
} |
| 21840 |
} |
| 21841 |
function onGlobalKeyDown(event) { |
| 21842 |
if (event.metaKey) return; |
| 21843 |
if (event.ctrlKey) return; |
| 21844 |
if (event.altKey) return; |
| 21845 |
isKeyboardModality = true; |
| 21846 |
} |
| 21847 |
var useFocusable = createHook( |
| 21848 |
function useFocusable2({ |
| 21849 |
focusable: focusable2 = true, |
| 21850 |
accessibleWhenDisabled, |
| 21851 |
autoFocus, |
| 21852 |
onFocusVisible, |
| 21853 |
...props |
| 21854 |
}) { |
| 21855 |
const ref = (0, import_react25.useRef)(null); |
| 21856 |
(0, import_react25.useEffect)(() => { |
| 21857 |
if (!focusable2) return; |
| 21858 |
if (hasInstalledGlobalEventListeners2) return; |
| 21859 |
addGlobalEventListener("mousedown", onGlobalMouseDown, true); |
| 21860 |
addGlobalEventListener("keydown", onGlobalKeyDown, true); |
| 21861 |
hasInstalledGlobalEventListeners2 = true; |
| 21862 |
}, [focusable2]); |
| 21863 |
if (isSafariBrowser) { |
| 21864 |
(0, import_react25.useEffect)(() => { |
| 21865 |
if (!focusable2) return; |
| 21866 |
const element = ref.current; |
| 21867 |
if (!element) return; |
| 21868 |
if (!isNativeCheckboxOrRadio(element)) return; |
| 21869 |
const labels = getLabels(element); |
| 21870 |
if (!labels) return; |
| 21871 |
const onMouseUp = () => queueMicrotask(() => element.focus()); |
| 21872 |
for (const label of labels) { |
| 21873 |
label.addEventListener("mouseup", onMouseUp); |
| 21874 |
} |
| 21875 |
return () => { |
| 21876 |
for (const label of labels) { |
| 21877 |
label.removeEventListener("mouseup", onMouseUp); |
| 21878 |
} |
| 21879 |
}; |
| 21880 |
}, [focusable2]); |
| 21881 |
} |
| 21882 |
const disabled2 = focusable2 && disabledFromProps(props); |
| 21883 |
const trulyDisabled = !!disabled2 && !accessibleWhenDisabled; |
| 21884 |
const [focusVisible, setFocusVisible] = (0, import_react25.useState)(false); |
| 21885 |
(0, import_react25.useEffect)(() => { |
| 21886 |
if (!focusable2) return; |
| 21887 |
if (trulyDisabled && focusVisible) { |
| 21888 |
setFocusVisible(false); |
| 21889 |
} |
| 21890 |
}, [focusable2, trulyDisabled, focusVisible]); |
| 21891 |
(0, import_react25.useEffect)(() => { |
| 21892 |
if (!focusable2) return; |
| 21893 |
if (!focusVisible) return; |
| 21894 |
const element = ref.current; |
| 21895 |
if (!element) return; |
| 21896 |
if (typeof IntersectionObserver === "undefined") return; |
| 21897 |
const observer = new IntersectionObserver(() => { |
| 21898 |
if (!isFocusable(element)) { |
| 21899 |
setFocusVisible(false); |
| 21900 |
} |
| 21901 |
}); |
| 21902 |
observer.observe(element); |
| 21903 |
return () => observer.disconnect(); |
| 21904 |
}, [focusable2, focusVisible]); |
| 21905 |
const onKeyPressCapture = useDisableEvent( |
| 21906 |
props.onKeyPressCapture, |
| 21907 |
disabled2 |
| 21908 |
); |
| 21909 |
const onMouseDownCapture = useDisableEvent( |
| 21910 |
props.onMouseDownCapture, |
| 21911 |
disabled2 |
| 21912 |
); |
| 21913 |
const onClickCapture = useDisableEvent(props.onClickCapture, disabled2); |
| 21914 |
const onMouseDownProp = props.onMouseDown; |
| 21915 |
const onMouseDown = useEvent((event) => { |
| 21916 |
onMouseDownProp == null ? void 0 : onMouseDownProp(event); |
| 21917 |
if (event.defaultPrevented) return; |
| 21918 |
if (!focusable2) return; |
| 21919 |
const element = event.currentTarget; |
| 21920 |
if (!isSafariBrowser) return; |
| 21921 |
if (isPortalEvent(event)) return; |
| 21922 |
if (!isButton(element) && !isNativeCheckboxOrRadio(element)) return; |
| 21923 |
let receivedFocus = false; |
| 21924 |
const onFocus = () => { |
| 21925 |
receivedFocus = true; |
| 21926 |
}; |
| 21927 |
const options = { capture: true, once: true }; |
| 21928 |
element.addEventListener("focusin", onFocus, options); |
| 21929 |
const focusableContainer = getClosestFocusable(element.parentElement); |
| 21930 |
markSafariFocusAncestor(focusableContainer, true); |
| 21931 |
queueBeforeEvent(element, "mouseup", () => { |
| 21932 |
element.removeEventListener("focusin", onFocus, true); |
| 21933 |
markSafariFocusAncestor(focusableContainer, false); |
| 21934 |
if (receivedFocus) return; |
| 21935 |
focusIfNeeded(element); |
| 21936 |
}); |
| 21937 |
}); |
| 21938 |
const handleFocusVisible = (event, currentTarget) => { |
| 21939 |
if (currentTarget) { |
| 21940 |
event.currentTarget = currentTarget; |
| 21941 |
} |
| 21942 |
if (!focusable2) return; |
| 21943 |
const element = event.currentTarget; |
| 21944 |
if (!element) return; |
| 21945 |
if (!hasFocus(element)) return; |
| 21946 |
onFocusVisible == null ? void 0 : onFocusVisible(event); |
| 21947 |
if (event.defaultPrevented) return; |
| 21948 |
element.dataset.focusVisible = "true"; |
| 21949 |
setFocusVisible(true); |
| 21950 |
}; |
| 21951 |
const onKeyDownCaptureProp = props.onKeyDownCapture; |
| 21952 |
const onKeyDownCapture = useEvent((event) => { |
| 21953 |
onKeyDownCaptureProp == null ? void 0 : onKeyDownCaptureProp(event); |
| 21954 |
if (event.defaultPrevented) return; |
| 21955 |
if (!focusable2) return; |
| 21956 |
if (focusVisible) return; |
| 21957 |
if (event.metaKey) return; |
| 21958 |
if (event.altKey) return; |
| 21959 |
if (event.ctrlKey) return; |
| 21960 |
if (!isSelfTarget(event)) return; |
| 21961 |
const element = event.currentTarget; |
| 21962 |
const applyFocusVisible = () => handleFocusVisible(event, element); |
| 21963 |
queueBeforeEvent(element, "focusout", applyFocusVisible); |
| 21964 |
}); |
| 21965 |
const onFocusCaptureProp = props.onFocusCapture; |
| 21966 |
const onFocusCapture = useEvent((event) => { |
| 21967 |
onFocusCaptureProp == null ? void 0 : onFocusCaptureProp(event); |
| 21968 |
if (event.defaultPrevented) return; |
| 21969 |
if (!focusable2) return; |
| 21970 |
if (!isSelfTarget(event)) { |
| 21971 |
setFocusVisible(false); |
| 21972 |
return; |
| 21973 |
} |
| 21974 |
const element = event.currentTarget; |
| 21975 |
const applyFocusVisible = () => handleFocusVisible(event, element); |
| 21976 |
if (isKeyboardModality || isAlwaysFocusVisible(event.target)) { |
| 21977 |
queueBeforeEvent(event.target, "focusout", applyFocusVisible); |
| 21978 |
} else { |
| 21979 |
setFocusVisible(false); |
| 21980 |
} |
| 21981 |
}); |
| 21982 |
const onBlurProp = props.onBlur; |
| 21983 |
const onBlur = useEvent((event) => { |
| 21984 |
onBlurProp == null ? void 0 : onBlurProp(event); |
| 21985 |
if (!focusable2) return; |
| 21986 |
if (!isFocusEventOutside(event)) return; |
| 21987 |
event.currentTarget.removeAttribute("data-focus-visible"); |
| 21988 |
setFocusVisible(false); |
| 21989 |
}); |
| 21990 |
const autoFocusOnShow = (0, import_react25.useContext)(FocusableContext); |
| 21991 |
const autoFocusRef = useEvent((element) => { |
| 21992 |
if (!focusable2) return; |
| 21993 |
if (!autoFocus) return; |
| 21994 |
if (!element) return; |
| 21995 |
if (!autoFocusOnShow) return; |
| 21996 |
queueMicrotask(() => { |
| 21997 |
if (hasFocus(element)) return; |
| 21998 |
if (!isFocusable(element)) return; |
| 21999 |
element.focus(); |
| 22000 |
}); |
| 22001 |
}); |
| 22002 |
const tagName = useTagName(ref); |
| 22003 |
const nativeTabbable = focusable2 && isNativeTabbable(tagName); |
| 22004 |
const supportsDisabled = focusable2 && supportsDisabledAttribute(tagName); |
| 22005 |
const styleProp = props.style; |
| 22006 |
const style = (0, import_react25.useMemo)(() => { |
| 22007 |
if (trulyDisabled) { |
| 22008 |
return { pointerEvents: "none", ...styleProp }; |
| 22009 |
} |
| 22010 |
return styleProp; |
| 22011 |
}, [trulyDisabled, styleProp]); |
| 22012 |
props = { |
| 22013 |
"data-focus-visible": focusable2 && focusVisible || void 0, |
| 22014 |
"data-autofocus": autoFocus || void 0, |
| 22015 |
"aria-disabled": disabled2 || void 0, |
| 22016 |
...props, |
| 22017 |
ref: useMergeRefs5(ref, autoFocusRef, props.ref), |
| 22018 |
style, |
| 22019 |
tabIndex: getTabIndex4( |
| 22020 |
focusable2, |
| 22021 |
trulyDisabled, |
| 22022 |
nativeTabbable, |
| 22023 |
supportsDisabled, |
| 22024 |
props.tabIndex |
| 22025 |
), |
| 22026 |
disabled: supportsDisabled && trulyDisabled ? true : void 0, |
| 22027 |
// TODO: Test Focusable contentEditable. |
| 22028 |
contentEditable: disabled2 ? void 0 : props.contentEditable, |
| 22029 |
onKeyPressCapture, |
| 22030 |
onClickCapture, |
| 22031 |
onMouseDownCapture, |
| 22032 |
onMouseDown, |
| 22033 |
onKeyDownCapture, |
| 22034 |
onFocusCapture, |
| 22035 |
onBlur |
| 22036 |
}; |
| 22037 |
return removeUndefinedValues(props); |
| 22038 |
} |
| 22039 |
); |
| 22040 |
var Focusable = forwardRef210(function Focusable2(props) { |
| 22041 |
const htmlProps = useFocusable(props); |
| 22042 |
return createElement3(TagName2, htmlProps); |
| 22043 |
}); |
| 22044 |
|
| 22045 |
// node_modules/@ariakit/react-core/esm/__chunks/PZ3OL7I2.js |
| 22046 |
var import_react26 = __toESM(require_react(), 1); |
| 22047 |
var TagName3 = "button"; |
| 22048 |
function isNativeClick(event) { |
| 22049 |
if (!event.isTrusted) return false; |
| 22050 |
const element = event.currentTarget; |
| 22051 |
if (event.key === "Enter") { |
| 22052 |
return isButton(element) || element.tagName === "SUMMARY" || element.tagName === "A"; |
| 22053 |
} |
| 22054 |
if (event.key === " ") { |
| 22055 |
return isButton(element) || element.tagName === "SUMMARY" || element.tagName === "INPUT" || element.tagName === "SELECT"; |
| 22056 |
} |
| 22057 |
return false; |
| 22058 |
} |
| 22059 |
var symbol = /* @__PURE__ */ Symbol("command"); |
| 22060 |
var useCommand = createHook( |
| 22061 |
function useCommand2({ clickOnEnter = true, clickOnSpace = true, ...props }) { |
| 22062 |
const ref = (0, import_react26.useRef)(null); |
| 22063 |
const [isNativeButton, setIsNativeButton] = (0, import_react26.useState)(false); |
| 22064 |
(0, import_react26.useEffect)(() => { |
| 22065 |
if (!ref.current) return; |
| 22066 |
setIsNativeButton(isButton(ref.current)); |
| 22067 |
}, []); |
| 22068 |
const [active, setActive] = (0, import_react26.useState)(false); |
| 22069 |
const activeRef = (0, import_react26.useRef)(false); |
| 22070 |
const disabled2 = disabledFromProps(props); |
| 22071 |
const [isDuplicate, metadataProps] = useMetadataProps(props, symbol, true); |
| 22072 |
const onKeyDownProp = props.onKeyDown; |
| 22073 |
const onKeyDown = useEvent((event) => { |
| 22074 |
onKeyDownProp == null ? void 0 : onKeyDownProp(event); |
| 22075 |
const element = event.currentTarget; |
| 22076 |
if (event.defaultPrevented) return; |
| 22077 |
if (isDuplicate) return; |
| 22078 |
if (disabled2) return; |
| 22079 |
if (!isSelfTarget(event)) return; |
| 22080 |
if (isTextField(element)) return; |
| 22081 |
if (element.isContentEditable) return; |
| 22082 |
const isEnter = clickOnEnter && event.key === "Enter"; |
| 22083 |
const isSpace = clickOnSpace && event.key === " "; |
| 22084 |
const shouldPreventEnter = event.key === "Enter" && !clickOnEnter; |
| 22085 |
const shouldPreventSpace = event.key === " " && !clickOnSpace; |
| 22086 |
if (shouldPreventEnter || shouldPreventSpace) { |
| 22087 |
event.preventDefault(); |
| 22088 |
return; |
| 22089 |
} |
| 22090 |
if (isEnter || isSpace) { |
| 22091 |
const nativeClick = isNativeClick(event); |
| 22092 |
if (isEnter) { |
| 22093 |
if (!nativeClick) { |
| 22094 |
event.preventDefault(); |
| 22095 |
const { view, ...eventInit } = event; |
| 22096 |
const click = () => fireClickEvent(element, eventInit); |
| 22097 |
if (isFirefox2()) { |
| 22098 |
queueBeforeEvent(element, "keyup", click); |
| 22099 |
} else { |
| 22100 |
queueMicrotask(click); |
| 22101 |
} |
| 22102 |
} |
| 22103 |
} else if (isSpace) { |
| 22104 |
activeRef.current = true; |
| 22105 |
if (!nativeClick) { |
| 22106 |
event.preventDefault(); |
| 22107 |
setActive(true); |
| 22108 |
} |
| 22109 |
} |
| 22110 |
} |
| 22111 |
}); |
| 22112 |
const onKeyUpProp = props.onKeyUp; |
| 22113 |
const onKeyUp = useEvent((event) => { |
| 22114 |
onKeyUpProp == null ? void 0 : onKeyUpProp(event); |
| 22115 |
if (event.defaultPrevented) return; |
| 22116 |
if (isDuplicate) return; |
| 22117 |
if (disabled2) return; |
| 22118 |
if (event.metaKey) return; |
| 22119 |
const isSpace = clickOnSpace && event.key === " "; |
| 22120 |
if (activeRef.current && isSpace) { |
| 22121 |
activeRef.current = false; |
| 22122 |
if (!isNativeClick(event)) { |
| 22123 |
event.preventDefault(); |
| 22124 |
setActive(false); |
| 22125 |
const element = event.currentTarget; |
| 22126 |
const { view, ...eventInit } = event; |
| 22127 |
queueMicrotask(() => fireClickEvent(element, eventInit)); |
| 22128 |
} |
| 22129 |
} |
| 22130 |
}); |
| 22131 |
props = { |
| 22132 |
"data-active": active || void 0, |
| 22133 |
type: isNativeButton ? "button" : void 0, |
| 22134 |
...metadataProps, |
| 22135 |
...props, |
| 22136 |
ref: useMergeRefs5(ref, props.ref), |
| 22137 |
onKeyDown, |
| 22138 |
onKeyUp |
| 22139 |
}; |
| 22140 |
props = useFocusable(props); |
| 22141 |
return props; |
| 22142 |
} |
| 22143 |
); |
| 22144 |
var Command = forwardRef210(function Command2(props) { |
| 22145 |
const htmlProps = useCommand(props); |
| 22146 |
return createElement3(TagName3, htmlProps); |
| 22147 |
}); |
| 22148 |
|
| 22149 |
// node_modules/@ariakit/core/esm/__chunks/SXKM4CGU.js |
| 22150 |
function getInternal(store, key2) { |
| 22151 |
const internals = store.__unstableInternals; |
| 22152 |
invariant(internals, "Invalid store"); |
| 22153 |
return internals[key2]; |
| 22154 |
} |
| 22155 |
function createStore(initialState, ...stores) { |
| 22156 |
let state = initialState; |
| 22157 |
let prevStateBatch = state; |
| 22158 |
let lastUpdate = /* @__PURE__ */ Symbol(); |
| 22159 |
let destroy = noop5; |
| 22160 |
const instances = /* @__PURE__ */ new Set(); |
| 22161 |
const updatedKeys = /* @__PURE__ */ new Set(); |
| 22162 |
const setups = /* @__PURE__ */ new Set(); |
| 22163 |
const listeners = /* @__PURE__ */ new Set(); |
| 22164 |
const batchListeners = /* @__PURE__ */ new Set(); |
| 22165 |
const disposables = /* @__PURE__ */ new WeakMap(); |
| 22166 |
const listenerKeys = /* @__PURE__ */ new WeakMap(); |
| 22167 |
const storeSetup = (callback) => { |
| 22168 |
setups.add(callback); |
| 22169 |
return () => setups.delete(callback); |
| 22170 |
}; |
| 22171 |
const storeInit = () => { |
| 22172 |
const initialized = instances.size; |
| 22173 |
const instance = /* @__PURE__ */ Symbol(); |
| 22174 |
instances.add(instance); |
| 22175 |
const maybeDestroy = () => { |
| 22176 |
instances.delete(instance); |
| 22177 |
if (instances.size) return; |
| 22178 |
destroy(); |
| 22179 |
}; |
| 22180 |
if (initialized) return maybeDestroy; |
| 22181 |
const desyncs = getKeys(state).map( |
| 22182 |
(key2) => chain( |
| 22183 |
...stores.map((store) => { |
| 22184 |
var _a; |
| 22185 |
const storeState = (_a = store == null ? void 0 : store.getState) == null ? void 0 : _a.call(store); |
| 22186 |
if (!storeState) return; |
| 22187 |
if (!hasOwnProperty(storeState, key2)) return; |
| 22188 |
return sync(store, [key2], (state2) => { |
| 22189 |
setState( |
| 22190 |
key2, |
| 22191 |
state2[key2], |
| 22192 |
// @ts-expect-error - Not public API. This is just to prevent |
| 22193 |
// infinite loops. |
| 22194 |
true |
| 22195 |
); |
| 22196 |
}); |
| 22197 |
}) |
| 22198 |
) |
| 22199 |
); |
| 22200 |
const teardowns = []; |
| 22201 |
for (const setup2 of setups) { |
| 22202 |
teardowns.push(setup2()); |
| 22203 |
} |
| 22204 |
const cleanups = stores.map(init); |
| 22205 |
destroy = chain(...desyncs, ...teardowns, ...cleanups); |
| 22206 |
return maybeDestroy; |
| 22207 |
}; |
| 22208 |
const sub = (keys, listener, set3 = listeners) => { |
| 22209 |
set3.add(listener); |
| 22210 |
listenerKeys.set(listener, keys); |
| 22211 |
return () => { |
| 22212 |
var _a; |
| 22213 |
(_a = disposables.get(listener)) == null ? void 0 : _a(); |
| 22214 |
disposables.delete(listener); |
| 22215 |
listenerKeys.delete(listener); |
| 22216 |
set3.delete(listener); |
| 22217 |
}; |
| 22218 |
}; |
| 22219 |
const storeSubscribe = (keys, listener) => sub(keys, listener); |
| 22220 |
const storeSync = (keys, listener) => { |
| 22221 |
disposables.set(listener, listener(state, state)); |
| 22222 |
return sub(keys, listener); |
| 22223 |
}; |
| 22224 |
const storeBatch = (keys, listener) => { |
| 22225 |
disposables.set(listener, listener(state, prevStateBatch)); |
| 22226 |
return sub(keys, listener, batchListeners); |
| 22227 |
}; |
| 22228 |
const storePick = (keys) => createStore(pick(state, keys), finalStore); |
| 22229 |
const storeOmit = (keys) => createStore(omit(state, keys), finalStore); |
| 22230 |
const getState = () => state; |
| 22231 |
const setState = (key2, value, fromStores = false) => { |
| 22232 |
var _a; |
| 22233 |
if (!hasOwnProperty(state, key2)) return; |
| 22234 |
const nextValue = applyState(value, state[key2]); |
| 22235 |
if (nextValue === state[key2]) return; |
| 22236 |
if (!fromStores) { |
| 22237 |
for (const store of stores) { |
| 22238 |
(_a = store == null ? void 0 : store.setState) == null ? void 0 : _a.call(store, key2, nextValue); |
| 22239 |
} |
| 22240 |
} |
| 22241 |
const prevState = state; |
| 22242 |
state = { ...state, [key2]: nextValue }; |
| 22243 |
const thisUpdate = /* @__PURE__ */ Symbol(); |
| 22244 |
lastUpdate = thisUpdate; |
| 22245 |
updatedKeys.add(key2); |
| 22246 |
const run = (listener, prev, uKeys) => { |
| 22247 |
var _a2; |
| 22248 |
const keys = listenerKeys.get(listener); |
| 22249 |
const updated = (k) => uKeys ? uKeys.has(k) : k === key2; |
| 22250 |
if (!keys || keys.some(updated)) { |
| 22251 |
(_a2 = disposables.get(listener)) == null ? void 0 : _a2(); |
| 22252 |
disposables.set(listener, listener(state, prev)); |
| 22253 |
} |
| 22254 |
}; |
| 22255 |
for (const listener of listeners) { |
| 22256 |
run(listener, prevState); |
| 22257 |
} |
| 22258 |
queueMicrotask(() => { |
| 22259 |
if (lastUpdate !== thisUpdate) return; |
| 22260 |
const snapshot = state; |
| 22261 |
for (const listener of batchListeners) { |
| 22262 |
run(listener, prevStateBatch, updatedKeys); |
| 22263 |
} |
| 22264 |
prevStateBatch = snapshot; |
| 22265 |
updatedKeys.clear(); |
| 22266 |
}); |
| 22267 |
}; |
| 22268 |
const finalStore = { |
| 22269 |
getState, |
| 22270 |
setState, |
| 22271 |
__unstableInternals: { |
| 22272 |
setup: storeSetup, |
| 22273 |
init: storeInit, |
| 22274 |
subscribe: storeSubscribe, |
| 22275 |
sync: storeSync, |
| 22276 |
batch: storeBatch, |
| 22277 |
pick: storePick, |
| 22278 |
omit: storeOmit |
| 22279 |
} |
| 22280 |
}; |
| 22281 |
return finalStore; |
| 22282 |
} |
| 22283 |
function setup(store, ...args) { |
| 22284 |
if (!store) return; |
| 22285 |
return getInternal(store, "setup")(...args); |
| 22286 |
} |
| 22287 |
function init(store, ...args) { |
| 22288 |
if (!store) return; |
| 22289 |
return getInternal(store, "init")(...args); |
| 22290 |
} |
| 22291 |
function subscribe(store, ...args) { |
| 22292 |
if (!store) return; |
| 22293 |
return getInternal(store, "subscribe")(...args); |
| 22294 |
} |
| 22295 |
function sync(store, ...args) { |
| 22296 |
if (!store) return; |
| 22297 |
return getInternal(store, "sync")(...args); |
| 22298 |
} |
| 22299 |
function batch(store, ...args) { |
| 22300 |
if (!store) return; |
| 22301 |
return getInternal(store, "batch")(...args); |
| 22302 |
} |
| 22303 |
function omit2(store, ...args) { |
| 22304 |
if (!store) return; |
| 22305 |
return getInternal(store, "omit")(...args); |
| 22306 |
} |
| 22307 |
function pick2(store, ...args) { |
| 22308 |
if (!store) return; |
| 22309 |
return getInternal(store, "pick")(...args); |
| 22310 |
} |
| 22311 |
function mergeStore(...stores) { |
| 22312 |
var _a; |
| 22313 |
const initialState = {}; |
| 22314 |
for (const store2 of stores) { |
| 22315 |
const nextState = (_a = store2 == null ? void 0 : store2.getState) == null ? void 0 : _a.call(store2); |
| 22316 |
if (nextState) { |
| 22317 |
Object.assign(initialState, nextState); |
| 22318 |
} |
| 22319 |
} |
| 22320 |
const store = createStore(initialState, ...stores); |
| 22321 |
return Object.assign({}, ...stores, store); |
| 22322 |
} |
| 22323 |
function throwOnConflictingProps(props, store) { |
| 22324 |
if (false) return; |
| 22325 |
if (!store) return; |
| 22326 |
const defaultKeys = Object.entries(props).filter(([key2, value]) => key2.startsWith("default") && value !== void 0).map(([key2]) => { |
| 22327 |
var _a; |
| 22328 |
const stateKey = key2.replace("default", ""); |
| 22329 |
return `${((_a = stateKey[0]) == null ? void 0 : _a.toLowerCase()) || ""}${stateKey.slice(1)}`; |
| 22330 |
}); |
| 22331 |
if (!defaultKeys.length) return; |
| 22332 |
const storeState = store.getState(); |
| 22333 |
const conflictingProps = defaultKeys.filter( |
| 22334 |
(key2) => hasOwnProperty(storeState, key2) |
| 22335 |
); |
| 22336 |
if (!conflictingProps.length) return; |
| 22337 |
throw new Error( |
| 22338 |
`Passing a store prop in conjunction with a default state is not supported. |
| 22339 |
|
| 22340 |
const store = useSelectStore(); |
| 22341 |
<SelectProvider store={store} defaultValue="Apple" /> |
| 22342 |
^ ^ |
| 22343 |
|
| 22344 |
Instead, pass the default state to the topmost store: |
| 22345 |
|
| 22346 |
const store = useSelectStore({ defaultValue: "Apple" }); |
| 22347 |
<SelectProvider store={store} /> |
| 22348 |
|
| 22349 |
See https://github.com/ariakit/ariakit/pull/2745 for more details. |
| 22350 |
|
| 22351 |
If there's a particular need for this, please submit a feature request at https://github.com/ariakit/ariakit |
| 22352 |
` |
| 22353 |
); |
| 22354 |
} |
| 22355 |
|
| 22356 |
// node_modules/@ariakit/react-core/esm/__chunks/Q5W46E73.js |
| 22357 |
var React75 = __toESM(require_react(), 1); |
| 22358 |
var import_shim2 = __toESM(require_shim(), 1); |
| 22359 |
var { useSyncExternalStore: useSyncExternalStore2 } = import_shim2.default; |
| 22360 |
var noopSubscribe = () => () => { |
| 22361 |
}; |
| 22362 |
function useStoreState(store, keyOrSelector = identity) { |
| 22363 |
const storeSubscribe = React75.useCallback( |
| 22364 |
(callback) => { |
| 22365 |
if (!store) return noopSubscribe(); |
| 22366 |
return subscribe(store, null, callback); |
| 22367 |
}, |
| 22368 |
[store] |
| 22369 |
); |
| 22370 |
const getSnapshot = () => { |
| 22371 |
const key2 = typeof keyOrSelector === "string" ? keyOrSelector : null; |
| 22372 |
const selector2 = typeof keyOrSelector === "function" ? keyOrSelector : null; |
| 22373 |
const state = store == null ? void 0 : store.getState(); |
| 22374 |
if (selector2) return selector2(state); |
| 22375 |
if (!state) return; |
| 22376 |
if (!key2) return; |
| 22377 |
if (!hasOwnProperty(state, key2)) return; |
| 22378 |
return state[key2]; |
| 22379 |
}; |
| 22380 |
return useSyncExternalStore2(storeSubscribe, getSnapshot, getSnapshot); |
| 22381 |
} |
| 22382 |
function useStoreStateObject(store, object) { |
| 22383 |
const objRef = React75.useRef( |
| 22384 |
{} |
| 22385 |
); |
| 22386 |
const storeSubscribe = React75.useCallback( |
| 22387 |
(callback) => { |
| 22388 |
if (!store) return noopSubscribe(); |
| 22389 |
return subscribe(store, null, callback); |
| 22390 |
}, |
| 22391 |
[store] |
| 22392 |
); |
| 22393 |
const getSnapshot = () => { |
| 22394 |
const state = store == null ? void 0 : store.getState(); |
| 22395 |
let updated = false; |
| 22396 |
const obj = objRef.current; |
| 22397 |
for (const prop in object) { |
| 22398 |
const keyOrSelector = object[prop]; |
| 22399 |
if (typeof keyOrSelector === "function") { |
| 22400 |
const value = keyOrSelector(state); |
| 22401 |
if (value !== obj[prop]) { |
| 22402 |
obj[prop] = value; |
| 22403 |
updated = true; |
| 22404 |
} |
| 22405 |
} |
| 22406 |
if (typeof keyOrSelector === "string") { |
| 22407 |
if (!state) continue; |
| 22408 |
if (!hasOwnProperty(state, keyOrSelector)) continue; |
| 22409 |
const value = state[keyOrSelector]; |
| 22410 |
if (value !== obj[prop]) { |
| 22411 |
obj[prop] = value; |
| 22412 |
updated = true; |
| 22413 |
} |
| 22414 |
} |
| 22415 |
} |
| 22416 |
if (updated) { |
| 22417 |
objRef.current = { ...obj }; |
| 22418 |
} |
| 22419 |
return objRef.current; |
| 22420 |
}; |
| 22421 |
return useSyncExternalStore2(storeSubscribe, getSnapshot, getSnapshot); |
| 22422 |
} |
| 22423 |
function useStoreProps(store, props, key2, setKey) { |
| 22424 |
const value = hasOwnProperty(props, key2) ? props[key2] : void 0; |
| 22425 |
const setValue = setKey ? props[setKey] : void 0; |
| 22426 |
const propsRef = useLiveRef({ value, setValue }); |
| 22427 |
useSafeLayoutEffect(() => { |
| 22428 |
return sync(store, [key2], (state, prev) => { |
| 22429 |
const { value: value2, setValue: setValue2 } = propsRef.current; |
| 22430 |
if (!setValue2) return; |
| 22431 |
if (state[key2] === prev[key2]) return; |
| 22432 |
if (state[key2] === value2) return; |
| 22433 |
setValue2(state[key2]); |
| 22434 |
}); |
| 22435 |
}, [store, key2]); |
| 22436 |
useSafeLayoutEffect(() => { |
| 22437 |
if (value === void 0) return; |
| 22438 |
store.setState(key2, value); |
| 22439 |
return batch(store, [key2], () => { |
| 22440 |
if (value === void 0) return; |
| 22441 |
store.setState(key2, value); |
| 22442 |
}); |
| 22443 |
}); |
| 22444 |
} |
| 22445 |
function useStore2(createStore2, props) { |
| 22446 |
const [store, setStore] = React75.useState(() => createStore2(props)); |
| 22447 |
useSafeLayoutEffect(() => init(store), [store]); |
| 22448 |
const useState210 = React75.useCallback( |
| 22449 |
(keyOrSelector) => useStoreState(store, keyOrSelector), |
| 22450 |
[store] |
| 22451 |
); |
| 22452 |
const memoizedStore = React75.useMemo( |
| 22453 |
() => ({ ...store, useState: useState210 }), |
| 22454 |
[store, useState210] |
| 22455 |
); |
| 22456 |
const updateStore = useEvent(() => { |
| 22457 |
setStore((store2) => createStore2({ ...props, ...store2.getState() })); |
| 22458 |
}); |
| 22459 |
return [memoizedStore, updateStore]; |
| 22460 |
} |
| 22461 |
|
| 22462 |
// node_modules/@ariakit/react-core/esm/__chunks/WZWDIE3S.js |
| 22463 |
var import_react27 = __toESM(require_react(), 1); |
| 22464 |
var import_jsx_runtime111 = __toESM(require_jsx_runtime(), 1); |
| 22465 |
var TagName4 = "button"; |
| 22466 |
function isEditableElement(element) { |
| 22467 |
if (isTextbox(element)) return true; |
| 22468 |
return element.tagName === "INPUT" && !isButton(element); |
| 22469 |
} |
| 22470 |
function getNextPageOffset(scrollingElement, pageUp = false) { |
| 22471 |
const height = scrollingElement.clientHeight; |
| 22472 |
const { top } = scrollingElement.getBoundingClientRect(); |
| 22473 |
const pageSize = Math.max(height * 0.875, height - 40) * 1.5; |
| 22474 |
const pageOffset = pageUp ? height - pageSize + top : pageSize + top; |
| 22475 |
if (scrollingElement.tagName === "HTML") { |
| 22476 |
return pageOffset + scrollingElement.scrollTop; |
| 22477 |
} |
| 22478 |
return pageOffset; |
| 22479 |
} |
| 22480 |
function getItemOffset(itemElement, pageUp = false) { |
| 22481 |
const { top } = itemElement.getBoundingClientRect(); |
| 22482 |
if (pageUp) { |
| 22483 |
return top + itemElement.clientHeight; |
| 22484 |
} |
| 22485 |
return top; |
| 22486 |
} |
| 22487 |
function findNextPageItemId(element, store, next, pageUp = false) { |
| 22488 |
var _a; |
| 22489 |
if (!store) return; |
| 22490 |
if (!next) return; |
| 22491 |
const { renderedItems } = store.getState(); |
| 22492 |
const scrollingElement = getScrollingElement(element); |
| 22493 |
if (!scrollingElement) return; |
| 22494 |
const nextPageOffset = getNextPageOffset(scrollingElement, pageUp); |
| 22495 |
let id; |
| 22496 |
let prevDifference; |
| 22497 |
for (let i2 = 0; i2 < renderedItems.length; i2 += 1) { |
| 22498 |
const previousId = id; |
| 22499 |
id = next(i2); |
| 22500 |
if (!id) break; |
| 22501 |
if (id === previousId) continue; |
| 22502 |
const itemElement = (_a = getEnabledItem(store, id)) == null ? void 0 : _a.element; |
| 22503 |
if (!itemElement) continue; |
| 22504 |
const itemOffset = getItemOffset(itemElement, pageUp); |
| 22505 |
const difference = itemOffset - nextPageOffset; |
| 22506 |
const absDifference = Math.abs(difference); |
| 22507 |
if (pageUp && difference <= 0 || !pageUp && difference >= 0) { |
| 22508 |
if (prevDifference !== void 0 && prevDifference < absDifference) { |
| 22509 |
id = previousId; |
| 22510 |
} |
| 22511 |
break; |
| 22512 |
} |
| 22513 |
prevDifference = absDifference; |
| 22514 |
} |
| 22515 |
return id; |
| 22516 |
} |
| 22517 |
function targetIsAnotherItem(event, store) { |
| 22518 |
if (isSelfTarget(event)) return false; |
| 22519 |
return isItem(store, event.target); |
| 22520 |
} |
| 22521 |
var useCompositeItem = createHook( |
| 22522 |
function useCompositeItem2({ |
| 22523 |
store, |
| 22524 |
rowId: rowIdProp, |
| 22525 |
preventScrollOnKeyDown = false, |
| 22526 |
moveOnKeyPress = true, |
| 22527 |
tabbable: tabbable4 = false, |
| 22528 |
getItem: getItemProp, |
| 22529 |
"aria-setsize": ariaSetSizeProp, |
| 22530 |
"aria-posinset": ariaPosInSetProp, |
| 22531 |
...props |
| 22532 |
}) { |
| 22533 |
const context = useCompositeContext(); |
| 22534 |
store = store || context; |
| 22535 |
const id = useId4(props.id); |
| 22536 |
const ref = (0, import_react27.useRef)(null); |
| 22537 |
const row = (0, import_react27.useContext)(CompositeRowContext); |
| 22538 |
const disabled2 = disabledFromProps(props); |
| 22539 |
const trulyDisabled = disabled2 && !props.accessibleWhenDisabled; |
| 22540 |
const { |
| 22541 |
rowId, |
| 22542 |
baseElement, |
| 22543 |
isActiveItem, |
| 22544 |
ariaSetSize, |
| 22545 |
ariaPosInSet, |
| 22546 |
isTabbable: isTabbable2 |
| 22547 |
} = useStoreStateObject(store, { |
| 22548 |
rowId(state) { |
| 22549 |
if (rowIdProp) return rowIdProp; |
| 22550 |
if (!state) return; |
| 22551 |
if (!(row == null ? void 0 : row.baseElement)) return; |
| 22552 |
if (row.baseElement !== state.baseElement) return; |
| 22553 |
return row.id; |
| 22554 |
}, |
| 22555 |
baseElement(state) { |
| 22556 |
return (state == null ? void 0 : state.baseElement) || void 0; |
| 22557 |
}, |
| 22558 |
isActiveItem(state) { |
| 22559 |
return !!state && state.activeId === id; |
| 22560 |
}, |
| 22561 |
ariaSetSize(state) { |
| 22562 |
if (ariaSetSizeProp != null) return ariaSetSizeProp; |
| 22563 |
if (!state) return; |
| 22564 |
if (!(row == null ? void 0 : row.ariaSetSize)) return; |
| 22565 |
if (row.baseElement !== state.baseElement) return; |
| 22566 |
return row.ariaSetSize; |
| 22567 |
}, |
| 22568 |
ariaPosInSet(state) { |
| 22569 |
if (ariaPosInSetProp != null) return ariaPosInSetProp; |
| 22570 |
if (!state) return; |
| 22571 |
if (!(row == null ? void 0 : row.ariaPosInSet)) return; |
| 22572 |
if (row.baseElement !== state.baseElement) return; |
| 22573 |
const itemsInRow = state.renderedItems.filter( |
| 22574 |
(item) => item.rowId === rowId |
| 22575 |
); |
| 22576 |
return row.ariaPosInSet + itemsInRow.findIndex((item) => item.id === id); |
| 22577 |
}, |
| 22578 |
isTabbable(state) { |
| 22579 |
if (!(state == null ? void 0 : state.renderedItems.length)) return true; |
| 22580 |
if (state.virtualFocus) return false; |
| 22581 |
if (tabbable4) return true; |
| 22582 |
if (state.activeId === null) return false; |
| 22583 |
const item = store == null ? void 0 : store.item(state.activeId); |
| 22584 |
if (item == null ? void 0 : item.disabled) return true; |
| 22585 |
if (!(item == null ? void 0 : item.element)) return true; |
| 22586 |
return state.activeId === id; |
| 22587 |
} |
| 22588 |
}); |
| 22589 |
const getItem = (0, import_react27.useCallback)( |
| 22590 |
(item) => { |
| 22591 |
var _a; |
| 22592 |
const nextItem = { |
| 22593 |
...item, |
| 22594 |
id: id || item.id, |
| 22595 |
rowId, |
| 22596 |
disabled: !!trulyDisabled, |
| 22597 |
children: (_a = item.element) == null ? void 0 : _a.textContent |
| 22598 |
}; |
| 22599 |
if (getItemProp) { |
| 22600 |
return getItemProp(nextItem); |
| 22601 |
} |
| 22602 |
return nextItem; |
| 22603 |
}, |
| 22604 |
[id, rowId, trulyDisabled, getItemProp] |
| 22605 |
); |
| 22606 |
const onFocusProp = props.onFocus; |
| 22607 |
const hasFocusedComposite = (0, import_react27.useRef)(false); |
| 22608 |
const onFocus = useEvent((event) => { |
| 22609 |
onFocusProp == null ? void 0 : onFocusProp(event); |
| 22610 |
if (event.defaultPrevented) return; |
| 22611 |
if (isPortalEvent(event)) return; |
| 22612 |
if (!id) return; |
| 22613 |
if (!store) return; |
| 22614 |
if (targetIsAnotherItem(event, store)) return; |
| 22615 |
const { virtualFocus, baseElement: baseElement2 } = store.getState(); |
| 22616 |
store.setActiveId(id); |
| 22617 |
if (isTextbox(event.currentTarget)) { |
| 22618 |
selectTextField(event.currentTarget); |
| 22619 |
} |
| 22620 |
if (!virtualFocus) return; |
| 22621 |
if (!isSelfTarget(event)) return; |
| 22622 |
if (isEditableElement(event.currentTarget)) return; |
| 22623 |
if (!(baseElement2 == null ? void 0 : baseElement2.isConnected)) return; |
| 22624 |
if (isSafari2() && event.currentTarget.hasAttribute("data-autofocus")) { |
| 22625 |
event.currentTarget.scrollIntoView({ |
| 22626 |
block: "nearest", |
| 22627 |
inline: "nearest" |
| 22628 |
}); |
| 22629 |
} |
| 22630 |
hasFocusedComposite.current = true; |
| 22631 |
const fromComposite = event.relatedTarget === baseElement2 || isItem(store, event.relatedTarget); |
| 22632 |
if (fromComposite) { |
| 22633 |
focusSilently(baseElement2); |
| 22634 |
} else { |
| 22635 |
baseElement2.focus(); |
| 22636 |
} |
| 22637 |
}); |
| 22638 |
const onBlurCaptureProp = props.onBlurCapture; |
| 22639 |
const onBlurCapture = useEvent((event) => { |
| 22640 |
onBlurCaptureProp == null ? void 0 : onBlurCaptureProp(event); |
| 22641 |
if (event.defaultPrevented) return; |
| 22642 |
const state = store == null ? void 0 : store.getState(); |
| 22643 |
if ((state == null ? void 0 : state.virtualFocus) && hasFocusedComposite.current) { |
| 22644 |
hasFocusedComposite.current = false; |
| 22645 |
event.preventDefault(); |
| 22646 |
event.stopPropagation(); |
| 22647 |
} |
| 22648 |
}); |
| 22649 |
const onKeyDownProp = props.onKeyDown; |
| 22650 |
const preventScrollOnKeyDownProp = useBooleanEvent(preventScrollOnKeyDown); |
| 22651 |
const moveOnKeyPressProp = useBooleanEvent(moveOnKeyPress); |
| 22652 |
const onKeyDown = useEvent((event) => { |
| 22653 |
onKeyDownProp == null ? void 0 : onKeyDownProp(event); |
| 22654 |
if (event.defaultPrevented) return; |
| 22655 |
if (!isSelfTarget(event)) return; |
| 22656 |
if (!store) return; |
| 22657 |
const { currentTarget } = event; |
| 22658 |
const state = store.getState(); |
| 22659 |
const item = store.item(id); |
| 22660 |
const isGrid2 = !!(item == null ? void 0 : item.rowId); |
| 22661 |
const isVertical = state.orientation !== "horizontal"; |
| 22662 |
const isHorizontal = state.orientation !== "vertical"; |
| 22663 |
const canHomeEnd = () => { |
| 22664 |
if (isGrid2) return true; |
| 22665 |
if (isHorizontal) return true; |
| 22666 |
if (!state.baseElement) return true; |
| 22667 |
if (!isTextField(state.baseElement)) return true; |
| 22668 |
return false; |
| 22669 |
}; |
| 22670 |
const keyMap = { |
| 22671 |
ArrowUp: (isGrid2 || isVertical) && store.up, |
| 22672 |
ArrowRight: (isGrid2 || isHorizontal) && store.next, |
| 22673 |
ArrowDown: (isGrid2 || isVertical) && store.down, |
| 22674 |
ArrowLeft: (isGrid2 || isHorizontal) && store.previous, |
| 22675 |
Home: () => { |
| 22676 |
if (!canHomeEnd()) return; |
| 22677 |
if (!isGrid2 || event.ctrlKey) { |
| 22678 |
return store == null ? void 0 : store.first(); |
| 22679 |
} |
| 22680 |
return store == null ? void 0 : store.previous(-1); |
| 22681 |
}, |
| 22682 |
End: () => { |
| 22683 |
if (!canHomeEnd()) return; |
| 22684 |
if (!isGrid2 || event.ctrlKey) { |
| 22685 |
return store == null ? void 0 : store.last(); |
| 22686 |
} |
| 22687 |
return store == null ? void 0 : store.next(-1); |
| 22688 |
}, |
| 22689 |
PageUp: () => { |
| 22690 |
return findNextPageItemId(currentTarget, store, store == null ? void 0 : store.up, true); |
| 22691 |
}, |
| 22692 |
PageDown: () => { |
| 22693 |
return findNextPageItemId(currentTarget, store, store == null ? void 0 : store.down); |
| 22694 |
} |
| 22695 |
}; |
| 22696 |
const action = keyMap[event.key]; |
| 22697 |
if (action) { |
| 22698 |
if (isTextbox(currentTarget)) { |
| 22699 |
const selection = getTextboxSelection(currentTarget); |
| 22700 |
const isLeft = isHorizontal && event.key === "ArrowLeft"; |
| 22701 |
const isRight = isHorizontal && event.key === "ArrowRight"; |
| 22702 |
const isUp = isVertical && event.key === "ArrowUp"; |
| 22703 |
const isDown = isVertical && event.key === "ArrowDown"; |
| 22704 |
if (isRight || isDown) { |
| 22705 |
const { length: valueLength } = getTextboxValue(currentTarget); |
| 22706 |
if (selection.end !== valueLength) return; |
| 22707 |
} else if ((isLeft || isUp) && selection.start !== 0) return; |
| 22708 |
} |
| 22709 |
const nextId = action(); |
| 22710 |
if (preventScrollOnKeyDownProp(event) || nextId !== void 0) { |
| 22711 |
if (!moveOnKeyPressProp(event)) return; |
| 22712 |
event.preventDefault(); |
| 22713 |
store.move(nextId); |
| 22714 |
} |
| 22715 |
} |
| 22716 |
}); |
| 22717 |
const providerValue = (0, import_react27.useMemo)( |
| 22718 |
() => ({ id, baseElement }), |
| 22719 |
[id, baseElement] |
| 22720 |
); |
| 22721 |
props = useWrapElement( |
| 22722 |
props, |
| 22723 |
(element) => /* @__PURE__ */ (0, import_jsx_runtime111.jsx)(CompositeItemContext.Provider, { value: providerValue, children: element }), |
| 22724 |
[providerValue] |
| 22725 |
); |
| 22726 |
props = { |
| 22727 |
id, |
| 22728 |
"data-active-item": isActiveItem || void 0, |
| 22729 |
...props, |
| 22730 |
ref: useMergeRefs5(ref, props.ref), |
| 22731 |
tabIndex: isTabbable2 ? props.tabIndex : -1, |
| 22732 |
onFocus, |
| 22733 |
onBlurCapture, |
| 22734 |
onKeyDown |
| 22735 |
}; |
| 22736 |
props = useCommand(props); |
| 22737 |
props = useCollectionItem({ |
| 22738 |
store, |
| 22739 |
...props, |
| 22740 |
getItem, |
| 22741 |
shouldRegisterItem: id ? props.shouldRegisterItem : false |
| 22742 |
}); |
| 22743 |
return removeUndefinedValues({ |
| 22744 |
...props, |
| 22745 |
"aria-setsize": ariaSetSize, |
| 22746 |
"aria-posinset": ariaPosInSet |
| 22747 |
}); |
| 22748 |
} |
| 22749 |
); |
| 22750 |
var CompositeItem = memo22( |
| 22751 |
forwardRef210(function CompositeItem2(props) { |
| 22752 |
const htmlProps = useCompositeItem(props); |
| 22753 |
return createElement3(TagName4, htmlProps); |
| 22754 |
}) |
| 22755 |
); |
| 22756 |
|
| 22757 |
// node_modules/@ariakit/core/esm/__chunks/7PRQYBBV.js |
| 22758 |
function toArray(arg) { |
| 22759 |
if (Array.isArray(arg)) { |
| 22760 |
return arg; |
| 22761 |
} |
| 22762 |
return typeof arg !== "undefined" ? [arg] : []; |
| 22763 |
} |
| 22764 |
function flatten2DArray(array) { |
| 22765 |
const flattened = []; |
| 22766 |
for (const row of array) { |
| 22767 |
flattened.push(...row); |
| 22768 |
} |
| 22769 |
return flattened; |
| 22770 |
} |
| 22771 |
function reverseArray(array) { |
| 22772 |
return array.slice().reverse(); |
| 22773 |
} |
| 22774 |
|
| 22775 |
// node_modules/@ariakit/react-core/esm/__chunks/ZMWF7ASR.js |
| 22776 |
var import_react28 = __toESM(require_react(), 1); |
| 22777 |
var import_jsx_runtime112 = __toESM(require_jsx_runtime(), 1); |
| 22778 |
var TagName5 = "div"; |
| 22779 |
function isGrid(items) { |
| 22780 |
return items.some((item) => !!item.rowId); |
| 22781 |
} |
| 22782 |
function isPrintableKey(event) { |
| 22783 |
const target = event.target; |
| 22784 |
if (target && !isTextField(target)) return false; |
| 22785 |
return event.key.length === 1 && !event.ctrlKey && !event.metaKey; |
| 22786 |
} |
| 22787 |
function isModifierKey(event) { |
| 22788 |
return event.key === "Shift" || event.key === "Control" || event.key === "Alt" || event.key === "Meta"; |
| 22789 |
} |
| 22790 |
function useKeyboardEventProxy(store, onKeyboardEvent, previousElementRef) { |
| 22791 |
return useEvent((event) => { |
| 22792 |
var _a; |
| 22793 |
onKeyboardEvent == null ? void 0 : onKeyboardEvent(event); |
| 22794 |
if (event.defaultPrevented) return; |
| 22795 |
if (event.isPropagationStopped()) return; |
| 22796 |
if (!isSelfTarget(event)) return; |
| 22797 |
if (isModifierKey(event)) return; |
| 22798 |
if (isPrintableKey(event)) return; |
| 22799 |
const state = store.getState(); |
| 22800 |
const activeElement2 = (_a = getEnabledItem(store, state.activeId)) == null ? void 0 : _a.element; |
| 22801 |
if (!activeElement2) return; |
| 22802 |
const { view, ...eventInit } = event; |
| 22803 |
const previousElement = previousElementRef == null ? void 0 : previousElementRef.current; |
| 22804 |
if (activeElement2 !== previousElement) { |
| 22805 |
activeElement2.focus(); |
| 22806 |
} |
| 22807 |
if (!fireKeyboardEvent(activeElement2, event.type, eventInit)) { |
| 22808 |
event.preventDefault(); |
| 22809 |
} |
| 22810 |
if (event.currentTarget.contains(activeElement2)) { |
| 22811 |
event.stopPropagation(); |
| 22812 |
} |
| 22813 |
}); |
| 22814 |
} |
| 22815 |
function findFirstEnabledItemInTheLastRow(items) { |
| 22816 |
return findFirstEnabledItem( |
| 22817 |
flatten2DArray(reverseArray(groupItemsByRows(items))) |
| 22818 |
); |
| 22819 |
} |
| 22820 |
function useScheduleFocus(store) { |
| 22821 |
const [scheduled, setScheduled] = (0, import_react28.useState)(false); |
| 22822 |
const schedule = (0, import_react28.useCallback)(() => setScheduled(true), []); |
| 22823 |
const activeItem = store.useState( |
| 22824 |
(state) => getEnabledItem(store, state.activeId) |
| 22825 |
); |
| 22826 |
(0, import_react28.useEffect)(() => { |
| 22827 |
const activeElement2 = activeItem == null ? void 0 : activeItem.element; |
| 22828 |
if (!scheduled) return; |
| 22829 |
if (!activeElement2) return; |
| 22830 |
setScheduled(false); |
| 22831 |
activeElement2.focus({ preventScroll: true }); |
| 22832 |
}, [activeItem, scheduled]); |
| 22833 |
return schedule; |
| 22834 |
} |
| 22835 |
var useComposite = createHook( |
| 22836 |
function useComposite2({ |
| 22837 |
store, |
| 22838 |
composite = true, |
| 22839 |
focusOnMove = composite, |
| 22840 |
moveOnKeyPress = true, |
| 22841 |
...props |
| 22842 |
}) { |
| 22843 |
const context = useCompositeProviderContext(); |
| 22844 |
store = store || context; |
| 22845 |
invariant( |
| 22846 |
store, |
| 22847 |
"Composite must receive a `store` prop or be wrapped in a CompositeProvider component." |
| 22848 |
); |
| 22849 |
const ref = (0, import_react28.useRef)(null); |
| 22850 |
const previousElementRef = (0, import_react28.useRef)(null); |
| 22851 |
const scheduleFocus = useScheduleFocus(store); |
| 22852 |
const moves = store.useState("moves"); |
| 22853 |
const [, setBaseElement] = useTransactionState( |
| 22854 |
composite ? store.setBaseElement : null |
| 22855 |
); |
| 22856 |
(0, import_react28.useEffect)(() => { |
| 22857 |
var _a; |
| 22858 |
if (!store) return; |
| 22859 |
if (!moves) return; |
| 22860 |
if (!composite) return; |
| 22861 |
if (!focusOnMove) return; |
| 22862 |
const { activeId: activeId2 } = store.getState(); |
| 22863 |
const itemElement = (_a = getEnabledItem(store, activeId2)) == null ? void 0 : _a.element; |
| 22864 |
if (!itemElement) return; |
| 22865 |
focusIntoView(itemElement); |
| 22866 |
}, [store, moves, composite, focusOnMove]); |
| 22867 |
useSafeLayoutEffect(() => { |
| 22868 |
if (!store) return; |
| 22869 |
if (!moves) return; |
| 22870 |
if (!composite) return; |
| 22871 |
const { baseElement, activeId: activeId2 } = store.getState(); |
| 22872 |
const isSelfAcive = activeId2 === null; |
| 22873 |
if (!isSelfAcive) return; |
| 22874 |
if (!baseElement) return; |
| 22875 |
const previousElement = previousElementRef.current; |
| 22876 |
previousElementRef.current = null; |
| 22877 |
if (previousElement) { |
| 22878 |
fireBlurEvent(previousElement, { relatedTarget: baseElement }); |
| 22879 |
} |
| 22880 |
if (!hasFocus(baseElement)) { |
| 22881 |
baseElement.focus(); |
| 22882 |
} |
| 22883 |
}, [store, moves, composite]); |
| 22884 |
const activeId = store.useState("activeId"); |
| 22885 |
const virtualFocus = store.useState("virtualFocus"); |
| 22886 |
useSafeLayoutEffect(() => { |
| 22887 |
var _a; |
| 22888 |
if (!store) return; |
| 22889 |
if (!composite) return; |
| 22890 |
if (!virtualFocus) return; |
| 22891 |
const previousElement = previousElementRef.current; |
| 22892 |
previousElementRef.current = null; |
| 22893 |
if (!previousElement) return; |
| 22894 |
const activeElement2 = (_a = getEnabledItem(store, activeId)) == null ? void 0 : _a.element; |
| 22895 |
const relatedTarget = activeElement2 || getActiveElement(previousElement); |
| 22896 |
if (relatedTarget === previousElement) return; |
| 22897 |
fireBlurEvent(previousElement, { relatedTarget }); |
| 22898 |
}, [store, activeId, virtualFocus, composite]); |
| 22899 |
const onKeyDownCapture = useKeyboardEventProxy( |
| 22900 |
store, |
| 22901 |
props.onKeyDownCapture, |
| 22902 |
previousElementRef |
| 22903 |
); |
| 22904 |
const onKeyUpCapture = useKeyboardEventProxy( |
| 22905 |
store, |
| 22906 |
props.onKeyUpCapture, |
| 22907 |
previousElementRef |
| 22908 |
); |
| 22909 |
const onFocusCaptureProp = props.onFocusCapture; |
| 22910 |
const onFocusCapture = useEvent((event) => { |
| 22911 |
onFocusCaptureProp == null ? void 0 : onFocusCaptureProp(event); |
| 22912 |
if (event.defaultPrevented) return; |
| 22913 |
if (!store) return; |
| 22914 |
const { virtualFocus: virtualFocus2 } = store.getState(); |
| 22915 |
if (!virtualFocus2) return; |
| 22916 |
const previousActiveElement = event.relatedTarget; |
| 22917 |
const isSilentlyFocused = silentlyFocused(event.currentTarget); |
| 22918 |
if (isSelfTarget(event) && isSilentlyFocused) { |
| 22919 |
event.stopPropagation(); |
| 22920 |
previousElementRef.current = previousActiveElement; |
| 22921 |
} |
| 22922 |
}); |
| 22923 |
const onFocusProp = props.onFocus; |
| 22924 |
const onFocus = useEvent((event) => { |
| 22925 |
onFocusProp == null ? void 0 : onFocusProp(event); |
| 22926 |
if (event.defaultPrevented) return; |
| 22927 |
if (!composite) return; |
| 22928 |
if (!store) return; |
| 22929 |
const { relatedTarget } = event; |
| 22930 |
const { virtualFocus: virtualFocus2 } = store.getState(); |
| 22931 |
if (virtualFocus2) { |
| 22932 |
if (isSelfTarget(event) && !isItem(store, relatedTarget)) { |
| 22933 |
queueMicrotask(scheduleFocus); |
| 22934 |
} |
| 22935 |
} else if (isSelfTarget(event)) { |
| 22936 |
store.setActiveId(null); |
| 22937 |
} |
| 22938 |
}); |
| 22939 |
const onBlurCaptureProp = props.onBlurCapture; |
| 22940 |
const onBlurCapture = useEvent((event) => { |
| 22941 |
var _a; |
| 22942 |
onBlurCaptureProp == null ? void 0 : onBlurCaptureProp(event); |
| 22943 |
if (event.defaultPrevented) return; |
| 22944 |
if (!store) return; |
| 22945 |
const { virtualFocus: virtualFocus2, activeId: activeId2 } = store.getState(); |
| 22946 |
if (!virtualFocus2) return; |
| 22947 |
const activeElement2 = (_a = getEnabledItem(store, activeId2)) == null ? void 0 : _a.element; |
| 22948 |
const nextActiveElement = event.relatedTarget; |
| 22949 |
const nextActiveElementIsItem = isItem(store, nextActiveElement); |
| 22950 |
const previousElement = previousElementRef.current; |
| 22951 |
previousElementRef.current = null; |
| 22952 |
if (isSelfTarget(event) && nextActiveElementIsItem) { |
| 22953 |
if (nextActiveElement === activeElement2) { |
| 22954 |
if (previousElement && previousElement !== nextActiveElement) { |
| 22955 |
fireBlurEvent(previousElement, event); |
| 22956 |
} |
| 22957 |
} else if (activeElement2) { |
| 22958 |
fireBlurEvent(activeElement2, event); |
| 22959 |
} else if (previousElement) { |
| 22960 |
fireBlurEvent(previousElement, event); |
| 22961 |
} |
| 22962 |
event.stopPropagation(); |
| 22963 |
} else { |
| 22964 |
const targetIsItem = isItem(store, event.target); |
| 22965 |
if (!targetIsItem && activeElement2) { |
| 22966 |
fireBlurEvent(activeElement2, event); |
| 22967 |
} |
| 22968 |
} |
| 22969 |
}); |
| 22970 |
const onKeyDownProp = props.onKeyDown; |
| 22971 |
const moveOnKeyPressProp = useBooleanEvent(moveOnKeyPress); |
| 22972 |
const onKeyDown = useEvent((event) => { |
| 22973 |
var _a; |
| 22974 |
onKeyDownProp == null ? void 0 : onKeyDownProp(event); |
| 22975 |
if (event.nativeEvent.isComposing) return; |
| 22976 |
if (event.defaultPrevented) return; |
| 22977 |
if (!store) return; |
| 22978 |
if (!isSelfTarget(event)) return; |
| 22979 |
const { orientation, renderedItems, activeId: activeId2 } = store.getState(); |
| 22980 |
const activeItem = getEnabledItem(store, activeId2); |
| 22981 |
if ((_a = activeItem == null ? void 0 : activeItem.element) == null ? void 0 : _a.isConnected) return; |
| 22982 |
const isVertical = orientation !== "horizontal"; |
| 22983 |
const isHorizontal = orientation !== "vertical"; |
| 22984 |
const grid = isGrid(renderedItems); |
| 22985 |
const isHorizontalKey = event.key === "ArrowLeft" || event.key === "ArrowRight" || event.key === "Home" || event.key === "End"; |
| 22986 |
if (isHorizontalKey && isTextField(event.currentTarget)) return; |
| 22987 |
const up = () => { |
| 22988 |
if (grid) { |
| 22989 |
const item = findFirstEnabledItemInTheLastRow(renderedItems); |
| 22990 |
return item == null ? void 0 : item.id; |
| 22991 |
} |
| 22992 |
return store == null ? void 0 : store.last(); |
| 22993 |
}; |
| 22994 |
const keyMap = { |
| 22995 |
ArrowUp: (grid || isVertical) && up, |
| 22996 |
ArrowRight: (grid || isHorizontal) && store.first, |
| 22997 |
ArrowDown: (grid || isVertical) && store.first, |
| 22998 |
ArrowLeft: (grid || isHorizontal) && store.last, |
| 22999 |
Home: store.first, |
| 23000 |
End: store.last, |
| 23001 |
PageUp: store.first, |
| 23002 |
PageDown: store.last |
| 23003 |
}; |
| 23004 |
const action = keyMap[event.key]; |
| 23005 |
if (action) { |
| 23006 |
const id = action(); |
| 23007 |
if (id !== void 0) { |
| 23008 |
if (!moveOnKeyPressProp(event)) return; |
| 23009 |
event.preventDefault(); |
| 23010 |
store.move(id); |
| 23011 |
} |
| 23012 |
} |
| 23013 |
}); |
| 23014 |
props = useWrapElement( |
| 23015 |
props, |
| 23016 |
(element) => /* @__PURE__ */ (0, import_jsx_runtime112.jsx)(CompositeContextProvider, { value: store, children: element }), |
| 23017 |
[store] |
| 23018 |
); |
| 23019 |
const activeDescendant = store.useState((state) => { |
| 23020 |
var _a; |
| 23021 |
if (!store) return; |
| 23022 |
if (!composite) return; |
| 23023 |
if (!state.virtualFocus) return; |
| 23024 |
return (_a = getEnabledItem(store, state.activeId)) == null ? void 0 : _a.id; |
| 23025 |
}); |
| 23026 |
props = { |
| 23027 |
"aria-activedescendant": activeDescendant, |
| 23028 |
...props, |
| 23029 |
ref: useMergeRefs5(ref, setBaseElement, props.ref), |
| 23030 |
onKeyDownCapture, |
| 23031 |
onKeyUpCapture, |
| 23032 |
onFocusCapture, |
| 23033 |
onFocus, |
| 23034 |
onBlurCapture, |
| 23035 |
onKeyDown |
| 23036 |
}; |
| 23037 |
const focusable2 = store.useState( |
| 23038 |
(state) => composite && (state.virtualFocus || state.activeId === null) |
| 23039 |
); |
| 23040 |
props = useFocusable({ focusable: focusable2, ...props }); |
| 23041 |
return props; |
| 23042 |
} |
| 23043 |
); |
| 23044 |
var Composite5 = forwardRef210(function Composite22(props) { |
| 23045 |
const htmlProps = useComposite(props); |
| 23046 |
return createElement3(TagName5, htmlProps); |
| 23047 |
}); |
| 23048 |
|
| 23049 |
// node_modules/@ariakit/react-core/esm/__chunks/LVDQFHCH.js |
| 23050 |
var ctx3 = createStoreContext(); |
| 23051 |
var useDisclosureContext = ctx3.useContext; |
| 23052 |
var useDisclosureScopedContext = ctx3.useScopedContext; |
| 23053 |
var useDisclosureProviderContext = ctx3.useProviderContext; |
| 23054 |
var DisclosureContextProvider = ctx3.ContextProvider; |
| 23055 |
var DisclosureScopedContextProvider = ctx3.ScopedContextProvider; |
| 23056 |
|
| 23057 |
// node_modules/@ariakit/react-core/esm/__chunks/A62MDFCW.js |
| 23058 |
var import_react29 = __toESM(require_react(), 1); |
| 23059 |
var ctx4 = createStoreContext( |
| 23060 |
[DisclosureContextProvider], |
| 23061 |
[DisclosureScopedContextProvider] |
| 23062 |
); |
| 23063 |
var useDialogContext = ctx4.useContext; |
| 23064 |
var useDialogScopedContext = ctx4.useScopedContext; |
| 23065 |
var useDialogProviderContext = ctx4.useProviderContext; |
| 23066 |
var DialogContextProvider = ctx4.ContextProvider; |
| 23067 |
var DialogScopedContextProvider = ctx4.ScopedContextProvider; |
| 23068 |
var DialogHeadingContext = (0, import_react29.createContext)(void 0); |
| 23069 |
var DialogDescriptionContext = (0, import_react29.createContext)(void 0); |
| 23070 |
|
| 23071 |
// node_modules/@ariakit/react-core/esm/__chunks/6B3RXHKP.js |
| 23072 |
var import_react30 = __toESM(require_react(), 1); |
| 23073 |
var import_react_dom4 = __toESM(require_react_dom(), 1); |
| 23074 |
var import_jsx_runtime113 = __toESM(require_jsx_runtime(), 1); |
| 23075 |
var TagName6 = "div"; |
| 23076 |
function afterTimeout(timeoutMs, cb) { |
| 23077 |
const timeoutId = setTimeout(cb, timeoutMs); |
| 23078 |
return () => clearTimeout(timeoutId); |
| 23079 |
} |
| 23080 |
function afterPaint2(cb) { |
| 23081 |
let raf = requestAnimationFrame(() => { |
| 23082 |
raf = requestAnimationFrame(cb); |
| 23083 |
}); |
| 23084 |
return () => cancelAnimationFrame(raf); |
| 23085 |
} |
| 23086 |
function parseCSSTime(...times) { |
| 23087 |
return times.join(", ").split(", ").reduce((longestTime, currentTimeString) => { |
| 23088 |
const multiplier = currentTimeString.endsWith("ms") ? 1 : 1e3; |
| 23089 |
const currentTime = Number.parseFloat(currentTimeString || "0s") * multiplier; |
| 23090 |
if (currentTime > longestTime) return currentTime; |
| 23091 |
return longestTime; |
| 23092 |
}, 0); |
| 23093 |
} |
| 23094 |
function isHidden3(mounted, hidden, alwaysVisible) { |
| 23095 |
return !alwaysVisible && hidden !== false && (!mounted || !!hidden); |
| 23096 |
} |
| 23097 |
var useDisclosureContent = createHook(function useDisclosureContent2({ store, alwaysVisible, ...props }) { |
| 23098 |
const context = useDisclosureProviderContext(); |
| 23099 |
store = store || context; |
| 23100 |
invariant( |
| 23101 |
store, |
| 23102 |
"DisclosureContent must receive a `store` prop or be wrapped in a DisclosureProvider component." |
| 23103 |
); |
| 23104 |
const ref = (0, import_react30.useRef)(null); |
| 23105 |
const id = useId4(props.id); |
| 23106 |
const [transition, setTransition] = (0, import_react30.useState)(null); |
| 23107 |
const open = store.useState("open"); |
| 23108 |
const mounted = store.useState("mounted"); |
| 23109 |
const animated = store.useState("animated"); |
| 23110 |
const contentElement = store.useState("contentElement"); |
| 23111 |
const otherElement = useStoreState(store.disclosure, "contentElement"); |
| 23112 |
useSafeLayoutEffect(() => { |
| 23113 |
if (!ref.current) return; |
| 23114 |
store == null ? void 0 : store.setContentElement(ref.current); |
| 23115 |
}, [store]); |
| 23116 |
useSafeLayoutEffect(() => { |
| 23117 |
let previousAnimated; |
| 23118 |
store == null ? void 0 : store.setState("animated", (animated2) => { |
| 23119 |
previousAnimated = animated2; |
| 23120 |
return true; |
| 23121 |
}); |
| 23122 |
return () => { |
| 23123 |
if (previousAnimated === void 0) return; |
| 23124 |
store == null ? void 0 : store.setState("animated", previousAnimated); |
| 23125 |
}; |
| 23126 |
}, [store]); |
| 23127 |
useSafeLayoutEffect(() => { |
| 23128 |
if (!animated) return; |
| 23129 |
if (!(contentElement == null ? void 0 : contentElement.isConnected)) { |
| 23130 |
setTransition(null); |
| 23131 |
return; |
| 23132 |
} |
| 23133 |
return afterPaint2(() => { |
| 23134 |
setTransition(open ? "enter" : mounted ? "leave" : null); |
| 23135 |
}); |
| 23136 |
}, [animated, contentElement, open, mounted]); |
| 23137 |
useSafeLayoutEffect(() => { |
| 23138 |
if (!store) return; |
| 23139 |
if (!animated) return; |
| 23140 |
if (!transition) return; |
| 23141 |
if (!contentElement) return; |
| 23142 |
const stopAnimation = () => store == null ? void 0 : store.setState("animating", false); |
| 23143 |
const stopAnimationSync = () => (0, import_react_dom4.flushSync)(stopAnimation); |
| 23144 |
if (transition === "leave" && open) return; |
| 23145 |
if (transition === "enter" && !open) return; |
| 23146 |
if (typeof animated === "number") { |
| 23147 |
const timeout2 = animated; |
| 23148 |
return afterTimeout(timeout2, stopAnimationSync); |
| 23149 |
} |
| 23150 |
const { |
| 23151 |
transitionDuration, |
| 23152 |
animationDuration, |
| 23153 |
transitionDelay, |
| 23154 |
animationDelay |
| 23155 |
} = getComputedStyle(contentElement); |
| 23156 |
const { |
| 23157 |
transitionDuration: transitionDuration2 = "0", |
| 23158 |
animationDuration: animationDuration2 = "0", |
| 23159 |
transitionDelay: transitionDelay2 = "0", |
| 23160 |
animationDelay: animationDelay2 = "0" |
| 23161 |
} = otherElement ? getComputedStyle(otherElement) : {}; |
| 23162 |
const delay = parseCSSTime( |
| 23163 |
transitionDelay, |
| 23164 |
animationDelay, |
| 23165 |
transitionDelay2, |
| 23166 |
animationDelay2 |
| 23167 |
); |
| 23168 |
const duration = parseCSSTime( |
| 23169 |
transitionDuration, |
| 23170 |
animationDuration, |
| 23171 |
transitionDuration2, |
| 23172 |
animationDuration2 |
| 23173 |
); |
| 23174 |
const timeout = delay + duration; |
| 23175 |
if (!timeout) { |
| 23176 |
if (transition === "enter") { |
| 23177 |
store.setState("animated", false); |
| 23178 |
} |
| 23179 |
stopAnimation(); |
| 23180 |
return; |
| 23181 |
} |
| 23182 |
const frameRate = 1e3 / 60; |
| 23183 |
const maxTimeout = Math.max(timeout - frameRate, 0); |
| 23184 |
return afterTimeout(maxTimeout, stopAnimationSync); |
| 23185 |
}, [store, animated, contentElement, otherElement, open, transition]); |
| 23186 |
props = useWrapElement( |
| 23187 |
props, |
| 23188 |
(element) => /* @__PURE__ */ (0, import_jsx_runtime113.jsx)(DialogScopedContextProvider, { value: store, children: element }), |
| 23189 |
[store] |
| 23190 |
); |
| 23191 |
const hidden = isHidden3(mounted, props.hidden, alwaysVisible); |
| 23192 |
const styleProp = props.style; |
| 23193 |
const style = (0, import_react30.useMemo)(() => { |
| 23194 |
if (hidden) { |
| 23195 |
return { ...styleProp, display: "none" }; |
| 23196 |
} |
| 23197 |
return styleProp; |
| 23198 |
}, [hidden, styleProp]); |
| 23199 |
props = { |
| 23200 |
id, |
| 23201 |
"data-open": open || void 0, |
| 23202 |
"data-enter": transition === "enter" || void 0, |
| 23203 |
"data-leave": transition === "leave" || void 0, |
| 23204 |
hidden, |
| 23205 |
...props, |
| 23206 |
ref: useMergeRefs5(id ? store.setContentElement : null, ref, props.ref), |
| 23207 |
style |
| 23208 |
}; |
| 23209 |
return removeUndefinedValues(props); |
| 23210 |
}); |
| 23211 |
var DisclosureContentImpl = forwardRef210(function DisclosureContentImpl2(props) { |
| 23212 |
const htmlProps = useDisclosureContent(props); |
| 23213 |
return createElement3(TagName6, htmlProps); |
| 23214 |
}); |
| 23215 |
var DisclosureContent = forwardRef210(function DisclosureContent2({ |
| 23216 |
unmountOnHide, |
| 23217 |
...props |
| 23218 |
}) { |
| 23219 |
const context = useDisclosureProviderContext(); |
| 23220 |
const store = props.store || context; |
| 23221 |
const mounted = useStoreState( |
| 23222 |
store, |
| 23223 |
(state) => !unmountOnHide || (state == null ? void 0 : state.mounted) |
| 23224 |
); |
| 23225 |
if (mounted === false) return null; |
| 23226 |
return /* @__PURE__ */ (0, import_jsx_runtime113.jsx)(DisclosureContentImpl, { ...props }); |
| 23227 |
}); |
| 23228 |
|
| 23229 |
// node_modules/@ariakit/core/esm/__chunks/75BJEVSH.js |
| 23230 |
function createDisclosureStore(props = {}) { |
| 23231 |
const store = mergeStore( |
| 23232 |
props.store, |
| 23233 |
omit2(props.disclosure, ["contentElement", "disclosureElement"]) |
| 23234 |
); |
| 23235 |
throwOnConflictingProps(props, store); |
| 23236 |
const syncState = store == null ? void 0 : store.getState(); |
| 23237 |
const open = defaultValue( |
| 23238 |
props.open, |
| 23239 |
syncState == null ? void 0 : syncState.open, |
| 23240 |
props.defaultOpen, |
| 23241 |
false |
| 23242 |
); |
| 23243 |
const animated = defaultValue(props.animated, syncState == null ? void 0 : syncState.animated, false); |
| 23244 |
const initialState = { |
| 23245 |
open, |
| 23246 |
animated, |
| 23247 |
animating: !!animated && open, |
| 23248 |
mounted: open, |
| 23249 |
contentElement: defaultValue(syncState == null ? void 0 : syncState.contentElement, null), |
| 23250 |
disclosureElement: defaultValue(syncState == null ? void 0 : syncState.disclosureElement, null) |
| 23251 |
}; |
| 23252 |
const disclosure = createStore(initialState, store); |
| 23253 |
setup( |
| 23254 |
disclosure, |
| 23255 |
() => sync(disclosure, ["animated", "animating"], (state) => { |
| 23256 |
if (state.animated) return; |
| 23257 |
disclosure.setState("animating", false); |
| 23258 |
}) |
| 23259 |
); |
| 23260 |
setup( |
| 23261 |
disclosure, |
| 23262 |
() => subscribe(disclosure, ["open"], () => { |
| 23263 |
if (!disclosure.getState().animated) return; |
| 23264 |
disclosure.setState("animating", true); |
| 23265 |
}) |
| 23266 |
); |
| 23267 |
setup( |
| 23268 |
disclosure, |
| 23269 |
() => sync(disclosure, ["open", "animating"], (state) => { |
| 23270 |
disclosure.setState("mounted", state.open || state.animating); |
| 23271 |
}) |
| 23272 |
); |
| 23273 |
return { |
| 23274 |
...disclosure, |
| 23275 |
disclosure: props.disclosure, |
| 23276 |
setOpen: (value) => disclosure.setState("open", value), |
| 23277 |
show: () => disclosure.setState("open", true), |
| 23278 |
hide: () => disclosure.setState("open", false), |
| 23279 |
toggle: () => disclosure.setState("open", (open2) => !open2), |
| 23280 |
stopAnimation: () => disclosure.setState("animating", false), |
| 23281 |
setContentElement: (value) => disclosure.setState("contentElement", value), |
| 23282 |
setDisclosureElement: (value) => disclosure.setState("disclosureElement", value) |
| 23283 |
}; |
| 23284 |
} |
| 23285 |
|
| 23286 |
// node_modules/@ariakit/react-core/esm/__chunks/WLZ6H5FH.js |
| 23287 |
function useDisclosureStoreProps(store, update2, props) { |
| 23288 |
useUpdateEffect(update2, [props.store, props.disclosure]); |
| 23289 |
useStoreProps(store, props, "open", "setOpen"); |
| 23290 |
useStoreProps(store, props, "mounted", "setMounted"); |
| 23291 |
useStoreProps(store, props, "animated"); |
| 23292 |
return Object.assign(store, { disclosure: props.disclosure }); |
| 23293 |
} |
| 23294 |
|
| 23295 |
// node_modules/@ariakit/react-core/esm/__chunks/JMU4N4M5.js |
| 23296 |
var ctx5 = createStoreContext( |
| 23297 |
[DialogContextProvider], |
| 23298 |
[DialogScopedContextProvider] |
| 23299 |
); |
| 23300 |
var usePopoverContext = ctx5.useContext; |
| 23301 |
var usePopoverScopedContext = ctx5.useScopedContext; |
| 23302 |
var usePopoverProviderContext = ctx5.useProviderContext; |
| 23303 |
var PopoverContextProvider = ctx5.ContextProvider; |
| 23304 |
var PopoverScopedContextProvider = ctx5.ScopedContextProvider; |
| 23305 |
|
| 23306 |
// node_modules/@ariakit/core/esm/__chunks/N5XGANPW.js |
| 23307 |
function getCommonParent(items) { |
| 23308 |
var _a; |
| 23309 |
const firstItem = items.find((item) => !!item.element); |
| 23310 |
const lastItem = [...items].reverse().find((item) => !!item.element); |
| 23311 |
let parentElement = (_a = firstItem == null ? void 0 : firstItem.element) == null ? void 0 : _a.parentElement; |
| 23312 |
while (parentElement && (lastItem == null ? void 0 : lastItem.element)) { |
| 23313 |
const parent = parentElement; |
| 23314 |
if (lastItem && parent.contains(lastItem.element)) { |
| 23315 |
return parentElement; |
| 23316 |
} |
| 23317 |
parentElement = parentElement.parentElement; |
| 23318 |
} |
| 23319 |
return getDocument(parentElement).body; |
| 23320 |
} |
| 23321 |
function getPrivateStore(store) { |
| 23322 |
return store == null ? void 0 : store.__unstablePrivateStore; |
| 23323 |
} |
| 23324 |
function createCollectionStore(props = {}) { |
| 23325 |
var _a; |
| 23326 |
throwOnConflictingProps(props, props.store); |
| 23327 |
const syncState = (_a = props.store) == null ? void 0 : _a.getState(); |
| 23328 |
const items = defaultValue( |
| 23329 |
props.items, |
| 23330 |
syncState == null ? void 0 : syncState.items, |
| 23331 |
props.defaultItems, |
| 23332 |
[] |
| 23333 |
); |
| 23334 |
const itemsMap = new Map(items.map((item) => [item.id, item])); |
| 23335 |
const initialState = { |
| 23336 |
items, |
| 23337 |
renderedItems: defaultValue(syncState == null ? void 0 : syncState.renderedItems, []) |
| 23338 |
}; |
| 23339 |
const syncPrivateStore = getPrivateStore(props.store); |
| 23340 |
const privateStore = createStore( |
| 23341 |
{ items, renderedItems: initialState.renderedItems }, |
| 23342 |
syncPrivateStore |
| 23343 |
); |
| 23344 |
const collection = createStore(initialState, props.store); |
| 23345 |
const sortItems = (renderedItems) => { |
| 23346 |
const sortedItems = sortBasedOnDOMPosition(renderedItems, (i2) => i2.element); |
| 23347 |
privateStore.setState("renderedItems", sortedItems); |
| 23348 |
collection.setState("renderedItems", sortedItems); |
| 23349 |
}; |
| 23350 |
setup(collection, () => init(privateStore)); |
| 23351 |
setup(privateStore, () => { |
| 23352 |
return batch(privateStore, ["items"], (state) => { |
| 23353 |
collection.setState("items", state.items); |
| 23354 |
}); |
| 23355 |
}); |
| 23356 |
setup(privateStore, () => { |
| 23357 |
return batch(privateStore, ["renderedItems"], (state) => { |
| 23358 |
let firstRun = true; |
| 23359 |
let raf = requestAnimationFrame(() => { |
| 23360 |
const { renderedItems } = collection.getState(); |
| 23361 |
if (state.renderedItems === renderedItems) return; |
| 23362 |
sortItems(state.renderedItems); |
| 23363 |
}); |
| 23364 |
if (typeof IntersectionObserver !== "function") { |
| 23365 |
return () => cancelAnimationFrame(raf); |
| 23366 |
} |
| 23367 |
const ioCallback = () => { |
| 23368 |
if (firstRun) { |
| 23369 |
firstRun = false; |
| 23370 |
return; |
| 23371 |
} |
| 23372 |
cancelAnimationFrame(raf); |
| 23373 |
raf = requestAnimationFrame(() => sortItems(state.renderedItems)); |
| 23374 |
}; |
| 23375 |
const root = getCommonParent(state.renderedItems); |
| 23376 |
const observer = new IntersectionObserver(ioCallback, { root }); |
| 23377 |
for (const item of state.renderedItems) { |
| 23378 |
if (!item.element) continue; |
| 23379 |
observer.observe(item.element); |
| 23380 |
} |
| 23381 |
return () => { |
| 23382 |
cancelAnimationFrame(raf); |
| 23383 |
observer.disconnect(); |
| 23384 |
}; |
| 23385 |
}); |
| 23386 |
}); |
| 23387 |
const mergeItem = (item, setItems, canDeleteFromMap = false) => { |
| 23388 |
let prevItem; |
| 23389 |
setItems((items2) => { |
| 23390 |
const index2 = items2.findIndex(({ id }) => id === item.id); |
| 23391 |
const nextItems = items2.slice(); |
| 23392 |
if (index2 !== -1) { |
| 23393 |
prevItem = items2[index2]; |
| 23394 |
const nextItem = { ...prevItem, ...item }; |
| 23395 |
nextItems[index2] = nextItem; |
| 23396 |
itemsMap.set(item.id, nextItem); |
| 23397 |
} else { |
| 23398 |
nextItems.push(item); |
| 23399 |
itemsMap.set(item.id, item); |
| 23400 |
} |
| 23401 |
return nextItems; |
| 23402 |
}); |
| 23403 |
const unmergeItem = () => { |
| 23404 |
setItems((items2) => { |
| 23405 |
if (!prevItem) { |
| 23406 |
if (canDeleteFromMap) { |
| 23407 |
itemsMap.delete(item.id); |
| 23408 |
} |
| 23409 |
return items2.filter(({ id }) => id !== item.id); |
| 23410 |
} |
| 23411 |
const index2 = items2.findIndex(({ id }) => id === item.id); |
| 23412 |
if (index2 === -1) return items2; |
| 23413 |
const nextItems = items2.slice(); |
| 23414 |
nextItems[index2] = prevItem; |
| 23415 |
itemsMap.set(item.id, prevItem); |
| 23416 |
return nextItems; |
| 23417 |
}); |
| 23418 |
}; |
| 23419 |
return unmergeItem; |
| 23420 |
}; |
| 23421 |
const registerItem = (item) => mergeItem( |
| 23422 |
item, |
| 23423 |
(getItems) => privateStore.setState("items", getItems), |
| 23424 |
true |
| 23425 |
); |
| 23426 |
return { |
| 23427 |
...collection, |
| 23428 |
registerItem, |
| 23429 |
renderItem: (item) => chain( |
| 23430 |
registerItem(item), |
| 23431 |
mergeItem( |
| 23432 |
item, |
| 23433 |
(getItems) => privateStore.setState("renderedItems", getItems) |
| 23434 |
) |
| 23435 |
), |
| 23436 |
item: (id) => { |
| 23437 |
if (!id) return null; |
| 23438 |
let item = itemsMap.get(id); |
| 23439 |
if (!item) { |
| 23440 |
const { items: items2 } = privateStore.getState(); |
| 23441 |
item = items2.find((item2) => item2.id === id); |
| 23442 |
if (item) { |
| 23443 |
itemsMap.set(id, item); |
| 23444 |
} |
| 23445 |
} |
| 23446 |
return item || null; |
| 23447 |
}, |
| 23448 |
// @ts-expect-error Internal |
| 23449 |
__unstablePrivateStore: privateStore |
| 23450 |
}; |
| 23451 |
} |
| 23452 |
|
| 23453 |
// node_modules/@ariakit/react-core/esm/__chunks/GVAFFF2B.js |
| 23454 |
function useCollectionStoreProps(store, update2, props) { |
| 23455 |
useUpdateEffect(update2, [props.store]); |
| 23456 |
useStoreProps(store, props, "items", "setItems"); |
| 23457 |
return store; |
| 23458 |
} |
| 23459 |
|
| 23460 |
// node_modules/@ariakit/core/esm/__chunks/RVTIKFRL.js |
| 23461 |
var NULL_ITEM = { id: null }; |
| 23462 |
function findFirstEnabledItem2(items, excludeId) { |
| 23463 |
return items.find((item) => { |
| 23464 |
if (excludeId) { |
| 23465 |
return !item.disabled && item.id !== excludeId; |
| 23466 |
} |
| 23467 |
return !item.disabled; |
| 23468 |
}); |
| 23469 |
} |
| 23470 |
function getEnabledItems(items, excludeId) { |
| 23471 |
return items.filter((item) => { |
| 23472 |
if (excludeId) { |
| 23473 |
return !item.disabled && item.id !== excludeId; |
| 23474 |
} |
| 23475 |
return !item.disabled; |
| 23476 |
}); |
| 23477 |
} |
| 23478 |
function getItemsInRow(items, rowId) { |
| 23479 |
return items.filter((item) => item.rowId === rowId); |
| 23480 |
} |
| 23481 |
function flipItems(items, activeId, shouldInsertNullItem = false) { |
| 23482 |
const index2 = items.findIndex((item) => item.id === activeId); |
| 23483 |
return [ |
| 23484 |
...items.slice(index2 + 1), |
| 23485 |
...shouldInsertNullItem ? [NULL_ITEM] : [], |
| 23486 |
...items.slice(0, index2) |
| 23487 |
]; |
| 23488 |
} |
| 23489 |
function groupItemsByRows2(items) { |
| 23490 |
const rows = []; |
| 23491 |
for (const item of items) { |
| 23492 |
const row = rows.find((currentRow) => { |
| 23493 |
var _a; |
| 23494 |
return ((_a = currentRow[0]) == null ? void 0 : _a.rowId) === item.rowId; |
| 23495 |
}); |
| 23496 |
if (row) { |
| 23497 |
row.push(item); |
| 23498 |
} else { |
| 23499 |
rows.push([item]); |
| 23500 |
} |
| 23501 |
} |
| 23502 |
return rows; |
| 23503 |
} |
| 23504 |
function getMaxRowLength(array) { |
| 23505 |
let maxLength = 0; |
| 23506 |
for (const { length } of array) { |
| 23507 |
if (length > maxLength) { |
| 23508 |
maxLength = length; |
| 23509 |
} |
| 23510 |
} |
| 23511 |
return maxLength; |
| 23512 |
} |
| 23513 |
function createEmptyItem(rowId) { |
| 23514 |
return { |
| 23515 |
id: "__EMPTY_ITEM__", |
| 23516 |
disabled: true, |
| 23517 |
rowId |
| 23518 |
}; |
| 23519 |
} |
| 23520 |
function normalizeRows(rows, activeId, focusShift) { |
| 23521 |
const maxLength = getMaxRowLength(rows); |
| 23522 |
for (const row of rows) { |
| 23523 |
for (let i2 = 0; i2 < maxLength; i2 += 1) { |
| 23524 |
const item = row[i2]; |
| 23525 |
if (!item || focusShift && item.disabled) { |
| 23526 |
const isFirst = i2 === 0; |
| 23527 |
const previousItem = isFirst && focusShift ? findFirstEnabledItem2(row) : row[i2 - 1]; |
| 23528 |
row[i2] = previousItem && activeId !== previousItem.id && focusShift ? previousItem : createEmptyItem(previousItem == null ? void 0 : previousItem.rowId); |
| 23529 |
} |
| 23530 |
} |
| 23531 |
} |
| 23532 |
return rows; |
| 23533 |
} |
| 23534 |
function verticalizeItems(items) { |
| 23535 |
const rows = groupItemsByRows2(items); |
| 23536 |
const maxLength = getMaxRowLength(rows); |
| 23537 |
const verticalized = []; |
| 23538 |
for (let i2 = 0; i2 < maxLength; i2 += 1) { |
| 23539 |
for (const row of rows) { |
| 23540 |
const item = row[i2]; |
| 23541 |
if (item) { |
| 23542 |
verticalized.push({ |
| 23543 |
...item, |
| 23544 |
// If there's no rowId, it means that it's not a grid composite, but |
| 23545 |
// a single row instead. So, instead of verticalizing it, that is, |
| 23546 |
// assigning a different rowId based on the column index, we keep it |
| 23547 |
// undefined so they will be part of the same row. This is useful |
| 23548 |
// when using up/down on one-dimensional composites. |
| 23549 |
rowId: item.rowId ? `${i2}` : void 0 |
| 23550 |
}); |
| 23551 |
} |
| 23552 |
} |
| 23553 |
} |
| 23554 |
return verticalized; |
| 23555 |
} |
| 23556 |
function createCompositeStore(props = {}) { |
| 23557 |
var _a; |
| 23558 |
const syncState = (_a = props.store) == null ? void 0 : _a.getState(); |
| 23559 |
const collection = createCollectionStore(props); |
| 23560 |
const activeId = defaultValue( |
| 23561 |
props.activeId, |
| 23562 |
syncState == null ? void 0 : syncState.activeId, |
| 23563 |
props.defaultActiveId |
| 23564 |
); |
| 23565 |
const initialState = { |
| 23566 |
...collection.getState(), |
| 23567 |
id: defaultValue( |
| 23568 |
props.id, |
| 23569 |
syncState == null ? void 0 : syncState.id, |
| 23570 |
`id-${Math.random().toString(36).slice(2, 8)}` |
| 23571 |
), |
| 23572 |
activeId, |
| 23573 |
baseElement: defaultValue(syncState == null ? void 0 : syncState.baseElement, null), |
| 23574 |
includesBaseElement: defaultValue( |
| 23575 |
props.includesBaseElement, |
| 23576 |
syncState == null ? void 0 : syncState.includesBaseElement, |
| 23577 |
activeId === null |
| 23578 |
), |
| 23579 |
moves: defaultValue(syncState == null ? void 0 : syncState.moves, 0), |
| 23580 |
orientation: defaultValue( |
| 23581 |
props.orientation, |
| 23582 |
syncState == null ? void 0 : syncState.orientation, |
| 23583 |
"both" |
| 23584 |
), |
| 23585 |
rtl: defaultValue(props.rtl, syncState == null ? void 0 : syncState.rtl, false), |
| 23586 |
virtualFocus: defaultValue( |
| 23587 |
props.virtualFocus, |
| 23588 |
syncState == null ? void 0 : syncState.virtualFocus, |
| 23589 |
false |
| 23590 |
), |
| 23591 |
focusLoop: defaultValue(props.focusLoop, syncState == null ? void 0 : syncState.focusLoop, false), |
| 23592 |
focusWrap: defaultValue(props.focusWrap, syncState == null ? void 0 : syncState.focusWrap, false), |
| 23593 |
focusShift: defaultValue(props.focusShift, syncState == null ? void 0 : syncState.focusShift, false) |
| 23594 |
}; |
| 23595 |
const composite = createStore(initialState, collection, props.store); |
| 23596 |
setup( |
| 23597 |
composite, |
| 23598 |
() => sync(composite, ["renderedItems", "activeId"], (state) => { |
| 23599 |
composite.setState("activeId", (activeId2) => { |
| 23600 |
var _a2; |
| 23601 |
if (activeId2 !== void 0) return activeId2; |
| 23602 |
return (_a2 = findFirstEnabledItem2(state.renderedItems)) == null ? void 0 : _a2.id; |
| 23603 |
}); |
| 23604 |
}) |
| 23605 |
); |
| 23606 |
const getNextId = (direction = "next", options = {}) => { |
| 23607 |
var _a2, _b; |
| 23608 |
const defaultState = composite.getState(); |
| 23609 |
const { |
| 23610 |
skip = 0, |
| 23611 |
activeId: activeId2 = defaultState.activeId, |
| 23612 |
focusShift = defaultState.focusShift, |
| 23613 |
focusLoop = defaultState.focusLoop, |
| 23614 |
focusWrap = defaultState.focusWrap, |
| 23615 |
includesBaseElement = defaultState.includesBaseElement, |
| 23616 |
renderedItems = defaultState.renderedItems, |
| 23617 |
rtl = defaultState.rtl |
| 23618 |
} = options; |
| 23619 |
const isVerticalDirection = direction === "up" || direction === "down"; |
| 23620 |
const isNextDirection = direction === "next" || direction === "down"; |
| 23621 |
const canReverse = isNextDirection ? rtl && !isVerticalDirection : !rtl || isVerticalDirection; |
| 23622 |
const canShift = focusShift && !skip; |
| 23623 |
let items = !isVerticalDirection ? renderedItems : flatten2DArray( |
| 23624 |
normalizeRows(groupItemsByRows2(renderedItems), activeId2, canShift) |
| 23625 |
); |
| 23626 |
items = canReverse ? reverseArray(items) : items; |
| 23627 |
items = isVerticalDirection ? verticalizeItems(items) : items; |
| 23628 |
if (activeId2 == null) { |
| 23629 |
return (_a2 = findFirstEnabledItem2(items)) == null ? void 0 : _a2.id; |
| 23630 |
} |
| 23631 |
const activeItem = items.find((item) => item.id === activeId2); |
| 23632 |
if (!activeItem) { |
| 23633 |
return (_b = findFirstEnabledItem2(items)) == null ? void 0 : _b.id; |
| 23634 |
} |
| 23635 |
const isGrid2 = items.some((item) => item.rowId); |
| 23636 |
const activeIndex = items.indexOf(activeItem); |
| 23637 |
const nextItems = items.slice(activeIndex + 1); |
| 23638 |
const nextItemsInRow = getItemsInRow(nextItems, activeItem.rowId); |
| 23639 |
if (skip) { |
| 23640 |
const nextEnabledItemsInRow = getEnabledItems(nextItemsInRow, activeId2); |
| 23641 |
const nextItem2 = nextEnabledItemsInRow.slice(skip)[0] || // If we can't find an item, just return the last one. |
| 23642 |
nextEnabledItemsInRow[nextEnabledItemsInRow.length - 1]; |
| 23643 |
return nextItem2 == null ? void 0 : nextItem2.id; |
| 23644 |
} |
| 23645 |
const canLoop = focusLoop && (isVerticalDirection ? focusLoop !== "horizontal" : focusLoop !== "vertical"); |
| 23646 |
const canWrap = isGrid2 && focusWrap && (isVerticalDirection ? focusWrap !== "horizontal" : focusWrap !== "vertical"); |
| 23647 |
const hasNullItem = isNextDirection ? (!isGrid2 || isVerticalDirection) && canLoop && includesBaseElement : isVerticalDirection ? includesBaseElement : false; |
| 23648 |
if (canLoop) { |
| 23649 |
const loopItems = canWrap && !hasNullItem ? items : getItemsInRow(items, activeItem.rowId); |
| 23650 |
const sortedItems = flipItems(loopItems, activeId2, hasNullItem); |
| 23651 |
const nextItem2 = findFirstEnabledItem2(sortedItems, activeId2); |
| 23652 |
return nextItem2 == null ? void 0 : nextItem2.id; |
| 23653 |
} |
| 23654 |
if (canWrap) { |
| 23655 |
const nextItem2 = findFirstEnabledItem2( |
| 23656 |
// We can use nextItems, which contains all the next items, including |
| 23657 |
// items from other rows, to wrap between rows. However, if there is a |
| 23658 |
// null item (the composite container), we'll only use the next items in |
| 23659 |
// the row. So moving next from the last item will focus on the |
| 23660 |
// composite container. On grid composites, horizontal navigation never |
| 23661 |
// focuses on the composite container, only vertical. |
| 23662 |
hasNullItem ? nextItemsInRow : nextItems, |
| 23663 |
activeId2 |
| 23664 |
); |
| 23665 |
const nextId = hasNullItem ? (nextItem2 == null ? void 0 : nextItem2.id) || null : nextItem2 == null ? void 0 : nextItem2.id; |
| 23666 |
return nextId; |
| 23667 |
} |
| 23668 |
const nextItem = findFirstEnabledItem2(nextItemsInRow, activeId2); |
| 23669 |
if (!nextItem && hasNullItem) { |
| 23670 |
return null; |
| 23671 |
} |
| 23672 |
return nextItem == null ? void 0 : nextItem.id; |
| 23673 |
}; |
| 23674 |
return { |
| 23675 |
...collection, |
| 23676 |
...composite, |
| 23677 |
setBaseElement: (element) => composite.setState("baseElement", element), |
| 23678 |
setActiveId: (id) => composite.setState("activeId", id), |
| 23679 |
move: (id) => { |
| 23680 |
if (id === void 0) return; |
| 23681 |
composite.setState("activeId", id); |
| 23682 |
composite.setState("moves", (moves) => moves + 1); |
| 23683 |
}, |
| 23684 |
first: () => { |
| 23685 |
var _a2; |
| 23686 |
return (_a2 = findFirstEnabledItem2(composite.getState().renderedItems)) == null ? void 0 : _a2.id; |
| 23687 |
}, |
| 23688 |
last: () => { |
| 23689 |
var _a2; |
| 23690 |
return (_a2 = findFirstEnabledItem2(reverseArray(composite.getState().renderedItems))) == null ? void 0 : _a2.id; |
| 23691 |
}, |
| 23692 |
next: (options) => { |
| 23693 |
if (options !== void 0 && typeof options === "number") { |
| 23694 |
options = { skip: options }; |
| 23695 |
} |
| 23696 |
return getNextId("next", options); |
| 23697 |
}, |
| 23698 |
previous: (options) => { |
| 23699 |
if (options !== void 0 && typeof options === "number") { |
| 23700 |
options = { skip: options }; |
| 23701 |
} |
| 23702 |
return getNextId("previous", options); |
| 23703 |
}, |
| 23704 |
down: (options) => { |
| 23705 |
if (options !== void 0 && typeof options === "number") { |
| 23706 |
options = { skip: options }; |
| 23707 |
} |
| 23708 |
return getNextId("down", options); |
| 23709 |
}, |
| 23710 |
up: (options) => { |
| 23711 |
if (options !== void 0 && typeof options === "number") { |
| 23712 |
options = { skip: options }; |
| 23713 |
} |
| 23714 |
return getNextId("up", options); |
| 23715 |
} |
| 23716 |
}; |
| 23717 |
} |
| 23718 |
|
| 23719 |
// node_modules/@ariakit/react-core/esm/__chunks/IQYAUKXT.js |
| 23720 |
function useCompositeStoreOptions(props) { |
| 23721 |
const id = useId4(props.id); |
| 23722 |
return { id, ...props }; |
| 23723 |
} |
| 23724 |
function useCompositeStoreProps(store, update2, props) { |
| 23725 |
store = useCollectionStoreProps(store, update2, props); |
| 23726 |
useStoreProps(store, props, "activeId", "setActiveId"); |
| 23727 |
useStoreProps(store, props, "includesBaseElement"); |
| 23728 |
useStoreProps(store, props, "virtualFocus"); |
| 23729 |
useStoreProps(store, props, "orientation"); |
| 23730 |
useStoreProps(store, props, "rtl"); |
| 23731 |
useStoreProps(store, props, "focusLoop"); |
| 23732 |
useStoreProps(store, props, "focusWrap"); |
| 23733 |
useStoreProps(store, props, "focusShift"); |
| 23734 |
return store; |
| 23735 |
} |
| 23736 |
|
| 23737 |
// node_modules/@ariakit/react-core/esm/__chunks/CVCFNOHX.js |
| 23738 |
var import_react31 = __toESM(require_react(), 1); |
| 23739 |
var ComboboxListRoleContext = (0, import_react31.createContext)( |
| 23740 |
void 0 |
| 23741 |
); |
| 23742 |
var ctx6 = createStoreContext( |
| 23743 |
[PopoverContextProvider, CompositeContextProvider], |
| 23744 |
[PopoverScopedContextProvider, CompositeScopedContextProvider] |
| 23745 |
); |
| 23746 |
var useComboboxContext = ctx6.useContext; |
| 23747 |
var useComboboxScopedContext = ctx6.useScopedContext; |
| 23748 |
var useComboboxProviderContext = ctx6.useProviderContext; |
| 23749 |
var ComboboxContextProvider = ctx6.ContextProvider; |
| 23750 |
var ComboboxScopedContextProvider = ctx6.ScopedContextProvider; |
| 23751 |
var ComboboxItemValueContext = (0, import_react31.createContext)( |
| 23752 |
void 0 |
| 23753 |
); |
| 23754 |
var ComboboxItemCheckedContext = (0, import_react31.createContext)(false); |
| 23755 |
|
| 23756 |
// node_modules/@ariakit/core/esm/__chunks/KMAUV3TY.js |
| 23757 |
function createDialogStore(props = {}) { |
| 23758 |
return createDisclosureStore(props); |
| 23759 |
} |
| 23760 |
|
| 23761 |
// node_modules/@ariakit/react-core/esm/__chunks/4NYSH4UO.js |
| 23762 |
function useDialogStoreProps(store, update2, props) { |
| 23763 |
return useDisclosureStoreProps(store, update2, props); |
| 23764 |
} |
| 23765 |
|
| 23766 |
// node_modules/@ariakit/core/esm/__chunks/BFGNM53A.js |
| 23767 |
function createPopoverStore({ |
| 23768 |
popover: otherPopover, |
| 23769 |
...props |
| 23770 |
} = {}) { |
| 23771 |
const store = mergeStore( |
| 23772 |
props.store, |
| 23773 |
omit2(otherPopover, [ |
| 23774 |
"arrowElement", |
| 23775 |
"anchorElement", |
| 23776 |
"contentElement", |
| 23777 |
"popoverElement", |
| 23778 |
"disclosureElement" |
| 23779 |
]) |
| 23780 |
); |
| 23781 |
throwOnConflictingProps(props, store); |
| 23782 |
const syncState = store == null ? void 0 : store.getState(); |
| 23783 |
const dialog = createDialogStore({ ...props, store }); |
| 23784 |
const placement = defaultValue( |
| 23785 |
props.placement, |
| 23786 |
syncState == null ? void 0 : syncState.placement, |
| 23787 |
"bottom" |
| 23788 |
); |
| 23789 |
const initialState = { |
| 23790 |
...dialog.getState(), |
| 23791 |
placement, |
| 23792 |
currentPlacement: placement, |
| 23793 |
anchorElement: defaultValue(syncState == null ? void 0 : syncState.anchorElement, null), |
| 23794 |
popoverElement: defaultValue(syncState == null ? void 0 : syncState.popoverElement, null), |
| 23795 |
arrowElement: defaultValue(syncState == null ? void 0 : syncState.arrowElement, null), |
| 23796 |
rendered: /* @__PURE__ */ Symbol("rendered") |
| 23797 |
}; |
| 23798 |
const popover = createStore(initialState, dialog, store); |
| 23799 |
return { |
| 23800 |
...dialog, |
| 23801 |
...popover, |
| 23802 |
setAnchorElement: (element) => popover.setState("anchorElement", element), |
| 23803 |
setPopoverElement: (element) => popover.setState("popoverElement", element), |
| 23804 |
setArrowElement: (element) => popover.setState("arrowElement", element), |
| 23805 |
render: () => popover.setState("rendered", /* @__PURE__ */ Symbol("rendered")) |
| 23806 |
}; |
| 23807 |
} |
| 23808 |
|
| 23809 |
// node_modules/@ariakit/react-core/esm/__chunks/B6FLPFJM.js |
| 23810 |
function usePopoverStoreProps(store, update2, props) { |
| 23811 |
useUpdateEffect(update2, [props.popover]); |
| 23812 |
useStoreProps(store, props, "placement"); |
| 23813 |
return useDialogStoreProps(store, update2, props); |
| 23814 |
} |
| 23815 |
|
| 23816 |
// node_modules/@ariakit/react-core/esm/__chunks/4POTBZ2J.js |
| 23817 |
var TagName7 = "div"; |
| 23818 |
var usePopoverAnchor = createHook( |
| 23819 |
function usePopoverAnchor2({ store, ...props }) { |
| 23820 |
const context = usePopoverProviderContext(); |
| 23821 |
store = store || context; |
| 23822 |
props = { |
| 23823 |
...props, |
| 23824 |
ref: useMergeRefs5(store == null ? void 0 : store.setAnchorElement, props.ref) |
| 23825 |
}; |
| 23826 |
return props; |
| 23827 |
} |
| 23828 |
); |
| 23829 |
var PopoverAnchor = forwardRef210(function PopoverAnchor2(props) { |
| 23830 |
const htmlProps = usePopoverAnchor(props); |
| 23831 |
return createElement3(TagName7, htmlProps); |
| 23832 |
}); |
| 23833 |
|
| 23834 |
// node_modules/@ariakit/react-core/esm/__chunks/X6LNAU2F.js |
| 23835 |
var import_react32 = __toESM(require_react(), 1); |
| 23836 |
var TagName8 = "div"; |
| 23837 |
function getMouseDestination(event) { |
| 23838 |
const relatedTarget = event.relatedTarget; |
| 23839 |
if ((relatedTarget == null ? void 0 : relatedTarget.nodeType) === Node.ELEMENT_NODE) { |
| 23840 |
return relatedTarget; |
| 23841 |
} |
| 23842 |
return null; |
| 23843 |
} |
| 23844 |
function hoveringInside(event) { |
| 23845 |
const nextElement = getMouseDestination(event); |
| 23846 |
if (!nextElement) return false; |
| 23847 |
return contains2(event.currentTarget, nextElement); |
| 23848 |
} |
| 23849 |
var symbol2 = /* @__PURE__ */ Symbol("composite-hover"); |
| 23850 |
function movingToAnotherItem(event) { |
| 23851 |
let dest = getMouseDestination(event); |
| 23852 |
if (!dest) return false; |
| 23853 |
do { |
| 23854 |
if (hasOwnProperty(dest, symbol2) && dest[symbol2]) return true; |
| 23855 |
dest = dest.parentElement; |
| 23856 |
} while (dest); |
| 23857 |
return false; |
| 23858 |
} |
| 23859 |
var useCompositeHover = createHook( |
| 23860 |
function useCompositeHover2({ |
| 23861 |
store, |
| 23862 |
focusOnHover = true, |
| 23863 |
blurOnHoverEnd = !!focusOnHover, |
| 23864 |
...props |
| 23865 |
}) { |
| 23866 |
const context = useCompositeContext(); |
| 23867 |
store = store || context; |
| 23868 |
invariant( |
| 23869 |
store, |
| 23870 |
"CompositeHover must be wrapped in a Composite component." |
| 23871 |
); |
| 23872 |
const isMouseMoving = useIsMouseMoving(); |
| 23873 |
const onMouseMoveProp = props.onMouseMove; |
| 23874 |
const focusOnHoverProp = useBooleanEvent(focusOnHover); |
| 23875 |
const onMouseMove = useEvent((event) => { |
| 23876 |
onMouseMoveProp == null ? void 0 : onMouseMoveProp(event); |
| 23877 |
if (event.defaultPrevented) return; |
| 23878 |
if (!isMouseMoving()) return; |
| 23879 |
if (!focusOnHoverProp(event)) return; |
| 23880 |
if (!hasFocusWithin(event.currentTarget)) { |
| 23881 |
const baseElement = store == null ? void 0 : store.getState().baseElement; |
| 23882 |
if (baseElement && !hasFocus(baseElement)) { |
| 23883 |
baseElement.focus(); |
| 23884 |
} |
| 23885 |
} |
| 23886 |
store == null ? void 0 : store.setActiveId(event.currentTarget.id); |
| 23887 |
}); |
| 23888 |
const onMouseLeaveProp = props.onMouseLeave; |
| 23889 |
const blurOnHoverEndProp = useBooleanEvent(blurOnHoverEnd); |
| 23890 |
const onMouseLeave = useEvent((event) => { |
| 23891 |
var _a; |
| 23892 |
onMouseLeaveProp == null ? void 0 : onMouseLeaveProp(event); |
| 23893 |
if (event.defaultPrevented) return; |
| 23894 |
if (!isMouseMoving()) return; |
| 23895 |
if (hoveringInside(event)) return; |
| 23896 |
if (movingToAnotherItem(event)) return; |
| 23897 |
if (!focusOnHoverProp(event)) return; |
| 23898 |
if (!blurOnHoverEndProp(event)) return; |
| 23899 |
store == null ? void 0 : store.setActiveId(null); |
| 23900 |
(_a = store == null ? void 0 : store.getState().baseElement) == null ? void 0 : _a.focus(); |
| 23901 |
}); |
| 23902 |
const ref = (0, import_react32.useCallback)((element) => { |
| 23903 |
if (!element) return; |
| 23904 |
element[symbol2] = true; |
| 23905 |
}, []); |
| 23906 |
props = { |
| 23907 |
...props, |
| 23908 |
ref: useMergeRefs5(ref, props.ref), |
| 23909 |
onMouseMove, |
| 23910 |
onMouseLeave |
| 23911 |
}; |
| 23912 |
return removeUndefinedValues(props); |
| 23913 |
} |
| 23914 |
); |
| 23915 |
var CompositeHover = memo22( |
| 23916 |
forwardRef210(function CompositeHover2(props) { |
| 23917 |
const htmlProps = useCompositeHover(props); |
| 23918 |
return createElement3(TagName8, htmlProps); |
| 23919 |
}) |
| 23920 |
); |
| 23921 |
|
| 23922 |
// node_modules/@ariakit/react-core/esm/combobox/combobox.js |
| 23923 |
var import_react33 = __toESM(require_react(), 1); |
| 23924 |
var TagName9 = "input"; |
| 23925 |
function isFirstItemAutoSelected(items, activeValue, autoSelect) { |
| 23926 |
if (!autoSelect) return false; |
| 23927 |
const firstItem = items.find((item) => !item.disabled && item.value); |
| 23928 |
return (firstItem == null ? void 0 : firstItem.value) === activeValue; |
| 23929 |
} |
| 23930 |
function hasCompletionString(value, activeValue) { |
| 23931 |
if (!activeValue) return false; |
| 23932 |
if (value == null) return false; |
| 23933 |
value = normalizeString(value); |
| 23934 |
return activeValue.length > value.length && activeValue.toLowerCase().indexOf(value.toLowerCase()) === 0; |
| 23935 |
} |
| 23936 |
function isInputEvent(event) { |
| 23937 |
return event.type === "input"; |
| 23938 |
} |
| 23939 |
function isAriaAutoCompleteValue(value) { |
| 23940 |
return value === "inline" || value === "list" || value === "both" || value === "none"; |
| 23941 |
} |
| 23942 |
function getDefaultAutoSelectId(items) { |
| 23943 |
const item = items.find((item2) => { |
| 23944 |
var _a; |
| 23945 |
if (item2.disabled) return false; |
| 23946 |
return ((_a = item2.element) == null ? void 0 : _a.getAttribute("role")) !== "tab"; |
| 23947 |
}); |
| 23948 |
return item == null ? void 0 : item.id; |
| 23949 |
} |
| 23950 |
var useCombobox = createHook( |
| 23951 |
function useCombobox2({ |
| 23952 |
store, |
| 23953 |
focusable: focusable2 = true, |
| 23954 |
autoSelect: autoSelectProp = false, |
| 23955 |
getAutoSelectId, |
| 23956 |
setValueOnChange, |
| 23957 |
showMinLength = 0, |
| 23958 |
showOnChange, |
| 23959 |
showOnMouseDown, |
| 23960 |
showOnClick = showOnMouseDown, |
| 23961 |
showOnKeyDown, |
| 23962 |
showOnKeyPress = showOnKeyDown, |
| 23963 |
blurActiveItemOnClick, |
| 23964 |
setValueOnClick = true, |
| 23965 |
moveOnKeyPress = true, |
| 23966 |
autoComplete = "list", |
| 23967 |
...props |
| 23968 |
}) { |
| 23969 |
const context = useComboboxProviderContext(); |
| 23970 |
store = store || context; |
| 23971 |
invariant( |
| 23972 |
store, |
| 23973 |
"Combobox must receive a `store` prop or be wrapped in a ComboboxProvider component." |
| 23974 |
); |
| 23975 |
const ref = (0, import_react33.useRef)(null); |
| 23976 |
const [valueUpdated, forceValueUpdate] = useForceUpdate(); |
| 23977 |
const canAutoSelectRef = (0, import_react33.useRef)(false); |
| 23978 |
const composingRef = (0, import_react33.useRef)(false); |
| 23979 |
const autoSelect = store.useState( |
| 23980 |
(state) => state.virtualFocus && autoSelectProp |
| 23981 |
); |
| 23982 |
const inline4 = autoComplete === "inline" || autoComplete === "both"; |
| 23983 |
const [canInline, setCanInline] = (0, import_react33.useState)(inline4); |
| 23984 |
useUpdateLayoutEffect(() => { |
| 23985 |
if (!inline4) return; |
| 23986 |
setCanInline(true); |
| 23987 |
}, [inline4]); |
| 23988 |
const storeValue = store.useState("value"); |
| 23989 |
const prevSelectedValueRef = (0, import_react33.useRef)(void 0); |
| 23990 |
(0, import_react33.useEffect)(() => { |
| 23991 |
return sync(store, ["selectedValue", "activeId"], (_, prev) => { |
| 23992 |
prevSelectedValueRef.current = prev.selectedValue; |
| 23993 |
}); |
| 23994 |
}, []); |
| 23995 |
const inlineActiveValue = store.useState((state) => { |
| 23996 |
var _a; |
| 23997 |
if (!inline4) return; |
| 23998 |
if (!canInline) return; |
| 23999 |
if (state.activeValue && Array.isArray(state.selectedValue)) { |
| 24000 |
if (state.selectedValue.includes(state.activeValue)) return; |
| 24001 |
if ((_a = prevSelectedValueRef.current) == null ? void 0 : _a.includes(state.activeValue)) return; |
| 24002 |
} |
| 24003 |
return state.activeValue; |
| 24004 |
}); |
| 24005 |
const items = store.useState("renderedItems"); |
| 24006 |
const open = store.useState("open"); |
| 24007 |
const contentElement = store.useState("contentElement"); |
| 24008 |
const value = (0, import_react33.useMemo)(() => { |
| 24009 |
if (!inline4) return storeValue; |
| 24010 |
if (!canInline) return storeValue; |
| 24011 |
const firstItemAutoSelected = isFirstItemAutoSelected( |
| 24012 |
items, |
| 24013 |
inlineActiveValue, |
| 24014 |
autoSelect |
| 24015 |
); |
| 24016 |
if (firstItemAutoSelected) { |
| 24017 |
if (hasCompletionString(storeValue, inlineActiveValue)) { |
| 24018 |
const slice = (inlineActiveValue == null ? void 0 : inlineActiveValue.slice(storeValue.length)) || ""; |
| 24019 |
return storeValue + slice; |
| 24020 |
} |
| 24021 |
return storeValue; |
| 24022 |
} |
| 24023 |
return inlineActiveValue || storeValue; |
| 24024 |
}, [inline4, canInline, items, inlineActiveValue, autoSelect, storeValue]); |
| 24025 |
(0, import_react33.useEffect)(() => { |
| 24026 |
const element = ref.current; |
| 24027 |
if (!element) return; |
| 24028 |
const onCompositeItemMove = () => setCanInline(true); |
| 24029 |
element.addEventListener("combobox-item-move", onCompositeItemMove); |
| 24030 |
return () => { |
| 24031 |
element.removeEventListener("combobox-item-move", onCompositeItemMove); |
| 24032 |
}; |
| 24033 |
}, []); |
| 24034 |
(0, import_react33.useEffect)(() => { |
| 24035 |
if (!inline4) return; |
| 24036 |
if (!canInline) return; |
| 24037 |
if (!inlineActiveValue) return; |
| 24038 |
const firstItemAutoSelected = isFirstItemAutoSelected( |
| 24039 |
items, |
| 24040 |
inlineActiveValue, |
| 24041 |
autoSelect |
| 24042 |
); |
| 24043 |
if (!firstItemAutoSelected) return; |
| 24044 |
if (!hasCompletionString(storeValue, inlineActiveValue)) return; |
| 24045 |
let cleanup = noop5; |
| 24046 |
queueMicrotask(() => { |
| 24047 |
const element = ref.current; |
| 24048 |
if (!element) return; |
| 24049 |
const { start: prevStart, end: prevEnd } = getTextboxSelection(element); |
| 24050 |
const nextStart = storeValue.length; |
| 24051 |
const nextEnd = inlineActiveValue.length; |
| 24052 |
setSelectionRange(element, nextStart, nextEnd); |
| 24053 |
cleanup = () => { |
| 24054 |
if (!hasFocus(element)) return; |
| 24055 |
const { start, end } = getTextboxSelection(element); |
| 24056 |
if (start !== nextStart) return; |
| 24057 |
if (end !== nextEnd) return; |
| 24058 |
setSelectionRange(element, prevStart, prevEnd); |
| 24059 |
}; |
| 24060 |
}); |
| 24061 |
return () => cleanup(); |
| 24062 |
}, [ |
| 24063 |
valueUpdated, |
| 24064 |
inline4, |
| 24065 |
canInline, |
| 24066 |
inlineActiveValue, |
| 24067 |
items, |
| 24068 |
autoSelect, |
| 24069 |
storeValue |
| 24070 |
]); |
| 24071 |
const scrollingElementRef = (0, import_react33.useRef)(null); |
| 24072 |
const getAutoSelectIdProp = useEvent(getAutoSelectId); |
| 24073 |
const autoSelectIdRef = (0, import_react33.useRef)(null); |
| 24074 |
(0, import_react33.useEffect)(() => { |
| 24075 |
if (!open) return; |
| 24076 |
if (!contentElement) return; |
| 24077 |
const scrollingElement = getScrollingElement(contentElement); |
| 24078 |
if (!scrollingElement) return; |
| 24079 |
scrollingElementRef.current = scrollingElement; |
| 24080 |
const onUserScroll = () => { |
| 24081 |
canAutoSelectRef.current = false; |
| 24082 |
}; |
| 24083 |
const onScroll = () => { |
| 24084 |
if (!store) return; |
| 24085 |
if (!canAutoSelectRef.current) return; |
| 24086 |
const { activeId } = store.getState(); |
| 24087 |
if (activeId === null) return; |
| 24088 |
if (activeId === autoSelectIdRef.current) return; |
| 24089 |
canAutoSelectRef.current = false; |
| 24090 |
}; |
| 24091 |
const options = { passive: true, capture: true }; |
| 24092 |
scrollingElement.addEventListener("wheel", onUserScroll, options); |
| 24093 |
scrollingElement.addEventListener("touchmove", onUserScroll, options); |
| 24094 |
scrollingElement.addEventListener("scroll", onScroll, options); |
| 24095 |
return () => { |
| 24096 |
scrollingElement.removeEventListener("wheel", onUserScroll, true); |
| 24097 |
scrollingElement.removeEventListener("touchmove", onUserScroll, true); |
| 24098 |
scrollingElement.removeEventListener("scroll", onScroll, true); |
| 24099 |
}; |
| 24100 |
}, [open, contentElement, store]); |
| 24101 |
useSafeLayoutEffect(() => { |
| 24102 |
if (!storeValue) return; |
| 24103 |
if (composingRef.current) return; |
| 24104 |
canAutoSelectRef.current = true; |
| 24105 |
}, [storeValue]); |
| 24106 |
useSafeLayoutEffect(() => { |
| 24107 |
if (autoSelect !== "always" && open) return; |
| 24108 |
canAutoSelectRef.current = open; |
| 24109 |
}, [autoSelect, open]); |
| 24110 |
const resetValueOnSelect = store.useState("resetValueOnSelect"); |
| 24111 |
useUpdateEffect(() => { |
| 24112 |
var _a, _b; |
| 24113 |
const canAutoSelect = canAutoSelectRef.current; |
| 24114 |
if (!store) return; |
| 24115 |
if (!open) return; |
| 24116 |
if (!canAutoSelect && !resetValueOnSelect) return; |
| 24117 |
const { baseElement, contentElement: contentElement2, activeId } = store.getState(); |
| 24118 |
if (baseElement && !hasFocus(baseElement)) return; |
| 24119 |
if (contentElement2 == null ? void 0 : contentElement2.hasAttribute("data-placing")) { |
| 24120 |
const observer = new MutationObserver(forceValueUpdate); |
| 24121 |
observer.observe(contentElement2, { attributeFilter: ["data-placing"] }); |
| 24122 |
return () => observer.disconnect(); |
| 24123 |
} |
| 24124 |
if (autoSelect && canAutoSelect) { |
| 24125 |
const userAutoSelectId = getAutoSelectIdProp(items); |
| 24126 |
const autoSelectId = userAutoSelectId !== void 0 ? userAutoSelectId : (_a = getDefaultAutoSelectId(items)) != null ? _a : store.first(); |
| 24127 |
autoSelectIdRef.current = autoSelectId; |
| 24128 |
store.move(autoSelectId != null ? autoSelectId : null); |
| 24129 |
} else { |
| 24130 |
const element = (_b = store.item(activeId || store.first())) == null ? void 0 : _b.element; |
| 24131 |
if (element && "scrollIntoView" in element) { |
| 24132 |
element.scrollIntoView({ block: "nearest", inline: "nearest" }); |
| 24133 |
} |
| 24134 |
} |
| 24135 |
return; |
| 24136 |
}, [ |
| 24137 |
store, |
| 24138 |
open, |
| 24139 |
valueUpdated, |
| 24140 |
storeValue, |
| 24141 |
autoSelect, |
| 24142 |
resetValueOnSelect, |
| 24143 |
getAutoSelectIdProp, |
| 24144 |
items |
| 24145 |
]); |
| 24146 |
(0, import_react33.useEffect)(() => { |
| 24147 |
if (!inline4) return; |
| 24148 |
const combobox = ref.current; |
| 24149 |
if (!combobox) return; |
| 24150 |
const elements = [combobox, contentElement].filter( |
| 24151 |
(value2) => !!value2 |
| 24152 |
); |
| 24153 |
const onBlur2 = (event) => { |
| 24154 |
if (elements.every((el) => isFocusEventOutside(event, el))) { |
| 24155 |
store == null ? void 0 : store.setValue(value); |
| 24156 |
} |
| 24157 |
}; |
| 24158 |
for (const element of elements) { |
| 24159 |
element.addEventListener("focusout", onBlur2); |
| 24160 |
} |
| 24161 |
return () => { |
| 24162 |
for (const element of elements) { |
| 24163 |
element.removeEventListener("focusout", onBlur2); |
| 24164 |
} |
| 24165 |
}; |
| 24166 |
}, [inline4, contentElement, store, value]); |
| 24167 |
const canShow = (event) => { |
| 24168 |
const currentTarget = event.currentTarget; |
| 24169 |
return currentTarget.value.length >= showMinLength; |
| 24170 |
}; |
| 24171 |
const onChangeProp = props.onChange; |
| 24172 |
const showOnChangeProp = useBooleanEvent(showOnChange != null ? showOnChange : canShow); |
| 24173 |
const setValueOnChangeProp = useBooleanEvent( |
| 24174 |
// If the combobox is combined with tags, the value will be set by the tag |
| 24175 |
// input component. |
| 24176 |
setValueOnChange != null ? setValueOnChange : !store.tag |
| 24177 |
); |
| 24178 |
const onChange = useEvent((event) => { |
| 24179 |
onChangeProp == null ? void 0 : onChangeProp(event); |
| 24180 |
if (event.defaultPrevented) return; |
| 24181 |
if (!store) return; |
| 24182 |
const currentTarget = event.currentTarget; |
| 24183 |
const { value: value2, selectionStart, selectionEnd } = currentTarget; |
| 24184 |
const nativeEvent = event.nativeEvent; |
| 24185 |
canAutoSelectRef.current = true; |
| 24186 |
if (isInputEvent(nativeEvent)) { |
| 24187 |
if (nativeEvent.isComposing) { |
| 24188 |
canAutoSelectRef.current = false; |
| 24189 |
composingRef.current = true; |
| 24190 |
} |
| 24191 |
if (inline4) { |
| 24192 |
const textInserted = nativeEvent.inputType === "insertText" || nativeEvent.inputType === "insertCompositionText"; |
| 24193 |
const caretAtEnd = selectionStart === value2.length; |
| 24194 |
setCanInline(textInserted && caretAtEnd); |
| 24195 |
} |
| 24196 |
} |
| 24197 |
if (setValueOnChangeProp(event)) { |
| 24198 |
const isSameValue = value2 === store.getState().value; |
| 24199 |
store.setValue(value2); |
| 24200 |
queueMicrotask(() => { |
| 24201 |
setSelectionRange(currentTarget, selectionStart, selectionEnd); |
| 24202 |
}); |
| 24203 |
if (inline4 && autoSelect && isSameValue) { |
| 24204 |
forceValueUpdate(); |
| 24205 |
} |
| 24206 |
} |
| 24207 |
if (showOnChangeProp(event)) { |
| 24208 |
store.show(); |
| 24209 |
} |
| 24210 |
if (!autoSelect || !canAutoSelectRef.current) { |
| 24211 |
store.setActiveId(null); |
| 24212 |
} |
| 24213 |
}); |
| 24214 |
const onCompositionEndProp = props.onCompositionEnd; |
| 24215 |
const onCompositionEnd = useEvent((event) => { |
| 24216 |
canAutoSelectRef.current = true; |
| 24217 |
composingRef.current = false; |
| 24218 |
onCompositionEndProp == null ? void 0 : onCompositionEndProp(event); |
| 24219 |
if (event.defaultPrevented) return; |
| 24220 |
if (!autoSelect) return; |
| 24221 |
forceValueUpdate(); |
| 24222 |
}); |
| 24223 |
const onMouseDownProp = props.onMouseDown; |
| 24224 |
const blurActiveItemOnClickProp = useBooleanEvent( |
| 24225 |
blurActiveItemOnClick != null ? blurActiveItemOnClick : (() => !!(store == null ? void 0 : store.getState().includesBaseElement)) |
| 24226 |
); |
| 24227 |
const setValueOnClickProp = useBooleanEvent(setValueOnClick); |
| 24228 |
const showOnClickProp = useBooleanEvent(showOnClick != null ? showOnClick : canShow); |
| 24229 |
const onMouseDown = useEvent((event) => { |
| 24230 |
onMouseDownProp == null ? void 0 : onMouseDownProp(event); |
| 24231 |
if (event.defaultPrevented) return; |
| 24232 |
if (event.button) return; |
| 24233 |
if (event.ctrlKey) return; |
| 24234 |
if (!store) return; |
| 24235 |
if (blurActiveItemOnClickProp(event)) { |
| 24236 |
store.setActiveId(null); |
| 24237 |
} |
| 24238 |
if (setValueOnClickProp(event)) { |
| 24239 |
store.setValue(value); |
| 24240 |
} |
| 24241 |
if (showOnClickProp(event)) { |
| 24242 |
queueBeforeEvent(event.currentTarget, "mouseup", store.show); |
| 24243 |
} |
| 24244 |
}); |
| 24245 |
const onKeyDownProp = props.onKeyDown; |
| 24246 |
const showOnKeyPressProp = useBooleanEvent(showOnKeyPress != null ? showOnKeyPress : canShow); |
| 24247 |
const onKeyDown = useEvent((event) => { |
| 24248 |
onKeyDownProp == null ? void 0 : onKeyDownProp(event); |
| 24249 |
if (!event.repeat) { |
| 24250 |
canAutoSelectRef.current = false; |
| 24251 |
} |
| 24252 |
if (event.defaultPrevented) return; |
| 24253 |
if (event.ctrlKey) return; |
| 24254 |
if (event.altKey) return; |
| 24255 |
if (event.shiftKey) return; |
| 24256 |
if (event.metaKey) return; |
| 24257 |
if (!store) return; |
| 24258 |
const { open: open2 } = store.getState(); |
| 24259 |
if (open2) return; |
| 24260 |
if (event.key === "ArrowUp" || event.key === "ArrowDown") { |
| 24261 |
if (showOnKeyPressProp(event)) { |
| 24262 |
event.preventDefault(); |
| 24263 |
store.show(); |
| 24264 |
} |
| 24265 |
} |
| 24266 |
}); |
| 24267 |
const onBlurProp = props.onBlur; |
| 24268 |
const onBlur = useEvent((event) => { |
| 24269 |
canAutoSelectRef.current = false; |
| 24270 |
onBlurProp == null ? void 0 : onBlurProp(event); |
| 24271 |
if (event.defaultPrevented) return; |
| 24272 |
}); |
| 24273 |
const id = useId4(props.id); |
| 24274 |
const ariaAutoComplete = isAriaAutoCompleteValue(autoComplete) ? autoComplete : void 0; |
| 24275 |
const isActiveItem = store.useState((state) => state.activeId === null); |
| 24276 |
props = { |
| 24277 |
id, |
| 24278 |
role: "combobox", |
| 24279 |
"aria-autocomplete": ariaAutoComplete, |
| 24280 |
"aria-haspopup": getPopupRole(contentElement, "listbox"), |
| 24281 |
"aria-expanded": open, |
| 24282 |
"aria-controls": contentElement == null ? void 0 : contentElement.id, |
| 24283 |
"data-active-item": isActiveItem || void 0, |
| 24284 |
value, |
| 24285 |
...props, |
| 24286 |
ref: useMergeRefs5(ref, props.ref), |
| 24287 |
onChange, |
| 24288 |
onCompositionEnd, |
| 24289 |
onMouseDown, |
| 24290 |
onKeyDown, |
| 24291 |
onBlur |
| 24292 |
}; |
| 24293 |
props = useComposite({ |
| 24294 |
store, |
| 24295 |
focusable: focusable2, |
| 24296 |
...props, |
| 24297 |
// Enable inline autocomplete when the user moves from the combobox input |
| 24298 |
// to an item. |
| 24299 |
moveOnKeyPress: (event) => { |
| 24300 |
if (isFalsyBooleanCallback(moveOnKeyPress, event)) return false; |
| 24301 |
if (inline4) setCanInline(true); |
| 24302 |
return true; |
| 24303 |
} |
| 24304 |
}); |
| 24305 |
props = usePopoverAnchor({ store, ...props }); |
| 24306 |
return { autoComplete: "off", ...props }; |
| 24307 |
} |
| 24308 |
); |
| 24309 |
var Combobox = forwardRef210(function Combobox2(props) { |
| 24310 |
const htmlProps = useCombobox(props); |
| 24311 |
return createElement3(TagName9, htmlProps); |
| 24312 |
}); |
| 24313 |
|
| 24314 |
// node_modules/@ariakit/react-core/esm/__chunks/IBXZ2LQC.js |
| 24315 |
var import_react34 = __toESM(require_react(), 1); |
| 24316 |
var import_jsx_runtime114 = __toESM(require_jsx_runtime(), 1); |
| 24317 |
var TagName10 = "div"; |
| 24318 |
function isSelected(storeValue, itemValue) { |
| 24319 |
if (itemValue == null) return; |
| 24320 |
if (storeValue == null) return false; |
| 24321 |
if (Array.isArray(storeValue)) { |
| 24322 |
return storeValue.includes(itemValue); |
| 24323 |
} |
| 24324 |
return storeValue === itemValue; |
| 24325 |
} |
| 24326 |
function getItemRole(popupRole) { |
| 24327 |
var _a; |
| 24328 |
const itemRoleByPopupRole = { |
| 24329 |
menu: "menuitem", |
| 24330 |
listbox: "option", |
| 24331 |
tree: "treeitem" |
| 24332 |
}; |
| 24333 |
const key2 = popupRole; |
| 24334 |
return (_a = itemRoleByPopupRole[key2]) != null ? _a : "option"; |
| 24335 |
} |
| 24336 |
var useComboboxItem = createHook( |
| 24337 |
function useComboboxItem2({ |
| 24338 |
store, |
| 24339 |
value, |
| 24340 |
hideOnClick, |
| 24341 |
setValueOnClick, |
| 24342 |
selectValueOnClick = true, |
| 24343 |
resetValueOnSelect, |
| 24344 |
focusOnHover = false, |
| 24345 |
moveOnKeyPress = true, |
| 24346 |
getItem: getItemProp, |
| 24347 |
...props |
| 24348 |
}) { |
| 24349 |
var _a; |
| 24350 |
const context = useComboboxScopedContext(); |
| 24351 |
store = store || context; |
| 24352 |
invariant( |
| 24353 |
store, |
| 24354 |
"ComboboxItem must be wrapped in a ComboboxList or ComboboxPopover component." |
| 24355 |
); |
| 24356 |
const { resetValueOnSelectState, multiSelectable, selected } = useStoreStateObject(store, { |
| 24357 |
resetValueOnSelectState: "resetValueOnSelect", |
| 24358 |
multiSelectable(state) { |
| 24359 |
return Array.isArray(state.selectedValue); |
| 24360 |
}, |
| 24361 |
selected(state) { |
| 24362 |
return isSelected(state.selectedValue, value); |
| 24363 |
} |
| 24364 |
}); |
| 24365 |
const getItem = (0, import_react34.useCallback)( |
| 24366 |
(item) => { |
| 24367 |
const nextItem = { ...item, value }; |
| 24368 |
if (getItemProp) { |
| 24369 |
return getItemProp(nextItem); |
| 24370 |
} |
| 24371 |
return nextItem; |
| 24372 |
}, |
| 24373 |
[value, getItemProp] |
| 24374 |
); |
| 24375 |
setValueOnClick = setValueOnClick != null ? setValueOnClick : !multiSelectable; |
| 24376 |
hideOnClick = hideOnClick != null ? hideOnClick : value != null && !multiSelectable; |
| 24377 |
const onClickProp = props.onClick; |
| 24378 |
const setValueOnClickProp = useBooleanEvent(setValueOnClick); |
| 24379 |
const selectValueOnClickProp = useBooleanEvent(selectValueOnClick); |
| 24380 |
const resetValueOnSelectProp = useBooleanEvent( |
| 24381 |
(_a = resetValueOnSelect != null ? resetValueOnSelect : resetValueOnSelectState) != null ? _a : multiSelectable |
| 24382 |
); |
| 24383 |
const hideOnClickProp = useBooleanEvent(hideOnClick); |
| 24384 |
const onClick = useEvent((event) => { |
| 24385 |
onClickProp == null ? void 0 : onClickProp(event); |
| 24386 |
if (event.defaultPrevented) return; |
| 24387 |
if (isDownloading(event)) return; |
| 24388 |
if (isOpeningInNewTab(event)) return; |
| 24389 |
if (value != null) { |
| 24390 |
if (selectValueOnClickProp(event)) { |
| 24391 |
if (resetValueOnSelectProp(event)) { |
| 24392 |
store == null ? void 0 : store.resetValue(); |
| 24393 |
} |
| 24394 |
store == null ? void 0 : store.setSelectedValue((prevValue) => { |
| 24395 |
if (!Array.isArray(prevValue)) return value; |
| 24396 |
if (prevValue.includes(value)) { |
| 24397 |
return prevValue.filter((v2) => v2 !== value); |
| 24398 |
} |
| 24399 |
return [...prevValue, value]; |
| 24400 |
}); |
| 24401 |
} |
| 24402 |
if (setValueOnClickProp(event)) { |
| 24403 |
store == null ? void 0 : store.setValue(value); |
| 24404 |
} |
| 24405 |
} |
| 24406 |
if (hideOnClickProp(event)) { |
| 24407 |
store == null ? void 0 : store.hide(); |
| 24408 |
} |
| 24409 |
}); |
| 24410 |
const onKeyDownProp = props.onKeyDown; |
| 24411 |
const onKeyDown = useEvent((event) => { |
| 24412 |
onKeyDownProp == null ? void 0 : onKeyDownProp(event); |
| 24413 |
if (event.defaultPrevented) return; |
| 24414 |
const baseElement = store == null ? void 0 : store.getState().baseElement; |
| 24415 |
if (!baseElement) return; |
| 24416 |
if (hasFocus(baseElement)) return; |
| 24417 |
const printable = event.key.length === 1; |
| 24418 |
if (printable || event.key === "Backspace" || event.key === "Delete") { |
| 24419 |
queueMicrotask(() => baseElement.focus()); |
| 24420 |
if (isTextField(baseElement)) { |
| 24421 |
store == null ? void 0 : store.setValue(baseElement.value); |
| 24422 |
} |
| 24423 |
} |
| 24424 |
}); |
| 24425 |
if (multiSelectable && selected != null) { |
| 24426 |
props = { |
| 24427 |
"aria-selected": selected, |
| 24428 |
...props |
| 24429 |
}; |
| 24430 |
} |
| 24431 |
props = useWrapElement( |
| 24432 |
props, |
| 24433 |
(element) => /* @__PURE__ */ (0, import_jsx_runtime114.jsx)(ComboboxItemValueContext.Provider, { value, children: /* @__PURE__ */ (0, import_jsx_runtime114.jsx)(ComboboxItemCheckedContext.Provider, { value: selected != null ? selected : false, children: element }) }), |
| 24434 |
[value, selected] |
| 24435 |
); |
| 24436 |
const popupRole = (0, import_react34.useContext)(ComboboxListRoleContext); |
| 24437 |
props = { |
| 24438 |
role: getItemRole(popupRole), |
| 24439 |
children: value, |
| 24440 |
...props, |
| 24441 |
onClick, |
| 24442 |
onKeyDown |
| 24443 |
}; |
| 24444 |
const moveOnKeyPressProp = useBooleanEvent(moveOnKeyPress); |
| 24445 |
props = useCompositeItem({ |
| 24446 |
store, |
| 24447 |
...props, |
| 24448 |
getItem, |
| 24449 |
// Dispatch a custom event on the combobox input when moving to an item |
| 24450 |
// with the keyboard so the Combobox component can enable inline |
| 24451 |
// autocompletion. |
| 24452 |
moveOnKeyPress: (event) => { |
| 24453 |
if (!moveOnKeyPressProp(event)) return false; |
| 24454 |
const moveEvent = new Event("combobox-item-move"); |
| 24455 |
const baseElement = store == null ? void 0 : store.getState().baseElement; |
| 24456 |
baseElement == null ? void 0 : baseElement.dispatchEvent(moveEvent); |
| 24457 |
return true; |
| 24458 |
} |
| 24459 |
}); |
| 24460 |
props = useCompositeHover({ store, focusOnHover, ...props }); |
| 24461 |
return props; |
| 24462 |
} |
| 24463 |
); |
| 24464 |
var ComboboxItem = memo22( |
| 24465 |
forwardRef210(function ComboboxItem2(props) { |
| 24466 |
const htmlProps = useComboboxItem(props); |
| 24467 |
return createElement3(TagName10, htmlProps); |
| 24468 |
}) |
| 24469 |
); |
| 24470 |
|
| 24471 |
// node_modules/@ariakit/react-core/esm/combobox/combobox-item-value.js |
| 24472 |
var import_react35 = __toESM(require_react(), 1); |
| 24473 |
var import_jsx_runtime115 = __toESM(require_jsx_runtime(), 1); |
| 24474 |
var TagName11 = "span"; |
| 24475 |
function normalizeValue(value) { |
| 24476 |
return normalizeString(value).toLowerCase(); |
| 24477 |
} |
| 24478 |
function getOffsets(string, values) { |
| 24479 |
const offsets = []; |
| 24480 |
for (const value of values) { |
| 24481 |
let pos = 0; |
| 24482 |
const length = value.length; |
| 24483 |
while (string.indexOf(value, pos) !== -1) { |
| 24484 |
const index2 = string.indexOf(value, pos); |
| 24485 |
if (index2 !== -1) { |
| 24486 |
offsets.push([index2, length]); |
| 24487 |
} |
| 24488 |
pos = index2 + 1; |
| 24489 |
} |
| 24490 |
} |
| 24491 |
return offsets; |
| 24492 |
} |
| 24493 |
function filterOverlappingOffsets(offsets) { |
| 24494 |
return offsets.filter(([offset4, length], i2, arr) => { |
| 24495 |
return !arr.some( |
| 24496 |
([o2, l2], j2) => j2 !== i2 && o2 <= offset4 && o2 + l2 >= offset4 + length |
| 24497 |
); |
| 24498 |
}); |
| 24499 |
} |
| 24500 |
function sortOffsets(offsets) { |
| 24501 |
return offsets.sort(([a2], [b2]) => a2 - b2); |
| 24502 |
} |
| 24503 |
function splitValue(itemValue, userValue) { |
| 24504 |
if (!itemValue) return itemValue; |
| 24505 |
if (!userValue) return itemValue; |
| 24506 |
const userValues = toArray(userValue).filter(Boolean).map(normalizeValue); |
| 24507 |
const parts = []; |
| 24508 |
const span = (value, autocomplete = false) => /* @__PURE__ */ (0, import_jsx_runtime115.jsx)( |
| 24509 |
"span", |
| 24510 |
{ |
| 24511 |
"data-autocomplete-value": autocomplete ? "" : void 0, |
| 24512 |
"data-user-value": autocomplete ? void 0 : "", |
| 24513 |
children: value |
| 24514 |
}, |
| 24515 |
parts.length |
| 24516 |
); |
| 24517 |
const offsets = sortOffsets( |
| 24518 |
filterOverlappingOffsets( |
| 24519 |
// Convert userValues into a set to avoid duplicates |
| 24520 |
getOffsets(normalizeValue(itemValue), new Set(userValues)) |
| 24521 |
) |
| 24522 |
); |
| 24523 |
if (!offsets.length) { |
| 24524 |
parts.push(span(itemValue, true)); |
| 24525 |
return parts; |
| 24526 |
} |
| 24527 |
const [firstOffset] = offsets[0]; |
| 24528 |
const values = [ |
| 24529 |
itemValue.slice(0, firstOffset), |
| 24530 |
...offsets.flatMap(([offset4, length], i2) => { |
| 24531 |
var _a; |
| 24532 |
const value = itemValue.slice(offset4, offset4 + length); |
| 24533 |
const nextOffset = (_a = offsets[i2 + 1]) == null ? void 0 : _a[0]; |
| 24534 |
const nextValue = itemValue.slice(offset4 + length, nextOffset); |
| 24535 |
return [value, nextValue]; |
| 24536 |
}) |
| 24537 |
]; |
| 24538 |
values.forEach((value, i2) => { |
| 24539 |
if (!value) return; |
| 24540 |
parts.push(span(value, i2 % 2 === 0)); |
| 24541 |
}); |
| 24542 |
return parts; |
| 24543 |
} |
| 24544 |
var useComboboxItemValue = createHook(function useComboboxItemValue2({ store, value, userValue, ...props }) { |
| 24545 |
const context = useComboboxScopedContext(); |
| 24546 |
store = store || context; |
| 24547 |
const itemContext = (0, import_react35.useContext)(ComboboxItemValueContext); |
| 24548 |
const itemValue = value != null ? value : itemContext; |
| 24549 |
const inputValue = useStoreState(store, (state) => userValue != null ? userValue : state == null ? void 0 : state.value); |
| 24550 |
const children = (0, import_react35.useMemo)(() => { |
| 24551 |
if (!itemValue) return; |
| 24552 |
if (!inputValue) return itemValue; |
| 24553 |
return splitValue(itemValue, inputValue); |
| 24554 |
}, [itemValue, inputValue]); |
| 24555 |
props = { |
| 24556 |
children, |
| 24557 |
...props |
| 24558 |
}; |
| 24559 |
return removeUndefinedValues(props); |
| 24560 |
}); |
| 24561 |
var ComboboxItemValue = forwardRef210(function ComboboxItemValue2(props) { |
| 24562 |
const htmlProps = useComboboxItemValue(props); |
| 24563 |
return createElement3(TagName11, htmlProps); |
| 24564 |
}); |
| 24565 |
|
| 24566 |
// node_modules/@ariakit/react-core/esm/combobox/combobox-label.js |
| 24567 |
var TagName12 = "label"; |
| 24568 |
var useComboboxLabel = createHook( |
| 24569 |
function useComboboxLabel2({ store, ...props }) { |
| 24570 |
const context = useComboboxProviderContext(); |
| 24571 |
store = store || context; |
| 24572 |
invariant( |
| 24573 |
store, |
| 24574 |
"ComboboxLabel must receive a `store` prop or be wrapped in a ComboboxProvider component." |
| 24575 |
); |
| 24576 |
const comboboxId = store.useState((state) => { |
| 24577 |
var _a; |
| 24578 |
return (_a = state.baseElement) == null ? void 0 : _a.id; |
| 24579 |
}); |
| 24580 |
props = { |
| 24581 |
htmlFor: comboboxId, |
| 24582 |
...props |
| 24583 |
}; |
| 24584 |
return removeUndefinedValues(props); |
| 24585 |
} |
| 24586 |
); |
| 24587 |
var ComboboxLabel = memo22( |
| 24588 |
forwardRef210(function ComboboxLabel2(props) { |
| 24589 |
const htmlProps = useComboboxLabel(props); |
| 24590 |
return createElement3(TagName12, htmlProps); |
| 24591 |
}) |
| 24592 |
); |
| 24593 |
|
| 24594 |
// node_modules/@ariakit/react-core/esm/__chunks/2G6YEJT4.js |
| 24595 |
var import_react36 = __toESM(require_react(), 1); |
| 24596 |
var import_jsx_runtime116 = __toESM(require_jsx_runtime(), 1); |
| 24597 |
var TagName13 = "div"; |
| 24598 |
var useComboboxList = createHook( |
| 24599 |
function useComboboxList2({ store, alwaysVisible, ...props }) { |
| 24600 |
const scopedContext = useComboboxScopedContext(true); |
| 24601 |
const context = useComboboxContext(); |
| 24602 |
store = store || context; |
| 24603 |
const scopedContextSameStore = !!store && store === scopedContext; |
| 24604 |
invariant( |
| 24605 |
store, |
| 24606 |
"ComboboxList must receive a `store` prop or be wrapped in a ComboboxProvider component." |
| 24607 |
); |
| 24608 |
const ref = (0, import_react36.useRef)(null); |
| 24609 |
const id = useId4(props.id); |
| 24610 |
const mounted = store.useState("mounted"); |
| 24611 |
const hidden = isHidden3(mounted, props.hidden, alwaysVisible); |
| 24612 |
const style = hidden ? { ...props.style, display: "none" } : props.style; |
| 24613 |
const multiSelectable = store.useState( |
| 24614 |
(state) => Array.isArray(state.selectedValue) |
| 24615 |
); |
| 24616 |
const role = useAttribute(ref, "role", props.role); |
| 24617 |
const isCompositeRole = role === "listbox" || role === "tree" || role === "grid"; |
| 24618 |
const ariaMultiSelectable = isCompositeRole ? multiSelectable || void 0 : void 0; |
| 24619 |
const [hasListboxInside, setHasListboxInside] = (0, import_react36.useState)(false); |
| 24620 |
const contentElement = store.useState("contentElement"); |
| 24621 |
useSafeLayoutEffect(() => { |
| 24622 |
if (!mounted) return; |
| 24623 |
const element = ref.current; |
| 24624 |
if (!element) return; |
| 24625 |
if (contentElement !== element) return; |
| 24626 |
const callback = () => { |
| 24627 |
setHasListboxInside(!!element.querySelector("[role='listbox']")); |
| 24628 |
}; |
| 24629 |
const observer = new MutationObserver(callback); |
| 24630 |
observer.observe(element, { |
| 24631 |
subtree: true, |
| 24632 |
childList: true, |
| 24633 |
attributeFilter: ["role"] |
| 24634 |
}); |
| 24635 |
callback(); |
| 24636 |
return () => observer.disconnect(); |
| 24637 |
}, [mounted, contentElement]); |
| 24638 |
if (!hasListboxInside) { |
| 24639 |
props = { |
| 24640 |
role: "listbox", |
| 24641 |
"aria-multiselectable": ariaMultiSelectable, |
| 24642 |
...props |
| 24643 |
}; |
| 24644 |
} |
| 24645 |
props = useWrapElement( |
| 24646 |
props, |
| 24647 |
(element) => /* @__PURE__ */ (0, import_jsx_runtime116.jsx)(ComboboxScopedContextProvider, { value: store, children: /* @__PURE__ */ (0, import_jsx_runtime116.jsx)(ComboboxListRoleContext.Provider, { value: role, children: element }) }), |
| 24648 |
[store, role] |
| 24649 |
); |
| 24650 |
const setContentElement = id && (!scopedContext || !scopedContextSameStore) ? store.setContentElement : null; |
| 24651 |
props = { |
| 24652 |
id, |
| 24653 |
hidden, |
| 24654 |
...props, |
| 24655 |
ref: useMergeRefs5(setContentElement, ref, props.ref), |
| 24656 |
style |
| 24657 |
}; |
| 24658 |
return removeUndefinedValues(props); |
| 24659 |
} |
| 24660 |
); |
| 24661 |
var ComboboxList = forwardRef210(function ComboboxList2(props) { |
| 24662 |
const htmlProps = useComboboxList(props); |
| 24663 |
return createElement3(TagName13, htmlProps); |
| 24664 |
}); |
| 24665 |
|
| 24666 |
// node_modules/@ariakit/react-core/esm/__chunks/XSIEPKGA.js |
| 24667 |
var import_react37 = __toESM(require_react(), 1); |
| 24668 |
var TagValueContext = (0, import_react37.createContext)(null); |
| 24669 |
var TagRemoveIdContext = (0, import_react37.createContext)( |
| 24670 |
null |
| 24671 |
); |
| 24672 |
var ctx7 = createStoreContext( |
| 24673 |
[CompositeContextProvider], |
| 24674 |
[CompositeScopedContextProvider] |
| 24675 |
); |
| 24676 |
var useTagContext = ctx7.useContext; |
| 24677 |
var useTagScopedContext = ctx7.useScopedContext; |
| 24678 |
var useTagProviderContext = ctx7.useProviderContext; |
| 24679 |
var TagContextProvider = ctx7.ContextProvider; |
| 24680 |
var TagScopedContextProvider = ctx7.ScopedContextProvider; |
| 24681 |
|
| 24682 |
// node_modules/@ariakit/core/esm/combobox/combobox-store.js |
| 24683 |
var isTouchSafari = isSafari2() && isTouchDevice(); |
| 24684 |
function createComboboxStore({ |
| 24685 |
tag, |
| 24686 |
...props |
| 24687 |
} = {}) { |
| 24688 |
const store = mergeStore(props.store, pick2(tag, ["value", "rtl"])); |
| 24689 |
throwOnConflictingProps(props, store); |
| 24690 |
const tagState = tag == null ? void 0 : tag.getState(); |
| 24691 |
const syncState = store == null ? void 0 : store.getState(); |
| 24692 |
const activeId = defaultValue( |
| 24693 |
props.activeId, |
| 24694 |
syncState == null ? void 0 : syncState.activeId, |
| 24695 |
props.defaultActiveId, |
| 24696 |
null |
| 24697 |
); |
| 24698 |
const composite = createCompositeStore({ |
| 24699 |
...props, |
| 24700 |
activeId, |
| 24701 |
includesBaseElement: defaultValue( |
| 24702 |
props.includesBaseElement, |
| 24703 |
syncState == null ? void 0 : syncState.includesBaseElement, |
| 24704 |
true |
| 24705 |
), |
| 24706 |
orientation: defaultValue( |
| 24707 |
props.orientation, |
| 24708 |
syncState == null ? void 0 : syncState.orientation, |
| 24709 |
"vertical" |
| 24710 |
), |
| 24711 |
focusLoop: defaultValue(props.focusLoop, syncState == null ? void 0 : syncState.focusLoop, true), |
| 24712 |
focusWrap: defaultValue(props.focusWrap, syncState == null ? void 0 : syncState.focusWrap, true), |
| 24713 |
virtualFocus: defaultValue( |
| 24714 |
props.virtualFocus, |
| 24715 |
syncState == null ? void 0 : syncState.virtualFocus, |
| 24716 |
true |
| 24717 |
) |
| 24718 |
}); |
| 24719 |
const popover = createPopoverStore({ |
| 24720 |
...props, |
| 24721 |
placement: defaultValue( |
| 24722 |
props.placement, |
| 24723 |
syncState == null ? void 0 : syncState.placement, |
| 24724 |
"bottom-start" |
| 24725 |
) |
| 24726 |
}); |
| 24727 |
const value = defaultValue( |
| 24728 |
props.value, |
| 24729 |
syncState == null ? void 0 : syncState.value, |
| 24730 |
props.defaultValue, |
| 24731 |
"" |
| 24732 |
); |
| 24733 |
const selectedValue = defaultValue( |
| 24734 |
props.selectedValue, |
| 24735 |
syncState == null ? void 0 : syncState.selectedValue, |
| 24736 |
tagState == null ? void 0 : tagState.values, |
| 24737 |
props.defaultSelectedValue, |
| 24738 |
"" |
| 24739 |
); |
| 24740 |
const multiSelectable = Array.isArray(selectedValue); |
| 24741 |
const initialState = { |
| 24742 |
...composite.getState(), |
| 24743 |
...popover.getState(), |
| 24744 |
value, |
| 24745 |
selectedValue, |
| 24746 |
resetValueOnSelect: defaultValue( |
| 24747 |
props.resetValueOnSelect, |
| 24748 |
syncState == null ? void 0 : syncState.resetValueOnSelect, |
| 24749 |
multiSelectable |
| 24750 |
), |
| 24751 |
resetValueOnHide: defaultValue( |
| 24752 |
props.resetValueOnHide, |
| 24753 |
syncState == null ? void 0 : syncState.resetValueOnHide, |
| 24754 |
multiSelectable && !tag |
| 24755 |
), |
| 24756 |
activeValue: syncState == null ? void 0 : syncState.activeValue |
| 24757 |
}; |
| 24758 |
const combobox = createStore(initialState, composite, popover, store); |
| 24759 |
if (isTouchSafari) { |
| 24760 |
setup( |
| 24761 |
combobox, |
| 24762 |
() => sync(combobox, ["virtualFocus"], () => { |
| 24763 |
combobox.setState("virtualFocus", false); |
| 24764 |
}) |
| 24765 |
); |
| 24766 |
} |
| 24767 |
setup(combobox, () => { |
| 24768 |
if (!tag) return; |
| 24769 |
return chain( |
| 24770 |
sync(combobox, ["selectedValue"], (state) => { |
| 24771 |
if (!Array.isArray(state.selectedValue)) return; |
| 24772 |
tag.setValues(state.selectedValue); |
| 24773 |
}), |
| 24774 |
sync(tag, ["values"], (state) => { |
| 24775 |
combobox.setState("selectedValue", state.values); |
| 24776 |
}) |
| 24777 |
); |
| 24778 |
}); |
| 24779 |
setup( |
| 24780 |
combobox, |
| 24781 |
() => sync(combobox, ["resetValueOnHide", "mounted"], (state) => { |
| 24782 |
if (!state.resetValueOnHide) return; |
| 24783 |
if (state.mounted) return; |
| 24784 |
combobox.setState("value", value); |
| 24785 |
}) |
| 24786 |
); |
| 24787 |
setup( |
| 24788 |
combobox, |
| 24789 |
() => sync(combobox, ["open"], (state) => { |
| 24790 |
if (state.open) return; |
| 24791 |
combobox.setState("activeId", activeId); |
| 24792 |
combobox.setState("moves", 0); |
| 24793 |
}) |
| 24794 |
); |
| 24795 |
setup( |
| 24796 |
combobox, |
| 24797 |
() => sync(combobox, ["moves", "activeId"], (state, prevState) => { |
| 24798 |
if (state.moves === prevState.moves) { |
| 24799 |
combobox.setState("activeValue", void 0); |
| 24800 |
} |
| 24801 |
}) |
| 24802 |
); |
| 24803 |
setup( |
| 24804 |
combobox, |
| 24805 |
() => batch(combobox, ["moves", "renderedItems"], (state, prev) => { |
| 24806 |
if (state.moves === prev.moves) return; |
| 24807 |
const { activeId: activeId2 } = combobox.getState(); |
| 24808 |
const activeItem = composite.item(activeId2); |
| 24809 |
combobox.setState("activeValue", activeItem == null ? void 0 : activeItem.value); |
| 24810 |
}) |
| 24811 |
); |
| 24812 |
return { |
| 24813 |
...popover, |
| 24814 |
...composite, |
| 24815 |
...combobox, |
| 24816 |
tag, |
| 24817 |
setValue: (value2) => combobox.setState("value", value2), |
| 24818 |
resetValue: () => combobox.setState("value", initialState.value), |
| 24819 |
setSelectedValue: (selectedValue2) => combobox.setState("selectedValue", selectedValue2) |
| 24820 |
}; |
| 24821 |
} |
| 24822 |
|
| 24823 |
// node_modules/@ariakit/react-core/esm/__chunks/SVN33SY6.js |
| 24824 |
function useComboboxStoreOptions(props) { |
| 24825 |
const tag = useTagContext(); |
| 24826 |
props = { |
| 24827 |
...props, |
| 24828 |
tag: props.tag !== void 0 ? props.tag : tag |
| 24829 |
}; |
| 24830 |
return useCompositeStoreOptions(props); |
| 24831 |
} |
| 24832 |
function useComboboxStoreProps(store, update2, props) { |
| 24833 |
useUpdateEffect(update2, [props.tag]); |
| 24834 |
useStoreProps(store, props, "value", "setValue"); |
| 24835 |
useStoreProps(store, props, "selectedValue", "setSelectedValue"); |
| 24836 |
useStoreProps(store, props, "resetValueOnHide"); |
| 24837 |
useStoreProps(store, props, "resetValueOnSelect"); |
| 24838 |
return Object.assign( |
| 24839 |
useCompositeStoreProps( |
| 24840 |
usePopoverStoreProps(store, update2, props), |
| 24841 |
update2, |
| 24842 |
props |
| 24843 |
), |
| 24844 |
{ tag: props.tag } |
| 24845 |
); |
| 24846 |
} |
| 24847 |
function useComboboxStore(props = {}) { |
| 24848 |
props = useComboboxStoreOptions(props); |
| 24849 |
const [store, update2] = useStore2(createComboboxStore, props); |
| 24850 |
return useComboboxStoreProps(store, update2, props); |
| 24851 |
} |
| 24852 |
|
| 24853 |
// node_modules/@ariakit/react-core/esm/combobox/combobox-provider.js |
| 24854 |
var import_jsx_runtime117 = __toESM(require_jsx_runtime(), 1); |
| 24855 |
function ComboboxProvider(props = {}) { |
| 24856 |
const store = useComboboxStore(props); |
| 24857 |
return /* @__PURE__ */ (0, import_jsx_runtime117.jsx)(ComboboxContextProvider, { value: store, children: props.children }); |
| 24858 |
} |
| 24859 |
|
| 24860 |
// packages/dataviews/build-module/components/dataviews-filters/search-widget.mjs |
| 24861 |
var import_remove_accents = __toESM(require_remove_accents(), 1); |
| 24862 |
var import_compose11 = __toESM(require_compose(), 1); |
| 24863 |
var import_i18n29 = __toESM(require_i18n(), 1); |
| 24864 |
var import_element89 = __toESM(require_element(), 1); |
| 24865 |
var import_components20 = __toESM(require_components(), 1); |
| 24866 |
|
| 24867 |
// packages/dataviews/build-module/components/dataviews-filters/utils.mjs |
| 24868 |
var EMPTY_ARRAY3 = []; |
| 24869 |
var getCurrentValue = (filterDefinition, currentFilter) => { |
| 24870 |
if (filterDefinition.singleSelection) { |
| 24871 |
return currentFilter?.value; |
| 24872 |
} |
| 24873 |
if (Array.isArray(currentFilter?.value)) { |
| 24874 |
return currentFilter.value; |
| 24875 |
} |
| 24876 |
if (!Array.isArray(currentFilter?.value) && !!currentFilter?.value) { |
| 24877 |
return [currentFilter.value]; |
| 24878 |
} |
| 24879 |
return EMPTY_ARRAY3; |
| 24880 |
}; |
| 24881 |
|
| 24882 |
// packages/dataviews/build-module/hooks/use-elements.mjs |
| 24883 |
var import_element88 = __toESM(require_element(), 1); |
| 24884 |
var EMPTY_ARRAY4 = []; |
| 24885 |
function useElements({ |
| 24886 |
elements, |
| 24887 |
getElements |
| 24888 |
}) { |
| 24889 |
const staticElements = Array.isArray(elements) && elements.length > 0 ? elements : EMPTY_ARRAY4; |
| 24890 |
const [records, setRecords] = (0, import_element88.useState)(staticElements); |
| 24891 |
const [isLoading, setIsLoading] = (0, import_element88.useState)(false); |
| 24892 |
(0, import_element88.useEffect)(() => { |
| 24893 |
if (!getElements) { |
| 24894 |
setRecords(staticElements); |
| 24895 |
return; |
| 24896 |
} |
| 24897 |
let cancelled = false; |
| 24898 |
setIsLoading(true); |
| 24899 |
getElements().then((fetchedElements) => { |
| 24900 |
if (!cancelled) { |
| 24901 |
const dynamicElements = Array.isArray(fetchedElements) && fetchedElements.length > 0 ? fetchedElements : staticElements; |
| 24902 |
setRecords(dynamicElements); |
| 24903 |
} |
| 24904 |
}).catch(() => { |
| 24905 |
if (!cancelled) { |
| 24906 |
setRecords(staticElements); |
| 24907 |
} |
| 24908 |
}).finally(() => { |
| 24909 |
if (!cancelled) { |
| 24910 |
setIsLoading(false); |
| 24911 |
} |
| 24912 |
}); |
| 24913 |
return () => { |
| 24914 |
cancelled = true; |
| 24915 |
}; |
| 24916 |
}, [getElements, staticElements]); |
| 24917 |
return { |
| 24918 |
elements: records, |
| 24919 |
isLoading |
| 24920 |
}; |
| 24921 |
} |
| 24922 |
|
| 24923 |
// packages/dataviews/build-module/components/dataviews-filters/search-widget.mjs |
| 24924 |
var import_jsx_runtime118 = __toESM(require_jsx_runtime(), 1); |
| 24925 |
function normalizeSearchInput(input = "") { |
| 24926 |
return (0, import_remove_accents.default)(input.trim().toLowerCase()); |
| 24927 |
} |
| 24928 |
var getNewValue = (filterDefinition, currentFilter, value) => { |
| 24929 |
if (filterDefinition.singleSelection) { |
| 24930 |
return value; |
| 24931 |
} |
| 24932 |
if (Array.isArray(currentFilter?.value)) { |
| 24933 |
return currentFilter.value.includes(value) ? currentFilter.value.filter((v2) => v2 !== value) : [...currentFilter.value, value]; |
| 24934 |
} |
| 24935 |
return [value]; |
| 24936 |
}; |
| 24937 |
function generateFilterElementCompositeItemId(prefix, filterElementValue) { |
| 24938 |
return `${prefix}-${filterElementValue}`; |
| 24939 |
} |
| 24940 |
var MultiSelectionOption = ({ selected }) => { |
| 24941 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 24942 |
"span", |
| 24943 |
{ |
| 24944 |
className: clsx_default( |
| 24945 |
"dataviews-filters__search-widget-listitem-multi-selection", |
| 24946 |
{ "is-selected": selected } |
| 24947 |
), |
| 24948 |
children: selected && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(import_components20.Icon, { icon: check_default }) |
| 24949 |
} |
| 24950 |
); |
| 24951 |
}; |
| 24952 |
var SingleSelectionOption = ({ selected }) => { |
| 24953 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 24954 |
"span", |
| 24955 |
{ |
| 24956 |
className: clsx_default( |
| 24957 |
"dataviews-filters__search-widget-listitem-single-selection", |
| 24958 |
{ "is-selected": selected } |
| 24959 |
) |
| 24960 |
} |
| 24961 |
); |
| 24962 |
}; |
| 24963 |
function ListBox({ view, filter, onChangeView }) { |
| 24964 |
const baseId = (0, import_compose11.useInstanceId)(ListBox, "dataviews-filter-list-box"); |
| 24965 |
const [activeCompositeId, setActiveCompositeId] = (0, import_element89.useState)( |
| 24966 |
// When there are one or less operators, the first item is set as active |
| 24967 |
// (by setting the initial `activeId` to `undefined`). |
| 24968 |
// With 2 or more operators, the focus is moved on the operators control |
| 24969 |
// (by setting the initial `activeId` to `null`), meaning that there won't |
| 24970 |
// be an active item initially. Focus is then managed via the |
| 24971 |
// `onFocusVisible` callback. |
| 24972 |
filter.operators?.length === 1 ? void 0 : null |
| 24973 |
); |
| 24974 |
const currentFilter = view.filters?.find( |
| 24975 |
(f2) => f2.field === filter.field |
| 24976 |
); |
| 24977 |
const currentValue = getCurrentValue(filter, currentFilter); |
| 24978 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 24979 |
import_components20.Composite, |
| 24980 |
{ |
| 24981 |
virtualFocus: true, |
| 24982 |
focusLoop: true, |
| 24983 |
activeId: activeCompositeId, |
| 24984 |
setActiveId: setActiveCompositeId, |
| 24985 |
role: "listbox", |
| 24986 |
className: "dataviews-filters__search-widget-listbox", |
| 24987 |
"aria-label": (0, import_i18n29.sprintf)( |
| 24988 |
/* translators: List of items for a filter. 1: Filter name. e.g.: "List of: Author". */ |
| 24989 |
(0, import_i18n29.__)("List of: %1$s"), |
| 24990 |
filter.name |
| 24991 |
), |
| 24992 |
onFocusVisible: () => { |
| 24993 |
if (!activeCompositeId && filter.elements.length) { |
| 24994 |
setActiveCompositeId( |
| 24995 |
generateFilterElementCompositeItemId( |
| 24996 |
baseId, |
| 24997 |
filter.elements[0].value |
| 24998 |
) |
| 24999 |
); |
| 25000 |
} |
| 25001 |
}, |
| 25002 |
render: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(import_components20.Composite.Typeahead, {}), |
| 25003 |
children: filter.elements.map((element) => /* @__PURE__ */ (0, import_jsx_runtime118.jsxs)( |
| 25004 |
import_components20.Composite.Hover, |
| 25005 |
{ |
| 25006 |
render: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25007 |
import_components20.Composite.Item, |
| 25008 |
{ |
| 25009 |
id: generateFilterElementCompositeItemId( |
| 25010 |
baseId, |
| 25011 |
element.value |
| 25012 |
), |
| 25013 |
render: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25014 |
"div", |
| 25015 |
{ |
| 25016 |
"aria-label": element.label, |
| 25017 |
role: "option", |
| 25018 |
className: "dataviews-filters__search-widget-listitem" |
| 25019 |
} |
| 25020 |
), |
| 25021 |
onClick: () => { |
| 25022 |
const newFilters = currentFilter ? [ |
| 25023 |
...(view.filters ?? []).map( |
| 25024 |
(_filter) => { |
| 25025 |
if (_filter.field === filter.field) { |
| 25026 |
return { |
| 25027 |
..._filter, |
| 25028 |
operator: currentFilter.operator || filter.operators[0], |
| 25029 |
value: getNewValue( |
| 25030 |
filter, |
| 25031 |
currentFilter, |
| 25032 |
element.value |
| 25033 |
) |
| 25034 |
}; |
| 25035 |
} |
| 25036 |
return _filter; |
| 25037 |
} |
| 25038 |
) |
| 25039 |
] : [ |
| 25040 |
...view.filters ?? [], |
| 25041 |
{ |
| 25042 |
field: filter.field, |
| 25043 |
operator: filter.operators[0], |
| 25044 |
value: getNewValue( |
| 25045 |
filter, |
| 25046 |
currentFilter, |
| 25047 |
element.value |
| 25048 |
) |
| 25049 |
} |
| 25050 |
]; |
| 25051 |
onChangeView({ |
| 25052 |
...view, |
| 25053 |
page: 1, |
| 25054 |
filters: newFilters |
| 25055 |
}); |
| 25056 |
} |
| 25057 |
} |
| 25058 |
), |
| 25059 |
children: [ |
| 25060 |
filter.singleSelection && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25061 |
SingleSelectionOption, |
| 25062 |
{ |
| 25063 |
selected: currentValue === element.value |
| 25064 |
} |
| 25065 |
), |
| 25066 |
!filter.singleSelection && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25067 |
MultiSelectionOption, |
| 25068 |
{ |
| 25069 |
selected: currentValue.includes(element.value) |
| 25070 |
} |
| 25071 |
), |
| 25072 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25073 |
"span", |
| 25074 |
{ |
| 25075 |
className: "dataviews-filters__search-widget-listitem-value", |
| 25076 |
title: element.label, |
| 25077 |
children: element.label |
| 25078 |
} |
| 25079 |
) |
| 25080 |
] |
| 25081 |
}, |
| 25082 |
element.value |
| 25083 |
)) |
| 25084 |
} |
| 25085 |
); |
| 25086 |
} |
| 25087 |
function ComboboxList22({ view, filter, onChangeView }) { |
| 25088 |
const [searchValue, setSearchValue] = (0, import_element89.useState)(""); |
| 25089 |
const deferredSearchValue = (0, import_element89.useDeferredValue)(searchValue); |
| 25090 |
const currentFilter = view.filters?.find( |
| 25091 |
(_filter) => _filter.field === filter.field |
| 25092 |
); |
| 25093 |
const currentValue = getCurrentValue(filter, currentFilter); |
| 25094 |
const matches2 = (0, import_element89.useMemo)(() => { |
| 25095 |
const normalizedSearch = normalizeSearchInput(deferredSearchValue); |
| 25096 |
return filter.elements.filter( |
| 25097 |
(item) => normalizeSearchInput(item.label).includes(normalizedSearch) |
| 25098 |
); |
| 25099 |
}, [filter.elements, deferredSearchValue]); |
| 25100 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsxs)( |
| 25101 |
ComboboxProvider, |
| 25102 |
{ |
| 25103 |
selectedValue: currentValue, |
| 25104 |
setSelectedValue: (value) => { |
| 25105 |
const newFilters = currentFilter ? [ |
| 25106 |
...(view.filters ?? []).map((_filter) => { |
| 25107 |
if (_filter.field === filter.field) { |
| 25108 |
return { |
| 25109 |
..._filter, |
| 25110 |
operator: currentFilter.operator || filter.operators[0], |
| 25111 |
value |
| 25112 |
}; |
| 25113 |
} |
| 25114 |
return _filter; |
| 25115 |
}) |
| 25116 |
] : [ |
| 25117 |
...view.filters ?? [], |
| 25118 |
{ |
| 25119 |
field: filter.field, |
| 25120 |
operator: filter.operators[0], |
| 25121 |
value |
| 25122 |
} |
| 25123 |
]; |
| 25124 |
onChangeView({ |
| 25125 |
...view, |
| 25126 |
page: 1, |
| 25127 |
filters: newFilters |
| 25128 |
}); |
| 25129 |
}, |
| 25130 |
setValue: setSearchValue, |
| 25131 |
children: [ |
| 25132 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsxs)("div", { className: "dataviews-filters__search-widget-filter-combobox__wrapper", children: [ |
| 25133 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsx)(VisuallyHidden, { render: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(ComboboxLabel, {}), children: (0, import_i18n29.__)("Search items") }), |
| 25134 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25135 |
Combobox, |
| 25136 |
{ |
| 25137 |
autoSelect: "always", |
| 25138 |
placeholder: (0, import_i18n29.__)("Search"), |
| 25139 |
className: "dataviews-filters__search-widget-filter-combobox__input" |
| 25140 |
} |
| 25141 |
), |
| 25142 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsx)("div", { className: "dataviews-filters__search-widget-filter-combobox__icon", children: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(import_components20.Icon, { icon: search_default }) }) |
| 25143 |
] }), |
| 25144 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsxs)( |
| 25145 |
ComboboxList, |
| 25146 |
{ |
| 25147 |
className: "dataviews-filters__search-widget-filter-combobox-list", |
| 25148 |
alwaysVisible: true, |
| 25149 |
children: [ |
| 25150 |
matches2.map((element) => { |
| 25151 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsxs)( |
| 25152 |
ComboboxItem, |
| 25153 |
{ |
| 25154 |
resetValueOnSelect: false, |
| 25155 |
value: element.value, |
| 25156 |
className: "dataviews-filters__search-widget-listitem", |
| 25157 |
hideOnClick: false, |
| 25158 |
setValueOnClick: false, |
| 25159 |
focusOnHover: true, |
| 25160 |
children: [ |
| 25161 |
filter.singleSelection && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25162 |
SingleSelectionOption, |
| 25163 |
{ |
| 25164 |
selected: currentValue === element.value |
| 25165 |
} |
| 25166 |
), |
| 25167 |
!filter.singleSelection && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25168 |
MultiSelectionOption, |
| 25169 |
{ |
| 25170 |
selected: currentValue.includes( |
| 25171 |
element.value |
| 25172 |
) |
| 25173 |
} |
| 25174 |
), |
| 25175 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsxs)( |
| 25176 |
"span", |
| 25177 |
{ |
| 25178 |
className: "dataviews-filters__search-widget-listitem-value", |
| 25179 |
title: element.label, |
| 25180 |
children: [ |
| 25181 |
/* @__PURE__ */ (0, import_jsx_runtime118.jsx)( |
| 25182 |
ComboboxItemValue, |
| 25183 |
{ |
| 25184 |
className: "dataviews-filters__search-widget-filter-combobox-item-value", |
| 25185 |
value: element.label |
| 25186 |
} |
| 25187 |
), |
| 25188 |
!!element.description && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)("span", { className: "dataviews-filters__search-widget-listitem-description", children: element.description }) |
| 25189 |
] |
| 25190 |
} |
| 25191 |
) |
| 25192 |
] |
| 25193 |
}, |
| 25194 |
element.value |
| 25195 |
); |
| 25196 |
}), |
| 25197 |
!matches2.length && /* @__PURE__ */ (0, import_jsx_runtime118.jsx)("p", { children: (0, import_i18n29.__)("No results found") }) |
| 25198 |
] |
| 25199 |
} |
| 25200 |
) |
| 25201 |
] |
| 25202 |
} |
| 25203 |
); |
| 25204 |
} |
| 25205 |
function SearchWidget(props) { |
| 25206 |
const { elements, isLoading } = useElements({ |
| 25207 |
elements: props.filter.elements, |
| 25208 |
getElements: props.filter.getElements |
| 25209 |
}); |
| 25210 |
if (isLoading) { |
| 25211 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)("div", { className: "dataviews-filters__search-widget-no-elements", children: /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(import_components20.Spinner, {}) }); |
| 25212 |
} |
| 25213 |
if (elements.length === 0) { |
| 25214 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)("div", { className: "dataviews-filters__search-widget-no-elements", children: (0, import_i18n29.__)("No elements found") }); |
| 25215 |
} |
| 25216 |
const Widget = elements.length > 10 ? ComboboxList22 : ListBox; |
| 25217 |
return /* @__PURE__ */ (0, import_jsx_runtime118.jsx)(Widget, { ...props, filter: { ...props.filter, elements } }); |
| 25218 |
} |
| 25219 |
|
| 25220 |
// packages/dataviews/build-module/components/dataviews-filters/input-widget.mjs |
| 25221 |
var import_es62 = __toESM(require_es6(), 1); |
| 25222 |
var import_compose12 = __toESM(require_compose(), 1); |
| 25223 |
var import_element90 = __toESM(require_element(), 1); |
| 25224 |
var import_components21 = __toESM(require_components(), 1); |
| 25225 |
var import_jsx_runtime119 = __toESM(require_jsx_runtime(), 1); |
| 25226 |
function InputWidget({ |
| 25227 |
filter, |
| 25228 |
view, |
| 25229 |
onChangeView, |
| 25230 |
fields: fields2 |
| 25231 |
}) { |
| 25232 |
const currentFilter = view.filters?.find( |
| 25233 |
(f2) => f2.field === filter.field |
| 25234 |
); |
| 25235 |
const currentValue = getCurrentValue(filter, currentFilter); |
| 25236 |
const field = (0, import_element90.useMemo)(() => { |
| 25237 |
const currentField = fields2.find((f2) => f2.id === filter.field); |
| 25238 |
if (currentField) { |
| 25239 |
return { |
| 25240 |
...currentField, |
| 25241 |
// Deactivate validation for filters. |
| 25242 |
isValid: {}, |
| 25243 |
// Filter controls are always enabled. |
| 25244 |
isDisabled: () => false, |
| 25245 |
// Filter controls are always visible. |
| 25246 |
isVisible: () => true, |
| 25247 |
// Configure getValue/setValue as if Item was a plain object. |
| 25248 |
getValue: ({ item }) => item[currentField.id], |
| 25249 |
setValue: ({ value }) => ({ |
| 25250 |
[currentField.id]: value |
| 25251 |
}) |
| 25252 |
}; |
| 25253 |
} |
| 25254 |
return currentField; |
| 25255 |
}, [fields2, filter.field]); |
| 25256 |
const data = (0, import_element90.useMemo)(() => { |
| 25257 |
return (view.filters ?? []).reduce( |
| 25258 |
(acc, activeFilter) => { |
| 25259 |
acc[activeFilter.field] = activeFilter.value; |
| 25260 |
return acc; |
| 25261 |
}, |
| 25262 |
{} |
| 25263 |
); |
| 25264 |
}, [view.filters]); |
| 25265 |
const handleChange = (0, import_compose12.useEvent)((updatedData) => { |
| 25266 |
if (!field || !currentFilter) { |
| 25267 |
return; |
| 25268 |
} |
| 25269 |
const nextValue = field.getValue({ item: updatedData }); |
| 25270 |
if ((0, import_es62.default)(nextValue, currentValue)) { |
| 25271 |
return; |
| 25272 |
} |
| 25273 |
onChangeView({ |
| 25274 |
...view, |
| 25275 |
filters: (view.filters ?? []).map( |
| 25276 |
(_filter) => _filter.field === filter.field ? { |
| 25277 |
..._filter, |
| 25278 |
operator: currentFilter.operator || filter.operators[0], |
| 25279 |
// Consider empty strings as undefined: |
| 25280 |
// |
| 25281 |
// - undefined as value means the filter is unset: the filter widget displays no value and the search returns all records |
| 25282 |
// - empty string as value means "search empty string": returns only the records that have an empty string as value |
| 25283 |
// |
| 25284 |
// In practice, this means the filter will not be able to find an empty string as the value. |
| 25285 |
value: nextValue === "" ? void 0 : nextValue |
| 25286 |
} : _filter |
| 25287 |
) |
| 25288 |
}); |
| 25289 |
}); |
| 25290 |
if (!field || !field.Edit || !currentFilter) { |
| 25291 |
return null; |
| 25292 |
} |
| 25293 |
return /* @__PURE__ */ (0, import_jsx_runtime119.jsx)( |
| 25294 |
import_components21.Flex, |
| 25295 |
{ |
| 25296 |
className: "dataviews-filters__user-input-widget", |
| 25297 |
gap: 2.5, |
| 25298 |
direction: "column", |
| 25299 |
children: /* @__PURE__ */ (0, import_jsx_runtime119.jsx)( |
| 25300 |
field.Edit, |
| 25301 |
{ |
| 25302 |
hideLabelFromVision: true, |
| 25303 |
data, |
| 25304 |
field, |
| 25305 |
operator: currentFilter.operator, |
| 25306 |
onChange: handleChange |
| 25307 |
} |
| 25308 |
) |
| 25309 |
} |
| 25310 |
); |
| 25311 |
} |
| 25312 |
|
| 25313 |
// node_modules/date-fns/constants.js |
| 25314 |
var daysInYear = 365.2425; |
| 25315 |
var maxTime = Math.pow(10, 8) * 24 * 60 * 60 * 1e3; |
| 25316 |
var minTime = -maxTime; |
| 25317 |
var millisecondsInWeek = 6048e5; |
| 25318 |
var millisecondsInDay = 864e5; |
| 25319 |
var secondsInHour = 3600; |
| 25320 |
var secondsInDay = secondsInHour * 24; |
| 25321 |
var secondsInWeek = secondsInDay * 7; |
| 25322 |
var secondsInYear = secondsInDay * daysInYear; |
| 25323 |
var secondsInMonth = secondsInYear / 12; |
| 25324 |
var secondsInQuarter = secondsInMonth * 3; |
| 25325 |
var constructFromSymbol = /* @__PURE__ */ Symbol.for("constructDateFrom"); |
| 25326 |
|
| 25327 |
// node_modules/date-fns/constructFrom.js |
| 25328 |
function constructFrom(date, value) { |
| 25329 |
if (typeof date === "function") return date(value); |
| 25330 |
if (date && typeof date === "object" && constructFromSymbol in date) |
| 25331 |
return date[constructFromSymbol](value); |
| 25332 |
if (date instanceof Date) return new date.constructor(value); |
| 25333 |
return new Date(value); |
| 25334 |
} |
| 25335 |
|
| 25336 |
// node_modules/date-fns/toDate.js |
| 25337 |
function toDate(argument, context) { |
| 25338 |
return constructFrom(context || argument, argument); |
| 25339 |
} |
| 25340 |
|
| 25341 |
// node_modules/date-fns/addDays.js |
| 25342 |
function addDays(date, amount, options) { |
| 25343 |
const _date = toDate(date, options?.in); |
| 25344 |
if (isNaN(amount)) return constructFrom(options?.in || date, NaN); |
| 25345 |
if (!amount) return _date; |
| 25346 |
_date.setDate(_date.getDate() + amount); |
| 25347 |
return _date; |
| 25348 |
} |
| 25349 |
|
| 25350 |
// node_modules/date-fns/addMonths.js |
| 25351 |
function addMonths(date, amount, options) { |
| 25352 |
const _date = toDate(date, options?.in); |
| 25353 |
if (isNaN(amount)) return constructFrom(options?.in || date, NaN); |
| 25354 |
if (!amount) { |
| 25355 |
return _date; |
| 25356 |
} |
| 25357 |
const dayOfMonth = _date.getDate(); |
| 25358 |
const endOfDesiredMonth = constructFrom(options?.in || date, _date.getTime()); |
| 25359 |
endOfDesiredMonth.setMonth(_date.getMonth() + amount + 1, 0); |
| 25360 |
const daysInMonth = endOfDesiredMonth.getDate(); |
| 25361 |
if (dayOfMonth >= daysInMonth) { |
| 25362 |
return endOfDesiredMonth; |
| 25363 |
} else { |
| 25364 |
_date.setFullYear( |
| 25365 |
endOfDesiredMonth.getFullYear(), |
| 25366 |
endOfDesiredMonth.getMonth(), |
| 25367 |
dayOfMonth |
| 25368 |
); |
| 25369 |
return _date; |
| 25370 |
} |
| 25371 |
} |
| 25372 |
|
| 25373 |
// node_modules/date-fns/_lib/defaultOptions.js |
| 25374 |
var defaultOptions = {}; |
| 25375 |
function getDefaultOptions() { |
| 25376 |
return defaultOptions; |
| 25377 |
} |
| 25378 |
|
| 25379 |
// node_modules/date-fns/startOfWeek.js |
| 25380 |
function startOfWeek(date, options) { |
| 25381 |
const defaultOptions3 = getDefaultOptions(); |
| 25382 |
const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions3.weekStartsOn ?? defaultOptions3.locale?.options?.weekStartsOn ?? 0; |
| 25383 |
const _date = toDate(date, options?.in); |
| 25384 |
const day = _date.getDay(); |
| 25385 |
const diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn; |
| 25386 |
_date.setDate(_date.getDate() - diff); |
| 25387 |
_date.setHours(0, 0, 0, 0); |
| 25388 |
return _date; |
| 25389 |
} |
| 25390 |
|
| 25391 |
// node_modules/date-fns/startOfISOWeek.js |
| 25392 |
function startOfISOWeek(date, options) { |
| 25393 |
return startOfWeek(date, { ...options, weekStartsOn: 1 }); |
| 25394 |
} |
| 25395 |
|
| 25396 |
// node_modules/date-fns/getISOWeekYear.js |
| 25397 |
function getISOWeekYear(date, options) { |
| 25398 |
const _date = toDate(date, options?.in); |
| 25399 |
const year = _date.getFullYear(); |
| 25400 |
const fourthOfJanuaryOfNextYear = constructFrom(_date, 0); |
| 25401 |
fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4); |
| 25402 |
fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0); |
| 25403 |
const startOfNextYear = startOfISOWeek(fourthOfJanuaryOfNextYear); |
| 25404 |
const fourthOfJanuaryOfThisYear = constructFrom(_date, 0); |
| 25405 |
fourthOfJanuaryOfThisYear.setFullYear(year, 0, 4); |
| 25406 |
fourthOfJanuaryOfThisYear.setHours(0, 0, 0, 0); |
| 25407 |
const startOfThisYear = startOfISOWeek(fourthOfJanuaryOfThisYear); |
| 25408 |
if (_date.getTime() >= startOfNextYear.getTime()) { |
| 25409 |
return year + 1; |
| 25410 |
} else if (_date.getTime() >= startOfThisYear.getTime()) { |
| 25411 |
return year; |
| 25412 |
} else { |
| 25413 |
return year - 1; |
| 25414 |
} |
| 25415 |
} |
| 25416 |
|
| 25417 |
// node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds.js |
| 25418 |
function getTimezoneOffsetInMilliseconds(date) { |
| 25419 |
const _date = toDate(date); |
| 25420 |
const utcDate = new Date( |
| 25421 |
Date.UTC( |
| 25422 |
_date.getFullYear(), |
| 25423 |
_date.getMonth(), |
| 25424 |
_date.getDate(), |
| 25425 |
_date.getHours(), |
| 25426 |
_date.getMinutes(), |
| 25427 |
_date.getSeconds(), |
| 25428 |
_date.getMilliseconds() |
| 25429 |
) |
| 25430 |
); |
| 25431 |
utcDate.setUTCFullYear(_date.getFullYear()); |
| 25432 |
return +date - +utcDate; |
| 25433 |
} |
| 25434 |
|
| 25435 |
// node_modules/date-fns/_lib/normalizeDates.js |
| 25436 |
function normalizeDates(context, ...dates) { |
| 25437 |
const normalize = constructFrom.bind( |
| 25438 |
null, |
| 25439 |
context || dates.find((date) => typeof date === "object") |
| 25440 |
); |
| 25441 |
return dates.map(normalize); |
| 25442 |
} |
| 25443 |
|
| 25444 |
// node_modules/date-fns/startOfDay.js |
| 25445 |
function startOfDay(date, options) { |
| 25446 |
const _date = toDate(date, options?.in); |
| 25447 |
_date.setHours(0, 0, 0, 0); |
| 25448 |
return _date; |
| 25449 |
} |
| 25450 |
|
| 25451 |
// node_modules/date-fns/differenceInCalendarDays.js |
| 25452 |
function differenceInCalendarDays(laterDate, earlierDate, options) { |
| 25453 |
const [laterDate_, earlierDate_] = normalizeDates( |
| 25454 |
options?.in, |
| 25455 |
laterDate, |
| 25456 |
earlierDate |
| 25457 |
); |
| 25458 |
const laterStartOfDay = startOfDay(laterDate_); |
| 25459 |
const earlierStartOfDay = startOfDay(earlierDate_); |
| 25460 |
const laterTimestamp = +laterStartOfDay - getTimezoneOffsetInMilliseconds(laterStartOfDay); |
| 25461 |
const earlierTimestamp = +earlierStartOfDay - getTimezoneOffsetInMilliseconds(earlierStartOfDay); |
| 25462 |
return Math.round((laterTimestamp - earlierTimestamp) / millisecondsInDay); |
| 25463 |
} |
| 25464 |
|
| 25465 |
// node_modules/date-fns/startOfISOWeekYear.js |
| 25466 |
function startOfISOWeekYear(date, options) { |
| 25467 |
const year = getISOWeekYear(date, options); |
| 25468 |
const fourthOfJanuary = constructFrom(options?.in || date, 0); |
| 25469 |
fourthOfJanuary.setFullYear(year, 0, 4); |
| 25470 |
fourthOfJanuary.setHours(0, 0, 0, 0); |
| 25471 |
return startOfISOWeek(fourthOfJanuary); |
| 25472 |
} |
| 25473 |
|
| 25474 |
// node_modules/date-fns/addWeeks.js |
| 25475 |
function addWeeks(date, amount, options) { |
| 25476 |
return addDays(date, amount * 7, options); |
| 25477 |
} |
| 25478 |
|
| 25479 |
// node_modules/date-fns/addYears.js |
| 25480 |
function addYears(date, amount, options) { |
| 25481 |
return addMonths(date, amount * 12, options); |
| 25482 |
} |
| 25483 |
|
| 25484 |
// node_modules/date-fns/isDate.js |
| 25485 |
function isDate(value) { |
| 25486 |
return value instanceof Date || typeof value === "object" && Object.prototype.toString.call(value) === "[object Date]"; |
| 25487 |
} |
| 25488 |
|
| 25489 |
// node_modules/date-fns/isValid.js |
| 25490 |
function isValid(date) { |
| 25491 |
return !(!isDate(date) && typeof date !== "number" || isNaN(+toDate(date))); |
| 25492 |
} |
| 25493 |
|
| 25494 |
// node_modules/date-fns/startOfMonth.js |
| 25495 |
function startOfMonth(date, options) { |
| 25496 |
const _date = toDate(date, options?.in); |
| 25497 |
_date.setDate(1); |
| 25498 |
_date.setHours(0, 0, 0, 0); |
| 25499 |
return _date; |
| 25500 |
} |
| 25501 |
|
| 25502 |
// node_modules/date-fns/startOfYear.js |
| 25503 |
function startOfYear(date, options) { |
| 25504 |
const date_ = toDate(date, options?.in); |
| 25505 |
date_.setFullYear(date_.getFullYear(), 0, 1); |
| 25506 |
date_.setHours(0, 0, 0, 0); |
| 25507 |
return date_; |
| 25508 |
} |
| 25509 |
|
| 25510 |
// node_modules/date-fns/locale/en-US/_lib/formatDistance.js |
| 25511 |
var formatDistanceLocale = { |
| 25512 |
lessThanXSeconds: { |
| 25513 |
one: "less than a second", |
| 25514 |
other: "less than {{count}} seconds" |
| 25515 |
}, |
| 25516 |
xSeconds: { |
| 25517 |
one: "1 second", |
| 25518 |
other: "{{count}} seconds" |
| 25519 |
}, |
| 25520 |
halfAMinute: "half a minute", |
| 25521 |
lessThanXMinutes: { |
| 25522 |
one: "less than a minute", |
| 25523 |
other: "less than {{count}} minutes" |
| 25524 |
}, |
| 25525 |
xMinutes: { |
| 25526 |
one: "1 minute", |
| 25527 |
other: "{{count}} minutes" |
| 25528 |
}, |
| 25529 |
aboutXHours: { |
| 25530 |
one: "about 1 hour", |
| 25531 |
other: "about {{count}} hours" |
| 25532 |
}, |
| 25533 |
xHours: { |
| 25534 |
one: "1 hour", |
| 25535 |
other: "{{count}} hours" |
| 25536 |
}, |
| 25537 |
xDays: { |
| 25538 |
one: "1 day", |
| 25539 |
other: "{{count}} days" |
| 25540 |
}, |
| 25541 |
aboutXWeeks: { |
| 25542 |
one: "about 1 week", |
| 25543 |
other: "about {{count}} weeks" |
| 25544 |
}, |
| 25545 |
xWeeks: { |
| 25546 |
one: "1 week", |
| 25547 |
other: "{{count}} weeks" |
| 25548 |
}, |
| 25549 |
aboutXMonths: { |
| 25550 |
one: "about 1 month", |
| 25551 |
other: "about {{count}} months" |
| 25552 |
}, |
| 25553 |
xMonths: { |
| 25554 |
one: "1 month", |
| 25555 |
other: "{{count}} months" |
| 25556 |
}, |
| 25557 |
aboutXYears: { |
| 25558 |
one: "about 1 year", |
| 25559 |
other: "about {{count}} years" |
| 25560 |
}, |
| 25561 |
xYears: { |
| 25562 |
one: "1 year", |
| 25563 |
other: "{{count}} years" |
| 25564 |
}, |
| 25565 |
overXYears: { |
| 25566 |
one: "over 1 year", |
| 25567 |
other: "over {{count}} years" |
| 25568 |
}, |
| 25569 |
almostXYears: { |
| 25570 |
one: "almost 1 year", |
| 25571 |
other: "almost {{count}} years" |
| 25572 |
} |
| 25573 |
}; |
| 25574 |
var formatDistance = (token, count, options) => { |
| 25575 |
let result; |
| 25576 |
const tokenValue = formatDistanceLocale[token]; |
| 25577 |
if (typeof tokenValue === "string") { |
| 25578 |
result = tokenValue; |
| 25579 |
} else if (count === 1) { |
| 25580 |
result = tokenValue.one; |
| 25581 |
} else { |
| 25582 |
result = tokenValue.other.replace("{{count}}", count.toString()); |
| 25583 |
} |
| 25584 |
if (options?.addSuffix) { |
| 25585 |
if (options.comparison && options.comparison > 0) { |
| 25586 |
return "in " + result; |
| 25587 |
} else { |
| 25588 |
return result + " ago"; |
| 25589 |
} |
| 25590 |
} |
| 25591 |
return result; |
| 25592 |
}; |
| 25593 |
|
| 25594 |
// node_modules/date-fns/locale/_lib/buildFormatLongFn.js |
| 25595 |
function buildFormatLongFn(args) { |
| 25596 |
return (options = {}) => { |
| 25597 |
const width = options.width ? String(options.width) : args.defaultWidth; |
| 25598 |
const format6 = args.formats[width] || args.formats[args.defaultWidth]; |
| 25599 |
return format6; |
| 25600 |
}; |
| 25601 |
} |
| 25602 |
|
| 25603 |
// node_modules/date-fns/locale/en-US/_lib/formatLong.js |
| 25604 |
var dateFormats = { |
| 25605 |
full: "EEEE, MMMM do, y", |
| 25606 |
long: "MMMM do, y", |
| 25607 |
medium: "MMM d, y", |
| 25608 |
short: "MM/dd/yyyy" |
| 25609 |
}; |
| 25610 |
var timeFormats = { |
| 25611 |
full: "h:mm:ss a zzzz", |
| 25612 |
long: "h:mm:ss a z", |
| 25613 |
medium: "h:mm:ss a", |
| 25614 |
short: "h:mm a" |
| 25615 |
}; |
| 25616 |
var dateTimeFormats = { |
| 25617 |
full: "{{date}} 'at' {{time}}", |
| 25618 |
long: "{{date}} 'at' {{time}}", |
| 25619 |
medium: "{{date}}, {{time}}", |
| 25620 |
short: "{{date}}, {{time}}" |
| 25621 |
}; |
| 25622 |
var formatLong = { |
| 25623 |
date: buildFormatLongFn({ |
| 25624 |
formats: dateFormats, |
| 25625 |
defaultWidth: "full" |
| 25626 |
}), |
| 25627 |
time: buildFormatLongFn({ |
| 25628 |
formats: timeFormats, |
| 25629 |
defaultWidth: "full" |
| 25630 |
}), |
| 25631 |
dateTime: buildFormatLongFn({ |
| 25632 |
formats: dateTimeFormats, |
| 25633 |
defaultWidth: "full" |
| 25634 |
}) |
| 25635 |
}; |
| 25636 |
|
| 25637 |
// node_modules/date-fns/locale/en-US/_lib/formatRelative.js |
| 25638 |
var formatRelativeLocale = { |
| 25639 |
lastWeek: "'last' eeee 'at' p", |
| 25640 |
yesterday: "'yesterday at' p", |
| 25641 |
today: "'today at' p", |
| 25642 |
tomorrow: "'tomorrow at' p", |
| 25643 |
nextWeek: "eeee 'at' p", |
| 25644 |
other: "P" |
| 25645 |
}; |
| 25646 |
var formatRelative = (token, _date, _baseDate, _options) => formatRelativeLocale[token]; |
| 25647 |
|
| 25648 |
// node_modules/date-fns/locale/_lib/buildLocalizeFn.js |
| 25649 |
function buildLocalizeFn(args) { |
| 25650 |
return (value, options) => { |
| 25651 |
const context = options?.context ? String(options.context) : "standalone"; |
| 25652 |
let valuesArray; |
| 25653 |
if (context === "formatting" && args.formattingValues) { |
| 25654 |
const defaultWidth = args.defaultFormattingWidth || args.defaultWidth; |
| 25655 |
const width = options?.width ? String(options.width) : defaultWidth; |
| 25656 |
valuesArray = args.formattingValues[width] || args.formattingValues[defaultWidth]; |
| 25657 |
} else { |
| 25658 |
const defaultWidth = args.defaultWidth; |
| 25659 |
const width = options?.width ? String(options.width) : args.defaultWidth; |
| 25660 |
valuesArray = args.values[width] || args.values[defaultWidth]; |
| 25661 |
} |
| 25662 |
const index2 = args.argumentCallback ? args.argumentCallback(value) : value; |
| 25663 |
return valuesArray[index2]; |
| 25664 |
}; |
| 25665 |
} |
| 25666 |
|
| 25667 |
// node_modules/date-fns/locale/en-US/_lib/localize.js |
| 25668 |
var eraValues = { |
| 25669 |
narrow: ["B", "A"], |
| 25670 |
abbreviated: ["BC", "AD"], |
| 25671 |
wide: ["Before Christ", "Anno Domini"] |
| 25672 |
}; |
| 25673 |
var quarterValues = { |
| 25674 |
narrow: ["1", "2", "3", "4"], |
| 25675 |
abbreviated: ["Q1", "Q2", "Q3", "Q4"], |
| 25676 |
wide: ["1st quarter", "2nd quarter", "3rd quarter", "4th quarter"] |
| 25677 |
}; |
| 25678 |
var monthValues = { |
| 25679 |
narrow: ["J", "F", "M", "A", "M", "J", "J", "A", "S", "O", "N", "D"], |
| 25680 |
abbreviated: [ |
| 25681 |
"Jan", |
| 25682 |
"Feb", |
| 25683 |
"Mar", |
| 25684 |
"Apr", |
| 25685 |
"May", |
| 25686 |
"Jun", |
| 25687 |
"Jul", |
| 25688 |
"Aug", |
| 25689 |
"Sep", |
| 25690 |
"Oct", |
| 25691 |
"Nov", |
| 25692 |
"Dec" |
| 25693 |
], |
| 25694 |
wide: [ |
| 25695 |
"January", |
| 25696 |
"February", |
| 25697 |
"March", |
| 25698 |
"April", |
| 25699 |
"May", |
| 25700 |
"June", |
| 25701 |
"July", |
| 25702 |
"August", |
| 25703 |
"September", |
| 25704 |
"October", |
| 25705 |
"November", |
| 25706 |
"December" |
| 25707 |
] |
| 25708 |
}; |
| 25709 |
var dayValues = { |
| 25710 |
narrow: ["S", "M", "T", "W", "T", "F", "S"], |
| 25711 |
short: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"], |
| 25712 |
abbreviated: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], |
| 25713 |
wide: [ |
| 25714 |
"Sunday", |
| 25715 |
"Monday", |
| 25716 |
"Tuesday", |
| 25717 |
"Wednesday", |
| 25718 |
"Thursday", |
| 25719 |
"Friday", |
| 25720 |
"Saturday" |
| 25721 |
] |
| 25722 |
}; |
| 25723 |
var dayPeriodValues = { |
| 25724 |
narrow: { |
| 25725 |
am: "a", |
| 25726 |
pm: "p", |
| 25727 |
midnight: "mi", |
| 25728 |
noon: "n", |
| 25729 |
morning: "morning", |
| 25730 |
afternoon: "afternoon", |
| 25731 |
evening: "evening", |
| 25732 |
night: "night" |
| 25733 |
}, |
| 25734 |
abbreviated: { |
| 25735 |
am: "AM", |
| 25736 |
pm: "PM", |
| 25737 |
midnight: "midnight", |
| 25738 |
noon: "noon", |
| 25739 |
morning: "morning", |
| 25740 |
afternoon: "afternoon", |
| 25741 |
evening: "evening", |
| 25742 |
night: "night" |
| 25743 |
}, |
| 25744 |
wide: { |
| 25745 |
am: "a.m.", |
| 25746 |
pm: "p.m.", |
| 25747 |
midnight: "midnight", |
| 25748 |
noon: "noon", |
| 25749 |
morning: "morning", |
| 25750 |
afternoon: "afternoon", |
| 25751 |
evening: "evening", |
| 25752 |
night: "night" |
| 25753 |
} |
| 25754 |
}; |
| 25755 |
var formattingDayPeriodValues = { |
| 25756 |
narrow: { |
| 25757 |
am: "a", |
| 25758 |
pm: "p", |
| 25759 |
midnight: "mi", |
| 25760 |
noon: "n", |
| 25761 |
morning: "in the morning", |
| 25762 |
afternoon: "in the afternoon", |
| 25763 |
evening: "in the evening", |
| 25764 |
night: "at night" |
| 25765 |
}, |
| 25766 |
abbreviated: { |
| 25767 |
am: "AM", |
| 25768 |
pm: "PM", |
| 25769 |
midnight: "midnight", |
| 25770 |
noon: "noon", |
| 25771 |
morning: "in the morning", |
| 25772 |
afternoon: "in the afternoon", |
| 25773 |
evening: "in the evening", |
| 25774 |
night: "at night" |
| 25775 |
}, |
| 25776 |
wide: { |
| 25777 |
am: "a.m.", |
| 25778 |
pm: "p.m.", |
| 25779 |
midnight: "midnight", |
| 25780 |
noon: "noon", |
| 25781 |
morning: "in the morning", |
| 25782 |
afternoon: "in the afternoon", |
| 25783 |
evening: "in the evening", |
| 25784 |
night: "at night" |
| 25785 |
} |
| 25786 |
}; |
| 25787 |
var ordinalNumber = (dirtyNumber, _options) => { |
| 25788 |
const number = Number(dirtyNumber); |
| 25789 |
const rem100 = number % 100; |
| 25790 |
if (rem100 > 20 || rem100 < 10) { |
| 25791 |
switch (rem100 % 10) { |
| 25792 |
case 1: |
| 25793 |
return number + "st"; |
| 25794 |
case 2: |
| 25795 |
return number + "nd"; |
| 25796 |
case 3: |
| 25797 |
return number + "rd"; |
| 25798 |
} |
| 25799 |
} |
| 25800 |
return number + "th"; |
| 25801 |
}; |
| 25802 |
var localize = { |
| 25803 |
ordinalNumber, |
| 25804 |
era: buildLocalizeFn({ |
| 25805 |
values: eraValues, |
| 25806 |
defaultWidth: "wide" |
| 25807 |
}), |
| 25808 |
quarter: buildLocalizeFn({ |
| 25809 |
values: quarterValues, |
| 25810 |
defaultWidth: "wide", |
| 25811 |
argumentCallback: (quarter) => quarter - 1 |
| 25812 |
}), |
| 25813 |
month: buildLocalizeFn({ |
| 25814 |
values: monthValues, |
| 25815 |
defaultWidth: "wide" |
| 25816 |
}), |
| 25817 |
day: buildLocalizeFn({ |
| 25818 |
values: dayValues, |
| 25819 |
defaultWidth: "wide" |
| 25820 |
}), |
| 25821 |
dayPeriod: buildLocalizeFn({ |
| 25822 |
values: dayPeriodValues, |
| 25823 |
defaultWidth: "wide", |
| 25824 |
formattingValues: formattingDayPeriodValues, |
| 25825 |
defaultFormattingWidth: "wide" |
| 25826 |
}) |
| 25827 |
}; |
| 25828 |
|
| 25829 |
// node_modules/date-fns/locale/_lib/buildMatchFn.js |
| 25830 |
function buildMatchFn(args) { |
| 25831 |
return (string, options = {}) => { |
| 25832 |
const width = options.width; |
| 25833 |
const matchPattern = width && args.matchPatterns[width] || args.matchPatterns[args.defaultMatchWidth]; |
| 25834 |
const matchResult = string.match(matchPattern); |
| 25835 |
if (!matchResult) { |
| 25836 |
return null; |
| 25837 |
} |
| 25838 |
const matchedString = matchResult[0]; |
| 25839 |
const parsePatterns = width && args.parsePatterns[width] || args.parsePatterns[args.defaultParseWidth]; |
| 25840 |
const key2 = Array.isArray(parsePatterns) ? findIndex(parsePatterns, (pattern) => pattern.test(matchedString)) : ( |
| 25841 |
// [TODO] -- I challenge you to fix the type |
| 25842 |
findKey(parsePatterns, (pattern) => pattern.test(matchedString)) |
| 25843 |
); |
| 25844 |
let value; |
| 25845 |
value = args.valueCallback ? args.valueCallback(key2) : key2; |
| 25846 |
value = options.valueCallback ? ( |
| 25847 |
// [TODO] -- I challenge you to fix the type |
| 25848 |
options.valueCallback(value) |
| 25849 |
) : value; |
| 25850 |
const rest = string.slice(matchedString.length); |
| 25851 |
return { value, rest }; |
| 25852 |
}; |
| 25853 |
} |
| 25854 |
function findKey(object, predicate) { |
| 25855 |
for (const key2 in object) { |
| 25856 |
if (Object.prototype.hasOwnProperty.call(object, key2) && predicate(object[key2])) { |
| 25857 |
return key2; |
| 25858 |
} |
| 25859 |
} |
| 25860 |
return void 0; |
| 25861 |
} |
| 25862 |
function findIndex(array, predicate) { |
| 25863 |
for (let key2 = 0; key2 < array.length; key2++) { |
| 25864 |
if (predicate(array[key2])) { |
| 25865 |
return key2; |
| 25866 |
} |
| 25867 |
} |
| 25868 |
return void 0; |
| 25869 |
} |
| 25870 |
|
| 25871 |
// node_modules/date-fns/locale/_lib/buildMatchPatternFn.js |
| 25872 |
function buildMatchPatternFn(args) { |
| 25873 |
return (string, options = {}) => { |
| 25874 |
const matchResult = string.match(args.matchPattern); |
| 25875 |
if (!matchResult) return null; |
| 25876 |
const matchedString = matchResult[0]; |
| 25877 |
const parseResult = string.match(args.parsePattern); |
| 25878 |
if (!parseResult) return null; |
| 25879 |
let value = args.valueCallback ? args.valueCallback(parseResult[0]) : parseResult[0]; |
| 25880 |
value = options.valueCallback ? options.valueCallback(value) : value; |
| 25881 |
const rest = string.slice(matchedString.length); |
| 25882 |
return { value, rest }; |
| 25883 |
}; |
| 25884 |
} |
| 25885 |
|
| 25886 |
// node_modules/date-fns/locale/en-US/_lib/match.js |
| 25887 |
var matchOrdinalNumberPattern = /^(\d+)(th|st|nd|rd)?/i; |
| 25888 |
var parseOrdinalNumberPattern = /\d+/i; |
| 25889 |
var matchEraPatterns = { |
| 25890 |
narrow: /^(b|a)/i, |
| 25891 |
abbreviated: /^(b\.?\s?c\.?|b\.?\s?c\.?\s?e\.?|a\.?\s?d\.?|c\.?\s?e\.?)/i, |
| 25892 |
wide: /^(before christ|before common era|anno domini|common era)/i |
| 25893 |
}; |
| 25894 |
var parseEraPatterns = { |
| 25895 |
any: [/^b/i, /^(a|c)/i] |
| 25896 |
}; |
| 25897 |
var matchQuarterPatterns = { |
| 25898 |
narrow: /^[1234]/i, |
| 25899 |
abbreviated: /^q[1234]/i, |
| 25900 |
wide: /^[1234](th|st|nd|rd)? quarter/i |
| 25901 |
}; |
| 25902 |
var parseQuarterPatterns = { |
| 25903 |
any: [/1/i, /2/i, /3/i, /4/i] |
| 25904 |
}; |
| 25905 |
var matchMonthPatterns = { |
| 25906 |
narrow: /^[jfmasond]/i, |
| 25907 |
abbreviated: /^(jan|feb|mar|apr|may|jun|jul|aug|sep|oct|nov|dec)/i, |
| 25908 |
wide: /^(january|february|march|april|may|june|july|august|september|october|november|december)/i |
| 25909 |
}; |
| 25910 |
var parseMonthPatterns = { |
| 25911 |
narrow: [ |
| 25912 |
/^j/i, |
| 25913 |
/^f/i, |
| 25914 |
/^m/i, |
| 25915 |
/^a/i, |
| 25916 |
/^m/i, |
| 25917 |
/^j/i, |
| 25918 |
/^j/i, |
| 25919 |
/^a/i, |
| 25920 |
/^s/i, |
| 25921 |
/^o/i, |
| 25922 |
/^n/i, |
| 25923 |
/^d/i |
| 25924 |
], |
| 25925 |
any: [ |
| 25926 |
/^ja/i, |
| 25927 |
/^f/i, |
| 25928 |
/^mar/i, |
| 25929 |
/^ap/i, |
| 25930 |
/^may/i, |
| 25931 |
/^jun/i, |
| 25932 |
/^jul/i, |
| 25933 |
/^au/i, |
| 25934 |
/^s/i, |
| 25935 |
/^o/i, |
| 25936 |
/^n/i, |
| 25937 |
/^d/i |
| 25938 |
] |
| 25939 |
}; |
| 25940 |
var matchDayPatterns = { |
| 25941 |
narrow: /^[smtwf]/i, |
| 25942 |
short: /^(su|mo|tu|we|th|fr|sa)/i, |
| 25943 |
abbreviated: /^(sun|mon|tue|wed|thu|fri|sat)/i, |
| 25944 |
wide: /^(sunday|monday|tuesday|wednesday|thursday|friday|saturday)/i |
| 25945 |
}; |
| 25946 |
var parseDayPatterns = { |
| 25947 |
narrow: [/^s/i, /^m/i, /^t/i, /^w/i, /^t/i, /^f/i, /^s/i], |
| 25948 |
any: [/^su/i, /^m/i, /^tu/i, /^w/i, /^th/i, /^f/i, /^sa/i] |
| 25949 |
}; |
| 25950 |
var matchDayPeriodPatterns = { |
| 25951 |
narrow: /^(a|p|mi|n|(in the|at) (morning|afternoon|evening|night))/i, |
| 25952 |
any: /^([ap]\.?\s?m\.?|midnight|noon|(in the|at) (morning|afternoon|evening|night))/i |
| 25953 |
}; |
| 25954 |
var parseDayPeriodPatterns = { |
| 25955 |
any: { |
| 25956 |
am: /^a/i, |
| 25957 |
pm: /^p/i, |
| 25958 |
midnight: /^mi/i, |
| 25959 |
noon: /^no/i, |
| 25960 |
morning: /morning/i, |
| 25961 |
afternoon: /afternoon/i, |
| 25962 |
evening: /evening/i, |
| 25963 |
night: /night/i |
| 25964 |
} |
| 25965 |
}; |
| 25966 |
var match = { |
| 25967 |
ordinalNumber: buildMatchPatternFn({ |
| 25968 |
matchPattern: matchOrdinalNumberPattern, |
| 25969 |
parsePattern: parseOrdinalNumberPattern, |
| 25970 |
valueCallback: (value) => parseInt(value, 10) |
| 25971 |
}), |
| 25972 |
era: buildMatchFn({ |
| 25973 |
matchPatterns: matchEraPatterns, |
| 25974 |
defaultMatchWidth: "wide", |
| 25975 |
parsePatterns: parseEraPatterns, |
| 25976 |
defaultParseWidth: "any" |
| 25977 |
}), |
| 25978 |
quarter: buildMatchFn({ |
| 25979 |
matchPatterns: matchQuarterPatterns, |
| 25980 |
defaultMatchWidth: "wide", |
| 25981 |
parsePatterns: parseQuarterPatterns, |
| 25982 |
defaultParseWidth: "any", |
| 25983 |
valueCallback: (index2) => index2 + 1 |
| 25984 |
}), |
| 25985 |
month: buildMatchFn({ |
| 25986 |
matchPatterns: matchMonthPatterns, |
| 25987 |
defaultMatchWidth: "wide", |
| 25988 |
parsePatterns: parseMonthPatterns, |
| 25989 |
defaultParseWidth: "any" |
| 25990 |
}), |
| 25991 |
day: buildMatchFn({ |
| 25992 |
matchPatterns: matchDayPatterns, |
| 25993 |
defaultMatchWidth: "wide", |
| 25994 |
parsePatterns: parseDayPatterns, |
| 25995 |
defaultParseWidth: "any" |
| 25996 |
}), |
| 25997 |
dayPeriod: buildMatchFn({ |
| 25998 |
matchPatterns: matchDayPeriodPatterns, |
| 25999 |
defaultMatchWidth: "any", |
| 26000 |
parsePatterns: parseDayPeriodPatterns, |
| 26001 |
defaultParseWidth: "any" |
| 26002 |
}) |
| 26003 |
}; |
| 26004 |
|
| 26005 |
// node_modules/date-fns/locale/en-US.js |
| 26006 |
var enUS = { |
| 26007 |
code: "en-US", |
| 26008 |
formatDistance, |
| 26009 |
formatLong, |
| 26010 |
formatRelative, |
| 26011 |
localize, |
| 26012 |
match, |
| 26013 |
options: { |
| 26014 |
weekStartsOn: 0, |
| 26015 |
firstWeekContainsDate: 1 |
| 26016 |
} |
| 26017 |
}; |
| 26018 |
|
| 26019 |
// node_modules/date-fns/getDayOfYear.js |
| 26020 |
function getDayOfYear(date, options) { |
| 26021 |
const _date = toDate(date, options?.in); |
| 26022 |
const diff = differenceInCalendarDays(_date, startOfYear(_date)); |
| 26023 |
const dayOfYear = diff + 1; |
| 26024 |
return dayOfYear; |
| 26025 |
} |
| 26026 |
|
| 26027 |
// node_modules/date-fns/getISOWeek.js |
| 26028 |
function getISOWeek(date, options) { |
| 26029 |
const _date = toDate(date, options?.in); |
| 26030 |
const diff = +startOfISOWeek(_date) - +startOfISOWeekYear(_date); |
| 26031 |
return Math.round(diff / millisecondsInWeek) + 1; |
| 26032 |
} |
| 26033 |
|
| 26034 |
// node_modules/date-fns/getWeekYear.js |
| 26035 |
function getWeekYear(date, options) { |
| 26036 |
const _date = toDate(date, options?.in); |
| 26037 |
const year = _date.getFullYear(); |
| 26038 |
const defaultOptions3 = getDefaultOptions(); |
| 26039 |
const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions3.firstWeekContainsDate ?? defaultOptions3.locale?.options?.firstWeekContainsDate ?? 1; |
| 26040 |
const firstWeekOfNextYear = constructFrom(options?.in || date, 0); |
| 26041 |
firstWeekOfNextYear.setFullYear(year + 1, 0, firstWeekContainsDate); |
| 26042 |
firstWeekOfNextYear.setHours(0, 0, 0, 0); |
| 26043 |
const startOfNextYear = startOfWeek(firstWeekOfNextYear, options); |
| 26044 |
const firstWeekOfThisYear = constructFrom(options?.in || date, 0); |
| 26045 |
firstWeekOfThisYear.setFullYear(year, 0, firstWeekContainsDate); |
| 26046 |
firstWeekOfThisYear.setHours(0, 0, 0, 0); |
| 26047 |
const startOfThisYear = startOfWeek(firstWeekOfThisYear, options); |
| 26048 |
if (+_date >= +startOfNextYear) { |
| 26049 |
return year + 1; |
| 26050 |
} else if (+_date >= +startOfThisYear) { |
| 26051 |
return year; |
| 26052 |
} else { |
| 26053 |
return year - 1; |
| 26054 |
} |
| 26055 |
} |
| 26056 |
|
| 26057 |
// node_modules/date-fns/startOfWeekYear.js |
| 26058 |
function startOfWeekYear(date, options) { |
| 26059 |
const defaultOptions3 = getDefaultOptions(); |
| 26060 |
const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions3.firstWeekContainsDate ?? defaultOptions3.locale?.options?.firstWeekContainsDate ?? 1; |
| 26061 |
const year = getWeekYear(date, options); |
| 26062 |
const firstWeek = constructFrom(options?.in || date, 0); |
| 26063 |
firstWeek.setFullYear(year, 0, firstWeekContainsDate); |
| 26064 |
firstWeek.setHours(0, 0, 0, 0); |
| 26065 |
const _date = startOfWeek(firstWeek, options); |
| 26066 |
return _date; |
| 26067 |
} |
| 26068 |
|
| 26069 |
// node_modules/date-fns/getWeek.js |
| 26070 |
function getWeek(date, options) { |
| 26071 |
const _date = toDate(date, options?.in); |
| 26072 |
const diff = +startOfWeek(_date, options) - +startOfWeekYear(_date, options); |
| 26073 |
return Math.round(diff / millisecondsInWeek) + 1; |
| 26074 |
} |
| 26075 |
|
| 26076 |
// node_modules/date-fns/_lib/addLeadingZeros.js |
| 26077 |
function addLeadingZeros(number, targetLength) { |
| 26078 |
const sign = number < 0 ? "-" : ""; |
| 26079 |
const output = Math.abs(number).toString().padStart(targetLength, "0"); |
| 26080 |
return sign + output; |
| 26081 |
} |
| 26082 |
|
| 26083 |
// node_modules/date-fns/_lib/format/lightFormatters.js |
| 26084 |
var lightFormatters = { |
| 26085 |
// Year |
| 26086 |
y(date, token) { |
| 26087 |
const signedYear = date.getFullYear(); |
| 26088 |
const year = signedYear > 0 ? signedYear : 1 - signedYear; |
| 26089 |
return addLeadingZeros(token === "yy" ? year % 100 : year, token.length); |
| 26090 |
}, |
| 26091 |
// Month |
| 26092 |
M(date, token) { |
| 26093 |
const month = date.getMonth(); |
| 26094 |
return token === "M" ? String(month + 1) : addLeadingZeros(month + 1, 2); |
| 26095 |
}, |
| 26096 |
// Day of the month |
| 26097 |
d(date, token) { |
| 26098 |
return addLeadingZeros(date.getDate(), token.length); |
| 26099 |
}, |
| 26100 |
// AM or PM |
| 26101 |
a(date, token) { |
| 26102 |
const dayPeriodEnumValue = date.getHours() / 12 >= 1 ? "pm" : "am"; |
| 26103 |
switch (token) { |
| 26104 |
case "a": |
| 26105 |
case "aa": |
| 26106 |
return dayPeriodEnumValue.toUpperCase(); |
| 26107 |
case "aaa": |
| 26108 |
return dayPeriodEnumValue; |
| 26109 |
case "aaaaa": |
| 26110 |
return dayPeriodEnumValue[0]; |
| 26111 |
case "aaaa": |
| 26112 |
default: |
| 26113 |
return dayPeriodEnumValue === "am" ? "a.m." : "p.m."; |
| 26114 |
} |
| 26115 |
}, |
| 26116 |
// Hour [1-12] |
| 26117 |
h(date, token) { |
| 26118 |
return addLeadingZeros(date.getHours() % 12 || 12, token.length); |
| 26119 |
}, |
| 26120 |
// Hour [0-23] |
| 26121 |
H(date, token) { |
| 26122 |
return addLeadingZeros(date.getHours(), token.length); |
| 26123 |
}, |
| 26124 |
// Minute |
| 26125 |
m(date, token) { |
| 26126 |
return addLeadingZeros(date.getMinutes(), token.length); |
| 26127 |
}, |
| 26128 |
// Second |
| 26129 |
s(date, token) { |
| 26130 |
return addLeadingZeros(date.getSeconds(), token.length); |
| 26131 |
}, |
| 26132 |
// Fraction of second |
| 26133 |
S(date, token) { |
| 26134 |
const numberOfDigits = token.length; |
| 26135 |
const milliseconds = date.getMilliseconds(); |
| 26136 |
const fractionalSeconds = Math.trunc( |
| 26137 |
milliseconds * Math.pow(10, numberOfDigits - 3) |
| 26138 |
); |
| 26139 |
return addLeadingZeros(fractionalSeconds, token.length); |
| 26140 |
} |
| 26141 |
}; |
| 26142 |
|
| 26143 |
// node_modules/date-fns/_lib/format/formatters.js |
| 26144 |
var dayPeriodEnum = { |
| 26145 |
am: "am", |
| 26146 |
pm: "pm", |
| 26147 |
midnight: "midnight", |
| 26148 |
noon: "noon", |
| 26149 |
morning: "morning", |
| 26150 |
afternoon: "afternoon", |
| 26151 |
evening: "evening", |
| 26152 |
night: "night" |
| 26153 |
}; |
| 26154 |
var formatters = { |
| 26155 |
// Era |
| 26156 |
G: function(date, token, localize2) { |
| 26157 |
const era = date.getFullYear() > 0 ? 1 : 0; |
| 26158 |
switch (token) { |
| 26159 |
// AD, BC |
| 26160 |
case "G": |
| 26161 |
case "GG": |
| 26162 |
case "GGG": |
| 26163 |
return localize2.era(era, { width: "abbreviated" }); |
| 26164 |
// A, B |
| 26165 |
case "GGGGG": |
| 26166 |
return localize2.era(era, { width: "narrow" }); |
| 26167 |
// Anno Domini, Before Christ |
| 26168 |
case "GGGG": |
| 26169 |
default: |
| 26170 |
return localize2.era(era, { width: "wide" }); |
| 26171 |
} |
| 26172 |
}, |
| 26173 |
// Year |
| 26174 |
y: function(date, token, localize2) { |
| 26175 |
if (token === "yo") { |
| 26176 |
const signedYear = date.getFullYear(); |
| 26177 |
const year = signedYear > 0 ? signedYear : 1 - signedYear; |
| 26178 |
return localize2.ordinalNumber(year, { unit: "year" }); |
| 26179 |
} |
| 26180 |
return lightFormatters.y(date, token); |
| 26181 |
}, |
| 26182 |
// Local week-numbering year |
| 26183 |
Y: function(date, token, localize2, options) { |
| 26184 |
const signedWeekYear = getWeekYear(date, options); |
| 26185 |
const weekYear = signedWeekYear > 0 ? signedWeekYear : 1 - signedWeekYear; |
| 26186 |
if (token === "YY") { |
| 26187 |
const twoDigitYear = weekYear % 100; |
| 26188 |
return addLeadingZeros(twoDigitYear, 2); |
| 26189 |
} |
| 26190 |
if (token === "Yo") { |
| 26191 |
return localize2.ordinalNumber(weekYear, { unit: "year" }); |
| 26192 |
} |
| 26193 |
return addLeadingZeros(weekYear, token.length); |
| 26194 |
}, |
| 26195 |
// ISO week-numbering year |
| 26196 |
R: function(date, token) { |
| 26197 |
const isoWeekYear = getISOWeekYear(date); |
| 26198 |
return addLeadingZeros(isoWeekYear, token.length); |
| 26199 |
}, |
| 26200 |
// Extended year. This is a single number designating the year of this calendar system. |
| 26201 |
// The main difference between `y` and `u` localizers are B.C. years: |
| 26202 |
// | Year | `y` | `u` | |
| 26203 |
// |------|-----|-----| |
| 26204 |
// | AC 1 | 1 | 1 | |
| 26205 |
// | BC 1 | 1 | 0 | |
| 26206 |
// | BC 2 | 2 | -1 | |
| 26207 |
// Also `yy` always returns the last two digits of a year, |
| 26208 |
// while `uu` pads single digit years to 2 characters and returns other years unchanged. |
| 26209 |
u: function(date, token) { |
| 26210 |
const year = date.getFullYear(); |
| 26211 |
return addLeadingZeros(year, token.length); |
| 26212 |
}, |
| 26213 |
// Quarter |
| 26214 |
Q: function(date, token, localize2) { |
| 26215 |
const quarter = Math.ceil((date.getMonth() + 1) / 3); |
| 26216 |
switch (token) { |
| 26217 |
// 1, 2, 3, 4 |
| 26218 |
case "Q": |
| 26219 |
return String(quarter); |
| 26220 |
// 01, 02, 03, 04 |
| 26221 |
case "QQ": |
| 26222 |
return addLeadingZeros(quarter, 2); |
| 26223 |
// 1st, 2nd, 3rd, 4th |
| 26224 |
case "Qo": |
| 26225 |
return localize2.ordinalNumber(quarter, { unit: "quarter" }); |
| 26226 |
// Q1, Q2, Q3, Q4 |
| 26227 |
case "QQQ": |
| 26228 |
return localize2.quarter(quarter, { |
| 26229 |
width: "abbreviated", |
| 26230 |
context: "formatting" |
| 26231 |
}); |
| 26232 |
// 1, 2, 3, 4 (narrow quarter; could be not numerical) |
| 26233 |
case "QQQQQ": |
| 26234 |
return localize2.quarter(quarter, { |
| 26235 |
width: "narrow", |
| 26236 |
context: "formatting" |
| 26237 |
}); |
| 26238 |
// 1st quarter, 2nd quarter, ... |
| 26239 |
case "QQQQ": |
| 26240 |
default: |
| 26241 |
return localize2.quarter(quarter, { |
| 26242 |
width: "wide", |
| 26243 |
context: "formatting" |
| 26244 |
}); |
| 26245 |
} |
| 26246 |
}, |
| 26247 |
// Stand-alone quarter |
| 26248 |
q: function(date, token, localize2) { |
| 26249 |
const quarter = Math.ceil((date.getMonth() + 1) / 3); |
| 26250 |
switch (token) { |
| 26251 |
// 1, 2, 3, 4 |
| 26252 |
case "q": |
| 26253 |
return String(quarter); |
| 26254 |
// 01, 02, 03, 04 |
| 26255 |
case "qq": |
| 26256 |
return addLeadingZeros(quarter, 2); |
| 26257 |
// 1st, 2nd, 3rd, 4th |
| 26258 |
case "qo": |
| 26259 |
return localize2.ordinalNumber(quarter, { unit: "quarter" }); |
| 26260 |
// Q1, Q2, Q3, Q4 |
| 26261 |
case "qqq": |
| 26262 |
return localize2.quarter(quarter, { |
| 26263 |
width: "abbreviated", |
| 26264 |
context: "standalone" |
| 26265 |
}); |
| 26266 |
// 1, 2, 3, 4 (narrow quarter; could be not numerical) |
| 26267 |
case "qqqqq": |
| 26268 |
return localize2.quarter(quarter, { |
| 26269 |
width: "narrow", |
| 26270 |
context: "standalone" |
| 26271 |
}); |
| 26272 |
// 1st quarter, 2nd quarter, ... |
| 26273 |
case "qqqq": |
| 26274 |
default: |
| 26275 |
return localize2.quarter(quarter, { |
| 26276 |
width: "wide", |
| 26277 |
context: "standalone" |
| 26278 |
}); |
| 26279 |
} |
| 26280 |
}, |
| 26281 |
// Month |
| 26282 |
M: function(date, token, localize2) { |
| 26283 |
const month = date.getMonth(); |
| 26284 |
switch (token) { |
| 26285 |
case "M": |
| 26286 |
case "MM": |
| 26287 |
return lightFormatters.M(date, token); |
| 26288 |
// 1st, 2nd, ..., 12th |
| 26289 |
case "Mo": |
| 26290 |
return localize2.ordinalNumber(month + 1, { unit: "month" }); |
| 26291 |
// Jan, Feb, ..., Dec |
| 26292 |
case "MMM": |
| 26293 |
return localize2.month(month, { |
| 26294 |
width: "abbreviated", |
| 26295 |
context: "formatting" |
| 26296 |
}); |
| 26297 |
// J, F, ..., D |
| 26298 |
case "MMMMM": |
| 26299 |
return localize2.month(month, { |
| 26300 |
width: "narrow", |
| 26301 |
context: "formatting" |
| 26302 |
}); |
| 26303 |
// January, February, ..., December |
| 26304 |
case "MMMM": |
| 26305 |
default: |
| 26306 |
return localize2.month(month, { width: "wide", context: "formatting" }); |
| 26307 |
} |
| 26308 |
}, |
| 26309 |
// Stand-alone month |
| 26310 |
L: function(date, token, localize2) { |
| 26311 |
const month = date.getMonth(); |
| 26312 |
switch (token) { |
| 26313 |
// 1, 2, ..., 12 |
| 26314 |
case "L": |
| 26315 |
return String(month + 1); |
| 26316 |
// 01, 02, ..., 12 |
| 26317 |
case "LL": |
| 26318 |
return addLeadingZeros(month + 1, 2); |
| 26319 |
// 1st, 2nd, ..., 12th |
| 26320 |
case "Lo": |
| 26321 |
return localize2.ordinalNumber(month + 1, { unit: "month" }); |
| 26322 |
// Jan, Feb, ..., Dec |
| 26323 |
case "LLL": |
| 26324 |
return localize2.month(month, { |
| 26325 |
width: "abbreviated", |
| 26326 |
context: "standalone" |
| 26327 |
}); |
| 26328 |
// J, F, ..., D |
| 26329 |
case "LLLLL": |
| 26330 |
return localize2.month(month, { |
| 26331 |
width: "narrow", |
| 26332 |
context: "standalone" |
| 26333 |
}); |
| 26334 |
// January, February, ..., December |
| 26335 |
case "LLLL": |
| 26336 |
default: |
| 26337 |
return localize2.month(month, { width: "wide", context: "standalone" }); |
| 26338 |
} |
| 26339 |
}, |
| 26340 |
// Local week of year |
| 26341 |
w: function(date, token, localize2, options) { |
| 26342 |
const week = getWeek(date, options); |
| 26343 |
if (token === "wo") { |
| 26344 |
return localize2.ordinalNumber(week, { unit: "week" }); |
| 26345 |
} |
| 26346 |
return addLeadingZeros(week, token.length); |
| 26347 |
}, |
| 26348 |
// ISO week of year |
| 26349 |
I: function(date, token, localize2) { |
| 26350 |
const isoWeek = getISOWeek(date); |
| 26351 |
if (token === "Io") { |
| 26352 |
return localize2.ordinalNumber(isoWeek, { unit: "week" }); |
| 26353 |
} |
| 26354 |
return addLeadingZeros(isoWeek, token.length); |
| 26355 |
}, |
| 26356 |
// Day of the month |
| 26357 |
d: function(date, token, localize2) { |
| 26358 |
if (token === "do") { |
| 26359 |
return localize2.ordinalNumber(date.getDate(), { unit: "date" }); |
| 26360 |
} |
| 26361 |
return lightFormatters.d(date, token); |
| 26362 |
}, |
| 26363 |
// Day of year |
| 26364 |
D: function(date, token, localize2) { |
| 26365 |
const dayOfYear = getDayOfYear(date); |
| 26366 |
if (token === "Do") { |
| 26367 |
return localize2.ordinalNumber(dayOfYear, { unit: "dayOfYear" }); |
| 26368 |
} |
| 26369 |
return addLeadingZeros(dayOfYear, token.length); |
| 26370 |
}, |
| 26371 |
// Day of week |
| 26372 |
E: function(date, token, localize2) { |
| 26373 |
const dayOfWeek = date.getDay(); |
| 26374 |
switch (token) { |
| 26375 |
// Tue |
| 26376 |
case "E": |
| 26377 |
case "EE": |
| 26378 |
case "EEE": |
| 26379 |
return localize2.day(dayOfWeek, { |
| 26380 |
width: "abbreviated", |
| 26381 |
context: "formatting" |
| 26382 |
}); |
| 26383 |
// T |
| 26384 |
case "EEEEE": |
| 26385 |
return localize2.day(dayOfWeek, { |
| 26386 |
width: "narrow", |
| 26387 |
context: "formatting" |
| 26388 |
}); |
| 26389 |
// Tu |
| 26390 |
case "EEEEEE": |
| 26391 |
return localize2.day(dayOfWeek, { |
| 26392 |
width: "short", |
| 26393 |
context: "formatting" |
| 26394 |
}); |
| 26395 |
// Tuesday |
| 26396 |
case "EEEE": |
| 26397 |
default: |
| 26398 |
return localize2.day(dayOfWeek, { |
| 26399 |
width: "wide", |
| 26400 |
context: "formatting" |
| 26401 |
}); |
| 26402 |
} |
| 26403 |
}, |
| 26404 |
// Local day of week |
| 26405 |
e: function(date, token, localize2, options) { |
| 26406 |
const dayOfWeek = date.getDay(); |
| 26407 |
const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7; |
| 26408 |
switch (token) { |
| 26409 |
// Numerical value (Nth day of week with current locale or weekStartsOn) |
| 26410 |
case "e": |
| 26411 |
return String(localDayOfWeek); |
| 26412 |
// Padded numerical value |
| 26413 |
case "ee": |
| 26414 |
return addLeadingZeros(localDayOfWeek, 2); |
| 26415 |
// 1st, 2nd, ..., 7th |
| 26416 |
case "eo": |
| 26417 |
return localize2.ordinalNumber(localDayOfWeek, { unit: "day" }); |
| 26418 |
case "eee": |
| 26419 |
return localize2.day(dayOfWeek, { |
| 26420 |
width: "abbreviated", |
| 26421 |
context: "formatting" |
| 26422 |
}); |
| 26423 |
// T |
| 26424 |
case "eeeee": |
| 26425 |
return localize2.day(dayOfWeek, { |
| 26426 |
width: "narrow", |
| 26427 |
context: "formatting" |
| 26428 |
}); |
| 26429 |
// Tu |
| 26430 |
case "eeeeee": |
| 26431 |
return localize2.day(dayOfWeek, { |
| 26432 |
width: "short", |
| 26433 |
context: "formatting" |
| 26434 |
}); |
| 26435 |
// Tuesday |
| 26436 |
case "eeee": |
| 26437 |
default: |
| 26438 |
return localize2.day(dayOfWeek, { |
| 26439 |
width: "wide", |
| 26440 |
context: "formatting" |
| 26441 |
}); |
| 26442 |
} |
| 26443 |
}, |
| 26444 |
// Stand-alone local day of week |
| 26445 |
c: function(date, token, localize2, options) { |
| 26446 |
const dayOfWeek = date.getDay(); |
| 26447 |
const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7; |
| 26448 |
switch (token) { |
| 26449 |
// Numerical value (same as in `e`) |
| 26450 |
case "c": |
| 26451 |
return String(localDayOfWeek); |
| 26452 |
// Padded numerical value |
| 26453 |
case "cc": |
| 26454 |
return addLeadingZeros(localDayOfWeek, token.length); |
| 26455 |
// 1st, 2nd, ..., 7th |
| 26456 |
case "co": |
| 26457 |
return localize2.ordinalNumber(localDayOfWeek, { unit: "day" }); |
| 26458 |
case "ccc": |
| 26459 |
return localize2.day(dayOfWeek, { |
| 26460 |
width: "abbreviated", |
| 26461 |
context: "standalone" |
| 26462 |
}); |
| 26463 |
// T |
| 26464 |
case "ccccc": |
| 26465 |
return localize2.day(dayOfWeek, { |
| 26466 |
width: "narrow", |
| 26467 |
context: "standalone" |
| 26468 |
}); |
| 26469 |
// Tu |
| 26470 |
case "cccccc": |
| 26471 |
return localize2.day(dayOfWeek, { |
| 26472 |
width: "short", |
| 26473 |
context: "standalone" |
| 26474 |
}); |
| 26475 |
// Tuesday |
| 26476 |
case "cccc": |
| 26477 |
default: |
| 26478 |
return localize2.day(dayOfWeek, { |
| 26479 |
width: "wide", |
| 26480 |
context: "standalone" |
| 26481 |
}); |
| 26482 |
} |
| 26483 |
}, |
| 26484 |
// ISO day of week |
| 26485 |
i: function(date, token, localize2) { |
| 26486 |
const dayOfWeek = date.getDay(); |
| 26487 |
const isoDayOfWeek = dayOfWeek === 0 ? 7 : dayOfWeek; |
| 26488 |
switch (token) { |
| 26489 |
// 2 |
| 26490 |
case "i": |
| 26491 |
return String(isoDayOfWeek); |
| 26492 |
// 02 |
| 26493 |
case "ii": |
| 26494 |
return addLeadingZeros(isoDayOfWeek, token.length); |
| 26495 |
// 2nd |
| 26496 |
case "io": |
| 26497 |
return localize2.ordinalNumber(isoDayOfWeek, { unit: "day" }); |
| 26498 |
// Tue |
| 26499 |
case "iii": |
| 26500 |
return localize2.day(dayOfWeek, { |
| 26501 |
width: "abbreviated", |
| 26502 |
context: "formatting" |
| 26503 |
}); |
| 26504 |
// T |
| 26505 |
case "iiiii": |
| 26506 |
return localize2.day(dayOfWeek, { |
| 26507 |
width: "narrow", |
| 26508 |
context: "formatting" |
| 26509 |
}); |
| 26510 |
// Tu |
| 26511 |
case "iiiiii": |
| 26512 |
return localize2.day(dayOfWeek, { |
| 26513 |
width: "short", |
| 26514 |
context: "formatting" |
| 26515 |
}); |
| 26516 |
// Tuesday |
| 26517 |
case "iiii": |
| 26518 |
default: |
| 26519 |
return localize2.day(dayOfWeek, { |
| 26520 |
width: "wide", |
| 26521 |
context: "formatting" |
| 26522 |
}); |
| 26523 |
} |
| 26524 |
}, |
| 26525 |
// AM or PM |
| 26526 |
a: function(date, token, localize2) { |
| 26527 |
const hours = date.getHours(); |
| 26528 |
const dayPeriodEnumValue = hours / 12 >= 1 ? "pm" : "am"; |
| 26529 |
switch (token) { |
| 26530 |
case "a": |
| 26531 |
case "aa": |
| 26532 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26533 |
width: "abbreviated", |
| 26534 |
context: "formatting" |
| 26535 |
}); |
| 26536 |
case "aaa": |
| 26537 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26538 |
width: "abbreviated", |
| 26539 |
context: "formatting" |
| 26540 |
}).toLowerCase(); |
| 26541 |
case "aaaaa": |
| 26542 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26543 |
width: "narrow", |
| 26544 |
context: "formatting" |
| 26545 |
}); |
| 26546 |
case "aaaa": |
| 26547 |
default: |
| 26548 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26549 |
width: "wide", |
| 26550 |
context: "formatting" |
| 26551 |
}); |
| 26552 |
} |
| 26553 |
}, |
| 26554 |
// AM, PM, midnight, noon |
| 26555 |
b: function(date, token, localize2) { |
| 26556 |
const hours = date.getHours(); |
| 26557 |
let dayPeriodEnumValue; |
| 26558 |
if (hours === 12) { |
| 26559 |
dayPeriodEnumValue = dayPeriodEnum.noon; |
| 26560 |
} else if (hours === 0) { |
| 26561 |
dayPeriodEnumValue = dayPeriodEnum.midnight; |
| 26562 |
} else { |
| 26563 |
dayPeriodEnumValue = hours / 12 >= 1 ? "pm" : "am"; |
| 26564 |
} |
| 26565 |
switch (token) { |
| 26566 |
case "b": |
| 26567 |
case "bb": |
| 26568 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26569 |
width: "abbreviated", |
| 26570 |
context: "formatting" |
| 26571 |
}); |
| 26572 |
case "bbb": |
| 26573 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26574 |
width: "abbreviated", |
| 26575 |
context: "formatting" |
| 26576 |
}).toLowerCase(); |
| 26577 |
case "bbbbb": |
| 26578 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26579 |
width: "narrow", |
| 26580 |
context: "formatting" |
| 26581 |
}); |
| 26582 |
case "bbbb": |
| 26583 |
default: |
| 26584 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26585 |
width: "wide", |
| 26586 |
context: "formatting" |
| 26587 |
}); |
| 26588 |
} |
| 26589 |
}, |
| 26590 |
// in the morning, in the afternoon, in the evening, at night |
| 26591 |
B: function(date, token, localize2) { |
| 26592 |
const hours = date.getHours(); |
| 26593 |
let dayPeriodEnumValue; |
| 26594 |
if (hours >= 17) { |
| 26595 |
dayPeriodEnumValue = dayPeriodEnum.evening; |
| 26596 |
} else if (hours >= 12) { |
| 26597 |
dayPeriodEnumValue = dayPeriodEnum.afternoon; |
| 26598 |
} else if (hours >= 4) { |
| 26599 |
dayPeriodEnumValue = dayPeriodEnum.morning; |
| 26600 |
} else { |
| 26601 |
dayPeriodEnumValue = dayPeriodEnum.night; |
| 26602 |
} |
| 26603 |
switch (token) { |
| 26604 |
case "B": |
| 26605 |
case "BB": |
| 26606 |
case "BBB": |
| 26607 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26608 |
width: "abbreviated", |
| 26609 |
context: "formatting" |
| 26610 |
}); |
| 26611 |
case "BBBBB": |
| 26612 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26613 |
width: "narrow", |
| 26614 |
context: "formatting" |
| 26615 |
}); |
| 26616 |
case "BBBB": |
| 26617 |
default: |
| 26618 |
return localize2.dayPeriod(dayPeriodEnumValue, { |
| 26619 |
width: "wide", |
| 26620 |
context: "formatting" |
| 26621 |
}); |
| 26622 |
} |
| 26623 |
}, |
| 26624 |
// Hour [1-12] |
| 26625 |
h: function(date, token, localize2) { |
| 26626 |
if (token === "ho") { |
| 26627 |
let hours = date.getHours() % 12; |
| 26628 |
if (hours === 0) hours = 12; |
| 26629 |
return localize2.ordinalNumber(hours, { unit: "hour" }); |
| 26630 |
} |
| 26631 |
return lightFormatters.h(date, token); |
| 26632 |
}, |
| 26633 |
// Hour [0-23] |
| 26634 |
H: function(date, token, localize2) { |
| 26635 |
if (token === "Ho") { |
| 26636 |
return localize2.ordinalNumber(date.getHours(), { unit: "hour" }); |
| 26637 |
} |
| 26638 |
return lightFormatters.H(date, token); |
| 26639 |
}, |
| 26640 |
// Hour [0-11] |
| 26641 |
K: function(date, token, localize2) { |
| 26642 |
const hours = date.getHours() % 12; |
| 26643 |
if (token === "Ko") { |
| 26644 |
return localize2.ordinalNumber(hours, { unit: "hour" }); |
| 26645 |
} |
| 26646 |
return addLeadingZeros(hours, token.length); |
| 26647 |
}, |
| 26648 |
// Hour [1-24] |
| 26649 |
k: function(date, token, localize2) { |
| 26650 |
let hours = date.getHours(); |
| 26651 |
if (hours === 0) hours = 24; |
| 26652 |
if (token === "ko") { |
| 26653 |
return localize2.ordinalNumber(hours, { unit: "hour" }); |
| 26654 |
} |
| 26655 |
return addLeadingZeros(hours, token.length); |
| 26656 |
}, |
| 26657 |
// Minute |
| 26658 |
m: function(date, token, localize2) { |
| 26659 |
if (token === "mo") { |
| 26660 |
return localize2.ordinalNumber(date.getMinutes(), { unit: "minute" }); |
| 26661 |
} |
| 26662 |
return lightFormatters.m(date, token); |
| 26663 |
}, |
| 26664 |
// Second |
| 26665 |
s: function(date, token, localize2) { |
| 26666 |
if (token === "so") { |
| 26667 |
return localize2.ordinalNumber(date.getSeconds(), { unit: "second" }); |
| 26668 |
} |
| 26669 |
return lightFormatters.s(date, token); |
| 26670 |
}, |
| 26671 |
// Fraction of second |
| 26672 |
S: function(date, token) { |
| 26673 |
return lightFormatters.S(date, token); |
| 26674 |
}, |
| 26675 |
// Timezone (ISO-8601. If offset is 0, output is always `'Z'`) |
| 26676 |
X: function(date, token, _localize) { |
| 26677 |
const timezoneOffset = date.getTimezoneOffset(); |
| 26678 |
if (timezoneOffset === 0) { |
| 26679 |
return "Z"; |
| 26680 |
} |
| 26681 |
switch (token) { |
| 26682 |
// Hours and optional minutes |
| 26683 |
case "X": |
| 26684 |
return formatTimezoneWithOptionalMinutes(timezoneOffset); |
| 26685 |
// Hours, minutes and optional seconds without `:` delimiter |
| 26686 |
// Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets |
| 26687 |
// so this token always has the same output as `XX` |
| 26688 |
case "XXXX": |
| 26689 |
case "XX": |
| 26690 |
return formatTimezone(timezoneOffset); |
| 26691 |
// Hours, minutes and optional seconds with `:` delimiter |
| 26692 |
// Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets |
| 26693 |
// so this token always has the same output as `XXX` |
| 26694 |
case "XXXXX": |
| 26695 |
case "XXX": |
| 26696 |
// Hours and minutes with `:` delimiter |
| 26697 |
default: |
| 26698 |
return formatTimezone(timezoneOffset, ":"); |
| 26699 |
} |
| 26700 |
}, |
| 26701 |
// Timezone (ISO-8601. If offset is 0, output is `'+00:00'` or equivalent) |
| 26702 |
x: function(date, token, _localize) { |
| 26703 |
const timezoneOffset = date.getTimezoneOffset(); |
| 26704 |
switch (token) { |
| 26705 |
// Hours and optional minutes |
| 26706 |
case "x": |
| 26707 |
return formatTimezoneWithOptionalMinutes(timezoneOffset); |
| 26708 |
// Hours, minutes and optional seconds without `:` delimiter |
| 26709 |
// Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets |
| 26710 |
// so this token always has the same output as `xx` |
| 26711 |
case "xxxx": |
| 26712 |
case "xx": |
| 26713 |
return formatTimezone(timezoneOffset); |
| 26714 |
// Hours, minutes and optional seconds with `:` delimiter |
| 26715 |
// Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets |
| 26716 |
// so this token always has the same output as `xxx` |
| 26717 |
case "xxxxx": |
| 26718 |
case "xxx": |
| 26719 |
// Hours and minutes with `:` delimiter |
| 26720 |
default: |
| 26721 |
return formatTimezone(timezoneOffset, ":"); |
| 26722 |
} |
| 26723 |
}, |
| 26724 |
// Timezone (GMT) |
| 26725 |
O: function(date, token, _localize) { |
| 26726 |
const timezoneOffset = date.getTimezoneOffset(); |
| 26727 |
switch (token) { |
| 26728 |
// Short |
| 26729 |
case "O": |
| 26730 |
case "OO": |
| 26731 |
case "OOO": |
| 26732 |
return "GMT" + formatTimezoneShort(timezoneOffset, ":"); |
| 26733 |
// Long |
| 26734 |
case "OOOO": |
| 26735 |
default: |
| 26736 |
return "GMT" + formatTimezone(timezoneOffset, ":"); |
| 26737 |
} |
| 26738 |
}, |
| 26739 |
// Timezone (specific non-location) |
| 26740 |
z: function(date, token, _localize) { |
| 26741 |
const timezoneOffset = date.getTimezoneOffset(); |
| 26742 |
switch (token) { |
| 26743 |
// Short |
| 26744 |
case "z": |
| 26745 |
case "zz": |
| 26746 |
case "zzz": |
| 26747 |
return "GMT" + formatTimezoneShort(timezoneOffset, ":"); |
| 26748 |
// Long |
| 26749 |
case "zzzz": |
| 26750 |
default: |
| 26751 |
return "GMT" + formatTimezone(timezoneOffset, ":"); |
| 26752 |
} |
| 26753 |
}, |
| 26754 |
// Seconds timestamp |
| 26755 |
t: function(date, token, _localize) { |
| 26756 |
const timestamp = Math.trunc(+date / 1e3); |
| 26757 |
return addLeadingZeros(timestamp, token.length); |
| 26758 |
}, |
| 26759 |
// Milliseconds timestamp |
| 26760 |
T: function(date, token, _localize) { |
| 26761 |
return addLeadingZeros(+date, token.length); |
| 26762 |
} |
| 26763 |
}; |
| 26764 |
function formatTimezoneShort(offset4, delimiter = "") { |
| 26765 |
const sign = offset4 > 0 ? "-" : "+"; |
| 26766 |
const absOffset = Math.abs(offset4); |
| 26767 |
const hours = Math.trunc(absOffset / 60); |
| 26768 |
const minutes = absOffset % 60; |
| 26769 |
if (minutes === 0) { |
| 26770 |
return sign + String(hours); |
| 26771 |
} |
| 26772 |
return sign + String(hours) + delimiter + addLeadingZeros(minutes, 2); |
| 26773 |
} |
| 26774 |
function formatTimezoneWithOptionalMinutes(offset4, delimiter) { |
| 26775 |
if (offset4 % 60 === 0) { |
| 26776 |
const sign = offset4 > 0 ? "-" : "+"; |
| 26777 |
return sign + addLeadingZeros(Math.abs(offset4) / 60, 2); |
| 26778 |
} |
| 26779 |
return formatTimezone(offset4, delimiter); |
| 26780 |
} |
| 26781 |
function formatTimezone(offset4, delimiter = "") { |
| 26782 |
const sign = offset4 > 0 ? "-" : "+"; |
| 26783 |
const absOffset = Math.abs(offset4); |
| 26784 |
const hours = addLeadingZeros(Math.trunc(absOffset / 60), 2); |
| 26785 |
const minutes = addLeadingZeros(absOffset % 60, 2); |
| 26786 |
return sign + hours + delimiter + minutes; |
| 26787 |
} |
| 26788 |
|
| 26789 |
// node_modules/date-fns/_lib/format/longFormatters.js |
| 26790 |
var dateLongFormatter = (pattern, formatLong2) => { |
| 26791 |
switch (pattern) { |
| 26792 |
case "P": |
| 26793 |
return formatLong2.date({ width: "short" }); |
| 26794 |
case "PP": |
| 26795 |
return formatLong2.date({ width: "medium" }); |
| 26796 |
case "PPP": |
| 26797 |
return formatLong2.date({ width: "long" }); |
| 26798 |
case "PPPP": |
| 26799 |
default: |
| 26800 |
return formatLong2.date({ width: "full" }); |
| 26801 |
} |
| 26802 |
}; |
| 26803 |
var timeLongFormatter = (pattern, formatLong2) => { |
| 26804 |
switch (pattern) { |
| 26805 |
case "p": |
| 26806 |
return formatLong2.time({ width: "short" }); |
| 26807 |
case "pp": |
| 26808 |
return formatLong2.time({ width: "medium" }); |
| 26809 |
case "ppp": |
| 26810 |
return formatLong2.time({ width: "long" }); |
| 26811 |
case "pppp": |
| 26812 |
default: |
| 26813 |
return formatLong2.time({ width: "full" }); |
| 26814 |
} |
| 26815 |
}; |
| 26816 |
var dateTimeLongFormatter = (pattern, formatLong2) => { |
| 26817 |
const matchResult = pattern.match(/(P+)(p+)?/) || []; |
| 26818 |
const datePattern = matchResult[1]; |
| 26819 |
const timePattern = matchResult[2]; |
| 26820 |
if (!timePattern) { |
| 26821 |
return dateLongFormatter(pattern, formatLong2); |
| 26822 |
} |
| 26823 |
let dateTimeFormat; |
| 26824 |
switch (datePattern) { |
| 26825 |
case "P": |
| 26826 |
dateTimeFormat = formatLong2.dateTime({ width: "short" }); |
| 26827 |
break; |
| 26828 |
case "PP": |
| 26829 |
dateTimeFormat = formatLong2.dateTime({ width: "medium" }); |
| 26830 |
break; |
| 26831 |
case "PPP": |
| 26832 |
dateTimeFormat = formatLong2.dateTime({ width: "long" }); |
| 26833 |
break; |
| 26834 |
case "PPPP": |
| 26835 |
default: |
| 26836 |
dateTimeFormat = formatLong2.dateTime({ width: "full" }); |
| 26837 |
break; |
| 26838 |
} |
| 26839 |
return dateTimeFormat.replace("{{date}}", dateLongFormatter(datePattern, formatLong2)).replace("{{time}}", timeLongFormatter(timePattern, formatLong2)); |
| 26840 |
}; |
| 26841 |
var longFormatters = { |
| 26842 |
p: timeLongFormatter, |
| 26843 |
P: dateTimeLongFormatter |
| 26844 |
}; |
| 26845 |
|
| 26846 |
// node_modules/date-fns/_lib/protectedTokens.js |
| 26847 |
var dayOfYearTokenRE = /^D+$/; |
| 26848 |
var weekYearTokenRE = /^Y+$/; |
| 26849 |
var throwTokens = ["D", "DD", "YY", "YYYY"]; |
| 26850 |
function isProtectedDayOfYearToken(token) { |
| 26851 |
return dayOfYearTokenRE.test(token); |
| 26852 |
} |
| 26853 |
function isProtectedWeekYearToken(token) { |
| 26854 |
return weekYearTokenRE.test(token); |
| 26855 |
} |
| 26856 |
function warnOrThrowProtectedError(token, format6, input) { |
| 26857 |
const _message = message(token, format6, input); |
| 26858 |
console.warn(_message); |
| 26859 |
if (throwTokens.includes(token)) throw new RangeError(_message); |
| 26860 |
} |
| 26861 |
function message(token, format6, input) { |
| 26862 |
const subject = token[0] === "Y" ? "years" : "days of the month"; |
| 26863 |
return `Use \`${token.toLowerCase()}\` instead of \`${token}\` (in \`${format6}\`) for formatting ${subject} to the input \`${input}\`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md`; |
| 26864 |
} |
| 26865 |
|
| 26866 |
// node_modules/date-fns/format.js |
| 26867 |
var formattingTokensRegExp = /[yYQqMLwIdDecihHKkms]o|(\w)\1*|''|'(''|[^'])+('|$)|./g; |
| 26868 |
var longFormattingTokensRegExp = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g; |
| 26869 |
var escapedStringRegExp = /^'([^]*?)'?$/; |
| 26870 |
var doubleQuoteRegExp = /''/g; |
| 26871 |
var unescapedLatinCharacterRegExp = /[a-zA-Z]/; |
| 26872 |
function format(date, formatStr, options) { |
| 26873 |
const defaultOptions3 = getDefaultOptions(); |
| 26874 |
const locale = options?.locale ?? defaultOptions3.locale ?? enUS; |
| 26875 |
const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions3.firstWeekContainsDate ?? defaultOptions3.locale?.options?.firstWeekContainsDate ?? 1; |
| 26876 |
const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions3.weekStartsOn ?? defaultOptions3.locale?.options?.weekStartsOn ?? 0; |
| 26877 |
const originalDate = toDate(date, options?.in); |
| 26878 |
if (!isValid(originalDate)) { |
| 26879 |
throw new RangeError("Invalid time value"); |
| 26880 |
} |
| 26881 |
let parts = formatStr.match(longFormattingTokensRegExp).map((substring) => { |
| 26882 |
const firstCharacter = substring[0]; |
| 26883 |
if (firstCharacter === "p" || firstCharacter === "P") { |
| 26884 |
const longFormatter = longFormatters[firstCharacter]; |
| 26885 |
return longFormatter(substring, locale.formatLong); |
| 26886 |
} |
| 26887 |
return substring; |
| 26888 |
}).join("").match(formattingTokensRegExp).map((substring) => { |
| 26889 |
if (substring === "''") { |
| 26890 |
return { isToken: false, value: "'" }; |
| 26891 |
} |
| 26892 |
const firstCharacter = substring[0]; |
| 26893 |
if (firstCharacter === "'") { |
| 26894 |
return { isToken: false, value: cleanEscapedString(substring) }; |
| 26895 |
} |
| 26896 |
if (formatters[firstCharacter]) { |
| 26897 |
return { isToken: true, value: substring }; |
| 26898 |
} |
| 26899 |
if (firstCharacter.match(unescapedLatinCharacterRegExp)) { |
| 26900 |
throw new RangeError( |
| 26901 |
"Format string contains an unescaped latin alphabet character `" + firstCharacter + "`" |
| 26902 |
); |
| 26903 |
} |
| 26904 |
return { isToken: false, value: substring }; |
| 26905 |
}); |
| 26906 |
if (locale.localize.preprocessor) { |
| 26907 |
parts = locale.localize.preprocessor(originalDate, parts); |
| 26908 |
} |
| 26909 |
const formatterOptions = { |
| 26910 |
firstWeekContainsDate, |
| 26911 |
weekStartsOn, |
| 26912 |
locale |
| 26913 |
}; |
| 26914 |
return parts.map((part) => { |
| 26915 |
if (!part.isToken) return part.value; |
| 26916 |
const token = part.value; |
| 26917 |
if (!options?.useAdditionalWeekYearTokens && isProtectedWeekYearToken(token) || !options?.useAdditionalDayOfYearTokens && isProtectedDayOfYearToken(token)) { |
| 26918 |
warnOrThrowProtectedError(token, formatStr, String(date)); |
| 26919 |
} |
| 26920 |
const formatter = formatters[token[0]]; |
| 26921 |
return formatter(originalDate, token, locale.localize, formatterOptions); |
| 26922 |
}).join(""); |
| 26923 |
} |
| 26924 |
function cleanEscapedString(input) { |
| 26925 |
const matched = input.match(escapedStringRegExp); |
| 26926 |
if (!matched) { |
| 26927 |
return input; |
| 26928 |
} |
| 26929 |
return matched[1].replace(doubleQuoteRegExp, "'"); |
| 26930 |
} |
| 26931 |
|
| 26932 |
// node_modules/date-fns/subDays.js |
| 26933 |
function subDays(date, amount, options) { |
| 26934 |
return addDays(date, -amount, options); |
| 26935 |
} |
| 26936 |
|
| 26937 |
// node_modules/date-fns/subMonths.js |
| 26938 |
function subMonths(date, amount, options) { |
| 26939 |
return addMonths(date, -amount, options); |
| 26940 |
} |
| 26941 |
|
| 26942 |
// node_modules/date-fns/subWeeks.js |
| 26943 |
function subWeeks(date, amount, options) { |
| 26944 |
return addWeeks(date, -amount, options); |
| 26945 |
} |
| 26946 |
|
| 26947 |
// node_modules/date-fns/subYears.js |
| 26948 |
function subYears(date, amount, options) { |
| 26949 |
return addYears(date, -amount, options); |
| 26950 |
} |
| 26951 |
|
| 26952 |
// packages/dataviews/build-module/utils/operators.mjs |
| 26953 |
var import_i18n30 = __toESM(require_i18n(), 1); |
| 26954 |
var import_element91 = __toESM(require_element(), 1); |
| 26955 |
var import_date = __toESM(require_date(), 1); |
| 26956 |
var import_jsx_runtime120 = __toESM(require_jsx_runtime(), 1); |
| 26957 |
var filterTextWrappers = { |
| 26958 |
Name: /* @__PURE__ */ (0, import_jsx_runtime120.jsx)("span", { className: "dataviews-filters__summary-filter-text-name" }), |
| 26959 |
Value: /* @__PURE__ */ (0, import_jsx_runtime120.jsx)("span", { className: "dataviews-filters__summary-filter-text-value" }) |
| 26960 |
}; |
| 26961 |
function getRelativeDate(value, unit) { |
| 26962 |
switch (unit) { |
| 26963 |
case "days": |
| 26964 |
return subDays(/* @__PURE__ */ new Date(), value); |
| 26965 |
case "weeks": |
| 26966 |
return subWeeks(/* @__PURE__ */ new Date(), value); |
| 26967 |
case "months": |
| 26968 |
return subMonths(/* @__PURE__ */ new Date(), value); |
| 26969 |
case "years": |
| 26970 |
return subYears(/* @__PURE__ */ new Date(), value); |
| 26971 |
default: |
| 26972 |
return /* @__PURE__ */ new Date(); |
| 26973 |
} |
| 26974 |
} |
| 26975 |
var isNoneOperatorDefinition = { |
| 26976 |
/* translators: DataViews operator name */ |
| 26977 |
label: (0, import_i18n30.__)("Is none of"), |
| 26978 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 26979 |
(0, import_i18n30.sprintf)( |
| 26980 |
/* translators: 1: Filter name (e.g. "Author"). 2: Filter value (e.g. "Admin"): "Author is none of: Admin, Editor". */ |
| 26981 |
(0, import_i18n30.__)("<Name>%1$s is none of: </Name><Value>%2$s</Value>"), |
| 26982 |
filter.name, |
| 26983 |
activeElements.map((element) => element.label).join(", ") |
| 26984 |
), |
| 26985 |
filterTextWrappers |
| 26986 |
), |
| 26987 |
filter: ((item, field, filterValue) => { |
| 26988 |
if (!filterValue?.length) { |
| 26989 |
return true; |
| 26990 |
} |
| 26991 |
const fieldValue = field.getValue({ item }); |
| 26992 |
if (Array.isArray(fieldValue)) { |
| 26993 |
return !filterValue.some( |
| 26994 |
(fv) => fieldValue.includes(fv) |
| 26995 |
); |
| 26996 |
} else if (typeof fieldValue === "string") { |
| 26997 |
return !filterValue.includes(fieldValue); |
| 26998 |
} |
| 26999 |
return false; |
| 27000 |
}), |
| 27001 |
selection: "multi" |
| 27002 |
}; |
| 27003 |
var OPERATORS = [ |
| 27004 |
{ |
| 27005 |
name: OPERATOR_IS_ANY, |
| 27006 |
/* translators: DataViews operator name */ |
| 27007 |
label: (0, import_i18n30.__)("Includes"), |
| 27008 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27009 |
(0, import_i18n30.sprintf)( |
| 27010 |
/* translators: 1: Filter name (e.g. "Author"). 2: Filter value (e.g. "Admin"): "Author is any: Admin, Editor". */ |
| 27011 |
(0, import_i18n30.__)("<Name>%1$s includes: </Name><Value>%2$s</Value>"), |
| 27012 |
filter.name, |
| 27013 |
activeElements.map((element) => element.label).join(", ") |
| 27014 |
), |
| 27015 |
filterTextWrappers |
| 27016 |
), |
| 27017 |
filter(item, field, filterValue) { |
| 27018 |
if (!filterValue?.length) { |
| 27019 |
return true; |
| 27020 |
} |
| 27021 |
const fieldValue = field.getValue({ item }); |
| 27022 |
if (Array.isArray(fieldValue)) { |
| 27023 |
return filterValue.some( |
| 27024 |
(fv) => fieldValue.includes(fv) |
| 27025 |
); |
| 27026 |
} else if (typeof fieldValue === "string") { |
| 27027 |
return filterValue.includes(fieldValue); |
| 27028 |
} |
| 27029 |
return false; |
| 27030 |
}, |
| 27031 |
selection: "multi" |
| 27032 |
}, |
| 27033 |
{ |
| 27034 |
name: OPERATOR_IS_NONE, |
| 27035 |
...isNoneOperatorDefinition |
| 27036 |
}, |
| 27037 |
{ |
| 27038 |
name: OPERATOR_IS_ALL, |
| 27039 |
/* translators: DataViews operator name */ |
| 27040 |
label: (0, import_i18n30.__)("Includes all"), |
| 27041 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27042 |
(0, import_i18n30.sprintf)( |
| 27043 |
/* translators: 1: Filter name (e.g. "Author"). 2: Filter value (e.g. "Admin"): "Author includes all: Admin, Editor". */ |
| 27044 |
(0, import_i18n30.__)("<Name>%1$s includes all: </Name><Value>%2$s</Value>"), |
| 27045 |
filter.name, |
| 27046 |
activeElements.map((element) => element.label).join(", ") |
| 27047 |
), |
| 27048 |
filterTextWrappers |
| 27049 |
), |
| 27050 |
filter(item, field, filterValue) { |
| 27051 |
if (!filterValue?.length) { |
| 27052 |
return true; |
| 27053 |
} |
| 27054 |
return filterValue.every((value) => { |
| 27055 |
return field.getValue({ item })?.includes(value); |
| 27056 |
}); |
| 27057 |
}, |
| 27058 |
selection: "multi" |
| 27059 |
}, |
| 27060 |
{ |
| 27061 |
name: OPERATOR_IS_NOT_ALL, |
| 27062 |
...isNoneOperatorDefinition |
| 27063 |
}, |
| 27064 |
{ |
| 27065 |
name: OPERATOR_BETWEEN, |
| 27066 |
/* translators: DataViews operator name */ |
| 27067 |
label: (0, import_i18n30.__)("Between (inc)"), |
| 27068 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27069 |
(0, import_i18n30.sprintf)( |
| 27070 |
/* translators: 1: Filter name (e.g. "Item count"). 2: Filter value min. 3: Filter value max. e.g.: "Item count between (inc): 10 and 180". */ |
| 27071 |
(0, import_i18n30.__)( |
| 27072 |
"<Name>%1$s between (inc): </Name><Value>%2$s and %3$s</Value>" |
| 27073 |
), |
| 27074 |
filter.name, |
| 27075 |
activeElements[0].label[0], |
| 27076 |
activeElements[0].label[1] |
| 27077 |
), |
| 27078 |
filterTextWrappers |
| 27079 |
), |
| 27080 |
filter(item, field, filterValue) { |
| 27081 |
if (!Array.isArray(filterValue) || filterValue.length !== 2 || filterValue[0] === void 0 || filterValue[1] === void 0) { |
| 27082 |
return true; |
| 27083 |
} |
| 27084 |
const fieldValue = field.getValue({ item }); |
| 27085 |
if (typeof fieldValue === "number" || fieldValue instanceof Date || typeof fieldValue === "string") { |
| 27086 |
return fieldValue >= filterValue[0] && fieldValue <= filterValue[1]; |
| 27087 |
} |
| 27088 |
return false; |
| 27089 |
}, |
| 27090 |
selection: "custom" |
| 27091 |
}, |
| 27092 |
{ |
| 27093 |
name: OPERATOR_IN_THE_PAST, |
| 27094 |
/* translators: DataViews operator name */ |
| 27095 |
label: (0, import_i18n30.__)("In the past"), |
| 27096 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27097 |
(0, import_i18n30.sprintf)( |
| 27098 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "7 days"): "Date is in the past: 7 days". */ |
| 27099 |
(0, import_i18n30.__)( |
| 27100 |
"<Name>%1$s is in the past: </Name><Value>%2$s</Value>" |
| 27101 |
), |
| 27102 |
filter.name, |
| 27103 |
`${activeElements[0].value.value} ${activeElements[0].value.unit}` |
| 27104 |
), |
| 27105 |
filterTextWrappers |
| 27106 |
), |
| 27107 |
filter(item, field, filterValue) { |
| 27108 |
if (filterValue?.value === void 0 || filterValue?.unit === void 0) { |
| 27109 |
return true; |
| 27110 |
} |
| 27111 |
const targetDate = getRelativeDate( |
| 27112 |
filterValue.value, |
| 27113 |
filterValue.unit |
| 27114 |
); |
| 27115 |
const fieldValue = (0, import_date.getDate)(field.getValue({ item })); |
| 27116 |
return fieldValue >= targetDate && fieldValue <= /* @__PURE__ */ new Date(); |
| 27117 |
}, |
| 27118 |
selection: "custom" |
| 27119 |
}, |
| 27120 |
{ |
| 27121 |
name: OPERATOR_OVER, |
| 27122 |
/* translators: DataViews operator name */ |
| 27123 |
label: (0, import_i18n30.__)("Over"), |
| 27124 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27125 |
(0, import_i18n30.sprintf)( |
| 27126 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "7 days"): "Date is over: 7 days". */ |
| 27127 |
(0, import_i18n30.__)("<Name>%1$s is over: </Name><Value>%2$s</Value>"), |
| 27128 |
filter.name, |
| 27129 |
`${activeElements[0].value.value} ${activeElements[0].value.unit}` |
| 27130 |
), |
| 27131 |
filterTextWrappers |
| 27132 |
), |
| 27133 |
filter(item, field, filterValue) { |
| 27134 |
if (filterValue?.value === void 0 || filterValue?.unit === void 0) { |
| 27135 |
return true; |
| 27136 |
} |
| 27137 |
const targetDate = getRelativeDate( |
| 27138 |
filterValue.value, |
| 27139 |
filterValue.unit |
| 27140 |
); |
| 27141 |
const fieldValue = (0, import_date.getDate)(field.getValue({ item })); |
| 27142 |
return fieldValue < targetDate; |
| 27143 |
}, |
| 27144 |
selection: "custom" |
| 27145 |
}, |
| 27146 |
{ |
| 27147 |
name: OPERATOR_IS, |
| 27148 |
/* translators: DataViews operator name */ |
| 27149 |
label: (0, import_i18n30.__)("Is"), |
| 27150 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27151 |
(0, import_i18n30.sprintf)( |
| 27152 |
/* translators: 1: Filter name (e.g. "Author"). 2: Filter value (e.g. "Admin"): "Author is: Admin". */ |
| 27153 |
(0, import_i18n30.__)("<Name>%1$s is: </Name><Value>%2$s</Value>"), |
| 27154 |
filter.name, |
| 27155 |
activeElements[0].label |
| 27156 |
), |
| 27157 |
filterTextWrappers |
| 27158 |
), |
| 27159 |
filter(item, field, filterValue) { |
| 27160 |
return filterValue === field.getValue({ item }) || filterValue === void 0; |
| 27161 |
}, |
| 27162 |
selection: "single" |
| 27163 |
}, |
| 27164 |
{ |
| 27165 |
name: OPERATOR_IS_NOT, |
| 27166 |
/* translators: DataViews operator name */ |
| 27167 |
label: (0, import_i18n30.__)("Is not"), |
| 27168 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27169 |
(0, import_i18n30.sprintf)( |
| 27170 |
/* translators: 1: Filter name (e.g. "Author"). 2: Filter value (e.g. "Admin"): "Author is not: Admin". */ |
| 27171 |
(0, import_i18n30.__)("<Name>%1$s is not: </Name><Value>%2$s</Value>"), |
| 27172 |
filter.name, |
| 27173 |
activeElements[0].label |
| 27174 |
), |
| 27175 |
filterTextWrappers |
| 27176 |
), |
| 27177 |
filter(item, field, filterValue) { |
| 27178 |
return filterValue !== field.getValue({ item }); |
| 27179 |
}, |
| 27180 |
selection: "single" |
| 27181 |
}, |
| 27182 |
{ |
| 27183 |
name: OPERATOR_LESS_THAN, |
| 27184 |
/* translators: DataViews operator name */ |
| 27185 |
label: (0, import_i18n30.__)("Less than"), |
| 27186 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27187 |
(0, import_i18n30.sprintf)( |
| 27188 |
/* translators: 1: Filter name (e.g. "Count"). 2: Filter value (e.g. "10"): "Count is less than: 10". */ |
| 27189 |
(0, import_i18n30.__)("<Name>%1$s is less than: </Name><Value>%2$s</Value>"), |
| 27190 |
filter.name, |
| 27191 |
activeElements[0].label |
| 27192 |
), |
| 27193 |
filterTextWrappers |
| 27194 |
), |
| 27195 |
filter(item, field, filterValue) { |
| 27196 |
if (filterValue === void 0) { |
| 27197 |
return true; |
| 27198 |
} |
| 27199 |
const fieldValue = field.getValue({ item }); |
| 27200 |
return fieldValue < filterValue; |
| 27201 |
}, |
| 27202 |
selection: "single" |
| 27203 |
}, |
| 27204 |
{ |
| 27205 |
name: OPERATOR_GREATER_THAN, |
| 27206 |
/* translators: DataViews operator name */ |
| 27207 |
label: (0, import_i18n30.__)("Greater than"), |
| 27208 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27209 |
(0, import_i18n30.sprintf)( |
| 27210 |
/* translators: 1: Filter name (e.g. "Count"). 2: Filter value (e.g. "10"): "Count is greater than: 10". */ |
| 27211 |
(0, import_i18n30.__)( |
| 27212 |
"<Name>%1$s is greater than: </Name><Value>%2$s</Value>" |
| 27213 |
), |
| 27214 |
filter.name, |
| 27215 |
activeElements[0].label |
| 27216 |
), |
| 27217 |
filterTextWrappers |
| 27218 |
), |
| 27219 |
filter(item, field, filterValue) { |
| 27220 |
if (filterValue === void 0) { |
| 27221 |
return true; |
| 27222 |
} |
| 27223 |
const fieldValue = field.getValue({ item }); |
| 27224 |
return fieldValue > filterValue; |
| 27225 |
}, |
| 27226 |
selection: "single" |
| 27227 |
}, |
| 27228 |
{ |
| 27229 |
name: OPERATOR_LESS_THAN_OR_EQUAL, |
| 27230 |
/* translators: DataViews operator name */ |
| 27231 |
label: (0, import_i18n30.__)("Less than or equal"), |
| 27232 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27233 |
(0, import_i18n30.sprintf)( |
| 27234 |
/* translators: 1: Filter name (e.g. "Count"). 2: Filter value (e.g. "10"): "Count is less than or equal to: 10". */ |
| 27235 |
(0, import_i18n30.__)( |
| 27236 |
"<Name>%1$s is less than or equal to: </Name><Value>%2$s</Value>" |
| 27237 |
), |
| 27238 |
filter.name, |
| 27239 |
activeElements[0].label |
| 27240 |
), |
| 27241 |
filterTextWrappers |
| 27242 |
), |
| 27243 |
filter(item, field, filterValue) { |
| 27244 |
if (filterValue === void 0) { |
| 27245 |
return true; |
| 27246 |
} |
| 27247 |
const fieldValue = field.getValue({ item }); |
| 27248 |
return fieldValue <= filterValue; |
| 27249 |
}, |
| 27250 |
selection: "single" |
| 27251 |
}, |
| 27252 |
{ |
| 27253 |
name: OPERATOR_GREATER_THAN_OR_EQUAL, |
| 27254 |
/* translators: DataViews operator name */ |
| 27255 |
label: (0, import_i18n30.__)("Greater than or equal"), |
| 27256 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27257 |
(0, import_i18n30.sprintf)( |
| 27258 |
/* translators: 1: Filter name (e.g. "Count"). 2: Filter value (e.g. "10"): "Count is greater than or equal to: 10". */ |
| 27259 |
(0, import_i18n30.__)( |
| 27260 |
"<Name>%1$s is greater than or equal to: </Name><Value>%2$s</Value>" |
| 27261 |
), |
| 27262 |
filter.name, |
| 27263 |
activeElements[0].label |
| 27264 |
), |
| 27265 |
filterTextWrappers |
| 27266 |
), |
| 27267 |
filter(item, field, filterValue) { |
| 27268 |
if (filterValue === void 0) { |
| 27269 |
return true; |
| 27270 |
} |
| 27271 |
const fieldValue = field.getValue({ item }); |
| 27272 |
return fieldValue >= filterValue; |
| 27273 |
}, |
| 27274 |
selection: "single" |
| 27275 |
}, |
| 27276 |
{ |
| 27277 |
name: OPERATOR_BEFORE, |
| 27278 |
/* translators: DataViews operator name */ |
| 27279 |
label: (0, import_i18n30.__)("Before"), |
| 27280 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27281 |
(0, import_i18n30.sprintf)( |
| 27282 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is before: 2024-01-01". */ |
| 27283 |
(0, import_i18n30.__)("<Name>%1$s is before: </Name><Value>%2$s</Value>"), |
| 27284 |
filter.name, |
| 27285 |
activeElements[0].label |
| 27286 |
), |
| 27287 |
filterTextWrappers |
| 27288 |
), |
| 27289 |
filter(item, field, filterValue) { |
| 27290 |
if (filterValue === void 0) { |
| 27291 |
return true; |
| 27292 |
} |
| 27293 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27294 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27295 |
return fieldDate < filterDate; |
| 27296 |
}, |
| 27297 |
selection: "single" |
| 27298 |
}, |
| 27299 |
{ |
| 27300 |
name: OPERATOR_AFTER, |
| 27301 |
/* translators: DataViews operator name */ |
| 27302 |
label: (0, import_i18n30.__)("After"), |
| 27303 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27304 |
(0, import_i18n30.sprintf)( |
| 27305 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is after: 2024-01-01". */ |
| 27306 |
(0, import_i18n30.__)("<Name>%1$s is after: </Name><Value>%2$s</Value>"), |
| 27307 |
filter.name, |
| 27308 |
activeElements[0].label |
| 27309 |
), |
| 27310 |
filterTextWrappers |
| 27311 |
), |
| 27312 |
filter(item, field, filterValue) { |
| 27313 |
if (filterValue === void 0) { |
| 27314 |
return true; |
| 27315 |
} |
| 27316 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27317 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27318 |
return fieldDate > filterDate; |
| 27319 |
}, |
| 27320 |
selection: "single" |
| 27321 |
}, |
| 27322 |
{ |
| 27323 |
name: OPERATOR_BEFORE_INC, |
| 27324 |
/* translators: DataViews operator name */ |
| 27325 |
label: (0, import_i18n30.__)("Before (inc)"), |
| 27326 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27327 |
(0, import_i18n30.sprintf)( |
| 27328 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is on or before: 2024-01-01". */ |
| 27329 |
(0, import_i18n30.__)( |
| 27330 |
"<Name>%1$s is on or before: </Name><Value>%2$s</Value>" |
| 27331 |
), |
| 27332 |
filter.name, |
| 27333 |
activeElements[0].label |
| 27334 |
), |
| 27335 |
filterTextWrappers |
| 27336 |
), |
| 27337 |
filter(item, field, filterValue) { |
| 27338 |
if (filterValue === void 0) { |
| 27339 |
return true; |
| 27340 |
} |
| 27341 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27342 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27343 |
return fieldDate <= filterDate; |
| 27344 |
}, |
| 27345 |
selection: "single" |
| 27346 |
}, |
| 27347 |
{ |
| 27348 |
name: OPERATOR_AFTER_INC, |
| 27349 |
/* translators: DataViews operator name */ |
| 27350 |
label: (0, import_i18n30.__)("After (inc)"), |
| 27351 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27352 |
(0, import_i18n30.sprintf)( |
| 27353 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is on or after: 2024-01-01". */ |
| 27354 |
(0, import_i18n30.__)( |
| 27355 |
"<Name>%1$s is on or after: </Name><Value>%2$s</Value>" |
| 27356 |
), |
| 27357 |
filter.name, |
| 27358 |
activeElements[0].label |
| 27359 |
), |
| 27360 |
filterTextWrappers |
| 27361 |
), |
| 27362 |
filter(item, field, filterValue) { |
| 27363 |
if (filterValue === void 0) { |
| 27364 |
return true; |
| 27365 |
} |
| 27366 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27367 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27368 |
return fieldDate >= filterDate; |
| 27369 |
}, |
| 27370 |
selection: "single" |
| 27371 |
}, |
| 27372 |
{ |
| 27373 |
name: OPERATOR_CONTAINS, |
| 27374 |
/* translators: DataViews operator name */ |
| 27375 |
label: (0, import_i18n30.__)("Contains"), |
| 27376 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27377 |
(0, import_i18n30.sprintf)( |
| 27378 |
/* translators: 1: Filter name (e.g. "Title"). 2: Filter value (e.g. "Hello"): "Title contains: Hello". */ |
| 27379 |
(0, import_i18n30.__)("<Name>%1$s contains: </Name><Value>%2$s</Value>"), |
| 27380 |
filter.name, |
| 27381 |
activeElements[0].label |
| 27382 |
), |
| 27383 |
filterTextWrappers |
| 27384 |
), |
| 27385 |
filter(item, field, filterValue) { |
| 27386 |
if (filterValue === void 0) { |
| 27387 |
return true; |
| 27388 |
} |
| 27389 |
const fieldValue = field.getValue({ item }); |
| 27390 |
return typeof fieldValue === "string" && filterValue && fieldValue.toLowerCase().includes(String(filterValue).toLowerCase()); |
| 27391 |
}, |
| 27392 |
selection: "single" |
| 27393 |
}, |
| 27394 |
{ |
| 27395 |
name: OPERATOR_NOT_CONTAINS, |
| 27396 |
/* translators: DataViews operator name */ |
| 27397 |
label: (0, import_i18n30.__)("Doesn't contain"), |
| 27398 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27399 |
(0, import_i18n30.sprintf)( |
| 27400 |
/* translators: 1: Filter name (e.g. "Title"). 2: Filter value (e.g. "Hello"): "Title doesn't contain: Hello". */ |
| 27401 |
(0, import_i18n30.__)( |
| 27402 |
"<Name>%1$s doesn't contain: </Name><Value>%2$s</Value>" |
| 27403 |
), |
| 27404 |
filter.name, |
| 27405 |
activeElements[0].label |
| 27406 |
), |
| 27407 |
filterTextWrappers |
| 27408 |
), |
| 27409 |
filter(item, field, filterValue) { |
| 27410 |
if (filterValue === void 0) { |
| 27411 |
return true; |
| 27412 |
} |
| 27413 |
const fieldValue = field.getValue({ item }); |
| 27414 |
return typeof fieldValue === "string" && filterValue && !fieldValue.toLowerCase().includes(String(filterValue).toLowerCase()); |
| 27415 |
}, |
| 27416 |
selection: "single" |
| 27417 |
}, |
| 27418 |
{ |
| 27419 |
name: OPERATOR_STARTS_WITH, |
| 27420 |
/* translators: DataViews operator name */ |
| 27421 |
label: (0, import_i18n30.__)("Starts with"), |
| 27422 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27423 |
(0, import_i18n30.sprintf)( |
| 27424 |
/* translators: 1: Filter name (e.g. "Title"). 2: Filter value (e.g. "Hello"): "Title starts with: Hello". */ |
| 27425 |
(0, import_i18n30.__)("<Name>%1$s starts with: </Name><Value>%2$s</Value>"), |
| 27426 |
filter.name, |
| 27427 |
activeElements[0].label |
| 27428 |
), |
| 27429 |
filterTextWrappers |
| 27430 |
), |
| 27431 |
filter(item, field, filterValue) { |
| 27432 |
if (filterValue === void 0) { |
| 27433 |
return true; |
| 27434 |
} |
| 27435 |
const fieldValue = field.getValue({ item }); |
| 27436 |
return typeof fieldValue === "string" && filterValue && fieldValue.toLowerCase().startsWith(String(filterValue).toLowerCase()); |
| 27437 |
}, |
| 27438 |
selection: "single" |
| 27439 |
}, |
| 27440 |
{ |
| 27441 |
name: OPERATOR_ON, |
| 27442 |
/* translators: DataViews operator name */ |
| 27443 |
label: (0, import_i18n30.__)("On"), |
| 27444 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27445 |
(0, import_i18n30.sprintf)( |
| 27446 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is: 2024-01-01". */ |
| 27447 |
(0, import_i18n30.__)("<Name>%1$s is: </Name><Value>%2$s</Value>"), |
| 27448 |
filter.name, |
| 27449 |
activeElements[0].label |
| 27450 |
), |
| 27451 |
filterTextWrappers |
| 27452 |
), |
| 27453 |
filter(item, field, filterValue) { |
| 27454 |
if (filterValue === void 0) { |
| 27455 |
return true; |
| 27456 |
} |
| 27457 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27458 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27459 |
return filterDate.getTime() === fieldDate.getTime(); |
| 27460 |
}, |
| 27461 |
selection: "single" |
| 27462 |
}, |
| 27463 |
{ |
| 27464 |
name: OPERATOR_NOT_ON, |
| 27465 |
/* translators: DataViews operator name */ |
| 27466 |
label: (0, import_i18n30.__)("Not on"), |
| 27467 |
filterText: (filter, activeElements) => (0, import_element91.createInterpolateElement)( |
| 27468 |
(0, import_i18n30.sprintf)( |
| 27469 |
/* translators: 1: Filter name (e.g. "Date"). 2: Filter value (e.g. "2024-01-01"): "Date is not: 2024-01-01". */ |
| 27470 |
(0, import_i18n30.__)("<Name>%1$s is not: </Name><Value>%2$s</Value>"), |
| 27471 |
filter.name, |
| 27472 |
activeElements[0].label |
| 27473 |
), |
| 27474 |
filterTextWrappers |
| 27475 |
), |
| 27476 |
filter(item, field, filterValue) { |
| 27477 |
if (filterValue === void 0) { |
| 27478 |
return true; |
| 27479 |
} |
| 27480 |
const filterDate = (0, import_date.getDate)(filterValue); |
| 27481 |
const fieldDate = (0, import_date.getDate)(field.getValue({ item })); |
| 27482 |
return filterDate.getTime() !== fieldDate.getTime(); |
| 27483 |
}, |
| 27484 |
selection: "single" |
| 27485 |
} |
| 27486 |
]; |
| 27487 |
var getOperatorByName = (name) => OPERATORS.find((op) => op.name === name); |
| 27488 |
var getAllOperatorNames = () => OPERATORS.map((op) => op.name); |
| 27489 |
var isSingleSelectionOperator = (name) => OPERATORS.filter((op) => op.selection === "single").some( |
| 27490 |
(op) => op.name === name |
| 27491 |
); |
| 27492 |
var isRegisteredOperator = (name) => OPERATORS.some((op) => op.name === name); |
| 27493 |
|
| 27494 |
// packages/dataviews/build-module/components/dataviews-filters/filter.mjs |
| 27495 |
var import_jsx_runtime121 = __toESM(require_jsx_runtime(), 1); |
| 27496 |
var ENTER = "Enter"; |
| 27497 |
var SPACE = " "; |
| 27498 |
var FilterText = ({ |
| 27499 |
activeElements, |
| 27500 |
filterInView, |
| 27501 |
filter |
| 27502 |
}) => { |
| 27503 |
if (activeElements === void 0 || activeElements.length === 0) { |
| 27504 |
return filter.name; |
| 27505 |
} |
| 27506 |
const operator = getOperatorByName(filterInView?.operator); |
| 27507 |
if (operator !== void 0) { |
| 27508 |
return operator.filterText(filter, activeElements); |
| 27509 |
} |
| 27510 |
return (0, import_i18n31.sprintf)( |
| 27511 |
/* translators: 1: Filter name e.g.: "Unknown status for Author". */ |
| 27512 |
(0, import_i18n31.__)("Unknown status for %1$s"), |
| 27513 |
filter.name |
| 27514 |
); |
| 27515 |
}; |
| 27516 |
function OperatorSelector({ |
| 27517 |
filter, |
| 27518 |
view, |
| 27519 |
onChangeView |
| 27520 |
}) { |
| 27521 |
const operatorOptions = filter.operators?.map((operator) => ({ |
| 27522 |
value: operator, |
| 27523 |
label: getOperatorByName(operator)?.label || operator |
| 27524 |
})); |
| 27525 |
const currentFilter = view.filters?.find( |
| 27526 |
(_filter) => _filter.field === filter.field |
| 27527 |
); |
| 27528 |
const value = currentFilter?.operator || filter.operators[0]; |
| 27529 |
return operatorOptions.length > 1 && /* @__PURE__ */ (0, import_jsx_runtime121.jsxs)( |
| 27530 |
Stack, |
| 27531 |
{ |
| 27532 |
direction: "row", |
| 27533 |
gap: "sm", |
| 27534 |
justify: "flex-start", |
| 27535 |
className: "dataviews-filters__summary-operators-container", |
| 27536 |
align: "center", |
| 27537 |
children: [ |
| 27538 |
/* @__PURE__ */ (0, import_jsx_runtime121.jsx)(import_components22.FlexItem, { className: "dataviews-filters__summary-operators-filter-name", children: filter.name }), |
| 27539 |
/* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27540 |
import_components22.SelectControl, |
| 27541 |
{ |
| 27542 |
className: "dataviews-filters__summary-operators-filter-select", |
| 27543 |
label: (0, import_i18n31.__)("Conditions"), |
| 27544 |
value, |
| 27545 |
options: operatorOptions, |
| 27546 |
onChange: (newValue) => { |
| 27547 |
const newOperator = newValue; |
| 27548 |
const currentOperator = currentFilter?.operator; |
| 27549 |
const newFilters = currentFilter ? [ |
| 27550 |
...(view.filters ?? []).map( |
| 27551 |
(_filter) => { |
| 27552 |
if (_filter.field === filter.field) { |
| 27553 |
const currentOpSelectionModel = getOperatorByName( |
| 27554 |
currentOperator |
| 27555 |
)?.selection; |
| 27556 |
const newOpSelectionModel = getOperatorByName( |
| 27557 |
newOperator |
| 27558 |
)?.selection; |
| 27559 |
const shouldResetValue = currentOpSelectionModel !== newOpSelectionModel || [ |
| 27560 |
currentOpSelectionModel, |
| 27561 |
newOpSelectionModel |
| 27562 |
].includes("custom"); |
| 27563 |
return { |
| 27564 |
..._filter, |
| 27565 |
value: shouldResetValue ? void 0 : _filter.value, |
| 27566 |
operator: newOperator |
| 27567 |
}; |
| 27568 |
} |
| 27569 |
return _filter; |
| 27570 |
} |
| 27571 |
) |
| 27572 |
] : [ |
| 27573 |
...view.filters ?? [], |
| 27574 |
{ |
| 27575 |
field: filter.field, |
| 27576 |
operator: newOperator, |
| 27577 |
value: void 0 |
| 27578 |
} |
| 27579 |
]; |
| 27580 |
onChangeView({ |
| 27581 |
...view, |
| 27582 |
page: 1, |
| 27583 |
filters: newFilters |
| 27584 |
}); |
| 27585 |
}, |
| 27586 |
size: "small", |
| 27587 |
variant: "minimal", |
| 27588 |
hideLabelFromVision: true |
| 27589 |
} |
| 27590 |
) |
| 27591 |
] |
| 27592 |
} |
| 27593 |
); |
| 27594 |
} |
| 27595 |
function Filter({ |
| 27596 |
addFilterRef, |
| 27597 |
openedFilter, |
| 27598 |
fields: fields2, |
| 27599 |
...commonProps |
| 27600 |
}) { |
| 27601 |
const toggleRef = (0, import_element92.useRef)(null); |
| 27602 |
const { filter, view, onChangeView } = commonProps; |
| 27603 |
const filterInView = view.filters?.find( |
| 27604 |
(f2) => f2.field === filter.field |
| 27605 |
); |
| 27606 |
let activeElements = []; |
| 27607 |
const field = (0, import_element92.useMemo)(() => { |
| 27608 |
const currentField = fields2.find((f2) => f2.id === filter.field); |
| 27609 |
if (currentField) { |
| 27610 |
return { |
| 27611 |
...currentField, |
| 27612 |
// Configure getValue as if Item was a plain object. |
| 27613 |
// See related input-widget.tsx |
| 27614 |
getValue: ({ item }) => item[currentField.id] |
| 27615 |
}; |
| 27616 |
} |
| 27617 |
return currentField; |
| 27618 |
}, [fields2, filter.field]); |
| 27619 |
const { elements } = useElements({ |
| 27620 |
elements: filter.elements, |
| 27621 |
getElements: filter.getElements |
| 27622 |
}); |
| 27623 |
if (elements.length > 0) { |
| 27624 |
activeElements = elements.filter((element) => { |
| 27625 |
if (filter.singleSelection) { |
| 27626 |
return element.value === filterInView?.value; |
| 27627 |
} |
| 27628 |
return filterInView?.value?.includes(element.value); |
| 27629 |
}); |
| 27630 |
} else if (Array.isArray(filterInView?.value)) { |
| 27631 |
const label = filterInView.value.map((v2) => { |
| 27632 |
const formattedValue = field?.getValueFormatted({ |
| 27633 |
item: { [field.id]: v2 }, |
| 27634 |
field |
| 27635 |
}); |
| 27636 |
return formattedValue || String(v2); |
| 27637 |
}); |
| 27638 |
activeElements = [ |
| 27639 |
{ |
| 27640 |
value: filterInView.value, |
| 27641 |
// @ts-ignore |
| 27642 |
label |
| 27643 |
} |
| 27644 |
]; |
| 27645 |
} else if (typeof filterInView?.value === "object") { |
| 27646 |
activeElements = [ |
| 27647 |
{ value: filterInView.value, label: filterInView.value } |
| 27648 |
]; |
| 27649 |
} else if (filterInView?.value !== void 0) { |
| 27650 |
const label = field !== void 0 ? field.getValueFormatted({ |
| 27651 |
item: { [field.id]: filterInView.value }, |
| 27652 |
field |
| 27653 |
}) : String(filterInView.value); |
| 27654 |
activeElements = [ |
| 27655 |
{ |
| 27656 |
value: filterInView.value, |
| 27657 |
label |
| 27658 |
} |
| 27659 |
]; |
| 27660 |
} |
| 27661 |
const isPrimary = filter.isPrimary; |
| 27662 |
const isLocked = filterInView?.isLocked; |
| 27663 |
const hasValues = !isLocked && filterInView?.value !== void 0; |
| 27664 |
const canResetOrRemove = !isLocked && (!isPrimary || hasValues); |
| 27665 |
return /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27666 |
import_components22.Dropdown, |
| 27667 |
{ |
| 27668 |
defaultOpen: openedFilter === filter.field, |
| 27669 |
contentClassName: "dataviews-filters__summary-popover", |
| 27670 |
popoverProps: { placement: "bottom-start", role: "dialog" }, |
| 27671 |
onClose: () => { |
| 27672 |
toggleRef.current?.focus(); |
| 27673 |
}, |
| 27674 |
renderToggle: ({ isOpen, onToggle }) => /* @__PURE__ */ (0, import_jsx_runtime121.jsxs)("div", { className: "dataviews-filters__summary-chip-container", children: [ |
| 27675 |
/* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27676 |
import_components22.Tooltip, |
| 27677 |
{ |
| 27678 |
text: (0, import_i18n31.sprintf)( |
| 27679 |
/* translators: 1: Filter name. */ |
| 27680 |
(0, import_i18n31.__)("Filter by: %1$s"), |
| 27681 |
filter.name.toLowerCase() |
| 27682 |
), |
| 27683 |
placement: "top", |
| 27684 |
children: /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27685 |
"div", |
| 27686 |
{ |
| 27687 |
className: clsx_default( |
| 27688 |
"dataviews-filters__summary-chip", |
| 27689 |
{ |
| 27690 |
"has-reset": canResetOrRemove, |
| 27691 |
"has-values": hasValues, |
| 27692 |
"is-not-clickable": isLocked |
| 27693 |
} |
| 27694 |
), |
| 27695 |
role: "button", |
| 27696 |
tabIndex: isLocked ? -1 : 0, |
| 27697 |
onClick: () => { |
| 27698 |
if (!isLocked) { |
| 27699 |
onToggle(); |
| 27700 |
} |
| 27701 |
}, |
| 27702 |
onKeyDown: (event) => { |
| 27703 |
if (!isLocked && [ENTER, SPACE].includes(event.key)) { |
| 27704 |
onToggle(); |
| 27705 |
event.preventDefault(); |
| 27706 |
} |
| 27707 |
}, |
| 27708 |
"aria-disabled": isLocked, |
| 27709 |
"aria-pressed": isOpen, |
| 27710 |
"aria-expanded": isOpen, |
| 27711 |
ref: toggleRef, |
| 27712 |
children: /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27713 |
FilterText, |
| 27714 |
{ |
| 27715 |
activeElements, |
| 27716 |
filterInView, |
| 27717 |
filter |
| 27718 |
} |
| 27719 |
) |
| 27720 |
} |
| 27721 |
) |
| 27722 |
} |
| 27723 |
), |
| 27724 |
canResetOrRemove && /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27725 |
import_components22.Tooltip, |
| 27726 |
{ |
| 27727 |
text: isPrimary ? (0, import_i18n31.__)("Reset") : (0, import_i18n31.__)("Remove"), |
| 27728 |
placement: "top", |
| 27729 |
children: /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27730 |
"button", |
| 27731 |
{ |
| 27732 |
className: clsx_default( |
| 27733 |
"dataviews-filters__summary-chip-remove", |
| 27734 |
{ "has-values": hasValues } |
| 27735 |
), |
| 27736 |
onClick: () => { |
| 27737 |
onChangeView({ |
| 27738 |
...view, |
| 27739 |
page: 1, |
| 27740 |
filters: view.filters?.filter( |
| 27741 |
(_filter) => _filter.field !== filter.field |
| 27742 |
) |
| 27743 |
}); |
| 27744 |
if (!isPrimary) { |
| 27745 |
addFilterRef.current?.focus(); |
| 27746 |
} else { |
| 27747 |
toggleRef.current?.focus(); |
| 27748 |
} |
| 27749 |
}, |
| 27750 |
children: /* @__PURE__ */ (0, import_jsx_runtime121.jsx)(import_components22.Icon, { icon: close_small_default }) |
| 27751 |
} |
| 27752 |
) |
| 27753 |
} |
| 27754 |
) |
| 27755 |
] }), |
| 27756 |
renderContent: () => { |
| 27757 |
return /* @__PURE__ */ (0, import_jsx_runtime121.jsxs)(Stack, { direction: "column", justify: "flex-start", children: [ |
| 27758 |
/* @__PURE__ */ (0, import_jsx_runtime121.jsx)(OperatorSelector, { ...commonProps }), |
| 27759 |
commonProps.filter.hasElements ? /* @__PURE__ */ (0, import_jsx_runtime121.jsx)( |
| 27760 |
SearchWidget, |
| 27761 |
{ |
| 27762 |
...commonProps, |
| 27763 |
filter: { |
| 27764 |
...commonProps.filter, |
| 27765 |
elements |
| 27766 |
} |
| 27767 |
} |
| 27768 |
) : /* @__PURE__ */ (0, import_jsx_runtime121.jsx)(InputWidget, { ...commonProps, fields: fields2 }) |
| 27769 |
] }); |
| 27770 |
} |
| 27771 |
} |
| 27772 |
); |
| 27773 |
} |
| 27774 |
|
| 27775 |
// packages/dataviews/build-module/components/dataviews-filters/add-filter.mjs |
| 27776 |
var import_components23 = __toESM(require_components(), 1); |
| 27777 |
var import_i18n32 = __toESM(require_i18n(), 1); |
| 27778 |
var import_element93 = __toESM(require_element(), 1); |
| 27779 |
var import_jsx_runtime122 = __toESM(require_jsx_runtime(), 1); |
| 27780 |
var { Menu: Menu5 } = unlock3(import_components23.privateApis); |
| 27781 |
function AddFilterMenu({ |
| 27782 |
filters, |
| 27783 |
view, |
| 27784 |
onChangeView, |
| 27785 |
setOpenedFilter, |
| 27786 |
triggerProps |
| 27787 |
}) { |
| 27788 |
const inactiveFilters = filters.filter((filter) => !filter.isVisible); |
| 27789 |
return /* @__PURE__ */ (0, import_jsx_runtime122.jsxs)(Menu5, { children: [ |
| 27790 |
/* @__PURE__ */ (0, import_jsx_runtime122.jsx)(Menu5.TriggerButton, { ...triggerProps }), |
| 27791 |
/* @__PURE__ */ (0, import_jsx_runtime122.jsx)(Menu5.Popover, { children: inactiveFilters.map((filter) => { |
| 27792 |
return /* @__PURE__ */ (0, import_jsx_runtime122.jsx)( |
| 27793 |
Menu5.Item, |
| 27794 |
{ |
| 27795 |
onClick: () => { |
| 27796 |
setOpenedFilter(filter.field); |
| 27797 |
onChangeView({ |
| 27798 |
...view, |
| 27799 |
page: 1, |
| 27800 |
filters: [ |
| 27801 |
...view.filters || [], |
| 27802 |
{ |
| 27803 |
field: filter.field, |
| 27804 |
value: void 0, |
| 27805 |
operator: filter.operators[0] |
| 27806 |
} |
| 27807 |
] |
| 27808 |
}); |
| 27809 |
}, |
| 27810 |
children: /* @__PURE__ */ (0, import_jsx_runtime122.jsx)(Menu5.ItemLabel, { children: filter.name }) |
| 27811 |
}, |
| 27812 |
filter.field |
| 27813 |
); |
| 27814 |
}) }) |
| 27815 |
] }); |
| 27816 |
} |
| 27817 |
function AddFilter({ filters, view, onChangeView, setOpenedFilter }, ref) { |
| 27818 |
if (!filters.length || filters.every(({ isPrimary }) => isPrimary)) { |
| 27819 |
return null; |
| 27820 |
} |
| 27821 |
const inactiveFilters = filters.filter((filter) => !filter.isVisible); |
| 27822 |
return /* @__PURE__ */ (0, import_jsx_runtime122.jsx)( |
| 27823 |
AddFilterMenu, |
| 27824 |
{ |
| 27825 |
triggerProps: { |
| 27826 |
render: /* @__PURE__ */ (0, import_jsx_runtime122.jsx)( |
| 27827 |
import_components23.Button, |
| 27828 |
{ |
| 27829 |
accessibleWhenDisabled: true, |
| 27830 |
size: "compact", |
| 27831 |
className: "dataviews-filters-button", |
| 27832 |
variant: "tertiary", |
| 27833 |
disabled: !inactiveFilters.length, |
| 27834 |
ref |
| 27835 |
} |
| 27836 |
), |
| 27837 |
children: (0, import_i18n32.__)("Add filter") |
| 27838 |
}, |
| 27839 |
...{ filters, view, onChangeView, setOpenedFilter } |
| 27840 |
} |
| 27841 |
); |
| 27842 |
} |
| 27843 |
var add_filter_default = (0, import_element93.forwardRef)(AddFilter); |
| 27844 |
|
| 27845 |
// packages/dataviews/build-module/components/dataviews-filters/reset-filters.mjs |
| 27846 |
var import_components24 = __toESM(require_components(), 1); |
| 27847 |
var import_i18n33 = __toESM(require_i18n(), 1); |
| 27848 |
var import_jsx_runtime123 = __toESM(require_jsx_runtime(), 1); |
| 27849 |
function ResetFilter({ |
| 27850 |
filters, |
| 27851 |
view, |
| 27852 |
onChangeView |
| 27853 |
}) { |
| 27854 |
const isPrimary = (field) => filters.some( |
| 27855 |
(_filter) => _filter.field === field && _filter.isPrimary |
| 27856 |
); |
| 27857 |
const isDisabled = !view.search && !view.filters?.some( |
| 27858 |
(_filter) => !_filter.isLocked && (_filter.value !== void 0 || !isPrimary(_filter.field)) |
| 27859 |
); |
| 27860 |
return /* @__PURE__ */ (0, import_jsx_runtime123.jsx)( |
| 27861 |
import_components24.Button, |
| 27862 |
{ |
| 27863 |
disabled: isDisabled, |
| 27864 |
accessibleWhenDisabled: true, |
| 27865 |
size: "compact", |
| 27866 |
variant: "tertiary", |
| 27867 |
className: "dataviews-filters__reset-button", |
| 27868 |
onClick: () => { |
| 27869 |
onChangeView({ |
| 27870 |
...view, |
| 27871 |
page: 1, |
| 27872 |
search: "", |
| 27873 |
filters: view.filters?.filter((f2) => !!f2.isLocked) || [] |
| 27874 |
}); |
| 27875 |
}, |
| 27876 |
children: (0, import_i18n33.__)("Reset") |
| 27877 |
} |
| 27878 |
); |
| 27879 |
} |
| 27880 |
|
| 27881 |
// packages/dataviews/build-module/components/dataviews-filters/use-filters.mjs |
| 27882 |
var import_element94 = __toESM(require_element(), 1); |
| 27883 |
function useFilters(fields2, view) { |
| 27884 |
return (0, import_element94.useMemo)(() => { |
| 27885 |
const filters = []; |
| 27886 |
fields2.forEach((field) => { |
| 27887 |
if (field.filterBy === false || !field.hasElements && !field.Edit) { |
| 27888 |
return; |
| 27889 |
} |
| 27890 |
const operators = field.filterBy.operators; |
| 27891 |
const isPrimary = !!field.filterBy?.isPrimary; |
| 27892 |
const isLocked = view.filters?.some( |
| 27893 |
(f2) => f2.field === field.id && !!f2.isLocked |
| 27894 |
) ?? false; |
| 27895 |
filters.push({ |
| 27896 |
field: field.id, |
| 27897 |
name: field.label, |
| 27898 |
elements: field.elements, |
| 27899 |
getElements: field.getElements, |
| 27900 |
hasElements: field.hasElements, |
| 27901 |
singleSelection: operators.some( |
| 27902 |
(op) => isSingleSelectionOperator(op) |
| 27903 |
), |
| 27904 |
operators, |
| 27905 |
isVisible: isLocked || isPrimary || !!view.filters?.some( |
| 27906 |
(f2) => f2.field === field.id && isRegisteredOperator(f2.operator) |
| 27907 |
), |
| 27908 |
isPrimary, |
| 27909 |
isLocked |
| 27910 |
}); |
| 27911 |
}); |
| 27912 |
filters.sort((a2, b2) => { |
| 27913 |
if (a2.isLocked && !b2.isLocked) { |
| 27914 |
return -1; |
| 27915 |
} |
| 27916 |
if (!a2.isLocked && b2.isLocked) { |
| 27917 |
return 1; |
| 27918 |
} |
| 27919 |
if (a2.isPrimary && !b2.isPrimary) { |
| 27920 |
return -1; |
| 27921 |
} |
| 27922 |
if (!a2.isPrimary && b2.isPrimary) { |
| 27923 |
return 1; |
| 27924 |
} |
| 27925 |
return a2.name.localeCompare(b2.name); |
| 27926 |
}); |
| 27927 |
return filters; |
| 27928 |
}, [fields2, view]); |
| 27929 |
} |
| 27930 |
var use_filters_default = useFilters; |
| 27931 |
|
| 27932 |
// packages/dataviews/build-module/components/dataviews-filters/filters.mjs |
| 27933 |
var import_jsx_runtime124 = __toESM(require_jsx_runtime(), 1); |
| 27934 |
function Filters({ className }) { |
| 27935 |
const { fields: fields2, view, onChangeView, openedFilter, setOpenedFilter } = (0, import_element95.useContext)(dataviews_context_default); |
| 27936 |
const addFilterRef = (0, import_element95.useRef)(null); |
| 27937 |
const filters = use_filters_default(fields2, view); |
| 27938 |
const addFilter = /* @__PURE__ */ (0, import_jsx_runtime124.jsx)( |
| 27939 |
add_filter_default, |
| 27940 |
{ |
| 27941 |
filters, |
| 27942 |
view, |
| 27943 |
onChangeView, |
| 27944 |
ref: addFilterRef, |
| 27945 |
setOpenedFilter |
| 27946 |
}, |
| 27947 |
"add-filter" |
| 27948 |
); |
| 27949 |
const visibleFilters = filters.filter((filter) => filter.isVisible); |
| 27950 |
if (visibleFilters.length === 0) { |
| 27951 |
return null; |
| 27952 |
} |
| 27953 |
const filterComponents = [ |
| 27954 |
...visibleFilters.map((filter) => { |
| 27955 |
return /* @__PURE__ */ (0, import_jsx_runtime124.jsx)( |
| 27956 |
Filter, |
| 27957 |
{ |
| 27958 |
filter, |
| 27959 |
view, |
| 27960 |
fields: fields2, |
| 27961 |
onChangeView, |
| 27962 |
addFilterRef, |
| 27963 |
openedFilter |
| 27964 |
}, |
| 27965 |
filter.field |
| 27966 |
); |
| 27967 |
}), |
| 27968 |
addFilter |
| 27969 |
]; |
| 27970 |
filterComponents.push( |
| 27971 |
/* @__PURE__ */ (0, import_jsx_runtime124.jsx)( |
| 27972 |
ResetFilter, |
| 27973 |
{ |
| 27974 |
filters, |
| 27975 |
view, |
| 27976 |
onChangeView |
| 27977 |
}, |
| 27978 |
"reset-filters" |
| 27979 |
) |
| 27980 |
); |
| 27981 |
return /* @__PURE__ */ (0, import_jsx_runtime124.jsx)( |
| 27982 |
Stack, |
| 27983 |
{ |
| 27984 |
direction: "row", |
| 27985 |
justify: "flex-start", |
| 27986 |
gap: "sm", |
| 27987 |
style: { width: "fit-content" }, |
| 27988 |
wrap: "wrap", |
| 27989 |
className, |
| 27990 |
children: filterComponents |
| 27991 |
} |
| 27992 |
); |
| 27993 |
} |
| 27994 |
var filters_default = (0, import_element95.memo)(Filters); |
| 27995 |
|
| 27996 |
// packages/dataviews/build-module/components/dataviews-filters/toggle.mjs |
| 27997 |
var import_element96 = __toESM(require_element(), 1); |
| 27998 |
var import_components25 = __toESM(require_components(), 1); |
| 27999 |
var import_i18n34 = __toESM(require_i18n(), 1); |
| 28000 |
var import_jsx_runtime125 = __toESM(require_jsx_runtime(), 1); |
| 28001 |
function FiltersToggle() { |
| 28002 |
const { |
| 28003 |
filters, |
| 28004 |
view, |
| 28005 |
onChangeView, |
| 28006 |
setOpenedFilter, |
| 28007 |
isShowingFilter, |
| 28008 |
setIsShowingFilter |
| 28009 |
} = (0, import_element96.useContext)(dataviews_context_default); |
| 28010 |
const buttonRef = (0, import_element96.useRef)(null); |
| 28011 |
const onChangeViewWithFilterVisibility = (0, import_element96.useCallback)( |
| 28012 |
(_view) => { |
| 28013 |
onChangeView(_view); |
| 28014 |
setIsShowingFilter(true); |
| 28015 |
}, |
| 28016 |
[onChangeView, setIsShowingFilter] |
| 28017 |
); |
| 28018 |
if (filters.length === 0) { |
| 28019 |
return null; |
| 28020 |
} |
| 28021 |
const hasVisibleFilters = filters.some((filter) => filter.isVisible); |
| 28022 |
const addFilterButtonProps = { |
| 28023 |
label: (0, import_i18n34.__)("Add filter"), |
| 28024 |
"aria-expanded": false, |
| 28025 |
isPressed: false |
| 28026 |
}; |
| 28027 |
const toggleFiltersButtonProps = { |
| 28028 |
label: (0, import_i18n34._x)("Filter", "verb"), |
| 28029 |
"aria-expanded": isShowingFilter, |
| 28030 |
isPressed: isShowingFilter, |
| 28031 |
onClick: () => { |
| 28032 |
if (!isShowingFilter) { |
| 28033 |
setOpenedFilter(null); |
| 28034 |
} |
| 28035 |
setIsShowingFilter(!isShowingFilter); |
| 28036 |
} |
| 28037 |
}; |
| 28038 |
const hasPrimaryOrLockedFilters = filters.some( |
| 28039 |
(filter) => filter.isPrimary || filter.isLocked |
| 28040 |
); |
| 28041 |
const buttonComponent = /* @__PURE__ */ (0, import_jsx_runtime125.jsx)( |
| 28042 |
import_components25.Button, |
| 28043 |
{ |
| 28044 |
ref: buttonRef, |
| 28045 |
className: "dataviews-filters__visibility-toggle", |
| 28046 |
size: "compact", |
| 28047 |
icon: funnel_default, |
| 28048 |
disabled: hasPrimaryOrLockedFilters, |
| 28049 |
accessibleWhenDisabled: true, |
| 28050 |
...hasVisibleFilters ? toggleFiltersButtonProps : addFilterButtonProps |
| 28051 |
} |
| 28052 |
); |
| 28053 |
return /* @__PURE__ */ (0, import_jsx_runtime125.jsx)("div", { className: "dataviews-filters__container-visibility-toggle", children: !hasVisibleFilters ? /* @__PURE__ */ (0, import_jsx_runtime125.jsx)( |
| 28054 |
AddFilterMenu, |
| 28055 |
{ |
| 28056 |
filters, |
| 28057 |
view, |
| 28058 |
onChangeView: onChangeViewWithFilterVisibility, |
| 28059 |
setOpenedFilter, |
| 28060 |
triggerProps: { render: buttonComponent } |
| 28061 |
} |
| 28062 |
) : /* @__PURE__ */ (0, import_jsx_runtime125.jsx)( |
| 28063 |
FilterVisibilityToggle, |
| 28064 |
{ |
| 28065 |
buttonRef, |
| 28066 |
filtersCount: view.filters?.length, |
| 28067 |
children: buttonComponent |
| 28068 |
} |
| 28069 |
) }); |
| 28070 |
} |
| 28071 |
function FilterVisibilityToggle({ |
| 28072 |
buttonRef, |
| 28073 |
filtersCount, |
| 28074 |
children |
| 28075 |
}) { |
| 28076 |
(0, import_element96.useEffect)( |
| 28077 |
() => () => { |
| 28078 |
buttonRef.current?.focus(); |
| 28079 |
}, |
| 28080 |
[buttonRef] |
| 28081 |
); |
| 28082 |
return /* @__PURE__ */ (0, import_jsx_runtime125.jsxs)(import_jsx_runtime125.Fragment, { children: [ |
| 28083 |
children, |
| 28084 |
!!filtersCount && /* @__PURE__ */ (0, import_jsx_runtime125.jsx)("span", { className: "dataviews-filters-toggle__count", children: filtersCount }) |
| 28085 |
] }); |
| 28086 |
} |
| 28087 |
var toggle_default = FiltersToggle; |
| 28088 |
|
| 28089 |
// packages/dataviews/build-module/components/dataviews-filters/filters-toggled.mjs |
| 28090 |
var import_element97 = __toESM(require_element(), 1); |
| 28091 |
var import_jsx_runtime126 = __toESM(require_jsx_runtime(), 1); |
| 28092 |
function FiltersToggled(props) { |
| 28093 |
const { isShowingFilter } = (0, import_element97.useContext)(dataviews_context_default); |
| 28094 |
if (!isShowingFilter) { |
| 28095 |
return null; |
| 28096 |
} |
| 28097 |
return /* @__PURE__ */ (0, import_jsx_runtime126.jsx)(filters_default, { ...props }); |
| 28098 |
} |
| 28099 |
var filters_toggled_default = FiltersToggled; |
| 28100 |
|
| 28101 |
// packages/dataviews/build-module/components/dataviews-layout/index.mjs |
| 28102 |
var import_element98 = __toESM(require_element(), 1); |
| 28103 |
var import_components26 = __toESM(require_components(), 1); |
| 28104 |
var import_i18n35 = __toESM(require_i18n(), 1); |
| 28105 |
var import_jsx_runtime127 = __toESM(require_jsx_runtime(), 1); |
| 28106 |
function DataViewsLayout({ className }) { |
| 28107 |
const { |
| 28108 |
actions = [], |
| 28109 |
data, |
| 28110 |
fields: fields2, |
| 28111 |
getItemId: getItemId2, |
| 28112 |
getItemLevel, |
| 28113 |
hasInitiallyLoaded, |
| 28114 |
isLoading, |
| 28115 |
view, |
| 28116 |
onChangeView, |
| 28117 |
selection, |
| 28118 |
onChangeSelection, |
| 28119 |
setOpenedFilter, |
| 28120 |
onClickItem, |
| 28121 |
isItemClickable: isItemClickable2, |
| 28122 |
renderItemLink, |
| 28123 |
defaultLayouts, |
| 28124 |
containerRef, |
| 28125 |
empty = /* @__PURE__ */ (0, import_jsx_runtime127.jsx)("p", { children: (0, import_i18n35.__)("No results") }) |
| 28126 |
} = (0, import_element98.useContext)(dataviews_context_default); |
| 28127 |
const isDelayedInitialLoading = useDelayedLoading(!hasInitiallyLoaded, { |
| 28128 |
delay: 200 |
| 28129 |
}); |
| 28130 |
if (!hasInitiallyLoaded) { |
| 28131 |
if (!isDelayedInitialLoading) { |
| 28132 |
return null; |
| 28133 |
} |
| 28134 |
return /* @__PURE__ */ (0, import_jsx_runtime127.jsx)("div", { className: "dataviews-loading", children: /* @__PURE__ */ (0, import_jsx_runtime127.jsx)("p", { children: /* @__PURE__ */ (0, import_jsx_runtime127.jsx)(import_components26.Spinner, {}) }) }); |
| 28135 |
} |
| 28136 |
const ViewComponent = VIEW_LAYOUTS.find( |
| 28137 |
(v2) => v2.type === view.type && defaultLayouts[v2.type] |
| 28138 |
)?.component; |
| 28139 |
return /* @__PURE__ */ (0, import_jsx_runtime127.jsx)("div", { className: "dataviews-layout__container", ref: containerRef, children: /* @__PURE__ */ (0, import_jsx_runtime127.jsx)( |
| 28140 |
ViewComponent, |
| 28141 |
{ |
| 28142 |
className, |
| 28143 |
actions, |
| 28144 |
data, |
| 28145 |
fields: fields2, |
| 28146 |
getItemId: getItemId2, |
| 28147 |
getItemLevel, |
| 28148 |
isLoading, |
| 28149 |
onChangeView, |
| 28150 |
onChangeSelection, |
| 28151 |
selection, |
| 28152 |
setOpenedFilter, |
| 28153 |
onClickItem, |
| 28154 |
renderItemLink, |
| 28155 |
isItemClickable: isItemClickable2, |
| 28156 |
view, |
| 28157 |
empty |
| 28158 |
} |
| 28159 |
) }); |
| 28160 |
} |
| 28161 |
|
| 28162 |
// packages/dataviews/build-module/components/dataviews-search/index.mjs |
| 28163 |
var import_i18n36 = __toESM(require_i18n(), 1); |
| 28164 |
var import_element99 = __toESM(require_element(), 1); |
| 28165 |
var import_components27 = __toESM(require_components(), 1); |
| 28166 |
var import_compose13 = __toESM(require_compose(), 1); |
| 28167 |
var import_jsx_runtime128 = __toESM(require_jsx_runtime(), 1); |
| 28168 |
var DataViewsSearch = (0, import_element99.memo)(function Search({ label }) { |
| 28169 |
const { view, onChangeView } = (0, import_element99.useContext)(dataviews_context_default); |
| 28170 |
const [search, setSearch, debouncedSearch] = (0, import_compose13.useDebouncedInput)( |
| 28171 |
view.search |
| 28172 |
); |
| 28173 |
(0, import_element99.useEffect)(() => { |
| 28174 |
if (view.search !== debouncedSearch) { |
| 28175 |
setSearch(view.search ?? ""); |
| 28176 |
} |
| 28177 |
}, [view.search, setSearch]); |
| 28178 |
const onChangeViewRef = (0, import_element99.useRef)(onChangeView); |
| 28179 |
const viewRef = (0, import_element99.useRef)(view); |
| 28180 |
(0, import_element99.useEffect)(() => { |
| 28181 |
onChangeViewRef.current = onChangeView; |
| 28182 |
viewRef.current = view; |
| 28183 |
}, [onChangeView, view]); |
| 28184 |
(0, import_element99.useEffect)(() => { |
| 28185 |
if (debouncedSearch !== viewRef.current?.search) { |
| 28186 |
onChangeViewRef.current({ |
| 28187 |
...viewRef.current, |
| 28188 |
page: view.page ? 1 : void 0, |
| 28189 |
startPosition: view.startPosition ? 1 : void 0, |
| 28190 |
search: debouncedSearch |
| 28191 |
}); |
| 28192 |
} |
| 28193 |
}, [debouncedSearch]); |
| 28194 |
const searchLabel = label || (0, import_i18n36.__)("Search"); |
| 28195 |
return /* @__PURE__ */ (0, import_jsx_runtime128.jsx)( |
| 28196 |
import_components27.SearchControl, |
| 28197 |
{ |
| 28198 |
className: "dataviews-search", |
| 28199 |
onChange: setSearch, |
| 28200 |
value: search, |
| 28201 |
label: searchLabel, |
| 28202 |
placeholder: searchLabel, |
| 28203 |
size: "compact" |
| 28204 |
} |
| 28205 |
); |
| 28206 |
}); |
| 28207 |
var dataviews_search_default = DataViewsSearch; |
| 28208 |
|
| 28209 |
// packages/dataviews/build-module/components/dataviews-view-config/index.mjs |
| 28210 |
var import_components28 = __toESM(require_components(), 1); |
| 28211 |
var import_i18n37 = __toESM(require_i18n(), 1); |
| 28212 |
var import_element100 = __toESM(require_element(), 1); |
| 28213 |
var import_warning = __toESM(require_warning(), 1); |
| 28214 |
var import_compose14 = __toESM(require_compose(), 1); |
| 28215 |
var import_jsx_runtime129 = __toESM(require_jsx_runtime(), 1); |
| 28216 |
var { Menu: Menu6 } = unlock3(import_components28.privateApis); |
| 28217 |
var DATAVIEWS_CONFIG_POPOVER_PROPS = { |
| 28218 |
className: "dataviews-config__popover", |
| 28219 |
placement: "bottom-end", |
| 28220 |
offset: 9 |
| 28221 |
}; |
| 28222 |
function ViewTypeMenu() { |
| 28223 |
const { view, onChangeView, defaultLayouts } = (0, import_element100.useContext)(dataviews_context_default); |
| 28224 |
const availableLayouts = Object.keys(defaultLayouts); |
| 28225 |
if (availableLayouts.length <= 1) { |
| 28226 |
return null; |
| 28227 |
} |
| 28228 |
const activeView = VIEW_LAYOUTS.find((v2) => view.type === v2.type); |
| 28229 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsxs)(Menu6, { children: [ |
| 28230 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28231 |
Menu6.TriggerButton, |
| 28232 |
{ |
| 28233 |
render: /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28234 |
import_components28.Button, |
| 28235 |
{ |
| 28236 |
size: "compact", |
| 28237 |
icon: activeView?.icon, |
| 28238 |
label: (0, import_i18n37.__)("Layout") |
| 28239 |
} |
| 28240 |
) |
| 28241 |
} |
| 28242 |
), |
| 28243 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(Menu6.Popover, { children: availableLayouts.map((layout) => { |
| 28244 |
const config = VIEW_LAYOUTS.find( |
| 28245 |
(v2) => v2.type === layout |
| 28246 |
); |
| 28247 |
if (!config) { |
| 28248 |
return null; |
| 28249 |
} |
| 28250 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28251 |
Menu6.RadioItem, |
| 28252 |
{ |
| 28253 |
value: layout, |
| 28254 |
name: "view-actions-available-view", |
| 28255 |
checked: layout === view.type, |
| 28256 |
hideOnClick: true, |
| 28257 |
onChange: (e2) => { |
| 28258 |
switch (e2.target.value) { |
| 28259 |
case "list": |
| 28260 |
case "grid": |
| 28261 |
case "table": |
| 28262 |
case "pickerGrid": |
| 28263 |
case "pickerTable": |
| 28264 |
case "activity": |
| 28265 |
const viewWithoutLayout = { ...view }; |
| 28266 |
if ("layout" in viewWithoutLayout) { |
| 28267 |
delete viewWithoutLayout.layout; |
| 28268 |
} |
| 28269 |
return onChangeView({ |
| 28270 |
...viewWithoutLayout, |
| 28271 |
type: e2.target.value, |
| 28272 |
...defaultLayouts[e2.target.value] |
| 28273 |
}); |
| 28274 |
} |
| 28275 |
(0, import_warning.default)("Invalid dataview"); |
| 28276 |
}, |
| 28277 |
children: /* @__PURE__ */ (0, import_jsx_runtime129.jsx)(Menu6.ItemLabel, { children: config.label }) |
| 28278 |
}, |
| 28279 |
layout |
| 28280 |
); |
| 28281 |
}) }) |
| 28282 |
] }); |
| 28283 |
} |
| 28284 |
function SortFieldControl() { |
| 28285 |
const { view, fields: fields2, onChangeView } = (0, import_element100.useContext)(dataviews_context_default); |
| 28286 |
const orderOptions = (0, import_element100.useMemo)(() => { |
| 28287 |
const sortableFields = fields2.filter( |
| 28288 |
(field) => field.enableSorting !== false |
| 28289 |
); |
| 28290 |
return sortableFields.map((field) => { |
| 28291 |
return { |
| 28292 |
label: field.label, |
| 28293 |
value: field.id |
| 28294 |
}; |
| 28295 |
}); |
| 28296 |
}, [fields2]); |
| 28297 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28298 |
import_components28.SelectControl, |
| 28299 |
{ |
| 28300 |
__next40pxDefaultSize: true, |
| 28301 |
label: (0, import_i18n37.__)("Sort by"), |
| 28302 |
value: view.sort?.field, |
| 28303 |
options: orderOptions, |
| 28304 |
onChange: (value) => { |
| 28305 |
onChangeView({ |
| 28306 |
...view, |
| 28307 |
sort: { |
| 28308 |
direction: view?.sort?.direction || "desc", |
| 28309 |
field: value |
| 28310 |
}, |
| 28311 |
showLevels: false |
| 28312 |
}); |
| 28313 |
} |
| 28314 |
} |
| 28315 |
); |
| 28316 |
} |
| 28317 |
function SortDirectionControl() { |
| 28318 |
const { view, fields: fields2, onChangeView } = (0, import_element100.useContext)(dataviews_context_default); |
| 28319 |
const sortableFields = fields2.filter( |
| 28320 |
(field) => field.enableSorting !== false |
| 28321 |
); |
| 28322 |
if (sortableFields.length === 0) { |
| 28323 |
return null; |
| 28324 |
} |
| 28325 |
let value = view.sort?.direction; |
| 28326 |
if (!value && view.sort?.field) { |
| 28327 |
value = "desc"; |
| 28328 |
} |
| 28329 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28330 |
import_components28.__experimentalToggleGroupControl, |
| 28331 |
{ |
| 28332 |
className: "dataviews-view-config__sort-direction", |
| 28333 |
__next40pxDefaultSize: true, |
| 28334 |
isBlock: true, |
| 28335 |
label: (0, import_i18n37.__)("Order"), |
| 28336 |
value, |
| 28337 |
onChange: (newDirection) => { |
| 28338 |
if (newDirection === "asc" || newDirection === "desc") { |
| 28339 |
onChangeView({ |
| 28340 |
...view, |
| 28341 |
sort: { |
| 28342 |
direction: newDirection, |
| 28343 |
field: view.sort?.field || // If there is no field assigned as the sorting field assign the first sortable field. |
| 28344 |
fields2.find( |
| 28345 |
(field) => field.enableSorting !== false |
| 28346 |
)?.id || "" |
| 28347 |
}, |
| 28348 |
showLevels: false |
| 28349 |
}); |
| 28350 |
return; |
| 28351 |
} |
| 28352 |
(0, import_warning.default)("Invalid direction"); |
| 28353 |
}, |
| 28354 |
children: SORTING_DIRECTIONS.map((direction) => { |
| 28355 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28356 |
import_components28.__experimentalToggleGroupControlOptionIcon, |
| 28357 |
{ |
| 28358 |
value: direction, |
| 28359 |
icon: sortIcons[direction], |
| 28360 |
label: sortLabels[direction] |
| 28361 |
}, |
| 28362 |
direction |
| 28363 |
); |
| 28364 |
}) |
| 28365 |
} |
| 28366 |
); |
| 28367 |
} |
| 28368 |
function ItemsPerPageControl() { |
| 28369 |
const { view, config, onChangeView } = (0, import_element100.useContext)(dataviews_context_default); |
| 28370 |
const { infiniteScrollEnabled } = view; |
| 28371 |
if (!config || !config.perPageSizes || config.perPageSizes.length < 2 || config.perPageSizes.length > 6 || infiniteScrollEnabled) { |
| 28372 |
return null; |
| 28373 |
} |
| 28374 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28375 |
import_components28.__experimentalToggleGroupControl, |
| 28376 |
{ |
| 28377 |
__next40pxDefaultSize: true, |
| 28378 |
isBlock: true, |
| 28379 |
label: (0, import_i18n37.__)("Items per page"), |
| 28380 |
value: view.perPage || 10, |
| 28381 |
disabled: !view?.sort?.field, |
| 28382 |
onChange: (newItemsPerPage) => { |
| 28383 |
const newItemsPerPageNumber = typeof newItemsPerPage === "number" || newItemsPerPage === void 0 ? newItemsPerPage : parseInt(newItemsPerPage, 10); |
| 28384 |
onChangeView({ |
| 28385 |
...view, |
| 28386 |
perPage: newItemsPerPageNumber, |
| 28387 |
page: 1 |
| 28388 |
}); |
| 28389 |
}, |
| 28390 |
children: config.perPageSizes.map((value) => { |
| 28391 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28392 |
import_components28.__experimentalToggleGroupControlOption, |
| 28393 |
{ |
| 28394 |
value, |
| 28395 |
label: value.toString() |
| 28396 |
}, |
| 28397 |
value |
| 28398 |
); |
| 28399 |
}) |
| 28400 |
} |
| 28401 |
); |
| 28402 |
} |
| 28403 |
function ResetViewButton() { |
| 28404 |
const { onReset } = (0, import_element100.useContext)(dataviews_context_default); |
| 28405 |
if (onReset === void 0) { |
| 28406 |
return null; |
| 28407 |
} |
| 28408 |
const isDisabled = onReset === false; |
| 28409 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28410 |
import_components28.Button, |
| 28411 |
{ |
| 28412 |
variant: "tertiary", |
| 28413 |
size: "compact", |
| 28414 |
disabled: isDisabled, |
| 28415 |
accessibleWhenDisabled: true, |
| 28416 |
className: "dataviews-view-config__reset-button", |
| 28417 |
onClick: () => { |
| 28418 |
if (typeof onReset === "function") { |
| 28419 |
onReset(); |
| 28420 |
} |
| 28421 |
}, |
| 28422 |
children: (0, import_i18n37.__)("Reset view") |
| 28423 |
} |
| 28424 |
); |
| 28425 |
} |
| 28426 |
function DataviewsViewConfigDropdown() { |
| 28427 |
const { view, onReset } = (0, import_element100.useContext)(dataviews_context_default); |
| 28428 |
const popoverId = (0, import_compose14.useInstanceId)( |
| 28429 |
_DataViewsViewConfig, |
| 28430 |
"dataviews-view-config-dropdown" |
| 28431 |
); |
| 28432 |
const activeLayout = VIEW_LAYOUTS.find( |
| 28433 |
(layout) => layout.type === view.type |
| 28434 |
); |
| 28435 |
const isModified = typeof onReset === "function"; |
| 28436 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28437 |
import_components28.Dropdown, |
| 28438 |
{ |
| 28439 |
expandOnMobile: true, |
| 28440 |
popoverProps: { |
| 28441 |
...DATAVIEWS_CONFIG_POPOVER_PROPS, |
| 28442 |
id: popoverId |
| 28443 |
}, |
| 28444 |
renderToggle: ({ onToggle, isOpen }) => { |
| 28445 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsxs)("div", { className: "dataviews-view-config__toggle-wrapper", children: [ |
| 28446 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28447 |
import_components28.Button, |
| 28448 |
{ |
| 28449 |
size: "compact", |
| 28450 |
icon: cog_default, |
| 28451 |
label: (0, import_i18n37._x)( |
| 28452 |
"View options", |
| 28453 |
"View is used as a noun" |
| 28454 |
), |
| 28455 |
onClick: onToggle, |
| 28456 |
"aria-expanded": isOpen ? "true" : "false", |
| 28457 |
"aria-controls": popoverId |
| 28458 |
} |
| 28459 |
), |
| 28460 |
isModified && /* @__PURE__ */ (0, import_jsx_runtime129.jsx)("span", { className: "dataviews-view-config__modified-indicator" }) |
| 28461 |
] }); |
| 28462 |
}, |
| 28463 |
renderContent: () => /* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28464 |
import_components28.__experimentalDropdownContentWrapper, |
| 28465 |
{ |
| 28466 |
paddingSize: "medium", |
| 28467 |
className: "dataviews-config__popover-content-wrapper", |
| 28468 |
children: /* @__PURE__ */ (0, import_jsx_runtime129.jsxs)( |
| 28469 |
Stack, |
| 28470 |
{ |
| 28471 |
direction: "column", |
| 28472 |
className: "dataviews-view-config", |
| 28473 |
gap: "xl", |
| 28474 |
children: [ |
| 28475 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsxs)( |
| 28476 |
Stack, |
| 28477 |
{ |
| 28478 |
direction: "row", |
| 28479 |
justify: "space-between", |
| 28480 |
align: "center", |
| 28481 |
className: "dataviews-view-config__header", |
| 28482 |
children: [ |
| 28483 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)( |
| 28484 |
import_components28.__experimentalHeading, |
| 28485 |
{ |
| 28486 |
level: 2, |
| 28487 |
className: "dataviews-settings-section__title", |
| 28488 |
children: (0, import_i18n37.__)("Appearance") |
| 28489 |
} |
| 28490 |
), |
| 28491 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(ResetViewButton, {}) |
| 28492 |
] |
| 28493 |
} |
| 28494 |
), |
| 28495 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsxs)(Stack, { direction: "column", gap: "lg", children: [ |
| 28496 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsxs)( |
| 28497 |
Stack, |
| 28498 |
{ |
| 28499 |
direction: "row", |
| 28500 |
gap: "sm", |
| 28501 |
className: "dataviews-view-config__sort-controls", |
| 28502 |
children: [ |
| 28503 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(SortFieldControl, {}), |
| 28504 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(SortDirectionControl, {}) |
| 28505 |
] |
| 28506 |
} |
| 28507 |
), |
| 28508 |
!!activeLayout?.viewConfigOptions && /* @__PURE__ */ (0, import_jsx_runtime129.jsx)(activeLayout.viewConfigOptions, {}), |
| 28509 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(ItemsPerPageControl, {}), |
| 28510 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(PropertiesSection, {}) |
| 28511 |
] }) |
| 28512 |
] |
| 28513 |
} |
| 28514 |
) |
| 28515 |
} |
| 28516 |
) |
| 28517 |
} |
| 28518 |
); |
| 28519 |
} |
| 28520 |
function _DataViewsViewConfig() { |
| 28521 |
return /* @__PURE__ */ (0, import_jsx_runtime129.jsxs)(import_jsx_runtime129.Fragment, { children: [ |
| 28522 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(ViewTypeMenu, {}), |
| 28523 |
/* @__PURE__ */ (0, import_jsx_runtime129.jsx)(DataviewsViewConfigDropdown, {}) |
| 28524 |
] }); |
| 28525 |
} |
| 28526 |
var DataViewsViewConfig = (0, import_element100.memo)(_DataViewsViewConfig); |
| 28527 |
var dataviews_view_config_default = DataViewsViewConfig; |
| 28528 |
|
| 28529 |
// packages/dataviews/build-module/components/dataform-controls/checkbox.mjs |
| 28530 |
var import_components29 = __toESM(require_components(), 1); |
| 28531 |
var import_element101 = __toESM(require_element(), 1); |
| 28532 |
|
| 28533 |
// packages/dataviews/build-module/components/dataform-controls/utils/get-custom-validity.mjs |
| 28534 |
function getCustomValidity(isValid2, validity) { |
| 28535 |
let customValidity; |
| 28536 |
if (isValid2?.required && validity?.required) { |
| 28537 |
customValidity = validity?.required?.message ? validity.required : void 0; |
| 28538 |
} else if (isValid2?.pattern && validity?.pattern) { |
| 28539 |
customValidity = validity.pattern; |
| 28540 |
} else if (isValid2?.min && validity?.min) { |
| 28541 |
customValidity = validity.min; |
| 28542 |
} else if (isValid2?.max && validity?.max) { |
| 28543 |
customValidity = validity.max; |
| 28544 |
} else if (isValid2?.minLength && validity?.minLength) { |
| 28545 |
customValidity = validity.minLength; |
| 28546 |
} else if (isValid2?.maxLength && validity?.maxLength) { |
| 28547 |
customValidity = validity.maxLength; |
| 28548 |
} else if (isValid2?.elements && validity?.elements) { |
| 28549 |
customValidity = validity.elements; |
| 28550 |
} else if (validity?.custom) { |
| 28551 |
customValidity = validity.custom; |
| 28552 |
} |
| 28553 |
return customValidity; |
| 28554 |
} |
| 28555 |
|
| 28556 |
// packages/dataviews/build-module/components/dataform-controls/checkbox.mjs |
| 28557 |
var import_jsx_runtime130 = __toESM(require_jsx_runtime(), 1); |
| 28558 |
var { ValidatedCheckboxControl } = unlock3(import_components29.privateApis); |
| 28559 |
function Checkbox({ |
| 28560 |
field, |
| 28561 |
onChange, |
| 28562 |
data, |
| 28563 |
hideLabelFromVision, |
| 28564 |
markWhenOptional, |
| 28565 |
validity |
| 28566 |
}) { |
| 28567 |
const { getValue, setValue, label, description, isValid: isValid2 } = field; |
| 28568 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 28569 |
const onChangeControl = (0, import_element101.useCallback)(() => { |
| 28570 |
onChange( |
| 28571 |
setValue({ item: data, value: !getValue({ item: data }) }) |
| 28572 |
); |
| 28573 |
}, [data, getValue, onChange, setValue]); |
| 28574 |
return /* @__PURE__ */ (0, import_jsx_runtime130.jsx)( |
| 28575 |
ValidatedCheckboxControl, |
| 28576 |
{ |
| 28577 |
required: !!field.isValid?.required, |
| 28578 |
markWhenOptional, |
| 28579 |
customValidity: getCustomValidity(isValid2, validity), |
| 28580 |
hidden: hideLabelFromVision, |
| 28581 |
label, |
| 28582 |
help: description, |
| 28583 |
checked: getValue({ item: data }), |
| 28584 |
onChange: onChangeControl, |
| 28585 |
disabled: disabled2 |
| 28586 |
} |
| 28587 |
); |
| 28588 |
} |
| 28589 |
|
| 28590 |
// packages/dataviews/build-module/components/dataform-controls/combobox.mjs |
| 28591 |
var import_components30 = __toESM(require_components(), 1); |
| 28592 |
var import_element102 = __toESM(require_element(), 1); |
| 28593 |
var import_jsx_runtime131 = __toESM(require_jsx_runtime(), 1); |
| 28594 |
var { ValidatedComboboxControl } = unlock3(import_components30.privateApis); |
| 28595 |
function Combobox3({ |
| 28596 |
data, |
| 28597 |
field, |
| 28598 |
onChange, |
| 28599 |
hideLabelFromVision, |
| 28600 |
validity |
| 28601 |
}) { |
| 28602 |
const { label, description, placeholder, getValue, setValue, isValid: isValid2 } = field; |
| 28603 |
const value = getValue({ item: data }) ?? ""; |
| 28604 |
const onChangeControl = (0, import_element102.useCallback)( |
| 28605 |
(newValue) => onChange(setValue({ item: data, value: newValue ?? "" })), |
| 28606 |
[data, onChange, setValue] |
| 28607 |
); |
| 28608 |
const { elements, isLoading } = useElements({ |
| 28609 |
elements: field.elements, |
| 28610 |
getElements: field.getElements |
| 28611 |
}); |
| 28612 |
if (isLoading) { |
| 28613 |
return /* @__PURE__ */ (0, import_jsx_runtime131.jsx)(import_components30.Spinner, {}); |
| 28614 |
} |
| 28615 |
return /* @__PURE__ */ (0, import_jsx_runtime131.jsx)( |
| 28616 |
ValidatedComboboxControl, |
| 28617 |
{ |
| 28618 |
required: !!field.isValid?.required, |
| 28619 |
customValidity: getCustomValidity(isValid2, validity), |
| 28620 |
label, |
| 28621 |
value, |
| 28622 |
help: description, |
| 28623 |
placeholder, |
| 28624 |
options: elements, |
| 28625 |
onChange: onChangeControl, |
| 28626 |
hideLabelFromVision, |
| 28627 |
allowReset: true, |
| 28628 |
expandOnFocus: true |
| 28629 |
} |
| 28630 |
); |
| 28631 |
} |
| 28632 |
|
| 28633 |
// packages/dataviews/build-module/components/dataform-controls/datetime.mjs |
| 28634 |
var import_components32 = __toESM(require_components(), 1); |
| 28635 |
var import_element105 = __toESM(require_element(), 1); |
| 28636 |
var import_i18n39 = __toESM(require_i18n(), 1); |
| 28637 |
var import_date3 = __toESM(require_date(), 1); |
| 28638 |
|
| 28639 |
// packages/dataviews/build-module/components/dataform-controls/utils/relative-date-control.mjs |
| 28640 |
var import_components31 = __toESM(require_components(), 1); |
| 28641 |
var import_element103 = __toESM(require_element(), 1); |
| 28642 |
var import_i18n38 = __toESM(require_i18n(), 1); |
| 28643 |
var import_jsx_runtime132 = __toESM(require_jsx_runtime(), 1); |
| 28644 |
var TIME_UNITS_OPTIONS = { |
| 28645 |
[OPERATOR_IN_THE_PAST]: [ |
| 28646 |
{ value: "days", label: (0, import_i18n38.__)("Days") }, |
| 28647 |
{ value: "weeks", label: (0, import_i18n38.__)("Weeks") }, |
| 28648 |
{ value: "months", label: (0, import_i18n38.__)("Months") }, |
| 28649 |
{ value: "years", label: (0, import_i18n38.__)("Years") } |
| 28650 |
], |
| 28651 |
[OPERATOR_OVER]: [ |
| 28652 |
{ value: "days", label: (0, import_i18n38.__)("Days ago") }, |
| 28653 |
{ value: "weeks", label: (0, import_i18n38.__)("Weeks ago") }, |
| 28654 |
{ value: "months", label: (0, import_i18n38.__)("Months ago") }, |
| 28655 |
{ value: "years", label: (0, import_i18n38.__)("Years ago") } |
| 28656 |
] |
| 28657 |
}; |
| 28658 |
function RelativeDateControl({ |
| 28659 |
className, |
| 28660 |
data, |
| 28661 |
field, |
| 28662 |
onChange, |
| 28663 |
hideLabelFromVision, |
| 28664 |
operator |
| 28665 |
}) { |
| 28666 |
const options = TIME_UNITS_OPTIONS[operator === OPERATOR_IN_THE_PAST ? "inThePast" : "over"]; |
| 28667 |
const { id, label, description, getValue, setValue } = field; |
| 28668 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 28669 |
const fieldValue = getValue({ item: data }); |
| 28670 |
const { value: relValue = "", unit = options[0].value } = fieldValue && typeof fieldValue === "object" ? fieldValue : {}; |
| 28671 |
const onChangeValue = (0, import_element103.useCallback)( |
| 28672 |
(newValue) => onChange( |
| 28673 |
setValue({ |
| 28674 |
item: data, |
| 28675 |
value: { value: Number(newValue), unit } |
| 28676 |
}) |
| 28677 |
), |
| 28678 |
[onChange, setValue, data, unit] |
| 28679 |
); |
| 28680 |
const onChangeUnit = (0, import_element103.useCallback)( |
| 28681 |
(newUnit) => onChange( |
| 28682 |
setValue({ |
| 28683 |
item: data, |
| 28684 |
value: { value: relValue, unit: newUnit } |
| 28685 |
}) |
| 28686 |
), |
| 28687 |
[onChange, setValue, data, relValue] |
| 28688 |
); |
| 28689 |
return /* @__PURE__ */ (0, import_jsx_runtime132.jsx)( |
| 28690 |
import_components31.BaseControl, |
| 28691 |
{ |
| 28692 |
id, |
| 28693 |
className: clsx_default(className, "dataviews-controls__relative-date"), |
| 28694 |
label, |
| 28695 |
hideLabelFromVision, |
| 28696 |
help: description, |
| 28697 |
children: /* @__PURE__ */ (0, import_jsx_runtime132.jsxs)(Stack, { direction: "row", gap: "sm", children: [ |
| 28698 |
/* @__PURE__ */ (0, import_jsx_runtime132.jsx)( |
| 28699 |
import_components31.__experimentalNumberControl, |
| 28700 |
{ |
| 28701 |
__next40pxDefaultSize: true, |
| 28702 |
className: "dataviews-controls__relative-date-number", |
| 28703 |
spinControls: "none", |
| 28704 |
min: 1, |
| 28705 |
step: 1, |
| 28706 |
value: relValue, |
| 28707 |
onChange: onChangeValue, |
| 28708 |
disabled: disabled2 |
| 28709 |
} |
| 28710 |
), |
| 28711 |
/* @__PURE__ */ (0, import_jsx_runtime132.jsx)( |
| 28712 |
import_components31.SelectControl, |
| 28713 |
{ |
| 28714 |
className: "dataviews-controls__relative-date-unit", |
| 28715 |
__next40pxDefaultSize: true, |
| 28716 |
label: (0, import_i18n38.__)("Unit"), |
| 28717 |
value: unit, |
| 28718 |
options, |
| 28719 |
onChange: onChangeUnit, |
| 28720 |
hideLabelFromVision: true, |
| 28721 |
disabled: disabled2 |
| 28722 |
} |
| 28723 |
) |
| 28724 |
] }) |
| 28725 |
} |
| 28726 |
); |
| 28727 |
} |
| 28728 |
|
| 28729 |
// packages/dataviews/build-module/components/dataform-controls/utils/use-disabled-date-matchers.mjs |
| 28730 |
var import_element104 = __toESM(require_element(), 1); |
| 28731 |
function useDisabledDateMatchers(isValid2, parseDateFn) { |
| 28732 |
const minConstraint = typeof isValid2.min?.constraint === "string" ? isValid2.min.constraint : void 0; |
| 28733 |
const maxConstraint = typeof isValid2.max?.constraint === "string" ? isValid2.max.constraint : void 0; |
| 28734 |
const disabledMatchers = (0, import_element104.useMemo)(() => { |
| 28735 |
const matchers = []; |
| 28736 |
if (minConstraint) { |
| 28737 |
const minDate = parseDateFn(minConstraint); |
| 28738 |
if (minDate) { |
| 28739 |
matchers.push({ before: minDate }); |
| 28740 |
} |
| 28741 |
} |
| 28742 |
if (maxConstraint) { |
| 28743 |
const maxDate = parseDateFn(maxConstraint); |
| 28744 |
if (maxDate) { |
| 28745 |
matchers.push({ after: maxDate }); |
| 28746 |
} |
| 28747 |
} |
| 28748 |
return matchers.length > 0 ? matchers : void 0; |
| 28749 |
}, [minConstraint, maxConstraint, parseDateFn]); |
| 28750 |
return { minConstraint, maxConstraint, disabledMatchers }; |
| 28751 |
} |
| 28752 |
|
| 28753 |
// packages/dataviews/build-module/field-types/utils/parse-date-time.mjs |
| 28754 |
var import_date2 = __toESM(require_date(), 1); |
| 28755 |
function parseDateTime(dateTimeString) { |
| 28756 |
if (!dateTimeString) { |
| 28757 |
return null; |
| 28758 |
} |
| 28759 |
const parsed = (0, import_date2.getDate)(dateTimeString); |
| 28760 |
return parsed && isValid(parsed) ? parsed : null; |
| 28761 |
} |
| 28762 |
|
| 28763 |
// packages/dataviews/build-module/components/dataform-controls/datetime.mjs |
| 28764 |
var import_jsx_runtime133 = __toESM(require_jsx_runtime(), 1); |
| 28765 |
var { DateCalendar, ValidatedInputControl } = unlock3(import_components32.privateApis); |
| 28766 |
var formatDateTime = (value) => { |
| 28767 |
if (!value) { |
| 28768 |
return ""; |
| 28769 |
} |
| 28770 |
return (0, import_date3.dateI18n)("Y-m-d\\TH:i", (0, import_date3.getDate)(value)); |
| 28771 |
}; |
| 28772 |
function CalendarDateTimeControl({ |
| 28773 |
data, |
| 28774 |
field, |
| 28775 |
onChange, |
| 28776 |
hideLabelFromVision, |
| 28777 |
markWhenOptional, |
| 28778 |
validity, |
| 28779 |
config |
| 28780 |
}) { |
| 28781 |
const { compact } = config || {}; |
| 28782 |
const { id, label, description, setValue, getValue, isValid: isValid2 } = field; |
| 28783 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 28784 |
const fieldValue = getValue({ item: data }); |
| 28785 |
const value = typeof fieldValue === "string" ? fieldValue : void 0; |
| 28786 |
const [calendarMonth, setCalendarMonth] = (0, import_element105.useState)(() => { |
| 28787 |
const parsedDate = parseDateTime(value); |
| 28788 |
return parsedDate || /* @__PURE__ */ new Date(); |
| 28789 |
}); |
| 28790 |
const inputControlRef = (0, import_element105.useRef)(null); |
| 28791 |
const validationTimeoutRef = (0, import_element105.useRef)(void 0); |
| 28792 |
const previousFocusRef = (0, import_element105.useRef)(null); |
| 28793 |
const { minConstraint, maxConstraint, disabledMatchers } = useDisabledDateMatchers(isValid2, parseDateTime); |
| 28794 |
const onChangeCallback = (0, import_element105.useCallback)( |
| 28795 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 28796 |
[data, onChange, setValue] |
| 28797 |
); |
| 28798 |
(0, import_element105.useEffect)(() => { |
| 28799 |
return () => { |
| 28800 |
if (validationTimeoutRef.current) { |
| 28801 |
clearTimeout(validationTimeoutRef.current); |
| 28802 |
} |
| 28803 |
}; |
| 28804 |
}, []); |
| 28805 |
const onSelectDate = (0, import_element105.useCallback)( |
| 28806 |
(newDate) => { |
| 28807 |
let dateTimeValue; |
| 28808 |
if (newDate) { |
| 28809 |
const wpDate = (0, import_date3.dateI18n)("Y-m-d", newDate); |
| 28810 |
let wpTime; |
| 28811 |
if (value) { |
| 28812 |
wpTime = (0, import_date3.dateI18n)("H:i", (0, import_date3.getDate)(value)); |
| 28813 |
} else { |
| 28814 |
wpTime = (0, import_date3.dateI18n)("H:i", newDate); |
| 28815 |
} |
| 28816 |
const finalDateTime = (0, import_date3.getDate)(`${wpDate}T${wpTime}`); |
| 28817 |
dateTimeValue = finalDateTime.toISOString(); |
| 28818 |
onChangeCallback(dateTimeValue); |
| 28819 |
if (validationTimeoutRef.current) { |
| 28820 |
clearTimeout(validationTimeoutRef.current); |
| 28821 |
} |
| 28822 |
} else { |
| 28823 |
onChangeCallback(void 0); |
| 28824 |
} |
| 28825 |
previousFocusRef.current = inputControlRef.current && inputControlRef.current.ownerDocument.activeElement; |
| 28826 |
validationTimeoutRef.current = setTimeout(() => { |
| 28827 |
if (inputControlRef.current) { |
| 28828 |
inputControlRef.current.focus(); |
| 28829 |
inputControlRef.current.blur(); |
| 28830 |
onChangeCallback(dateTimeValue); |
| 28831 |
if (previousFocusRef.current && previousFocusRef.current instanceof HTMLElement) { |
| 28832 |
previousFocusRef.current.focus(); |
| 28833 |
} |
| 28834 |
} |
| 28835 |
}, 0); |
| 28836 |
}, |
| 28837 |
[onChangeCallback, value] |
| 28838 |
); |
| 28839 |
const handleManualDateTimeChange = (0, import_element105.useCallback)( |
| 28840 |
(newValue) => { |
| 28841 |
if (newValue) { |
| 28842 |
const dateTime = (0, import_date3.getDate)(newValue); |
| 28843 |
onChangeCallback(dateTime.toISOString()); |
| 28844 |
const parsedDate = parseDateTime(dateTime.toISOString()); |
| 28845 |
if (parsedDate) { |
| 28846 |
setCalendarMonth(parsedDate); |
| 28847 |
} |
| 28848 |
} else { |
| 28849 |
onChangeCallback(void 0); |
| 28850 |
} |
| 28851 |
}, |
| 28852 |
[onChangeCallback] |
| 28853 |
); |
| 28854 |
const { format: fieldFormat } = field; |
| 28855 |
const weekStartsOn = fieldFormat.weekStartsOn ?? (0, import_date3.getSettings)().l10n.startOfWeek; |
| 28856 |
const { |
| 28857 |
timezone: { string: timezoneString } |
| 28858 |
} = (0, import_date3.getSettings)(); |
| 28859 |
let displayLabel = label; |
| 28860 |
if (isValid2?.required && !markWhenOptional && !hideLabelFromVision) { |
| 28861 |
displayLabel = `${label} (${(0, import_i18n39.__)("Required")})`; |
| 28862 |
} else if (!isValid2?.required && markWhenOptional && !hideLabelFromVision) { |
| 28863 |
displayLabel = `${label} (${(0, import_i18n39.__)("Optional")})`; |
| 28864 |
} |
| 28865 |
return /* @__PURE__ */ (0, import_jsx_runtime133.jsx)( |
| 28866 |
import_components32.BaseControl, |
| 28867 |
{ |
| 28868 |
id, |
| 28869 |
label: displayLabel, |
| 28870 |
help: description, |
| 28871 |
hideLabelFromVision, |
| 28872 |
children: /* @__PURE__ */ (0, import_jsx_runtime133.jsxs)(Stack, { direction: "column", gap: "lg", children: [ |
| 28873 |
/* @__PURE__ */ (0, import_jsx_runtime133.jsx)( |
| 28874 |
ValidatedInputControl, |
| 28875 |
{ |
| 28876 |
ref: inputControlRef, |
| 28877 |
__next40pxDefaultSize: true, |
| 28878 |
required: !!isValid2?.required, |
| 28879 |
customValidity: getCustomValidity(isValid2, validity), |
| 28880 |
type: "datetime-local", |
| 28881 |
label: (0, import_i18n39.__)("Date time"), |
| 28882 |
hideLabelFromVision: true, |
| 28883 |
value: formatDateTime(value), |
| 28884 |
onChange: handleManualDateTimeChange, |
| 28885 |
disabled: disabled2, |
| 28886 |
min: minConstraint ? formatDateTime(minConstraint) : void 0, |
| 28887 |
max: maxConstraint ? formatDateTime(maxConstraint) : void 0 |
| 28888 |
} |
| 28889 |
), |
| 28890 |
!compact && /* @__PURE__ */ (0, import_jsx_runtime133.jsx)( |
| 28891 |
DateCalendar, |
| 28892 |
{ |
| 28893 |
style: { width: "100%" }, |
| 28894 |
selected: value ? parseDateTime(value) || void 0 : void 0, |
| 28895 |
onSelect: onSelectDate, |
| 28896 |
month: calendarMonth, |
| 28897 |
onMonthChange: setCalendarMonth, |
| 28898 |
timeZone: timezoneString || void 0, |
| 28899 |
weekStartsOn, |
| 28900 |
disabled: disabled2 || disabledMatchers |
| 28901 |
} |
| 28902 |
) |
| 28903 |
] }) |
| 28904 |
} |
| 28905 |
); |
| 28906 |
} |
| 28907 |
function DateTime({ |
| 28908 |
data, |
| 28909 |
field, |
| 28910 |
onChange, |
| 28911 |
hideLabelFromVision, |
| 28912 |
markWhenOptional, |
| 28913 |
operator, |
| 28914 |
validity, |
| 28915 |
config |
| 28916 |
}) { |
| 28917 |
if (operator === OPERATOR_IN_THE_PAST || operator === OPERATOR_OVER) { |
| 28918 |
return /* @__PURE__ */ (0, import_jsx_runtime133.jsx)( |
| 28919 |
RelativeDateControl, |
| 28920 |
{ |
| 28921 |
className: "dataviews-controls__datetime", |
| 28922 |
data, |
| 28923 |
field, |
| 28924 |
onChange, |
| 28925 |
hideLabelFromVision, |
| 28926 |
operator |
| 28927 |
} |
| 28928 |
); |
| 28929 |
} |
| 28930 |
return /* @__PURE__ */ (0, import_jsx_runtime133.jsx)( |
| 28931 |
CalendarDateTimeControl, |
| 28932 |
{ |
| 28933 |
data, |
| 28934 |
field, |
| 28935 |
onChange, |
| 28936 |
hideLabelFromVision, |
| 28937 |
markWhenOptional, |
| 28938 |
validity, |
| 28939 |
config |
| 28940 |
} |
| 28941 |
); |
| 28942 |
} |
| 28943 |
|
| 28944 |
// packages/dataviews/build-module/components/dataform-controls/date.mjs |
| 28945 |
var import_components33 = __toESM(require_components(), 1); |
| 28946 |
var import_element106 = __toESM(require_element(), 1); |
| 28947 |
var import_i18n40 = __toESM(require_i18n(), 1); |
| 28948 |
var import_date4 = __toESM(require_date(), 1); |
| 28949 |
var import_jsx_runtime134 = __toESM(require_jsx_runtime(), 1); |
| 28950 |
var { DateCalendar: DateCalendar2, DateRangeCalendar } = unlock3(import_components33.privateApis); |
| 28951 |
var DATE_PRESETS = [ |
| 28952 |
{ |
| 28953 |
id: "today", |
| 28954 |
label: (0, import_i18n40.__)("Today"), |
| 28955 |
getValue: () => (0, import_date4.getDate)(null) |
| 28956 |
}, |
| 28957 |
{ |
| 28958 |
id: "yesterday", |
| 28959 |
label: (0, import_i18n40.__)("Yesterday"), |
| 28960 |
getValue: () => { |
| 28961 |
const today = (0, import_date4.getDate)(null); |
| 28962 |
return subDays(today, 1); |
| 28963 |
} |
| 28964 |
}, |
| 28965 |
{ |
| 28966 |
id: "past-week", |
| 28967 |
label: (0, import_i18n40.__)("Past week"), |
| 28968 |
getValue: () => { |
| 28969 |
const today = (0, import_date4.getDate)(null); |
| 28970 |
return subDays(today, 7); |
| 28971 |
} |
| 28972 |
}, |
| 28973 |
{ |
| 28974 |
id: "past-month", |
| 28975 |
label: (0, import_i18n40.__)("Past month"), |
| 28976 |
getValue: () => { |
| 28977 |
const today = (0, import_date4.getDate)(null); |
| 28978 |
return subMonths(today, 1); |
| 28979 |
} |
| 28980 |
} |
| 28981 |
]; |
| 28982 |
var DATE_RANGE_PRESETS = [ |
| 28983 |
{ |
| 28984 |
id: "last-7-days", |
| 28985 |
label: (0, import_i18n40.__)("Last 7 days"), |
| 28986 |
getValue: () => { |
| 28987 |
const today = (0, import_date4.getDate)(null); |
| 28988 |
return [subDays(today, 7), today]; |
| 28989 |
} |
| 28990 |
}, |
| 28991 |
{ |
| 28992 |
id: "last-30-days", |
| 28993 |
label: (0, import_i18n40.__)("Last 30 days"), |
| 28994 |
getValue: () => { |
| 28995 |
const today = (0, import_date4.getDate)(null); |
| 28996 |
return [subDays(today, 30), today]; |
| 28997 |
} |
| 28998 |
}, |
| 28999 |
{ |
| 29000 |
id: "month-to-date", |
| 29001 |
label: (0, import_i18n40.__)("Month to date"), |
| 29002 |
getValue: () => { |
| 29003 |
const today = (0, import_date4.getDate)(null); |
| 29004 |
return [startOfMonth(today), today]; |
| 29005 |
} |
| 29006 |
}, |
| 29007 |
{ |
| 29008 |
id: "last-year", |
| 29009 |
label: (0, import_i18n40.__)("Last year"), |
| 29010 |
getValue: () => { |
| 29011 |
const today = (0, import_date4.getDate)(null); |
| 29012 |
return [subYears(today, 1), today]; |
| 29013 |
} |
| 29014 |
}, |
| 29015 |
{ |
| 29016 |
id: "year-to-date", |
| 29017 |
label: (0, import_i18n40.__)("Year to date"), |
| 29018 |
getValue: () => { |
| 29019 |
const today = (0, import_date4.getDate)(null); |
| 29020 |
return [startOfYear(today), today]; |
| 29021 |
} |
| 29022 |
} |
| 29023 |
]; |
| 29024 |
var parseDate = (dateString) => { |
| 29025 |
if (!dateString) { |
| 29026 |
return null; |
| 29027 |
} |
| 29028 |
const parsed = (0, import_date4.getDate)(dateString); |
| 29029 |
return parsed && isValid(parsed) ? parsed : null; |
| 29030 |
}; |
| 29031 |
var formatDate = (date) => { |
| 29032 |
if (!date) { |
| 29033 |
return ""; |
| 29034 |
} |
| 29035 |
return typeof date === "string" ? date : format(date, "yyyy-MM-dd"); |
| 29036 |
}; |
| 29037 |
function ValidatedDateControl({ |
| 29038 |
field, |
| 29039 |
validity, |
| 29040 |
inputRefs, |
| 29041 |
isTouched, |
| 29042 |
setIsTouched, |
| 29043 |
children |
| 29044 |
}) { |
| 29045 |
const { isValid: isValid2 } = field; |
| 29046 |
const [customValidity, setCustomValidity] = (0, import_element106.useState)(void 0); |
| 29047 |
const validateRefs = (0, import_element106.useCallback)(() => { |
| 29048 |
const refs = Array.isArray(inputRefs) ? inputRefs : [inputRefs]; |
| 29049 |
for (const ref of refs) { |
| 29050 |
const input = ref.current; |
| 29051 |
if (input && !input.validity.valid) { |
| 29052 |
setCustomValidity({ |
| 29053 |
type: "invalid", |
| 29054 |
message: input.validationMessage |
| 29055 |
}); |
| 29056 |
return; |
| 29057 |
} |
| 29058 |
} |
| 29059 |
setCustomValidity(void 0); |
| 29060 |
}, [inputRefs]); |
| 29061 |
(0, import_element106.useEffect)(() => { |
| 29062 |
const refs = Array.isArray(inputRefs) ? inputRefs : [inputRefs]; |
| 29063 |
const result = validity ? getCustomValidity(isValid2, validity) : void 0; |
| 29064 |
for (const ref of refs) { |
| 29065 |
const input = ref.current; |
| 29066 |
if (input) { |
| 29067 |
input.setCustomValidity( |
| 29068 |
result?.type === "invalid" && result.message ? result.message : "" |
| 29069 |
); |
| 29070 |
} |
| 29071 |
} |
| 29072 |
}, [inputRefs, isValid2, validity]); |
| 29073 |
(0, import_element106.useEffect)(() => { |
| 29074 |
const refs = Array.isArray(inputRefs) ? inputRefs : [inputRefs]; |
| 29075 |
const handleInvalid = (event) => { |
| 29076 |
event.preventDefault(); |
| 29077 |
setIsTouched(true); |
| 29078 |
}; |
| 29079 |
for (const ref of refs) { |
| 29080 |
ref.current?.addEventListener("invalid", handleInvalid); |
| 29081 |
} |
| 29082 |
return () => { |
| 29083 |
for (const ref of refs) { |
| 29084 |
ref.current?.removeEventListener("invalid", handleInvalid); |
| 29085 |
} |
| 29086 |
}; |
| 29087 |
}, [inputRefs, setIsTouched]); |
| 29088 |
(0, import_element106.useEffect)(() => { |
| 29089 |
if (!isTouched) { |
| 29090 |
return; |
| 29091 |
} |
| 29092 |
const result = validity ? getCustomValidity(isValid2, validity) : void 0; |
| 29093 |
if (result) { |
| 29094 |
setCustomValidity(result); |
| 29095 |
} else { |
| 29096 |
validateRefs(); |
| 29097 |
} |
| 29098 |
}, [isTouched, isValid2, validity, validateRefs]); |
| 29099 |
const onBlur = (event) => { |
| 29100 |
if (isTouched) { |
| 29101 |
return; |
| 29102 |
} |
| 29103 |
if (!event.relatedTarget || !event.currentTarget.contains(event.relatedTarget)) { |
| 29104 |
setIsTouched(true); |
| 29105 |
} |
| 29106 |
}; |
| 29107 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsxs)("div", { onBlur, children: [ |
| 29108 |
children, |
| 29109 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)("div", { "aria-live": "polite", children: customValidity && /* @__PURE__ */ (0, import_jsx_runtime134.jsxs)( |
| 29110 |
"p", |
| 29111 |
{ |
| 29112 |
className: clsx_default( |
| 29113 |
"components-validated-control__indicator", |
| 29114 |
customValidity.type === "invalid" ? "is-invalid" : void 0 |
| 29115 |
), |
| 29116 |
children: [ |
| 29117 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29118 |
import_components33.Icon, |
| 29119 |
{ |
| 29120 |
className: "components-validated-control__indicator-icon", |
| 29121 |
icon: error_default, |
| 29122 |
size: 16, |
| 29123 |
fill: "currentColor" |
| 29124 |
} |
| 29125 |
), |
| 29126 |
customValidity.message |
| 29127 |
] |
| 29128 |
} |
| 29129 |
) }) |
| 29130 |
] }); |
| 29131 |
} |
| 29132 |
function CalendarDateControl({ |
| 29133 |
data, |
| 29134 |
field, |
| 29135 |
onChange, |
| 29136 |
hideLabelFromVision, |
| 29137 |
markWhenOptional, |
| 29138 |
validity |
| 29139 |
}) { |
| 29140 |
const { |
| 29141 |
id, |
| 29142 |
label, |
| 29143 |
description, |
| 29144 |
setValue, |
| 29145 |
getValue, |
| 29146 |
isValid: isValid2, |
| 29147 |
format: fieldFormat |
| 29148 |
} = field; |
| 29149 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29150 |
const [selectedPresetId, setSelectedPresetId] = (0, import_element106.useState)( |
| 29151 |
null |
| 29152 |
); |
| 29153 |
const weekStartsOn = fieldFormat.weekStartsOn ?? (0, import_date4.getSettings)().l10n.startOfWeek; |
| 29154 |
const fieldValue = getValue({ item: data }); |
| 29155 |
const value = typeof fieldValue === "string" ? fieldValue : void 0; |
| 29156 |
const [calendarMonth, setCalendarMonth] = (0, import_element106.useState)(() => { |
| 29157 |
const parsedDate = parseDate(value); |
| 29158 |
return parsedDate || /* @__PURE__ */ new Date(); |
| 29159 |
}); |
| 29160 |
const [isTouched, setIsTouched] = (0, import_element106.useState)(false); |
| 29161 |
const validityTargetRef = (0, import_element106.useRef)(null); |
| 29162 |
const { minConstraint, maxConstraint, disabledMatchers } = useDisabledDateMatchers(isValid2, parseDate); |
| 29163 |
const onChangeCallback = (0, import_element106.useCallback)( |
| 29164 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 29165 |
[data, onChange, setValue] |
| 29166 |
); |
| 29167 |
const onSelectDate = (0, import_element106.useCallback)( |
| 29168 |
(newDate) => { |
| 29169 |
const dateValue = newDate ? format(newDate, "yyyy-MM-dd") : void 0; |
| 29170 |
onChangeCallback(dateValue); |
| 29171 |
setSelectedPresetId(null); |
| 29172 |
setIsTouched(true); |
| 29173 |
}, |
| 29174 |
[onChangeCallback] |
| 29175 |
); |
| 29176 |
const handlePresetClick = (0, import_element106.useCallback)( |
| 29177 |
(preset) => { |
| 29178 |
const presetDate = preset.getValue(); |
| 29179 |
const dateValue = formatDate(presetDate); |
| 29180 |
setCalendarMonth(presetDate); |
| 29181 |
onChangeCallback(dateValue); |
| 29182 |
setSelectedPresetId(preset.id); |
| 29183 |
setIsTouched(true); |
| 29184 |
}, |
| 29185 |
[onChangeCallback] |
| 29186 |
); |
| 29187 |
const handleManualDateChange = (0, import_element106.useCallback)( |
| 29188 |
(newValue) => { |
| 29189 |
onChangeCallback(newValue); |
| 29190 |
if (newValue) { |
| 29191 |
const parsedDate = parseDate(newValue); |
| 29192 |
if (parsedDate) { |
| 29193 |
setCalendarMonth(parsedDate); |
| 29194 |
} |
| 29195 |
} |
| 29196 |
setSelectedPresetId(null); |
| 29197 |
setIsTouched(true); |
| 29198 |
}, |
| 29199 |
[onChangeCallback] |
| 29200 |
); |
| 29201 |
const { |
| 29202 |
timezone: { string: timezoneString } |
| 29203 |
} = (0, import_date4.getSettings)(); |
| 29204 |
let displayLabel = label; |
| 29205 |
if (isValid2?.required && !markWhenOptional) { |
| 29206 |
displayLabel = `${label} (${(0, import_i18n40.__)("Required")})`; |
| 29207 |
} else if (!isValid2?.required && markWhenOptional) { |
| 29208 |
displayLabel = `${label} (${(0, import_i18n40.__)("Optional")})`; |
| 29209 |
} |
| 29210 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29211 |
ValidatedDateControl, |
| 29212 |
{ |
| 29213 |
field, |
| 29214 |
validity, |
| 29215 |
inputRefs: validityTargetRef, |
| 29216 |
isTouched, |
| 29217 |
setIsTouched, |
| 29218 |
children: /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29219 |
import_components33.BaseControl, |
| 29220 |
{ |
| 29221 |
id, |
| 29222 |
className: "dataviews-controls__date", |
| 29223 |
label: displayLabel, |
| 29224 |
help: description, |
| 29225 |
hideLabelFromVision, |
| 29226 |
children: /* @__PURE__ */ (0, import_jsx_runtime134.jsxs)(Stack, { direction: "column", gap: "lg", children: [ |
| 29227 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsxs)( |
| 29228 |
Stack, |
| 29229 |
{ |
| 29230 |
direction: "row", |
| 29231 |
gap: "sm", |
| 29232 |
wrap: "wrap", |
| 29233 |
justify: "flex-start", |
| 29234 |
children: [ |
| 29235 |
DATE_PRESETS.map((preset) => { |
| 29236 |
const isSelected2 = selectedPresetId === preset.id; |
| 29237 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29238 |
import_components33.Button, |
| 29239 |
{ |
| 29240 |
className: "dataviews-controls__date-preset", |
| 29241 |
variant: "tertiary", |
| 29242 |
isPressed: isSelected2, |
| 29243 |
size: "small", |
| 29244 |
disabled: disabled2, |
| 29245 |
accessibleWhenDisabled: true, |
| 29246 |
onClick: () => handlePresetClick(preset), |
| 29247 |
children: preset.label |
| 29248 |
}, |
| 29249 |
preset.id |
| 29250 |
); |
| 29251 |
}), |
| 29252 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29253 |
import_components33.Button, |
| 29254 |
{ |
| 29255 |
className: "dataviews-controls__date-preset", |
| 29256 |
variant: "tertiary", |
| 29257 |
isPressed: !selectedPresetId, |
| 29258 |
size: "small", |
| 29259 |
disabled: !!selectedPresetId || disabled2, |
| 29260 |
accessibleWhenDisabled: true, |
| 29261 |
children: (0, import_i18n40.__)("Custom") |
| 29262 |
} |
| 29263 |
) |
| 29264 |
] |
| 29265 |
} |
| 29266 |
), |
| 29267 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29268 |
import_components33.__experimentalInputControl, |
| 29269 |
{ |
| 29270 |
__next40pxDefaultSize: true, |
| 29271 |
ref: validityTargetRef, |
| 29272 |
type: "date", |
| 29273 |
label: (0, import_i18n40.__)("Date"), |
| 29274 |
hideLabelFromVision: true, |
| 29275 |
value, |
| 29276 |
onChange: handleManualDateChange, |
| 29277 |
required: !!field.isValid?.required, |
| 29278 |
disabled: disabled2, |
| 29279 |
min: minConstraint, |
| 29280 |
max: maxConstraint |
| 29281 |
} |
| 29282 |
), |
| 29283 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29284 |
DateCalendar2, |
| 29285 |
{ |
| 29286 |
style: { width: "100%" }, |
| 29287 |
selected: value ? parseDate(value) || void 0 : void 0, |
| 29288 |
onSelect: onSelectDate, |
| 29289 |
month: calendarMonth, |
| 29290 |
onMonthChange: setCalendarMonth, |
| 29291 |
timeZone: timezoneString || void 0, |
| 29292 |
weekStartsOn, |
| 29293 |
disabled: disabled2 || disabledMatchers, |
| 29294 |
disableNavigation: disabled2 |
| 29295 |
} |
| 29296 |
) |
| 29297 |
] }) |
| 29298 |
} |
| 29299 |
) |
| 29300 |
} |
| 29301 |
); |
| 29302 |
} |
| 29303 |
function CalendarDateRangeControl({ |
| 29304 |
data, |
| 29305 |
field, |
| 29306 |
onChange, |
| 29307 |
hideLabelFromVision, |
| 29308 |
markWhenOptional, |
| 29309 |
validity |
| 29310 |
}) { |
| 29311 |
const { |
| 29312 |
id, |
| 29313 |
label, |
| 29314 |
description, |
| 29315 |
getValue, |
| 29316 |
setValue, |
| 29317 |
isValid: isValid2, |
| 29318 |
format: fieldFormat |
| 29319 |
} = field; |
| 29320 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29321 |
let value; |
| 29322 |
const fieldValue = getValue({ item: data }); |
| 29323 |
if (Array.isArray(fieldValue) && fieldValue.length === 2 && fieldValue.every((date) => typeof date === "string")) { |
| 29324 |
value = fieldValue; |
| 29325 |
} |
| 29326 |
const weekStartsOn = fieldFormat.weekStartsOn ?? (0, import_date4.getSettings)().l10n.startOfWeek; |
| 29327 |
const { minConstraint, maxConstraint, disabledMatchers } = useDisabledDateMatchers(isValid2, parseDate); |
| 29328 |
const onChangeCallback = (0, import_element106.useCallback)( |
| 29329 |
(newValue) => { |
| 29330 |
onChange( |
| 29331 |
setValue({ |
| 29332 |
item: data, |
| 29333 |
value: newValue |
| 29334 |
}) |
| 29335 |
); |
| 29336 |
}, |
| 29337 |
[data, onChange, setValue] |
| 29338 |
); |
| 29339 |
const [selectedPresetId, setSelectedPresetId] = (0, import_element106.useState)( |
| 29340 |
null |
| 29341 |
); |
| 29342 |
const selectedRange = (0, import_element106.useMemo)(() => { |
| 29343 |
if (!value) { |
| 29344 |
return { from: void 0, to: void 0 }; |
| 29345 |
} |
| 29346 |
const [from, to] = value; |
| 29347 |
return { |
| 29348 |
from: parseDate(from) || void 0, |
| 29349 |
to: parseDate(to) || void 0 |
| 29350 |
}; |
| 29351 |
}, [value]); |
| 29352 |
const [calendarMonth, setCalendarMonth] = (0, import_element106.useState)(() => { |
| 29353 |
return selectedRange.from || /* @__PURE__ */ new Date(); |
| 29354 |
}); |
| 29355 |
const [isTouched, setIsTouched] = (0, import_element106.useState)(false); |
| 29356 |
const fromInputRef = (0, import_element106.useRef)(null); |
| 29357 |
const toInputRef = (0, import_element106.useRef)(null); |
| 29358 |
const updateDateRange = (0, import_element106.useCallback)( |
| 29359 |
(fromDate, toDate2) => { |
| 29360 |
if (fromDate && toDate2) { |
| 29361 |
onChangeCallback([ |
| 29362 |
formatDate(fromDate), |
| 29363 |
formatDate(toDate2) |
| 29364 |
]); |
| 29365 |
} else if (!fromDate && !toDate2) { |
| 29366 |
onChangeCallback(void 0); |
| 29367 |
} |
| 29368 |
}, |
| 29369 |
[onChangeCallback] |
| 29370 |
); |
| 29371 |
const onSelectCalendarRange = (0, import_element106.useCallback)( |
| 29372 |
(newRange) => { |
| 29373 |
updateDateRange(newRange?.from, newRange?.to); |
| 29374 |
setSelectedPresetId(null); |
| 29375 |
setIsTouched(true); |
| 29376 |
}, |
| 29377 |
[updateDateRange] |
| 29378 |
); |
| 29379 |
const handlePresetClick = (0, import_element106.useCallback)( |
| 29380 |
(preset) => { |
| 29381 |
const [startDate, endDate] = preset.getValue(); |
| 29382 |
setCalendarMonth(startDate); |
| 29383 |
updateDateRange(startDate, endDate); |
| 29384 |
setSelectedPresetId(preset.id); |
| 29385 |
setIsTouched(true); |
| 29386 |
}, |
| 29387 |
[updateDateRange] |
| 29388 |
); |
| 29389 |
const handleManualDateChange = (0, import_element106.useCallback)( |
| 29390 |
(fromOrTo, newValue) => { |
| 29391 |
const [currentFrom, currentTo] = value || [ |
| 29392 |
void 0, |
| 29393 |
void 0 |
| 29394 |
]; |
| 29395 |
const updatedFrom = fromOrTo === "from" ? newValue : currentFrom; |
| 29396 |
const updatedTo = fromOrTo === "to" ? newValue : currentTo; |
| 29397 |
updateDateRange(updatedFrom, updatedTo); |
| 29398 |
if (newValue) { |
| 29399 |
const parsedDate = parseDate(newValue); |
| 29400 |
if (parsedDate) { |
| 29401 |
setCalendarMonth(parsedDate); |
| 29402 |
} |
| 29403 |
} |
| 29404 |
setSelectedPresetId(null); |
| 29405 |
setIsTouched(true); |
| 29406 |
}, |
| 29407 |
[value, updateDateRange] |
| 29408 |
); |
| 29409 |
const { timezone } = (0, import_date4.getSettings)(); |
| 29410 |
let displayLabel = label; |
| 29411 |
if (field.isValid?.required && !markWhenOptional) { |
| 29412 |
displayLabel = `${label} (${(0, import_i18n40.__)("Required")})`; |
| 29413 |
} else if (!field.isValid?.required && markWhenOptional) { |
| 29414 |
displayLabel = `${label} (${(0, import_i18n40.__)("Optional")})`; |
| 29415 |
} |
| 29416 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29417 |
ValidatedDateControl, |
| 29418 |
{ |
| 29419 |
field, |
| 29420 |
validity, |
| 29421 |
inputRefs: [fromInputRef, toInputRef], |
| 29422 |
isTouched, |
| 29423 |
setIsTouched, |
| 29424 |
children: /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29425 |
import_components33.BaseControl, |
| 29426 |
{ |
| 29427 |
id, |
| 29428 |
className: "dataviews-controls__date", |
| 29429 |
label: displayLabel, |
| 29430 |
help: description, |
| 29431 |
hideLabelFromVision, |
| 29432 |
children: /* @__PURE__ */ (0, import_jsx_runtime134.jsxs)(Stack, { direction: "column", gap: "lg", children: [ |
| 29433 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsxs)( |
| 29434 |
Stack, |
| 29435 |
{ |
| 29436 |
direction: "row", |
| 29437 |
gap: "sm", |
| 29438 |
wrap: "wrap", |
| 29439 |
justify: "flex-start", |
| 29440 |
children: [ |
| 29441 |
DATE_RANGE_PRESETS.map((preset) => { |
| 29442 |
const isSelected2 = selectedPresetId === preset.id; |
| 29443 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29444 |
import_components33.Button, |
| 29445 |
{ |
| 29446 |
className: "dataviews-controls__date-preset", |
| 29447 |
variant: "tertiary", |
| 29448 |
isPressed: isSelected2, |
| 29449 |
size: "small", |
| 29450 |
disabled: disabled2, |
| 29451 |
accessibleWhenDisabled: true, |
| 29452 |
onClick: () => handlePresetClick(preset), |
| 29453 |
children: preset.label |
| 29454 |
}, |
| 29455 |
preset.id |
| 29456 |
); |
| 29457 |
}), |
| 29458 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29459 |
import_components33.Button, |
| 29460 |
{ |
| 29461 |
className: "dataviews-controls__date-preset", |
| 29462 |
variant: "tertiary", |
| 29463 |
isPressed: !selectedPresetId, |
| 29464 |
size: "small", |
| 29465 |
accessibleWhenDisabled: true, |
| 29466 |
disabled: !!selectedPresetId || disabled2, |
| 29467 |
children: (0, import_i18n40.__)("Custom") |
| 29468 |
} |
| 29469 |
) |
| 29470 |
] |
| 29471 |
} |
| 29472 |
), |
| 29473 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsxs)( |
| 29474 |
Stack, |
| 29475 |
{ |
| 29476 |
direction: "row", |
| 29477 |
gap: "sm", |
| 29478 |
justify: "space-between", |
| 29479 |
className: "dataviews-controls__date-range-inputs", |
| 29480 |
children: [ |
| 29481 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29482 |
import_components33.__experimentalInputControl, |
| 29483 |
{ |
| 29484 |
__next40pxDefaultSize: true, |
| 29485 |
ref: fromInputRef, |
| 29486 |
type: "date", |
| 29487 |
label: (0, import_i18n40.__)("From"), |
| 29488 |
hideLabelFromVision: true, |
| 29489 |
value: value?.[0], |
| 29490 |
onChange: (newValue) => handleManualDateChange("from", newValue), |
| 29491 |
required: !!field.isValid?.required, |
| 29492 |
disabled: disabled2, |
| 29493 |
min: minConstraint, |
| 29494 |
max: maxConstraint |
| 29495 |
} |
| 29496 |
), |
| 29497 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29498 |
import_components33.__experimentalInputControl, |
| 29499 |
{ |
| 29500 |
__next40pxDefaultSize: true, |
| 29501 |
ref: toInputRef, |
| 29502 |
type: "date", |
| 29503 |
label: (0, import_i18n40.__)("To"), |
| 29504 |
hideLabelFromVision: true, |
| 29505 |
value: value?.[1], |
| 29506 |
onChange: (newValue) => handleManualDateChange("to", newValue), |
| 29507 |
required: !!field.isValid?.required, |
| 29508 |
disabled: disabled2, |
| 29509 |
min: minConstraint, |
| 29510 |
max: maxConstraint |
| 29511 |
} |
| 29512 |
) |
| 29513 |
] |
| 29514 |
} |
| 29515 |
), |
| 29516 |
/* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29517 |
DateRangeCalendar, |
| 29518 |
{ |
| 29519 |
style: { width: "100%" }, |
| 29520 |
selected: selectedRange, |
| 29521 |
onSelect: onSelectCalendarRange, |
| 29522 |
month: calendarMonth, |
| 29523 |
onMonthChange: setCalendarMonth, |
| 29524 |
timeZone: timezone.string || void 0, |
| 29525 |
weekStartsOn, |
| 29526 |
disabled: disabled2 || disabledMatchers |
| 29527 |
} |
| 29528 |
) |
| 29529 |
] }) |
| 29530 |
} |
| 29531 |
) |
| 29532 |
} |
| 29533 |
); |
| 29534 |
} |
| 29535 |
function DateControl({ |
| 29536 |
data, |
| 29537 |
field, |
| 29538 |
onChange, |
| 29539 |
hideLabelFromVision, |
| 29540 |
markWhenOptional, |
| 29541 |
operator, |
| 29542 |
validity |
| 29543 |
}) { |
| 29544 |
if (operator === OPERATOR_IN_THE_PAST || operator === OPERATOR_OVER) { |
| 29545 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29546 |
RelativeDateControl, |
| 29547 |
{ |
| 29548 |
className: "dataviews-controls__date", |
| 29549 |
data, |
| 29550 |
field, |
| 29551 |
onChange, |
| 29552 |
hideLabelFromVision, |
| 29553 |
operator |
| 29554 |
} |
| 29555 |
); |
| 29556 |
} |
| 29557 |
if (operator === OPERATOR_BETWEEN) { |
| 29558 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29559 |
CalendarDateRangeControl, |
| 29560 |
{ |
| 29561 |
data, |
| 29562 |
field, |
| 29563 |
onChange, |
| 29564 |
hideLabelFromVision, |
| 29565 |
markWhenOptional, |
| 29566 |
validity |
| 29567 |
} |
| 29568 |
); |
| 29569 |
} |
| 29570 |
return /* @__PURE__ */ (0, import_jsx_runtime134.jsx)( |
| 29571 |
CalendarDateControl, |
| 29572 |
{ |
| 29573 |
data, |
| 29574 |
field, |
| 29575 |
onChange, |
| 29576 |
hideLabelFromVision, |
| 29577 |
markWhenOptional, |
| 29578 |
validity |
| 29579 |
} |
| 29580 |
); |
| 29581 |
} |
| 29582 |
|
| 29583 |
// packages/dataviews/build-module/components/dataform-controls/select.mjs |
| 29584 |
var import_components34 = __toESM(require_components(), 1); |
| 29585 |
var import_element107 = __toESM(require_element(), 1); |
| 29586 |
var import_jsx_runtime135 = __toESM(require_jsx_runtime(), 1); |
| 29587 |
var { ValidatedSelectControl } = unlock3(import_components34.privateApis); |
| 29588 |
function Select({ |
| 29589 |
data, |
| 29590 |
field, |
| 29591 |
onChange, |
| 29592 |
hideLabelFromVision, |
| 29593 |
markWhenOptional, |
| 29594 |
validity |
| 29595 |
}) { |
| 29596 |
const { type, label, description, getValue, setValue, isValid: isValid2 } = field; |
| 29597 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29598 |
const isMultiple = type === "array"; |
| 29599 |
const value = getValue({ item: data }) ?? (isMultiple ? [] : ""); |
| 29600 |
const onChangeControl = (0, import_element107.useCallback)( |
| 29601 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 29602 |
[data, onChange, setValue] |
| 29603 |
); |
| 29604 |
const { elements, isLoading } = useElements({ |
| 29605 |
elements: field.elements, |
| 29606 |
getElements: field.getElements |
| 29607 |
}); |
| 29608 |
if (isLoading) { |
| 29609 |
return /* @__PURE__ */ (0, import_jsx_runtime135.jsx)(import_components34.Spinner, {}); |
| 29610 |
} |
| 29611 |
return /* @__PURE__ */ (0, import_jsx_runtime135.jsx)( |
| 29612 |
ValidatedSelectControl, |
| 29613 |
{ |
| 29614 |
required: !!field.isValid?.required, |
| 29615 |
markWhenOptional, |
| 29616 |
customValidity: getCustomValidity(isValid2, validity), |
| 29617 |
label, |
| 29618 |
value, |
| 29619 |
help: description, |
| 29620 |
options: elements, |
| 29621 |
onChange: onChangeControl, |
| 29622 |
__next40pxDefaultSize: true, |
| 29623 |
hideLabelFromVision, |
| 29624 |
multiple: isMultiple, |
| 29625 |
disabled: disabled2 |
| 29626 |
} |
| 29627 |
); |
| 29628 |
} |
| 29629 |
|
| 29630 |
// packages/dataviews/build-module/components/dataform-controls/adaptive-select.mjs |
| 29631 |
var import_jsx_runtime136 = __toESM(require_jsx_runtime(), 1); |
| 29632 |
var ELEMENTS_THRESHOLD = 10; |
| 29633 |
function AdaptiveSelect(props) { |
| 29634 |
const { field } = props; |
| 29635 |
const { elements } = useElements({ |
| 29636 |
elements: field.elements, |
| 29637 |
getElements: field.getElements |
| 29638 |
}); |
| 29639 |
if (elements.length >= ELEMENTS_THRESHOLD) { |
| 29640 |
return /* @__PURE__ */ (0, import_jsx_runtime136.jsx)(Combobox3, { ...props }); |
| 29641 |
} |
| 29642 |
return /* @__PURE__ */ (0, import_jsx_runtime136.jsx)(Select, { ...props }); |
| 29643 |
} |
| 29644 |
|
| 29645 |
// packages/dataviews/build-module/components/dataform-controls/email.mjs |
| 29646 |
var import_components36 = __toESM(require_components(), 1); |
| 29647 |
|
| 29648 |
// packages/dataviews/build-module/components/dataform-controls/utils/validated-input.mjs |
| 29649 |
var import_components35 = __toESM(require_components(), 1); |
| 29650 |
var import_element108 = __toESM(require_element(), 1); |
| 29651 |
var import_jsx_runtime137 = __toESM(require_jsx_runtime(), 1); |
| 29652 |
var { ValidatedInputControl: ValidatedInputControl2 } = unlock3(import_components35.privateApis); |
| 29653 |
function ValidatedText({ |
| 29654 |
data, |
| 29655 |
field, |
| 29656 |
onChange, |
| 29657 |
hideLabelFromVision, |
| 29658 |
markWhenOptional, |
| 29659 |
type, |
| 29660 |
prefix, |
| 29661 |
suffix, |
| 29662 |
validity |
| 29663 |
}) { |
| 29664 |
const { label, placeholder, description, getValue, setValue, isValid: isValid2 } = field; |
| 29665 |
const value = getValue({ item: data }); |
| 29666 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29667 |
const onChangeControl = (0, import_element108.useCallback)( |
| 29668 |
(newValue) => onChange( |
| 29669 |
setValue({ |
| 29670 |
item: data, |
| 29671 |
value: newValue |
| 29672 |
}) |
| 29673 |
), |
| 29674 |
[data, setValue, onChange] |
| 29675 |
); |
| 29676 |
return /* @__PURE__ */ (0, import_jsx_runtime137.jsx)( |
| 29677 |
ValidatedInputControl2, |
| 29678 |
{ |
| 29679 |
required: !!isValid2.required, |
| 29680 |
markWhenOptional, |
| 29681 |
customValidity: getCustomValidity(isValid2, validity), |
| 29682 |
label, |
| 29683 |
placeholder, |
| 29684 |
value: value ?? "", |
| 29685 |
help: description, |
| 29686 |
onChange: onChangeControl, |
| 29687 |
hideLabelFromVision, |
| 29688 |
type, |
| 29689 |
prefix, |
| 29690 |
suffix, |
| 29691 |
disabled: disabled2, |
| 29692 |
pattern: isValid2.pattern ? isValid2.pattern.constraint : void 0, |
| 29693 |
minLength: isValid2.minLength ? isValid2.minLength.constraint : void 0, |
| 29694 |
maxLength: isValid2.maxLength ? isValid2.maxLength.constraint : void 0, |
| 29695 |
__next40pxDefaultSize: true |
| 29696 |
} |
| 29697 |
); |
| 29698 |
} |
| 29699 |
|
| 29700 |
// packages/dataviews/build-module/components/dataform-controls/email.mjs |
| 29701 |
var import_jsx_runtime138 = __toESM(require_jsx_runtime(), 1); |
| 29702 |
function Email({ |
| 29703 |
data, |
| 29704 |
field, |
| 29705 |
onChange, |
| 29706 |
hideLabelFromVision, |
| 29707 |
markWhenOptional, |
| 29708 |
validity |
| 29709 |
}) { |
| 29710 |
return /* @__PURE__ */ (0, import_jsx_runtime138.jsx)( |
| 29711 |
ValidatedText, |
| 29712 |
{ |
| 29713 |
...{ |
| 29714 |
data, |
| 29715 |
field, |
| 29716 |
onChange, |
| 29717 |
hideLabelFromVision, |
| 29718 |
markWhenOptional, |
| 29719 |
validity, |
| 29720 |
type: "email", |
| 29721 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime138.jsx)(import_components36.__experimentalInputControlPrefixWrapper, { variant: "icon", children: /* @__PURE__ */ (0, import_jsx_runtime138.jsx)(import_components36.Icon, { icon: envelope_default }) }) |
| 29722 |
} |
| 29723 |
} |
| 29724 |
); |
| 29725 |
} |
| 29726 |
|
| 29727 |
// packages/dataviews/build-module/components/dataform-controls/telephone.mjs |
| 29728 |
var import_components37 = __toESM(require_components(), 1); |
| 29729 |
var import_jsx_runtime139 = __toESM(require_jsx_runtime(), 1); |
| 29730 |
function Telephone({ |
| 29731 |
data, |
| 29732 |
field, |
| 29733 |
onChange, |
| 29734 |
hideLabelFromVision, |
| 29735 |
markWhenOptional, |
| 29736 |
validity |
| 29737 |
}) { |
| 29738 |
return /* @__PURE__ */ (0, import_jsx_runtime139.jsx)( |
| 29739 |
ValidatedText, |
| 29740 |
{ |
| 29741 |
...{ |
| 29742 |
data, |
| 29743 |
field, |
| 29744 |
onChange, |
| 29745 |
hideLabelFromVision, |
| 29746 |
markWhenOptional, |
| 29747 |
validity, |
| 29748 |
type: "tel", |
| 29749 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime139.jsx)(import_components37.__experimentalInputControlPrefixWrapper, { variant: "icon", children: /* @__PURE__ */ (0, import_jsx_runtime139.jsx)(import_components37.Icon, { icon: mobile_default }) }) |
| 29750 |
} |
| 29751 |
} |
| 29752 |
); |
| 29753 |
} |
| 29754 |
|
| 29755 |
// packages/dataviews/build-module/components/dataform-controls/url.mjs |
| 29756 |
var import_components38 = __toESM(require_components(), 1); |
| 29757 |
var import_jsx_runtime140 = __toESM(require_jsx_runtime(), 1); |
| 29758 |
function Url({ |
| 29759 |
data, |
| 29760 |
field, |
| 29761 |
onChange, |
| 29762 |
hideLabelFromVision, |
| 29763 |
markWhenOptional, |
| 29764 |
validity |
| 29765 |
}) { |
| 29766 |
return /* @__PURE__ */ (0, import_jsx_runtime140.jsx)( |
| 29767 |
ValidatedText, |
| 29768 |
{ |
| 29769 |
...{ |
| 29770 |
data, |
| 29771 |
field, |
| 29772 |
onChange, |
| 29773 |
hideLabelFromVision, |
| 29774 |
markWhenOptional, |
| 29775 |
validity, |
| 29776 |
type: "url", |
| 29777 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime140.jsx)(import_components38.__experimentalInputControlPrefixWrapper, { variant: "icon", children: /* @__PURE__ */ (0, import_jsx_runtime140.jsx)(import_components38.Icon, { icon: link_default }) }) |
| 29778 |
} |
| 29779 |
} |
| 29780 |
); |
| 29781 |
} |
| 29782 |
|
| 29783 |
// packages/dataviews/build-module/components/dataform-controls/utils/validated-number.mjs |
| 29784 |
var import_components39 = __toESM(require_components(), 1); |
| 29785 |
var import_element109 = __toESM(require_element(), 1); |
| 29786 |
var import_i18n41 = __toESM(require_i18n(), 1); |
| 29787 |
var import_jsx_runtime141 = __toESM(require_jsx_runtime(), 1); |
| 29788 |
var { ValidatedNumberControl } = unlock3(import_components39.privateApis); |
| 29789 |
function toNumberOrEmpty(value) { |
| 29790 |
if (value === "" || value === void 0) { |
| 29791 |
return ""; |
| 29792 |
} |
| 29793 |
const number = Number(value); |
| 29794 |
return Number.isFinite(number) ? number : ""; |
| 29795 |
} |
| 29796 |
function BetweenControls({ |
| 29797 |
value, |
| 29798 |
onChange, |
| 29799 |
hideLabelFromVision, |
| 29800 |
step |
| 29801 |
}) { |
| 29802 |
const [min2 = "", max2 = ""] = value; |
| 29803 |
const onChangeMin = (0, import_element109.useCallback)( |
| 29804 |
(newValue) => onChange([toNumberOrEmpty(newValue), max2]), |
| 29805 |
[onChange, max2] |
| 29806 |
); |
| 29807 |
const onChangeMax = (0, import_element109.useCallback)( |
| 29808 |
(newValue) => onChange([min2, toNumberOrEmpty(newValue)]), |
| 29809 |
[onChange, min2] |
| 29810 |
); |
| 29811 |
return /* @__PURE__ */ (0, import_jsx_runtime141.jsx)( |
| 29812 |
import_components39.BaseControl, |
| 29813 |
{ |
| 29814 |
help: (0, import_i18n41.__)("The max. value must be greater than the min. value."), |
| 29815 |
children: /* @__PURE__ */ (0, import_jsx_runtime141.jsxs)(import_components39.Flex, { direction: "row", gap: 4, children: [ |
| 29816 |
/* @__PURE__ */ (0, import_jsx_runtime141.jsx)( |
| 29817 |
import_components39.__experimentalNumberControl, |
| 29818 |
{ |
| 29819 |
label: (0, import_i18n41.__)("Min."), |
| 29820 |
value: min2, |
| 29821 |
max: max2 ? Number(max2) - step : void 0, |
| 29822 |
onChange: onChangeMin, |
| 29823 |
__next40pxDefaultSize: true, |
| 29824 |
hideLabelFromVision, |
| 29825 |
step |
| 29826 |
} |
| 29827 |
), |
| 29828 |
/* @__PURE__ */ (0, import_jsx_runtime141.jsx)( |
| 29829 |
import_components39.__experimentalNumberControl, |
| 29830 |
{ |
| 29831 |
label: (0, import_i18n41.__)("Max."), |
| 29832 |
value: max2, |
| 29833 |
min: min2 ? Number(min2) + step : void 0, |
| 29834 |
onChange: onChangeMax, |
| 29835 |
__next40pxDefaultSize: true, |
| 29836 |
hideLabelFromVision, |
| 29837 |
step |
| 29838 |
} |
| 29839 |
) |
| 29840 |
] }) |
| 29841 |
} |
| 29842 |
); |
| 29843 |
} |
| 29844 |
function ValidatedNumber({ |
| 29845 |
data, |
| 29846 |
field, |
| 29847 |
onChange, |
| 29848 |
hideLabelFromVision, |
| 29849 |
markWhenOptional, |
| 29850 |
operator, |
| 29851 |
validity |
| 29852 |
}) { |
| 29853 |
const decimals = field.format?.decimals ?? 0; |
| 29854 |
const step = Math.pow(10, Math.abs(decimals) * -1); |
| 29855 |
const { label, description, getValue, setValue, isValid: isValid2 } = field; |
| 29856 |
const value = getValue({ item: data }) ?? ""; |
| 29857 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29858 |
const onChangeControl = (0, import_element109.useCallback)( |
| 29859 |
(newValue) => { |
| 29860 |
onChange( |
| 29861 |
setValue({ |
| 29862 |
item: data, |
| 29863 |
// Do not convert an empty string or undefined to a number, |
| 29864 |
// otherwise there's a mismatch between the UI control (empty) |
| 29865 |
// and the data relied by onChange (0). |
| 29866 |
value: ["", void 0].includes(newValue) ? void 0 : Number(newValue) |
| 29867 |
}) |
| 29868 |
); |
| 29869 |
}, |
| 29870 |
[data, onChange, setValue] |
| 29871 |
); |
| 29872 |
const onChangeBetweenControls = (0, import_element109.useCallback)( |
| 29873 |
(newValue) => { |
| 29874 |
onChange( |
| 29875 |
setValue({ |
| 29876 |
item: data, |
| 29877 |
value: newValue |
| 29878 |
}) |
| 29879 |
); |
| 29880 |
}, |
| 29881 |
[data, onChange, setValue] |
| 29882 |
); |
| 29883 |
if (operator === OPERATOR_BETWEEN) { |
| 29884 |
let valueBetween = ["", ""]; |
| 29885 |
if (Array.isArray(value) && value.length === 2 && value.every( |
| 29886 |
(element) => typeof element === "number" || element === "" |
| 29887 |
)) { |
| 29888 |
valueBetween = value; |
| 29889 |
} |
| 29890 |
return /* @__PURE__ */ (0, import_jsx_runtime141.jsx)( |
| 29891 |
BetweenControls, |
| 29892 |
{ |
| 29893 |
value: valueBetween, |
| 29894 |
onChange: onChangeBetweenControls, |
| 29895 |
hideLabelFromVision, |
| 29896 |
step |
| 29897 |
} |
| 29898 |
); |
| 29899 |
} |
| 29900 |
return /* @__PURE__ */ (0, import_jsx_runtime141.jsx)( |
| 29901 |
ValidatedNumberControl, |
| 29902 |
{ |
| 29903 |
required: !!isValid2.required, |
| 29904 |
markWhenOptional, |
| 29905 |
customValidity: getCustomValidity(isValid2, validity), |
| 29906 |
label, |
| 29907 |
help: description, |
| 29908 |
value, |
| 29909 |
onChange: onChangeControl, |
| 29910 |
__next40pxDefaultSize: true, |
| 29911 |
hideLabelFromVision, |
| 29912 |
step, |
| 29913 |
min: isValid2.min ? isValid2.min.constraint : void 0, |
| 29914 |
max: isValid2.max ? isValid2.max.constraint : void 0, |
| 29915 |
disabled: disabled2 |
| 29916 |
} |
| 29917 |
); |
| 29918 |
} |
| 29919 |
|
| 29920 |
// packages/dataviews/build-module/components/dataform-controls/integer.mjs |
| 29921 |
var import_jsx_runtime142 = __toESM(require_jsx_runtime(), 1); |
| 29922 |
function Integer(props) { |
| 29923 |
return /* @__PURE__ */ (0, import_jsx_runtime142.jsx)(ValidatedNumber, { ...props }); |
| 29924 |
} |
| 29925 |
|
| 29926 |
// packages/dataviews/build-module/components/dataform-controls/number.mjs |
| 29927 |
var import_jsx_runtime143 = __toESM(require_jsx_runtime(), 1); |
| 29928 |
function Number2(props) { |
| 29929 |
return /* @__PURE__ */ (0, import_jsx_runtime143.jsx)(ValidatedNumber, { ...props }); |
| 29930 |
} |
| 29931 |
|
| 29932 |
// packages/dataviews/build-module/components/dataform-controls/radio.mjs |
| 29933 |
var import_components40 = __toESM(require_components(), 1); |
| 29934 |
var import_element110 = __toESM(require_element(), 1); |
| 29935 |
var import_jsx_runtime144 = __toESM(require_jsx_runtime(), 1); |
| 29936 |
var { ValidatedRadioControl } = unlock3(import_components40.privateApis); |
| 29937 |
function Radio({ |
| 29938 |
data, |
| 29939 |
field, |
| 29940 |
onChange, |
| 29941 |
hideLabelFromVision, |
| 29942 |
markWhenOptional, |
| 29943 |
validity |
| 29944 |
}) { |
| 29945 |
const { label, description, getValue, setValue, isValid: isValid2 } = field; |
| 29946 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 29947 |
const { elements, isLoading } = useElements({ |
| 29948 |
elements: field.elements, |
| 29949 |
getElements: field.getElements |
| 29950 |
}); |
| 29951 |
const value = getValue({ item: data }); |
| 29952 |
const onChangeControl = (0, import_element110.useCallback)( |
| 29953 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 29954 |
[data, onChange, setValue] |
| 29955 |
); |
| 29956 |
if (isLoading) { |
| 29957 |
return /* @__PURE__ */ (0, import_jsx_runtime144.jsx)(import_components40.Spinner, {}); |
| 29958 |
} |
| 29959 |
return /* @__PURE__ */ (0, import_jsx_runtime144.jsx)( |
| 29960 |
ValidatedRadioControl, |
| 29961 |
{ |
| 29962 |
required: !!field.isValid?.required, |
| 29963 |
markWhenOptional, |
| 29964 |
customValidity: getCustomValidity(isValid2, validity), |
| 29965 |
label, |
| 29966 |
help: description, |
| 29967 |
onChange: onChangeControl, |
| 29968 |
options: elements, |
| 29969 |
selected: value, |
| 29970 |
hideLabelFromVision, |
| 29971 |
disabled: disabled2 |
| 29972 |
} |
| 29973 |
); |
| 29974 |
} |
| 29975 |
|
| 29976 |
// packages/dataviews/build-module/components/dataform-controls/text.mjs |
| 29977 |
var import_element111 = __toESM(require_element(), 1); |
| 29978 |
var import_jsx_runtime145 = __toESM(require_jsx_runtime(), 1); |
| 29979 |
function Text3({ |
| 29980 |
data, |
| 29981 |
field, |
| 29982 |
onChange, |
| 29983 |
hideLabelFromVision, |
| 29984 |
markWhenOptional, |
| 29985 |
config, |
| 29986 |
validity |
| 29987 |
}) { |
| 29988 |
const { prefix, suffix } = config || {}; |
| 29989 |
return /* @__PURE__ */ (0, import_jsx_runtime145.jsx)( |
| 29990 |
ValidatedText, |
| 29991 |
{ |
| 29992 |
...{ |
| 29993 |
data, |
| 29994 |
field, |
| 29995 |
onChange, |
| 29996 |
hideLabelFromVision, |
| 29997 |
markWhenOptional, |
| 29998 |
validity, |
| 29999 |
prefix: prefix ? (0, import_element111.createElement)(prefix) : void 0, |
| 30000 |
suffix: suffix ? (0, import_element111.createElement)(suffix) : void 0 |
| 30001 |
} |
| 30002 |
} |
| 30003 |
); |
| 30004 |
} |
| 30005 |
|
| 30006 |
// packages/dataviews/build-module/components/dataform-controls/toggle.mjs |
| 30007 |
var import_components41 = __toESM(require_components(), 1); |
| 30008 |
var import_element112 = __toESM(require_element(), 1); |
| 30009 |
var import_jsx_runtime146 = __toESM(require_jsx_runtime(), 1); |
| 30010 |
var { ValidatedToggleControl } = unlock3(import_components41.privateApis); |
| 30011 |
function Toggle({ |
| 30012 |
field, |
| 30013 |
onChange, |
| 30014 |
data, |
| 30015 |
hideLabelFromVision, |
| 30016 |
markWhenOptional, |
| 30017 |
validity |
| 30018 |
}) { |
| 30019 |
const { label, description, getValue, setValue, isValid: isValid2 } = field; |
| 30020 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30021 |
const onChangeControl = (0, import_element112.useCallback)(() => { |
| 30022 |
onChange( |
| 30023 |
setValue({ item: data, value: !getValue({ item: data }) }) |
| 30024 |
); |
| 30025 |
}, [onChange, setValue, data, getValue]); |
| 30026 |
return /* @__PURE__ */ (0, import_jsx_runtime146.jsx)( |
| 30027 |
ValidatedToggleControl, |
| 30028 |
{ |
| 30029 |
required: !!isValid2.required, |
| 30030 |
markWhenOptional, |
| 30031 |
customValidity: getCustomValidity(isValid2, validity), |
| 30032 |
hidden: hideLabelFromVision, |
| 30033 |
label, |
| 30034 |
help: description, |
| 30035 |
checked: getValue({ item: data }), |
| 30036 |
onChange: onChangeControl, |
| 30037 |
disabled: disabled2 |
| 30038 |
} |
| 30039 |
); |
| 30040 |
} |
| 30041 |
|
| 30042 |
// packages/dataviews/build-module/components/dataform-controls/textarea.mjs |
| 30043 |
var import_components42 = __toESM(require_components(), 1); |
| 30044 |
var import_element113 = __toESM(require_element(), 1); |
| 30045 |
var import_jsx_runtime147 = __toESM(require_jsx_runtime(), 1); |
| 30046 |
var { ValidatedTextareaControl } = unlock3(import_components42.privateApis); |
| 30047 |
function Textarea({ |
| 30048 |
data, |
| 30049 |
field, |
| 30050 |
onChange, |
| 30051 |
hideLabelFromVision, |
| 30052 |
markWhenOptional, |
| 30053 |
config, |
| 30054 |
validity |
| 30055 |
}) { |
| 30056 |
const { rows = 4 } = config || {}; |
| 30057 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30058 |
const { label, placeholder, description, setValue, isValid: isValid2 } = field; |
| 30059 |
const value = field.getValue({ item: data }); |
| 30060 |
const onChangeControl = (0, import_element113.useCallback)( |
| 30061 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 30062 |
[data, onChange, setValue] |
| 30063 |
); |
| 30064 |
return /* @__PURE__ */ (0, import_jsx_runtime147.jsx)( |
| 30065 |
ValidatedTextareaControl, |
| 30066 |
{ |
| 30067 |
required: !!isValid2.required, |
| 30068 |
markWhenOptional, |
| 30069 |
customValidity: getCustomValidity(isValid2, validity), |
| 30070 |
label, |
| 30071 |
placeholder, |
| 30072 |
value: value ?? "", |
| 30073 |
help: description, |
| 30074 |
onChange: onChangeControl, |
| 30075 |
rows, |
| 30076 |
disabled: disabled2, |
| 30077 |
minLength: isValid2.minLength ? isValid2.minLength.constraint : void 0, |
| 30078 |
maxLength: isValid2.maxLength ? isValid2.maxLength.constraint : void 0, |
| 30079 |
__next40pxDefaultSize: true, |
| 30080 |
hideLabelFromVision |
| 30081 |
} |
| 30082 |
); |
| 30083 |
} |
| 30084 |
|
| 30085 |
// packages/dataviews/build-module/components/dataform-controls/toggle-group.mjs |
| 30086 |
var import_components43 = __toESM(require_components(), 1); |
| 30087 |
var import_element114 = __toESM(require_element(), 1); |
| 30088 |
var import_jsx_runtime148 = __toESM(require_jsx_runtime(), 1); |
| 30089 |
var { ValidatedToggleGroupControl } = unlock3(import_components43.privateApis); |
| 30090 |
function ToggleGroup({ |
| 30091 |
data, |
| 30092 |
field, |
| 30093 |
onChange, |
| 30094 |
hideLabelFromVision, |
| 30095 |
markWhenOptional, |
| 30096 |
validity |
| 30097 |
}) { |
| 30098 |
const { getValue, setValue, isValid: isValid2 } = field; |
| 30099 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30100 |
const value = getValue({ item: data }); |
| 30101 |
const onChangeControl = (0, import_element114.useCallback)( |
| 30102 |
(newValue) => onChange(setValue({ item: data, value: newValue })), |
| 30103 |
[data, onChange, setValue] |
| 30104 |
); |
| 30105 |
const { elements, isLoading } = useElements({ |
| 30106 |
elements: field.elements, |
| 30107 |
getElements: field.getElements |
| 30108 |
}); |
| 30109 |
if (isLoading) { |
| 30110 |
return /* @__PURE__ */ (0, import_jsx_runtime148.jsx)(import_components43.Spinner, {}); |
| 30111 |
} |
| 30112 |
if (elements.length === 0) { |
| 30113 |
return null; |
| 30114 |
} |
| 30115 |
const selectedOption = elements.find((el) => el.value === value); |
| 30116 |
return /* @__PURE__ */ (0, import_jsx_runtime148.jsx)( |
| 30117 |
ValidatedToggleGroupControl, |
| 30118 |
{ |
| 30119 |
required: !!field.isValid?.required, |
| 30120 |
markWhenOptional, |
| 30121 |
customValidity: getCustomValidity(isValid2, validity), |
| 30122 |
__next40pxDefaultSize: true, |
| 30123 |
isBlock: true, |
| 30124 |
label: field.label, |
| 30125 |
help: selectedOption?.description || field.description, |
| 30126 |
onChange: onChangeControl, |
| 30127 |
value, |
| 30128 |
hideLabelFromVision, |
| 30129 |
children: elements.map((el) => /* @__PURE__ */ (0, import_jsx_runtime148.jsx)( |
| 30130 |
import_components43.__experimentalToggleGroupControlOption, |
| 30131 |
{ |
| 30132 |
label: el.label, |
| 30133 |
value: el.value, |
| 30134 |
disabled: disabled2 |
| 30135 |
}, |
| 30136 |
el.value |
| 30137 |
)) |
| 30138 |
} |
| 30139 |
); |
| 30140 |
} |
| 30141 |
|
| 30142 |
// packages/dataviews/build-module/components/dataform-controls/array.mjs |
| 30143 |
var import_components44 = __toESM(require_components(), 1); |
| 30144 |
var import_element115 = __toESM(require_element(), 1); |
| 30145 |
var import_jsx_runtime149 = __toESM(require_jsx_runtime(), 1); |
| 30146 |
var { ValidatedFormTokenField } = unlock3(import_components44.privateApis); |
| 30147 |
function ArrayControl({ |
| 30148 |
data, |
| 30149 |
field, |
| 30150 |
onChange, |
| 30151 |
hideLabelFromVision, |
| 30152 |
markWhenOptional, |
| 30153 |
validity |
| 30154 |
}) { |
| 30155 |
const { label, placeholder, description, getValue, setValue, isValid: isValid2 } = field; |
| 30156 |
const value = getValue({ item: data }); |
| 30157 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30158 |
const { elements, isLoading } = useElements({ |
| 30159 |
elements: field.elements, |
| 30160 |
getElements: field.getElements |
| 30161 |
}); |
| 30162 |
const arrayValueAsElements = (0, import_element115.useMemo)( |
| 30163 |
() => Array.isArray(value) ? value.map((token) => { |
| 30164 |
const element = elements?.find( |
| 30165 |
(suggestion) => suggestion.value === token |
| 30166 |
); |
| 30167 |
return element || { value: token, label: token }; |
| 30168 |
}) : [], |
| 30169 |
[value, elements] |
| 30170 |
); |
| 30171 |
const onChangeControl = (0, import_element115.useCallback)( |
| 30172 |
(tokens) => { |
| 30173 |
const valueTokens = tokens.map((token) => { |
| 30174 |
if (typeof token === "object" && "value" in token) { |
| 30175 |
return token.value; |
| 30176 |
} |
| 30177 |
return token; |
| 30178 |
}); |
| 30179 |
onChange(setValue({ item: data, value: valueTokens })); |
| 30180 |
}, |
| 30181 |
[onChange, setValue, data] |
| 30182 |
); |
| 30183 |
if (isLoading) { |
| 30184 |
return /* @__PURE__ */ (0, import_jsx_runtime149.jsx)(import_components44.Spinner, {}); |
| 30185 |
} |
| 30186 |
return /* @__PURE__ */ (0, import_jsx_runtime149.jsx)( |
| 30187 |
ValidatedFormTokenField, |
| 30188 |
{ |
| 30189 |
required: !!isValid2?.required, |
| 30190 |
markWhenOptional, |
| 30191 |
customValidity: getCustomValidity(isValid2, validity), |
| 30192 |
label: hideLabelFromVision ? void 0 : label, |
| 30193 |
value: arrayValueAsElements, |
| 30194 |
onChange: onChangeControl, |
| 30195 |
placeholder, |
| 30196 |
suggestions: elements?.map((element) => element.value), |
| 30197 |
disabled: disabled2, |
| 30198 |
__experimentalValidateInput: (token) => { |
| 30199 |
if (field.isValid?.elements && elements) { |
| 30200 |
return elements.some( |
| 30201 |
(element) => element.value === token || element.label === token |
| 30202 |
); |
| 30203 |
} |
| 30204 |
return true; |
| 30205 |
}, |
| 30206 |
__experimentalExpandOnFocus: elements && elements.length > 0, |
| 30207 |
help: description ?? (field.isValid?.elements ? "" : void 0), |
| 30208 |
displayTransform: (token) => { |
| 30209 |
if (typeof token === "object" && "label" in token) { |
| 30210 |
return token.label; |
| 30211 |
} |
| 30212 |
if (typeof token === "string" && elements) { |
| 30213 |
const element = elements.find( |
| 30214 |
(el) => el.value === token |
| 30215 |
); |
| 30216 |
return element?.label || token; |
| 30217 |
} |
| 30218 |
return token; |
| 30219 |
}, |
| 30220 |
__experimentalRenderItem: ({ item }) => { |
| 30221 |
if (typeof item === "string" && elements) { |
| 30222 |
const element = elements.find( |
| 30223 |
(el) => el.value === item |
| 30224 |
); |
| 30225 |
return /* @__PURE__ */ (0, import_jsx_runtime149.jsx)("span", { children: element?.label || item }); |
| 30226 |
} |
| 30227 |
return /* @__PURE__ */ (0, import_jsx_runtime149.jsx)("span", { children: item }); |
| 30228 |
} |
| 30229 |
} |
| 30230 |
); |
| 30231 |
} |
| 30232 |
|
| 30233 |
// node_modules/colord/index.mjs |
| 30234 |
var r2 = { grad: 0.9, turn: 360, rad: 360 / (2 * Math.PI) }; |
| 30235 |
var t = function(r3) { |
| 30236 |
return "string" == typeof r3 ? r3.length > 0 : "number" == typeof r3; |
| 30237 |
}; |
| 30238 |
var n = function(r3, t2, n2) { |
| 30239 |
return void 0 === t2 && (t2 = 0), void 0 === n2 && (n2 = Math.pow(10, t2)), Math.round(n2 * r3) / n2 + 0; |
| 30240 |
}; |
| 30241 |
var e = function(r3, t2, n2) { |
| 30242 |
return void 0 === t2 && (t2 = 0), void 0 === n2 && (n2 = 1), r3 > n2 ? n2 : r3 > t2 ? r3 : t2; |
| 30243 |
}; |
| 30244 |
var u = function(r3) { |
| 30245 |
return (r3 = isFinite(r3) ? r3 % 360 : 0) > 0 ? r3 : r3 + 360; |
| 30246 |
}; |
| 30247 |
var a = function(r3) { |
| 30248 |
return { r: e(r3.r, 0, 255), g: e(r3.g, 0, 255), b: e(r3.b, 0, 255), a: e(r3.a) }; |
| 30249 |
}; |
| 30250 |
var o = function(r3) { |
| 30251 |
return { r: n(r3.r), g: n(r3.g), b: n(r3.b), a: n(r3.a, 3) }; |
| 30252 |
}; |
| 30253 |
var i = /^#([0-9a-f]{3,8})$/i; |
| 30254 |
var s = function(r3) { |
| 30255 |
var t2 = r3.toString(16); |
| 30256 |
return t2.length < 2 ? "0" + t2 : t2; |
| 30257 |
}; |
| 30258 |
var h = function(r3) { |
| 30259 |
var t2 = r3.r, n2 = r3.g, e2 = r3.b, u2 = r3.a, a2 = Math.max(t2, n2, e2), o2 = a2 - Math.min(t2, n2, e2), i2 = o2 ? a2 === t2 ? (n2 - e2) / o2 : a2 === n2 ? 2 + (e2 - t2) / o2 : 4 + (t2 - n2) / o2 : 0; |
| 30260 |
return { h: 60 * (i2 < 0 ? i2 + 6 : i2), s: a2 ? o2 / a2 * 100 : 0, v: a2 / 255 * 100, a: u2 }; |
| 30261 |
}; |
| 30262 |
var b = function(r3) { |
| 30263 |
var t2 = r3.h, n2 = r3.s, e2 = r3.v, u2 = r3.a; |
| 30264 |
t2 = t2 / 360 * 6, n2 /= 100, e2 /= 100; |
| 30265 |
var a2 = Math.floor(t2), o2 = e2 * (1 - n2), i2 = e2 * (1 - (t2 - a2) * n2), s2 = e2 * (1 - (1 - t2 + a2) * n2), h2 = a2 % 6; |
| 30266 |
return { r: 255 * [e2, i2, o2, o2, s2, e2][h2], g: 255 * [s2, e2, e2, i2, o2, o2][h2], b: 255 * [o2, o2, s2, e2, e2, i2][h2], a: u2 }; |
| 30267 |
}; |
| 30268 |
var g = function(r3) { |
| 30269 |
return { h: u(r3.h), s: e(r3.s, 0, 100), l: e(r3.l, 0, 100), a: e(r3.a) }; |
| 30270 |
}; |
| 30271 |
var d = function(r3) { |
| 30272 |
return { h: n(r3.h), s: n(r3.s), l: n(r3.l), a: n(r3.a, 3) }; |
| 30273 |
}; |
| 30274 |
var f = function(r3) { |
| 30275 |
return b((n2 = (t2 = r3).s, { h: t2.h, s: (n2 *= ((e2 = t2.l) < 50 ? e2 : 100 - e2) / 100) > 0 ? 2 * n2 / (e2 + n2) * 100 : 0, v: e2 + n2, a: t2.a })); |
| 30276 |
var t2, n2, e2; |
| 30277 |
}; |
| 30278 |
var c = function(r3) { |
| 30279 |
return { h: (t2 = h(r3)).h, s: (u2 = (200 - (n2 = t2.s)) * (e2 = t2.v) / 100) > 0 && u2 < 200 ? n2 * e2 / 100 / (u2 <= 100 ? u2 : 200 - u2) * 100 : 0, l: u2 / 2, a: t2.a }; |
| 30280 |
var t2, n2, e2, u2; |
| 30281 |
}; |
| 30282 |
var l = /^hsla?\(\s*([+-]?\d*\.?\d+)(deg|rad|grad|turn)?\s*,\s*([+-]?\d*\.?\d+)%\s*,\s*([+-]?\d*\.?\d+)%\s*(?:,\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i; |
| 30283 |
var p = /^hsla?\(\s*([+-]?\d*\.?\d+)(deg|rad|grad|turn)?\s+([+-]?\d*\.?\d+)%\s+([+-]?\d*\.?\d+)%\s*(?:\/\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i; |
| 30284 |
var v = /^rgba?\(\s*([+-]?\d*\.?\d+)(%)?\s*,\s*([+-]?\d*\.?\d+)(%)?\s*,\s*([+-]?\d*\.?\d+)(%)?\s*(?:,\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i; |
| 30285 |
var m = /^rgba?\(\s*([+-]?\d*\.?\d+)(%)?\s+([+-]?\d*\.?\d+)(%)?\s+([+-]?\d*\.?\d+)(%)?\s*(?:\/\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i; |
| 30286 |
var y = { string: [[function(r3) { |
| 30287 |
var t2 = i.exec(r3); |
| 30288 |
return t2 ? (r3 = t2[1]).length <= 4 ? { r: parseInt(r3[0] + r3[0], 16), g: parseInt(r3[1] + r3[1], 16), b: parseInt(r3[2] + r3[2], 16), a: 4 === r3.length ? n(parseInt(r3[3] + r3[3], 16) / 255, 2) : 1 } : 6 === r3.length || 8 === r3.length ? { r: parseInt(r3.substr(0, 2), 16), g: parseInt(r3.substr(2, 2), 16), b: parseInt(r3.substr(4, 2), 16), a: 8 === r3.length ? n(parseInt(r3.substr(6, 2), 16) / 255, 2) : 1 } : null : null; |
| 30289 |
}, "hex"], [function(r3) { |
| 30290 |
var t2 = v.exec(r3) || m.exec(r3); |
| 30291 |
return t2 ? t2[2] !== t2[4] || t2[4] !== t2[6] ? null : a({ r: Number(t2[1]) / (t2[2] ? 100 / 255 : 1), g: Number(t2[3]) / (t2[4] ? 100 / 255 : 1), b: Number(t2[5]) / (t2[6] ? 100 / 255 : 1), a: void 0 === t2[7] ? 1 : Number(t2[7]) / (t2[8] ? 100 : 1) }) : null; |
| 30292 |
}, "rgb"], [function(t2) { |
| 30293 |
var n2 = l.exec(t2) || p.exec(t2); |
| 30294 |
if (!n2) return null; |
| 30295 |
var e2, u2, a2 = g({ h: (e2 = n2[1], u2 = n2[2], void 0 === u2 && (u2 = "deg"), Number(e2) * (r2[u2] || 1)), s: Number(n2[3]), l: Number(n2[4]), a: void 0 === n2[5] ? 1 : Number(n2[5]) / (n2[6] ? 100 : 1) }); |
| 30296 |
return f(a2); |
| 30297 |
}, "hsl"]], object: [[function(r3) { |
| 30298 |
var n2 = r3.r, e2 = r3.g, u2 = r3.b, o2 = r3.a, i2 = void 0 === o2 ? 1 : o2; |
| 30299 |
return t(n2) && t(e2) && t(u2) ? a({ r: Number(n2), g: Number(e2), b: Number(u2), a: Number(i2) }) : null; |
| 30300 |
}, "rgb"], [function(r3) { |
| 30301 |
var n2 = r3.h, e2 = r3.s, u2 = r3.l, a2 = r3.a, o2 = void 0 === a2 ? 1 : a2; |
| 30302 |
if (!t(n2) || !t(e2) || !t(u2)) return null; |
| 30303 |
var i2 = g({ h: Number(n2), s: Number(e2), l: Number(u2), a: Number(o2) }); |
| 30304 |
return f(i2); |
| 30305 |
}, "hsl"], [function(r3) { |
| 30306 |
var n2 = r3.h, a2 = r3.s, o2 = r3.v, i2 = r3.a, s2 = void 0 === i2 ? 1 : i2; |
| 30307 |
if (!t(n2) || !t(a2) || !t(o2)) return null; |
| 30308 |
var h2 = (function(r4) { |
| 30309 |
return { h: u(r4.h), s: e(r4.s, 0, 100), v: e(r4.v, 0, 100), a: e(r4.a) }; |
| 30310 |
})({ h: Number(n2), s: Number(a2), v: Number(o2), a: Number(s2) }); |
| 30311 |
return b(h2); |
| 30312 |
}, "hsv"]] }; |
| 30313 |
var N = function(r3, t2) { |
| 30314 |
for (var n2 = 0; n2 < t2.length; n2++) { |
| 30315 |
var e2 = t2[n2][0](r3); |
| 30316 |
if (e2) return [e2, t2[n2][1]]; |
| 30317 |
} |
| 30318 |
return [null, void 0]; |
| 30319 |
}; |
| 30320 |
var x = function(r3) { |
| 30321 |
return "string" == typeof r3 ? N(r3.trim(), y.string) : "object" == typeof r3 && null !== r3 ? N(r3, y.object) : [null, void 0]; |
| 30322 |
}; |
| 30323 |
var M = function(r3, t2) { |
| 30324 |
var n2 = c(r3); |
| 30325 |
return { h: n2.h, s: e(n2.s + 100 * t2, 0, 100), l: n2.l, a: n2.a }; |
| 30326 |
}; |
| 30327 |
var H = function(r3) { |
| 30328 |
return (299 * r3.r + 587 * r3.g + 114 * r3.b) / 1e3 / 255; |
| 30329 |
}; |
| 30330 |
var $ = function(r3, t2) { |
| 30331 |
var n2 = c(r3); |
| 30332 |
return { h: n2.h, s: n2.s, l: e(n2.l + 100 * t2, 0, 100), a: n2.a }; |
| 30333 |
}; |
| 30334 |
var j = (function() { |
| 30335 |
function r3(r4) { |
| 30336 |
this.parsed = x(r4)[0], this.rgba = this.parsed || { r: 0, g: 0, b: 0, a: 1 }; |
| 30337 |
} |
| 30338 |
return r3.prototype.isValid = function() { |
| 30339 |
return null !== this.parsed; |
| 30340 |
}, r3.prototype.brightness = function() { |
| 30341 |
return n(H(this.rgba), 2); |
| 30342 |
}, r3.prototype.isDark = function() { |
| 30343 |
return H(this.rgba) < 0.5; |
| 30344 |
}, r3.prototype.isLight = function() { |
| 30345 |
return H(this.rgba) >= 0.5; |
| 30346 |
}, r3.prototype.toHex = function() { |
| 30347 |
return r4 = o(this.rgba), t2 = r4.r, e2 = r4.g, u2 = r4.b, i2 = (a2 = r4.a) < 1 ? s(n(255 * a2)) : "", "#" + s(t2) + s(e2) + s(u2) + i2; |
| 30348 |
var r4, t2, e2, u2, a2, i2; |
| 30349 |
}, r3.prototype.toRgb = function() { |
| 30350 |
return o(this.rgba); |
| 30351 |
}, r3.prototype.toRgbString = function() { |
| 30352 |
return r4 = o(this.rgba), t2 = r4.r, n2 = r4.g, e2 = r4.b, (u2 = r4.a) < 1 ? "rgba(" + t2 + ", " + n2 + ", " + e2 + ", " + u2 + ")" : "rgb(" + t2 + ", " + n2 + ", " + e2 + ")"; |
| 30353 |
var r4, t2, n2, e2, u2; |
| 30354 |
}, r3.prototype.toHsl = function() { |
| 30355 |
return d(c(this.rgba)); |
| 30356 |
}, r3.prototype.toHslString = function() { |
| 30357 |
return r4 = d(c(this.rgba)), t2 = r4.h, n2 = r4.s, e2 = r4.l, (u2 = r4.a) < 1 ? "hsla(" + t2 + ", " + n2 + "%, " + e2 + "%, " + u2 + ")" : "hsl(" + t2 + ", " + n2 + "%, " + e2 + "%)"; |
| 30358 |
var r4, t2, n2, e2, u2; |
| 30359 |
}, r3.prototype.toHsv = function() { |
| 30360 |
return r4 = h(this.rgba), { h: n(r4.h), s: n(r4.s), v: n(r4.v), a: n(r4.a, 3) }; |
| 30361 |
var r4; |
| 30362 |
}, r3.prototype.invert = function() { |
| 30363 |
return w({ r: 255 - (r4 = this.rgba).r, g: 255 - r4.g, b: 255 - r4.b, a: r4.a }); |
| 30364 |
var r4; |
| 30365 |
}, r3.prototype.saturate = function(r4) { |
| 30366 |
return void 0 === r4 && (r4 = 0.1), w(M(this.rgba, r4)); |
| 30367 |
}, r3.prototype.desaturate = function(r4) { |
| 30368 |
return void 0 === r4 && (r4 = 0.1), w(M(this.rgba, -r4)); |
| 30369 |
}, r3.prototype.grayscale = function() { |
| 30370 |
return w(M(this.rgba, -1)); |
| 30371 |
}, r3.prototype.lighten = function(r4) { |
| 30372 |
return void 0 === r4 && (r4 = 0.1), w($(this.rgba, r4)); |
| 30373 |
}, r3.prototype.darken = function(r4) { |
| 30374 |
return void 0 === r4 && (r4 = 0.1), w($(this.rgba, -r4)); |
| 30375 |
}, r3.prototype.rotate = function(r4) { |
| 30376 |
return void 0 === r4 && (r4 = 15), this.hue(this.hue() + r4); |
| 30377 |
}, r3.prototype.alpha = function(r4) { |
| 30378 |
return "number" == typeof r4 ? w({ r: (t2 = this.rgba).r, g: t2.g, b: t2.b, a: r4 }) : n(this.rgba.a, 3); |
| 30379 |
var t2; |
| 30380 |
}, r3.prototype.hue = function(r4) { |
| 30381 |
var t2 = c(this.rgba); |
| 30382 |
return "number" == typeof r4 ? w({ h: r4, s: t2.s, l: t2.l, a: t2.a }) : n(t2.h); |
| 30383 |
}, r3.prototype.isEqual = function(r4) { |
| 30384 |
return this.toHex() === w(r4).toHex(); |
| 30385 |
}, r3; |
| 30386 |
})(); |
| 30387 |
var w = function(r3) { |
| 30388 |
return r3 instanceof j ? r3 : new j(r3); |
| 30389 |
}; |
| 30390 |
|
| 30391 |
// packages/dataviews/build-module/components/dataform-controls/color.mjs |
| 30392 |
var import_components45 = __toESM(require_components(), 1); |
| 30393 |
var import_element116 = __toESM(require_element(), 1); |
| 30394 |
var import_i18n42 = __toESM(require_i18n(), 1); |
| 30395 |
var import_jsx_runtime150 = __toESM(require_jsx_runtime(), 1); |
| 30396 |
var { ValidatedInputControl: ValidatedInputControl3 } = unlock3(import_components45.privateApis); |
| 30397 |
var ColorPickerDropdown = ({ |
| 30398 |
color, |
| 30399 |
onColorChange, |
| 30400 |
disabled: disabled2 |
| 30401 |
}) => { |
| 30402 |
const validColor = color && w(color).isValid() ? color : "#ffffff"; |
| 30403 |
return /* @__PURE__ */ (0, import_jsx_runtime150.jsx)( |
| 30404 |
import_components45.Dropdown, |
| 30405 |
{ |
| 30406 |
className: "dataviews-controls__color-picker-dropdown", |
| 30407 |
popoverProps: { resize: false }, |
| 30408 |
renderToggle: ({ onToggle }) => /* @__PURE__ */ (0, import_jsx_runtime150.jsx)( |
| 30409 |
import_components45.Button, |
| 30410 |
{ |
| 30411 |
onClick: onToggle, |
| 30412 |
"aria-label": (0, import_i18n42.__)("Open color picker"), |
| 30413 |
size: "small", |
| 30414 |
disabled: disabled2, |
| 30415 |
accessibleWhenDisabled: true, |
| 30416 |
icon: () => /* @__PURE__ */ (0, import_jsx_runtime150.jsx)(import_components45.ColorIndicator, { colorValue: validColor }) |
| 30417 |
} |
| 30418 |
), |
| 30419 |
renderContent: () => /* @__PURE__ */ (0, import_jsx_runtime150.jsx)(import_components45.__experimentalDropdownContentWrapper, { paddingSize: "none", children: /* @__PURE__ */ (0, import_jsx_runtime150.jsx)( |
| 30420 |
import_components45.ColorPicker, |
| 30421 |
{ |
| 30422 |
color: validColor, |
| 30423 |
onChange: onColorChange, |
| 30424 |
enableAlpha: true |
| 30425 |
} |
| 30426 |
) }) |
| 30427 |
} |
| 30428 |
); |
| 30429 |
}; |
| 30430 |
function Color({ |
| 30431 |
data, |
| 30432 |
field, |
| 30433 |
onChange, |
| 30434 |
hideLabelFromVision, |
| 30435 |
markWhenOptional, |
| 30436 |
validity |
| 30437 |
}) { |
| 30438 |
const { label, placeholder, description, setValue, isValid: isValid2 } = field; |
| 30439 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30440 |
const value = field.getValue({ item: data }) || ""; |
| 30441 |
const handleColorChange = (0, import_element116.useCallback)( |
| 30442 |
(newColor) => { |
| 30443 |
onChange(setValue({ item: data, value: newColor })); |
| 30444 |
}, |
| 30445 |
[data, onChange, setValue] |
| 30446 |
); |
| 30447 |
const handleInputChange = (0, import_element116.useCallback)( |
| 30448 |
(newValue) => { |
| 30449 |
onChange(setValue({ item: data, value: newValue || "" })); |
| 30450 |
}, |
| 30451 |
[data, onChange, setValue] |
| 30452 |
); |
| 30453 |
return /* @__PURE__ */ (0, import_jsx_runtime150.jsx)( |
| 30454 |
ValidatedInputControl3, |
| 30455 |
{ |
| 30456 |
required: !!field.isValid?.required, |
| 30457 |
markWhenOptional, |
| 30458 |
customValidity: getCustomValidity(isValid2, validity), |
| 30459 |
label, |
| 30460 |
placeholder, |
| 30461 |
value, |
| 30462 |
help: description, |
| 30463 |
onChange: handleInputChange, |
| 30464 |
hideLabelFromVision, |
| 30465 |
type: "text", |
| 30466 |
disabled: disabled2, |
| 30467 |
prefix: /* @__PURE__ */ (0, import_jsx_runtime150.jsx)(import_components45.__experimentalInputControlPrefixWrapper, { variant: "control", children: /* @__PURE__ */ (0, import_jsx_runtime150.jsx)( |
| 30468 |
ColorPickerDropdown, |
| 30469 |
{ |
| 30470 |
color: value, |
| 30471 |
onColorChange: handleColorChange, |
| 30472 |
disabled: disabled2 |
| 30473 |
} |
| 30474 |
) }) |
| 30475 |
} |
| 30476 |
); |
| 30477 |
} |
| 30478 |
|
| 30479 |
// packages/dataviews/build-module/components/dataform-controls/password.mjs |
| 30480 |
var import_components46 = __toESM(require_components(), 1); |
| 30481 |
var import_element117 = __toESM(require_element(), 1); |
| 30482 |
var import_i18n43 = __toESM(require_i18n(), 1); |
| 30483 |
var import_jsx_runtime151 = __toESM(require_jsx_runtime(), 1); |
| 30484 |
function Password({ |
| 30485 |
data, |
| 30486 |
field, |
| 30487 |
onChange, |
| 30488 |
hideLabelFromVision, |
| 30489 |
markWhenOptional, |
| 30490 |
validity |
| 30491 |
}) { |
| 30492 |
const [isVisible2, setIsVisible] = (0, import_element117.useState)(false); |
| 30493 |
const disabled2 = field.isDisabled({ item: data, field }); |
| 30494 |
const toggleVisibility = (0, import_element117.useCallback)(() => { |
| 30495 |
setIsVisible((prev) => !prev); |
| 30496 |
}, []); |
| 30497 |
return /* @__PURE__ */ (0, import_jsx_runtime151.jsx)( |
| 30498 |
ValidatedText, |
| 30499 |
{ |
| 30500 |
...{ |
| 30501 |
data, |
| 30502 |
field, |
| 30503 |
onChange, |
| 30504 |
hideLabelFromVision, |
| 30505 |
markWhenOptional, |
| 30506 |
validity, |
| 30507 |
type: isVisible2 ? "text" : "password", |
| 30508 |
suffix: /* @__PURE__ */ (0, import_jsx_runtime151.jsx)(import_components46.__experimentalInputControlSuffixWrapper, { variant: "control", children: /* @__PURE__ */ (0, import_jsx_runtime151.jsx)( |
| 30509 |
import_components46.Button, |
| 30510 |
{ |
| 30511 |
icon: isVisible2 ? unseen_default : seen_default, |
| 30512 |
onClick: toggleVisibility, |
| 30513 |
size: "small", |
| 30514 |
label: isVisible2 ? (0, import_i18n43.__)("Hide password") : (0, import_i18n43.__)("Show password"), |
| 30515 |
disabled: disabled2, |
| 30516 |
accessibleWhenDisabled: true |
| 30517 |
} |
| 30518 |
) }) |
| 30519 |
} |
| 30520 |
} |
| 30521 |
); |
| 30522 |
} |
| 30523 |
|
| 30524 |
// packages/dataviews/build-module/field-types/utils/has-elements.mjs |
| 30525 |
function hasElements(field) { |
| 30526 |
return Array.isArray(field.elements) && field.elements.length > 0 || typeof field.getElements === "function"; |
| 30527 |
} |
| 30528 |
|
| 30529 |
// packages/dataviews/build-module/components/dataform-controls/index.mjs |
| 30530 |
var import_jsx_runtime152 = __toESM(require_jsx_runtime(), 1); |
| 30531 |
var FORM_CONTROLS = { |
| 30532 |
adaptiveSelect: AdaptiveSelect, |
| 30533 |
array: ArrayControl, |
| 30534 |
checkbox: Checkbox, |
| 30535 |
color: Color, |
| 30536 |
combobox: Combobox3, |
| 30537 |
datetime: DateTime, |
| 30538 |
date: DateControl, |
| 30539 |
email: Email, |
| 30540 |
telephone: Telephone, |
| 30541 |
url: Url, |
| 30542 |
integer: Integer, |
| 30543 |
number: Number2, |
| 30544 |
password: Password, |
| 30545 |
radio: Radio, |
| 30546 |
select: Select, |
| 30547 |
text: Text3, |
| 30548 |
toggle: Toggle, |
| 30549 |
textarea: Textarea, |
| 30550 |
toggleGroup: ToggleGroup |
| 30551 |
}; |
| 30552 |
function isEditConfig(value) { |
| 30553 |
return value && typeof value === "object" && typeof value.control === "string"; |
| 30554 |
} |
| 30555 |
function createConfiguredControl(config) { |
| 30556 |
const { control, ...controlConfig } = config; |
| 30557 |
const BaseControlType = getControlByType(control); |
| 30558 |
if (BaseControlType === null) { |
| 30559 |
return null; |
| 30560 |
} |
| 30561 |
return function ConfiguredControl(props) { |
| 30562 |
return /* @__PURE__ */ (0, import_jsx_runtime152.jsx)(BaseControlType, { ...props, config: controlConfig }); |
| 30563 |
}; |
| 30564 |
} |
| 30565 |
function getControl(field, fallback) { |
| 30566 |
if (typeof field.Edit === "function") { |
| 30567 |
return field.Edit; |
| 30568 |
} |
| 30569 |
if (typeof field.Edit === "string") { |
| 30570 |
return getControlByType(field.Edit); |
| 30571 |
} |
| 30572 |
if (isEditConfig(field.Edit)) { |
| 30573 |
return createConfiguredControl(field.Edit); |
| 30574 |
} |
| 30575 |
if (hasElements(field) && field.type !== "array") { |
| 30576 |
return getControlByType("adaptiveSelect"); |
| 30577 |
} |
| 30578 |
if (fallback === null) { |
| 30579 |
return null; |
| 30580 |
} |
| 30581 |
return getControlByType(fallback); |
| 30582 |
} |
| 30583 |
function getControlByType(type) { |
| 30584 |
if (Object.keys(FORM_CONTROLS).includes(type)) { |
| 30585 |
return FORM_CONTROLS[type]; |
| 30586 |
} |
| 30587 |
return null; |
| 30588 |
} |
| 30589 |
|
| 30590 |
// packages/dataviews/build-module/field-types/utils/get-filter-by.mjs |
| 30591 |
function getFilterBy(field, defaultOperators, validOperators) { |
| 30592 |
if (field.filterBy === false) { |
| 30593 |
return false; |
| 30594 |
} |
| 30595 |
const operators = field.filterBy?.operators?.filter( |
| 30596 |
(op) => validOperators.includes(op) |
| 30597 |
) ?? defaultOperators; |
| 30598 |
if (operators.length === 0) { |
| 30599 |
return false; |
| 30600 |
} |
| 30601 |
return { |
| 30602 |
isPrimary: !!field.filterBy?.isPrimary, |
| 30603 |
operators |
| 30604 |
}; |
| 30605 |
} |
| 30606 |
var get_filter_by_default = getFilterBy; |
| 30607 |
|
| 30608 |
// packages/dataviews/build-module/field-types/utils/get-value-from-id.mjs |
| 30609 |
var getValueFromId = (id) => ({ item }) => { |
| 30610 |
const path = id.split("."); |
| 30611 |
let value = item; |
| 30612 |
for (const segment of path) { |
| 30613 |
if (value.hasOwnProperty(segment)) { |
| 30614 |
value = value[segment]; |
| 30615 |
} else { |
| 30616 |
value = void 0; |
| 30617 |
} |
| 30618 |
} |
| 30619 |
return value; |
| 30620 |
}; |
| 30621 |
var get_value_from_id_default = getValueFromId; |
| 30622 |
|
| 30623 |
// packages/dataviews/build-module/field-types/utils/set-value-from-id.mjs |
| 30624 |
var setValueFromId = (id) => ({ value }) => { |
| 30625 |
const path = id.split("."); |
| 30626 |
const result = {}; |
| 30627 |
let current = result; |
| 30628 |
for (const segment of path.slice(0, -1)) { |
| 30629 |
current[segment] = {}; |
| 30630 |
current = current[segment]; |
| 30631 |
} |
| 30632 |
current[path.at(-1)] = value; |
| 30633 |
return result; |
| 30634 |
}; |
| 30635 |
var set_value_from_id_default = setValueFromId; |
| 30636 |
|
| 30637 |
// packages/dataviews/build-module/field-types/email.mjs |
| 30638 |
var import_i18n44 = __toESM(require_i18n(), 1); |
| 30639 |
|
| 30640 |
// packages/dataviews/build-module/field-types/utils/render-from-elements.mjs |
| 30641 |
function RenderFromElements({ |
| 30642 |
item, |
| 30643 |
field |
| 30644 |
}) { |
| 30645 |
const { elements, isLoading } = useElements({ |
| 30646 |
elements: field.elements, |
| 30647 |
getElements: field.getElements |
| 30648 |
}); |
| 30649 |
const value = field.getValue({ item }); |
| 30650 |
if (isLoading) { |
| 30651 |
return value; |
| 30652 |
} |
| 30653 |
if (elements.length === 0) { |
| 30654 |
return value; |
| 30655 |
} |
| 30656 |
return elements?.find((element) => element.value === value)?.label || field.getValue({ item }); |
| 30657 |
} |
| 30658 |
|
| 30659 |
// packages/dataviews/build-module/field-types/utils/render-default.mjs |
| 30660 |
var import_jsx_runtime153 = __toESM(require_jsx_runtime(), 1); |
| 30661 |
function render({ |
| 30662 |
item, |
| 30663 |
field |
| 30664 |
}) { |
| 30665 |
if (field.hasElements) { |
| 30666 |
return /* @__PURE__ */ (0, import_jsx_runtime153.jsx)(RenderFromElements, { item, field }); |
| 30667 |
} |
| 30668 |
return field.getValueFormatted({ item, field }); |
| 30669 |
} |
| 30670 |
|
| 30671 |
// packages/dataviews/build-module/field-types/utils/sort-text.mjs |
| 30672 |
var sort_text_default = (a2, b2, direction) => { |
| 30673 |
return direction === "asc" ? a2.localeCompare(b2) : b2.localeCompare(a2); |
| 30674 |
}; |
| 30675 |
|
| 30676 |
// packages/dataviews/build-module/field-types/utils/is-valid-required.mjs |
| 30677 |
function isValidRequired(item, field) { |
| 30678 |
const value = field.getValue({ item }); |
| 30679 |
return ![void 0, "", null].includes(value); |
| 30680 |
} |
| 30681 |
|
| 30682 |
// packages/dataviews/build-module/field-types/utils/is-valid-min-length.mjs |
| 30683 |
function isValidMinLength(item, field) { |
| 30684 |
if (typeof field.isValid.minLength?.constraint !== "number") { |
| 30685 |
return false; |
| 30686 |
} |
| 30687 |
const value = field.getValue({ item }); |
| 30688 |
if ([void 0, "", null].includes(value)) { |
| 30689 |
return true; |
| 30690 |
} |
| 30691 |
return String(value).length >= field.isValid.minLength.constraint; |
| 30692 |
} |
| 30693 |
|
| 30694 |
// packages/dataviews/build-module/field-types/utils/is-valid-max-length.mjs |
| 30695 |
function isValidMaxLength(item, field) { |
| 30696 |
if (typeof field.isValid.maxLength?.constraint !== "number") { |
| 30697 |
return false; |
| 30698 |
} |
| 30699 |
const value = field.getValue({ item }); |
| 30700 |
if ([void 0, "", null].includes(value)) { |
| 30701 |
return true; |
| 30702 |
} |
| 30703 |
return String(value).length <= field.isValid.maxLength.constraint; |
| 30704 |
} |
| 30705 |
|
| 30706 |
// packages/dataviews/build-module/field-types/utils/is-valid-pattern.mjs |
| 30707 |
function isValidPattern(item, field) { |
| 30708 |
if (field.isValid.pattern?.constraint === void 0) { |
| 30709 |
return true; |
| 30710 |
} |
| 30711 |
try { |
| 30712 |
const regexp = new RegExp(field.isValid.pattern.constraint); |
| 30713 |
const value = field.getValue({ item }); |
| 30714 |
if ([void 0, "", null].includes(value)) { |
| 30715 |
return true; |
| 30716 |
} |
| 30717 |
return regexp.test(String(value)); |
| 30718 |
} catch { |
| 30719 |
return false; |
| 30720 |
} |
| 30721 |
} |
| 30722 |
|
| 30723 |
// packages/dataviews/build-module/field-types/utils/is-valid-elements.mjs |
| 30724 |
function isValidElements(item, field) { |
| 30725 |
const elements = field.elements ?? []; |
| 30726 |
const validValues = elements.map((el) => el.value); |
| 30727 |
if (validValues.length === 0) { |
| 30728 |
return true; |
| 30729 |
} |
| 30730 |
const value = field.getValue({ item }); |
| 30731 |
return [].concat(value).every((v2) => validValues.includes(v2)); |
| 30732 |
} |
| 30733 |
|
| 30734 |
// packages/dataviews/build-module/field-types/utils/get-value-formatted-default.mjs |
| 30735 |
function getValueFormatted({ |
| 30736 |
item, |
| 30737 |
field |
| 30738 |
}) { |
| 30739 |
return field.getValue({ item }); |
| 30740 |
} |
| 30741 |
var get_value_formatted_default_default = getValueFormatted; |
| 30742 |
|
| 30743 |
// packages/dataviews/build-module/field-types/email.mjs |
| 30744 |
var emailRegex = /^[a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/; |
| 30745 |
function isValidCustom(item, field) { |
| 30746 |
const value = field.getValue({ item }); |
| 30747 |
if (![void 0, "", null].includes(value) && !emailRegex.test(value)) { |
| 30748 |
return (0, import_i18n44.__)("Value must be a valid email address."); |
| 30749 |
} |
| 30750 |
return null; |
| 30751 |
} |
| 30752 |
var email_default = { |
| 30753 |
type: "email", |
| 30754 |
render, |
| 30755 |
Edit: "email", |
| 30756 |
sort: sort_text_default, |
| 30757 |
enableSorting: true, |
| 30758 |
enableGlobalSearch: false, |
| 30759 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 30760 |
validOperators: [ |
| 30761 |
OPERATOR_IS, |
| 30762 |
OPERATOR_IS_NOT, |
| 30763 |
OPERATOR_CONTAINS, |
| 30764 |
OPERATOR_NOT_CONTAINS, |
| 30765 |
OPERATOR_STARTS_WITH, |
| 30766 |
// Multiple selection |
| 30767 |
OPERATOR_IS_ANY, |
| 30768 |
OPERATOR_IS_NONE, |
| 30769 |
OPERATOR_IS_ALL, |
| 30770 |
OPERATOR_IS_NOT_ALL |
| 30771 |
], |
| 30772 |
format: {}, |
| 30773 |
getValueFormatted: get_value_formatted_default_default, |
| 30774 |
validate: { |
| 30775 |
required: isValidRequired, |
| 30776 |
pattern: isValidPattern, |
| 30777 |
minLength: isValidMinLength, |
| 30778 |
maxLength: isValidMaxLength, |
| 30779 |
elements: isValidElements, |
| 30780 |
custom: isValidCustom |
| 30781 |
} |
| 30782 |
}; |
| 30783 |
|
| 30784 |
// packages/dataviews/build-module/field-types/integer.mjs |
| 30785 |
var import_i18n45 = __toESM(require_i18n(), 1); |
| 30786 |
|
| 30787 |
// packages/dataviews/build-module/field-types/utils/sort-number.mjs |
| 30788 |
var sort_number_default = (a2, b2, direction) => { |
| 30789 |
return direction === "asc" ? a2 - b2 : b2 - a2; |
| 30790 |
}; |
| 30791 |
|
| 30792 |
// packages/dataviews/build-module/field-types/utils/is-valid-min.mjs |
| 30793 |
function isValidMin(item, field) { |
| 30794 |
if (typeof field.isValid.min?.constraint !== "number") { |
| 30795 |
return false; |
| 30796 |
} |
| 30797 |
const value = field.getValue({ item }); |
| 30798 |
if ([void 0, "", null].includes(value)) { |
| 30799 |
return true; |
| 30800 |
} |
| 30801 |
return Number(value) >= field.isValid.min.constraint; |
| 30802 |
} |
| 30803 |
|
| 30804 |
// packages/dataviews/build-module/field-types/utils/is-valid-max.mjs |
| 30805 |
function isValidMax(item, field) { |
| 30806 |
if (typeof field.isValid.max?.constraint !== "number") { |
| 30807 |
return false; |
| 30808 |
} |
| 30809 |
const value = field.getValue({ item }); |
| 30810 |
if ([void 0, "", null].includes(value)) { |
| 30811 |
return true; |
| 30812 |
} |
| 30813 |
return Number(value) <= field.isValid.max.constraint; |
| 30814 |
} |
| 30815 |
|
| 30816 |
// packages/dataviews/build-module/field-types/integer.mjs |
| 30817 |
var format2 = { |
| 30818 |
separatorThousand: "," |
| 30819 |
}; |
| 30820 |
function getValueFormatted2({ |
| 30821 |
item, |
| 30822 |
field |
| 30823 |
}) { |
| 30824 |
let value = field.getValue({ item }); |
| 30825 |
if (value === null || value === void 0) { |
| 30826 |
return ""; |
| 30827 |
} |
| 30828 |
value = Number(value); |
| 30829 |
if (!Number.isFinite(value)) { |
| 30830 |
return String(value); |
| 30831 |
} |
| 30832 |
let formatInteger; |
| 30833 |
if (field.type !== "integer") { |
| 30834 |
formatInteger = format2; |
| 30835 |
} else { |
| 30836 |
formatInteger = field.format; |
| 30837 |
} |
| 30838 |
const { separatorThousand } = formatInteger; |
| 30839 |
const integerValue = Math.trunc(value); |
| 30840 |
if (!separatorThousand) { |
| 30841 |
return String(integerValue); |
| 30842 |
} |
| 30843 |
return String(integerValue).replace( |
| 30844 |
/\B(?=(\d{3})+(?!\d))/g, |
| 30845 |
separatorThousand |
| 30846 |
); |
| 30847 |
} |
| 30848 |
function isValidCustom2(item, field) { |
| 30849 |
const value = field.getValue({ item }); |
| 30850 |
if (![void 0, "", null].includes(value) && !Number.isInteger(value)) { |
| 30851 |
return (0, import_i18n45.__)("Value must be an integer."); |
| 30852 |
} |
| 30853 |
return null; |
| 30854 |
} |
| 30855 |
var integer_default = { |
| 30856 |
type: "integer", |
| 30857 |
render, |
| 30858 |
Edit: "integer", |
| 30859 |
sort: sort_number_default, |
| 30860 |
enableSorting: true, |
| 30861 |
enableGlobalSearch: false, |
| 30862 |
defaultOperators: [ |
| 30863 |
OPERATOR_IS, |
| 30864 |
OPERATOR_IS_NOT, |
| 30865 |
OPERATOR_LESS_THAN, |
| 30866 |
OPERATOR_GREATER_THAN, |
| 30867 |
OPERATOR_LESS_THAN_OR_EQUAL, |
| 30868 |
OPERATOR_GREATER_THAN_OR_EQUAL, |
| 30869 |
OPERATOR_BETWEEN |
| 30870 |
], |
| 30871 |
validOperators: [ |
| 30872 |
// Single-selection |
| 30873 |
OPERATOR_IS, |
| 30874 |
OPERATOR_IS_NOT, |
| 30875 |
OPERATOR_LESS_THAN, |
| 30876 |
OPERATOR_GREATER_THAN, |
| 30877 |
OPERATOR_LESS_THAN_OR_EQUAL, |
| 30878 |
OPERATOR_GREATER_THAN_OR_EQUAL, |
| 30879 |
OPERATOR_BETWEEN, |
| 30880 |
// Multiple-selection |
| 30881 |
OPERATOR_IS_ANY, |
| 30882 |
OPERATOR_IS_NONE, |
| 30883 |
OPERATOR_IS_ALL, |
| 30884 |
OPERATOR_IS_NOT_ALL |
| 30885 |
], |
| 30886 |
format: format2, |
| 30887 |
getValueFormatted: getValueFormatted2, |
| 30888 |
validate: { |
| 30889 |
required: isValidRequired, |
| 30890 |
min: isValidMin, |
| 30891 |
max: isValidMax, |
| 30892 |
elements: isValidElements, |
| 30893 |
custom: isValidCustom2 |
| 30894 |
} |
| 30895 |
}; |
| 30896 |
|
| 30897 |
// packages/dataviews/build-module/field-types/number.mjs |
| 30898 |
var import_i18n46 = __toESM(require_i18n(), 1); |
| 30899 |
var format3 = { |
| 30900 |
separatorThousand: ",", |
| 30901 |
separatorDecimal: ".", |
| 30902 |
decimals: 2 |
| 30903 |
}; |
| 30904 |
function getValueFormatted3({ |
| 30905 |
item, |
| 30906 |
field |
| 30907 |
}) { |
| 30908 |
let value = field.getValue({ item }); |
| 30909 |
if (value === null || value === void 0) { |
| 30910 |
return ""; |
| 30911 |
} |
| 30912 |
value = Number(value); |
| 30913 |
if (!Number.isFinite(value)) { |
| 30914 |
return String(value); |
| 30915 |
} |
| 30916 |
let formatNumber; |
| 30917 |
if (field.type !== "number") { |
| 30918 |
formatNumber = format3; |
| 30919 |
} else { |
| 30920 |
formatNumber = field.format; |
| 30921 |
} |
| 30922 |
const { separatorThousand, separatorDecimal, decimals } = formatNumber; |
| 30923 |
const fixedValue = value.toFixed(decimals); |
| 30924 |
const [integerPart, decimalPart] = fixedValue.split("."); |
| 30925 |
const formattedInteger = separatorThousand ? integerPart.replace(/\B(?=(\d{3})+(?!\d))/g, separatorThousand) : integerPart; |
| 30926 |
return decimals === 0 ? formattedInteger : formattedInteger + separatorDecimal + decimalPart; |
| 30927 |
} |
| 30928 |
function isEmpty2(value) { |
| 30929 |
return value === "" || value === void 0 || value === null; |
| 30930 |
} |
| 30931 |
function isValidCustom3(item, field) { |
| 30932 |
const value = field.getValue({ item }); |
| 30933 |
if (!isEmpty2(value) && !Number.isFinite(value)) { |
| 30934 |
return (0, import_i18n46.__)("Value must be a number."); |
| 30935 |
} |
| 30936 |
return null; |
| 30937 |
} |
| 30938 |
var number_default = { |
| 30939 |
type: "number", |
| 30940 |
render, |
| 30941 |
Edit: "number", |
| 30942 |
sort: sort_number_default, |
| 30943 |
enableSorting: true, |
| 30944 |
enableGlobalSearch: false, |
| 30945 |
defaultOperators: [ |
| 30946 |
OPERATOR_IS, |
| 30947 |
OPERATOR_IS_NOT, |
| 30948 |
OPERATOR_LESS_THAN, |
| 30949 |
OPERATOR_GREATER_THAN, |
| 30950 |
OPERATOR_LESS_THAN_OR_EQUAL, |
| 30951 |
OPERATOR_GREATER_THAN_OR_EQUAL, |
| 30952 |
OPERATOR_BETWEEN |
| 30953 |
], |
| 30954 |
validOperators: [ |
| 30955 |
// Single-selection |
| 30956 |
OPERATOR_IS, |
| 30957 |
OPERATOR_IS_NOT, |
| 30958 |
OPERATOR_LESS_THAN, |
| 30959 |
OPERATOR_GREATER_THAN, |
| 30960 |
OPERATOR_LESS_THAN_OR_EQUAL, |
| 30961 |
OPERATOR_GREATER_THAN_OR_EQUAL, |
| 30962 |
OPERATOR_BETWEEN, |
| 30963 |
// Multiple-selection |
| 30964 |
OPERATOR_IS_ANY, |
| 30965 |
OPERATOR_IS_NONE, |
| 30966 |
OPERATOR_IS_ALL, |
| 30967 |
OPERATOR_IS_NOT_ALL |
| 30968 |
], |
| 30969 |
format: format3, |
| 30970 |
getValueFormatted: getValueFormatted3, |
| 30971 |
validate: { |
| 30972 |
required: isValidRequired, |
| 30973 |
min: isValidMin, |
| 30974 |
max: isValidMax, |
| 30975 |
elements: isValidElements, |
| 30976 |
custom: isValidCustom3 |
| 30977 |
} |
| 30978 |
}; |
| 30979 |
|
| 30980 |
// packages/dataviews/build-module/field-types/text.mjs |
| 30981 |
var text_default = { |
| 30982 |
type: "text", |
| 30983 |
render, |
| 30984 |
Edit: "text", |
| 30985 |
sort: sort_text_default, |
| 30986 |
enableSorting: true, |
| 30987 |
enableGlobalSearch: false, |
| 30988 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 30989 |
validOperators: [ |
| 30990 |
// Single selection |
| 30991 |
OPERATOR_IS, |
| 30992 |
OPERATOR_IS_NOT, |
| 30993 |
OPERATOR_CONTAINS, |
| 30994 |
OPERATOR_NOT_CONTAINS, |
| 30995 |
OPERATOR_STARTS_WITH, |
| 30996 |
// Multiple selection |
| 30997 |
OPERATOR_IS_ANY, |
| 30998 |
OPERATOR_IS_NONE, |
| 30999 |
OPERATOR_IS_ALL, |
| 31000 |
OPERATOR_IS_NOT_ALL |
| 31001 |
], |
| 31002 |
format: {}, |
| 31003 |
getValueFormatted: get_value_formatted_default_default, |
| 31004 |
validate: { |
| 31005 |
required: isValidRequired, |
| 31006 |
pattern: isValidPattern, |
| 31007 |
minLength: isValidMinLength, |
| 31008 |
maxLength: isValidMaxLength, |
| 31009 |
elements: isValidElements |
| 31010 |
} |
| 31011 |
}; |
| 31012 |
|
| 31013 |
// packages/dataviews/build-module/field-types/datetime.mjs |
| 31014 |
var import_date7 = __toESM(require_date(), 1); |
| 31015 |
|
| 31016 |
// packages/dataviews/build-module/field-types/utils/is-valid-date-boundary.mjs |
| 31017 |
var import_date6 = __toESM(require_date(), 1); |
| 31018 |
function parseDateLike(value) { |
| 31019 |
if (!value) { |
| 31020 |
return null; |
| 31021 |
} |
| 31022 |
if (!isValid(new Date(value))) { |
| 31023 |
return null; |
| 31024 |
} |
| 31025 |
const parsed = (0, import_date6.getDate)(value); |
| 31026 |
return parsed && isValid(parsed) ? parsed : null; |
| 31027 |
} |
| 31028 |
function validateDateLikeBoundary(item, field, boundary) { |
| 31029 |
const constraint = field.isValid[boundary]?.constraint; |
| 31030 |
if (typeof constraint !== "string") { |
| 31031 |
return false; |
| 31032 |
} |
| 31033 |
const value = field.getValue({ item }); |
| 31034 |
const boundaryValue = Array.isArray(value) ? value[boundary === "min" ? 0 : value.length - 1] : value; |
| 31035 |
if (boundaryValue === void 0 || boundaryValue === null || boundaryValue === "") { |
| 31036 |
return true; |
| 31037 |
} |
| 31038 |
const parsedConstraint = parseDateLike(constraint); |
| 31039 |
const parsedValue = parseDateLike(String(boundaryValue)); |
| 31040 |
return !!parsedConstraint && !!parsedValue && (boundary === "min" ? parsedValue.getTime() >= parsedConstraint.getTime() : parsedValue.getTime() <= parsedConstraint.getTime()); |
| 31041 |
} |
| 31042 |
function isValidMinDate(item, field) { |
| 31043 |
return validateDateLikeBoundary(item, field, "min"); |
| 31044 |
} |
| 31045 |
function isValidMaxDate(item, field) { |
| 31046 |
return validateDateLikeBoundary(item, field, "max"); |
| 31047 |
} |
| 31048 |
|
| 31049 |
// packages/dataviews/build-module/field-types/datetime.mjs |
| 31050 |
var format4 = { |
| 31051 |
datetime: (0, import_date7.getSettings)().formats.datetime, |
| 31052 |
weekStartsOn: (0, import_date7.getSettings)().l10n.startOfWeek |
| 31053 |
}; |
| 31054 |
function getValueFormatted4({ |
| 31055 |
item, |
| 31056 |
field |
| 31057 |
}) { |
| 31058 |
const value = field.getValue({ item }); |
| 31059 |
if (["", void 0, null].includes(value)) { |
| 31060 |
return ""; |
| 31061 |
} |
| 31062 |
let formatDatetime; |
| 31063 |
if (field.type !== "datetime") { |
| 31064 |
formatDatetime = format4; |
| 31065 |
} else { |
| 31066 |
formatDatetime = field.format; |
| 31067 |
} |
| 31068 |
return (0, import_date7.dateI18n)(formatDatetime.datetime, (0, import_date7.getDate)(value)); |
| 31069 |
} |
| 31070 |
var sort = (a2, b2, direction) => { |
| 31071 |
const timeA = new Date(a2).getTime(); |
| 31072 |
const timeB = new Date(b2).getTime(); |
| 31073 |
return direction === "asc" ? timeA - timeB : timeB - timeA; |
| 31074 |
}; |
| 31075 |
var datetime_default = { |
| 31076 |
type: "datetime", |
| 31077 |
render, |
| 31078 |
Edit: "datetime", |
| 31079 |
sort, |
| 31080 |
enableSorting: true, |
| 31081 |
enableGlobalSearch: false, |
| 31082 |
defaultOperators: [ |
| 31083 |
OPERATOR_ON, |
| 31084 |
OPERATOR_NOT_ON, |
| 31085 |
OPERATOR_BEFORE, |
| 31086 |
OPERATOR_AFTER, |
| 31087 |
OPERATOR_BEFORE_INC, |
| 31088 |
OPERATOR_AFTER_INC, |
| 31089 |
OPERATOR_IN_THE_PAST, |
| 31090 |
OPERATOR_OVER |
| 31091 |
], |
| 31092 |
validOperators: [ |
| 31093 |
OPERATOR_ON, |
| 31094 |
OPERATOR_NOT_ON, |
| 31095 |
OPERATOR_BEFORE, |
| 31096 |
OPERATOR_AFTER, |
| 31097 |
OPERATOR_BEFORE_INC, |
| 31098 |
OPERATOR_AFTER_INC, |
| 31099 |
OPERATOR_IN_THE_PAST, |
| 31100 |
OPERATOR_OVER |
| 31101 |
], |
| 31102 |
format: format4, |
| 31103 |
getValueFormatted: getValueFormatted4, |
| 31104 |
validate: { |
| 31105 |
required: isValidRequired, |
| 31106 |
elements: isValidElements, |
| 31107 |
min: isValidMinDate, |
| 31108 |
max: isValidMaxDate |
| 31109 |
} |
| 31110 |
}; |
| 31111 |
|
| 31112 |
// packages/dataviews/build-module/field-types/date.mjs |
| 31113 |
var import_date8 = __toESM(require_date(), 1); |
| 31114 |
var format5 = { |
| 31115 |
date: (0, import_date8.getSettings)().formats.date, |
| 31116 |
weekStartsOn: (0, import_date8.getSettings)().l10n.startOfWeek |
| 31117 |
}; |
| 31118 |
function getValueFormatted5({ |
| 31119 |
item, |
| 31120 |
field |
| 31121 |
}) { |
| 31122 |
const value = field.getValue({ item }); |
| 31123 |
if (["", void 0, null].includes(value)) { |
| 31124 |
return ""; |
| 31125 |
} |
| 31126 |
let formatDate2; |
| 31127 |
if (field.type !== "date") { |
| 31128 |
formatDate2 = format5; |
| 31129 |
} else { |
| 31130 |
formatDate2 = field.format; |
| 31131 |
} |
| 31132 |
return (0, import_date8.dateI18n)(formatDate2.date, (0, import_date8.getDate)(value)); |
| 31133 |
} |
| 31134 |
var sort2 = (a2, b2, direction) => { |
| 31135 |
const timeA = new Date(a2).getTime(); |
| 31136 |
const timeB = new Date(b2).getTime(); |
| 31137 |
return direction === "asc" ? timeA - timeB : timeB - timeA; |
| 31138 |
}; |
| 31139 |
var date_default = { |
| 31140 |
type: "date", |
| 31141 |
render, |
| 31142 |
Edit: "date", |
| 31143 |
sort: sort2, |
| 31144 |
enableSorting: true, |
| 31145 |
enableGlobalSearch: false, |
| 31146 |
defaultOperators: [ |
| 31147 |
OPERATOR_ON, |
| 31148 |
OPERATOR_NOT_ON, |
| 31149 |
OPERATOR_BEFORE, |
| 31150 |
OPERATOR_AFTER, |
| 31151 |
OPERATOR_BEFORE_INC, |
| 31152 |
OPERATOR_AFTER_INC, |
| 31153 |
OPERATOR_IN_THE_PAST, |
| 31154 |
OPERATOR_OVER, |
| 31155 |
OPERATOR_BETWEEN |
| 31156 |
], |
| 31157 |
validOperators: [ |
| 31158 |
OPERATOR_ON, |
| 31159 |
OPERATOR_NOT_ON, |
| 31160 |
OPERATOR_BEFORE, |
| 31161 |
OPERATOR_AFTER, |
| 31162 |
OPERATOR_BEFORE_INC, |
| 31163 |
OPERATOR_AFTER_INC, |
| 31164 |
OPERATOR_IN_THE_PAST, |
| 31165 |
OPERATOR_OVER, |
| 31166 |
OPERATOR_BETWEEN |
| 31167 |
], |
| 31168 |
format: format5, |
| 31169 |
getValueFormatted: getValueFormatted5, |
| 31170 |
validate: { |
| 31171 |
required: isValidRequired, |
| 31172 |
elements: isValidElements, |
| 31173 |
min: isValidMinDate, |
| 31174 |
max: isValidMaxDate |
| 31175 |
} |
| 31176 |
}; |
| 31177 |
|
| 31178 |
// packages/dataviews/build-module/field-types/boolean.mjs |
| 31179 |
var import_i18n47 = __toESM(require_i18n(), 1); |
| 31180 |
|
| 31181 |
// packages/dataviews/build-module/field-types/utils/is-valid-required-for-bool.mjs |
| 31182 |
function isValidRequiredForBool(item, field) { |
| 31183 |
const value = field.getValue({ item }); |
| 31184 |
return value === true; |
| 31185 |
} |
| 31186 |
|
| 31187 |
// packages/dataviews/build-module/field-types/boolean.mjs |
| 31188 |
function getValueFormatted6({ |
| 31189 |
item, |
| 31190 |
field |
| 31191 |
}) { |
| 31192 |
const value = field.getValue({ item }); |
| 31193 |
if (value === true) { |
| 31194 |
return (0, import_i18n47.__)("True"); |
| 31195 |
} |
| 31196 |
if (value === false) { |
| 31197 |
return (0, import_i18n47.__)("False"); |
| 31198 |
} |
| 31199 |
return ""; |
| 31200 |
} |
| 31201 |
function isValidCustom4(item, field) { |
| 31202 |
const value = field.getValue({ item }); |
| 31203 |
if (![void 0, "", null].includes(value) && ![true, false].includes(value)) { |
| 31204 |
return (0, import_i18n47.__)("Value must be true, false, or undefined"); |
| 31205 |
} |
| 31206 |
return null; |
| 31207 |
} |
| 31208 |
var sort3 = (a2, b2, direction) => { |
| 31209 |
const boolA = Boolean(a2); |
| 31210 |
const boolB = Boolean(b2); |
| 31211 |
if (boolA === boolB) { |
| 31212 |
return 0; |
| 31213 |
} |
| 31214 |
if (direction === "asc") { |
| 31215 |
return boolA ? 1 : -1; |
| 31216 |
} |
| 31217 |
return boolA ? -1 : 1; |
| 31218 |
}; |
| 31219 |
var boolean_default = { |
| 31220 |
type: "boolean", |
| 31221 |
render, |
| 31222 |
Edit: "checkbox", |
| 31223 |
sort: sort3, |
| 31224 |
validate: { |
| 31225 |
required: isValidRequiredForBool, |
| 31226 |
elements: isValidElements, |
| 31227 |
custom: isValidCustom4 |
| 31228 |
}, |
| 31229 |
enableSorting: true, |
| 31230 |
enableGlobalSearch: false, |
| 31231 |
defaultOperators: [OPERATOR_IS, OPERATOR_IS_NOT], |
| 31232 |
validOperators: [OPERATOR_IS, OPERATOR_IS_NOT], |
| 31233 |
format: {}, |
| 31234 |
getValueFormatted: getValueFormatted6 |
| 31235 |
}; |
| 31236 |
|
| 31237 |
// packages/dataviews/build-module/field-types/media.mjs |
| 31238 |
var media_default = { |
| 31239 |
type: "media", |
| 31240 |
render: () => null, |
| 31241 |
Edit: null, |
| 31242 |
sort: () => 0, |
| 31243 |
enableSorting: false, |
| 31244 |
enableGlobalSearch: false, |
| 31245 |
defaultOperators: [], |
| 31246 |
validOperators: [], |
| 31247 |
format: {}, |
| 31248 |
getValueFormatted: get_value_formatted_default_default, |
| 31249 |
// cannot validate any constraint, so |
| 31250 |
// the only available validation for the field author |
| 31251 |
// would be providing a custom validator. |
| 31252 |
validate: {} |
| 31253 |
}; |
| 31254 |
|
| 31255 |
// packages/dataviews/build-module/field-types/array.mjs |
| 31256 |
var import_i18n48 = __toESM(require_i18n(), 1); |
| 31257 |
|
| 31258 |
// packages/dataviews/build-module/field-types/utils/is-valid-required-for-array.mjs |
| 31259 |
function isValidRequiredForArray(item, field) { |
| 31260 |
const value = field.getValue({ item }); |
| 31261 |
return Array.isArray(value) && value.length > 0 && value.every( |
| 31262 |
(element) => ![void 0, "", null].includes(element) |
| 31263 |
); |
| 31264 |
} |
| 31265 |
|
| 31266 |
// packages/dataviews/build-module/field-types/array.mjs |
| 31267 |
function getValueFormatted7({ |
| 31268 |
item, |
| 31269 |
field |
| 31270 |
}) { |
| 31271 |
const value = field.getValue({ item }); |
| 31272 |
const arr = Array.isArray(value) ? value : []; |
| 31273 |
return arr.join(", "); |
| 31274 |
} |
| 31275 |
function render2({ item, field }) { |
| 31276 |
return getValueFormatted7({ item, field }); |
| 31277 |
} |
| 31278 |
function isValidCustom5(item, field) { |
| 31279 |
const value = field.getValue({ item }); |
| 31280 |
if (![void 0, "", null].includes(value) && !Array.isArray(value)) { |
| 31281 |
return (0, import_i18n48.__)("Value must be an array."); |
| 31282 |
} |
| 31283 |
if (!value.every((v2) => typeof v2 === "string")) { |
| 31284 |
return (0, import_i18n48.__)("Every value must be a string."); |
| 31285 |
} |
| 31286 |
return null; |
| 31287 |
} |
| 31288 |
var sort4 = (a2, b2, direction) => { |
| 31289 |
const arrA = Array.isArray(a2) ? a2 : []; |
| 31290 |
const arrB = Array.isArray(b2) ? b2 : []; |
| 31291 |
if (arrA.length !== arrB.length) { |
| 31292 |
return direction === "asc" ? arrA.length - arrB.length : arrB.length - arrA.length; |
| 31293 |
} |
| 31294 |
const joinedA = arrA.join(","); |
| 31295 |
const joinedB = arrB.join(","); |
| 31296 |
return direction === "asc" ? joinedA.localeCompare(joinedB) : joinedB.localeCompare(joinedA); |
| 31297 |
}; |
| 31298 |
var array_default = { |
| 31299 |
type: "array", |
| 31300 |
render: render2, |
| 31301 |
Edit: "array", |
| 31302 |
sort: sort4, |
| 31303 |
enableSorting: true, |
| 31304 |
enableGlobalSearch: false, |
| 31305 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 31306 |
validOperators: [ |
| 31307 |
OPERATOR_IS_ANY, |
| 31308 |
OPERATOR_IS_NONE, |
| 31309 |
OPERATOR_IS_ALL, |
| 31310 |
OPERATOR_IS_NOT_ALL |
| 31311 |
], |
| 31312 |
format: {}, |
| 31313 |
getValueFormatted: getValueFormatted7, |
| 31314 |
validate: { |
| 31315 |
required: isValidRequiredForArray, |
| 31316 |
elements: isValidElements, |
| 31317 |
custom: isValidCustom5 |
| 31318 |
} |
| 31319 |
}; |
| 31320 |
|
| 31321 |
// packages/dataviews/build-module/field-types/password.mjs |
| 31322 |
function getValueFormatted8({ |
| 31323 |
item, |
| 31324 |
field |
| 31325 |
}) { |
| 31326 |
return field.getValue({ item }) ? "\u2022\u2022\u2022\u2022\u2022\u2022\u2022\u2022" : ""; |
| 31327 |
} |
| 31328 |
var password_default = { |
| 31329 |
type: "password", |
| 31330 |
render, |
| 31331 |
Edit: "password", |
| 31332 |
sort: () => 0, |
| 31333 |
// Passwords should not be sortable for security reasons |
| 31334 |
enableSorting: false, |
| 31335 |
enableGlobalSearch: false, |
| 31336 |
defaultOperators: [], |
| 31337 |
validOperators: [], |
| 31338 |
format: {}, |
| 31339 |
getValueFormatted: getValueFormatted8, |
| 31340 |
validate: { |
| 31341 |
required: isValidRequired, |
| 31342 |
pattern: isValidPattern, |
| 31343 |
minLength: isValidMinLength, |
| 31344 |
maxLength: isValidMaxLength, |
| 31345 |
elements: isValidElements |
| 31346 |
} |
| 31347 |
}; |
| 31348 |
|
| 31349 |
// packages/dataviews/build-module/field-types/telephone.mjs |
| 31350 |
var telephone_default = { |
| 31351 |
type: "telephone", |
| 31352 |
render, |
| 31353 |
Edit: "telephone", |
| 31354 |
sort: sort_text_default, |
| 31355 |
enableSorting: true, |
| 31356 |
enableGlobalSearch: false, |
| 31357 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 31358 |
validOperators: [ |
| 31359 |
OPERATOR_IS, |
| 31360 |
OPERATOR_IS_NOT, |
| 31361 |
OPERATOR_CONTAINS, |
| 31362 |
OPERATOR_NOT_CONTAINS, |
| 31363 |
OPERATOR_STARTS_WITH, |
| 31364 |
// Multiple selection |
| 31365 |
OPERATOR_IS_ANY, |
| 31366 |
OPERATOR_IS_NONE, |
| 31367 |
OPERATOR_IS_ALL, |
| 31368 |
OPERATOR_IS_NOT_ALL |
| 31369 |
], |
| 31370 |
format: {}, |
| 31371 |
getValueFormatted: get_value_formatted_default_default, |
| 31372 |
validate: { |
| 31373 |
required: isValidRequired, |
| 31374 |
pattern: isValidPattern, |
| 31375 |
minLength: isValidMinLength, |
| 31376 |
maxLength: isValidMaxLength, |
| 31377 |
elements: isValidElements |
| 31378 |
} |
| 31379 |
}; |
| 31380 |
|
| 31381 |
// packages/dataviews/build-module/field-types/color.mjs |
| 31382 |
var import_i18n49 = __toESM(require_i18n(), 1); |
| 31383 |
var import_jsx_runtime154 = __toESM(require_jsx_runtime(), 1); |
| 31384 |
function render3({ item, field }) { |
| 31385 |
if (field.hasElements) { |
| 31386 |
return /* @__PURE__ */ (0, import_jsx_runtime154.jsx)(RenderFromElements, { item, field }); |
| 31387 |
} |
| 31388 |
const value = get_value_formatted_default_default({ item, field }); |
| 31389 |
if (!value || !w(value).isValid()) { |
| 31390 |
return value; |
| 31391 |
} |
| 31392 |
return /* @__PURE__ */ (0, import_jsx_runtime154.jsxs)("div", { style: { display: "flex", alignItems: "center", gap: "8px" }, children: [ |
| 31393 |
/* @__PURE__ */ (0, import_jsx_runtime154.jsx)( |
| 31394 |
"div", |
| 31395 |
{ |
| 31396 |
style: { |
| 31397 |
width: "16px", |
| 31398 |
height: "16px", |
| 31399 |
borderRadius: "50%", |
| 31400 |
backgroundColor: value, |
| 31401 |
border: "1px solid #ddd", |
| 31402 |
flexShrink: 0 |
| 31403 |
} |
| 31404 |
} |
| 31405 |
), |
| 31406 |
/* @__PURE__ */ (0, import_jsx_runtime154.jsx)("span", { children: value }) |
| 31407 |
] }); |
| 31408 |
} |
| 31409 |
function isValidCustom6(item, field) { |
| 31410 |
const value = field.getValue({ item }); |
| 31411 |
if (![void 0, "", null].includes(value) && !w(value).isValid()) { |
| 31412 |
return (0, import_i18n49.__)("Value must be a valid color."); |
| 31413 |
} |
| 31414 |
return null; |
| 31415 |
} |
| 31416 |
var sort5 = (a2, b2, direction) => { |
| 31417 |
const colorA = w(a2); |
| 31418 |
const colorB = w(b2); |
| 31419 |
if (!colorA.isValid() && !colorB.isValid()) { |
| 31420 |
return 0; |
| 31421 |
} |
| 31422 |
if (!colorA.isValid()) { |
| 31423 |
return direction === "asc" ? 1 : -1; |
| 31424 |
} |
| 31425 |
if (!colorB.isValid()) { |
| 31426 |
return direction === "asc" ? -1 : 1; |
| 31427 |
} |
| 31428 |
const hslA = colorA.toHsl(); |
| 31429 |
const hslB = colorB.toHsl(); |
| 31430 |
if (hslA.h !== hslB.h) { |
| 31431 |
return direction === "asc" ? hslA.h - hslB.h : hslB.h - hslA.h; |
| 31432 |
} |
| 31433 |
if (hslA.s !== hslB.s) { |
| 31434 |
return direction === "asc" ? hslA.s - hslB.s : hslB.s - hslA.s; |
| 31435 |
} |
| 31436 |
return direction === "asc" ? hslA.l - hslB.l : hslB.l - hslA.l; |
| 31437 |
}; |
| 31438 |
var color_default = { |
| 31439 |
type: "color", |
| 31440 |
render: render3, |
| 31441 |
Edit: "color", |
| 31442 |
sort: sort5, |
| 31443 |
enableSorting: true, |
| 31444 |
enableGlobalSearch: false, |
| 31445 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 31446 |
validOperators: [ |
| 31447 |
OPERATOR_IS, |
| 31448 |
OPERATOR_IS_NOT, |
| 31449 |
OPERATOR_IS_ANY, |
| 31450 |
OPERATOR_IS_NONE |
| 31451 |
], |
| 31452 |
format: {}, |
| 31453 |
getValueFormatted: get_value_formatted_default_default, |
| 31454 |
validate: { |
| 31455 |
required: isValidRequired, |
| 31456 |
elements: isValidElements, |
| 31457 |
custom: isValidCustom6 |
| 31458 |
} |
| 31459 |
}; |
| 31460 |
|
| 31461 |
// packages/dataviews/build-module/field-types/url.mjs |
| 31462 |
var url_default = { |
| 31463 |
type: "url", |
| 31464 |
render, |
| 31465 |
Edit: "url", |
| 31466 |
sort: sort_text_default, |
| 31467 |
enableSorting: true, |
| 31468 |
enableGlobalSearch: false, |
| 31469 |
defaultOperators: [OPERATOR_IS_ANY, OPERATOR_IS_NONE], |
| 31470 |
validOperators: [ |
| 31471 |
OPERATOR_IS, |
| 31472 |
OPERATOR_IS_NOT, |
| 31473 |
OPERATOR_CONTAINS, |
| 31474 |
OPERATOR_NOT_CONTAINS, |
| 31475 |
OPERATOR_STARTS_WITH, |
| 31476 |
// Multiple selection |
| 31477 |
OPERATOR_IS_ANY, |
| 31478 |
OPERATOR_IS_NONE, |
| 31479 |
OPERATOR_IS_ALL, |
| 31480 |
OPERATOR_IS_NOT_ALL |
| 31481 |
], |
| 31482 |
format: {}, |
| 31483 |
getValueFormatted: get_value_formatted_default_default, |
| 31484 |
validate: { |
| 31485 |
required: isValidRequired, |
| 31486 |
pattern: isValidPattern, |
| 31487 |
minLength: isValidMinLength, |
| 31488 |
maxLength: isValidMaxLength, |
| 31489 |
elements: isValidElements |
| 31490 |
} |
| 31491 |
}; |
| 31492 |
|
| 31493 |
// packages/dataviews/build-module/field-types/no-type.mjs |
| 31494 |
var sort6 = (a2, b2, direction) => { |
| 31495 |
if (typeof a2 === "number" && typeof b2 === "number") { |
| 31496 |
return sort_number_default(a2, b2, direction); |
| 31497 |
} |
| 31498 |
return sort_text_default(a2, b2, direction); |
| 31499 |
}; |
| 31500 |
var no_type_default = { |
| 31501 |
// type: no type for this one |
| 31502 |
render, |
| 31503 |
Edit: null, |
| 31504 |
sort: sort6, |
| 31505 |
enableSorting: true, |
| 31506 |
enableGlobalSearch: false, |
| 31507 |
defaultOperators: [OPERATOR_IS, OPERATOR_IS_NOT], |
| 31508 |
validOperators: getAllOperatorNames(), |
| 31509 |
format: {}, |
| 31510 |
getValueFormatted: get_value_formatted_default_default, |
| 31511 |
validate: { |
| 31512 |
required: isValidRequired, |
| 31513 |
elements: isValidElements |
| 31514 |
} |
| 31515 |
}; |
| 31516 |
|
| 31517 |
// packages/dataviews/build-module/field-types/utils/get-is-valid.mjs |
| 31518 |
function supportsNumericRangeConstraint(type) { |
| 31519 |
return type === "integer" || type === "number"; |
| 31520 |
} |
| 31521 |
function supportsDateRangeConstraint(type) { |
| 31522 |
return type === "date" || type === "datetime"; |
| 31523 |
} |
| 31524 |
function normalizeRangeRule(value, fieldType, key2) { |
| 31525 |
const validator = fieldType.validate[key2]; |
| 31526 |
if (validator && (typeof value === "number" && supportsNumericRangeConstraint(fieldType.type) || typeof value === "string" && supportsDateRangeConstraint(fieldType.type))) { |
| 31527 |
return { constraint: value, validate: validator }; |
| 31528 |
} |
| 31529 |
return void 0; |
| 31530 |
} |
| 31531 |
function getIsValid(field, fieldType) { |
| 31532 |
const rules = field.isValid; |
| 31533 |
let required; |
| 31534 |
if (rules?.required === true && fieldType.validate.required !== void 0) { |
| 31535 |
required = { |
| 31536 |
constraint: true, |
| 31537 |
validate: fieldType.validate.required |
| 31538 |
}; |
| 31539 |
} |
| 31540 |
let elements; |
| 31541 |
if ((rules?.elements === true || // elements is enabled unless the field opts-out |
| 31542 |
rules?.elements === void 0 && (!!field.elements || !!field.getElements)) && fieldType.validate.elements !== void 0) { |
| 31543 |
elements = { |
| 31544 |
constraint: true, |
| 31545 |
validate: fieldType.validate.elements |
| 31546 |
}; |
| 31547 |
} |
| 31548 |
const min2 = normalizeRangeRule(rules?.min, fieldType, "min"); |
| 31549 |
const max2 = normalizeRangeRule(rules?.max, fieldType, "max"); |
| 31550 |
const minLengthValue = rules?.minLength; |
| 31551 |
let minLength; |
| 31552 |
if (typeof minLengthValue === "number" && fieldType.validate.minLength !== void 0) { |
| 31553 |
minLength = { |
| 31554 |
constraint: minLengthValue, |
| 31555 |
validate: fieldType.validate.minLength |
| 31556 |
}; |
| 31557 |
} |
| 31558 |
const maxLengthValue = rules?.maxLength; |
| 31559 |
let maxLength; |
| 31560 |
if (typeof maxLengthValue === "number" && fieldType.validate.maxLength !== void 0) { |
| 31561 |
maxLength = { |
| 31562 |
constraint: maxLengthValue, |
| 31563 |
validate: fieldType.validate.maxLength |
| 31564 |
}; |
| 31565 |
} |
| 31566 |
const patternValue = rules?.pattern; |
| 31567 |
let pattern; |
| 31568 |
if (patternValue !== void 0 && fieldType.validate.pattern !== void 0) { |
| 31569 |
pattern = { |
| 31570 |
constraint: patternValue, |
| 31571 |
validate: fieldType.validate.pattern |
| 31572 |
}; |
| 31573 |
} |
| 31574 |
const custom = rules?.custom ?? fieldType.validate.custom; |
| 31575 |
return { |
| 31576 |
required, |
| 31577 |
elements, |
| 31578 |
min: min2, |
| 31579 |
max: max2, |
| 31580 |
minLength, |
| 31581 |
maxLength, |
| 31582 |
pattern, |
| 31583 |
custom |
| 31584 |
}; |
| 31585 |
} |
| 31586 |
|
| 31587 |
// packages/dataviews/build-module/field-types/utils/get-filter.mjs |
| 31588 |
function getFilter(fieldType) { |
| 31589 |
return fieldType.validOperators.reduce((accumulator, operator) => { |
| 31590 |
const operatorObj = getOperatorByName(operator); |
| 31591 |
if (operatorObj?.filter) { |
| 31592 |
accumulator[operator] = operatorObj.filter; |
| 31593 |
} |
| 31594 |
return accumulator; |
| 31595 |
}, {}); |
| 31596 |
} |
| 31597 |
|
| 31598 |
// packages/dataviews/build-module/field-types/utils/get-format.mjs |
| 31599 |
function getFormat(field, fieldType) { |
| 31600 |
return { |
| 31601 |
...fieldType.format, |
| 31602 |
...field.format |
| 31603 |
}; |
| 31604 |
} |
| 31605 |
var get_format_default = getFormat; |
| 31606 |
|
| 31607 |
// packages/dataviews/build-module/field-types/index.mjs |
| 31608 |
function getFieldTypeByName(type) { |
| 31609 |
const found = [ |
| 31610 |
email_default, |
| 31611 |
integer_default, |
| 31612 |
number_default, |
| 31613 |
text_default, |
| 31614 |
datetime_default, |
| 31615 |
date_default, |
| 31616 |
boolean_default, |
| 31617 |
media_default, |
| 31618 |
array_default, |
| 31619 |
password_default, |
| 31620 |
telephone_default, |
| 31621 |
color_default, |
| 31622 |
url_default |
| 31623 |
].find((fieldType) => fieldType?.type === type); |
| 31624 |
if (!!found) { |
| 31625 |
return found; |
| 31626 |
} |
| 31627 |
return no_type_default; |
| 31628 |
} |
| 31629 |
function normalizeFields(fields2) { |
| 31630 |
return fields2.map((field) => { |
| 31631 |
const fieldType = getFieldTypeByName(field.type); |
| 31632 |
const getValue = field.getValue || get_value_from_id_default(field.id); |
| 31633 |
const sort7 = function(a2, b2, direction) { |
| 31634 |
const aValue = getValue({ item: a2 }); |
| 31635 |
const bValue = getValue({ item: b2 }); |
| 31636 |
return field.sort ? field.sort(aValue, bValue, direction) : fieldType.sort(aValue, bValue, direction); |
| 31637 |
}; |
| 31638 |
return { |
| 31639 |
id: field.id, |
| 31640 |
label: field.label || field.id, |
| 31641 |
header: field.header || field.label || field.id, |
| 31642 |
description: field.description, |
| 31643 |
placeholder: field.placeholder, |
| 31644 |
getValue, |
| 31645 |
setValue: field.setValue || set_value_from_id_default(field.id), |
| 31646 |
elements: field.elements, |
| 31647 |
getElements: field.getElements, |
| 31648 |
hasElements: hasElements(field), |
| 31649 |
isVisible: field.isVisible, |
| 31650 |
isDisabled: typeof field.isDisabled === "function" ? field.isDisabled : () => !!field.isDisabled, |
| 31651 |
enableHiding: field.enableHiding ?? true, |
| 31652 |
readOnly: field.readOnly ?? false, |
| 31653 |
// The type provides defaults for the following props |
| 31654 |
type: fieldType.type, |
| 31655 |
render: field.render ?? fieldType.render, |
| 31656 |
Edit: getControl(field, fieldType.Edit), |
| 31657 |
sort: sort7, |
| 31658 |
enableSorting: field.enableSorting ?? fieldType.enableSorting, |
| 31659 |
enableGlobalSearch: field.enableGlobalSearch ?? fieldType.enableGlobalSearch, |
| 31660 |
isValid: getIsValid(field, fieldType), |
| 31661 |
filterBy: get_filter_by_default( |
| 31662 |
field, |
| 31663 |
fieldType.defaultOperators, |
| 31664 |
fieldType.validOperators |
| 31665 |
), |
| 31666 |
filter: getFilter(fieldType), |
| 31667 |
format: get_format_default(field, fieldType), |
| 31668 |
getValueFormatted: field.getValueFormatted ?? fieldType.getValueFormatted |
| 31669 |
}; |
| 31670 |
}); |
| 31671 |
} |
| 31672 |
|
| 31673 |
// packages/dataviews/build-module/hooks/use-data.mjs |
| 31674 |
var import_element118 = __toESM(require_element(), 1); |
| 31675 |
function useData({ |
| 31676 |
view, |
| 31677 |
data: shownData, |
| 31678 |
getItemId: getItemId2, |
| 31679 |
isLoading, |
| 31680 |
paginationInfo, |
| 31681 |
selection |
| 31682 |
}) { |
| 31683 |
const isInfiniteScrollEnabled = view.infiniteScrollEnabled; |
| 31684 |
const [hasInitiallyLoaded, setHasInitiallyLoaded] = (0, import_element118.useState)( |
| 31685 |
!isLoading |
| 31686 |
); |
| 31687 |
(0, import_element118.useEffect)(() => { |
| 31688 |
if (!isLoading) { |
| 31689 |
setHasInitiallyLoaded(true); |
| 31690 |
} |
| 31691 |
}, [isLoading]); |
| 31692 |
const previousDataRef = (0, import_element118.useRef)(shownData); |
| 31693 |
const previousPaginationInfoRef = (0, import_element118.useRef)(paginationInfo); |
| 31694 |
(0, import_element118.useEffect)(() => { |
| 31695 |
if (!isLoading) { |
| 31696 |
previousDataRef.current = shownData; |
| 31697 |
previousPaginationInfoRef.current = paginationInfo; |
| 31698 |
} |
| 31699 |
}, [shownData, isLoading, paginationInfo]); |
| 31700 |
const [visibleEntries, setVisibleEntries] = (0, import_element118.useState)([]); |
| 31701 |
const positionMapRef = (0, import_element118.useRef)(/* @__PURE__ */ new Map()); |
| 31702 |
const allLoadedRecordsRef = (0, import_element118.useRef)([]); |
| 31703 |
const prevViewParamsRef = (0, import_element118.useRef)({ |
| 31704 |
search: void 0, |
| 31705 |
filters: void 0, |
| 31706 |
perPage: void 0 |
| 31707 |
}); |
| 31708 |
const scrollDirectionRef = (0, import_element118.useRef)(void 0); |
| 31709 |
const prevStartPositionRef = (0, import_element118.useRef)(void 0); |
| 31710 |
const hasInitializedRef = (0, import_element118.useRef)(false); |
| 31711 |
const allLoadedRecords = (0, import_element118.useMemo)(() => { |
| 31712 |
if (view.startPosition !== void 0 && prevStartPositionRef.current !== void 0) { |
| 31713 |
if (view.startPosition < prevStartPositionRef.current) { |
| 31714 |
scrollDirectionRef.current = "up"; |
| 31715 |
} else if (view.startPosition > prevStartPositionRef.current) { |
| 31716 |
scrollDirectionRef.current = "down"; |
| 31717 |
} |
| 31718 |
} |
| 31719 |
prevStartPositionRef.current = view.startPosition; |
| 31720 |
const currentFiltersKey = JSON.stringify(view.filters ?? []); |
| 31721 |
const prevFiltersKey = prevViewParamsRef.current.filters; |
| 31722 |
const shouldReset = !hasInitializedRef.current || !view.infiniteScrollEnabled || view.search !== prevViewParamsRef.current.search || currentFiltersKey !== prevFiltersKey || view.perPage !== prevViewParamsRef.current.perPage; |
| 31723 |
hasInitializedRef.current = true; |
| 31724 |
prevViewParamsRef.current = { |
| 31725 |
search: view.search, |
| 31726 |
filters: currentFiltersKey, |
| 31727 |
perPage: view.perPage |
| 31728 |
}; |
| 31729 |
if (shouldReset) { |
| 31730 |
positionMapRef.current.clear(); |
| 31731 |
scrollDirectionRef.current = void 0; |
| 31732 |
const startPosition = view.search ? 1 : view.startPosition ?? 1; |
| 31733 |
const records = shownData.map((record, index2) => { |
| 31734 |
const position = startPosition + index2; |
| 31735 |
positionMapRef.current.set(getItemId2(record), position); |
| 31736 |
return { |
| 31737 |
...record, |
| 31738 |
position |
| 31739 |
}; |
| 31740 |
}); |
| 31741 |
allLoadedRecordsRef.current = records; |
| 31742 |
return records; |
| 31743 |
} |
| 31744 |
const prev = allLoadedRecordsRef.current; |
| 31745 |
const shownDataIds = new Set(shownData.map(getItemId2)); |
| 31746 |
const scrollDirection = scrollDirectionRef.current; |
| 31747 |
const basePosition = view.search ? 1 : view.startPosition ?? 1; |
| 31748 |
const newRecords = shownData.map((record, index2) => { |
| 31749 |
const itemId = getItemId2(record); |
| 31750 |
const position = view.infiniteScrollEnabled ? basePosition + index2 : void 0; |
| 31751 |
if (position !== void 0) { |
| 31752 |
positionMapRef.current.set(itemId, position); |
| 31753 |
} |
| 31754 |
return { |
| 31755 |
...record, |
| 31756 |
position |
| 31757 |
}; |
| 31758 |
}); |
| 31759 |
if (newRecords.length === 0) { |
| 31760 |
return prev; |
| 31761 |
} |
| 31762 |
const prevWithoutDuplicates = prev.filter( |
| 31763 |
(record) => !shownDataIds.has(getItemId2(record)) |
| 31764 |
); |
| 31765 |
const allRecords = scrollDirection === "up" ? [...newRecords, ...prevWithoutDuplicates] : [...prevWithoutDuplicates, ...newRecords]; |
| 31766 |
allRecords.sort((a2, b2) => { |
| 31767 |
const posA = a2.position; |
| 31768 |
const posB = b2.position; |
| 31769 |
return posA - posB; |
| 31770 |
}); |
| 31771 |
let result = allRecords; |
| 31772 |
if (visibleEntries.length > 0) { |
| 31773 |
const visibleMin = Math.min(...visibleEntries); |
| 31774 |
const visibleMax = Math.max(...visibleEntries); |
| 31775 |
const buffer = 20; |
| 31776 |
const recordPositions = allRecords.map( |
| 31777 |
(r3) => r3.position |
| 31778 |
); |
| 31779 |
const minRecordPos = Math.min(...recordPositions); |
| 31780 |
const maxRecordPos = Math.max(...recordPositions); |
| 31781 |
const hasOverlap = !(maxRecordPos < visibleMin - buffer || minRecordPos > visibleMax + buffer); |
| 31782 |
if (hasOverlap) { |
| 31783 |
result = allRecords.filter((record) => { |
| 31784 |
const itemId = getItemId2(record); |
| 31785 |
const isSelected2 = selection?.includes(itemId); |
| 31786 |
if (isSelected2) { |
| 31787 |
return true; |
| 31788 |
} |
| 31789 |
const itemPosition = record.position; |
| 31790 |
if (scrollDirection === "up") { |
| 31791 |
return itemPosition <= visibleMax + buffer; |
| 31792 |
} else if (scrollDirection === "down") { |
| 31793 |
return itemPosition >= visibleMin - buffer; |
| 31794 |
} |
| 31795 |
return itemPosition >= visibleMin - buffer && itemPosition <= visibleMax + buffer; |
| 31796 |
}); |
| 31797 |
} |
| 31798 |
} |
| 31799 |
allLoadedRecordsRef.current = result; |
| 31800 |
return result; |
| 31801 |
}, [ |
| 31802 |
shownData, |
| 31803 |
view.search, |
| 31804 |
view.filters, |
| 31805 |
view.perPage, |
| 31806 |
view.startPosition, |
| 31807 |
view.infiniteScrollEnabled, |
| 31808 |
visibleEntries, |
| 31809 |
selection, |
| 31810 |
getItemId2 |
| 31811 |
]); |
| 31812 |
if (!isInfiniteScrollEnabled) { |
| 31813 |
const dataToReturn = isLoading && previousDataRef.current?.length ? previousDataRef.current : shownData; |
| 31814 |
return { |
| 31815 |
data: dataToReturn.map((item) => ({ |
| 31816 |
...item, |
| 31817 |
position: void 0 |
| 31818 |
})), |
| 31819 |
paginationInfo: isLoading && previousDataRef.current?.length ? previousPaginationInfoRef.current : paginationInfo, |
| 31820 |
hasInitiallyLoaded, |
| 31821 |
setVisibleEntries: void 0 |
| 31822 |
}; |
| 31823 |
} |
| 31824 |
return { |
| 31825 |
data: allLoadedRecords, |
| 31826 |
paginationInfo, |
| 31827 |
hasInitiallyLoaded, |
| 31828 |
setVisibleEntries |
| 31829 |
}; |
| 31830 |
} |
| 31831 |
|
| 31832 |
// packages/dataviews/build-module/hooks/use-infinite-scroll.mjs |
| 31833 |
var import_element119 = __toESM(require_element(), 1); |
| 31834 |
var import_compose15 = __toESM(require_compose(), 1); |
| 31835 |
function captureAnchorElement(container, anchorElementRef, direction) { |
| 31836 |
const containerRect = container.getBoundingClientRect(); |
| 31837 |
const centerY = containerRect.top + containerRect.height / 2; |
| 31838 |
const items = Array.from(container.querySelectorAll("[aria-posinset]")); |
| 31839 |
if (items.length === 0) { |
| 31840 |
return false; |
| 31841 |
} |
| 31842 |
const bestAnchor = items.reduce((best, item) => { |
| 31843 |
const itemRect = item.getBoundingClientRect(); |
| 31844 |
const itemCenterY = itemRect.top + itemRect.height / 2; |
| 31845 |
const distance = Math.abs(itemCenterY - centerY); |
| 31846 |
const bestRect = best.getBoundingClientRect(); |
| 31847 |
const bestCenterY = bestRect.top + bestRect.height / 2; |
| 31848 |
const bestDistance = Math.abs(bestCenterY - centerY); |
| 31849 |
return distance < bestDistance ? item : best; |
| 31850 |
}); |
| 31851 |
const posinset = Number(bestAnchor.getAttribute("aria-posinset")); |
| 31852 |
const anchorRect = bestAnchor.getBoundingClientRect(); |
| 31853 |
anchorElementRef.current = { |
| 31854 |
posinset, |
| 31855 |
viewportOffset: anchorRect.top - containerRect.top, |
| 31856 |
direction |
| 31857 |
}; |
| 31858 |
return true; |
| 31859 |
} |
| 31860 |
function useInfiniteScroll({ |
| 31861 |
view, |
| 31862 |
onChangeView, |
| 31863 |
isLoading, |
| 31864 |
paginationInfo, |
| 31865 |
containerRef, |
| 31866 |
setVisibleEntries |
| 31867 |
}) { |
| 31868 |
const anchorElementRef = (0, import_element119.useRef)(null); |
| 31869 |
const viewRef = (0, import_element119.useRef)(view); |
| 31870 |
const isLoadingRef = (0, import_element119.useRef)(isLoading); |
| 31871 |
const onChangeViewRef = (0, import_element119.useRef)(onChangeView); |
| 31872 |
const totalItemsRef = (0, import_element119.useRef)(paginationInfo.totalItems); |
| 31873 |
(0, import_element119.useLayoutEffect)(() => { |
| 31874 |
viewRef.current = view; |
| 31875 |
isLoadingRef.current = isLoading; |
| 31876 |
onChangeViewRef.current = onChangeView; |
| 31877 |
totalItemsRef.current = paginationInfo.totalItems; |
| 31878 |
}, [view, isLoading, onChangeView, paginationInfo.totalItems]); |
| 31879 |
const intersectionObserverCallback = (0, import_element119.useCallback)( |
| 31880 |
(entries) => { |
| 31881 |
if (!setVisibleEntries) { |
| 31882 |
return; |
| 31883 |
} |
| 31884 |
setVisibleEntries((prev) => { |
| 31885 |
const newVisibleEntries = new Set(prev); |
| 31886 |
let hasChanged = false; |
| 31887 |
entries.forEach((entry) => { |
| 31888 |
const posInSet = Number( |
| 31889 |
entry.target?.attributes?.getNamedItem( |
| 31890 |
"aria-posinset" |
| 31891 |
)?.value |
| 31892 |
); |
| 31893 |
if (isNaN(posInSet)) { |
| 31894 |
return; |
| 31895 |
} |
| 31896 |
if (entry.isIntersecting) { |
| 31897 |
if (!newVisibleEntries.has(posInSet)) { |
| 31898 |
newVisibleEntries.add(posInSet); |
| 31899 |
hasChanged = true; |
| 31900 |
} |
| 31901 |
} else if (newVisibleEntries.has(posInSet)) { |
| 31902 |
newVisibleEntries.delete(posInSet); |
| 31903 |
hasChanged = true; |
| 31904 |
} |
| 31905 |
}); |
| 31906 |
return hasChanged ? Array.from(newVisibleEntries).sort() : prev; |
| 31907 |
}); |
| 31908 |
}, |
| 31909 |
[setVisibleEntries] |
| 31910 |
); |
| 31911 |
(0, import_element119.useLayoutEffect)(() => { |
| 31912 |
const container = containerRef.current; |
| 31913 |
const anchor = anchorElementRef.current; |
| 31914 |
if (!container || !view.infiniteScrollEnabled || !anchor || isLoading) { |
| 31915 |
return; |
| 31916 |
} |
| 31917 |
const anchorElement = container.querySelector( |
| 31918 |
`[aria-posinset="${anchor.posinset}"]` |
| 31919 |
); |
| 31920 |
if (anchorElement) { |
| 31921 |
const containerRect = container.getBoundingClientRect(); |
| 31922 |
const anchorRect = anchorElement.getBoundingClientRect(); |
| 31923 |
const currentOffset = anchorRect.top - containerRect.top; |
| 31924 |
const scrollAdjustment = currentOffset - anchor.viewportOffset; |
| 31925 |
if (Math.abs(scrollAdjustment) > 1) { |
| 31926 |
container.scrollTop += scrollAdjustment; |
| 31927 |
} |
| 31928 |
} |
| 31929 |
anchorElementRef.current = null; |
| 31930 |
}, [containerRef, isLoading, view.infiniteScrollEnabled]); |
| 31931 |
const intersectionObserverRef = (0, import_element119.useRef)( |
| 31932 |
null |
| 31933 |
); |
| 31934 |
(0, import_element119.useEffect)(() => { |
| 31935 |
if (!view.infiniteScrollEnabled || !intersectionObserverCallback) { |
| 31936 |
if (intersectionObserverRef.current) { |
| 31937 |
intersectionObserverRef.current.disconnect(); |
| 31938 |
intersectionObserverRef.current = null; |
| 31939 |
} |
| 31940 |
return; |
| 31941 |
} |
| 31942 |
intersectionObserverRef.current = new IntersectionObserver( |
| 31943 |
intersectionObserverCallback, |
| 31944 |
{ root: null, rootMargin: "0px", threshold: 0.1 } |
| 31945 |
); |
| 31946 |
return () => { |
| 31947 |
if (intersectionObserverRef.current) { |
| 31948 |
intersectionObserverRef.current.disconnect(); |
| 31949 |
intersectionObserverRef.current = null; |
| 31950 |
} |
| 31951 |
}; |
| 31952 |
}, [view.infiniteScrollEnabled, intersectionObserverCallback]); |
| 31953 |
(0, import_element119.useEffect)(() => { |
| 31954 |
if (!view.infiniteScrollEnabled || !containerRef.current) { |
| 31955 |
return; |
| 31956 |
} |
| 31957 |
let lastScrollTop = 0; |
| 31958 |
const BOTTOM_THRESHOLD = 600; |
| 31959 |
const TOP_THRESHOLD = 800; |
| 31960 |
const handleScroll = (0, import_compose15.throttle)((event) => { |
| 31961 |
const currentView = viewRef.current; |
| 31962 |
const totalItems = totalItemsRef.current; |
| 31963 |
const target = event.target; |
| 31964 |
const scrollTop = target.scrollTop; |
| 31965 |
const scrollHeight = target.scrollHeight; |
| 31966 |
const clientHeight = target.clientHeight; |
| 31967 |
const scrollDirection = scrollTop > lastScrollTop ? "down" : "up"; |
| 31968 |
lastScrollTop = scrollTop; |
| 31969 |
if (isLoadingRef.current) { |
| 31970 |
return; |
| 31971 |
} |
| 31972 |
const currentStartPosition = currentView.startPosition || 1; |
| 31973 |
const batchSize = currentView.perPage || 10; |
| 31974 |
const currentEndPosition = Math.min( |
| 31975 |
currentStartPosition + batchSize, |
| 31976 |
totalItems |
| 31977 |
); |
| 31978 |
if (scrollDirection === "down" && scrollTop + clientHeight >= scrollHeight - BOTTOM_THRESHOLD) { |
| 31979 |
if (currentEndPosition < totalItems) { |
| 31980 |
const newStartPosition = currentEndPosition; |
| 31981 |
captureAnchorElement(target, anchorElementRef, "down"); |
| 31982 |
onChangeViewRef.current({ |
| 31983 |
...currentView, |
| 31984 |
startPosition: newStartPosition |
| 31985 |
}); |
| 31986 |
} |
| 31987 |
} |
| 31988 |
if (scrollDirection === "up" && scrollTop <= TOP_THRESHOLD) { |
| 31989 |
if (currentStartPosition > 1) { |
| 31990 |
const calculatedStartPosition = currentStartPosition - batchSize; |
| 31991 |
const newStartPosition = calculatedStartPosition < 6 ? 1 : calculatedStartPosition; |
| 31992 |
captureAnchorElement(target, anchorElementRef, "up"); |
| 31993 |
onChangeViewRef.current({ |
| 31994 |
...currentView, |
| 31995 |
startPosition: newStartPosition |
| 31996 |
}); |
| 31997 |
} |
| 31998 |
} |
| 31999 |
}, 50); |
| 32000 |
const container = containerRef.current; |
| 32001 |
container.addEventListener("scroll", handleScroll); |
| 32002 |
return () => { |
| 32003 |
container.removeEventListener("scroll", handleScroll); |
| 32004 |
handleScroll.cancel(); |
| 32005 |
}; |
| 32006 |
}, [containerRef, view.infiniteScrollEnabled]); |
| 32007 |
return { |
| 32008 |
intersectionObserver: intersectionObserverRef.current |
| 32009 |
}; |
| 32010 |
} |
| 32011 |
|
| 32012 |
// packages/dataviews/build-module/dataviews-picker/index.mjs |
| 32013 |
var import_element120 = __toESM(require_element(), 1); |
| 32014 |
var import_compose16 = __toESM(require_compose(), 1); |
| 32015 |
var import_jsx_runtime155 = __toESM(require_jsx_runtime(), 1); |
| 32016 |
var isItemClickable = () => false; |
| 32017 |
var dataViewsPickerLayouts = VIEW_LAYOUTS.filter( |
| 32018 |
(viewLayout) => viewLayout.isPicker |
| 32019 |
); |
| 32020 |
var defaultGetItemId = (item) => item.id; |
| 32021 |
var EMPTY_ARRAY5 = []; |
| 32022 |
var DEFAULT_PICKER_LAYOUTS = { |
| 32023 |
pickerGrid: true, |
| 32024 |
pickerTable: true |
| 32025 |
}; |
| 32026 |
function DefaultUI({ |
| 32027 |
search = true, |
| 32028 |
searchLabel = void 0 |
| 32029 |
}) { |
| 32030 |
const { view } = (0, import_element120.useContext)(dataviews_context_default); |
| 32031 |
const isInfiniteScroll = view.infiniteScrollEnabled; |
| 32032 |
return /* @__PURE__ */ (0, import_jsx_runtime155.jsxs)(import_jsx_runtime155.Fragment, { children: [ |
| 32033 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsxs)( |
| 32034 |
Stack, |
| 32035 |
{ |
| 32036 |
direction: "row", |
| 32037 |
align: "top", |
| 32038 |
justify: "space-between", |
| 32039 |
className: clsx_default("dataviews__view-actions", { |
| 32040 |
"dataviews__view-actions--infinite-scroll": isInfiniteScroll |
| 32041 |
}), |
| 32042 |
gap: "xs", |
| 32043 |
children: [ |
| 32044 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsxs)( |
| 32045 |
Stack, |
| 32046 |
{ |
| 32047 |
direction: "row", |
| 32048 |
gap: "sm", |
| 32049 |
justify: "start", |
| 32050 |
className: "dataviews__search", |
| 32051 |
children: [ |
| 32052 |
search && /* @__PURE__ */ (0, import_jsx_runtime155.jsx)(dataviews_search_default, { label: searchLabel }), |
| 32053 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsx)(toggle_default, {}) |
| 32054 |
] |
| 32055 |
} |
| 32056 |
), |
| 32057 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsx)(Stack, { direction: "row", gap: "xs", style: { flexShrink: 0 }, children: /* @__PURE__ */ (0, import_jsx_runtime155.jsx)(dataviews_view_config_default, {}) }) |
| 32058 |
] |
| 32059 |
} |
| 32060 |
), |
| 32061 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsx)(filters_toggled_default, { className: "dataviews-filters__container" }), |
| 32062 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsx)(DataViewsLayout, {}), |
| 32063 |
/* @__PURE__ */ (0, import_jsx_runtime155.jsx)(DataViewsPickerFooter, {}) |
| 32064 |
] }); |
| 32065 |
} |
| 32066 |
function DataViewsPicker({ |
| 32067 |
view, |
| 32068 |
onChangeView, |
| 32069 |
fields: fields2, |
| 32070 |
search = true, |
| 32071 |
searchLabel = void 0, |
| 32072 |
actions = EMPTY_ARRAY5, |
| 32073 |
data, |
| 32074 |
getItemId: getItemId2 = defaultGetItemId, |
| 32075 |
isLoading = false, |
| 32076 |
paginationInfo, |
| 32077 |
defaultLayouts: defaultLayoutsProperty = DEFAULT_PICKER_LAYOUTS, |
| 32078 |
selection, |
| 32079 |
onChangeSelection, |
| 32080 |
children, |
| 32081 |
config = { perPageSizes: [10, 20, 50, 100] }, |
| 32082 |
itemListLabel, |
| 32083 |
empty, |
| 32084 |
onReset |
| 32085 |
}) { |
| 32086 |
const { data: displayData, setVisibleEntries } = useData({ |
| 32087 |
view, |
| 32088 |
data, |
| 32089 |
getItemId: getItemId2, |
| 32090 |
selection, |
| 32091 |
paginationInfo |
| 32092 |
}); |
| 32093 |
const containerRef = (0, import_element120.useRef)(null); |
| 32094 |
const [containerWidth, setContainerWidth] = (0, import_element120.useState)(0); |
| 32095 |
const resizeObserverRef = (0, import_compose16.useResizeObserver)( |
| 32096 |
(resizeObserverEntries) => { |
| 32097 |
setContainerWidth( |
| 32098 |
resizeObserverEntries[0].borderBoxSize[0].inlineSize |
| 32099 |
); |
| 32100 |
}, |
| 32101 |
{ box: "border-box" } |
| 32102 |
); |
| 32103 |
const [openedFilter, setOpenedFilter] = (0, import_element120.useState)(null); |
| 32104 |
function setSelectionWithChange(value) { |
| 32105 |
const newValue = typeof value === "function" ? value(selection) : value; |
| 32106 |
if (onChangeSelection) { |
| 32107 |
onChangeSelection(newValue); |
| 32108 |
} |
| 32109 |
} |
| 32110 |
const _fields = (0, import_element120.useMemo)(() => normalizeFields(fields2), [fields2]); |
| 32111 |
const filters = use_filters_default(_fields, view); |
| 32112 |
const hasPrimaryOrLockedFilters = (0, import_element120.useMemo)( |
| 32113 |
() => (filters || []).some( |
| 32114 |
(filter) => filter.isPrimary || filter.isLocked |
| 32115 |
), |
| 32116 |
[filters] |
| 32117 |
); |
| 32118 |
const [isShowingFilter, setIsShowingFilter] = (0, import_element120.useState)( |
| 32119 |
hasPrimaryOrLockedFilters |
| 32120 |
); |
| 32121 |
const { intersectionObserver } = useInfiniteScroll({ |
| 32122 |
view, |
| 32123 |
onChangeView, |
| 32124 |
isLoading, |
| 32125 |
paginationInfo, |
| 32126 |
containerRef, |
| 32127 |
setVisibleEntries |
| 32128 |
}); |
| 32129 |
(0, import_element120.useEffect)(() => { |
| 32130 |
if (hasPrimaryOrLockedFilters && !isShowingFilter) { |
| 32131 |
setIsShowingFilter(true); |
| 32132 |
} |
| 32133 |
}, [hasPrimaryOrLockedFilters, isShowingFilter]); |
| 32134 |
const defaultLayouts = (0, import_element120.useMemo)( |
| 32135 |
() => Object.fromEntries( |
| 32136 |
Object.entries(defaultLayoutsProperty).filter(([layoutType]) => { |
| 32137 |
return dataViewsPickerLayouts.some( |
| 32138 |
(viewLayout) => viewLayout.type === layoutType |
| 32139 |
); |
| 32140 |
}).map(([key2, value]) => [ |
| 32141 |
key2, |
| 32142 |
value === true ? {} : value |
| 32143 |
]) |
| 32144 |
), |
| 32145 |
[defaultLayoutsProperty] |
| 32146 |
); |
| 32147 |
if (!defaultLayouts[view.type]) { |
| 32148 |
return null; |
| 32149 |
} |
| 32150 |
return /* @__PURE__ */ (0, import_jsx_runtime155.jsx)( |
| 32151 |
dataviews_context_default.Provider, |
| 32152 |
{ |
| 32153 |
value: { |
| 32154 |
view, |
| 32155 |
onChangeView, |
| 32156 |
fields: _fields, |
| 32157 |
actions, |
| 32158 |
data: displayData, |
| 32159 |
isLoading, |
| 32160 |
paginationInfo, |
| 32161 |
isItemClickable, |
| 32162 |
selection, |
| 32163 |
onChangeSelection: setSelectionWithChange, |
| 32164 |
openedFilter, |
| 32165 |
setOpenedFilter, |
| 32166 |
getItemId: getItemId2, |
| 32167 |
containerWidth, |
| 32168 |
containerRef, |
| 32169 |
resizeObserverRef, |
| 32170 |
defaultLayouts, |
| 32171 |
filters, |
| 32172 |
isShowingFilter, |
| 32173 |
setIsShowingFilter, |
| 32174 |
config, |
| 32175 |
itemListLabel, |
| 32176 |
empty, |
| 32177 |
onReset, |
| 32178 |
hasInitiallyLoaded: true, |
| 32179 |
intersectionObserver |
| 32180 |
}, |
| 32181 |
children: /* @__PURE__ */ (0, import_jsx_runtime155.jsx)("div", { className: "dataviews-picker-wrapper", children: children ?? /* @__PURE__ */ (0, import_jsx_runtime155.jsx)(DefaultUI, { search, searchLabel }) }) |
| 32182 |
} |
| 32183 |
); |
| 32184 |
} |
| 32185 |
var DataViewsPickerSubComponents = DataViewsPicker; |
| 32186 |
DataViewsPickerSubComponents.BulkActionToolbar = DataViewsPickerFooter; |
| 32187 |
DataViewsPickerSubComponents.Filters = filters_default; |
| 32188 |
DataViewsPickerSubComponents.FiltersToggled = filters_toggled_default; |
| 32189 |
DataViewsPickerSubComponents.FiltersToggle = toggle_default; |
| 32190 |
DataViewsPickerSubComponents.Layout = DataViewsLayout; |
| 32191 |
DataViewsPickerSubComponents.LayoutSwitcher = ViewTypeMenu; |
| 32192 |
DataViewsPickerSubComponents.Pagination = DataViewsPagination; |
| 32193 |
DataViewsPickerSubComponents.Search = dataviews_search_default; |
| 32194 |
DataViewsPickerSubComponents.ViewConfig = DataviewsViewConfigDropdown; |
| 32195 |
var dataviews_picker_default = DataViewsPickerSubComponents; |
| 32196 |
|
| 32197 |
// packages/dataviews/build-module/utils/filter-sort-and-paginate.mjs |
| 32198 |
var import_remove_accents2 = __toESM(require_remove_accents(), 1); |
| 32199 |
var import_deprecated = __toESM(require_deprecated(), 1); |
| 32200 |
function normalizeSearchInput2(input = "") { |
| 32201 |
return (0, import_remove_accents2.default)(input.trim().toLowerCase()); |
| 32202 |
} |
| 32203 |
var EMPTY_ARRAY6 = []; |
| 32204 |
function filterSortAndPaginate(data, view, fields2) { |
| 32205 |
if (!data) { |
| 32206 |
return { |
| 32207 |
data: EMPTY_ARRAY6, |
| 32208 |
paginationInfo: { totalItems: 0, totalPages: 0 } |
| 32209 |
}; |
| 32210 |
} |
| 32211 |
const _fields = normalizeFields(fields2); |
| 32212 |
let filteredData = [...data]; |
| 32213 |
if (view.search) { |
| 32214 |
const normalizedSearch = normalizeSearchInput2(view.search); |
| 32215 |
filteredData = filteredData.filter((item) => { |
| 32216 |
return _fields.filter((field) => field.enableGlobalSearch).some((field) => { |
| 32217 |
const fieldValue = field.getValue({ item }); |
| 32218 |
const values = Array.isArray(fieldValue) ? fieldValue : [fieldValue]; |
| 32219 |
return values.some( |
| 32220 |
(value) => normalizeSearchInput2(String(value)).includes( |
| 32221 |
normalizedSearch |
| 32222 |
) |
| 32223 |
); |
| 32224 |
}); |
| 32225 |
}); |
| 32226 |
} |
| 32227 |
if (view.filters && view.filters?.length > 0) { |
| 32228 |
view.filters.forEach((filter) => { |
| 32229 |
const field = _fields.find( |
| 32230 |
(_field) => _field.id === filter.field |
| 32231 |
); |
| 32232 |
if (field) { |
| 32233 |
if (filter.operator === OPERATOR_IS_NOT_ALL) { |
| 32234 |
(0, import_deprecated.default)("The 'isNotAll' filter operator", { |
| 32235 |
since: "7.0", |
| 32236 |
alternative: "'isNone'" |
| 32237 |
}); |
| 32238 |
} |
| 32239 |
const handler = field.filter[filter.operator]; |
| 32240 |
if (handler) { |
| 32241 |
filteredData = filteredData.filter( |
| 32242 |
(item) => handler(item, field, filter.value) |
| 32243 |
); |
| 32244 |
} |
| 32245 |
} |
| 32246 |
}); |
| 32247 |
} |
| 32248 |
const sortByField = view.sort?.field ? _fields.find((field) => { |
| 32249 |
return field.enableSorting !== false && field.id === view.sort?.field; |
| 32250 |
}) : null; |
| 32251 |
const groupByField = view.groupBy?.field ? _fields.find((field) => { |
| 32252 |
return field.enableSorting !== false && field.id === view.groupBy?.field; |
| 32253 |
}) : null; |
| 32254 |
if (sortByField || groupByField) { |
| 32255 |
filteredData.sort((a2, b2) => { |
| 32256 |
if (groupByField) { |
| 32257 |
const groupCompare = groupByField.sort( |
| 32258 |
a2, |
| 32259 |
b2, |
| 32260 |
view.groupBy?.direction ?? "asc" |
| 32261 |
); |
| 32262 |
if (groupCompare !== 0) { |
| 32263 |
return groupCompare; |
| 32264 |
} |
| 32265 |
} |
| 32266 |
if (sortByField) { |
| 32267 |
return sortByField.sort(a2, b2, view.sort?.direction ?? "desc"); |
| 32268 |
} |
| 32269 |
return 0; |
| 32270 |
}); |
| 32271 |
} |
| 32272 |
let totalItems = filteredData.length; |
| 32273 |
let totalPages = 1; |
| 32274 |
if (view.infiniteScrollEnabled && view.startPosition !== void 0 && view.perPage !== void 0) { |
| 32275 |
const start = view.startPosition - 1; |
| 32276 |
const end = Math.min(start + view.perPage, totalItems); |
| 32277 |
filteredData = filteredData?.slice(start, end); |
| 32278 |
} else if (view.page !== void 0 && view.perPage !== void 0) { |
| 32279 |
const start = (view.page - 1) * view.perPage; |
| 32280 |
totalItems = filteredData?.length || 0; |
| 32281 |
totalPages = Math.ceil(totalItems / view.perPage); |
| 32282 |
filteredData = filteredData?.slice(start, start + view.perPage); |
| 32283 |
} |
| 32284 |
return { |
| 32285 |
data: filteredData, |
| 32286 |
paginationInfo: { |
| 32287 |
totalItems, |
| 32288 |
totalPages |
| 32289 |
} |
| 32290 |
}; |
| 32291 |
} |
| 32292 |
|
| 32293 |
// routes/dashboard/widget-dashboard/components/widget-picker/widget-picker.tsx |
| 32294 |
var import_element123 = __toESM(require_element()); |
| 32295 |
var import_i18n50 = __toESM(require_i18n()); |
| 32296 |
|
| 32297 |
// routes/dashboard/widget-dashboard/components/widget-render/widget-render.tsx |
| 32298 |
var import_element122 = __toESM(require_element()); |
| 32299 |
|
| 32300 |
// routes/dashboard/widget-dashboard/utils/get-lazy-widget-component/get-lazy-widget-component.ts |
| 32301 |
var import_element121 = __toESM(require_element()); |
| 32302 |
function isValidWidgetModule(module) { |
| 32303 |
return typeof module === "object" && module !== null && "default" in module && typeof module.default === "function"; |
| 32304 |
} |
| 32305 |
var componentCache = /* @__PURE__ */ new Map(); |
| 32306 |
function getLazyWidgetComponent(renderModule, resolveWidgetModule) { |
| 32307 |
const cached = componentCache.get(renderModule); |
| 32308 |
if (cached) { |
| 32309 |
return cached; |
| 32310 |
} |
| 32311 |
const lazyComponent = (0, import_element121.lazy)(async () => { |
| 32312 |
const module = await resolveWidgetModule(renderModule); |
| 32313 |
if (!isValidWidgetModule(module)) { |
| 32314 |
throw new Error(`Invalid widget module: ${renderModule}`); |
| 32315 |
} |
| 32316 |
return module; |
| 32317 |
}); |
| 32318 |
componentCache.set(renderModule, lazyComponent); |
| 32319 |
return lazyComponent; |
| 32320 |
} |
| 32321 |
|
| 32322 |
// routes/dashboard/widget-dashboard/components/widget-render/widget-render.tsx |
| 32323 |
var import_jsx_runtime156 = __toESM(require_jsx_runtime()); |
| 32324 |
function WidgetRenderImpl({ widget, widgetType }) { |
| 32325 |
const { layout, onLayoutChange, resolveWidgetModule } = useDashboardInternalContext(); |
| 32326 |
const WidgetComponent = getLazyWidgetComponent( |
| 32327 |
widgetType.renderModule, |
| 32328 |
resolveWidgetModule |
| 32329 |
); |
| 32330 |
const setAttributes = (0, import_element122.useCallback)( |
| 32331 |
(next) => { |
| 32332 |
onLayoutChange( |
| 32333 |
layout.map( |
| 32334 |
(w2) => w2.uuid === widget.uuid ? { |
| 32335 |
...w2, |
| 32336 |
attributes: { |
| 32337 |
...w2.attributes, |
| 32338 |
...next |
| 32339 |
} |
| 32340 |
} : w2 |
| 32341 |
) |
| 32342 |
); |
| 32343 |
}, |
| 32344 |
[widget.uuid, layout, onLayoutChange] |
| 32345 |
); |
| 32346 |
return /* @__PURE__ */ (0, import_jsx_runtime156.jsx)(import_jsx_runtime156.Fragment, { children: /* @__PURE__ */ (0, import_jsx_runtime156.jsx)( |
| 32347 |
WidgetComponent, |
| 32348 |
{ |
| 32349 |
attributes: widget.attributes, |
| 32350 |
setAttributes |
| 32351 |
} |
| 32352 |
) }); |
| 32353 |
} |
| 32354 |
var WidgetRender = WidgetRenderImpl; |
| 32355 |
|
| 32356 |
// routes/dashboard/widget-dashboard/components/widget-picker/widget-picker.module.css |
| 32357 |
if (typeof process === "undefined" || true) { |
| 32358 |
registerStyle35("5f9f70868a", "._32fba4d898ff4e12__preview{height:100%;overflow:hidden;padding:var(--wpds-dimension-padding-md,12px)}"); |
| 32359 |
} |
| 32360 |
var widget_picker_default = { "preview": "_32fba4d898ff4e12__preview" }; |
| 32361 |
|
| 32362 |
// routes/dashboard/widget-dashboard/components/widget-picker/widget-picker.tsx |
| 32363 |
var import_jsx_runtime157 = __toESM(require_jsx_runtime()); |
| 32364 |
var DEFAULT_VIEW = { |
| 32365 |
type: "pickerGrid", |
| 32366 |
page: 1, |
| 32367 |
search: "", |
| 32368 |
mediaField: "preview", |
| 32369 |
titleField: "title" |
| 32370 |
}; |
| 32371 |
var getItemId = (item) => item.name; |
| 32372 |
function WidgetPreview({ item }) { |
| 32373 |
const exampleWidget = (0, import_element123.useMemo)( |
| 32374 |
() => createDashboardWidget(item, item.example?.attributes), |
| 32375 |
[item] |
| 32376 |
); |
| 32377 |
return /* @__PURE__ */ (0, import_jsx_runtime157.jsx)("div", { className: widget_picker_default.preview, ...{ inert: "" }, children: /* @__PURE__ */ (0, import_jsx_runtime157.jsx)(import_element123.Suspense, { fallback: null, children: /* @__PURE__ */ (0, import_jsx_runtime157.jsx)(WidgetRender, { widget: exampleWidget, widgetType: item }) }) }); |
| 32378 |
} |
| 32379 |
var fields = [ |
| 32380 |
{ |
| 32381 |
id: "title", |
| 32382 |
type: "text", |
| 32383 |
label: (0, import_i18n50.__)("Title"), |
| 32384 |
filterBy: false |
| 32385 |
}, |
| 32386 |
{ |
| 32387 |
id: "preview", |
| 32388 |
type: "media", |
| 32389 |
render: WidgetPreview |
| 32390 |
}, |
| 32391 |
{ |
| 32392 |
id: "name", |
| 32393 |
type: "text", |
| 32394 |
enableGlobalSearch: true, |
| 32395 |
enableHiding: false, |
| 32396 |
enableSorting: false, |
| 32397 |
filterBy: false, |
| 32398 |
getValue: ({ item }) => `${item.name.replace(/[\/,\-_]/g, " ")} ${item.title}` |
| 32399 |
} |
| 32400 |
]; |
| 32401 |
function WidgetPicker({ |
| 32402 |
onSelect, |
| 32403 |
itemListLabel = (0, import_i18n50.__)("Widget list") |
| 32404 |
}) { |
| 32405 |
const { widgetTypes: registeredTypes } = useDashboardInternalContext(); |
| 32406 |
const [selection, setSelection] = (0, import_element123.useState)([]); |
| 32407 |
const [view, setView] = (0, import_element123.useState)(DEFAULT_VIEW); |
| 32408 |
const { data: widgetTypes } = filterSortAndPaginate( |
| 32409 |
registeredTypes, |
| 32410 |
view, |
| 32411 |
fields |
| 32412 |
); |
| 32413 |
const actions = (0, import_element123.useMemo)( |
| 32414 |
() => [ |
| 32415 |
{ |
| 32416 |
id: "select", |
| 32417 |
label: (0, import_i18n50.__)("Select"), |
| 32418 |
isPrimary: true, |
| 32419 |
supportsBulk: true, |
| 32420 |
callback: (items) => onSelect(items) |
| 32421 |
} |
| 32422 |
], |
| 32423 |
[onSelect] |
| 32424 |
); |
| 32425 |
return /* @__PURE__ */ (0, import_jsx_runtime157.jsx)( |
| 32426 |
dataviews_picker_default, |
| 32427 |
{ |
| 32428 |
data: widgetTypes, |
| 32429 |
fields, |
| 32430 |
view, |
| 32431 |
actions, |
| 32432 |
defaultLayouts: { pickerGrid: {} }, |
| 32433 |
onChangeView: setView, |
| 32434 |
isLoading: false, |
| 32435 |
paginationInfo: { |
| 32436 |
totalItems: widgetTypes.length, |
| 32437 |
totalPages: 1 |
| 32438 |
}, |
| 32439 |
selection, |
| 32440 |
onChangeSelection: setSelection, |
| 32441 |
getItemId, |
| 32442 |
itemListLabel |
| 32443 |
} |
| 32444 |
); |
| 32445 |
} |
| 32446 |
|
| 32447 |
// routes/dashboard/widget-dashboard/components/inserter/inserter.tsx |
| 32448 |
var import_jsx_runtime158 = __toESM(require_jsx_runtime()); |
| 32449 |
function Inserter() { |
| 32450 |
const { layout, onLayoutChange } = useDashboardInternalContext(); |
| 32451 |
const { inserterOpen, setInserterOpen } = useDashboardUIContext(); |
| 32452 |
const insertWidgets = (0, import_element124.useCallback)( |
| 32453 |
(widgetTypes) => { |
| 32454 |
if (widgetTypes.length > 0) { |
| 32455 |
const newWidgets = widgetTypes.map( |
| 32456 |
(widgetType) => createDashboardWidget(widgetType) |
| 32457 |
); |
| 32458 |
onLayoutChange([...layout, ...newWidgets]); |
| 32459 |
} |
| 32460 |
setInserterOpen(false); |
| 32461 |
}, |
| 32462 |
[layout, onLayoutChange, setInserterOpen] |
| 32463 |
); |
| 32464 |
if (!inserterOpen) { |
| 32465 |
return null; |
| 32466 |
} |
| 32467 |
return /* @__PURE__ */ (0, import_jsx_runtime158.jsx)(dialog_exports.Root, { open: inserterOpen, onOpenChange: setInserterOpen, children: /* @__PURE__ */ (0, import_jsx_runtime158.jsxs)( |
| 32468 |
dialog_exports.Popup, |
| 32469 |
{ |
| 32470 |
size: "large", |
| 32471 |
portal: /* @__PURE__ */ (0, import_jsx_runtime158.jsx)( |
| 32472 |
dialog_exports.Portal, |
| 32473 |
{ |
| 32474 |
style: { |
| 32475 |
"--wp-ui-dialog-z-index": 99999 |
| 32476 |
} |
| 32477 |
} |
| 32478 |
), |
| 32479 |
children: [ |
| 32480 |
/* @__PURE__ */ (0, import_jsx_runtime158.jsxs)(dialog_exports.Header, { children: [ |
| 32481 |
/* @__PURE__ */ (0, import_jsx_runtime158.jsx)(dialog_exports.Title, { children: (0, import_i18n51.__)("Add widget") }), |
| 32482 |
/* @__PURE__ */ (0, import_jsx_runtime158.jsx)(dialog_exports.CloseIcon, {}) |
| 32483 |
] }), |
| 32484 |
/* @__PURE__ */ (0, import_jsx_runtime158.jsx)(dialog_exports.Content, { children: /* @__PURE__ */ (0, import_jsx_runtime158.jsx)(WidgetPicker, { onSelect: insertWidgets }) }) |
| 32485 |
] |
| 32486 |
} |
| 32487 |
) }); |
| 32488 |
} |
| 32489 |
|
| 32490 |
// routes/dashboard/widget-dashboard/components/widget-chrome/widget-chrome.tsx |
| 32491 |
var import_components47 = __toESM(require_components()); |
| 32492 |
var import_element126 = __toESM(require_element()); |
| 32493 |
var import_i18n52 = __toESM(require_i18n()); |
| 32494 |
|
| 32495 |
// routes/dashboard/widget-dashboard/context/widget-context.tsx |
| 32496 |
var import_element125 = __toESM(require_element()); |
| 32497 |
var import_jsx_runtime159 = __toESM(require_jsx_runtime()); |
| 32498 |
var WidgetContext = (0, import_element125.createContext)(null); |
| 32499 |
function WidgetContextProvider({ |
| 32500 |
value, |
| 32501 |
children |
| 32502 |
}) { |
| 32503 |
return /* @__PURE__ */ (0, import_jsx_runtime159.jsx)(WidgetContext.Provider, { value, children }); |
| 32504 |
} |
| 32505 |
|
| 32506 |
// routes/dashboard/widget-dashboard/components/widget-chrome/widget-chrome.module.css |
| 32507 |
if (typeof process === "undefined" || true) { |
| 32508 |
registerStyle35("a89e624f79", "._22b961782d58cf14__widgetChrome{height:100%}._2e38cde45383ef41__widgetChromeHeaderIcon{color:var(--wpds-color-fg-content-neutral-weak,#707070);display:inline-flex}._65ccc0ffeadb15bf__widgetChromeContent{flex:1}.d86427717f1c6168__loading{height:100%}"); |
| 32509 |
} |
| 32510 |
var widget_chrome_default = { "widgetChrome": "_22b961782d58cf14__widgetChrome", "widgetChromeHeaderIcon": "_2e38cde45383ef41__widgetChromeHeaderIcon", "widgetChromeContent": "_65ccc0ffeadb15bf__widgetChromeContent", "loading": "d86427717f1c6168__loading" }; |
| 32511 |
|
| 32512 |
// routes/dashboard/widget-dashboard/components/widget-chrome/widget-chrome.tsx |
| 32513 |
var import_jsx_runtime160 = __toESM(require_jsx_runtime()); |
| 32514 |
var WidgetErrorBoundary = class extends import_element126.Component { |
| 32515 |
state = { hasError: false }; |
| 32516 |
static getDerivedStateFromError() { |
| 32517 |
return { hasError: true }; |
| 32518 |
} |
| 32519 |
render() { |
| 32520 |
if (this.state.hasError) { |
| 32521 |
return /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(notice_exports.Root, { intent: "error", children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(notice_exports.Description, { children: (0, import_i18n52.__)("This widget encountered an error.") }) }); |
| 32522 |
} |
| 32523 |
return this.props.children; |
| 32524 |
} |
| 32525 |
}; |
| 32526 |
function LoadingOverlay() { |
| 32527 |
return /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(Stack, { justify: "center", align: "center", className: widget_chrome_default.loading, children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(import_components47.Spinner, {}) }); |
| 32528 |
} |
| 32529 |
function Header4({ titleId, widgetType }) { |
| 32530 |
if (!widgetType.title) { |
| 32531 |
return null; |
| 32532 |
} |
| 32533 |
return /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(card_exports.Header, { children: /* @__PURE__ */ (0, import_jsx_runtime160.jsxs)(Stack, { direction: "row", align: "center", gap: "sm", children: [ |
| 32534 |
widgetType.icon && /* @__PURE__ */ (0, import_jsx_runtime160.jsx)( |
| 32535 |
"span", |
| 32536 |
{ |
| 32537 |
className: widget_chrome_default.widgetChromeHeaderIcon, |
| 32538 |
"aria-hidden": "true", |
| 32539 |
children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(import_components47.Icon, { icon: widgetType.icon }) |
| 32540 |
} |
| 32541 |
), |
| 32542 |
/* @__PURE__ */ (0, import_jsx_runtime160.jsx)(card_exports.Title, { id: titleId, render: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)("h3", {}), children: widgetType.title }) |
| 32543 |
] }) }); |
| 32544 |
} |
| 32545 |
var WidgetChrome = (0, import_element126.forwardRef)( |
| 32546 |
function WidgetChrome2({ widget, index: index2 }, ref) { |
| 32547 |
const { widgetTypes, editMode } = useDashboardInternalContext(); |
| 32548 |
const widgetType = widgetTypes.find((t2) => t2.name === widget.type); |
| 32549 |
const titleId = (0, import_element126.useId)(); |
| 32550 |
const contextValue = (0, import_element126.useMemo)( |
| 32551 |
() => ({ |
| 32552 |
uuid: widget.uuid, |
| 32553 |
name: widget.type, |
| 32554 |
index: index2 |
| 32555 |
}), |
| 32556 |
[widget.uuid, widget.type, index2] |
| 32557 |
); |
| 32558 |
if (!widgetType) { |
| 32559 |
return null; |
| 32560 |
} |
| 32561 |
return /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(WidgetContextProvider, { value: contextValue, children: /* @__PURE__ */ (0, import_jsx_runtime160.jsxs)( |
| 32562 |
card_exports.Root, |
| 32563 |
{ |
| 32564 |
render: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)("section", {}), |
| 32565 |
ref, |
| 32566 |
className: widget_chrome_default.widgetChrome, |
| 32567 |
"aria-labelledby": widgetType.title ? titleId : void 0, |
| 32568 |
...editMode ? { inert: "" } : {}, |
| 32569 |
children: [ |
| 32570 |
/* @__PURE__ */ (0, import_jsx_runtime160.jsx)(Header4, { titleId, widgetType }), |
| 32571 |
/* @__PURE__ */ (0, import_jsx_runtime160.jsx)(card_exports.Content, { className: widget_chrome_default.widgetChromeContent, children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(WidgetErrorBoundary, { children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(import_element126.Suspense, { fallback: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)(LoadingOverlay, {}), children: /* @__PURE__ */ (0, import_jsx_runtime160.jsx)( |
| 32572 |
WidgetRender, |
| 32573 |
{ |
| 32574 |
widget, |
| 32575 |
widgetType |
| 32576 |
} |
| 32577 |
) }) }) }) |
| 32578 |
] |
| 32579 |
} |
| 32580 |
) }); |
| 32581 |
} |
| 32582 |
); |
| 32583 |
|
| 32584 |
// routes/dashboard/widget-dashboard/components/widgets/widgets.tsx |
| 32585 |
var import_element130 = __toESM(require_element()); |
| 32586 |
|
| 32587 |
// node_modules/@dnd-kit/core/dist/core.esm.js |
| 32588 |
var import_react40 = __toESM(require_react()); |
| 32589 |
var import_react_dom5 = __toESM(require_react_dom()); |
| 32590 |
|
| 32591 |
// node_modules/@dnd-kit/utilities/dist/utilities.esm.js |
| 32592 |
var import_react38 = __toESM(require_react()); |
| 32593 |
function useCombinedRefs() { |
| 32594 |
for (var _len = arguments.length, refs = new Array(_len), _key = 0; _key < _len; _key++) { |
| 32595 |
refs[_key] = arguments[_key]; |
| 32596 |
} |
| 32597 |
return (0, import_react38.useMemo)( |
| 32598 |
() => (node) => { |
| 32599 |
refs.forEach((ref) => ref(node)); |
| 32600 |
}, |
| 32601 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 32602 |
refs |
| 32603 |
); |
| 32604 |
} |
| 32605 |
var canUseDOM2 = typeof window !== "undefined" && typeof window.document !== "undefined" && typeof window.document.createElement !== "undefined"; |
| 32606 |
function isWindow(element) { |
| 32607 |
const elementString = Object.prototype.toString.call(element); |
| 32608 |
return elementString === "[object Window]" || // In Electron context the Window object serializes to [object global] |
| 32609 |
elementString === "[object global]"; |
| 32610 |
} |
| 32611 |
function isNode2(node) { |
| 32612 |
return "nodeType" in node; |
| 32613 |
} |
| 32614 |
function getWindow3(target) { |
| 32615 |
var _target$ownerDocument, _target$ownerDocument2; |
| 32616 |
if (!target) { |
| 32617 |
return window; |
| 32618 |
} |
| 32619 |
if (isWindow(target)) { |
| 32620 |
return target; |
| 32621 |
} |
| 32622 |
if (!isNode2(target)) { |
| 32623 |
return window; |
| 32624 |
} |
| 32625 |
return (_target$ownerDocument = (_target$ownerDocument2 = target.ownerDocument) == null ? void 0 : _target$ownerDocument2.defaultView) != null ? _target$ownerDocument : window; |
| 32626 |
} |
| 32627 |
function isDocument(node) { |
| 32628 |
const { |
| 32629 |
Document |
| 32630 |
} = getWindow3(node); |
| 32631 |
return node instanceof Document; |
| 32632 |
} |
| 32633 |
function isHTMLElement2(node) { |
| 32634 |
if (isWindow(node)) { |
| 32635 |
return false; |
| 32636 |
} |
| 32637 |
return node instanceof getWindow3(node).HTMLElement; |
| 32638 |
} |
| 32639 |
function isSVGElement(node) { |
| 32640 |
return node instanceof getWindow3(node).SVGElement; |
| 32641 |
} |
| 32642 |
function getOwnerDocument(target) { |
| 32643 |
if (!target) { |
| 32644 |
return document; |
| 32645 |
} |
| 32646 |
if (isWindow(target)) { |
| 32647 |
return target.document; |
| 32648 |
} |
| 32649 |
if (!isNode2(target)) { |
| 32650 |
return document; |
| 32651 |
} |
| 32652 |
if (isDocument(target)) { |
| 32653 |
return target; |
| 32654 |
} |
| 32655 |
if (isHTMLElement2(target) || isSVGElement(target)) { |
| 32656 |
return target.ownerDocument; |
| 32657 |
} |
| 32658 |
return document; |
| 32659 |
} |
| 32660 |
var useIsomorphicLayoutEffect = canUseDOM2 ? import_react38.useLayoutEffect : import_react38.useEffect; |
| 32661 |
function useEvent3(handler) { |
| 32662 |
const handlerRef = (0, import_react38.useRef)(handler); |
| 32663 |
useIsomorphicLayoutEffect(() => { |
| 32664 |
handlerRef.current = handler; |
| 32665 |
}); |
| 32666 |
return (0, import_react38.useCallback)(function() { |
| 32667 |
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { |
| 32668 |
args[_key] = arguments[_key]; |
| 32669 |
} |
| 32670 |
return handlerRef.current == null ? void 0 : handlerRef.current(...args); |
| 32671 |
}, []); |
| 32672 |
} |
| 32673 |
function useInterval() { |
| 32674 |
const intervalRef = (0, import_react38.useRef)(null); |
| 32675 |
const set3 = (0, import_react38.useCallback)((listener, duration) => { |
| 32676 |
intervalRef.current = setInterval(listener, duration); |
| 32677 |
}, []); |
| 32678 |
const clear = (0, import_react38.useCallback)(() => { |
| 32679 |
if (intervalRef.current !== null) { |
| 32680 |
clearInterval(intervalRef.current); |
| 32681 |
intervalRef.current = null; |
| 32682 |
} |
| 32683 |
}, []); |
| 32684 |
return [set3, clear]; |
| 32685 |
} |
| 32686 |
function useLatestValue(value, dependencies) { |
| 32687 |
if (dependencies === void 0) { |
| 32688 |
dependencies = [value]; |
| 32689 |
} |
| 32690 |
const valueRef = (0, import_react38.useRef)(value); |
| 32691 |
useIsomorphicLayoutEffect(() => { |
| 32692 |
if (valueRef.current !== value) { |
| 32693 |
valueRef.current = value; |
| 32694 |
} |
| 32695 |
}, dependencies); |
| 32696 |
return valueRef; |
| 32697 |
} |
| 32698 |
function useLazyMemo(callback, dependencies) { |
| 32699 |
const valueRef = (0, import_react38.useRef)(); |
| 32700 |
return (0, import_react38.useMemo)( |
| 32701 |
() => { |
| 32702 |
const newValue = callback(valueRef.current); |
| 32703 |
valueRef.current = newValue; |
| 32704 |
return newValue; |
| 32705 |
}, |
| 32706 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 32707 |
[...dependencies] |
| 32708 |
); |
| 32709 |
} |
| 32710 |
function useNodeRef(onChange) { |
| 32711 |
const onChangeHandler = useEvent3(onChange); |
| 32712 |
const node = (0, import_react38.useRef)(null); |
| 32713 |
const setNodeRef = (0, import_react38.useCallback)( |
| 32714 |
(element) => { |
| 32715 |
if (element !== node.current) { |
| 32716 |
onChangeHandler == null ? void 0 : onChangeHandler(element, node.current); |
| 32717 |
} |
| 32718 |
node.current = element; |
| 32719 |
}, |
| 32720 |
//eslint-disable-next-line |
| 32721 |
[] |
| 32722 |
); |
| 32723 |
return [node, setNodeRef]; |
| 32724 |
} |
| 32725 |
function usePrevious2(value) { |
| 32726 |
const ref = (0, import_react38.useRef)(); |
| 32727 |
(0, import_react38.useEffect)(() => { |
| 32728 |
ref.current = value; |
| 32729 |
}, [value]); |
| 32730 |
return ref.current; |
| 32731 |
} |
| 32732 |
var ids = {}; |
| 32733 |
function useUniqueId(prefix, value) { |
| 32734 |
return (0, import_react38.useMemo)(() => { |
| 32735 |
if (value) { |
| 32736 |
return value; |
| 32737 |
} |
| 32738 |
const id = ids[prefix] == null ? 0 : ids[prefix] + 1; |
| 32739 |
ids[prefix] = id; |
| 32740 |
return prefix + "-" + id; |
| 32741 |
}, [prefix, value]); |
| 32742 |
} |
| 32743 |
function createAdjustmentFn(modifier) { |
| 32744 |
return function(object) { |
| 32745 |
for (var _len = arguments.length, adjustments = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { |
| 32746 |
adjustments[_key - 1] = arguments[_key]; |
| 32747 |
} |
| 32748 |
return adjustments.reduce((accumulator, adjustment) => { |
| 32749 |
const entries = Object.entries(adjustment); |
| 32750 |
for (const [key2, valueAdjustment] of entries) { |
| 32751 |
const value = accumulator[key2]; |
| 32752 |
if (value != null) { |
| 32753 |
accumulator[key2] = value + modifier * valueAdjustment; |
| 32754 |
} |
| 32755 |
} |
| 32756 |
return accumulator; |
| 32757 |
}, { |
| 32758 |
...object |
| 32759 |
}); |
| 32760 |
}; |
| 32761 |
} |
| 32762 |
var add = /* @__PURE__ */ createAdjustmentFn(1); |
| 32763 |
var subtract = /* @__PURE__ */ createAdjustmentFn(-1); |
| 32764 |
function hasViewportRelativeCoordinates(event) { |
| 32765 |
return "clientX" in event && "clientY" in event; |
| 32766 |
} |
| 32767 |
function isKeyboardEvent(event) { |
| 32768 |
if (!event) { |
| 32769 |
return false; |
| 32770 |
} |
| 32771 |
const { |
| 32772 |
KeyboardEvent: KeyboardEvent2 |
| 32773 |
} = getWindow3(event.target); |
| 32774 |
return KeyboardEvent2 && event instanceof KeyboardEvent2; |
| 32775 |
} |
| 32776 |
function isTouchEvent(event) { |
| 32777 |
if (!event) { |
| 32778 |
return false; |
| 32779 |
} |
| 32780 |
const { |
| 32781 |
TouchEvent |
| 32782 |
} = getWindow3(event.target); |
| 32783 |
return TouchEvent && event instanceof TouchEvent; |
| 32784 |
} |
| 32785 |
function getEventCoordinates(event) { |
| 32786 |
if (isTouchEvent(event)) { |
| 32787 |
if (event.touches && event.touches.length) { |
| 32788 |
const { |
| 32789 |
clientX: x2, |
| 32790 |
clientY: y2 |
| 32791 |
} = event.touches[0]; |
| 32792 |
return { |
| 32793 |
x: x2, |
| 32794 |
y: y2 |
| 32795 |
}; |
| 32796 |
} else if (event.changedTouches && event.changedTouches.length) { |
| 32797 |
const { |
| 32798 |
clientX: x2, |
| 32799 |
clientY: y2 |
| 32800 |
} = event.changedTouches[0]; |
| 32801 |
return { |
| 32802 |
x: x2, |
| 32803 |
y: y2 |
| 32804 |
}; |
| 32805 |
} |
| 32806 |
} |
| 32807 |
if (hasViewportRelativeCoordinates(event)) { |
| 32808 |
return { |
| 32809 |
x: event.clientX, |
| 32810 |
y: event.clientY |
| 32811 |
}; |
| 32812 |
} |
| 32813 |
return null; |
| 32814 |
} |
| 32815 |
var CSS2 = /* @__PURE__ */ Object.freeze({ |
| 32816 |
Translate: { |
| 32817 |
toString(transform) { |
| 32818 |
if (!transform) { |
| 32819 |
return; |
| 32820 |
} |
| 32821 |
const { |
| 32822 |
x: x2, |
| 32823 |
y: y2 |
| 32824 |
} = transform; |
| 32825 |
return "translate3d(" + (x2 ? Math.round(x2) : 0) + "px, " + (y2 ? Math.round(y2) : 0) + "px, 0)"; |
| 32826 |
} |
| 32827 |
}, |
| 32828 |
Scale: { |
| 32829 |
toString(transform) { |
| 32830 |
if (!transform) { |
| 32831 |
return; |
| 32832 |
} |
| 32833 |
const { |
| 32834 |
scaleX, |
| 32835 |
scaleY |
| 32836 |
} = transform; |
| 32837 |
return "scaleX(" + scaleX + ") scaleY(" + scaleY + ")"; |
| 32838 |
} |
| 32839 |
}, |
| 32840 |
Transform: { |
| 32841 |
toString(transform) { |
| 32842 |
if (!transform) { |
| 32843 |
return; |
| 32844 |
} |
| 32845 |
return [CSS2.Translate.toString(transform), CSS2.Scale.toString(transform)].join(" "); |
| 32846 |
} |
| 32847 |
}, |
| 32848 |
Transition: { |
| 32849 |
toString(_ref) { |
| 32850 |
let { |
| 32851 |
property, |
| 32852 |
duration, |
| 32853 |
easing |
| 32854 |
} = _ref; |
| 32855 |
return property + " " + duration + "ms " + easing; |
| 32856 |
} |
| 32857 |
} |
| 32858 |
}); |
| 32859 |
var SELECTOR = "a,frame,iframe,input:not([type=hidden]):not(:disabled),select:not(:disabled),textarea:not(:disabled),button:not(:disabled),*[tabindex]"; |
| 32860 |
function findFirstFocusableNode(element) { |
| 32861 |
if (element.matches(SELECTOR)) { |
| 32862 |
return element; |
| 32863 |
} |
| 32864 |
return element.querySelector(SELECTOR); |
| 32865 |
} |
| 32866 |
|
| 32867 |
// node_modules/@dnd-kit/accessibility/dist/accessibility.esm.js |
| 32868 |
var import_react39 = __toESM(require_react()); |
| 32869 |
var hiddenStyles = { |
| 32870 |
display: "none" |
| 32871 |
}; |
| 32872 |
function HiddenText(_ref) { |
| 32873 |
let { |
| 32874 |
id, |
| 32875 |
value |
| 32876 |
} = _ref; |
| 32877 |
return import_react39.default.createElement("div", { |
| 32878 |
id, |
| 32879 |
style: hiddenStyles |
| 32880 |
}, value); |
| 32881 |
} |
| 32882 |
function LiveRegion(_ref) { |
| 32883 |
let { |
| 32884 |
id, |
| 32885 |
announcement, |
| 32886 |
ariaLiveType = "assertive" |
| 32887 |
} = _ref; |
| 32888 |
const visuallyHidden2 = { |
| 32889 |
position: "fixed", |
| 32890 |
top: 0, |
| 32891 |
left: 0, |
| 32892 |
width: 1, |
| 32893 |
height: 1, |
| 32894 |
margin: -1, |
| 32895 |
border: 0, |
| 32896 |
padding: 0, |
| 32897 |
overflow: "hidden", |
| 32898 |
clip: "rect(0 0 0 0)", |
| 32899 |
clipPath: "inset(100%)", |
| 32900 |
whiteSpace: "nowrap" |
| 32901 |
}; |
| 32902 |
return import_react39.default.createElement("div", { |
| 32903 |
id, |
| 32904 |
style: visuallyHidden2, |
| 32905 |
role: "status", |
| 32906 |
"aria-live": ariaLiveType, |
| 32907 |
"aria-atomic": true |
| 32908 |
}, announcement); |
| 32909 |
} |
| 32910 |
function useAnnouncement() { |
| 32911 |
const [announcement, setAnnouncement] = (0, import_react39.useState)(""); |
| 32912 |
const announce = (0, import_react39.useCallback)((value) => { |
| 32913 |
if (value != null) { |
| 32914 |
setAnnouncement(value); |
| 32915 |
} |
| 32916 |
}, []); |
| 32917 |
return { |
| 32918 |
announce, |
| 32919 |
announcement |
| 32920 |
}; |
| 32921 |
} |
| 32922 |
|
| 32923 |
// node_modules/@dnd-kit/core/dist/core.esm.js |
| 32924 |
var DndMonitorContext = /* @__PURE__ */ (0, import_react40.createContext)(null); |
| 32925 |
function useDndMonitor(listener) { |
| 32926 |
const registerListener = (0, import_react40.useContext)(DndMonitorContext); |
| 32927 |
(0, import_react40.useEffect)(() => { |
| 32928 |
if (!registerListener) { |
| 32929 |
throw new Error("useDndMonitor must be used within a children of <DndContext>"); |
| 32930 |
} |
| 32931 |
const unsubscribe = registerListener(listener); |
| 32932 |
return unsubscribe; |
| 32933 |
}, [listener, registerListener]); |
| 32934 |
} |
| 32935 |
function useDndMonitorProvider() { |
| 32936 |
const [listeners] = (0, import_react40.useState)(() => /* @__PURE__ */ new Set()); |
| 32937 |
const registerListener = (0, import_react40.useCallback)((listener) => { |
| 32938 |
listeners.add(listener); |
| 32939 |
return () => listeners.delete(listener); |
| 32940 |
}, [listeners]); |
| 32941 |
const dispatch2 = (0, import_react40.useCallback)((_ref) => { |
| 32942 |
let { |
| 32943 |
type, |
| 32944 |
event |
| 32945 |
} = _ref; |
| 32946 |
listeners.forEach((listener) => { |
| 32947 |
var _listener$type; |
| 32948 |
return (_listener$type = listener[type]) == null ? void 0 : _listener$type.call(listener, event); |
| 32949 |
}); |
| 32950 |
}, [listeners]); |
| 32951 |
return [dispatch2, registerListener]; |
| 32952 |
} |
| 32953 |
var defaultScreenReaderInstructions = { |
| 32954 |
draggable: "\n To pick up a draggable item, press the space bar.\n While dragging, use the arrow keys to move the item.\n Press space again to drop the item in its new position, or press escape to cancel.\n " |
| 32955 |
}; |
| 32956 |
var defaultAnnouncements = { |
| 32957 |
onDragStart(_ref) { |
| 32958 |
let { |
| 32959 |
active |
| 32960 |
} = _ref; |
| 32961 |
return "Picked up draggable item " + active.id + "."; |
| 32962 |
}, |
| 32963 |
onDragOver(_ref2) { |
| 32964 |
let { |
| 32965 |
active, |
| 32966 |
over |
| 32967 |
} = _ref2; |
| 32968 |
if (over) { |
| 32969 |
return "Draggable item " + active.id + " was moved over droppable area " + over.id + "."; |
| 32970 |
} |
| 32971 |
return "Draggable item " + active.id + " is no longer over a droppable area."; |
| 32972 |
}, |
| 32973 |
onDragEnd(_ref3) { |
| 32974 |
let { |
| 32975 |
active, |
| 32976 |
over |
| 32977 |
} = _ref3; |
| 32978 |
if (over) { |
| 32979 |
return "Draggable item " + active.id + " was dropped over droppable area " + over.id; |
| 32980 |
} |
| 32981 |
return "Draggable item " + active.id + " was dropped."; |
| 32982 |
}, |
| 32983 |
onDragCancel(_ref4) { |
| 32984 |
let { |
| 32985 |
active |
| 32986 |
} = _ref4; |
| 32987 |
return "Dragging was cancelled. Draggable item " + active.id + " was dropped."; |
| 32988 |
} |
| 32989 |
}; |
| 32990 |
function Accessibility(_ref) { |
| 32991 |
let { |
| 32992 |
announcements = defaultAnnouncements, |
| 32993 |
container, |
| 32994 |
hiddenTextDescribedById, |
| 32995 |
screenReaderInstructions = defaultScreenReaderInstructions |
| 32996 |
} = _ref; |
| 32997 |
const { |
| 32998 |
announce, |
| 32999 |
announcement |
| 33000 |
} = useAnnouncement(); |
| 33001 |
const liveRegionId = useUniqueId("DndLiveRegion"); |
| 33002 |
const [mounted, setMounted] = (0, import_react40.useState)(false); |
| 33003 |
(0, import_react40.useEffect)(() => { |
| 33004 |
setMounted(true); |
| 33005 |
}, []); |
| 33006 |
useDndMonitor((0, import_react40.useMemo)(() => ({ |
| 33007 |
onDragStart(_ref2) { |
| 33008 |
let { |
| 33009 |
active |
| 33010 |
} = _ref2; |
| 33011 |
announce(announcements.onDragStart({ |
| 33012 |
active |
| 33013 |
})); |
| 33014 |
}, |
| 33015 |
onDragMove(_ref3) { |
| 33016 |
let { |
| 33017 |
active, |
| 33018 |
over |
| 33019 |
} = _ref3; |
| 33020 |
if (announcements.onDragMove) { |
| 33021 |
announce(announcements.onDragMove({ |
| 33022 |
active, |
| 33023 |
over |
| 33024 |
})); |
| 33025 |
} |
| 33026 |
}, |
| 33027 |
onDragOver(_ref4) { |
| 33028 |
let { |
| 33029 |
active, |
| 33030 |
over |
| 33031 |
} = _ref4; |
| 33032 |
announce(announcements.onDragOver({ |
| 33033 |
active, |
| 33034 |
over |
| 33035 |
})); |
| 33036 |
}, |
| 33037 |
onDragEnd(_ref5) { |
| 33038 |
let { |
| 33039 |
active, |
| 33040 |
over |
| 33041 |
} = _ref5; |
| 33042 |
announce(announcements.onDragEnd({ |
| 33043 |
active, |
| 33044 |
over |
| 33045 |
})); |
| 33046 |
}, |
| 33047 |
onDragCancel(_ref6) { |
| 33048 |
let { |
| 33049 |
active, |
| 33050 |
over |
| 33051 |
} = _ref6; |
| 33052 |
announce(announcements.onDragCancel({ |
| 33053 |
active, |
| 33054 |
over |
| 33055 |
})); |
| 33056 |
} |
| 33057 |
}), [announce, announcements])); |
| 33058 |
if (!mounted) { |
| 33059 |
return null; |
| 33060 |
} |
| 33061 |
const markup = import_react40.default.createElement(import_react40.default.Fragment, null, import_react40.default.createElement(HiddenText, { |
| 33062 |
id: hiddenTextDescribedById, |
| 33063 |
value: screenReaderInstructions.draggable |
| 33064 |
}), import_react40.default.createElement(LiveRegion, { |
| 33065 |
id: liveRegionId, |
| 33066 |
announcement |
| 33067 |
})); |
| 33068 |
return container ? (0, import_react_dom5.createPortal)(markup, container) : markup; |
| 33069 |
} |
| 33070 |
var Action2; |
| 33071 |
(function(Action3) { |
| 33072 |
Action3["DragStart"] = "dragStart"; |
| 33073 |
Action3["DragMove"] = "dragMove"; |
| 33074 |
Action3["DragEnd"] = "dragEnd"; |
| 33075 |
Action3["DragCancel"] = "dragCancel"; |
| 33076 |
Action3["DragOver"] = "dragOver"; |
| 33077 |
Action3["RegisterDroppable"] = "registerDroppable"; |
| 33078 |
Action3["SetDroppableDisabled"] = "setDroppableDisabled"; |
| 33079 |
Action3["UnregisterDroppable"] = "unregisterDroppable"; |
| 33080 |
})(Action2 || (Action2 = {})); |
| 33081 |
function noop6() { |
| 33082 |
} |
| 33083 |
function useSensor(sensor, options) { |
| 33084 |
return (0, import_react40.useMemo)( |
| 33085 |
() => ({ |
| 33086 |
sensor, |
| 33087 |
options: options != null ? options : {} |
| 33088 |
}), |
| 33089 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 33090 |
[sensor, options] |
| 33091 |
); |
| 33092 |
} |
| 33093 |
function useSensors() { |
| 33094 |
for (var _len = arguments.length, sensors = new Array(_len), _key = 0; _key < _len; _key++) { |
| 33095 |
sensors[_key] = arguments[_key]; |
| 33096 |
} |
| 33097 |
return (0, import_react40.useMemo)( |
| 33098 |
() => [...sensors].filter((sensor) => sensor != null), |
| 33099 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 33100 |
[...sensors] |
| 33101 |
); |
| 33102 |
} |
| 33103 |
var defaultCoordinates = /* @__PURE__ */ Object.freeze({ |
| 33104 |
x: 0, |
| 33105 |
y: 0 |
| 33106 |
}); |
| 33107 |
function distanceBetween(p1, p2) { |
| 33108 |
return Math.sqrt(Math.pow(p1.x - p2.x, 2) + Math.pow(p1.y - p2.y, 2)); |
| 33109 |
} |
| 33110 |
function getRelativeTransformOrigin(event, rect) { |
| 33111 |
const eventCoordinates = getEventCoordinates(event); |
| 33112 |
if (!eventCoordinates) { |
| 33113 |
return "0 0"; |
| 33114 |
} |
| 33115 |
const transformOrigin = { |
| 33116 |
x: (eventCoordinates.x - rect.left) / rect.width * 100, |
| 33117 |
y: (eventCoordinates.y - rect.top) / rect.height * 100 |
| 33118 |
}; |
| 33119 |
return transformOrigin.x + "% " + transformOrigin.y + "%"; |
| 33120 |
} |
| 33121 |
function sortCollisionsAsc(_ref, _ref2) { |
| 33122 |
let { |
| 33123 |
data: { |
| 33124 |
value: a2 |
| 33125 |
} |
| 33126 |
} = _ref; |
| 33127 |
let { |
| 33128 |
data: { |
| 33129 |
value: b2 |
| 33130 |
} |
| 33131 |
} = _ref2; |
| 33132 |
return a2 - b2; |
| 33133 |
} |
| 33134 |
function sortCollisionsDesc(_ref3, _ref4) { |
| 33135 |
let { |
| 33136 |
data: { |
| 33137 |
value: a2 |
| 33138 |
} |
| 33139 |
} = _ref3; |
| 33140 |
let { |
| 33141 |
data: { |
| 33142 |
value: b2 |
| 33143 |
} |
| 33144 |
} = _ref4; |
| 33145 |
return b2 - a2; |
| 33146 |
} |
| 33147 |
function cornersOfRectangle(_ref5) { |
| 33148 |
let { |
| 33149 |
left, |
| 33150 |
top, |
| 33151 |
height, |
| 33152 |
width |
| 33153 |
} = _ref5; |
| 33154 |
return [{ |
| 33155 |
x: left, |
| 33156 |
y: top |
| 33157 |
}, { |
| 33158 |
x: left + width, |
| 33159 |
y: top |
| 33160 |
}, { |
| 33161 |
x: left, |
| 33162 |
y: top + height |
| 33163 |
}, { |
| 33164 |
x: left + width, |
| 33165 |
y: top + height |
| 33166 |
}]; |
| 33167 |
} |
| 33168 |
function getFirstCollision(collisions, property) { |
| 33169 |
if (!collisions || collisions.length === 0) { |
| 33170 |
return null; |
| 33171 |
} |
| 33172 |
const [firstCollision] = collisions; |
| 33173 |
return property ? firstCollision[property] : firstCollision; |
| 33174 |
} |
| 33175 |
var closestCorners = (_ref) => { |
| 33176 |
let { |
| 33177 |
collisionRect, |
| 33178 |
droppableRects, |
| 33179 |
droppableContainers |
| 33180 |
} = _ref; |
| 33181 |
const corners = cornersOfRectangle(collisionRect); |
| 33182 |
const collisions = []; |
| 33183 |
for (const droppableContainer of droppableContainers) { |
| 33184 |
const { |
| 33185 |
id |
| 33186 |
} = droppableContainer; |
| 33187 |
const rect = droppableRects.get(id); |
| 33188 |
if (rect) { |
| 33189 |
const rectCorners = cornersOfRectangle(rect); |
| 33190 |
const distances = corners.reduce((accumulator, corner, index2) => { |
| 33191 |
return accumulator + distanceBetween(rectCorners[index2], corner); |
| 33192 |
}, 0); |
| 33193 |
const effectiveDistance = Number((distances / 4).toFixed(4)); |
| 33194 |
collisions.push({ |
| 33195 |
id, |
| 33196 |
data: { |
| 33197 |
droppableContainer, |
| 33198 |
value: effectiveDistance |
| 33199 |
} |
| 33200 |
}); |
| 33201 |
} |
| 33202 |
} |
| 33203 |
return collisions.sort(sortCollisionsAsc); |
| 33204 |
}; |
| 33205 |
function getIntersectionRatio(entry, target) { |
| 33206 |
const top = Math.max(target.top, entry.top); |
| 33207 |
const left = Math.max(target.left, entry.left); |
| 33208 |
const right = Math.min(target.left + target.width, entry.left + entry.width); |
| 33209 |
const bottom = Math.min(target.top + target.height, entry.top + entry.height); |
| 33210 |
const width = right - left; |
| 33211 |
const height = bottom - top; |
| 33212 |
if (left < right && top < bottom) { |
| 33213 |
const targetArea = target.width * target.height; |
| 33214 |
const entryArea = entry.width * entry.height; |
| 33215 |
const intersectionArea = width * height; |
| 33216 |
const intersectionRatio = intersectionArea / (targetArea + entryArea - intersectionArea); |
| 33217 |
return Number(intersectionRatio.toFixed(4)); |
| 33218 |
} |
| 33219 |
return 0; |
| 33220 |
} |
| 33221 |
var rectIntersection = (_ref) => { |
| 33222 |
let { |
| 33223 |
collisionRect, |
| 33224 |
droppableRects, |
| 33225 |
droppableContainers |
| 33226 |
} = _ref; |
| 33227 |
const collisions = []; |
| 33228 |
for (const droppableContainer of droppableContainers) { |
| 33229 |
const { |
| 33230 |
id |
| 33231 |
} = droppableContainer; |
| 33232 |
const rect = droppableRects.get(id); |
| 33233 |
if (rect) { |
| 33234 |
const intersectionRatio = getIntersectionRatio(rect, collisionRect); |
| 33235 |
if (intersectionRatio > 0) { |
| 33236 |
collisions.push({ |
| 33237 |
id, |
| 33238 |
data: { |
| 33239 |
droppableContainer, |
| 33240 |
value: intersectionRatio |
| 33241 |
} |
| 33242 |
}); |
| 33243 |
} |
| 33244 |
} |
| 33245 |
} |
| 33246 |
return collisions.sort(sortCollisionsDesc); |
| 33247 |
}; |
| 33248 |
function adjustScale(transform, rect1, rect2) { |
| 33249 |
return { |
| 33250 |
...transform, |
| 33251 |
scaleX: rect1 && rect2 ? rect1.width / rect2.width : 1, |
| 33252 |
scaleY: rect1 && rect2 ? rect1.height / rect2.height : 1 |
| 33253 |
}; |
| 33254 |
} |
| 33255 |
function getRectDelta(rect1, rect2) { |
| 33256 |
return rect1 && rect2 ? { |
| 33257 |
x: rect1.left - rect2.left, |
| 33258 |
y: rect1.top - rect2.top |
| 33259 |
} : defaultCoordinates; |
| 33260 |
} |
| 33261 |
function createRectAdjustmentFn(modifier) { |
| 33262 |
return function adjustClientRect(rect) { |
| 33263 |
for (var _len = arguments.length, adjustments = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { |
| 33264 |
adjustments[_key - 1] = arguments[_key]; |
| 33265 |
} |
| 33266 |
return adjustments.reduce((acc, adjustment) => ({ |
| 33267 |
...acc, |
| 33268 |
top: acc.top + modifier * adjustment.y, |
| 33269 |
bottom: acc.bottom + modifier * adjustment.y, |
| 33270 |
left: acc.left + modifier * adjustment.x, |
| 33271 |
right: acc.right + modifier * adjustment.x |
| 33272 |
}), { |
| 33273 |
...rect |
| 33274 |
}); |
| 33275 |
}; |
| 33276 |
} |
| 33277 |
var getAdjustedRect = /* @__PURE__ */ createRectAdjustmentFn(1); |
| 33278 |
function parseTransform(transform) { |
| 33279 |
if (transform.startsWith("matrix3d(")) { |
| 33280 |
const transformArray = transform.slice(9, -1).split(/, /); |
| 33281 |
return { |
| 33282 |
x: +transformArray[12], |
| 33283 |
y: +transformArray[13], |
| 33284 |
scaleX: +transformArray[0], |
| 33285 |
scaleY: +transformArray[5] |
| 33286 |
}; |
| 33287 |
} else if (transform.startsWith("matrix(")) { |
| 33288 |
const transformArray = transform.slice(7, -1).split(/, /); |
| 33289 |
return { |
| 33290 |
x: +transformArray[4], |
| 33291 |
y: +transformArray[5], |
| 33292 |
scaleX: +transformArray[0], |
| 33293 |
scaleY: +transformArray[3] |
| 33294 |
}; |
| 33295 |
} |
| 33296 |
return null; |
| 33297 |
} |
| 33298 |
function inverseTransform(rect, transform, transformOrigin) { |
| 33299 |
const parsedTransform = parseTransform(transform); |
| 33300 |
if (!parsedTransform) { |
| 33301 |
return rect; |
| 33302 |
} |
| 33303 |
const { |
| 33304 |
scaleX, |
| 33305 |
scaleY, |
| 33306 |
x: translateX, |
| 33307 |
y: translateY |
| 33308 |
} = parsedTransform; |
| 33309 |
const x2 = rect.left - translateX - (1 - scaleX) * parseFloat(transformOrigin); |
| 33310 |
const y2 = rect.top - translateY - (1 - scaleY) * parseFloat(transformOrigin.slice(transformOrigin.indexOf(" ") + 1)); |
| 33311 |
const w2 = scaleX ? rect.width / scaleX : rect.width; |
| 33312 |
const h2 = scaleY ? rect.height / scaleY : rect.height; |
| 33313 |
return { |
| 33314 |
width: w2, |
| 33315 |
height: h2, |
| 33316 |
top: y2, |
| 33317 |
right: x2 + w2, |
| 33318 |
bottom: y2 + h2, |
| 33319 |
left: x2 |
| 33320 |
}; |
| 33321 |
} |
| 33322 |
var defaultOptions2 = { |
| 33323 |
ignoreTransform: false |
| 33324 |
}; |
| 33325 |
function getClientRect(element, options) { |
| 33326 |
if (options === void 0) { |
| 33327 |
options = defaultOptions2; |
| 33328 |
} |
| 33329 |
let rect = element.getBoundingClientRect(); |
| 33330 |
if (options.ignoreTransform) { |
| 33331 |
const { |
| 33332 |
transform, |
| 33333 |
transformOrigin |
| 33334 |
} = getWindow3(element).getComputedStyle(element); |
| 33335 |
if (transform) { |
| 33336 |
rect = inverseTransform(rect, transform, transformOrigin); |
| 33337 |
} |
| 33338 |
} |
| 33339 |
const { |
| 33340 |
top, |
| 33341 |
left, |
| 33342 |
width, |
| 33343 |
height, |
| 33344 |
bottom, |
| 33345 |
right |
| 33346 |
} = rect; |
| 33347 |
return { |
| 33348 |
top, |
| 33349 |
left, |
| 33350 |
width, |
| 33351 |
height, |
| 33352 |
bottom, |
| 33353 |
right |
| 33354 |
}; |
| 33355 |
} |
| 33356 |
function getTransformAgnosticClientRect(element) { |
| 33357 |
return getClientRect(element, { |
| 33358 |
ignoreTransform: true |
| 33359 |
}); |
| 33360 |
} |
| 33361 |
function getWindowClientRect(element) { |
| 33362 |
const width = element.innerWidth; |
| 33363 |
const height = element.innerHeight; |
| 33364 |
return { |
| 33365 |
top: 0, |
| 33366 |
left: 0, |
| 33367 |
right: width, |
| 33368 |
bottom: height, |
| 33369 |
width, |
| 33370 |
height |
| 33371 |
}; |
| 33372 |
} |
| 33373 |
function isFixed(node, computedStyle) { |
| 33374 |
if (computedStyle === void 0) { |
| 33375 |
computedStyle = getWindow3(node).getComputedStyle(node); |
| 33376 |
} |
| 33377 |
return computedStyle.position === "fixed"; |
| 33378 |
} |
| 33379 |
function isScrollable(element, computedStyle) { |
| 33380 |
if (computedStyle === void 0) { |
| 33381 |
computedStyle = getWindow3(element).getComputedStyle(element); |
| 33382 |
} |
| 33383 |
const overflowRegex = /(auto|scroll|overlay)/; |
| 33384 |
const properties2 = ["overflow", "overflowX", "overflowY"]; |
| 33385 |
return properties2.some((property) => { |
| 33386 |
const value = computedStyle[property]; |
| 33387 |
return typeof value === "string" ? overflowRegex.test(value) : false; |
| 33388 |
}); |
| 33389 |
} |
| 33390 |
function getScrollableAncestors(element, limit) { |
| 33391 |
const scrollParents = []; |
| 33392 |
function findScrollableAncestors(node) { |
| 33393 |
if (limit != null && scrollParents.length >= limit) { |
| 33394 |
return scrollParents; |
| 33395 |
} |
| 33396 |
if (!node) { |
| 33397 |
return scrollParents; |
| 33398 |
} |
| 33399 |
if (isDocument(node) && node.scrollingElement != null && !scrollParents.includes(node.scrollingElement)) { |
| 33400 |
scrollParents.push(node.scrollingElement); |
| 33401 |
return scrollParents; |
| 33402 |
} |
| 33403 |
if (!isHTMLElement2(node) || isSVGElement(node)) { |
| 33404 |
return scrollParents; |
| 33405 |
} |
| 33406 |
if (scrollParents.includes(node)) { |
| 33407 |
return scrollParents; |
| 33408 |
} |
| 33409 |
const computedStyle = getWindow3(element).getComputedStyle(node); |
| 33410 |
if (node !== element) { |
| 33411 |
if (isScrollable(node, computedStyle)) { |
| 33412 |
scrollParents.push(node); |
| 33413 |
} |
| 33414 |
} |
| 33415 |
if (isFixed(node, computedStyle)) { |
| 33416 |
return scrollParents; |
| 33417 |
} |
| 33418 |
return findScrollableAncestors(node.parentNode); |
| 33419 |
} |
| 33420 |
if (!element) { |
| 33421 |
return scrollParents; |
| 33422 |
} |
| 33423 |
return findScrollableAncestors(element); |
| 33424 |
} |
| 33425 |
function getFirstScrollableAncestor(node) { |
| 33426 |
const [firstScrollableAncestor] = getScrollableAncestors(node, 1); |
| 33427 |
return firstScrollableAncestor != null ? firstScrollableAncestor : null; |
| 33428 |
} |
| 33429 |
function getScrollableElement(element) { |
| 33430 |
if (!canUseDOM2 || !element) { |
| 33431 |
return null; |
| 33432 |
} |
| 33433 |
if (isWindow(element)) { |
| 33434 |
return element; |
| 33435 |
} |
| 33436 |
if (!isNode2(element)) { |
| 33437 |
return null; |
| 33438 |
} |
| 33439 |
if (isDocument(element) || element === getOwnerDocument(element).scrollingElement) { |
| 33440 |
return window; |
| 33441 |
} |
| 33442 |
if (isHTMLElement2(element)) { |
| 33443 |
return element; |
| 33444 |
} |
| 33445 |
return null; |
| 33446 |
} |
| 33447 |
function getScrollXCoordinate(element) { |
| 33448 |
if (isWindow(element)) { |
| 33449 |
return element.scrollX; |
| 33450 |
} |
| 33451 |
return element.scrollLeft; |
| 33452 |
} |
| 33453 |
function getScrollYCoordinate(element) { |
| 33454 |
if (isWindow(element)) { |
| 33455 |
return element.scrollY; |
| 33456 |
} |
| 33457 |
return element.scrollTop; |
| 33458 |
} |
| 33459 |
function getScrollCoordinates(element) { |
| 33460 |
return { |
| 33461 |
x: getScrollXCoordinate(element), |
| 33462 |
y: getScrollYCoordinate(element) |
| 33463 |
}; |
| 33464 |
} |
| 33465 |
var Direction; |
| 33466 |
(function(Direction2) { |
| 33467 |
Direction2[Direction2["Forward"] = 1] = "Forward"; |
| 33468 |
Direction2[Direction2["Backward"] = -1] = "Backward"; |
| 33469 |
})(Direction || (Direction = {})); |
| 33470 |
function isDocumentScrollingElement(element) { |
| 33471 |
if (!canUseDOM2 || !element) { |
| 33472 |
return false; |
| 33473 |
} |
| 33474 |
return element === document.scrollingElement; |
| 33475 |
} |
| 33476 |
function getScrollPosition(scrollingContainer) { |
| 33477 |
const minScroll = { |
| 33478 |
x: 0, |
| 33479 |
y: 0 |
| 33480 |
}; |
| 33481 |
const dimensions = isDocumentScrollingElement(scrollingContainer) ? { |
| 33482 |
height: window.innerHeight, |
| 33483 |
width: window.innerWidth |
| 33484 |
} : { |
| 33485 |
height: scrollingContainer.clientHeight, |
| 33486 |
width: scrollingContainer.clientWidth |
| 33487 |
}; |
| 33488 |
const maxScroll = { |
| 33489 |
x: scrollingContainer.scrollWidth - dimensions.width, |
| 33490 |
y: scrollingContainer.scrollHeight - dimensions.height |
| 33491 |
}; |
| 33492 |
const isTop = scrollingContainer.scrollTop <= minScroll.y; |
| 33493 |
const isLeft = scrollingContainer.scrollLeft <= minScroll.x; |
| 33494 |
const isBottom = scrollingContainer.scrollTop >= maxScroll.y; |
| 33495 |
const isRight = scrollingContainer.scrollLeft >= maxScroll.x; |
| 33496 |
return { |
| 33497 |
isTop, |
| 33498 |
isLeft, |
| 33499 |
isBottom, |
| 33500 |
isRight, |
| 33501 |
maxScroll, |
| 33502 |
minScroll |
| 33503 |
}; |
| 33504 |
} |
| 33505 |
var defaultThreshold = { |
| 33506 |
x: 0.2, |
| 33507 |
y: 0.2 |
| 33508 |
}; |
| 33509 |
function getScrollDirectionAndSpeed(scrollContainer, scrollContainerRect, _ref, acceleration, thresholdPercentage) { |
| 33510 |
let { |
| 33511 |
top, |
| 33512 |
left, |
| 33513 |
right, |
| 33514 |
bottom |
| 33515 |
} = _ref; |
| 33516 |
if (acceleration === void 0) { |
| 33517 |
acceleration = 10; |
| 33518 |
} |
| 33519 |
if (thresholdPercentage === void 0) { |
| 33520 |
thresholdPercentage = defaultThreshold; |
| 33521 |
} |
| 33522 |
const { |
| 33523 |
isTop, |
| 33524 |
isBottom, |
| 33525 |
isLeft, |
| 33526 |
isRight |
| 33527 |
} = getScrollPosition(scrollContainer); |
| 33528 |
const direction = { |
| 33529 |
x: 0, |
| 33530 |
y: 0 |
| 33531 |
}; |
| 33532 |
const speed = { |
| 33533 |
x: 0, |
| 33534 |
y: 0 |
| 33535 |
}; |
| 33536 |
const threshold = { |
| 33537 |
height: scrollContainerRect.height * thresholdPercentage.y, |
| 33538 |
width: scrollContainerRect.width * thresholdPercentage.x |
| 33539 |
}; |
| 33540 |
if (!isTop && top <= scrollContainerRect.top + threshold.height) { |
| 33541 |
direction.y = Direction.Backward; |
| 33542 |
speed.y = acceleration * Math.abs((scrollContainerRect.top + threshold.height - top) / threshold.height); |
| 33543 |
} else if (!isBottom && bottom >= scrollContainerRect.bottom - threshold.height) { |
| 33544 |
direction.y = Direction.Forward; |
| 33545 |
speed.y = acceleration * Math.abs((scrollContainerRect.bottom - threshold.height - bottom) / threshold.height); |
| 33546 |
} |
| 33547 |
if (!isRight && right >= scrollContainerRect.right - threshold.width) { |
| 33548 |
direction.x = Direction.Forward; |
| 33549 |
speed.x = acceleration * Math.abs((scrollContainerRect.right - threshold.width - right) / threshold.width); |
| 33550 |
} else if (!isLeft && left <= scrollContainerRect.left + threshold.width) { |
| 33551 |
direction.x = Direction.Backward; |
| 33552 |
speed.x = acceleration * Math.abs((scrollContainerRect.left + threshold.width - left) / threshold.width); |
| 33553 |
} |
| 33554 |
return { |
| 33555 |
direction, |
| 33556 |
speed |
| 33557 |
}; |
| 33558 |
} |
| 33559 |
function getScrollElementRect(element) { |
| 33560 |
if (element === document.scrollingElement) { |
| 33561 |
const { |
| 33562 |
innerWidth, |
| 33563 |
innerHeight |
| 33564 |
} = window; |
| 33565 |
return { |
| 33566 |
top: 0, |
| 33567 |
left: 0, |
| 33568 |
right: innerWidth, |
| 33569 |
bottom: innerHeight, |
| 33570 |
width: innerWidth, |
| 33571 |
height: innerHeight |
| 33572 |
}; |
| 33573 |
} |
| 33574 |
const { |
| 33575 |
top, |
| 33576 |
left, |
| 33577 |
right, |
| 33578 |
bottom |
| 33579 |
} = element.getBoundingClientRect(); |
| 33580 |
return { |
| 33581 |
top, |
| 33582 |
left, |
| 33583 |
right, |
| 33584 |
bottom, |
| 33585 |
width: element.clientWidth, |
| 33586 |
height: element.clientHeight |
| 33587 |
}; |
| 33588 |
} |
| 33589 |
function getScrollOffsets(scrollableAncestors) { |
| 33590 |
return scrollableAncestors.reduce((acc, node) => { |
| 33591 |
return add(acc, getScrollCoordinates(node)); |
| 33592 |
}, defaultCoordinates); |
| 33593 |
} |
| 33594 |
function getScrollXOffset(scrollableAncestors) { |
| 33595 |
return scrollableAncestors.reduce((acc, node) => { |
| 33596 |
return acc + getScrollXCoordinate(node); |
| 33597 |
}, 0); |
| 33598 |
} |
| 33599 |
function getScrollYOffset(scrollableAncestors) { |
| 33600 |
return scrollableAncestors.reduce((acc, node) => { |
| 33601 |
return acc + getScrollYCoordinate(node); |
| 33602 |
}, 0); |
| 33603 |
} |
| 33604 |
function scrollIntoViewIfNeeded2(element, measure) { |
| 33605 |
if (measure === void 0) { |
| 33606 |
measure = getClientRect; |
| 33607 |
} |
| 33608 |
if (!element) { |
| 33609 |
return; |
| 33610 |
} |
| 33611 |
const { |
| 33612 |
top, |
| 33613 |
left, |
| 33614 |
bottom, |
| 33615 |
right |
| 33616 |
} = measure(element); |
| 33617 |
const firstScrollableAncestor = getFirstScrollableAncestor(element); |
| 33618 |
if (!firstScrollableAncestor) { |
| 33619 |
return; |
| 33620 |
} |
| 33621 |
if (bottom <= 0 || right <= 0 || top >= window.innerHeight || left >= window.innerWidth) { |
| 33622 |
element.scrollIntoView({ |
| 33623 |
block: "center", |
| 33624 |
inline: "center" |
| 33625 |
}); |
| 33626 |
} |
| 33627 |
} |
| 33628 |
var properties = [["x", ["left", "right"], getScrollXOffset], ["y", ["top", "bottom"], getScrollYOffset]]; |
| 33629 |
var Rect = class { |
| 33630 |
constructor(rect, element) { |
| 33631 |
this.rect = void 0; |
| 33632 |
this.width = void 0; |
| 33633 |
this.height = void 0; |
| 33634 |
this.top = void 0; |
| 33635 |
this.bottom = void 0; |
| 33636 |
this.right = void 0; |
| 33637 |
this.left = void 0; |
| 33638 |
const scrollableAncestors = getScrollableAncestors(element); |
| 33639 |
const scrollOffsets = getScrollOffsets(scrollableAncestors); |
| 33640 |
this.rect = { |
| 33641 |
...rect |
| 33642 |
}; |
| 33643 |
this.width = rect.width; |
| 33644 |
this.height = rect.height; |
| 33645 |
for (const [axis, keys, getScrollOffset] of properties) { |
| 33646 |
for (const key2 of keys) { |
| 33647 |
Object.defineProperty(this, key2, { |
| 33648 |
get: () => { |
| 33649 |
const currentOffsets = getScrollOffset(scrollableAncestors); |
| 33650 |
const scrollOffsetsDeltla = scrollOffsets[axis] - currentOffsets; |
| 33651 |
return this.rect[key2] + scrollOffsetsDeltla; |
| 33652 |
}, |
| 33653 |
enumerable: true |
| 33654 |
}); |
| 33655 |
} |
| 33656 |
} |
| 33657 |
Object.defineProperty(this, "rect", { |
| 33658 |
enumerable: false |
| 33659 |
}); |
| 33660 |
} |
| 33661 |
}; |
| 33662 |
var Listeners = class { |
| 33663 |
constructor(target) { |
| 33664 |
this.target = void 0; |
| 33665 |
this.listeners = []; |
| 33666 |
this.removeAll = () => { |
| 33667 |
this.listeners.forEach((listener) => { |
| 33668 |
var _this$target; |
| 33669 |
return (_this$target = this.target) == null ? void 0 : _this$target.removeEventListener(...listener); |
| 33670 |
}); |
| 33671 |
}; |
| 33672 |
this.target = target; |
| 33673 |
} |
| 33674 |
add(eventName, handler, options) { |
| 33675 |
var _this$target2; |
| 33676 |
(_this$target2 = this.target) == null ? void 0 : _this$target2.addEventListener(eventName, handler, options); |
| 33677 |
this.listeners.push([eventName, handler, options]); |
| 33678 |
} |
| 33679 |
}; |
| 33680 |
function getEventListenerTarget(target) { |
| 33681 |
const { |
| 33682 |
EventTarget |
| 33683 |
} = getWindow3(target); |
| 33684 |
return target instanceof EventTarget ? target : getOwnerDocument(target); |
| 33685 |
} |
| 33686 |
function hasExceededDistance(delta, measurement) { |
| 33687 |
const dx = Math.abs(delta.x); |
| 33688 |
const dy = Math.abs(delta.y); |
| 33689 |
if (typeof measurement === "number") { |
| 33690 |
return Math.sqrt(dx ** 2 + dy ** 2) > measurement; |
| 33691 |
} |
| 33692 |
if ("x" in measurement && "y" in measurement) { |
| 33693 |
return dx > measurement.x && dy > measurement.y; |
| 33694 |
} |
| 33695 |
if ("x" in measurement) { |
| 33696 |
return dx > measurement.x; |
| 33697 |
} |
| 33698 |
if ("y" in measurement) { |
| 33699 |
return dy > measurement.y; |
| 33700 |
} |
| 33701 |
return false; |
| 33702 |
} |
| 33703 |
var EventName; |
| 33704 |
(function(EventName2) { |
| 33705 |
EventName2["Click"] = "click"; |
| 33706 |
EventName2["DragStart"] = "dragstart"; |
| 33707 |
EventName2["Keydown"] = "keydown"; |
| 33708 |
EventName2["ContextMenu"] = "contextmenu"; |
| 33709 |
EventName2["Resize"] = "resize"; |
| 33710 |
EventName2["SelectionChange"] = "selectionchange"; |
| 33711 |
EventName2["VisibilityChange"] = "visibilitychange"; |
| 33712 |
})(EventName || (EventName = {})); |
| 33713 |
function preventDefault(event) { |
| 33714 |
event.preventDefault(); |
| 33715 |
} |
| 33716 |
function stopPropagation(event) { |
| 33717 |
event.stopPropagation(); |
| 33718 |
} |
| 33719 |
var KeyboardCode; |
| 33720 |
(function(KeyboardCode2) { |
| 33721 |
KeyboardCode2["Space"] = "Space"; |
| 33722 |
KeyboardCode2["Down"] = "ArrowDown"; |
| 33723 |
KeyboardCode2["Right"] = "ArrowRight"; |
| 33724 |
KeyboardCode2["Left"] = "ArrowLeft"; |
| 33725 |
KeyboardCode2["Up"] = "ArrowUp"; |
| 33726 |
KeyboardCode2["Esc"] = "Escape"; |
| 33727 |
KeyboardCode2["Enter"] = "Enter"; |
| 33728 |
KeyboardCode2["Tab"] = "Tab"; |
| 33729 |
})(KeyboardCode || (KeyboardCode = {})); |
| 33730 |
var defaultKeyboardCodes = { |
| 33731 |
start: [KeyboardCode.Space, KeyboardCode.Enter], |
| 33732 |
cancel: [KeyboardCode.Esc], |
| 33733 |
end: [KeyboardCode.Space, KeyboardCode.Enter, KeyboardCode.Tab] |
| 33734 |
}; |
| 33735 |
var defaultKeyboardCoordinateGetter = (event, _ref) => { |
| 33736 |
let { |
| 33737 |
currentCoordinates |
| 33738 |
} = _ref; |
| 33739 |
switch (event.code) { |
| 33740 |
case KeyboardCode.Right: |
| 33741 |
return { |
| 33742 |
...currentCoordinates, |
| 33743 |
x: currentCoordinates.x + 25 |
| 33744 |
}; |
| 33745 |
case KeyboardCode.Left: |
| 33746 |
return { |
| 33747 |
...currentCoordinates, |
| 33748 |
x: currentCoordinates.x - 25 |
| 33749 |
}; |
| 33750 |
case KeyboardCode.Down: |
| 33751 |
return { |
| 33752 |
...currentCoordinates, |
| 33753 |
y: currentCoordinates.y + 25 |
| 33754 |
}; |
| 33755 |
case KeyboardCode.Up: |
| 33756 |
return { |
| 33757 |
...currentCoordinates, |
| 33758 |
y: currentCoordinates.y - 25 |
| 33759 |
}; |
| 33760 |
} |
| 33761 |
return void 0; |
| 33762 |
}; |
| 33763 |
var KeyboardSensor = class { |
| 33764 |
constructor(props) { |
| 33765 |
this.props = void 0; |
| 33766 |
this.autoScrollEnabled = false; |
| 33767 |
this.referenceCoordinates = void 0; |
| 33768 |
this.listeners = void 0; |
| 33769 |
this.windowListeners = void 0; |
| 33770 |
this.props = props; |
| 33771 |
const { |
| 33772 |
event: { |
| 33773 |
target |
| 33774 |
} |
| 33775 |
} = props; |
| 33776 |
this.props = props; |
| 33777 |
this.listeners = new Listeners(getOwnerDocument(target)); |
| 33778 |
this.windowListeners = new Listeners(getWindow3(target)); |
| 33779 |
this.handleKeyDown = this.handleKeyDown.bind(this); |
| 33780 |
this.handleCancel = this.handleCancel.bind(this); |
| 33781 |
this.attach(); |
| 33782 |
} |
| 33783 |
attach() { |
| 33784 |
this.handleStart(); |
| 33785 |
this.windowListeners.add(EventName.Resize, this.handleCancel); |
| 33786 |
this.windowListeners.add(EventName.VisibilityChange, this.handleCancel); |
| 33787 |
setTimeout(() => this.listeners.add(EventName.Keydown, this.handleKeyDown)); |
| 33788 |
} |
| 33789 |
handleStart() { |
| 33790 |
const { |
| 33791 |
activeNode, |
| 33792 |
onStart |
| 33793 |
} = this.props; |
| 33794 |
const node = activeNode.node.current; |
| 33795 |
if (node) { |
| 33796 |
scrollIntoViewIfNeeded2(node); |
| 33797 |
} |
| 33798 |
onStart(defaultCoordinates); |
| 33799 |
} |
| 33800 |
handleKeyDown(event) { |
| 33801 |
if (isKeyboardEvent(event)) { |
| 33802 |
const { |
| 33803 |
active, |
| 33804 |
context, |
| 33805 |
options |
| 33806 |
} = this.props; |
| 33807 |
const { |
| 33808 |
keyboardCodes = defaultKeyboardCodes, |
| 33809 |
coordinateGetter = defaultKeyboardCoordinateGetter, |
| 33810 |
scrollBehavior = "smooth" |
| 33811 |
} = options; |
| 33812 |
const { |
| 33813 |
code |
| 33814 |
} = event; |
| 33815 |
if (keyboardCodes.end.includes(code)) { |
| 33816 |
this.handleEnd(event); |
| 33817 |
return; |
| 33818 |
} |
| 33819 |
if (keyboardCodes.cancel.includes(code)) { |
| 33820 |
this.handleCancel(event); |
| 33821 |
return; |
| 33822 |
} |
| 33823 |
const { |
| 33824 |
collisionRect |
| 33825 |
} = context.current; |
| 33826 |
const currentCoordinates = collisionRect ? { |
| 33827 |
x: collisionRect.left, |
| 33828 |
y: collisionRect.top |
| 33829 |
} : defaultCoordinates; |
| 33830 |
if (!this.referenceCoordinates) { |
| 33831 |
this.referenceCoordinates = currentCoordinates; |
| 33832 |
} |
| 33833 |
const newCoordinates = coordinateGetter(event, { |
| 33834 |
active, |
| 33835 |
context: context.current, |
| 33836 |
currentCoordinates |
| 33837 |
}); |
| 33838 |
if (newCoordinates) { |
| 33839 |
const coordinatesDelta = subtract(newCoordinates, currentCoordinates); |
| 33840 |
const scrollDelta = { |
| 33841 |
x: 0, |
| 33842 |
y: 0 |
| 33843 |
}; |
| 33844 |
const { |
| 33845 |
scrollableAncestors |
| 33846 |
} = context.current; |
| 33847 |
for (const scrollContainer of scrollableAncestors) { |
| 33848 |
const direction = event.code; |
| 33849 |
const { |
| 33850 |
isTop, |
| 33851 |
isRight, |
| 33852 |
isLeft, |
| 33853 |
isBottom, |
| 33854 |
maxScroll, |
| 33855 |
minScroll |
| 33856 |
} = getScrollPosition(scrollContainer); |
| 33857 |
const scrollElementRect = getScrollElementRect(scrollContainer); |
| 33858 |
const clampedCoordinates = { |
| 33859 |
x: Math.min(direction === KeyboardCode.Right ? scrollElementRect.right - scrollElementRect.width / 2 : scrollElementRect.right, Math.max(direction === KeyboardCode.Right ? scrollElementRect.left : scrollElementRect.left + scrollElementRect.width / 2, newCoordinates.x)), |
| 33860 |
y: Math.min(direction === KeyboardCode.Down ? scrollElementRect.bottom - scrollElementRect.height / 2 : scrollElementRect.bottom, Math.max(direction === KeyboardCode.Down ? scrollElementRect.top : scrollElementRect.top + scrollElementRect.height / 2, newCoordinates.y)) |
| 33861 |
}; |
| 33862 |
const canScrollX = direction === KeyboardCode.Right && !isRight || direction === KeyboardCode.Left && !isLeft; |
| 33863 |
const canScrollY = direction === KeyboardCode.Down && !isBottom || direction === KeyboardCode.Up && !isTop; |
| 33864 |
if (canScrollX && clampedCoordinates.x !== newCoordinates.x) { |
| 33865 |
const newScrollCoordinates = scrollContainer.scrollLeft + coordinatesDelta.x; |
| 33866 |
const canScrollToNewCoordinates = direction === KeyboardCode.Right && newScrollCoordinates <= maxScroll.x || direction === KeyboardCode.Left && newScrollCoordinates >= minScroll.x; |
| 33867 |
if (canScrollToNewCoordinates && !coordinatesDelta.y) { |
| 33868 |
scrollContainer.scrollTo({ |
| 33869 |
left: newScrollCoordinates, |
| 33870 |
behavior: scrollBehavior |
| 33871 |
}); |
| 33872 |
return; |
| 33873 |
} |
| 33874 |
if (canScrollToNewCoordinates) { |
| 33875 |
scrollDelta.x = scrollContainer.scrollLeft - newScrollCoordinates; |
| 33876 |
} else { |
| 33877 |
scrollDelta.x = direction === KeyboardCode.Right ? scrollContainer.scrollLeft - maxScroll.x : scrollContainer.scrollLeft - minScroll.x; |
| 33878 |
} |
| 33879 |
if (scrollDelta.x) { |
| 33880 |
scrollContainer.scrollBy({ |
| 33881 |
left: -scrollDelta.x, |
| 33882 |
behavior: scrollBehavior |
| 33883 |
}); |
| 33884 |
} |
| 33885 |
break; |
| 33886 |
} else if (canScrollY && clampedCoordinates.y !== newCoordinates.y) { |
| 33887 |
const newScrollCoordinates = scrollContainer.scrollTop + coordinatesDelta.y; |
| 33888 |
const canScrollToNewCoordinates = direction === KeyboardCode.Down && newScrollCoordinates <= maxScroll.y || direction === KeyboardCode.Up && newScrollCoordinates >= minScroll.y; |
| 33889 |
if (canScrollToNewCoordinates && !coordinatesDelta.x) { |
| 33890 |
scrollContainer.scrollTo({ |
| 33891 |
top: newScrollCoordinates, |
| 33892 |
behavior: scrollBehavior |
| 33893 |
}); |
| 33894 |
return; |
| 33895 |
} |
| 33896 |
if (canScrollToNewCoordinates) { |
| 33897 |
scrollDelta.y = scrollContainer.scrollTop - newScrollCoordinates; |
| 33898 |
} else { |
| 33899 |
scrollDelta.y = direction === KeyboardCode.Down ? scrollContainer.scrollTop - maxScroll.y : scrollContainer.scrollTop - minScroll.y; |
| 33900 |
} |
| 33901 |
if (scrollDelta.y) { |
| 33902 |
scrollContainer.scrollBy({ |
| 33903 |
top: -scrollDelta.y, |
| 33904 |
behavior: scrollBehavior |
| 33905 |
}); |
| 33906 |
} |
| 33907 |
break; |
| 33908 |
} |
| 33909 |
} |
| 33910 |
this.handleMove(event, add(subtract(newCoordinates, this.referenceCoordinates), scrollDelta)); |
| 33911 |
} |
| 33912 |
} |
| 33913 |
} |
| 33914 |
handleMove(event, coordinates) { |
| 33915 |
const { |
| 33916 |
onMove |
| 33917 |
} = this.props; |
| 33918 |
event.preventDefault(); |
| 33919 |
onMove(coordinates); |
| 33920 |
} |
| 33921 |
handleEnd(event) { |
| 33922 |
const { |
| 33923 |
onEnd |
| 33924 |
} = this.props; |
| 33925 |
event.preventDefault(); |
| 33926 |
this.detach(); |
| 33927 |
onEnd(); |
| 33928 |
} |
| 33929 |
handleCancel(event) { |
| 33930 |
const { |
| 33931 |
onCancel |
| 33932 |
} = this.props; |
| 33933 |
event.preventDefault(); |
| 33934 |
this.detach(); |
| 33935 |
onCancel(); |
| 33936 |
} |
| 33937 |
detach() { |
| 33938 |
this.listeners.removeAll(); |
| 33939 |
this.windowListeners.removeAll(); |
| 33940 |
} |
| 33941 |
}; |
| 33942 |
KeyboardSensor.activators = [{ |
| 33943 |
eventName: "onKeyDown", |
| 33944 |
handler: (event, _ref, _ref2) => { |
| 33945 |
let { |
| 33946 |
keyboardCodes = defaultKeyboardCodes, |
| 33947 |
onActivation |
| 33948 |
} = _ref; |
| 33949 |
let { |
| 33950 |
active |
| 33951 |
} = _ref2; |
| 33952 |
const { |
| 33953 |
code |
| 33954 |
} = event.nativeEvent; |
| 33955 |
if (keyboardCodes.start.includes(code)) { |
| 33956 |
const activator = active.activatorNode.current; |
| 33957 |
if (activator && event.target !== activator) { |
| 33958 |
return false; |
| 33959 |
} |
| 33960 |
event.preventDefault(); |
| 33961 |
onActivation == null ? void 0 : onActivation({ |
| 33962 |
event: event.nativeEvent |
| 33963 |
}); |
| 33964 |
return true; |
| 33965 |
} |
| 33966 |
return false; |
| 33967 |
} |
| 33968 |
}]; |
| 33969 |
function isDistanceConstraint(constraint) { |
| 33970 |
return Boolean(constraint && "distance" in constraint); |
| 33971 |
} |
| 33972 |
function isDelayConstraint(constraint) { |
| 33973 |
return Boolean(constraint && "delay" in constraint); |
| 33974 |
} |
| 33975 |
var AbstractPointerSensor = class { |
| 33976 |
constructor(props, events2, listenerTarget) { |
| 33977 |
var _getEventCoordinates; |
| 33978 |
if (listenerTarget === void 0) { |
| 33979 |
listenerTarget = getEventListenerTarget(props.event.target); |
| 33980 |
} |
| 33981 |
this.props = void 0; |
| 33982 |
this.events = void 0; |
| 33983 |
this.autoScrollEnabled = true; |
| 33984 |
this.document = void 0; |
| 33985 |
this.activated = false; |
| 33986 |
this.initialCoordinates = void 0; |
| 33987 |
this.timeoutId = null; |
| 33988 |
this.listeners = void 0; |
| 33989 |
this.documentListeners = void 0; |
| 33990 |
this.windowListeners = void 0; |
| 33991 |
this.props = props; |
| 33992 |
this.events = events2; |
| 33993 |
const { |
| 33994 |
event |
| 33995 |
} = props; |
| 33996 |
const { |
| 33997 |
target |
| 33998 |
} = event; |
| 33999 |
this.props = props; |
| 34000 |
this.events = events2; |
| 34001 |
this.document = getOwnerDocument(target); |
| 34002 |
this.documentListeners = new Listeners(this.document); |
| 34003 |
this.listeners = new Listeners(listenerTarget); |
| 34004 |
this.windowListeners = new Listeners(getWindow3(target)); |
| 34005 |
this.initialCoordinates = (_getEventCoordinates = getEventCoordinates(event)) != null ? _getEventCoordinates : defaultCoordinates; |
| 34006 |
this.handleStart = this.handleStart.bind(this); |
| 34007 |
this.handleMove = this.handleMove.bind(this); |
| 34008 |
this.handleEnd = this.handleEnd.bind(this); |
| 34009 |
this.handleCancel = this.handleCancel.bind(this); |
| 34010 |
this.handleKeydown = this.handleKeydown.bind(this); |
| 34011 |
this.removeTextSelection = this.removeTextSelection.bind(this); |
| 34012 |
this.attach(); |
| 34013 |
} |
| 34014 |
attach() { |
| 34015 |
const { |
| 34016 |
events: events2, |
| 34017 |
props: { |
| 34018 |
options: { |
| 34019 |
activationConstraint, |
| 34020 |
bypassActivationConstraint |
| 34021 |
} |
| 34022 |
} |
| 34023 |
} = this; |
| 34024 |
this.listeners.add(events2.move.name, this.handleMove, { |
| 34025 |
passive: false |
| 34026 |
}); |
| 34027 |
this.listeners.add(events2.end.name, this.handleEnd); |
| 34028 |
if (events2.cancel) { |
| 34029 |
this.listeners.add(events2.cancel.name, this.handleCancel); |
| 34030 |
} |
| 34031 |
this.windowListeners.add(EventName.Resize, this.handleCancel); |
| 34032 |
this.windowListeners.add(EventName.DragStart, preventDefault); |
| 34033 |
this.windowListeners.add(EventName.VisibilityChange, this.handleCancel); |
| 34034 |
this.windowListeners.add(EventName.ContextMenu, preventDefault); |
| 34035 |
this.documentListeners.add(EventName.Keydown, this.handleKeydown); |
| 34036 |
if (activationConstraint) { |
| 34037 |
if (bypassActivationConstraint != null && bypassActivationConstraint({ |
| 34038 |
event: this.props.event, |
| 34039 |
activeNode: this.props.activeNode, |
| 34040 |
options: this.props.options |
| 34041 |
})) { |
| 34042 |
return this.handleStart(); |
| 34043 |
} |
| 34044 |
if (isDelayConstraint(activationConstraint)) { |
| 34045 |
this.timeoutId = setTimeout(this.handleStart, activationConstraint.delay); |
| 34046 |
this.handlePending(activationConstraint); |
| 34047 |
return; |
| 34048 |
} |
| 34049 |
if (isDistanceConstraint(activationConstraint)) { |
| 34050 |
this.handlePending(activationConstraint); |
| 34051 |
return; |
| 34052 |
} |
| 34053 |
} |
| 34054 |
this.handleStart(); |
| 34055 |
} |
| 34056 |
detach() { |
| 34057 |
this.listeners.removeAll(); |
| 34058 |
this.windowListeners.removeAll(); |
| 34059 |
setTimeout(this.documentListeners.removeAll, 50); |
| 34060 |
if (this.timeoutId !== null) { |
| 34061 |
clearTimeout(this.timeoutId); |
| 34062 |
this.timeoutId = null; |
| 34063 |
} |
| 34064 |
} |
| 34065 |
handlePending(constraint, offset4) { |
| 34066 |
const { |
| 34067 |
active, |
| 34068 |
onPending |
| 34069 |
} = this.props; |
| 34070 |
onPending(active, constraint, this.initialCoordinates, offset4); |
| 34071 |
} |
| 34072 |
handleStart() { |
| 34073 |
const { |
| 34074 |
initialCoordinates |
| 34075 |
} = this; |
| 34076 |
const { |
| 34077 |
onStart |
| 34078 |
} = this.props; |
| 34079 |
if (initialCoordinates) { |
| 34080 |
this.activated = true; |
| 34081 |
this.documentListeners.add(EventName.Click, stopPropagation, { |
| 34082 |
capture: true |
| 34083 |
}); |
| 34084 |
this.removeTextSelection(); |
| 34085 |
this.documentListeners.add(EventName.SelectionChange, this.removeTextSelection); |
| 34086 |
onStart(initialCoordinates); |
| 34087 |
} |
| 34088 |
} |
| 34089 |
handleMove(event) { |
| 34090 |
var _getEventCoordinates2; |
| 34091 |
const { |
| 34092 |
activated, |
| 34093 |
initialCoordinates, |
| 34094 |
props |
| 34095 |
} = this; |
| 34096 |
const { |
| 34097 |
onMove, |
| 34098 |
options: { |
| 34099 |
activationConstraint |
| 34100 |
} |
| 34101 |
} = props; |
| 34102 |
if (!initialCoordinates) { |
| 34103 |
return; |
| 34104 |
} |
| 34105 |
const coordinates = (_getEventCoordinates2 = getEventCoordinates(event)) != null ? _getEventCoordinates2 : defaultCoordinates; |
| 34106 |
const delta = subtract(initialCoordinates, coordinates); |
| 34107 |
if (!activated && activationConstraint) { |
| 34108 |
if (isDistanceConstraint(activationConstraint)) { |
| 34109 |
if (activationConstraint.tolerance != null && hasExceededDistance(delta, activationConstraint.tolerance)) { |
| 34110 |
return this.handleCancel(); |
| 34111 |
} |
| 34112 |
if (hasExceededDistance(delta, activationConstraint.distance)) { |
| 34113 |
return this.handleStart(); |
| 34114 |
} |
| 34115 |
} |
| 34116 |
if (isDelayConstraint(activationConstraint)) { |
| 34117 |
if (hasExceededDistance(delta, activationConstraint.tolerance)) { |
| 34118 |
return this.handleCancel(); |
| 34119 |
} |
| 34120 |
} |
| 34121 |
this.handlePending(activationConstraint, delta); |
| 34122 |
return; |
| 34123 |
} |
| 34124 |
if (event.cancelable) { |
| 34125 |
event.preventDefault(); |
| 34126 |
} |
| 34127 |
onMove(coordinates); |
| 34128 |
} |
| 34129 |
handleEnd() { |
| 34130 |
const { |
| 34131 |
onAbort, |
| 34132 |
onEnd |
| 34133 |
} = this.props; |
| 34134 |
this.detach(); |
| 34135 |
if (!this.activated) { |
| 34136 |
onAbort(this.props.active); |
| 34137 |
} |
| 34138 |
onEnd(); |
| 34139 |
} |
| 34140 |
handleCancel() { |
| 34141 |
const { |
| 34142 |
onAbort, |
| 34143 |
onCancel |
| 34144 |
} = this.props; |
| 34145 |
this.detach(); |
| 34146 |
if (!this.activated) { |
| 34147 |
onAbort(this.props.active); |
| 34148 |
} |
| 34149 |
onCancel(); |
| 34150 |
} |
| 34151 |
handleKeydown(event) { |
| 34152 |
if (event.code === KeyboardCode.Esc) { |
| 34153 |
this.handleCancel(); |
| 34154 |
} |
| 34155 |
} |
| 34156 |
removeTextSelection() { |
| 34157 |
var _this$document$getSel; |
| 34158 |
(_this$document$getSel = this.document.getSelection()) == null ? void 0 : _this$document$getSel.removeAllRanges(); |
| 34159 |
} |
| 34160 |
}; |
| 34161 |
var events = { |
| 34162 |
cancel: { |
| 34163 |
name: "pointercancel" |
| 34164 |
}, |
| 34165 |
move: { |
| 34166 |
name: "pointermove" |
| 34167 |
}, |
| 34168 |
end: { |
| 34169 |
name: "pointerup" |
| 34170 |
} |
| 34171 |
}; |
| 34172 |
var PointerSensor = class extends AbstractPointerSensor { |
| 34173 |
constructor(props) { |
| 34174 |
const { |
| 34175 |
event |
| 34176 |
} = props; |
| 34177 |
const listenerTarget = getOwnerDocument(event.target); |
| 34178 |
super(props, events, listenerTarget); |
| 34179 |
} |
| 34180 |
}; |
| 34181 |
PointerSensor.activators = [{ |
| 34182 |
eventName: "onPointerDown", |
| 34183 |
handler: (_ref, _ref2) => { |
| 34184 |
let { |
| 34185 |
nativeEvent: event |
| 34186 |
} = _ref; |
| 34187 |
let { |
| 34188 |
onActivation |
| 34189 |
} = _ref2; |
| 34190 |
if (!event.isPrimary || event.button !== 0) { |
| 34191 |
return false; |
| 34192 |
} |
| 34193 |
onActivation == null ? void 0 : onActivation({ |
| 34194 |
event |
| 34195 |
}); |
| 34196 |
return true; |
| 34197 |
} |
| 34198 |
}]; |
| 34199 |
var events$1 = { |
| 34200 |
move: { |
| 34201 |
name: "mousemove" |
| 34202 |
}, |
| 34203 |
end: { |
| 34204 |
name: "mouseup" |
| 34205 |
} |
| 34206 |
}; |
| 34207 |
var MouseButton; |
| 34208 |
(function(MouseButton2) { |
| 34209 |
MouseButton2[MouseButton2["RightClick"] = 2] = "RightClick"; |
| 34210 |
})(MouseButton || (MouseButton = {})); |
| 34211 |
var MouseSensor = class extends AbstractPointerSensor { |
| 34212 |
constructor(props) { |
| 34213 |
super(props, events$1, getOwnerDocument(props.event.target)); |
| 34214 |
} |
| 34215 |
}; |
| 34216 |
MouseSensor.activators = [{ |
| 34217 |
eventName: "onMouseDown", |
| 34218 |
handler: (_ref, _ref2) => { |
| 34219 |
let { |
| 34220 |
nativeEvent: event |
| 34221 |
} = _ref; |
| 34222 |
let { |
| 34223 |
onActivation |
| 34224 |
} = _ref2; |
| 34225 |
if (event.button === MouseButton.RightClick) { |
| 34226 |
return false; |
| 34227 |
} |
| 34228 |
onActivation == null ? void 0 : onActivation({ |
| 34229 |
event |
| 34230 |
}); |
| 34231 |
return true; |
| 34232 |
} |
| 34233 |
}]; |
| 34234 |
var events$2 = { |
| 34235 |
cancel: { |
| 34236 |
name: "touchcancel" |
| 34237 |
}, |
| 34238 |
move: { |
| 34239 |
name: "touchmove" |
| 34240 |
}, |
| 34241 |
end: { |
| 34242 |
name: "touchend" |
| 34243 |
} |
| 34244 |
}; |
| 34245 |
var TouchSensor = class extends AbstractPointerSensor { |
| 34246 |
constructor(props) { |
| 34247 |
super(props, events$2); |
| 34248 |
} |
| 34249 |
static setup() { |
| 34250 |
window.addEventListener(events$2.move.name, noop7, { |
| 34251 |
capture: false, |
| 34252 |
passive: false |
| 34253 |
}); |
| 34254 |
return function teardown() { |
| 34255 |
window.removeEventListener(events$2.move.name, noop7); |
| 34256 |
}; |
| 34257 |
function noop7() { |
| 34258 |
} |
| 34259 |
} |
| 34260 |
}; |
| 34261 |
TouchSensor.activators = [{ |
| 34262 |
eventName: "onTouchStart", |
| 34263 |
handler: (_ref, _ref2) => { |
| 34264 |
let { |
| 34265 |
nativeEvent: event |
| 34266 |
} = _ref; |
| 34267 |
let { |
| 34268 |
onActivation |
| 34269 |
} = _ref2; |
| 34270 |
const { |
| 34271 |
touches |
| 34272 |
} = event; |
| 34273 |
if (touches.length > 1) { |
| 34274 |
return false; |
| 34275 |
} |
| 34276 |
onActivation == null ? void 0 : onActivation({ |
| 34277 |
event |
| 34278 |
}); |
| 34279 |
return true; |
| 34280 |
} |
| 34281 |
}]; |
| 34282 |
var AutoScrollActivator; |
| 34283 |
(function(AutoScrollActivator2) { |
| 34284 |
AutoScrollActivator2[AutoScrollActivator2["Pointer"] = 0] = "Pointer"; |
| 34285 |
AutoScrollActivator2[AutoScrollActivator2["DraggableRect"] = 1] = "DraggableRect"; |
| 34286 |
})(AutoScrollActivator || (AutoScrollActivator = {})); |
| 34287 |
var TraversalOrder; |
| 34288 |
(function(TraversalOrder2) { |
| 34289 |
TraversalOrder2[TraversalOrder2["TreeOrder"] = 0] = "TreeOrder"; |
| 34290 |
TraversalOrder2[TraversalOrder2["ReversedTreeOrder"] = 1] = "ReversedTreeOrder"; |
| 34291 |
})(TraversalOrder || (TraversalOrder = {})); |
| 34292 |
function useAutoScroller(_ref) { |
| 34293 |
let { |
| 34294 |
acceleration, |
| 34295 |
activator = AutoScrollActivator.Pointer, |
| 34296 |
canScroll, |
| 34297 |
draggingRect, |
| 34298 |
enabled, |
| 34299 |
interval = 5, |
| 34300 |
order = TraversalOrder.TreeOrder, |
| 34301 |
pointerCoordinates, |
| 34302 |
scrollableAncestors, |
| 34303 |
scrollableAncestorRects, |
| 34304 |
delta, |
| 34305 |
threshold |
| 34306 |
} = _ref; |
| 34307 |
const scrollIntent = useScrollIntent({ |
| 34308 |
delta, |
| 34309 |
disabled: !enabled |
| 34310 |
}); |
| 34311 |
const [setAutoScrollInterval, clearAutoScrollInterval] = useInterval(); |
| 34312 |
const scrollSpeed = (0, import_react40.useRef)({ |
| 34313 |
x: 0, |
| 34314 |
y: 0 |
| 34315 |
}); |
| 34316 |
const scrollDirection = (0, import_react40.useRef)({ |
| 34317 |
x: 0, |
| 34318 |
y: 0 |
| 34319 |
}); |
| 34320 |
const rect = (0, import_react40.useMemo)(() => { |
| 34321 |
switch (activator) { |
| 34322 |
case AutoScrollActivator.Pointer: |
| 34323 |
return pointerCoordinates ? { |
| 34324 |
top: pointerCoordinates.y, |
| 34325 |
bottom: pointerCoordinates.y, |
| 34326 |
left: pointerCoordinates.x, |
| 34327 |
right: pointerCoordinates.x |
| 34328 |
} : null; |
| 34329 |
case AutoScrollActivator.DraggableRect: |
| 34330 |
return draggingRect; |
| 34331 |
} |
| 34332 |
}, [activator, draggingRect, pointerCoordinates]); |
| 34333 |
const scrollContainerRef = (0, import_react40.useRef)(null); |
| 34334 |
const autoScroll = (0, import_react40.useCallback)(() => { |
| 34335 |
const scrollContainer = scrollContainerRef.current; |
| 34336 |
if (!scrollContainer) { |
| 34337 |
return; |
| 34338 |
} |
| 34339 |
const scrollLeft = scrollSpeed.current.x * scrollDirection.current.x; |
| 34340 |
const scrollTop = scrollSpeed.current.y * scrollDirection.current.y; |
| 34341 |
scrollContainer.scrollBy(scrollLeft, scrollTop); |
| 34342 |
}, []); |
| 34343 |
const sortedScrollableAncestors = (0, import_react40.useMemo)(() => order === TraversalOrder.TreeOrder ? [...scrollableAncestors].reverse() : scrollableAncestors, [order, scrollableAncestors]); |
| 34344 |
(0, import_react40.useEffect)( |
| 34345 |
() => { |
| 34346 |
if (!enabled || !scrollableAncestors.length || !rect) { |
| 34347 |
clearAutoScrollInterval(); |
| 34348 |
return; |
| 34349 |
} |
| 34350 |
for (const scrollContainer of sortedScrollableAncestors) { |
| 34351 |
if ((canScroll == null ? void 0 : canScroll(scrollContainer)) === false) { |
| 34352 |
continue; |
| 34353 |
} |
| 34354 |
const index2 = scrollableAncestors.indexOf(scrollContainer); |
| 34355 |
const scrollContainerRect = scrollableAncestorRects[index2]; |
| 34356 |
if (!scrollContainerRect) { |
| 34357 |
continue; |
| 34358 |
} |
| 34359 |
const { |
| 34360 |
direction, |
| 34361 |
speed |
| 34362 |
} = getScrollDirectionAndSpeed(scrollContainer, scrollContainerRect, rect, acceleration, threshold); |
| 34363 |
for (const axis of ["x", "y"]) { |
| 34364 |
if (!scrollIntent[axis][direction[axis]]) { |
| 34365 |
speed[axis] = 0; |
| 34366 |
direction[axis] = 0; |
| 34367 |
} |
| 34368 |
} |
| 34369 |
if (speed.x > 0 || speed.y > 0) { |
| 34370 |
clearAutoScrollInterval(); |
| 34371 |
scrollContainerRef.current = scrollContainer; |
| 34372 |
setAutoScrollInterval(autoScroll, interval); |
| 34373 |
scrollSpeed.current = speed; |
| 34374 |
scrollDirection.current = direction; |
| 34375 |
return; |
| 34376 |
} |
| 34377 |
} |
| 34378 |
scrollSpeed.current = { |
| 34379 |
x: 0, |
| 34380 |
y: 0 |
| 34381 |
}; |
| 34382 |
scrollDirection.current = { |
| 34383 |
x: 0, |
| 34384 |
y: 0 |
| 34385 |
}; |
| 34386 |
clearAutoScrollInterval(); |
| 34387 |
}, |
| 34388 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34389 |
[ |
| 34390 |
acceleration, |
| 34391 |
autoScroll, |
| 34392 |
canScroll, |
| 34393 |
clearAutoScrollInterval, |
| 34394 |
enabled, |
| 34395 |
interval, |
| 34396 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34397 |
JSON.stringify(rect), |
| 34398 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34399 |
JSON.stringify(scrollIntent), |
| 34400 |
setAutoScrollInterval, |
| 34401 |
scrollableAncestors, |
| 34402 |
sortedScrollableAncestors, |
| 34403 |
scrollableAncestorRects, |
| 34404 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34405 |
JSON.stringify(threshold) |
| 34406 |
] |
| 34407 |
); |
| 34408 |
} |
| 34409 |
var defaultScrollIntent = { |
| 34410 |
x: { |
| 34411 |
[Direction.Backward]: false, |
| 34412 |
[Direction.Forward]: false |
| 34413 |
}, |
| 34414 |
y: { |
| 34415 |
[Direction.Backward]: false, |
| 34416 |
[Direction.Forward]: false |
| 34417 |
} |
| 34418 |
}; |
| 34419 |
function useScrollIntent(_ref2) { |
| 34420 |
let { |
| 34421 |
delta, |
| 34422 |
disabled: disabled2 |
| 34423 |
} = _ref2; |
| 34424 |
const previousDelta = usePrevious2(delta); |
| 34425 |
return useLazyMemo((previousIntent) => { |
| 34426 |
if (disabled2 || !previousDelta || !previousIntent) { |
| 34427 |
return defaultScrollIntent; |
| 34428 |
} |
| 34429 |
const direction = { |
| 34430 |
x: Math.sign(delta.x - previousDelta.x), |
| 34431 |
y: Math.sign(delta.y - previousDelta.y) |
| 34432 |
}; |
| 34433 |
return { |
| 34434 |
x: { |
| 34435 |
[Direction.Backward]: previousIntent.x[Direction.Backward] || direction.x === -1, |
| 34436 |
[Direction.Forward]: previousIntent.x[Direction.Forward] || direction.x === 1 |
| 34437 |
}, |
| 34438 |
y: { |
| 34439 |
[Direction.Backward]: previousIntent.y[Direction.Backward] || direction.y === -1, |
| 34440 |
[Direction.Forward]: previousIntent.y[Direction.Forward] || direction.y === 1 |
| 34441 |
} |
| 34442 |
}; |
| 34443 |
}, [disabled2, delta, previousDelta]); |
| 34444 |
} |
| 34445 |
function useCachedNode(draggableNodes, id) { |
| 34446 |
const draggableNode = id != null ? draggableNodes.get(id) : void 0; |
| 34447 |
const node = draggableNode ? draggableNode.node.current : null; |
| 34448 |
return useLazyMemo((cachedNode) => { |
| 34449 |
var _ref; |
| 34450 |
if (id == null) { |
| 34451 |
return null; |
| 34452 |
} |
| 34453 |
return (_ref = node != null ? node : cachedNode) != null ? _ref : null; |
| 34454 |
}, [node, id]); |
| 34455 |
} |
| 34456 |
function useCombineActivators(sensors, getSyntheticHandler) { |
| 34457 |
return (0, import_react40.useMemo)(() => sensors.reduce((accumulator, sensor) => { |
| 34458 |
const { |
| 34459 |
sensor: Sensor |
| 34460 |
} = sensor; |
| 34461 |
const sensorActivators = Sensor.activators.map((activator) => ({ |
| 34462 |
eventName: activator.eventName, |
| 34463 |
handler: getSyntheticHandler(activator.handler, sensor) |
| 34464 |
})); |
| 34465 |
return [...accumulator, ...sensorActivators]; |
| 34466 |
}, []), [sensors, getSyntheticHandler]); |
| 34467 |
} |
| 34468 |
var MeasuringStrategy; |
| 34469 |
(function(MeasuringStrategy2) { |
| 34470 |
MeasuringStrategy2[MeasuringStrategy2["Always"] = 0] = "Always"; |
| 34471 |
MeasuringStrategy2[MeasuringStrategy2["BeforeDragging"] = 1] = "BeforeDragging"; |
| 34472 |
MeasuringStrategy2[MeasuringStrategy2["WhileDragging"] = 2] = "WhileDragging"; |
| 34473 |
})(MeasuringStrategy || (MeasuringStrategy = {})); |
| 34474 |
var MeasuringFrequency; |
| 34475 |
(function(MeasuringFrequency2) { |
| 34476 |
MeasuringFrequency2["Optimized"] = "optimized"; |
| 34477 |
})(MeasuringFrequency || (MeasuringFrequency = {})); |
| 34478 |
var defaultValue2 = /* @__PURE__ */ new Map(); |
| 34479 |
function useDroppableMeasuring(containers, _ref) { |
| 34480 |
let { |
| 34481 |
dragging, |
| 34482 |
dependencies, |
| 34483 |
config |
| 34484 |
} = _ref; |
| 34485 |
const [queue, setQueue] = (0, import_react40.useState)(null); |
| 34486 |
const { |
| 34487 |
frequency, |
| 34488 |
measure, |
| 34489 |
strategy |
| 34490 |
} = config; |
| 34491 |
const containersRef = (0, import_react40.useRef)(containers); |
| 34492 |
const disabled2 = isDisabled(); |
| 34493 |
const disabledRef = useLatestValue(disabled2); |
| 34494 |
const measureDroppableContainers = (0, import_react40.useCallback)(function(ids2) { |
| 34495 |
if (ids2 === void 0) { |
| 34496 |
ids2 = []; |
| 34497 |
} |
| 34498 |
if (disabledRef.current) { |
| 34499 |
return; |
| 34500 |
} |
| 34501 |
setQueue((value) => { |
| 34502 |
if (value === null) { |
| 34503 |
return ids2; |
| 34504 |
} |
| 34505 |
return value.concat(ids2.filter((id) => !value.includes(id))); |
| 34506 |
}); |
| 34507 |
}, [disabledRef]); |
| 34508 |
const timeoutId = (0, import_react40.useRef)(null); |
| 34509 |
const droppableRects = useLazyMemo((previousValue) => { |
| 34510 |
if (disabled2 && !dragging) { |
| 34511 |
return defaultValue2; |
| 34512 |
} |
| 34513 |
if (!previousValue || previousValue === defaultValue2 || containersRef.current !== containers || queue != null) { |
| 34514 |
const map = /* @__PURE__ */ new Map(); |
| 34515 |
for (let container of containers) { |
| 34516 |
if (!container) { |
| 34517 |
continue; |
| 34518 |
} |
| 34519 |
if (queue && queue.length > 0 && !queue.includes(container.id) && container.rect.current) { |
| 34520 |
map.set(container.id, container.rect.current); |
| 34521 |
continue; |
| 34522 |
} |
| 34523 |
const node = container.node.current; |
| 34524 |
const rect = node ? new Rect(measure(node), node) : null; |
| 34525 |
container.rect.current = rect; |
| 34526 |
if (rect) { |
| 34527 |
map.set(container.id, rect); |
| 34528 |
} |
| 34529 |
} |
| 34530 |
return map; |
| 34531 |
} |
| 34532 |
return previousValue; |
| 34533 |
}, [containers, queue, dragging, disabled2, measure]); |
| 34534 |
(0, import_react40.useEffect)(() => { |
| 34535 |
containersRef.current = containers; |
| 34536 |
}, [containers]); |
| 34537 |
(0, import_react40.useEffect)( |
| 34538 |
() => { |
| 34539 |
if (disabled2) { |
| 34540 |
return; |
| 34541 |
} |
| 34542 |
measureDroppableContainers(); |
| 34543 |
}, |
| 34544 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34545 |
[dragging, disabled2] |
| 34546 |
); |
| 34547 |
(0, import_react40.useEffect)( |
| 34548 |
() => { |
| 34549 |
if (queue && queue.length > 0) { |
| 34550 |
setQueue(null); |
| 34551 |
} |
| 34552 |
}, |
| 34553 |
//eslint-disable-next-line react-hooks/exhaustive-deps |
| 34554 |
[JSON.stringify(queue)] |
| 34555 |
); |
| 34556 |
(0, import_react40.useEffect)( |
| 34557 |
() => { |
| 34558 |
if (disabled2 || typeof frequency !== "number" || timeoutId.current !== null) { |
| 34559 |
return; |
| 34560 |
} |
| 34561 |
timeoutId.current = setTimeout(() => { |
| 34562 |
measureDroppableContainers(); |
| 34563 |
timeoutId.current = null; |
| 34564 |
}, frequency); |
| 34565 |
}, |
| 34566 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34567 |
[frequency, disabled2, measureDroppableContainers, ...dependencies] |
| 34568 |
); |
| 34569 |
return { |
| 34570 |
droppableRects, |
| 34571 |
measureDroppableContainers, |
| 34572 |
measuringScheduled: queue != null |
| 34573 |
}; |
| 34574 |
function isDisabled() { |
| 34575 |
switch (strategy) { |
| 34576 |
case MeasuringStrategy.Always: |
| 34577 |
return false; |
| 34578 |
case MeasuringStrategy.BeforeDragging: |
| 34579 |
return dragging; |
| 34580 |
default: |
| 34581 |
return !dragging; |
| 34582 |
} |
| 34583 |
} |
| 34584 |
} |
| 34585 |
function useInitialValue2(value, computeFn) { |
| 34586 |
return useLazyMemo((previousValue) => { |
| 34587 |
if (!value) { |
| 34588 |
return null; |
| 34589 |
} |
| 34590 |
if (previousValue) { |
| 34591 |
return previousValue; |
| 34592 |
} |
| 34593 |
return typeof computeFn === "function" ? computeFn(value) : value; |
| 34594 |
}, [computeFn, value]); |
| 34595 |
} |
| 34596 |
function useInitialRect(node, measure) { |
| 34597 |
return useInitialValue2(node, measure); |
| 34598 |
} |
| 34599 |
function useMutationObserver(_ref) { |
| 34600 |
let { |
| 34601 |
callback, |
| 34602 |
disabled: disabled2 |
| 34603 |
} = _ref; |
| 34604 |
const handleMutations = useEvent3(callback); |
| 34605 |
const mutationObserver = (0, import_react40.useMemo)(() => { |
| 34606 |
if (disabled2 || typeof window === "undefined" || typeof window.MutationObserver === "undefined") { |
| 34607 |
return void 0; |
| 34608 |
} |
| 34609 |
const { |
| 34610 |
MutationObserver: MutationObserver2 |
| 34611 |
} = window; |
| 34612 |
return new MutationObserver2(handleMutations); |
| 34613 |
}, [handleMutations, disabled2]); |
| 34614 |
(0, import_react40.useEffect)(() => { |
| 34615 |
return () => mutationObserver == null ? void 0 : mutationObserver.disconnect(); |
| 34616 |
}, [mutationObserver]); |
| 34617 |
return mutationObserver; |
| 34618 |
} |
| 34619 |
function useResizeObserver2(_ref) { |
| 34620 |
let { |
| 34621 |
callback, |
| 34622 |
disabled: disabled2 |
| 34623 |
} = _ref; |
| 34624 |
const handleResize = useEvent3(callback); |
| 34625 |
const resizeObserver = (0, import_react40.useMemo)( |
| 34626 |
() => { |
| 34627 |
if (disabled2 || typeof window === "undefined" || typeof window.ResizeObserver === "undefined") { |
| 34628 |
return void 0; |
| 34629 |
} |
| 34630 |
const { |
| 34631 |
ResizeObserver: ResizeObserver2 |
| 34632 |
} = window; |
| 34633 |
return new ResizeObserver2(handleResize); |
| 34634 |
}, |
| 34635 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34636 |
[disabled2] |
| 34637 |
); |
| 34638 |
(0, import_react40.useEffect)(() => { |
| 34639 |
return () => resizeObserver == null ? void 0 : resizeObserver.disconnect(); |
| 34640 |
}, [resizeObserver]); |
| 34641 |
return resizeObserver; |
| 34642 |
} |
| 34643 |
function defaultMeasure(element) { |
| 34644 |
return new Rect(getClientRect(element), element); |
| 34645 |
} |
| 34646 |
function useRect(element, measure, fallbackRect) { |
| 34647 |
if (measure === void 0) { |
| 34648 |
measure = defaultMeasure; |
| 34649 |
} |
| 34650 |
const [rect, setRect] = (0, import_react40.useState)(null); |
| 34651 |
function measureRect() { |
| 34652 |
setRect((currentRect) => { |
| 34653 |
if (!element) { |
| 34654 |
return null; |
| 34655 |
} |
| 34656 |
if (element.isConnected === false) { |
| 34657 |
var _ref; |
| 34658 |
return (_ref = currentRect != null ? currentRect : fallbackRect) != null ? _ref : null; |
| 34659 |
} |
| 34660 |
const newRect = measure(element); |
| 34661 |
if (JSON.stringify(currentRect) === JSON.stringify(newRect)) { |
| 34662 |
return currentRect; |
| 34663 |
} |
| 34664 |
return newRect; |
| 34665 |
}); |
| 34666 |
} |
| 34667 |
const mutationObserver = useMutationObserver({ |
| 34668 |
callback(records) { |
| 34669 |
if (!element) { |
| 34670 |
return; |
| 34671 |
} |
| 34672 |
for (const record of records) { |
| 34673 |
const { |
| 34674 |
type, |
| 34675 |
target |
| 34676 |
} = record; |
| 34677 |
if (type === "childList" && target instanceof HTMLElement && target.contains(element)) { |
| 34678 |
measureRect(); |
| 34679 |
break; |
| 34680 |
} |
| 34681 |
} |
| 34682 |
} |
| 34683 |
}); |
| 34684 |
const resizeObserver = useResizeObserver2({ |
| 34685 |
callback: measureRect |
| 34686 |
}); |
| 34687 |
useIsomorphicLayoutEffect(() => { |
| 34688 |
measureRect(); |
| 34689 |
if (element) { |
| 34690 |
resizeObserver == null ? void 0 : resizeObserver.observe(element); |
| 34691 |
mutationObserver == null ? void 0 : mutationObserver.observe(document.body, { |
| 34692 |
childList: true, |
| 34693 |
subtree: true |
| 34694 |
}); |
| 34695 |
} else { |
| 34696 |
resizeObserver == null ? void 0 : resizeObserver.disconnect(); |
| 34697 |
mutationObserver == null ? void 0 : mutationObserver.disconnect(); |
| 34698 |
} |
| 34699 |
}, [element]); |
| 34700 |
return rect; |
| 34701 |
} |
| 34702 |
function useRectDelta(rect) { |
| 34703 |
const initialRect = useInitialValue2(rect); |
| 34704 |
return getRectDelta(rect, initialRect); |
| 34705 |
} |
| 34706 |
var defaultValue$1 = []; |
| 34707 |
function useScrollableAncestors(node) { |
| 34708 |
const previousNode = (0, import_react40.useRef)(node); |
| 34709 |
const ancestors = useLazyMemo((previousValue) => { |
| 34710 |
if (!node) { |
| 34711 |
return defaultValue$1; |
| 34712 |
} |
| 34713 |
if (previousValue && previousValue !== defaultValue$1 && node && previousNode.current && node.parentNode === previousNode.current.parentNode) { |
| 34714 |
return previousValue; |
| 34715 |
} |
| 34716 |
return getScrollableAncestors(node); |
| 34717 |
}, [node]); |
| 34718 |
(0, import_react40.useEffect)(() => { |
| 34719 |
previousNode.current = node; |
| 34720 |
}, [node]); |
| 34721 |
return ancestors; |
| 34722 |
} |
| 34723 |
function useScrollOffsets(elements) { |
| 34724 |
const [scrollCoordinates, setScrollCoordinates] = (0, import_react40.useState)(null); |
| 34725 |
const prevElements = (0, import_react40.useRef)(elements); |
| 34726 |
const handleScroll = (0, import_react40.useCallback)((event) => { |
| 34727 |
const scrollingElement = getScrollableElement(event.target); |
| 34728 |
if (!scrollingElement) { |
| 34729 |
return; |
| 34730 |
} |
| 34731 |
setScrollCoordinates((scrollCoordinates2) => { |
| 34732 |
if (!scrollCoordinates2) { |
| 34733 |
return null; |
| 34734 |
} |
| 34735 |
scrollCoordinates2.set(scrollingElement, getScrollCoordinates(scrollingElement)); |
| 34736 |
return new Map(scrollCoordinates2); |
| 34737 |
}); |
| 34738 |
}, []); |
| 34739 |
(0, import_react40.useEffect)(() => { |
| 34740 |
const previousElements = prevElements.current; |
| 34741 |
if (elements !== previousElements) { |
| 34742 |
cleanup(previousElements); |
| 34743 |
const entries = elements.map((element) => { |
| 34744 |
const scrollableElement = getScrollableElement(element); |
| 34745 |
if (scrollableElement) { |
| 34746 |
scrollableElement.addEventListener("scroll", handleScroll, { |
| 34747 |
passive: true |
| 34748 |
}); |
| 34749 |
return [scrollableElement, getScrollCoordinates(scrollableElement)]; |
| 34750 |
} |
| 34751 |
return null; |
| 34752 |
}).filter((entry) => entry != null); |
| 34753 |
setScrollCoordinates(entries.length ? new Map(entries) : null); |
| 34754 |
prevElements.current = elements; |
| 34755 |
} |
| 34756 |
return () => { |
| 34757 |
cleanup(elements); |
| 34758 |
cleanup(previousElements); |
| 34759 |
}; |
| 34760 |
function cleanup(elements2) { |
| 34761 |
elements2.forEach((element) => { |
| 34762 |
const scrollableElement = getScrollableElement(element); |
| 34763 |
scrollableElement == null ? void 0 : scrollableElement.removeEventListener("scroll", handleScroll); |
| 34764 |
}); |
| 34765 |
} |
| 34766 |
}, [handleScroll, elements]); |
| 34767 |
return (0, import_react40.useMemo)(() => { |
| 34768 |
if (elements.length) { |
| 34769 |
return scrollCoordinates ? Array.from(scrollCoordinates.values()).reduce((acc, coordinates) => add(acc, coordinates), defaultCoordinates) : getScrollOffsets(elements); |
| 34770 |
} |
| 34771 |
return defaultCoordinates; |
| 34772 |
}, [elements, scrollCoordinates]); |
| 34773 |
} |
| 34774 |
function useScrollOffsetsDelta(scrollOffsets, dependencies) { |
| 34775 |
if (dependencies === void 0) { |
| 34776 |
dependencies = []; |
| 34777 |
} |
| 34778 |
const initialScrollOffsets = (0, import_react40.useRef)(null); |
| 34779 |
(0, import_react40.useEffect)( |
| 34780 |
() => { |
| 34781 |
initialScrollOffsets.current = null; |
| 34782 |
}, |
| 34783 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34784 |
dependencies |
| 34785 |
); |
| 34786 |
(0, import_react40.useEffect)(() => { |
| 34787 |
const hasScrollOffsets = scrollOffsets !== defaultCoordinates; |
| 34788 |
if (hasScrollOffsets && !initialScrollOffsets.current) { |
| 34789 |
initialScrollOffsets.current = scrollOffsets; |
| 34790 |
} |
| 34791 |
if (!hasScrollOffsets && initialScrollOffsets.current) { |
| 34792 |
initialScrollOffsets.current = null; |
| 34793 |
} |
| 34794 |
}, [scrollOffsets]); |
| 34795 |
return initialScrollOffsets.current ? subtract(scrollOffsets, initialScrollOffsets.current) : defaultCoordinates; |
| 34796 |
} |
| 34797 |
function useSensorSetup(sensors) { |
| 34798 |
(0, import_react40.useEffect)( |
| 34799 |
() => { |
| 34800 |
if (!canUseDOM2) { |
| 34801 |
return; |
| 34802 |
} |
| 34803 |
const teardownFns = sensors.map((_ref) => { |
| 34804 |
let { |
| 34805 |
sensor |
| 34806 |
} = _ref; |
| 34807 |
return sensor.setup == null ? void 0 : sensor.setup(); |
| 34808 |
}); |
| 34809 |
return () => { |
| 34810 |
for (const teardown of teardownFns) { |
| 34811 |
teardown == null ? void 0 : teardown(); |
| 34812 |
} |
| 34813 |
}; |
| 34814 |
}, |
| 34815 |
// TO-DO: Sensors length could theoretically change which would not be a valid dependency |
| 34816 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 34817 |
sensors.map((_ref2) => { |
| 34818 |
let { |
| 34819 |
sensor |
| 34820 |
} = _ref2; |
| 34821 |
return sensor; |
| 34822 |
}) |
| 34823 |
); |
| 34824 |
} |
| 34825 |
function useSyntheticListeners(listeners, id) { |
| 34826 |
return (0, import_react40.useMemo)(() => { |
| 34827 |
return listeners.reduce((acc, _ref) => { |
| 34828 |
let { |
| 34829 |
eventName, |
| 34830 |
handler |
| 34831 |
} = _ref; |
| 34832 |
acc[eventName] = (event) => { |
| 34833 |
handler(event, id); |
| 34834 |
}; |
| 34835 |
return acc; |
| 34836 |
}, {}); |
| 34837 |
}, [listeners, id]); |
| 34838 |
} |
| 34839 |
function useWindowRect(element) { |
| 34840 |
return (0, import_react40.useMemo)(() => element ? getWindowClientRect(element) : null, [element]); |
| 34841 |
} |
| 34842 |
var defaultValue$2 = []; |
| 34843 |
function useRects(elements, measure) { |
| 34844 |
if (measure === void 0) { |
| 34845 |
measure = getClientRect; |
| 34846 |
} |
| 34847 |
const [firstElement] = elements; |
| 34848 |
const windowRect = useWindowRect(firstElement ? getWindow3(firstElement) : null); |
| 34849 |
const [rects, setRects] = (0, import_react40.useState)(defaultValue$2); |
| 34850 |
function measureRects() { |
| 34851 |
setRects(() => { |
| 34852 |
if (!elements.length) { |
| 34853 |
return defaultValue$2; |
| 34854 |
} |
| 34855 |
return elements.map((element) => isDocumentScrollingElement(element) ? windowRect : new Rect(measure(element), element)); |
| 34856 |
}); |
| 34857 |
} |
| 34858 |
const resizeObserver = useResizeObserver2({ |
| 34859 |
callback: measureRects |
| 34860 |
}); |
| 34861 |
useIsomorphicLayoutEffect(() => { |
| 34862 |
resizeObserver == null ? void 0 : resizeObserver.disconnect(); |
| 34863 |
measureRects(); |
| 34864 |
elements.forEach((element) => resizeObserver == null ? void 0 : resizeObserver.observe(element)); |
| 34865 |
}, [elements]); |
| 34866 |
return rects; |
| 34867 |
} |
| 34868 |
function getMeasurableNode(node) { |
| 34869 |
if (!node) { |
| 34870 |
return null; |
| 34871 |
} |
| 34872 |
if (node.children.length > 1) { |
| 34873 |
return node; |
| 34874 |
} |
| 34875 |
const firstChild = node.children[0]; |
| 34876 |
return isHTMLElement2(firstChild) ? firstChild : node; |
| 34877 |
} |
| 34878 |
function useDragOverlayMeasuring(_ref) { |
| 34879 |
let { |
| 34880 |
measure |
| 34881 |
} = _ref; |
| 34882 |
const [rect, setRect] = (0, import_react40.useState)(null); |
| 34883 |
const handleResize = (0, import_react40.useCallback)((entries) => { |
| 34884 |
for (const { |
| 34885 |
target |
| 34886 |
} of entries) { |
| 34887 |
if (isHTMLElement2(target)) { |
| 34888 |
setRect((rect2) => { |
| 34889 |
const newRect = measure(target); |
| 34890 |
return rect2 ? { |
| 34891 |
...rect2, |
| 34892 |
width: newRect.width, |
| 34893 |
height: newRect.height |
| 34894 |
} : newRect; |
| 34895 |
}); |
| 34896 |
break; |
| 34897 |
} |
| 34898 |
} |
| 34899 |
}, [measure]); |
| 34900 |
const resizeObserver = useResizeObserver2({ |
| 34901 |
callback: handleResize |
| 34902 |
}); |
| 34903 |
const handleNodeChange = (0, import_react40.useCallback)((element) => { |
| 34904 |
const node = getMeasurableNode(element); |
| 34905 |
resizeObserver == null ? void 0 : resizeObserver.disconnect(); |
| 34906 |
if (node) { |
| 34907 |
resizeObserver == null ? void 0 : resizeObserver.observe(node); |
| 34908 |
} |
| 34909 |
setRect(node ? measure(node) : null); |
| 34910 |
}, [measure, resizeObserver]); |
| 34911 |
const [nodeRef, setRef2] = useNodeRef(handleNodeChange); |
| 34912 |
return (0, import_react40.useMemo)(() => ({ |
| 34913 |
nodeRef, |
| 34914 |
rect, |
| 34915 |
setRef: setRef2 |
| 34916 |
}), [rect, nodeRef, setRef2]); |
| 34917 |
} |
| 34918 |
var defaultSensors = [{ |
| 34919 |
sensor: PointerSensor, |
| 34920 |
options: {} |
| 34921 |
}, { |
| 34922 |
sensor: KeyboardSensor, |
| 34923 |
options: {} |
| 34924 |
}]; |
| 34925 |
var defaultData = { |
| 34926 |
current: {} |
| 34927 |
}; |
| 34928 |
var defaultMeasuringConfiguration = { |
| 34929 |
draggable: { |
| 34930 |
measure: getTransformAgnosticClientRect |
| 34931 |
}, |
| 34932 |
droppable: { |
| 34933 |
measure: getTransformAgnosticClientRect, |
| 34934 |
strategy: MeasuringStrategy.WhileDragging, |
| 34935 |
frequency: MeasuringFrequency.Optimized |
| 34936 |
}, |
| 34937 |
dragOverlay: { |
| 34938 |
measure: getClientRect |
| 34939 |
} |
| 34940 |
}; |
| 34941 |
var DroppableContainersMap = class extends Map { |
| 34942 |
get(id) { |
| 34943 |
var _super$get; |
| 34944 |
return id != null ? (_super$get = super.get(id)) != null ? _super$get : void 0 : void 0; |
| 34945 |
} |
| 34946 |
toArray() { |
| 34947 |
return Array.from(this.values()); |
| 34948 |
} |
| 34949 |
getEnabled() { |
| 34950 |
return this.toArray().filter((_ref) => { |
| 34951 |
let { |
| 34952 |
disabled: disabled2 |
| 34953 |
} = _ref; |
| 34954 |
return !disabled2; |
| 34955 |
}); |
| 34956 |
} |
| 34957 |
getNodeFor(id) { |
| 34958 |
var _this$get$node$curren, _this$get; |
| 34959 |
return (_this$get$node$curren = (_this$get = this.get(id)) == null ? void 0 : _this$get.node.current) != null ? _this$get$node$curren : void 0; |
| 34960 |
} |
| 34961 |
}; |
| 34962 |
var defaultPublicContext = { |
| 34963 |
activatorEvent: null, |
| 34964 |
active: null, |
| 34965 |
activeNode: null, |
| 34966 |
activeNodeRect: null, |
| 34967 |
collisions: null, |
| 34968 |
containerNodeRect: null, |
| 34969 |
draggableNodes: /* @__PURE__ */ new Map(), |
| 34970 |
droppableRects: /* @__PURE__ */ new Map(), |
| 34971 |
droppableContainers: /* @__PURE__ */ new DroppableContainersMap(), |
| 34972 |
over: null, |
| 34973 |
dragOverlay: { |
| 34974 |
nodeRef: { |
| 34975 |
current: null |
| 34976 |
}, |
| 34977 |
rect: null, |
| 34978 |
setRef: noop6 |
| 34979 |
}, |
| 34980 |
scrollableAncestors: [], |
| 34981 |
scrollableAncestorRects: [], |
| 34982 |
measuringConfiguration: defaultMeasuringConfiguration, |
| 34983 |
measureDroppableContainers: noop6, |
| 34984 |
windowRect: null, |
| 34985 |
measuringScheduled: false |
| 34986 |
}; |
| 34987 |
var defaultInternalContext = { |
| 34988 |
activatorEvent: null, |
| 34989 |
activators: [], |
| 34990 |
active: null, |
| 34991 |
activeNodeRect: null, |
| 34992 |
ariaDescribedById: { |
| 34993 |
draggable: "" |
| 34994 |
}, |
| 34995 |
dispatch: noop6, |
| 34996 |
draggableNodes: /* @__PURE__ */ new Map(), |
| 34997 |
over: null, |
| 34998 |
measureDroppableContainers: noop6 |
| 34999 |
}; |
| 35000 |
var InternalContext = /* @__PURE__ */ (0, import_react40.createContext)(defaultInternalContext); |
| 35001 |
var PublicContext = /* @__PURE__ */ (0, import_react40.createContext)(defaultPublicContext); |
| 35002 |
function getInitialState() { |
| 35003 |
return { |
| 35004 |
draggable: { |
| 35005 |
active: null, |
| 35006 |
initialCoordinates: { |
| 35007 |
x: 0, |
| 35008 |
y: 0 |
| 35009 |
}, |
| 35010 |
nodes: /* @__PURE__ */ new Map(), |
| 35011 |
translate: { |
| 35012 |
x: 0, |
| 35013 |
y: 0 |
| 35014 |
} |
| 35015 |
}, |
| 35016 |
droppable: { |
| 35017 |
containers: new DroppableContainersMap() |
| 35018 |
} |
| 35019 |
}; |
| 35020 |
} |
| 35021 |
function reducer(state, action) { |
| 35022 |
switch (action.type) { |
| 35023 |
case Action2.DragStart: |
| 35024 |
return { |
| 35025 |
...state, |
| 35026 |
draggable: { |
| 35027 |
...state.draggable, |
| 35028 |
initialCoordinates: action.initialCoordinates, |
| 35029 |
active: action.active |
| 35030 |
} |
| 35031 |
}; |
| 35032 |
case Action2.DragMove: |
| 35033 |
if (state.draggable.active == null) { |
| 35034 |
return state; |
| 35035 |
} |
| 35036 |
return { |
| 35037 |
...state, |
| 35038 |
draggable: { |
| 35039 |
...state.draggable, |
| 35040 |
translate: { |
| 35041 |
x: action.coordinates.x - state.draggable.initialCoordinates.x, |
| 35042 |
y: action.coordinates.y - state.draggable.initialCoordinates.y |
| 35043 |
} |
| 35044 |
} |
| 35045 |
}; |
| 35046 |
case Action2.DragEnd: |
| 35047 |
case Action2.DragCancel: |
| 35048 |
return { |
| 35049 |
...state, |
| 35050 |
draggable: { |
| 35051 |
...state.draggable, |
| 35052 |
active: null, |
| 35053 |
initialCoordinates: { |
| 35054 |
x: 0, |
| 35055 |
y: 0 |
| 35056 |
}, |
| 35057 |
translate: { |
| 35058 |
x: 0, |
| 35059 |
y: 0 |
| 35060 |
} |
| 35061 |
} |
| 35062 |
}; |
| 35063 |
case Action2.RegisterDroppable: { |
| 35064 |
const { |
| 35065 |
element |
| 35066 |
} = action; |
| 35067 |
const { |
| 35068 |
id |
| 35069 |
} = element; |
| 35070 |
const containers = new DroppableContainersMap(state.droppable.containers); |
| 35071 |
containers.set(id, element); |
| 35072 |
return { |
| 35073 |
...state, |
| 35074 |
droppable: { |
| 35075 |
...state.droppable, |
| 35076 |
containers |
| 35077 |
} |
| 35078 |
}; |
| 35079 |
} |
| 35080 |
case Action2.SetDroppableDisabled: { |
| 35081 |
const { |
| 35082 |
id, |
| 35083 |
key: key2, |
| 35084 |
disabled: disabled2 |
| 35085 |
} = action; |
| 35086 |
const element = state.droppable.containers.get(id); |
| 35087 |
if (!element || key2 !== element.key) { |
| 35088 |
return state; |
| 35089 |
} |
| 35090 |
const containers = new DroppableContainersMap(state.droppable.containers); |
| 35091 |
containers.set(id, { |
| 35092 |
...element, |
| 35093 |
disabled: disabled2 |
| 35094 |
}); |
| 35095 |
return { |
| 35096 |
...state, |
| 35097 |
droppable: { |
| 35098 |
...state.droppable, |
| 35099 |
containers |
| 35100 |
} |
| 35101 |
}; |
| 35102 |
} |
| 35103 |
case Action2.UnregisterDroppable: { |
| 35104 |
const { |
| 35105 |
id, |
| 35106 |
key: key2 |
| 35107 |
} = action; |
| 35108 |
const element = state.droppable.containers.get(id); |
| 35109 |
if (!element || key2 !== element.key) { |
| 35110 |
return state; |
| 35111 |
} |
| 35112 |
const containers = new DroppableContainersMap(state.droppable.containers); |
| 35113 |
containers.delete(id); |
| 35114 |
return { |
| 35115 |
...state, |
| 35116 |
droppable: { |
| 35117 |
...state.droppable, |
| 35118 |
containers |
| 35119 |
} |
| 35120 |
}; |
| 35121 |
} |
| 35122 |
default: { |
| 35123 |
return state; |
| 35124 |
} |
| 35125 |
} |
| 35126 |
} |
| 35127 |
function RestoreFocus(_ref) { |
| 35128 |
let { |
| 35129 |
disabled: disabled2 |
| 35130 |
} = _ref; |
| 35131 |
const { |
| 35132 |
active, |
| 35133 |
activatorEvent, |
| 35134 |
draggableNodes |
| 35135 |
} = (0, import_react40.useContext)(InternalContext); |
| 35136 |
const previousActivatorEvent = usePrevious2(activatorEvent); |
| 35137 |
const previousActiveId = usePrevious2(active == null ? void 0 : active.id); |
| 35138 |
(0, import_react40.useEffect)(() => { |
| 35139 |
if (disabled2) { |
| 35140 |
return; |
| 35141 |
} |
| 35142 |
if (!activatorEvent && previousActivatorEvent && previousActiveId != null) { |
| 35143 |
if (!isKeyboardEvent(previousActivatorEvent)) { |
| 35144 |
return; |
| 35145 |
} |
| 35146 |
if (document.activeElement === previousActivatorEvent.target) { |
| 35147 |
return; |
| 35148 |
} |
| 35149 |
const draggableNode = draggableNodes.get(previousActiveId); |
| 35150 |
if (!draggableNode) { |
| 35151 |
return; |
| 35152 |
} |
| 35153 |
const { |
| 35154 |
activatorNode, |
| 35155 |
node |
| 35156 |
} = draggableNode; |
| 35157 |
if (!activatorNode.current && !node.current) { |
| 35158 |
return; |
| 35159 |
} |
| 35160 |
requestAnimationFrame(() => { |
| 35161 |
for (const element of [activatorNode.current, node.current]) { |
| 35162 |
if (!element) { |
| 35163 |
continue; |
| 35164 |
} |
| 35165 |
const focusableNode = findFirstFocusableNode(element); |
| 35166 |
if (focusableNode) { |
| 35167 |
focusableNode.focus(); |
| 35168 |
break; |
| 35169 |
} |
| 35170 |
} |
| 35171 |
}); |
| 35172 |
} |
| 35173 |
}, [activatorEvent, disabled2, draggableNodes, previousActiveId, previousActivatorEvent]); |
| 35174 |
return null; |
| 35175 |
} |
| 35176 |
function applyModifiers(modifiers, _ref) { |
| 35177 |
let { |
| 35178 |
transform, |
| 35179 |
...args |
| 35180 |
} = _ref; |
| 35181 |
return modifiers != null && modifiers.length ? modifiers.reduce((accumulator, modifier) => { |
| 35182 |
return modifier({ |
| 35183 |
transform: accumulator, |
| 35184 |
...args |
| 35185 |
}); |
| 35186 |
}, transform) : transform; |
| 35187 |
} |
| 35188 |
function useMeasuringConfiguration(config) { |
| 35189 |
return (0, import_react40.useMemo)( |
| 35190 |
() => ({ |
| 35191 |
draggable: { |
| 35192 |
...defaultMeasuringConfiguration.draggable, |
| 35193 |
...config == null ? void 0 : config.draggable |
| 35194 |
}, |
| 35195 |
droppable: { |
| 35196 |
...defaultMeasuringConfiguration.droppable, |
| 35197 |
...config == null ? void 0 : config.droppable |
| 35198 |
}, |
| 35199 |
dragOverlay: { |
| 35200 |
...defaultMeasuringConfiguration.dragOverlay, |
| 35201 |
...config == null ? void 0 : config.dragOverlay |
| 35202 |
} |
| 35203 |
}), |
| 35204 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35205 |
[config == null ? void 0 : config.draggable, config == null ? void 0 : config.droppable, config == null ? void 0 : config.dragOverlay] |
| 35206 |
); |
| 35207 |
} |
| 35208 |
function useLayoutShiftScrollCompensation(_ref) { |
| 35209 |
let { |
| 35210 |
activeNode, |
| 35211 |
measure, |
| 35212 |
initialRect, |
| 35213 |
config = true |
| 35214 |
} = _ref; |
| 35215 |
const initialized = (0, import_react40.useRef)(false); |
| 35216 |
const { |
| 35217 |
x: x2, |
| 35218 |
y: y2 |
| 35219 |
} = typeof config === "boolean" ? { |
| 35220 |
x: config, |
| 35221 |
y: config |
| 35222 |
} : config; |
| 35223 |
useIsomorphicLayoutEffect(() => { |
| 35224 |
const disabled2 = !x2 && !y2; |
| 35225 |
if (disabled2 || !activeNode) { |
| 35226 |
initialized.current = false; |
| 35227 |
return; |
| 35228 |
} |
| 35229 |
if (initialized.current || !initialRect) { |
| 35230 |
return; |
| 35231 |
} |
| 35232 |
const node = activeNode == null ? void 0 : activeNode.node.current; |
| 35233 |
if (!node || node.isConnected === false) { |
| 35234 |
return; |
| 35235 |
} |
| 35236 |
const rect = measure(node); |
| 35237 |
const rectDelta = getRectDelta(rect, initialRect); |
| 35238 |
if (!x2) { |
| 35239 |
rectDelta.x = 0; |
| 35240 |
} |
| 35241 |
if (!y2) { |
| 35242 |
rectDelta.y = 0; |
| 35243 |
} |
| 35244 |
initialized.current = true; |
| 35245 |
if (Math.abs(rectDelta.x) > 0 || Math.abs(rectDelta.y) > 0) { |
| 35246 |
const firstScrollableAncestor = getFirstScrollableAncestor(node); |
| 35247 |
if (firstScrollableAncestor) { |
| 35248 |
firstScrollableAncestor.scrollBy({ |
| 35249 |
top: rectDelta.y, |
| 35250 |
left: rectDelta.x |
| 35251 |
}); |
| 35252 |
} |
| 35253 |
} |
| 35254 |
}, [activeNode, x2, y2, initialRect, measure]); |
| 35255 |
} |
| 35256 |
var ActiveDraggableContext = /* @__PURE__ */ (0, import_react40.createContext)({ |
| 35257 |
...defaultCoordinates, |
| 35258 |
scaleX: 1, |
| 35259 |
scaleY: 1 |
| 35260 |
}); |
| 35261 |
var Status; |
| 35262 |
(function(Status2) { |
| 35263 |
Status2[Status2["Uninitialized"] = 0] = "Uninitialized"; |
| 35264 |
Status2[Status2["Initializing"] = 1] = "Initializing"; |
| 35265 |
Status2[Status2["Initialized"] = 2] = "Initialized"; |
| 35266 |
})(Status || (Status = {})); |
| 35267 |
var DndContext = /* @__PURE__ */ (0, import_react40.memo)(function DndContext2(_ref) { |
| 35268 |
var _sensorContext$curren, _dragOverlay$nodeRef$, _dragOverlay$rect, _over$rect; |
| 35269 |
let { |
| 35270 |
id, |
| 35271 |
accessibility, |
| 35272 |
autoScroll = true, |
| 35273 |
children, |
| 35274 |
sensors = defaultSensors, |
| 35275 |
collisionDetection = rectIntersection, |
| 35276 |
measuring, |
| 35277 |
modifiers, |
| 35278 |
...props |
| 35279 |
} = _ref; |
| 35280 |
const store = (0, import_react40.useReducer)(reducer, void 0, getInitialState); |
| 35281 |
const [state, dispatch2] = store; |
| 35282 |
const [dispatchMonitorEvent, registerMonitorListener] = useDndMonitorProvider(); |
| 35283 |
const [status, setStatus] = (0, import_react40.useState)(Status.Uninitialized); |
| 35284 |
const isInitialized = status === Status.Initialized; |
| 35285 |
const { |
| 35286 |
draggable: { |
| 35287 |
active: activeId, |
| 35288 |
nodes: draggableNodes, |
| 35289 |
translate |
| 35290 |
}, |
| 35291 |
droppable: { |
| 35292 |
containers: droppableContainers |
| 35293 |
} |
| 35294 |
} = state; |
| 35295 |
const node = activeId != null ? draggableNodes.get(activeId) : null; |
| 35296 |
const activeRects = (0, import_react40.useRef)({ |
| 35297 |
initial: null, |
| 35298 |
translated: null |
| 35299 |
}); |
| 35300 |
const active = (0, import_react40.useMemo)(() => { |
| 35301 |
var _node$data; |
| 35302 |
return activeId != null ? { |
| 35303 |
id: activeId, |
| 35304 |
// It's possible for the active node to unmount while dragging |
| 35305 |
data: (_node$data = node == null ? void 0 : node.data) != null ? _node$data : defaultData, |
| 35306 |
rect: activeRects |
| 35307 |
} : null; |
| 35308 |
}, [activeId, node]); |
| 35309 |
const activeRef = (0, import_react40.useRef)(null); |
| 35310 |
const [activeSensor, setActiveSensor] = (0, import_react40.useState)(null); |
| 35311 |
const [activatorEvent, setActivatorEvent] = (0, import_react40.useState)(null); |
| 35312 |
const latestProps = useLatestValue(props, Object.values(props)); |
| 35313 |
const draggableDescribedById = useUniqueId("DndDescribedBy", id); |
| 35314 |
const enabledDroppableContainers = (0, import_react40.useMemo)(() => droppableContainers.getEnabled(), [droppableContainers]); |
| 35315 |
const measuringConfiguration = useMeasuringConfiguration(measuring); |
| 35316 |
const { |
| 35317 |
droppableRects, |
| 35318 |
measureDroppableContainers, |
| 35319 |
measuringScheduled |
| 35320 |
} = useDroppableMeasuring(enabledDroppableContainers, { |
| 35321 |
dragging: isInitialized, |
| 35322 |
dependencies: [translate.x, translate.y], |
| 35323 |
config: measuringConfiguration.droppable |
| 35324 |
}); |
| 35325 |
const activeNode = useCachedNode(draggableNodes, activeId); |
| 35326 |
const activationCoordinates = (0, import_react40.useMemo)(() => activatorEvent ? getEventCoordinates(activatorEvent) : null, [activatorEvent]); |
| 35327 |
const autoScrollOptions = getAutoScrollerOptions(); |
| 35328 |
const initialActiveNodeRect = useInitialRect(activeNode, measuringConfiguration.draggable.measure); |
| 35329 |
useLayoutShiftScrollCompensation({ |
| 35330 |
activeNode: activeId != null ? draggableNodes.get(activeId) : null, |
| 35331 |
config: autoScrollOptions.layoutShiftCompensation, |
| 35332 |
initialRect: initialActiveNodeRect, |
| 35333 |
measure: measuringConfiguration.draggable.measure |
| 35334 |
}); |
| 35335 |
const activeNodeRect = useRect(activeNode, measuringConfiguration.draggable.measure, initialActiveNodeRect); |
| 35336 |
const containerNodeRect = useRect(activeNode ? activeNode.parentElement : null); |
| 35337 |
const sensorContext = (0, import_react40.useRef)({ |
| 35338 |
activatorEvent: null, |
| 35339 |
active: null, |
| 35340 |
activeNode, |
| 35341 |
collisionRect: null, |
| 35342 |
collisions: null, |
| 35343 |
droppableRects, |
| 35344 |
draggableNodes, |
| 35345 |
draggingNode: null, |
| 35346 |
draggingNodeRect: null, |
| 35347 |
droppableContainers, |
| 35348 |
over: null, |
| 35349 |
scrollableAncestors: [], |
| 35350 |
scrollAdjustedTranslate: null |
| 35351 |
}); |
| 35352 |
const overNode = droppableContainers.getNodeFor((_sensorContext$curren = sensorContext.current.over) == null ? void 0 : _sensorContext$curren.id); |
| 35353 |
const dragOverlay = useDragOverlayMeasuring({ |
| 35354 |
measure: measuringConfiguration.dragOverlay.measure |
| 35355 |
}); |
| 35356 |
const draggingNode = (_dragOverlay$nodeRef$ = dragOverlay.nodeRef.current) != null ? _dragOverlay$nodeRef$ : activeNode; |
| 35357 |
const draggingNodeRect = isInitialized ? (_dragOverlay$rect = dragOverlay.rect) != null ? _dragOverlay$rect : activeNodeRect : null; |
| 35358 |
const usesDragOverlay = Boolean(dragOverlay.nodeRef.current && dragOverlay.rect); |
| 35359 |
const nodeRectDelta = useRectDelta(usesDragOverlay ? null : activeNodeRect); |
| 35360 |
const windowRect = useWindowRect(draggingNode ? getWindow3(draggingNode) : null); |
| 35361 |
const scrollableAncestors = useScrollableAncestors(isInitialized ? overNode != null ? overNode : activeNode : null); |
| 35362 |
const scrollableAncestorRects = useRects(scrollableAncestors); |
| 35363 |
const modifiedTranslate = applyModifiers(modifiers, { |
| 35364 |
transform: { |
| 35365 |
x: translate.x - nodeRectDelta.x, |
| 35366 |
y: translate.y - nodeRectDelta.y, |
| 35367 |
scaleX: 1, |
| 35368 |
scaleY: 1 |
| 35369 |
}, |
| 35370 |
activatorEvent, |
| 35371 |
active, |
| 35372 |
activeNodeRect, |
| 35373 |
containerNodeRect, |
| 35374 |
draggingNodeRect, |
| 35375 |
over: sensorContext.current.over, |
| 35376 |
overlayNodeRect: dragOverlay.rect, |
| 35377 |
scrollableAncestors, |
| 35378 |
scrollableAncestorRects, |
| 35379 |
windowRect |
| 35380 |
}); |
| 35381 |
const pointerCoordinates = activationCoordinates ? add(activationCoordinates, translate) : null; |
| 35382 |
const scrollOffsets = useScrollOffsets(scrollableAncestors); |
| 35383 |
const scrollAdjustment = useScrollOffsetsDelta(scrollOffsets); |
| 35384 |
const activeNodeScrollDelta = useScrollOffsetsDelta(scrollOffsets, [activeNodeRect]); |
| 35385 |
const scrollAdjustedTranslate = add(modifiedTranslate, scrollAdjustment); |
| 35386 |
const collisionRect = draggingNodeRect ? getAdjustedRect(draggingNodeRect, modifiedTranslate) : null; |
| 35387 |
const collisions = active && collisionRect ? collisionDetection({ |
| 35388 |
active, |
| 35389 |
collisionRect, |
| 35390 |
droppableRects, |
| 35391 |
droppableContainers: enabledDroppableContainers, |
| 35392 |
pointerCoordinates |
| 35393 |
}) : null; |
| 35394 |
const overId = getFirstCollision(collisions, "id"); |
| 35395 |
const [over, setOver] = (0, import_react40.useState)(null); |
| 35396 |
const appliedTranslate = usesDragOverlay ? modifiedTranslate : add(modifiedTranslate, activeNodeScrollDelta); |
| 35397 |
const transform = adjustScale(appliedTranslate, (_over$rect = over == null ? void 0 : over.rect) != null ? _over$rect : null, activeNodeRect); |
| 35398 |
const activeSensorRef = (0, import_react40.useRef)(null); |
| 35399 |
const instantiateSensor = (0, import_react40.useCallback)( |
| 35400 |
(event, _ref2) => { |
| 35401 |
let { |
| 35402 |
sensor: Sensor, |
| 35403 |
options |
| 35404 |
} = _ref2; |
| 35405 |
if (activeRef.current == null) { |
| 35406 |
return; |
| 35407 |
} |
| 35408 |
const activeNode2 = draggableNodes.get(activeRef.current); |
| 35409 |
if (!activeNode2) { |
| 35410 |
return; |
| 35411 |
} |
| 35412 |
const activatorEvent2 = event.nativeEvent; |
| 35413 |
const sensorInstance = new Sensor({ |
| 35414 |
active: activeRef.current, |
| 35415 |
activeNode: activeNode2, |
| 35416 |
event: activatorEvent2, |
| 35417 |
options, |
| 35418 |
// Sensors need to be instantiated with refs for arguments that change over time |
| 35419 |
// otherwise they are frozen in time with the stale arguments |
| 35420 |
context: sensorContext, |
| 35421 |
onAbort(id2) { |
| 35422 |
const draggableNode = draggableNodes.get(id2); |
| 35423 |
if (!draggableNode) { |
| 35424 |
return; |
| 35425 |
} |
| 35426 |
const { |
| 35427 |
onDragAbort |
| 35428 |
} = latestProps.current; |
| 35429 |
const event2 = { |
| 35430 |
id: id2 |
| 35431 |
}; |
| 35432 |
onDragAbort == null ? void 0 : onDragAbort(event2); |
| 35433 |
dispatchMonitorEvent({ |
| 35434 |
type: "onDragAbort", |
| 35435 |
event: event2 |
| 35436 |
}); |
| 35437 |
}, |
| 35438 |
onPending(id2, constraint, initialCoordinates, offset4) { |
| 35439 |
const draggableNode = draggableNodes.get(id2); |
| 35440 |
if (!draggableNode) { |
| 35441 |
return; |
| 35442 |
} |
| 35443 |
const { |
| 35444 |
onDragPending |
| 35445 |
} = latestProps.current; |
| 35446 |
const event2 = { |
| 35447 |
id: id2, |
| 35448 |
constraint, |
| 35449 |
initialCoordinates, |
| 35450 |
offset: offset4 |
| 35451 |
}; |
| 35452 |
onDragPending == null ? void 0 : onDragPending(event2); |
| 35453 |
dispatchMonitorEvent({ |
| 35454 |
type: "onDragPending", |
| 35455 |
event: event2 |
| 35456 |
}); |
| 35457 |
}, |
| 35458 |
onStart(initialCoordinates) { |
| 35459 |
const id2 = activeRef.current; |
| 35460 |
if (id2 == null) { |
| 35461 |
return; |
| 35462 |
} |
| 35463 |
const draggableNode = draggableNodes.get(id2); |
| 35464 |
if (!draggableNode) { |
| 35465 |
return; |
| 35466 |
} |
| 35467 |
const { |
| 35468 |
onDragStart |
| 35469 |
} = latestProps.current; |
| 35470 |
const event2 = { |
| 35471 |
activatorEvent: activatorEvent2, |
| 35472 |
active: { |
| 35473 |
id: id2, |
| 35474 |
data: draggableNode.data, |
| 35475 |
rect: activeRects |
| 35476 |
} |
| 35477 |
}; |
| 35478 |
(0, import_react_dom5.unstable_batchedUpdates)(() => { |
| 35479 |
onDragStart == null ? void 0 : onDragStart(event2); |
| 35480 |
setStatus(Status.Initializing); |
| 35481 |
dispatch2({ |
| 35482 |
type: Action2.DragStart, |
| 35483 |
initialCoordinates, |
| 35484 |
active: id2 |
| 35485 |
}); |
| 35486 |
dispatchMonitorEvent({ |
| 35487 |
type: "onDragStart", |
| 35488 |
event: event2 |
| 35489 |
}); |
| 35490 |
setActiveSensor(activeSensorRef.current); |
| 35491 |
setActivatorEvent(activatorEvent2); |
| 35492 |
}); |
| 35493 |
}, |
| 35494 |
onMove(coordinates) { |
| 35495 |
dispatch2({ |
| 35496 |
type: Action2.DragMove, |
| 35497 |
coordinates |
| 35498 |
}); |
| 35499 |
}, |
| 35500 |
onEnd: createHandler(Action2.DragEnd), |
| 35501 |
onCancel: createHandler(Action2.DragCancel) |
| 35502 |
}); |
| 35503 |
activeSensorRef.current = sensorInstance; |
| 35504 |
function createHandler(type) { |
| 35505 |
return async function handler() { |
| 35506 |
const { |
| 35507 |
active: active2, |
| 35508 |
collisions: collisions2, |
| 35509 |
over: over2, |
| 35510 |
scrollAdjustedTranslate: scrollAdjustedTranslate2 |
| 35511 |
} = sensorContext.current; |
| 35512 |
let event2 = null; |
| 35513 |
if (active2 && scrollAdjustedTranslate2) { |
| 35514 |
const { |
| 35515 |
cancelDrop |
| 35516 |
} = latestProps.current; |
| 35517 |
event2 = { |
| 35518 |
activatorEvent: activatorEvent2, |
| 35519 |
active: active2, |
| 35520 |
collisions: collisions2, |
| 35521 |
delta: scrollAdjustedTranslate2, |
| 35522 |
over: over2 |
| 35523 |
}; |
| 35524 |
if (type === Action2.DragEnd && typeof cancelDrop === "function") { |
| 35525 |
const shouldCancel = await Promise.resolve(cancelDrop(event2)); |
| 35526 |
if (shouldCancel) { |
| 35527 |
type = Action2.DragCancel; |
| 35528 |
} |
| 35529 |
} |
| 35530 |
} |
| 35531 |
activeRef.current = null; |
| 35532 |
(0, import_react_dom5.unstable_batchedUpdates)(() => { |
| 35533 |
dispatch2({ |
| 35534 |
type |
| 35535 |
}); |
| 35536 |
setStatus(Status.Uninitialized); |
| 35537 |
setOver(null); |
| 35538 |
setActiveSensor(null); |
| 35539 |
setActivatorEvent(null); |
| 35540 |
activeSensorRef.current = null; |
| 35541 |
const eventName = type === Action2.DragEnd ? "onDragEnd" : "onDragCancel"; |
| 35542 |
if (event2) { |
| 35543 |
const handler2 = latestProps.current[eventName]; |
| 35544 |
handler2 == null ? void 0 : handler2(event2); |
| 35545 |
dispatchMonitorEvent({ |
| 35546 |
type: eventName, |
| 35547 |
event: event2 |
| 35548 |
}); |
| 35549 |
} |
| 35550 |
}); |
| 35551 |
}; |
| 35552 |
} |
| 35553 |
}, |
| 35554 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35555 |
[draggableNodes] |
| 35556 |
); |
| 35557 |
const bindActivatorToSensorInstantiator = (0, import_react40.useCallback)((handler, sensor) => { |
| 35558 |
return (event, active2) => { |
| 35559 |
const nativeEvent = event.nativeEvent; |
| 35560 |
const activeDraggableNode = draggableNodes.get(active2); |
| 35561 |
if ( |
| 35562 |
// Another sensor is already instantiating |
| 35563 |
activeRef.current !== null || // No active draggable |
| 35564 |
!activeDraggableNode || // Event has already been captured |
| 35565 |
nativeEvent.dndKit || nativeEvent.defaultPrevented |
| 35566 |
) { |
| 35567 |
return; |
| 35568 |
} |
| 35569 |
const activationContext = { |
| 35570 |
active: activeDraggableNode |
| 35571 |
}; |
| 35572 |
const shouldActivate = handler(event, sensor.options, activationContext); |
| 35573 |
if (shouldActivate === true) { |
| 35574 |
nativeEvent.dndKit = { |
| 35575 |
capturedBy: sensor.sensor |
| 35576 |
}; |
| 35577 |
activeRef.current = active2; |
| 35578 |
instantiateSensor(event, sensor); |
| 35579 |
} |
| 35580 |
}; |
| 35581 |
}, [draggableNodes, instantiateSensor]); |
| 35582 |
const activators = useCombineActivators(sensors, bindActivatorToSensorInstantiator); |
| 35583 |
useSensorSetup(sensors); |
| 35584 |
useIsomorphicLayoutEffect(() => { |
| 35585 |
if (activeNodeRect && status === Status.Initializing) { |
| 35586 |
setStatus(Status.Initialized); |
| 35587 |
} |
| 35588 |
}, [activeNodeRect, status]); |
| 35589 |
(0, import_react40.useEffect)( |
| 35590 |
() => { |
| 35591 |
const { |
| 35592 |
onDragMove |
| 35593 |
} = latestProps.current; |
| 35594 |
const { |
| 35595 |
active: active2, |
| 35596 |
activatorEvent: activatorEvent2, |
| 35597 |
collisions: collisions2, |
| 35598 |
over: over2 |
| 35599 |
} = sensorContext.current; |
| 35600 |
if (!active2 || !activatorEvent2) { |
| 35601 |
return; |
| 35602 |
} |
| 35603 |
const event = { |
| 35604 |
active: active2, |
| 35605 |
activatorEvent: activatorEvent2, |
| 35606 |
collisions: collisions2, |
| 35607 |
delta: { |
| 35608 |
x: scrollAdjustedTranslate.x, |
| 35609 |
y: scrollAdjustedTranslate.y |
| 35610 |
}, |
| 35611 |
over: over2 |
| 35612 |
}; |
| 35613 |
(0, import_react_dom5.unstable_batchedUpdates)(() => { |
| 35614 |
onDragMove == null ? void 0 : onDragMove(event); |
| 35615 |
dispatchMonitorEvent({ |
| 35616 |
type: "onDragMove", |
| 35617 |
event |
| 35618 |
}); |
| 35619 |
}); |
| 35620 |
}, |
| 35621 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35622 |
[scrollAdjustedTranslate.x, scrollAdjustedTranslate.y] |
| 35623 |
); |
| 35624 |
(0, import_react40.useEffect)( |
| 35625 |
() => { |
| 35626 |
const { |
| 35627 |
active: active2, |
| 35628 |
activatorEvent: activatorEvent2, |
| 35629 |
collisions: collisions2, |
| 35630 |
droppableContainers: droppableContainers2, |
| 35631 |
scrollAdjustedTranslate: scrollAdjustedTranslate2 |
| 35632 |
} = sensorContext.current; |
| 35633 |
if (!active2 || activeRef.current == null || !activatorEvent2 || !scrollAdjustedTranslate2) { |
| 35634 |
return; |
| 35635 |
} |
| 35636 |
const { |
| 35637 |
onDragOver |
| 35638 |
} = latestProps.current; |
| 35639 |
const overContainer = droppableContainers2.get(overId); |
| 35640 |
const over2 = overContainer && overContainer.rect.current ? { |
| 35641 |
id: overContainer.id, |
| 35642 |
rect: overContainer.rect.current, |
| 35643 |
data: overContainer.data, |
| 35644 |
disabled: overContainer.disabled |
| 35645 |
} : null; |
| 35646 |
const event = { |
| 35647 |
active: active2, |
| 35648 |
activatorEvent: activatorEvent2, |
| 35649 |
collisions: collisions2, |
| 35650 |
delta: { |
| 35651 |
x: scrollAdjustedTranslate2.x, |
| 35652 |
y: scrollAdjustedTranslate2.y |
| 35653 |
}, |
| 35654 |
over: over2 |
| 35655 |
}; |
| 35656 |
(0, import_react_dom5.unstable_batchedUpdates)(() => { |
| 35657 |
setOver(over2); |
| 35658 |
onDragOver == null ? void 0 : onDragOver(event); |
| 35659 |
dispatchMonitorEvent({ |
| 35660 |
type: "onDragOver", |
| 35661 |
event |
| 35662 |
}); |
| 35663 |
}); |
| 35664 |
}, |
| 35665 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35666 |
[overId] |
| 35667 |
); |
| 35668 |
useIsomorphicLayoutEffect(() => { |
| 35669 |
sensorContext.current = { |
| 35670 |
activatorEvent, |
| 35671 |
active, |
| 35672 |
activeNode, |
| 35673 |
collisionRect, |
| 35674 |
collisions, |
| 35675 |
droppableRects, |
| 35676 |
draggableNodes, |
| 35677 |
draggingNode, |
| 35678 |
draggingNodeRect, |
| 35679 |
droppableContainers, |
| 35680 |
over, |
| 35681 |
scrollableAncestors, |
| 35682 |
scrollAdjustedTranslate |
| 35683 |
}; |
| 35684 |
activeRects.current = { |
| 35685 |
initial: draggingNodeRect, |
| 35686 |
translated: collisionRect |
| 35687 |
}; |
| 35688 |
}, [active, activeNode, collisions, collisionRect, draggableNodes, draggingNode, draggingNodeRect, droppableRects, droppableContainers, over, scrollableAncestors, scrollAdjustedTranslate]); |
| 35689 |
useAutoScroller({ |
| 35690 |
...autoScrollOptions, |
| 35691 |
delta: translate, |
| 35692 |
draggingRect: collisionRect, |
| 35693 |
pointerCoordinates, |
| 35694 |
scrollableAncestors, |
| 35695 |
scrollableAncestorRects |
| 35696 |
}); |
| 35697 |
const publicContext = (0, import_react40.useMemo)(() => { |
| 35698 |
const context = { |
| 35699 |
active, |
| 35700 |
activeNode, |
| 35701 |
activeNodeRect, |
| 35702 |
activatorEvent, |
| 35703 |
collisions, |
| 35704 |
containerNodeRect, |
| 35705 |
dragOverlay, |
| 35706 |
draggableNodes, |
| 35707 |
droppableContainers, |
| 35708 |
droppableRects, |
| 35709 |
over, |
| 35710 |
measureDroppableContainers, |
| 35711 |
scrollableAncestors, |
| 35712 |
scrollableAncestorRects, |
| 35713 |
measuringConfiguration, |
| 35714 |
measuringScheduled, |
| 35715 |
windowRect |
| 35716 |
}; |
| 35717 |
return context; |
| 35718 |
}, [active, activeNode, activeNodeRect, activatorEvent, collisions, containerNodeRect, dragOverlay, draggableNodes, droppableContainers, droppableRects, over, measureDroppableContainers, scrollableAncestors, scrollableAncestorRects, measuringConfiguration, measuringScheduled, windowRect]); |
| 35719 |
const internalContext = (0, import_react40.useMemo)(() => { |
| 35720 |
const context = { |
| 35721 |
activatorEvent, |
| 35722 |
activators, |
| 35723 |
active, |
| 35724 |
activeNodeRect, |
| 35725 |
ariaDescribedById: { |
| 35726 |
draggable: draggableDescribedById |
| 35727 |
}, |
| 35728 |
dispatch: dispatch2, |
| 35729 |
draggableNodes, |
| 35730 |
over, |
| 35731 |
measureDroppableContainers |
| 35732 |
}; |
| 35733 |
return context; |
| 35734 |
}, [activatorEvent, activators, active, activeNodeRect, dispatch2, draggableDescribedById, draggableNodes, over, measureDroppableContainers]); |
| 35735 |
return import_react40.default.createElement(DndMonitorContext.Provider, { |
| 35736 |
value: registerMonitorListener |
| 35737 |
}, import_react40.default.createElement(InternalContext.Provider, { |
| 35738 |
value: internalContext |
| 35739 |
}, import_react40.default.createElement(PublicContext.Provider, { |
| 35740 |
value: publicContext |
| 35741 |
}, import_react40.default.createElement(ActiveDraggableContext.Provider, { |
| 35742 |
value: transform |
| 35743 |
}, children)), import_react40.default.createElement(RestoreFocus, { |
| 35744 |
disabled: (accessibility == null ? void 0 : accessibility.restoreFocus) === false |
| 35745 |
})), import_react40.default.createElement(Accessibility, { |
| 35746 |
...accessibility, |
| 35747 |
hiddenTextDescribedById: draggableDescribedById |
| 35748 |
})); |
| 35749 |
function getAutoScrollerOptions() { |
| 35750 |
const activeSensorDisablesAutoscroll = (activeSensor == null ? void 0 : activeSensor.autoScrollEnabled) === false; |
| 35751 |
const autoScrollGloballyDisabled = typeof autoScroll === "object" ? autoScroll.enabled === false : autoScroll === false; |
| 35752 |
const enabled = isInitialized && !activeSensorDisablesAutoscroll && !autoScrollGloballyDisabled; |
| 35753 |
if (typeof autoScroll === "object") { |
| 35754 |
return { |
| 35755 |
...autoScroll, |
| 35756 |
enabled |
| 35757 |
}; |
| 35758 |
} |
| 35759 |
return { |
| 35760 |
enabled |
| 35761 |
}; |
| 35762 |
} |
| 35763 |
}); |
| 35764 |
var NullContext = /* @__PURE__ */ (0, import_react40.createContext)(null); |
| 35765 |
var defaultRole = "button"; |
| 35766 |
var ID_PREFIX = "Draggable"; |
| 35767 |
function useDraggable(_ref) { |
| 35768 |
let { |
| 35769 |
id, |
| 35770 |
data, |
| 35771 |
disabled: disabled2 = false, |
| 35772 |
attributes |
| 35773 |
} = _ref; |
| 35774 |
const key2 = useUniqueId(ID_PREFIX); |
| 35775 |
const { |
| 35776 |
activators, |
| 35777 |
activatorEvent, |
| 35778 |
active, |
| 35779 |
activeNodeRect, |
| 35780 |
ariaDescribedById, |
| 35781 |
draggableNodes, |
| 35782 |
over |
| 35783 |
} = (0, import_react40.useContext)(InternalContext); |
| 35784 |
const { |
| 35785 |
role = defaultRole, |
| 35786 |
roleDescription = "draggable", |
| 35787 |
tabIndex = 0 |
| 35788 |
} = attributes != null ? attributes : {}; |
| 35789 |
const isDragging = (active == null ? void 0 : active.id) === id; |
| 35790 |
const transform = (0, import_react40.useContext)(isDragging ? ActiveDraggableContext : NullContext); |
| 35791 |
const [node, setNodeRef] = useNodeRef(); |
| 35792 |
const [activatorNode, setActivatorNodeRef] = useNodeRef(); |
| 35793 |
const listeners = useSyntheticListeners(activators, id); |
| 35794 |
const dataRef = useLatestValue(data); |
| 35795 |
useIsomorphicLayoutEffect( |
| 35796 |
() => { |
| 35797 |
draggableNodes.set(id, { |
| 35798 |
id, |
| 35799 |
key: key2, |
| 35800 |
node, |
| 35801 |
activatorNode, |
| 35802 |
data: dataRef |
| 35803 |
}); |
| 35804 |
return () => { |
| 35805 |
const node2 = draggableNodes.get(id); |
| 35806 |
if (node2 && node2.key === key2) { |
| 35807 |
draggableNodes.delete(id); |
| 35808 |
} |
| 35809 |
}; |
| 35810 |
}, |
| 35811 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35812 |
[draggableNodes, id] |
| 35813 |
); |
| 35814 |
const memoizedAttributes = (0, import_react40.useMemo)(() => ({ |
| 35815 |
role, |
| 35816 |
tabIndex, |
| 35817 |
"aria-disabled": disabled2, |
| 35818 |
"aria-pressed": isDragging && role === defaultRole ? true : void 0, |
| 35819 |
"aria-roledescription": roleDescription, |
| 35820 |
"aria-describedby": ariaDescribedById.draggable |
| 35821 |
}), [disabled2, role, tabIndex, isDragging, roleDescription, ariaDescribedById.draggable]); |
| 35822 |
return { |
| 35823 |
active, |
| 35824 |
activatorEvent, |
| 35825 |
activeNodeRect, |
| 35826 |
attributes: memoizedAttributes, |
| 35827 |
isDragging, |
| 35828 |
listeners: disabled2 ? void 0 : listeners, |
| 35829 |
node, |
| 35830 |
over, |
| 35831 |
setNodeRef, |
| 35832 |
setActivatorNodeRef, |
| 35833 |
transform |
| 35834 |
}; |
| 35835 |
} |
| 35836 |
function useDndContext() { |
| 35837 |
return (0, import_react40.useContext)(PublicContext); |
| 35838 |
} |
| 35839 |
var ID_PREFIX$1 = "Droppable"; |
| 35840 |
var defaultResizeObserverConfig = { |
| 35841 |
timeout: 25 |
| 35842 |
}; |
| 35843 |
function useDroppable(_ref) { |
| 35844 |
let { |
| 35845 |
data, |
| 35846 |
disabled: disabled2 = false, |
| 35847 |
id, |
| 35848 |
resizeObserverConfig |
| 35849 |
} = _ref; |
| 35850 |
const key2 = useUniqueId(ID_PREFIX$1); |
| 35851 |
const { |
| 35852 |
active, |
| 35853 |
dispatch: dispatch2, |
| 35854 |
over, |
| 35855 |
measureDroppableContainers |
| 35856 |
} = (0, import_react40.useContext)(InternalContext); |
| 35857 |
const previous = (0, import_react40.useRef)({ |
| 35858 |
disabled: disabled2 |
| 35859 |
}); |
| 35860 |
const resizeObserverConnected = (0, import_react40.useRef)(false); |
| 35861 |
const rect = (0, import_react40.useRef)(null); |
| 35862 |
const callbackId = (0, import_react40.useRef)(null); |
| 35863 |
const { |
| 35864 |
disabled: resizeObserverDisabled, |
| 35865 |
updateMeasurementsFor, |
| 35866 |
timeout: resizeObserverTimeout |
| 35867 |
} = { |
| 35868 |
...defaultResizeObserverConfig, |
| 35869 |
...resizeObserverConfig |
| 35870 |
}; |
| 35871 |
const ids2 = useLatestValue(updateMeasurementsFor != null ? updateMeasurementsFor : id); |
| 35872 |
const handleResize = (0, import_react40.useCallback)( |
| 35873 |
() => { |
| 35874 |
if (!resizeObserverConnected.current) { |
| 35875 |
resizeObserverConnected.current = true; |
| 35876 |
return; |
| 35877 |
} |
| 35878 |
if (callbackId.current != null) { |
| 35879 |
clearTimeout(callbackId.current); |
| 35880 |
} |
| 35881 |
callbackId.current = setTimeout(() => { |
| 35882 |
measureDroppableContainers(Array.isArray(ids2.current) ? ids2.current : [ids2.current]); |
| 35883 |
callbackId.current = null; |
| 35884 |
}, resizeObserverTimeout); |
| 35885 |
}, |
| 35886 |
//eslint-disable-next-line react-hooks/exhaustive-deps |
| 35887 |
[resizeObserverTimeout] |
| 35888 |
); |
| 35889 |
const resizeObserver = useResizeObserver2({ |
| 35890 |
callback: handleResize, |
| 35891 |
disabled: resizeObserverDisabled || !active |
| 35892 |
}); |
| 35893 |
const handleNodeChange = (0, import_react40.useCallback)((newElement, previousElement) => { |
| 35894 |
if (!resizeObserver) { |
| 35895 |
return; |
| 35896 |
} |
| 35897 |
if (previousElement) { |
| 35898 |
resizeObserver.unobserve(previousElement); |
| 35899 |
resizeObserverConnected.current = false; |
| 35900 |
} |
| 35901 |
if (newElement) { |
| 35902 |
resizeObserver.observe(newElement); |
| 35903 |
} |
| 35904 |
}, [resizeObserver]); |
| 35905 |
const [nodeRef, setNodeRef] = useNodeRef(handleNodeChange); |
| 35906 |
const dataRef = useLatestValue(data); |
| 35907 |
(0, import_react40.useEffect)(() => { |
| 35908 |
if (!resizeObserver || !nodeRef.current) { |
| 35909 |
return; |
| 35910 |
} |
| 35911 |
resizeObserver.disconnect(); |
| 35912 |
resizeObserverConnected.current = false; |
| 35913 |
resizeObserver.observe(nodeRef.current); |
| 35914 |
}, [nodeRef, resizeObserver]); |
| 35915 |
(0, import_react40.useEffect)( |
| 35916 |
() => { |
| 35917 |
dispatch2({ |
| 35918 |
type: Action2.RegisterDroppable, |
| 35919 |
element: { |
| 35920 |
id, |
| 35921 |
key: key2, |
| 35922 |
disabled: disabled2, |
| 35923 |
node: nodeRef, |
| 35924 |
rect, |
| 35925 |
data: dataRef |
| 35926 |
} |
| 35927 |
}); |
| 35928 |
return () => dispatch2({ |
| 35929 |
type: Action2.UnregisterDroppable, |
| 35930 |
key: key2, |
| 35931 |
id |
| 35932 |
}); |
| 35933 |
}, |
| 35934 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 35935 |
[id] |
| 35936 |
); |
| 35937 |
(0, import_react40.useEffect)(() => { |
| 35938 |
if (disabled2 !== previous.current.disabled) { |
| 35939 |
dispatch2({ |
| 35940 |
type: Action2.SetDroppableDisabled, |
| 35941 |
id, |
| 35942 |
key: key2, |
| 35943 |
disabled: disabled2 |
| 35944 |
}); |
| 35945 |
previous.current.disabled = disabled2; |
| 35946 |
} |
| 35947 |
}, [id, key2, disabled2, dispatch2]); |
| 35948 |
return { |
| 35949 |
active, |
| 35950 |
rect, |
| 35951 |
isOver: (over == null ? void 0 : over.id) === id, |
| 35952 |
node: nodeRef, |
| 35953 |
over, |
| 35954 |
setNodeRef |
| 35955 |
}; |
| 35956 |
} |
| 35957 |
function AnimationManager(_ref) { |
| 35958 |
let { |
| 35959 |
animation, |
| 35960 |
children |
| 35961 |
} = _ref; |
| 35962 |
const [clonedChildren, setClonedChildren] = (0, import_react40.useState)(null); |
| 35963 |
const [element, setElement] = (0, import_react40.useState)(null); |
| 35964 |
const previousChildren = usePrevious2(children); |
| 35965 |
if (!children && !clonedChildren && previousChildren) { |
| 35966 |
setClonedChildren(previousChildren); |
| 35967 |
} |
| 35968 |
useIsomorphicLayoutEffect(() => { |
| 35969 |
if (!element) { |
| 35970 |
return; |
| 35971 |
} |
| 35972 |
const key2 = clonedChildren == null ? void 0 : clonedChildren.key; |
| 35973 |
const id = clonedChildren == null ? void 0 : clonedChildren.props.id; |
| 35974 |
if (key2 == null || id == null) { |
| 35975 |
setClonedChildren(null); |
| 35976 |
return; |
| 35977 |
} |
| 35978 |
Promise.resolve(animation(id, element)).then(() => { |
| 35979 |
setClonedChildren(null); |
| 35980 |
}); |
| 35981 |
}, [animation, clonedChildren, element]); |
| 35982 |
return import_react40.default.createElement(import_react40.default.Fragment, null, children, clonedChildren ? (0, import_react40.cloneElement)(clonedChildren, { |
| 35983 |
ref: setElement |
| 35984 |
}) : null); |
| 35985 |
} |
| 35986 |
var defaultTransform = { |
| 35987 |
x: 0, |
| 35988 |
y: 0, |
| 35989 |
scaleX: 1, |
| 35990 |
scaleY: 1 |
| 35991 |
}; |
| 35992 |
function NullifiedContextProvider(_ref) { |
| 35993 |
let { |
| 35994 |
children |
| 35995 |
} = _ref; |
| 35996 |
return import_react40.default.createElement(InternalContext.Provider, { |
| 35997 |
value: defaultInternalContext |
| 35998 |
}, import_react40.default.createElement(ActiveDraggableContext.Provider, { |
| 35999 |
value: defaultTransform |
| 36000 |
}, children)); |
| 36001 |
} |
| 36002 |
var baseStyles = { |
| 36003 |
position: "fixed", |
| 36004 |
touchAction: "none" |
| 36005 |
}; |
| 36006 |
var defaultTransition = (activatorEvent) => { |
| 36007 |
const isKeyboardActivator = isKeyboardEvent(activatorEvent); |
| 36008 |
return isKeyboardActivator ? "transform 250ms ease" : void 0; |
| 36009 |
}; |
| 36010 |
var PositionedOverlay = /* @__PURE__ */ (0, import_react40.forwardRef)((_ref, ref) => { |
| 36011 |
let { |
| 36012 |
as, |
| 36013 |
activatorEvent, |
| 36014 |
adjustScale: adjustScale2, |
| 36015 |
children, |
| 36016 |
className, |
| 36017 |
rect, |
| 36018 |
style, |
| 36019 |
transform, |
| 36020 |
transition = defaultTransition |
| 36021 |
} = _ref; |
| 36022 |
if (!rect) { |
| 36023 |
return null; |
| 36024 |
} |
| 36025 |
const scaleAdjustedTransform = adjustScale2 ? transform : { |
| 36026 |
...transform, |
| 36027 |
scaleX: 1, |
| 36028 |
scaleY: 1 |
| 36029 |
}; |
| 36030 |
const styles = { |
| 36031 |
...baseStyles, |
| 36032 |
width: rect.width, |
| 36033 |
height: rect.height, |
| 36034 |
top: rect.top, |
| 36035 |
left: rect.left, |
| 36036 |
transform: CSS2.Transform.toString(scaleAdjustedTransform), |
| 36037 |
transformOrigin: adjustScale2 && activatorEvent ? getRelativeTransformOrigin(activatorEvent, rect) : void 0, |
| 36038 |
transition: typeof transition === "function" ? transition(activatorEvent) : transition, |
| 36039 |
...style |
| 36040 |
}; |
| 36041 |
return import_react40.default.createElement(as, { |
| 36042 |
className, |
| 36043 |
style: styles, |
| 36044 |
ref |
| 36045 |
}, children); |
| 36046 |
}); |
| 36047 |
var defaultDropAnimationSideEffects = (options) => (_ref) => { |
| 36048 |
let { |
| 36049 |
active, |
| 36050 |
dragOverlay |
| 36051 |
} = _ref; |
| 36052 |
const originalStyles = {}; |
| 36053 |
const { |
| 36054 |
styles, |
| 36055 |
className |
| 36056 |
} = options; |
| 36057 |
if (styles != null && styles.active) { |
| 36058 |
for (const [key2, value] of Object.entries(styles.active)) { |
| 36059 |
if (value === void 0) { |
| 36060 |
continue; |
| 36061 |
} |
| 36062 |
originalStyles[key2] = active.node.style.getPropertyValue(key2); |
| 36063 |
active.node.style.setProperty(key2, value); |
| 36064 |
} |
| 36065 |
} |
| 36066 |
if (styles != null && styles.dragOverlay) { |
| 36067 |
for (const [key2, value] of Object.entries(styles.dragOverlay)) { |
| 36068 |
if (value === void 0) { |
| 36069 |
continue; |
| 36070 |
} |
| 36071 |
dragOverlay.node.style.setProperty(key2, value); |
| 36072 |
} |
| 36073 |
} |
| 36074 |
if (className != null && className.active) { |
| 36075 |
active.node.classList.add(className.active); |
| 36076 |
} |
| 36077 |
if (className != null && className.dragOverlay) { |
| 36078 |
dragOverlay.node.classList.add(className.dragOverlay); |
| 36079 |
} |
| 36080 |
return function cleanup() { |
| 36081 |
for (const [key2, value] of Object.entries(originalStyles)) { |
| 36082 |
active.node.style.setProperty(key2, value); |
| 36083 |
} |
| 36084 |
if (className != null && className.active) { |
| 36085 |
active.node.classList.remove(className.active); |
| 36086 |
} |
| 36087 |
}; |
| 36088 |
}; |
| 36089 |
var defaultKeyframeResolver = (_ref2) => { |
| 36090 |
let { |
| 36091 |
transform: { |
| 36092 |
initial, |
| 36093 |
final |
| 36094 |
} |
| 36095 |
} = _ref2; |
| 36096 |
return [{ |
| 36097 |
transform: CSS2.Transform.toString(initial) |
| 36098 |
}, { |
| 36099 |
transform: CSS2.Transform.toString(final) |
| 36100 |
}]; |
| 36101 |
}; |
| 36102 |
var defaultDropAnimationConfiguration = { |
| 36103 |
duration: 250, |
| 36104 |
easing: "ease", |
| 36105 |
keyframes: defaultKeyframeResolver, |
| 36106 |
sideEffects: /* @__PURE__ */ defaultDropAnimationSideEffects({ |
| 36107 |
styles: { |
| 36108 |
active: { |
| 36109 |
opacity: "0" |
| 36110 |
} |
| 36111 |
} |
| 36112 |
}) |
| 36113 |
}; |
| 36114 |
function useDropAnimation(_ref3) { |
| 36115 |
let { |
| 36116 |
config, |
| 36117 |
draggableNodes, |
| 36118 |
droppableContainers, |
| 36119 |
measuringConfiguration |
| 36120 |
} = _ref3; |
| 36121 |
return useEvent3((id, node) => { |
| 36122 |
if (config === null) { |
| 36123 |
return; |
| 36124 |
} |
| 36125 |
const activeDraggable = draggableNodes.get(id); |
| 36126 |
if (!activeDraggable) { |
| 36127 |
return; |
| 36128 |
} |
| 36129 |
const activeNode = activeDraggable.node.current; |
| 36130 |
if (!activeNode) { |
| 36131 |
return; |
| 36132 |
} |
| 36133 |
const measurableNode = getMeasurableNode(node); |
| 36134 |
if (!measurableNode) { |
| 36135 |
return; |
| 36136 |
} |
| 36137 |
const { |
| 36138 |
transform |
| 36139 |
} = getWindow3(node).getComputedStyle(node); |
| 36140 |
const parsedTransform = parseTransform(transform); |
| 36141 |
if (!parsedTransform) { |
| 36142 |
return; |
| 36143 |
} |
| 36144 |
const animation = typeof config === "function" ? config : createDefaultDropAnimation(config); |
| 36145 |
scrollIntoViewIfNeeded2(activeNode, measuringConfiguration.draggable.measure); |
| 36146 |
return animation({ |
| 36147 |
active: { |
| 36148 |
id, |
| 36149 |
data: activeDraggable.data, |
| 36150 |
node: activeNode, |
| 36151 |
rect: measuringConfiguration.draggable.measure(activeNode) |
| 36152 |
}, |
| 36153 |
draggableNodes, |
| 36154 |
dragOverlay: { |
| 36155 |
node, |
| 36156 |
rect: measuringConfiguration.dragOverlay.measure(measurableNode) |
| 36157 |
}, |
| 36158 |
droppableContainers, |
| 36159 |
measuringConfiguration, |
| 36160 |
transform: parsedTransform |
| 36161 |
}); |
| 36162 |
}); |
| 36163 |
} |
| 36164 |
function createDefaultDropAnimation(options) { |
| 36165 |
const { |
| 36166 |
duration, |
| 36167 |
easing, |
| 36168 |
sideEffects, |
| 36169 |
keyframes |
| 36170 |
} = { |
| 36171 |
...defaultDropAnimationConfiguration, |
| 36172 |
...options |
| 36173 |
}; |
| 36174 |
return (_ref4) => { |
| 36175 |
let { |
| 36176 |
active, |
| 36177 |
dragOverlay, |
| 36178 |
transform, |
| 36179 |
...rest |
| 36180 |
} = _ref4; |
| 36181 |
if (!duration) { |
| 36182 |
return; |
| 36183 |
} |
| 36184 |
const delta = { |
| 36185 |
x: dragOverlay.rect.left - active.rect.left, |
| 36186 |
y: dragOverlay.rect.top - active.rect.top |
| 36187 |
}; |
| 36188 |
const scale = { |
| 36189 |
scaleX: transform.scaleX !== 1 ? active.rect.width * transform.scaleX / dragOverlay.rect.width : 1, |
| 36190 |
scaleY: transform.scaleY !== 1 ? active.rect.height * transform.scaleY / dragOverlay.rect.height : 1 |
| 36191 |
}; |
| 36192 |
const finalTransform = { |
| 36193 |
x: transform.x - delta.x, |
| 36194 |
y: transform.y - delta.y, |
| 36195 |
...scale |
| 36196 |
}; |
| 36197 |
const animationKeyframes = keyframes({ |
| 36198 |
...rest, |
| 36199 |
active, |
| 36200 |
dragOverlay, |
| 36201 |
transform: { |
| 36202 |
initial: transform, |
| 36203 |
final: finalTransform |
| 36204 |
} |
| 36205 |
}); |
| 36206 |
const [firstKeyframe] = animationKeyframes; |
| 36207 |
const lastKeyframe = animationKeyframes[animationKeyframes.length - 1]; |
| 36208 |
if (JSON.stringify(firstKeyframe) === JSON.stringify(lastKeyframe)) { |
| 36209 |
return; |
| 36210 |
} |
| 36211 |
const cleanup = sideEffects == null ? void 0 : sideEffects({ |
| 36212 |
active, |
| 36213 |
dragOverlay, |
| 36214 |
...rest |
| 36215 |
}); |
| 36216 |
const animation = dragOverlay.node.animate(animationKeyframes, { |
| 36217 |
duration, |
| 36218 |
easing, |
| 36219 |
fill: "forwards" |
| 36220 |
}); |
| 36221 |
return new Promise((resolve) => { |
| 36222 |
animation.onfinish = () => { |
| 36223 |
cleanup == null ? void 0 : cleanup(); |
| 36224 |
resolve(); |
| 36225 |
}; |
| 36226 |
}); |
| 36227 |
}; |
| 36228 |
} |
| 36229 |
var key = 0; |
| 36230 |
function useKey(id) { |
| 36231 |
return (0, import_react40.useMemo)(() => { |
| 36232 |
if (id == null) { |
| 36233 |
return; |
| 36234 |
} |
| 36235 |
key++; |
| 36236 |
return key; |
| 36237 |
}, [id]); |
| 36238 |
} |
| 36239 |
var DragOverlay = /* @__PURE__ */ import_react40.default.memo((_ref) => { |
| 36240 |
let { |
| 36241 |
adjustScale: adjustScale2 = false, |
| 36242 |
children, |
| 36243 |
dropAnimation: dropAnimationConfig, |
| 36244 |
style, |
| 36245 |
transition, |
| 36246 |
modifiers, |
| 36247 |
wrapperElement = "div", |
| 36248 |
className, |
| 36249 |
zIndex = 999 |
| 36250 |
} = _ref; |
| 36251 |
const { |
| 36252 |
activatorEvent, |
| 36253 |
active, |
| 36254 |
activeNodeRect, |
| 36255 |
containerNodeRect, |
| 36256 |
draggableNodes, |
| 36257 |
droppableContainers, |
| 36258 |
dragOverlay, |
| 36259 |
over, |
| 36260 |
measuringConfiguration, |
| 36261 |
scrollableAncestors, |
| 36262 |
scrollableAncestorRects, |
| 36263 |
windowRect |
| 36264 |
} = useDndContext(); |
| 36265 |
const transform = (0, import_react40.useContext)(ActiveDraggableContext); |
| 36266 |
const key2 = useKey(active == null ? void 0 : active.id); |
| 36267 |
const modifiedTransform = applyModifiers(modifiers, { |
| 36268 |
activatorEvent, |
| 36269 |
active, |
| 36270 |
activeNodeRect, |
| 36271 |
containerNodeRect, |
| 36272 |
draggingNodeRect: dragOverlay.rect, |
| 36273 |
over, |
| 36274 |
overlayNodeRect: dragOverlay.rect, |
| 36275 |
scrollableAncestors, |
| 36276 |
scrollableAncestorRects, |
| 36277 |
transform, |
| 36278 |
windowRect |
| 36279 |
}); |
| 36280 |
const initialRect = useInitialValue2(activeNodeRect); |
| 36281 |
const dropAnimation = useDropAnimation({ |
| 36282 |
config: dropAnimationConfig, |
| 36283 |
draggableNodes, |
| 36284 |
droppableContainers, |
| 36285 |
measuringConfiguration |
| 36286 |
}); |
| 36287 |
const ref = initialRect ? dragOverlay.setRef : void 0; |
| 36288 |
return import_react40.default.createElement(NullifiedContextProvider, null, import_react40.default.createElement(AnimationManager, { |
| 36289 |
animation: dropAnimation |
| 36290 |
}, active && key2 ? import_react40.default.createElement(PositionedOverlay, { |
| 36291 |
key: key2, |
| 36292 |
id: active.id, |
| 36293 |
ref, |
| 36294 |
as: wrapperElement, |
| 36295 |
activatorEvent, |
| 36296 |
adjustScale: adjustScale2, |
| 36297 |
className, |
| 36298 |
transition, |
| 36299 |
rect: initialRect, |
| 36300 |
style: { |
| 36301 |
zIndex, |
| 36302 |
...style |
| 36303 |
}, |
| 36304 |
transform: modifiedTransform |
| 36305 |
}, children) : null)); |
| 36306 |
}); |
| 36307 |
|
| 36308 |
// node_modules/@dnd-kit/sortable/dist/sortable.esm.js |
| 36309 |
var import_react41 = __toESM(require_react()); |
| 36310 |
function arrayMove(array, from, to) { |
| 36311 |
const newArray = array.slice(); |
| 36312 |
newArray.splice(to < 0 ? newArray.length + to : to, 0, newArray.splice(from, 1)[0]); |
| 36313 |
return newArray; |
| 36314 |
} |
| 36315 |
function getSortedRects(items, rects) { |
| 36316 |
return items.reduce((accumulator, id, index2) => { |
| 36317 |
const rect = rects.get(id); |
| 36318 |
if (rect) { |
| 36319 |
accumulator[index2] = rect; |
| 36320 |
} |
| 36321 |
return accumulator; |
| 36322 |
}, Array(items.length)); |
| 36323 |
} |
| 36324 |
function isValidIndex(index2) { |
| 36325 |
return index2 !== null && index2 >= 0; |
| 36326 |
} |
| 36327 |
function itemsEqual(a2, b2) { |
| 36328 |
if (a2 === b2) { |
| 36329 |
return true; |
| 36330 |
} |
| 36331 |
if (a2.length !== b2.length) { |
| 36332 |
return false; |
| 36333 |
} |
| 36334 |
for (let i2 = 0; i2 < a2.length; i2++) { |
| 36335 |
if (a2[i2] !== b2[i2]) { |
| 36336 |
return false; |
| 36337 |
} |
| 36338 |
} |
| 36339 |
return true; |
| 36340 |
} |
| 36341 |
function normalizeDisabled(disabled2) { |
| 36342 |
if (typeof disabled2 === "boolean") { |
| 36343 |
return { |
| 36344 |
draggable: disabled2, |
| 36345 |
droppable: disabled2 |
| 36346 |
}; |
| 36347 |
} |
| 36348 |
return disabled2; |
| 36349 |
} |
| 36350 |
var rectSortingStrategy = (_ref) => { |
| 36351 |
let { |
| 36352 |
rects, |
| 36353 |
activeIndex, |
| 36354 |
overIndex, |
| 36355 |
index: index2 |
| 36356 |
} = _ref; |
| 36357 |
const newRects = arrayMove(rects, overIndex, activeIndex); |
| 36358 |
const oldRect = rects[index2]; |
| 36359 |
const newRect = newRects[index2]; |
| 36360 |
if (!newRect || !oldRect) { |
| 36361 |
return null; |
| 36362 |
} |
| 36363 |
return { |
| 36364 |
x: newRect.left - oldRect.left, |
| 36365 |
y: newRect.top - oldRect.top, |
| 36366 |
scaleX: newRect.width / oldRect.width, |
| 36367 |
scaleY: newRect.height / oldRect.height |
| 36368 |
}; |
| 36369 |
}; |
| 36370 |
var ID_PREFIX2 = "Sortable"; |
| 36371 |
var Context3 = /* @__PURE__ */ import_react41.default.createContext({ |
| 36372 |
activeIndex: -1, |
| 36373 |
containerId: ID_PREFIX2, |
| 36374 |
disableTransforms: false, |
| 36375 |
items: [], |
| 36376 |
overIndex: -1, |
| 36377 |
useDragOverlay: false, |
| 36378 |
sortedRects: [], |
| 36379 |
strategy: rectSortingStrategy, |
| 36380 |
disabled: { |
| 36381 |
draggable: false, |
| 36382 |
droppable: false |
| 36383 |
} |
| 36384 |
}); |
| 36385 |
function SortableContext(_ref) { |
| 36386 |
let { |
| 36387 |
children, |
| 36388 |
id, |
| 36389 |
items: userDefinedItems, |
| 36390 |
strategy = rectSortingStrategy, |
| 36391 |
disabled: disabledProp = false |
| 36392 |
} = _ref; |
| 36393 |
const { |
| 36394 |
active, |
| 36395 |
dragOverlay, |
| 36396 |
droppableRects, |
| 36397 |
over, |
| 36398 |
measureDroppableContainers |
| 36399 |
} = useDndContext(); |
| 36400 |
const containerId = useUniqueId(ID_PREFIX2, id); |
| 36401 |
const useDragOverlay = Boolean(dragOverlay.rect !== null); |
| 36402 |
const items = (0, import_react41.useMemo)(() => userDefinedItems.map((item) => typeof item === "object" && "id" in item ? item.id : item), [userDefinedItems]); |
| 36403 |
const isDragging = active != null; |
| 36404 |
const activeIndex = active ? items.indexOf(active.id) : -1; |
| 36405 |
const overIndex = over ? items.indexOf(over.id) : -1; |
| 36406 |
const previousItemsRef = (0, import_react41.useRef)(items); |
| 36407 |
const itemsHaveChanged = !itemsEqual(items, previousItemsRef.current); |
| 36408 |
const disableTransforms = overIndex !== -1 && activeIndex === -1 || itemsHaveChanged; |
| 36409 |
const disabled2 = normalizeDisabled(disabledProp); |
| 36410 |
useIsomorphicLayoutEffect(() => { |
| 36411 |
if (itemsHaveChanged && isDragging) { |
| 36412 |
measureDroppableContainers(items); |
| 36413 |
} |
| 36414 |
}, [itemsHaveChanged, items, isDragging, measureDroppableContainers]); |
| 36415 |
(0, import_react41.useEffect)(() => { |
| 36416 |
previousItemsRef.current = items; |
| 36417 |
}, [items]); |
| 36418 |
const contextValue = (0, import_react41.useMemo)( |
| 36419 |
() => ({ |
| 36420 |
activeIndex, |
| 36421 |
containerId, |
| 36422 |
disabled: disabled2, |
| 36423 |
disableTransforms, |
| 36424 |
items, |
| 36425 |
overIndex, |
| 36426 |
useDragOverlay, |
| 36427 |
sortedRects: getSortedRects(items, droppableRects), |
| 36428 |
strategy |
| 36429 |
}), |
| 36430 |
// eslint-disable-next-line react-hooks/exhaustive-deps |
| 36431 |
[activeIndex, containerId, disabled2.draggable, disabled2.droppable, disableTransforms, items, overIndex, droppableRects, useDragOverlay, strategy] |
| 36432 |
); |
| 36433 |
return import_react41.default.createElement(Context3.Provider, { |
| 36434 |
value: contextValue |
| 36435 |
}, children); |
| 36436 |
} |
| 36437 |
var defaultNewIndexGetter = (_ref) => { |
| 36438 |
let { |
| 36439 |
id, |
| 36440 |
items, |
| 36441 |
activeIndex, |
| 36442 |
overIndex |
| 36443 |
} = _ref; |
| 36444 |
return arrayMove(items, activeIndex, overIndex).indexOf(id); |
| 36445 |
}; |
| 36446 |
var defaultAnimateLayoutChanges = (_ref2) => { |
| 36447 |
let { |
| 36448 |
containerId, |
| 36449 |
isSorting, |
| 36450 |
wasDragging, |
| 36451 |
index: index2, |
| 36452 |
items, |
| 36453 |
newIndex, |
| 36454 |
previousItems, |
| 36455 |
previousContainerId, |
| 36456 |
transition |
| 36457 |
} = _ref2; |
| 36458 |
if (!transition || !wasDragging) { |
| 36459 |
return false; |
| 36460 |
} |
| 36461 |
if (previousItems !== items && index2 === newIndex) { |
| 36462 |
return false; |
| 36463 |
} |
| 36464 |
if (isSorting) { |
| 36465 |
return true; |
| 36466 |
} |
| 36467 |
return newIndex !== index2 && containerId === previousContainerId; |
| 36468 |
}; |
| 36469 |
var defaultTransition2 = { |
| 36470 |
duration: 200, |
| 36471 |
easing: "ease" |
| 36472 |
}; |
| 36473 |
var transitionProperty = "transform"; |
| 36474 |
var disabledTransition = /* @__PURE__ */ CSS2.Transition.toString({ |
| 36475 |
property: transitionProperty, |
| 36476 |
duration: 0, |
| 36477 |
easing: "linear" |
| 36478 |
}); |
| 36479 |
var defaultAttributes = { |
| 36480 |
roleDescription: "sortable" |
| 36481 |
}; |
| 36482 |
function useDerivedTransform(_ref) { |
| 36483 |
let { |
| 36484 |
disabled: disabled2, |
| 36485 |
index: index2, |
| 36486 |
node, |
| 36487 |
rect |
| 36488 |
} = _ref; |
| 36489 |
const [derivedTransform, setDerivedtransform] = (0, import_react41.useState)(null); |
| 36490 |
const previousIndex = (0, import_react41.useRef)(index2); |
| 36491 |
useIsomorphicLayoutEffect(() => { |
| 36492 |
if (!disabled2 && index2 !== previousIndex.current && node.current) { |
| 36493 |
const initial = rect.current; |
| 36494 |
if (initial) { |
| 36495 |
const current = getClientRect(node.current, { |
| 36496 |
ignoreTransform: true |
| 36497 |
}); |
| 36498 |
const delta = { |
| 36499 |
x: initial.left - current.left, |
| 36500 |
y: initial.top - current.top, |
| 36501 |
scaleX: initial.width / current.width, |
| 36502 |
scaleY: initial.height / current.height |
| 36503 |
}; |
| 36504 |
if (delta.x || delta.y) { |
| 36505 |
setDerivedtransform(delta); |
| 36506 |
} |
| 36507 |
} |
| 36508 |
} |
| 36509 |
if (index2 !== previousIndex.current) { |
| 36510 |
previousIndex.current = index2; |
| 36511 |
} |
| 36512 |
}, [disabled2, index2, node, rect]); |
| 36513 |
(0, import_react41.useEffect)(() => { |
| 36514 |
if (derivedTransform) { |
| 36515 |
setDerivedtransform(null); |
| 36516 |
} |
| 36517 |
}, [derivedTransform]); |
| 36518 |
return derivedTransform; |
| 36519 |
} |
| 36520 |
function useSortable(_ref) { |
| 36521 |
let { |
| 36522 |
animateLayoutChanges = defaultAnimateLayoutChanges, |
| 36523 |
attributes: userDefinedAttributes, |
| 36524 |
disabled: localDisabled, |
| 36525 |
data: customData, |
| 36526 |
getNewIndex = defaultNewIndexGetter, |
| 36527 |
id, |
| 36528 |
strategy: localStrategy, |
| 36529 |
resizeObserverConfig, |
| 36530 |
transition = defaultTransition2 |
| 36531 |
} = _ref; |
| 36532 |
const { |
| 36533 |
items, |
| 36534 |
containerId, |
| 36535 |
activeIndex, |
| 36536 |
disabled: globalDisabled, |
| 36537 |
disableTransforms, |
| 36538 |
sortedRects, |
| 36539 |
overIndex, |
| 36540 |
useDragOverlay, |
| 36541 |
strategy: globalStrategy |
| 36542 |
} = (0, import_react41.useContext)(Context3); |
| 36543 |
const disabled2 = normalizeLocalDisabled(localDisabled, globalDisabled); |
| 36544 |
const index2 = items.indexOf(id); |
| 36545 |
const data = (0, import_react41.useMemo)(() => ({ |
| 36546 |
sortable: { |
| 36547 |
containerId, |
| 36548 |
index: index2, |
| 36549 |
items |
| 36550 |
}, |
| 36551 |
...customData |
| 36552 |
}), [containerId, customData, index2, items]); |
| 36553 |
const itemsAfterCurrentSortable = (0, import_react41.useMemo)(() => items.slice(items.indexOf(id)), [items, id]); |
| 36554 |
const { |
| 36555 |
rect, |
| 36556 |
node, |
| 36557 |
isOver, |
| 36558 |
setNodeRef: setDroppableNodeRef |
| 36559 |
} = useDroppable({ |
| 36560 |
id, |
| 36561 |
data, |
| 36562 |
disabled: disabled2.droppable, |
| 36563 |
resizeObserverConfig: { |
| 36564 |
updateMeasurementsFor: itemsAfterCurrentSortable, |
| 36565 |
...resizeObserverConfig |
| 36566 |
} |
| 36567 |
}); |
| 36568 |
const { |
| 36569 |
active, |
| 36570 |
activatorEvent, |
| 36571 |
activeNodeRect, |
| 36572 |
attributes, |
| 36573 |
setNodeRef: setDraggableNodeRef, |
| 36574 |
listeners, |
| 36575 |
isDragging, |
| 36576 |
over, |
| 36577 |
setActivatorNodeRef, |
| 36578 |
transform |
| 36579 |
} = useDraggable({ |
| 36580 |
id, |
| 36581 |
data, |
| 36582 |
attributes: { |
| 36583 |
...defaultAttributes, |
| 36584 |
...userDefinedAttributes |
| 36585 |
}, |
| 36586 |
disabled: disabled2.draggable |
| 36587 |
}); |
| 36588 |
const setNodeRef = useCombinedRefs(setDroppableNodeRef, setDraggableNodeRef); |
| 36589 |
const isSorting = Boolean(active); |
| 36590 |
const displaceItem = isSorting && !disableTransforms && isValidIndex(activeIndex) && isValidIndex(overIndex); |
| 36591 |
const shouldDisplaceDragSource = !useDragOverlay && isDragging; |
| 36592 |
const dragSourceDisplacement = shouldDisplaceDragSource && displaceItem ? transform : null; |
| 36593 |
const strategy = localStrategy != null ? localStrategy : globalStrategy; |
| 36594 |
const finalTransform = displaceItem ? dragSourceDisplacement != null ? dragSourceDisplacement : strategy({ |
| 36595 |
rects: sortedRects, |
| 36596 |
activeNodeRect, |
| 36597 |
activeIndex, |
| 36598 |
overIndex, |
| 36599 |
index: index2 |
| 36600 |
}) : null; |
| 36601 |
const newIndex = isValidIndex(activeIndex) && isValidIndex(overIndex) ? getNewIndex({ |
| 36602 |
id, |
| 36603 |
items, |
| 36604 |
activeIndex, |
| 36605 |
overIndex |
| 36606 |
}) : index2; |
| 36607 |
const activeId = active == null ? void 0 : active.id; |
| 36608 |
const previous = (0, import_react41.useRef)({ |
| 36609 |
activeId, |
| 36610 |
items, |
| 36611 |
newIndex, |
| 36612 |
containerId |
| 36613 |
}); |
| 36614 |
const itemsHaveChanged = items !== previous.current.items; |
| 36615 |
const shouldAnimateLayoutChanges = animateLayoutChanges({ |
| 36616 |
active, |
| 36617 |
containerId, |
| 36618 |
isDragging, |
| 36619 |
isSorting, |
| 36620 |
id, |
| 36621 |
index: index2, |
| 36622 |
items, |
| 36623 |
newIndex: previous.current.newIndex, |
| 36624 |
previousItems: previous.current.items, |
| 36625 |
previousContainerId: previous.current.containerId, |
| 36626 |
transition, |
| 36627 |
wasDragging: previous.current.activeId != null |
| 36628 |
}); |
| 36629 |
const derivedTransform = useDerivedTransform({ |
| 36630 |
disabled: !shouldAnimateLayoutChanges, |
| 36631 |
index: index2, |
| 36632 |
node, |
| 36633 |
rect |
| 36634 |
}); |
| 36635 |
(0, import_react41.useEffect)(() => { |
| 36636 |
if (isSorting && previous.current.newIndex !== newIndex) { |
| 36637 |
previous.current.newIndex = newIndex; |
| 36638 |
} |
| 36639 |
if (containerId !== previous.current.containerId) { |
| 36640 |
previous.current.containerId = containerId; |
| 36641 |
} |
| 36642 |
if (items !== previous.current.items) { |
| 36643 |
previous.current.items = items; |
| 36644 |
} |
| 36645 |
}, [isSorting, newIndex, containerId, items]); |
| 36646 |
(0, import_react41.useEffect)(() => { |
| 36647 |
if (activeId === previous.current.activeId) { |
| 36648 |
return; |
| 36649 |
} |
| 36650 |
if (activeId != null && previous.current.activeId == null) { |
| 36651 |
previous.current.activeId = activeId; |
| 36652 |
return; |
| 36653 |
} |
| 36654 |
const timeoutId = setTimeout(() => { |
| 36655 |
previous.current.activeId = activeId; |
| 36656 |
}, 50); |
| 36657 |
return () => clearTimeout(timeoutId); |
| 36658 |
}, [activeId]); |
| 36659 |
return { |
| 36660 |
active, |
| 36661 |
activeIndex, |
| 36662 |
attributes, |
| 36663 |
data, |
| 36664 |
rect, |
| 36665 |
index: index2, |
| 36666 |
newIndex, |
| 36667 |
items, |
| 36668 |
isOver, |
| 36669 |
isSorting, |
| 36670 |
isDragging, |
| 36671 |
listeners, |
| 36672 |
node, |
| 36673 |
overIndex, |
| 36674 |
over, |
| 36675 |
setNodeRef, |
| 36676 |
setActivatorNodeRef, |
| 36677 |
setDroppableNodeRef, |
| 36678 |
setDraggableNodeRef, |
| 36679 |
transform: derivedTransform != null ? derivedTransform : finalTransform, |
| 36680 |
transition: getTransition() |
| 36681 |
}; |
| 36682 |
function getTransition() { |
| 36683 |
if ( |
| 36684 |
// Temporarily disable transitions for a single frame to set up derived transforms |
| 36685 |
derivedTransform || // Or to prevent items jumping to back to their "new" position when items change |
| 36686 |
itemsHaveChanged && previous.current.newIndex === index2 |
| 36687 |
) { |
| 36688 |
return disabledTransition; |
| 36689 |
} |
| 36690 |
if (shouldDisplaceDragSource && !isKeyboardEvent(activatorEvent) || !transition) { |
| 36691 |
return void 0; |
| 36692 |
} |
| 36693 |
if (isSorting || shouldAnimateLayoutChanges) { |
| 36694 |
return CSS2.Transition.toString({ |
| 36695 |
...transition, |
| 36696 |
property: transitionProperty |
| 36697 |
}); |
| 36698 |
} |
| 36699 |
return void 0; |
| 36700 |
} |
| 36701 |
} |
| 36702 |
function normalizeLocalDisabled(localDisabled, globalDisabled) { |
| 36703 |
var _localDisabled$dragga, _localDisabled$droppa; |
| 36704 |
if (typeof localDisabled === "boolean") { |
| 36705 |
return { |
| 36706 |
draggable: localDisabled, |
| 36707 |
// Backwards compatibility |
| 36708 |
droppable: false |
| 36709 |
}; |
| 36710 |
} |
| 36711 |
return { |
| 36712 |
draggable: (_localDisabled$dragga = localDisabled == null ? void 0 : localDisabled.draggable) != null ? _localDisabled$dragga : globalDisabled.draggable, |
| 36713 |
droppable: (_localDisabled$droppa = localDisabled == null ? void 0 : localDisabled.droppable) != null ? _localDisabled$droppa : globalDisabled.droppable |
| 36714 |
}; |
| 36715 |
} |
| 36716 |
function hasSortableData(entry) { |
| 36717 |
if (!entry) { |
| 36718 |
return false; |
| 36719 |
} |
| 36720 |
const data = entry.data.current; |
| 36721 |
if (data && "sortable" in data && typeof data.sortable === "object" && "containerId" in data.sortable && "items" in data.sortable && "index" in data.sortable) { |
| 36722 |
return true; |
| 36723 |
} |
| 36724 |
return false; |
| 36725 |
} |
| 36726 |
var directions = [KeyboardCode.Down, KeyboardCode.Right, KeyboardCode.Up, KeyboardCode.Left]; |
| 36727 |
var sortableKeyboardCoordinates = (event, _ref) => { |
| 36728 |
let { |
| 36729 |
context: { |
| 36730 |
active, |
| 36731 |
collisionRect, |
| 36732 |
droppableRects, |
| 36733 |
droppableContainers, |
| 36734 |
over, |
| 36735 |
scrollableAncestors |
| 36736 |
} |
| 36737 |
} = _ref; |
| 36738 |
if (directions.includes(event.code)) { |
| 36739 |
event.preventDefault(); |
| 36740 |
if (!active || !collisionRect) { |
| 36741 |
return; |
| 36742 |
} |
| 36743 |
const filteredContainers = []; |
| 36744 |
droppableContainers.getEnabled().forEach((entry) => { |
| 36745 |
if (!entry || entry != null && entry.disabled) { |
| 36746 |
return; |
| 36747 |
} |
| 36748 |
const rect = droppableRects.get(entry.id); |
| 36749 |
if (!rect) { |
| 36750 |
return; |
| 36751 |
} |
| 36752 |
switch (event.code) { |
| 36753 |
case KeyboardCode.Down: |
| 36754 |
if (collisionRect.top < rect.top) { |
| 36755 |
filteredContainers.push(entry); |
| 36756 |
} |
| 36757 |
break; |
| 36758 |
case KeyboardCode.Up: |
| 36759 |
if (collisionRect.top > rect.top) { |
| 36760 |
filteredContainers.push(entry); |
| 36761 |
} |
| 36762 |
break; |
| 36763 |
case KeyboardCode.Left: |
| 36764 |
if (collisionRect.left > rect.left) { |
| 36765 |
filteredContainers.push(entry); |
| 36766 |
} |
| 36767 |
break; |
| 36768 |
case KeyboardCode.Right: |
| 36769 |
if (collisionRect.left < rect.left) { |
| 36770 |
filteredContainers.push(entry); |
| 36771 |
} |
| 36772 |
break; |
| 36773 |
} |
| 36774 |
}); |
| 36775 |
const collisions = closestCorners({ |
| 36776 |
active, |
| 36777 |
collisionRect, |
| 36778 |
droppableRects, |
| 36779 |
droppableContainers: filteredContainers, |
| 36780 |
pointerCoordinates: null |
| 36781 |
}); |
| 36782 |
let closestId = getFirstCollision(collisions, "id"); |
| 36783 |
if (closestId === (over == null ? void 0 : over.id) && collisions.length > 1) { |
| 36784 |
closestId = collisions[1].id; |
| 36785 |
} |
| 36786 |
if (closestId != null) { |
| 36787 |
const activeDroppable = droppableContainers.get(active.id); |
| 36788 |
const newDroppable = droppableContainers.get(closestId); |
| 36789 |
const newRect = newDroppable ? droppableRects.get(newDroppable.id) : null; |
| 36790 |
const newNode = newDroppable == null ? void 0 : newDroppable.node.current; |
| 36791 |
if (newNode && newRect && activeDroppable && newDroppable) { |
| 36792 |
const newScrollAncestors = getScrollableAncestors(newNode); |
| 36793 |
const hasDifferentScrollAncestors = newScrollAncestors.some((element, index2) => scrollableAncestors[index2] !== element); |
| 36794 |
const hasSameContainer = isSameContainer(activeDroppable, newDroppable); |
| 36795 |
const isAfterActive = isAfter(activeDroppable, newDroppable); |
| 36796 |
const offset4 = hasDifferentScrollAncestors || !hasSameContainer ? { |
| 36797 |
x: 0, |
| 36798 |
y: 0 |
| 36799 |
} : { |
| 36800 |
x: isAfterActive ? collisionRect.width - newRect.width : 0, |
| 36801 |
y: isAfterActive ? collisionRect.height - newRect.height : 0 |
| 36802 |
}; |
| 36803 |
const rectCoordinates = { |
| 36804 |
x: newRect.left, |
| 36805 |
y: newRect.top |
| 36806 |
}; |
| 36807 |
const newCoordinates = offset4.x && offset4.y ? rectCoordinates : subtract(rectCoordinates, offset4); |
| 36808 |
return newCoordinates; |
| 36809 |
} |
| 36810 |
} |
| 36811 |
} |
| 36812 |
return void 0; |
| 36813 |
}; |
| 36814 |
function isSameContainer(a2, b2) { |
| 36815 |
if (!hasSortableData(a2) || !hasSortableData(b2)) { |
| 36816 |
return false; |
| 36817 |
} |
| 36818 |
return a2.data.current.sortable.containerId === b2.data.current.sortable.containerId; |
| 36819 |
} |
| 36820 |
function isAfter(a2, b2) { |
| 36821 |
if (!hasSortableData(a2) || !hasSortableData(b2)) { |
| 36822 |
return false; |
| 36823 |
} |
| 36824 |
if (!isSameContainer(a2, b2)) { |
| 36825 |
return false; |
| 36826 |
} |
| 36827 |
return a2.data.current.sortable.index < b2.data.current.sortable.index; |
| 36828 |
} |
| 36829 |
|
| 36830 |
// packages/grid/build-module/dashboard-grid/index.mjs |
| 36831 |
var import_compose19 = __toESM(require_compose(), 1); |
| 36832 |
var import_element129 = __toESM(require_element(), 1); |
| 36833 |
|
| 36834 |
// packages/grid/build-module/dashboard-grid/grid-item.mjs |
| 36835 |
var import_element128 = __toESM(require_element(), 1); |
| 36836 |
var import_compose18 = __toESM(require_compose(), 1); |
| 36837 |
|
| 36838 |
// packages/grid/build-module/shared/resize-handle.mjs |
| 36839 |
var import_element127 = __toESM(require_element(), 1); |
| 36840 |
var import_compose17 = __toESM(require_compose(), 1); |
| 36841 |
var import_jsx_runtime161 = __toESM(require_jsx_runtime(), 1); |
| 36842 |
var STYLE_HASH_ATTRIBUTE36 = "data-wp-hash"; |
| 36843 |
function getRuntime36() { |
| 36844 |
const globalScope = globalThis; |
| 36845 |
if (globalScope.__wpStyleRuntime) { |
| 36846 |
return globalScope.__wpStyleRuntime; |
| 36847 |
} |
| 36848 |
globalScope.__wpStyleRuntime = { |
| 36849 |
documents: /* @__PURE__ */ new Map(), |
| 36850 |
styles: /* @__PURE__ */ new Map(), |
| 36851 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 36852 |
}; |
| 36853 |
if (typeof document !== "undefined") { |
| 36854 |
registerDocument36(document); |
| 36855 |
} |
| 36856 |
return globalScope.__wpStyleRuntime; |
| 36857 |
} |
| 36858 |
function documentContainsStyleHash36(targetDocument, hash) { |
| 36859 |
if (!targetDocument.head) { |
| 36860 |
return false; |
| 36861 |
} |
| 36862 |
for (const style of targetDocument.head.querySelectorAll( |
| 36863 |
`style[${STYLE_HASH_ATTRIBUTE36}]` |
| 36864 |
)) { |
| 36865 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE36) === hash) { |
| 36866 |
return true; |
| 36867 |
} |
| 36868 |
} |
| 36869 |
return false; |
| 36870 |
} |
| 36871 |
function injectStyle36(targetDocument, hash, css) { |
| 36872 |
if (!targetDocument.head) { |
| 36873 |
return; |
| 36874 |
} |
| 36875 |
const runtime = getRuntime36(); |
| 36876 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 36877 |
if (!injectedStyles) { |
| 36878 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 36879 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 36880 |
} |
| 36881 |
if (injectedStyles.has(hash)) { |
| 36882 |
return; |
| 36883 |
} |
| 36884 |
if (documentContainsStyleHash36(targetDocument, hash)) { |
| 36885 |
injectedStyles.add(hash); |
| 36886 |
return; |
| 36887 |
} |
| 36888 |
const style = targetDocument.createElement("style"); |
| 36889 |
style.setAttribute(STYLE_HASH_ATTRIBUTE36, hash); |
| 36890 |
style.appendChild(targetDocument.createTextNode(css)); |
| 36891 |
targetDocument.head.appendChild(style); |
| 36892 |
injectedStyles.add(hash); |
| 36893 |
} |
| 36894 |
function registerDocument36(targetDocument) { |
| 36895 |
const runtime = getRuntime36(); |
| 36896 |
runtime.documents.set( |
| 36897 |
targetDocument, |
| 36898 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 36899 |
); |
| 36900 |
for (const [hash, css] of runtime.styles) { |
| 36901 |
injectStyle36(targetDocument, hash, css); |
| 36902 |
} |
| 36903 |
return () => { |
| 36904 |
const count = runtime.documents.get(targetDocument); |
| 36905 |
if (count === void 0) { |
| 36906 |
return; |
| 36907 |
} |
| 36908 |
if (count <= 1) { |
| 36909 |
runtime.documents.delete(targetDocument); |
| 36910 |
return; |
| 36911 |
} |
| 36912 |
runtime.documents.set(targetDocument, count - 1); |
| 36913 |
}; |
| 36914 |
} |
| 36915 |
function registerStyle36(hash, css) { |
| 36916 |
const runtime = getRuntime36(); |
| 36917 |
runtime.styles.set(hash, css); |
| 36918 |
for (const targetDocument of runtime.documents.keys()) { |
| 36919 |
injectStyle36(targetDocument, hash, css); |
| 36920 |
} |
| 36921 |
} |
| 36922 |
if (typeof process === "undefined" || true) { |
| 36923 |
registerStyle36("9ee34907fd", '._4da787f72dc00d8b__resize-handle{border-block-end:12px solid var(--wpds-color-fg-interactive-brand,var(--wp-admin-theme-color,#3858e9));border-inline-start:12px solid #0000;bottom:0;cursor:nwse-resize;height:0;inset-inline-end:0;position:absolute;width:0;z-index:1}._885412b44a137da0__is-horizontal-only{align-items:center;background:#0000;border-style:none;bottom:auto;cursor:ew-resize;display:flex;height:40px;justify-content:center;top:50%;transform:translateY(-50%);width:16px}._885412b44a137da0__is-horizontal-only:before{background-color:var(--wpds-color-fg-interactive-brand,var(--wp-admin-theme-color,#3858e9));border-radius:2px;content:"";height:24px;width:4px}@media (forced-colors:active){._885412b44a137da0__is-horizontal-only:before{background-color:Highlight}}'); |
| 36924 |
} |
| 36925 |
var resize_handle_default = { "resize-handle": "_4da787f72dc00d8b__resize-handle", "is-horizontal-only": "_885412b44a137da0__is-horizontal-only" }; |
| 36926 |
function ResizeHandle({ |
| 36927 |
itemId, |
| 36928 |
verticalResizable = true, |
| 36929 |
renderResizeHandle |
| 36930 |
}) { |
| 36931 |
const { attributes, listeners, setNodeRef, isDragging } = useDraggable({ |
| 36932 |
id: "draggable", |
| 36933 |
data: { itemId } |
| 36934 |
}); |
| 36935 |
const nodeRef = (0, import_element127.useRef)(null); |
| 36936 |
const mergedRef = (0, import_compose17.useMergeRefs)([nodeRef, setNodeRef]); |
| 36937 |
(0, import_element127.useEffect)(() => { |
| 36938 |
if (!isDragging) { |
| 36939 |
return; |
| 36940 |
} |
| 36941 |
const cursor = verticalResizable ? "nwse-resize" : "ew-resize"; |
| 36942 |
const root = (nodeRef.current?.ownerDocument ?? document).documentElement; |
| 36943 |
const previous = root.style.cursor; |
| 36944 |
root.style.cursor = cursor; |
| 36945 |
return () => { |
| 36946 |
root.style.cursor = previous; |
| 36947 |
}; |
| 36948 |
}, [isDragging, verticalResizable]); |
| 36949 |
if (renderResizeHandle) { |
| 36950 |
const RenderResizeHandle = renderResizeHandle; |
| 36951 |
return /* @__PURE__ */ (0, import_jsx_runtime161.jsx)( |
| 36952 |
RenderResizeHandle, |
| 36953 |
{ |
| 36954 |
ref: mergedRef, |
| 36955 |
listeners, |
| 36956 |
attributes, |
| 36957 |
verticalResizable, |
| 36958 |
isResizing: isDragging, |
| 36959 |
itemId |
| 36960 |
} |
| 36961 |
); |
| 36962 |
} |
| 36963 |
return /* @__PURE__ */ (0, import_jsx_runtime161.jsx)( |
| 36964 |
"div", |
| 36965 |
{ |
| 36966 |
ref: mergedRef, |
| 36967 |
className: clsx_default( |
| 36968 |
resize_handle_default["resize-handle"], |
| 36969 |
!verticalResizable && resize_handle_default["is-horizontal-only"] |
| 36970 |
), |
| 36971 |
...listeners, |
| 36972 |
...attributes |
| 36973 |
} |
| 36974 |
); |
| 36975 |
} |
| 36976 |
function ResizeHandleWrapper(props) { |
| 36977 |
const throttleDelay = 16; |
| 36978 |
const throttledResize = (0, import_compose17.useThrottle)((delta) => { |
| 36979 |
if (props.onResize) { |
| 36980 |
props.onResize(delta); |
| 36981 |
} |
| 36982 |
}, throttleDelay); |
| 36983 |
const handleDragMove = (event) => { |
| 36984 |
if (event.active.id !== "draggable") { |
| 36985 |
return; |
| 36986 |
} |
| 36987 |
throttledResize({ |
| 36988 |
width: event.delta.x, |
| 36989 |
height: event.delta.y |
| 36990 |
}); |
| 36991 |
}; |
| 36992 |
const handleDragEnd = () => { |
| 36993 |
if (props.onResizeEnd) { |
| 36994 |
props.onResizeEnd(); |
| 36995 |
} |
| 36996 |
}; |
| 36997 |
return /* @__PURE__ */ (0, import_jsx_runtime161.jsx)( |
| 36998 |
DndContext, |
| 36999 |
{ |
| 37000 |
autoScroll: { |
| 37001 |
threshold: { x: 5e-3, y: 5e-3 }, |
| 37002 |
acceleration: 1 |
| 37003 |
}, |
| 37004 |
onDragMove: handleDragMove, |
| 37005 |
onDragEnd: handleDragEnd, |
| 37006 |
children: /* @__PURE__ */ (0, import_jsx_runtime161.jsx)(ResizeHandle, { ...props }) |
| 37007 |
} |
| 37008 |
); |
| 37009 |
} |
| 37010 |
|
| 37011 |
// packages/grid/build-module/dashboard-grid/grid-item.mjs |
| 37012 |
var import_jsx_runtime162 = __toESM(require_jsx_runtime(), 1); |
| 37013 |
var STYLE_HASH_ATTRIBUTE37 = "data-wp-hash"; |
| 37014 |
function getRuntime37() { |
| 37015 |
const globalScope = globalThis; |
| 37016 |
if (globalScope.__wpStyleRuntime) { |
| 37017 |
return globalScope.__wpStyleRuntime; |
| 37018 |
} |
| 37019 |
globalScope.__wpStyleRuntime = { |
| 37020 |
documents: /* @__PURE__ */ new Map(), |
| 37021 |
styles: /* @__PURE__ */ new Map(), |
| 37022 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 37023 |
}; |
| 37024 |
if (typeof document !== "undefined") { |
| 37025 |
registerDocument37(document); |
| 37026 |
} |
| 37027 |
return globalScope.__wpStyleRuntime; |
| 37028 |
} |
| 37029 |
function documentContainsStyleHash37(targetDocument, hash) { |
| 37030 |
if (!targetDocument.head) { |
| 37031 |
return false; |
| 37032 |
} |
| 37033 |
for (const style of targetDocument.head.querySelectorAll( |
| 37034 |
`style[${STYLE_HASH_ATTRIBUTE37}]` |
| 37035 |
)) { |
| 37036 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE37) === hash) { |
| 37037 |
return true; |
| 37038 |
} |
| 37039 |
} |
| 37040 |
return false; |
| 37041 |
} |
| 37042 |
function injectStyle37(targetDocument, hash, css) { |
| 37043 |
if (!targetDocument.head) { |
| 37044 |
return; |
| 37045 |
} |
| 37046 |
const runtime = getRuntime37(); |
| 37047 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 37048 |
if (!injectedStyles) { |
| 37049 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 37050 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 37051 |
} |
| 37052 |
if (injectedStyles.has(hash)) { |
| 37053 |
return; |
| 37054 |
} |
| 37055 |
if (documentContainsStyleHash37(targetDocument, hash)) { |
| 37056 |
injectedStyles.add(hash); |
| 37057 |
return; |
| 37058 |
} |
| 37059 |
const style = targetDocument.createElement("style"); |
| 37060 |
style.setAttribute(STYLE_HASH_ATTRIBUTE37, hash); |
| 37061 |
style.appendChild(targetDocument.createTextNode(css)); |
| 37062 |
targetDocument.head.appendChild(style); |
| 37063 |
injectedStyles.add(hash); |
| 37064 |
} |
| 37065 |
function registerDocument37(targetDocument) { |
| 37066 |
const runtime = getRuntime37(); |
| 37067 |
runtime.documents.set( |
| 37068 |
targetDocument, |
| 37069 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 37070 |
); |
| 37071 |
for (const [hash, css] of runtime.styles) { |
| 37072 |
injectStyle37(targetDocument, hash, css); |
| 37073 |
} |
| 37074 |
return () => { |
| 37075 |
const count = runtime.documents.get(targetDocument); |
| 37076 |
if (count === void 0) { |
| 37077 |
return; |
| 37078 |
} |
| 37079 |
if (count <= 1) { |
| 37080 |
runtime.documents.delete(targetDocument); |
| 37081 |
return; |
| 37082 |
} |
| 37083 |
runtime.documents.set(targetDocument, count - 1); |
| 37084 |
}; |
| 37085 |
} |
| 37086 |
function registerStyle37(hash, css) { |
| 37087 |
const runtime = getRuntime37(); |
| 37088 |
runtime.styles.set(hash, css); |
| 37089 |
for (const targetDocument of runtime.documents.keys()) { |
| 37090 |
injectStyle37(targetDocument, hash, css); |
| 37091 |
} |
| 37092 |
} |
| 37093 |
if (typeof process === "undefined" || true) { |
| 37094 |
registerStyle37("d1d61343be", "._5d1abcb332a18701__item{position:relative}._54de57c12d3ce67e__item-content{height:100%;position:relative}._81d4e1a6c979f1e4__is-dragging{border-radius:var(--wp-grid-placeholder-radius,0);opacity:var(--wp-grid-placeholder-opacity,.4);outline:var(--wpds-border-width-sm,2px) dashed var(--wp-grid-placeholder-outline-color,var(--wpds-color-stroke-interactive-brand,var(--wp-admin-theme-color,#3858e9)));pointer-events:none}@media (forced-colors:active){._81d4e1a6c979f1e4__is-dragging{outline-color:Highlight}}._2028fc095dbc5cb2__preview-overlay{background:#0000;border:var(--wpds-border-width-sm,2px) dashed var(--wp-grid-placeholder-outline-color,var(--wpds-color-stroke-interactive-brand,var(--wp-admin-theme-color,#3858e9)));inset-inline-start:0;pointer-events:none;position:absolute;top:0;z-index:1}@media (forced-colors:active){._2028fc095dbc5cb2__preview-overlay{border-color:Highlight}}"); |
| 37095 |
} |
| 37096 |
var grid_item_default = { "item": "_5d1abcb332a18701__item", "item-content": "_54de57c12d3ce67e__item-content", "is-dragging": "_81d4e1a6c979f1e4__is-dragging", "preview-overlay": "_2028fc095dbc5cb2__preview-overlay" }; |
| 37097 |
function getItemCursor(disabled2, interacting) { |
| 37098 |
if (disabled2) { |
| 37099 |
return "default"; |
| 37100 |
} |
| 37101 |
if (interacting) { |
| 37102 |
return void 0; |
| 37103 |
} |
| 37104 |
return "grab"; |
| 37105 |
} |
| 37106 |
function GridItem4({ |
| 37107 |
item, |
| 37108 |
maxColumns, |
| 37109 |
disabled: disabled2 = false, |
| 37110 |
verticalResizable = true, |
| 37111 |
interacting = false, |
| 37112 |
children, |
| 37113 |
actionableArea = null, |
| 37114 |
onResize, |
| 37115 |
onResizeEnd, |
| 37116 |
renderResizeHandle |
| 37117 |
}) { |
| 37118 |
const [previewDelta, setPreviewDelta] = (0, import_element128.useState)( |
| 37119 |
null |
| 37120 |
); |
| 37121 |
const itemRef = (0, import_element128.useRef)(null); |
| 37122 |
const initialResizeRectRef = (0, import_element128.useRef)(null); |
| 37123 |
const initialResizeScrollRef = (0, import_element128.useRef)(null); |
| 37124 |
const lastResizeDeltaRef = (0, import_element128.useRef)(null); |
| 37125 |
const { |
| 37126 |
attributes, |
| 37127 |
listeners, |
| 37128 |
setNodeRef, |
| 37129 |
setActivatorNodeRef, |
| 37130 |
isDragging |
| 37131 |
} = useSortable({ |
| 37132 |
id: item.key, |
| 37133 |
disabled: disabled2 |
| 37134 |
}); |
| 37135 |
const mergedRef = (0, import_compose18.useMergeRefs)([itemRef, setNodeRef]); |
| 37136 |
const style = { |
| 37137 |
gridColumnEnd: `span ${item.width === "full" ? maxColumns : Math.min( |
| 37138 |
typeof item.width === "number" ? item.width : 1, |
| 37139 |
maxColumns |
| 37140 |
)}`, |
| 37141 |
gridRowEnd: `span ${item.height || 1}` |
| 37142 |
}; |
| 37143 |
const itemClassName = clsx_default( |
| 37144 |
grid_item_default.item, |
| 37145 |
isDragging && grid_item_default["is-dragging"] |
| 37146 |
); |
| 37147 |
const handleResize = (delta) => { |
| 37148 |
const clamped = { |
| 37149 |
width: delta.width, |
| 37150 |
height: verticalResizable ? delta.height : 0 |
| 37151 |
}; |
| 37152 |
const node = itemRef.current; |
| 37153 |
if (node && !initialResizeRectRef.current) { |
| 37154 |
initialResizeRectRef.current = node.getBoundingClientRect(); |
| 37155 |
const ownerWindow = node.ownerDocument.defaultView ?? window; |
| 37156 |
initialResizeScrollRef.current = { |
| 37157 |
x: ownerWindow.scrollX, |
| 37158 |
y: ownerWindow.scrollY |
| 37159 |
}; |
| 37160 |
} |
| 37161 |
lastResizeDeltaRef.current = clamped; |
| 37162 |
onResize(item.key, clamped); |
| 37163 |
if (node && initialResizeRectRef.current && initialResizeScrollRef.current) { |
| 37164 |
const currentRect = node.getBoundingClientRect(); |
| 37165 |
const ownerWindow = node.ownerDocument.defaultView ?? window; |
| 37166 |
const scrollDelta = { |
| 37167 |
x: ownerWindow.scrollX - initialResizeScrollRef.current.x, |
| 37168 |
y: ownerWindow.scrollY - initialResizeScrollRef.current.y |
| 37169 |
}; |
| 37170 |
const offsetX = currentRect.right - initialResizeRectRef.current.right; |
| 37171 |
const offsetY = currentRect.bottom - initialResizeRectRef.current.bottom; |
| 37172 |
setPreviewDelta({ |
| 37173 |
width: clamped.width - offsetX - scrollDelta.x, |
| 37174 |
height: verticalResizable ? clamped.height - offsetY - scrollDelta.y : 0 |
| 37175 |
}); |
| 37176 |
} |
| 37177 |
}; |
| 37178 |
(0, import_element128.useLayoutEffect)(() => { |
| 37179 |
const lastDelta = lastResizeDeltaRef.current; |
| 37180 |
const initialRect = initialResizeRectRef.current; |
| 37181 |
const initialScroll = initialResizeScrollRef.current; |
| 37182 |
const node = itemRef.current; |
| 37183 |
if (!lastDelta || !initialRect || !initialScroll || !node) { |
| 37184 |
return; |
| 37185 |
} |
| 37186 |
const currentRect = node.getBoundingClientRect(); |
| 37187 |
const ownerWindow = node.ownerDocument.defaultView ?? window; |
| 37188 |
const scrollDelta = { |
| 37189 |
x: ownerWindow.scrollX - initialScroll.x, |
| 37190 |
y: ownerWindow.scrollY - initialScroll.y |
| 37191 |
}; |
| 37192 |
const offsetX = currentRect.right - initialRect.right; |
| 37193 |
const offsetY = currentRect.bottom - initialRect.bottom; |
| 37194 |
const next = { |
| 37195 |
width: lastDelta.width - offsetX - scrollDelta.x, |
| 37196 |
height: verticalResizable ? lastDelta.height - offsetY - scrollDelta.y : 0 |
| 37197 |
}; |
| 37198 |
setPreviewDelta( |
| 37199 |
(prev) => next.width === prev?.width && next.height === prev?.height ? prev : next |
| 37200 |
); |
| 37201 |
}, [item.width, item.height, verticalResizable]); |
| 37202 |
const handleResizeEnd = () => { |
| 37203 |
setPreviewDelta(null); |
| 37204 |
initialResizeRectRef.current = null; |
| 37205 |
initialResizeScrollRef.current = null; |
| 37206 |
lastResizeDeltaRef.current = null; |
| 37207 |
onResizeEnd(); |
| 37208 |
}; |
| 37209 |
const previewOverlay = previewDelta ? /* @__PURE__ */ (0, import_jsx_runtime162.jsx)( |
| 37210 |
"div", |
| 37211 |
{ |
| 37212 |
className: grid_item_default["preview-overlay"], |
| 37213 |
style: { |
| 37214 |
insetInlineEnd: -previewDelta.width, |
| 37215 |
bottom: -previewDelta.height |
| 37216 |
} |
| 37217 |
} |
| 37218 |
) : null; |
| 37219 |
return /* @__PURE__ */ (0, import_jsx_runtime162.jsxs)("div", { ref: mergedRef, className: itemClassName, style, children: [ |
| 37220 |
actionableArea ? /* @__PURE__ */ (0, import_jsx_runtime162.jsx)( |
| 37221 |
"div", |
| 37222 |
{ |
| 37223 |
style: { display: "contents" }, |
| 37224 |
...interacting ? { inert: "" } : {}, |
| 37225 |
children: actionableArea |
| 37226 |
} |
| 37227 |
) : null, |
| 37228 |
/* @__PURE__ */ (0, import_jsx_runtime162.jsxs)( |
| 37229 |
"div", |
| 37230 |
{ |
| 37231 |
ref: setActivatorNodeRef, |
| 37232 |
...attributes, |
| 37233 |
...listeners, |
| 37234 |
style: { |
| 37235 |
height: "100%", |
| 37236 |
// Keyboard activation needs `attributes` (tabIndex) |
| 37237 |
// and `listeners` (onKeyDown) on the same focused |
| 37238 |
// node; `setActivatorNodeRef` points dnd-kit's |
| 37239 |
// keyboard sensor here, the outer keeps `setNodeRef` |
| 37240 |
// for measurement. |
| 37241 |
// |
| 37242 |
// Cursor lives on this wrapper so `actionableArea` |
| 37243 |
// children (mounted outside it) keep their own; |
| 37244 |
// `undefined` during a gesture defers to the resize |
| 37245 |
// handle's document cursor lock. |
| 37246 |
cursor: getItemCursor(disabled2, interacting) |
| 37247 |
}, |
| 37248 |
children: [ |
| 37249 |
/* @__PURE__ */ (0, import_jsx_runtime162.jsxs)("div", { className: grid_item_default["item-content"], children: [ |
| 37250 |
children, |
| 37251 |
!disabled2 && /* @__PURE__ */ (0, import_jsx_runtime162.jsx)( |
| 37252 |
ResizeHandleWrapper, |
| 37253 |
{ |
| 37254 |
itemId: item.key, |
| 37255 |
verticalResizable, |
| 37256 |
onResize: handleResize, |
| 37257 |
onResizeEnd: handleResizeEnd, |
| 37258 |
renderResizeHandle |
| 37259 |
} |
| 37260 |
) |
| 37261 |
] }), |
| 37262 |
previewOverlay |
| 37263 |
] |
| 37264 |
} |
| 37265 |
) |
| 37266 |
] }); |
| 37267 |
} |
| 37268 |
|
| 37269 |
// packages/grid/build-module/shared/grid-overlay.mjs |
| 37270 |
var import_jsx_runtime163 = __toESM(require_jsx_runtime(), 1); |
| 37271 |
var STYLE_HASH_ATTRIBUTE38 = "data-wp-hash"; |
| 37272 |
function getRuntime38() { |
| 37273 |
const globalScope = globalThis; |
| 37274 |
if (globalScope.__wpStyleRuntime) { |
| 37275 |
return globalScope.__wpStyleRuntime; |
| 37276 |
} |
| 37277 |
globalScope.__wpStyleRuntime = { |
| 37278 |
documents: /* @__PURE__ */ new Map(), |
| 37279 |
styles: /* @__PURE__ */ new Map(), |
| 37280 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 37281 |
}; |
| 37282 |
if (typeof document !== "undefined") { |
| 37283 |
registerDocument38(document); |
| 37284 |
} |
| 37285 |
return globalScope.__wpStyleRuntime; |
| 37286 |
} |
| 37287 |
function documentContainsStyleHash38(targetDocument, hash) { |
| 37288 |
if (!targetDocument.head) { |
| 37289 |
return false; |
| 37290 |
} |
| 37291 |
for (const style of targetDocument.head.querySelectorAll( |
| 37292 |
`style[${STYLE_HASH_ATTRIBUTE38}]` |
| 37293 |
)) { |
| 37294 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE38) === hash) { |
| 37295 |
return true; |
| 37296 |
} |
| 37297 |
} |
| 37298 |
return false; |
| 37299 |
} |
| 37300 |
function injectStyle38(targetDocument, hash, css) { |
| 37301 |
if (!targetDocument.head) { |
| 37302 |
return; |
| 37303 |
} |
| 37304 |
const runtime = getRuntime38(); |
| 37305 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 37306 |
if (!injectedStyles) { |
| 37307 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 37308 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 37309 |
} |
| 37310 |
if (injectedStyles.has(hash)) { |
| 37311 |
return; |
| 37312 |
} |
| 37313 |
if (documentContainsStyleHash38(targetDocument, hash)) { |
| 37314 |
injectedStyles.add(hash); |
| 37315 |
return; |
| 37316 |
} |
| 37317 |
const style = targetDocument.createElement("style"); |
| 37318 |
style.setAttribute(STYLE_HASH_ATTRIBUTE38, hash); |
| 37319 |
style.appendChild(targetDocument.createTextNode(css)); |
| 37320 |
targetDocument.head.appendChild(style); |
| 37321 |
injectedStyles.add(hash); |
| 37322 |
} |
| 37323 |
function registerDocument38(targetDocument) { |
| 37324 |
const runtime = getRuntime38(); |
| 37325 |
runtime.documents.set( |
| 37326 |
targetDocument, |
| 37327 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 37328 |
); |
| 37329 |
for (const [hash, css] of runtime.styles) { |
| 37330 |
injectStyle38(targetDocument, hash, css); |
| 37331 |
} |
| 37332 |
return () => { |
| 37333 |
const count = runtime.documents.get(targetDocument); |
| 37334 |
if (count === void 0) { |
| 37335 |
return; |
| 37336 |
} |
| 37337 |
if (count <= 1) { |
| 37338 |
runtime.documents.delete(targetDocument); |
| 37339 |
return; |
| 37340 |
} |
| 37341 |
runtime.documents.set(targetDocument, count - 1); |
| 37342 |
}; |
| 37343 |
} |
| 37344 |
function registerStyle38(hash, css) { |
| 37345 |
const runtime = getRuntime38(); |
| 37346 |
runtime.styles.set(hash, css); |
| 37347 |
for (const targetDocument of runtime.documents.keys()) { |
| 37348 |
injectStyle38(targetDocument, hash, css); |
| 37349 |
} |
| 37350 |
} |
| 37351 |
if (typeof process === "undefined" || true) { |
| 37352 |
registerStyle38("05bdcd8add", '._9d372b1b567c1c15__overlay{background-image:repeating-linear-gradient(135deg,var(--wp-grid-overlay-stripe-color,color-mix(in srgb,var(--wpds-color-bg-surface-info,#deebfa) 15%,#0000)) 0 6px,#0000 6px 12px);display:grid;inset:0;opacity:0;pointer-events:none;position:absolute;transition:opacity .2s ease,visibility 0s linear .2s;visibility:hidden}._9d372b1b567c1c15__overlay.acb42ab28bd5e371__is-active{opacity:1;transition:opacity .2s ease,visibility 0s linear 0s;visibility:visible}@media (prefers-reduced-motion:reduce){._9d372b1b567c1c15__overlay{transition:none}}._04ff499ab60b4891__column{background-color:var(--wp-grid-overlay-column-fill,color-mix(in srgb,var(--wpds-color-bg-surface-info,#deebfa) 10%,#0000));outline:1px dashed var(--wp-grid-overlay-track-color,var(--wpds-color-stroke-surface-neutral,#dbdbdb));position:relative}._1cee1202cb622c6b__has-rows ._04ff499ab60b4891__column:after{background-image:linear-gradient(to bottom,var(--wp-grid-overlay-track-color,var(--wpds-color-stroke-surface-neutral,#dbdbdb)) 0,var(--wp-grid-overlay-track-color,var(--wpds-color-stroke-surface-neutral,#dbdbdb)) 1px,#0000 1px,#0000 calc(var(--wp-grid-overlay-row-height) - 1px),var(--wp-grid-overlay-track-color,var(--wpds-color-stroke-surface-neutral,#dbdbdb)) calc(var(--wp-grid-overlay-row-height) - 1px),var(--wp-grid-overlay-track-color,var(--wpds-color-stroke-surface-neutral,#dbdbdb)) var(--wp-grid-overlay-row-height),#0000 var(--wp-grid-overlay-row-height),#0000 var(--wp-grid-overlay-row-tile));background-repeat:repeat;background-size:100% var(--wp-grid-overlay-row-tile);content:"";inset:0;mask-image:repeating-linear-gradient(90deg,#000 0 4px,#0000 4px 8px);-webkit-mask-image:repeating-linear-gradient(90deg,#000 0 4px,#0000 4px 8px);pointer-events:none;position:absolute}'); |
| 37353 |
} |
| 37354 |
var grid_overlay_default = { "overlay": "_9d372b1b567c1c15__overlay", "is-active": "acb42ab28bd5e371__is-active", "column": "_04ff499ab60b4891__column", "has-rows": "_1cee1202cb622c6b__has-rows" }; |
| 37355 |
function GridOverlay({ |
| 37356 |
columns, |
| 37357 |
gapPx, |
| 37358 |
rowHeight, |
| 37359 |
isActive |
| 37360 |
}) { |
| 37361 |
const showRows = typeof rowHeight === "number"; |
| 37362 |
const style = { |
| 37363 |
gridTemplateColumns: `repeat(${columns}, minmax(0, 1fr))`, |
| 37364 |
gap: `${gapPx}px`, |
| 37365 |
...showRows ? { |
| 37366 |
"--wp-grid-overlay-row-height": `${rowHeight}px`, |
| 37367 |
"--wp-grid-overlay-row-tile": `${rowHeight + gapPx}px` |
| 37368 |
} : {} |
| 37369 |
}; |
| 37370 |
return /* @__PURE__ */ (0, import_jsx_runtime163.jsx)( |
| 37371 |
"div", |
| 37372 |
{ |
| 37373 |
"aria-hidden": true, |
| 37374 |
className: clsx_default( |
| 37375 |
grid_overlay_default.overlay, |
| 37376 |
isActive && grid_overlay_default["is-active"], |
| 37377 |
showRows && grid_overlay_default["has-rows"] |
| 37378 |
), |
| 37379 |
style, |
| 37380 |
children: Array.from({ length: columns }).map((_, i2) => /* @__PURE__ */ (0, import_jsx_runtime163.jsx)("div", { className: grid_overlay_default.column }, i2)) |
| 37381 |
} |
| 37382 |
); |
| 37383 |
} |
| 37384 |
|
| 37385 |
// packages/grid/build-module/dashboard-grid/resolve-fill-widths.mjs |
| 37386 |
function resolveFillWidths(sortedKeys, layoutMap, maxColumns) { |
| 37387 |
const resolved = /* @__PURE__ */ new Map(); |
| 37388 |
const n2 = sortedKeys.length; |
| 37389 |
const items = new Array(n2); |
| 37390 |
const widths = new Array(n2); |
| 37391 |
const heights = new Array(n2); |
| 37392 |
let hasFill = false; |
| 37393 |
let hasMultiRow = false; |
| 37394 |
let totalRows = 0; |
| 37395 |
for (let i2 = 0; i2 < n2; i2++) { |
| 37396 |
const item = layoutMap.get(sortedKeys[i2]); |
| 37397 |
items[i2] = item; |
| 37398 |
widths[i2] = item && typeof item.width === "number" ? Math.min(item.width, maxColumns) : 1; |
| 37399 |
const h2 = Math.max(1, Math.floor(item?.height ?? 1)); |
| 37400 |
heights[i2] = h2; |
| 37401 |
if (item?.width === "fill") { |
| 37402 |
hasFill = true; |
| 37403 |
} |
| 37404 |
if (h2 > 1) { |
| 37405 |
hasMultiRow = true; |
| 37406 |
} |
| 37407 |
totalRows += h2; |
| 37408 |
} |
| 37409 |
if (!hasFill) { |
| 37410 |
return resolved; |
| 37411 |
} |
| 37412 |
if (!hasMultiRow) { |
| 37413 |
let currentCol = 0; |
| 37414 |
for (let i2 = 0; i2 < n2; i2++) { |
| 37415 |
const item = items[i2]; |
| 37416 |
if (!item) { |
| 37417 |
continue; |
| 37418 |
} |
| 37419 |
if (item.width === "full") { |
| 37420 |
currentCol = 0; |
| 37421 |
continue; |
| 37422 |
} |
| 37423 |
if (item.width === "fill") { |
| 37424 |
let reserved = 0; |
| 37425 |
for (let j2 = i2 + 1; j2 < n2; j2++) { |
| 37426 |
const next = items[j2]; |
| 37427 |
if (!next || next.width === "full" || next.width === "fill") { |
| 37428 |
break; |
| 37429 |
} |
| 37430 |
const nextW = widths[j2]; |
| 37431 |
if (currentCol + 1 + reserved + nextW <= maxColumns) { |
| 37432 |
reserved += nextW; |
| 37433 |
} else { |
| 37434 |
break; |
| 37435 |
} |
| 37436 |
} |
| 37437 |
const fillCols = Math.max( |
| 37438 |
1, |
| 37439 |
maxColumns - currentCol - reserved |
| 37440 |
); |
| 37441 |
resolved.set(item.key, fillCols); |
| 37442 |
currentCol += fillCols; |
| 37443 |
} else { |
| 37444 |
const w2 = widths[i2]; |
| 37445 |
if (currentCol + w2 > maxColumns) { |
| 37446 |
currentCol = 0; |
| 37447 |
} |
| 37448 |
currentCol += w2; |
| 37449 |
} |
| 37450 |
if (currentCol >= maxColumns) { |
| 37451 |
currentCol = 0; |
| 37452 |
} |
| 37453 |
} |
| 37454 |
return resolved; |
| 37455 |
} |
| 37456 |
const rowOccupancy = new Array(maxColumns).fill(0); |
| 37457 |
let cursorRow = 0; |
| 37458 |
let cursorCol = 0; |
| 37459 |
for (let i2 = 0; i2 < n2; i2++) { |
| 37460 |
const item = items[i2]; |
| 37461 |
if (!item) { |
| 37462 |
continue; |
| 37463 |
} |
| 37464 |
const h2 = heights[i2]; |
| 37465 |
if (item.width === "full") { |
| 37466 |
let r22 = cursorRow; |
| 37467 |
for (let c22 = 0; c22 < maxColumns; c22++) { |
| 37468 |
if (rowOccupancy[c22] > r22) { |
| 37469 |
r22 = rowOccupancy[c22]; |
| 37470 |
} |
| 37471 |
} |
| 37472 |
for (let c22 = 0; c22 < maxColumns; c22++) { |
| 37473 |
rowOccupancy[c22] = r22 + h2; |
| 37474 |
} |
| 37475 |
cursorRow = r22 + h2; |
| 37476 |
cursorCol = 0; |
| 37477 |
continue; |
| 37478 |
} |
| 37479 |
if (item.width === "fill") { |
| 37480 |
let r22 = cursorRow; |
| 37481 |
let c22 = cursorCol; |
| 37482 |
scan: for (; r22 <= totalRows; r22++) { |
| 37483 |
const start = r22 === cursorRow ? cursorCol : 0; |
| 37484 |
for (c22 = start; c22 < maxColumns; c22++) { |
| 37485 |
if (rowOccupancy[c22] <= r22) { |
| 37486 |
break scan; |
| 37487 |
} |
| 37488 |
} |
| 37489 |
} |
| 37490 |
const fillStartRow = r22; |
| 37491 |
const fillStartCol = c22; |
| 37492 |
let runLength = 0; |
| 37493 |
while (fillStartCol + runLength < maxColumns && rowOccupancy[fillStartCol + runLength] <= fillStartRow) { |
| 37494 |
runLength++; |
| 37495 |
} |
| 37496 |
let reserved = 0; |
| 37497 |
for (let j2 = i2 + 1; j2 < n2; j2++) { |
| 37498 |
const next = items[j2]; |
| 37499 |
if (!next || next.width === "full" || next.width === "fill") { |
| 37500 |
break; |
| 37501 |
} |
| 37502 |
const nextW = widths[j2]; |
| 37503 |
if (1 + reserved + nextW <= runLength) { |
| 37504 |
reserved += nextW; |
| 37505 |
} else { |
| 37506 |
break; |
| 37507 |
} |
| 37508 |
} |
| 37509 |
const fillCols = Math.max(1, runLength - reserved); |
| 37510 |
resolved.set(item.key, fillCols); |
| 37511 |
for (let k = 0; k < fillCols; k++) { |
| 37512 |
rowOccupancy[fillStartCol + k] = fillStartRow + h2; |
| 37513 |
} |
| 37514 |
cursorRow = fillStartRow; |
| 37515 |
cursorCol = fillStartCol + fillCols; |
| 37516 |
continue; |
| 37517 |
} |
| 37518 |
const w2 = widths[i2]; |
| 37519 |
let r3 = cursorRow; |
| 37520 |
let c2 = cursorCol; |
| 37521 |
place: for (; r3 <= totalRows; r3++) { |
| 37522 |
c2 = r3 === cursorRow ? cursorCol : 0; |
| 37523 |
while (c2 + w2 <= maxColumns) { |
| 37524 |
let blocked = -1; |
| 37525 |
for (let k = 0; k < w2; k++) { |
| 37526 |
if (rowOccupancy[c2 + k] > r3) { |
| 37527 |
blocked = c2 + k; |
| 37528 |
break; |
| 37529 |
} |
| 37530 |
} |
| 37531 |
if (blocked === -1) { |
| 37532 |
break place; |
| 37533 |
} |
| 37534 |
c2 = blocked + 1; |
| 37535 |
} |
| 37536 |
} |
| 37537 |
for (let k = 0; k < w2; k++) { |
| 37538 |
rowOccupancy[c2 + k] = r3 + h2; |
| 37539 |
} |
| 37540 |
cursorRow = r3; |
| 37541 |
cursorCol = c2 + w2; |
| 37542 |
} |
| 37543 |
return resolved; |
| 37544 |
} |
| 37545 |
|
| 37546 |
// packages/grid/build-module/dashboard-grid/index.mjs |
| 37547 |
var import_jsx_runtime164 = __toESM(require_jsx_runtime(), 1); |
| 37548 |
var STYLE_HASH_ATTRIBUTE39 = "data-wp-hash"; |
| 37549 |
function getRuntime39() { |
| 37550 |
const globalScope = globalThis; |
| 37551 |
if (globalScope.__wpStyleRuntime) { |
| 37552 |
return globalScope.__wpStyleRuntime; |
| 37553 |
} |
| 37554 |
globalScope.__wpStyleRuntime = { |
| 37555 |
documents: /* @__PURE__ */ new Map(), |
| 37556 |
styles: /* @__PURE__ */ new Map(), |
| 37557 |
injectedStyles: /* @__PURE__ */ new WeakMap() |
| 37558 |
}; |
| 37559 |
if (typeof document !== "undefined") { |
| 37560 |
registerDocument39(document); |
| 37561 |
} |
| 37562 |
return globalScope.__wpStyleRuntime; |
| 37563 |
} |
| 37564 |
function documentContainsStyleHash39(targetDocument, hash) { |
| 37565 |
if (!targetDocument.head) { |
| 37566 |
return false; |
| 37567 |
} |
| 37568 |
for (const style of targetDocument.head.querySelectorAll( |
| 37569 |
`style[${STYLE_HASH_ATTRIBUTE39}]` |
| 37570 |
)) { |
| 37571 |
if (style.getAttribute(STYLE_HASH_ATTRIBUTE39) === hash) { |
| 37572 |
return true; |
| 37573 |
} |
| 37574 |
} |
| 37575 |
return false; |
| 37576 |
} |
| 37577 |
function injectStyle39(targetDocument, hash, css) { |
| 37578 |
if (!targetDocument.head) { |
| 37579 |
return; |
| 37580 |
} |
| 37581 |
const runtime = getRuntime39(); |
| 37582 |
let injectedStyles = runtime.injectedStyles.get(targetDocument); |
| 37583 |
if (!injectedStyles) { |
| 37584 |
injectedStyles = /* @__PURE__ */ new Set(); |
| 37585 |
runtime.injectedStyles.set(targetDocument, injectedStyles); |
| 37586 |
} |
| 37587 |
if (injectedStyles.has(hash)) { |
| 37588 |
return; |
| 37589 |
} |
| 37590 |
if (documentContainsStyleHash39(targetDocument, hash)) { |
| 37591 |
injectedStyles.add(hash); |
| 37592 |
return; |
| 37593 |
} |
| 37594 |
const style = targetDocument.createElement("style"); |
| 37595 |
style.setAttribute(STYLE_HASH_ATTRIBUTE39, hash); |
| 37596 |
style.appendChild(targetDocument.createTextNode(css)); |
| 37597 |
targetDocument.head.appendChild(style); |
| 37598 |
injectedStyles.add(hash); |
| 37599 |
} |
| 37600 |
function registerDocument39(targetDocument) { |
| 37601 |
const runtime = getRuntime39(); |
| 37602 |
runtime.documents.set( |
| 37603 |
targetDocument, |
| 37604 |
(runtime.documents.get(targetDocument) ?? 0) + 1 |
| 37605 |
); |
| 37606 |
for (const [hash, css] of runtime.styles) { |
| 37607 |
injectStyle39(targetDocument, hash, css); |
| 37608 |
} |
| 37609 |
return () => { |
| 37610 |
const count = runtime.documents.get(targetDocument); |
| 37611 |
if (count === void 0) { |
| 37612 |
return; |
| 37613 |
} |
| 37614 |
if (count <= 1) { |
| 37615 |
runtime.documents.delete(targetDocument); |
| 37616 |
return; |
| 37617 |
} |
| 37618 |
runtime.documents.set(targetDocument, count - 1); |
| 37619 |
}; |
| 37620 |
} |
| 37621 |
function registerStyle39(hash, css) { |
| 37622 |
const runtime = getRuntime39(); |
| 37623 |
runtime.styles.set(hash, css); |
| 37624 |
for (const targetDocument of runtime.documents.keys()) { |
| 37625 |
injectStyle39(targetDocument, hash, css); |
| 37626 |
} |
| 37627 |
} |
| 37628 |
if (typeof process === "undefined" || true) { |
| 37629 |
registerStyle39("faf48c5174", "._960c435c33759f46__grid{display:grid;position:relative}._48e8cd4225dcb813__drag-preview-frame{cursor:grabbing;height:100%;pointer-events:none;transform:scale(var(--wp-grid-drag-preview-scale,1.05))}@media (prefers-reduced-motion:reduce){._48e8cd4225dcb813__drag-preview-frame{transform:none}}"); |
| 37630 |
} |
| 37631 |
var grid_default2 = { "grid": "_960c435c33759f46__grid", "drag-preview-frame": "_48e8cd4225dcb813__drag-preview-frame" }; |
| 37632 |
var NO_SORT_STRATEGY = () => null; |
| 37633 |
var DashboardGrid = (0, import_element129.forwardRef)( |
| 37634 |
function DashboardGrid2(props, ref) { |
| 37635 |
const { |
| 37636 |
layout, |
| 37637 |
columns = 6, |
| 37638 |
children, |
| 37639 |
className, |
| 37640 |
style, |
| 37641 |
spacing = 2, |
| 37642 |
rowHeight = "auto", |
| 37643 |
minColumnWidth, |
| 37644 |
editMode = false, |
| 37645 |
onChangeLayout, |
| 37646 |
onPreviewLayout, |
| 37647 |
renderResizeHandle, |
| 37648 |
renderDragPreview, |
| 37649 |
renderGridOverlay, |
| 37650 |
...divProps |
| 37651 |
} = props; |
| 37652 |
const [temporaryLayout, setTemporaryLayout] = (0, import_element129.useState)(); |
| 37653 |
const [activeId, setActiveId] = (0, import_element129.useState)(null); |
| 37654 |
const [isResizing, setIsResizing] = (0, import_element129.useState)(false); |
| 37655 |
const latestLayoutRef = (0, import_element129.useRef)(); |
| 37656 |
const lastReorderCursorRef = (0, import_element129.useRef)(null); |
| 37657 |
const resizeBaselineRef = (0, import_element129.useRef)(null); |
| 37658 |
const activeLayout = temporaryLayout ?? layout; |
| 37659 |
const rootRef = (0, import_element129.useRef)(null); |
| 37660 |
const [containerWidth, setContainerWidth] = (0, import_element129.useState)(0); |
| 37661 |
const resizeObserverRef = (0, import_compose19.useResizeObserver)( |
| 37662 |
([{ contentRect }]) => { |
| 37663 |
setContainerWidth(contentRect.width); |
| 37664 |
} |
| 37665 |
); |
| 37666 |
const mergedGridRef = (0, import_compose19.useMergeRefs)([ |
| 37667 |
rootRef, |
| 37668 |
resizeObserverRef, |
| 37669 |
ref |
| 37670 |
]); |
| 37671 |
(0, import_element129.useLayoutEffect)(() => { |
| 37672 |
if (rootRef.current) { |
| 37673 |
const { width } = rootRef.current.getBoundingClientRect(); |
| 37674 |
if (width > 0) { |
| 37675 |
setContainerWidth(width); |
| 37676 |
} |
| 37677 |
} |
| 37678 |
}, []); |
| 37679 |
const gapPx = spacing * 4; |
| 37680 |
const effectiveColumns = (0, import_element129.useMemo)(() => { |
| 37681 |
if (!minColumnWidth) { |
| 37682 |
return columns; |
| 37683 |
} |
| 37684 |
const totalWidthPerColumn = minColumnWidth + gapPx; |
| 37685 |
const maxColumns = Math.floor( |
| 37686 |
(containerWidth + gapPx) / totalWidthPerColumn |
| 37687 |
); |
| 37688 |
return Math.max(1, maxColumns); |
| 37689 |
}, [minColumnWidth, gapPx, containerWidth, columns]); |
| 37690 |
const columnWidth = (containerWidth - (effectiveColumns - 1) * gapPx) / effectiveColumns; |
| 37691 |
const layoutMap = (0, import_element129.useMemo)(() => { |
| 37692 |
const map = /* @__PURE__ */ new Map(); |
| 37693 |
activeLayout.forEach((item) => map.set(item.key, item)); |
| 37694 |
return map; |
| 37695 |
}, [activeLayout]); |
| 37696 |
const layoutKeysSig = layout.map((item) => item.key).join("\0"); |
| 37697 |
const layoutKeysRef = (0, import_element129.useRef)(null); |
| 37698 |
if (layoutKeysRef.current?.sig !== layoutKeysSig) { |
| 37699 |
layoutKeysRef.current = { |
| 37700 |
sig: layoutKeysSig, |
| 37701 |
set: new Set(layout.map((item) => item.key)) |
| 37702 |
}; |
| 37703 |
} |
| 37704 |
const layoutKeys = layoutKeysRef.current.set; |
| 37705 |
const sortedItems = activeLayout.map((item, index2) => ({ item, index: index2 })).sort( |
| 37706 |
(a2, b2) => (a2.item.order ?? a2.index) - (b2.item.order ?? b2.index) |
| 37707 |
).map(({ item }) => item.key); |
| 37708 |
const itemsSig = sortedItems.join("\0"); |
| 37709 |
const itemsRef = (0, import_element129.useRef)(null); |
| 37710 |
if (itemsRef.current?.sig !== itemsSig) { |
| 37711 |
itemsRef.current = { sig: itemsSig, arr: sortedItems }; |
| 37712 |
} |
| 37713 |
const items = itemsRef.current.arr; |
| 37714 |
const resolvedItemMap = (0, import_element129.useMemo)(() => { |
| 37715 |
const fillWidths = resolveFillWidths( |
| 37716 |
items, |
| 37717 |
layoutMap, |
| 37718 |
effectiveColumns |
| 37719 |
); |
| 37720 |
if (fillWidths.size === 0) { |
| 37721 |
return layoutMap; |
| 37722 |
} |
| 37723 |
const map = /* @__PURE__ */ new Map(); |
| 37724 |
for (const [key2, item] of layoutMap) { |
| 37725 |
const fillW = fillWidths.get(key2); |
| 37726 |
map.set( |
| 37727 |
key2, |
| 37728 |
fillW !== void 0 ? { ...item, width: fillW } : item |
| 37729 |
); |
| 37730 |
} |
| 37731 |
return map; |
| 37732 |
}, [items, layoutMap, effectiveColumns]); |
| 37733 |
const [childrenMap, actionableAreaMap, remaining] = (0, import_element129.useMemo)(() => { |
| 37734 |
const childMap = /* @__PURE__ */ new Map(); |
| 37735 |
const actionableMap = /* @__PURE__ */ new Map(); |
| 37736 |
const rest = []; |
| 37737 |
import_element129.Children.forEach(children, (child) => { |
| 37738 |
if (!(0, import_element129.isValidElement)(child)) { |
| 37739 |
rest.push(child); |
| 37740 |
return; |
| 37741 |
} |
| 37742 |
const key2 = child.key?.toString(); |
| 37743 |
if (key2 && layoutKeys.has(key2)) { |
| 37744 |
const { actionableArea } = child.props; |
| 37745 |
if (actionableArea !== void 0) { |
| 37746 |
actionableMap.set(key2, actionableArea); |
| 37747 |
childMap.set( |
| 37748 |
key2, |
| 37749 |
(0, import_element129.cloneElement)(child, { actionableArea: void 0 }) |
| 37750 |
); |
| 37751 |
} else { |
| 37752 |
childMap.set(key2, child); |
| 37753 |
} |
| 37754 |
} else { |
| 37755 |
rest.push(child); |
| 37756 |
} |
| 37757 |
}); |
| 37758 |
return [childMap, actionableMap, rest]; |
| 37759 |
}, [children, layoutKeys]); |
| 37760 |
const sensors = useSensors( |
| 37761 |
useSensor(PointerSensor), |
| 37762 |
useSensor(KeyboardSensor, { |
| 37763 |
coordinateGetter: sortableKeyboardCoordinates |
| 37764 |
}) |
| 37765 |
); |
| 37766 |
const handleDragStart = (0, import_compose19.useEvent)((event) => { |
| 37767 |
setActiveId(String(event.active.id)); |
| 37768 |
lastReorderCursorRef.current = null; |
| 37769 |
}); |
| 37770 |
const handleDragCancel = (0, import_compose19.useEvent)(() => { |
| 37771 |
setActiveId(null); |
| 37772 |
latestLayoutRef.current = void 0; |
| 37773 |
lastReorderCursorRef.current = null; |
| 37774 |
resizeBaselineRef.current = null; |
| 37775 |
setIsResizing(false); |
| 37776 |
setTemporaryLayout(void 0); |
| 37777 |
}); |
| 37778 |
const handleDragMove = (0, import_compose19.useEvent)((event) => { |
| 37779 |
const { active, over } = event; |
| 37780 |
if (!over || active.id === over.id) { |
| 37781 |
return; |
| 37782 |
} |
| 37783 |
const activeRect = active.rect.current.translated; |
| 37784 |
if (!activeRect) { |
| 37785 |
return; |
| 37786 |
} |
| 37787 |
const activeCenterX = activeRect.left + activeRect.width / 2; |
| 37788 |
const activeCenterY = activeRect.top + activeRect.height / 2; |
| 37789 |
const lastCursor = lastReorderCursorRef.current; |
| 37790 |
if (lastCursor) { |
| 37791 |
const dx = activeCenterX - lastCursor.x; |
| 37792 |
const dy = activeCenterY - lastCursor.y; |
| 37793 |
if (dx * dx + dy * dy < 100) { |
| 37794 |
return; |
| 37795 |
} |
| 37796 |
} |
| 37797 |
const overCenterX = over.rect.left + over.rect.width / 2; |
| 37798 |
const insertAfter = activeCenterX > overCenterX; |
| 37799 |
const currentIndex = items.indexOf(String(active.id)); |
| 37800 |
const overIndex = items.indexOf(String(over.id)); |
| 37801 |
let newIndex; |
| 37802 |
if (insertAfter) { |
| 37803 |
newIndex = currentIndex > overIndex ? overIndex + 1 : overIndex; |
| 37804 |
} else { |
| 37805 |
newIndex = currentIndex > overIndex ? overIndex : overIndex - 1; |
| 37806 |
} |
| 37807 |
newIndex = Math.max(0, Math.min(newIndex, items.length - 1)); |
| 37808 |
if (newIndex === currentIndex) { |
| 37809 |
return; |
| 37810 |
} |
| 37811 |
const updatedItems = arrayMove(items, currentIndex, newIndex); |
| 37812 |
const updatedLayout = activeLayout.map((item) => ({ |
| 37813 |
...item, |
| 37814 |
order: updatedItems.indexOf(item.key) |
| 37815 |
})); |
| 37816 |
lastReorderCursorRef.current = { |
| 37817 |
x: activeCenterX, |
| 37818 |
y: activeCenterY |
| 37819 |
}; |
| 37820 |
latestLayoutRef.current = updatedLayout; |
| 37821 |
setTemporaryLayout(updatedLayout); |
| 37822 |
onPreviewLayout?.(updatedLayout); |
| 37823 |
}); |
| 37824 |
const persistTemporaryLayout = (0, import_compose19.useEvent)(() => { |
| 37825 |
const latest = latestLayoutRef.current; |
| 37826 |
latestLayoutRef.current = void 0; |
| 37827 |
resizeBaselineRef.current = null; |
| 37828 |
setIsResizing(false); |
| 37829 |
if (!onChangeLayout || !latest) { |
| 37830 |
return; |
| 37831 |
} |
| 37832 |
onChangeLayout(latest); |
| 37833 |
setTemporaryLayout(void 0); |
| 37834 |
}); |
| 37835 |
const handleResize = (0, import_compose19.useEvent)((id, delta) => { |
| 37836 |
if (!editMode) { |
| 37837 |
return; |
| 37838 |
} |
| 37839 |
if (!isResizing) { |
| 37840 |
setIsResizing(true); |
| 37841 |
} |
| 37842 |
const relativeDelta = { |
| 37843 |
width: Math.round(delta.width / (columnWidth + gapPx)), |
| 37844 |
height: rowHeight === "auto" ? 0 : Math.round(delta.height / (rowHeight + gapPx)) |
| 37845 |
}; |
| 37846 |
if (!resizeBaselineRef.current) { |
| 37847 |
const baseItem = activeLayout.find( |
| 37848 |
(item) => item.key === id |
| 37849 |
); |
| 37850 |
const resolvedItem = resolvedItemMap.get(id); |
| 37851 |
let baseWidth; |
| 37852 |
if (baseItem?.width === "full") { |
| 37853 |
baseWidth = effectiveColumns; |
| 37854 |
} else if (baseItem?.width === "fill") { |
| 37855 |
baseWidth = typeof resolvedItem?.width === "number" ? resolvedItem.width : 1; |
| 37856 |
} else { |
| 37857 |
baseWidth = baseItem?.width ?? 1; |
| 37858 |
} |
| 37859 |
resizeBaselineRef.current = { |
| 37860 |
width: baseWidth, |
| 37861 |
height: baseItem?.height ?? 1 |
| 37862 |
}; |
| 37863 |
} |
| 37864 |
const baseline = resizeBaselineRef.current; |
| 37865 |
const newWidth = Math.max( |
| 37866 |
1, |
| 37867 |
Math.min( |
| 37868 |
baseline.width + relativeDelta.width, |
| 37869 |
effectiveColumns |
| 37870 |
) |
| 37871 |
); |
| 37872 |
const newHeight = Math.max( |
| 37873 |
1, |
| 37874 |
baseline.height + relativeDelta.height |
| 37875 |
); |
| 37876 |
const currentItem = activeLayout.find( |
| 37877 |
(item) => item.key === id |
| 37878 |
); |
| 37879 |
if (currentItem && currentItem.width === newWidth && (currentItem.height ?? 1) === newHeight) { |
| 37880 |
return; |
| 37881 |
} |
| 37882 |
const updatedLayout = activeLayout.map( |
| 37883 |
(item) => item.key === id ? { ...item, width: newWidth, height: newHeight } : item |
| 37884 |
); |
| 37885 |
latestLayoutRef.current = updatedLayout; |
| 37886 |
setTemporaryLayout(updatedLayout); |
| 37887 |
onPreviewLayout?.(updatedLayout); |
| 37888 |
}); |
| 37889 |
const activeClone = activeId ? childrenMap.get(activeId) : null; |
| 37890 |
const DragPreview = renderDragPreview; |
| 37891 |
const dragOverlayContent = activeId && activeClone ? /* @__PURE__ */ (0, import_jsx_runtime164.jsx)("div", { className: grid_default2["drag-preview-frame"], children: DragPreview ? /* @__PURE__ */ (0, import_jsx_runtime164.jsx)(DragPreview, { itemId: activeId, children: activeClone }) : activeClone }) : null; |
| 37892 |
const Overlay = renderGridOverlay ?? GridOverlay; |
| 37893 |
const overlayRowHeight = typeof rowHeight === "number" ? rowHeight : void 0; |
| 37894 |
const gridOverlay = (0, import_element129.useMemo)( |
| 37895 |
() => /* @__PURE__ */ (0, import_jsx_runtime164.jsx)( |
| 37896 |
Overlay, |
| 37897 |
{ |
| 37898 |
columns: effectiveColumns, |
| 37899 |
gapPx, |
| 37900 |
rowHeight: overlayRowHeight, |
| 37901 |
isActive: editMode |
| 37902 |
} |
| 37903 |
), |
| 37904 |
[Overlay, editMode, effectiveColumns, gapPx, overlayRowHeight] |
| 37905 |
); |
| 37906 |
return /* @__PURE__ */ (0, import_jsx_runtime164.jsxs)( |
| 37907 |
DndContext, |
| 37908 |
{ |
| 37909 |
sensors, |
| 37910 |
onDragStart: handleDragStart, |
| 37911 |
onDragCancel: handleDragCancel, |
| 37912 |
onDragMove: handleDragMove, |
| 37913 |
onDragEnd: () => { |
| 37914 |
persistTemporaryLayout(); |
| 37915 |
setActiveId(null); |
| 37916 |
lastReorderCursorRef.current = null; |
| 37917 |
}, |
| 37918 |
children: [ |
| 37919 |
/* @__PURE__ */ (0, import_jsx_runtime164.jsx)(SortableContext, { items, strategy: NO_SORT_STRATEGY, children: /* @__PURE__ */ (0, import_jsx_runtime164.jsxs)( |
| 37920 |
"div", |
| 37921 |
{ |
| 37922 |
...divProps, |
| 37923 |
ref: mergedGridRef, |
| 37924 |
className: clsx_default(grid_default2.grid, className), |
| 37925 |
style: { |
| 37926 |
...style, |
| 37927 |
gridTemplateColumns: `repeat(${effectiveColumns}, minmax(0, 1fr))`, |
| 37928 |
gridAutoRows: rowHeight, |
| 37929 |
gap: gapPx |
| 37930 |
}, |
| 37931 |
children: [ |
| 37932 |
gridOverlay, |
| 37933 |
items.map((id) => /* @__PURE__ */ (0, import_jsx_runtime164.jsx)( |
| 37934 |
GridItem4, |
| 37935 |
{ |
| 37936 |
item: resolvedItemMap.get( |
| 37937 |
id |
| 37938 |
), |
| 37939 |
maxColumns: effectiveColumns, |
| 37940 |
disabled: !editMode, |
| 37941 |
verticalResizable: rowHeight !== "auto", |
| 37942 |
interacting: activeId !== null || isResizing, |
| 37943 |
onResize: handleResize, |
| 37944 |
onResizeEnd: persistTemporaryLayout, |
| 37945 |
actionableArea: actionableAreaMap.get(id), |
| 37946 |
renderResizeHandle, |
| 37947 |
children: childrenMap.get(id) |
| 37948 |
}, |
| 37949 |
id |
| 37950 |
)), |
| 37951 |
remaining |
| 37952 |
] |
| 37953 |
} |
| 37954 |
) }), |
| 37955 |
/* @__PURE__ */ (0, import_jsx_runtime164.jsx)(DragOverlay, { children: dragOverlayContent }) |
| 37956 |
] |
| 37957 |
} |
| 37958 |
); |
| 37959 |
} |
| 37960 |
); |
| 37961 |
|
| 37962 |
// routes/dashboard/widget-dashboard/components/widgets/widgets.module.css |
| 37963 |
if (typeof process === "undefined" || true) { |
| 37964 |
registerStyle35("b78cb44834", "._561eb2c5c7cbcb6b__grid{width:100%}._8fa4ad5c2e86a6b9__tile{border-radius:var(--wpds-border-radius-lg,8px);height:100%}._8a257ea80aac989e__tileEditMode{box-shadow:var(--wpds-elevation-xs,0 1px 1px 0 #00000008,0 1px 2px 0 #00000005,0 3px 3px 0 #00000005,0 4px 4px 0 #00000003)}._8a257ea80aac989e__tileEditMode:focus-visible,._8a257ea80aac989e__tileEditMode:hover{box-shadow:var(--wpds-elevation-md,0 2px 3px 0 #0000000d,0 4px 5px 0 #0000000a,0 12px 12px 0 #00000008,0 16px 16px 0 #00000005)}._8a257ea80aac989e__tileEditMode:focus-visible{outline:var(--wpds-border-width-focus,var(--wp-admin-border-width-focus,2px)) solid var(--wpds-color-stroke-focus-brand,var(--wp-admin-theme-color,#3858e9));outline-offset:2px}._48e2b8516636ed6b__dragPreview{height:100%}._48e2b8516636ed6b__dragPreview ._8fa4ad5c2e86a6b9__tile{box-shadow:var(--wpds-elevation-md,0 2px 3px 0 #0000000d,0 4px 5px 0 #0000000a,0 12px 12px 0 #00000008,0 16px 16px 0 #00000005)}@media not (prefers-reduced-motion){._8fa4ad5c2e86a6b9__tile{transition:box-shadow var(--wpds-motion-duration-md,.2s) var(--wpds-motion-easing-subtle,cubic-bezier(.15,0,.15,1))}}"); |
| 37965 |
} |
| 37966 |
var widgets_default = { "grid": "_561eb2c5c7cbcb6b__grid", "tile": "_8fa4ad5c2e86a6b9__tile", "tileEditMode": "_8a257ea80aac989e__tileEditMode", "dragPreview": "_48e2b8516636ed6b__dragPreview" }; |
| 37967 |
|
| 37968 |
// routes/dashboard/widget-dashboard/components/widgets/widgets.tsx |
| 37969 |
var import_jsx_runtime165 = __toESM(require_jsx_runtime()); |
| 37970 |
function toGridLayout(widgets) { |
| 37971 |
return widgets.map((w2) => ({ |
| 37972 |
key: w2.uuid, |
| 37973 |
...w2.placement |
| 37974 |
})); |
| 37975 |
} |
| 37976 |
function applyGridChange(widgets, gridLayout) { |
| 37977 |
return gridLayout.map(({ key: key2, ...placement }) => { |
| 37978 |
const existing = widgets.find((w2) => w2.uuid === key2); |
| 37979 |
if (!existing) { |
| 37980 |
return { |
| 37981 |
uuid: key2, |
| 37982 |
type: "", |
| 37983 |
placement |
| 37984 |
}; |
| 37985 |
} |
| 37986 |
return { |
| 37987 |
...existing, |
| 37988 |
placement |
| 37989 |
}; |
| 37990 |
}); |
| 37991 |
} |
| 37992 |
var Widgets = (0, import_element130.forwardRef)( |
| 37993 |
function Widgets2({ className }, ref) { |
| 37994 |
const { layout, onLayoutChange, editMode, gridSettings } = useDashboardInternalContext(); |
| 37995 |
const gridLayout = (0, import_element130.useMemo)(() => toGridLayout(layout), [layout]); |
| 37996 |
const handleLayoutChange = (0, import_element130.useCallback)( |
| 37997 |
(newGridLayout) => { |
| 37998 |
onLayoutChange(applyGridChange(layout, newGridLayout)); |
| 37999 |
}, |
| 38000 |
[layout, onLayoutChange] |
| 38001 |
); |
| 38002 |
const children = layout.map((widget, index2) => /* @__PURE__ */ (0, import_jsx_runtime165.jsx)( |
| 38003 |
"div", |
| 38004 |
{ |
| 38005 |
className: clsx_default(widgets_default.tile, { |
| 38006 |
[widgets_default.tileEditMode]: editMode |
| 38007 |
}), |
| 38008 |
tabIndex: editMode ? 0 : void 0, |
| 38009 |
children: /* @__PURE__ */ (0, import_jsx_runtime165.jsx)(WidgetChrome, { widget, index: index2 }) |
| 38010 |
}, |
| 38011 |
widget.uuid |
| 38012 |
)); |
| 38013 |
const renderDragPreview = (0, import_element130.useCallback)( |
| 38014 |
({ children: clone }) => /* @__PURE__ */ (0, import_jsx_runtime165.jsx)("div", { className: widgets_default.dragPreview, children: clone }), |
| 38015 |
[] |
| 38016 |
); |
| 38017 |
const sharedProps = { |
| 38018 |
layout: gridLayout, |
| 38019 |
spacing: gridSettings.spacing, |
| 38020 |
rowHeight: gridSettings.rowHeight, |
| 38021 |
editMode, |
| 38022 |
onChangeLayout: handleLayoutChange, |
| 38023 |
renderDragPreview |
| 38024 |
}; |
| 38025 |
return /* @__PURE__ */ (0, import_jsx_runtime165.jsx)("div", { ref, className: clsx_default(widgets_default.grid, className), children: gridSettings.columns !== void 0 ? /* @__PURE__ */ (0, import_jsx_runtime165.jsx)( |
| 38026 |
DashboardGrid, |
| 38027 |
{ |
| 38028 |
...sharedProps, |
| 38029 |
columns: gridSettings.columns, |
| 38030 |
children |
| 38031 |
} |
| 38032 |
) : /* @__PURE__ */ (0, import_jsx_runtime165.jsx)( |
| 38033 |
DashboardGrid, |
| 38034 |
{ |
| 38035 |
...sharedProps, |
| 38036 |
minColumnWidth: gridSettings.minColumnWidth, |
| 38037 |
children |
| 38038 |
} |
| 38039 |
) }); |
| 38040 |
} |
| 38041 |
); |
| 38042 |
|
| 38043 |
// routes/dashboard/widget-dashboard/components/no-widgets-state/no-widgets-state.tsx |
| 38044 |
var import_i18n53 = __toESM(require_i18n()); |
| 38045 |
|
| 38046 |
// routes/dashboard/widget-dashboard/components/no-widgets-state/no-widgets-state.module.css |
| 38047 |
if (typeof process === "undefined" || true) { |
| 38048 |
registerStyle35("4dec2ea292", "._43aa5df1b0907556__root{padding-block-start:calc(var(--wpds-dimension-padding-3xl, 32px)*3.5)}"); |
| 38049 |
} |
| 38050 |
var no_widgets_state_default = { "root": "_43aa5df1b0907556__root" }; |
| 38051 |
|
| 38052 |
// routes/dashboard/widget-dashboard/components/no-widgets-state/no-widgets-state.tsx |
| 38053 |
var import_jsx_runtime166 = __toESM(require_jsx_runtime()); |
| 38054 |
function NoWidgetsStateImpl({ children }) { |
| 38055 |
const { layout } = useDashboardInternalContext(); |
| 38056 |
if (layout.length > 0) { |
| 38057 |
return null; |
| 38058 |
} |
| 38059 |
return /* @__PURE__ */ (0, import_jsx_runtime166.jsx)(Stack, { justify: "center", align: "center", className: no_widgets_state_default.root, children: children ?? /* @__PURE__ */ (0, import_jsx_runtime166.jsxs)(empty_state_exports.Root, { children: [ |
| 38060 |
/* @__PURE__ */ (0, import_jsx_runtime166.jsx)(empty_state_exports.Icon, { icon: home_default }), |
| 38061 |
/* @__PURE__ */ (0, import_jsx_runtime166.jsx)(empty_state_exports.Title, { children: (0, import_i18n53.__)("Your dashboard is empty") }), |
| 38062 |
/* @__PURE__ */ (0, import_jsx_runtime166.jsx)(empty_state_exports.Description, { children: (0, import_i18n53.__)( |
| 38063 |
"Add widgets to start customizing your dashboard." |
| 38064 |
) }) |
| 38065 |
] }) }); |
| 38066 |
} |
| 38067 |
var NoWidgetsState = NoWidgetsStateImpl; |
| 38068 |
|
| 38069 |
// routes/dashboard/widget-dashboard/widget-dashboard.tsx |
| 38070 |
var import_jsx_runtime167 = __toESM(require_jsx_runtime()); |
| 38071 |
var WidgetDashboard = Object.assign( |
| 38072 |
function WidgetDashboard2({ |
| 38073 |
layout, |
| 38074 |
onLayoutChange, |
| 38075 |
onLayoutReset, |
| 38076 |
widgetTypes, |
| 38077 |
editMode, |
| 38078 |
onEditChange, |
| 38079 |
resolveWidgetModule, |
| 38080 |
gridSettings, |
| 38081 |
children |
| 38082 |
}) { |
| 38083 |
return /* @__PURE__ */ (0, import_jsx_runtime167.jsx)( |
| 38084 |
WidgetDashboardProvider, |
| 38085 |
{ |
| 38086 |
layout, |
| 38087 |
onLayoutChange, |
| 38088 |
onLayoutReset, |
| 38089 |
widgetTypes, |
| 38090 |
editMode, |
| 38091 |
onEditChange, |
| 38092 |
resolveWidgetModule, |
| 38093 |
gridSettings, |
| 38094 |
children: /* @__PURE__ */ (0, import_jsx_runtime167.jsxs)(WidgetDashboardUIProvider, { children: [ |
| 38095 |
children ?? /* @__PURE__ */ (0, import_jsx_runtime167.jsxs)(import_jsx_runtime167.Fragment, { children: [ |
| 38096 |
/* @__PURE__ */ (0, import_jsx_runtime167.jsx)(NoWidgetsState, {}), |
| 38097 |
/* @__PURE__ */ (0, import_jsx_runtime167.jsx)(Actions3, {}), |
| 38098 |
/* @__PURE__ */ (0, import_jsx_runtime167.jsx)(Widgets, {}) |
| 38099 |
] }), |
| 38100 |
/* @__PURE__ */ (0, import_jsx_runtime167.jsx)(Inserter, {}) |
| 38101 |
] }) |
| 38102 |
} |
| 38103 |
); |
| 38104 |
}, |
| 38105 |
{ Actions: Actions3, Widgets, WidgetChrome, NoWidgetsState } |
| 38106 |
); |
| 38107 |
|
| 38108 |
// routes/dashboard/widget-types/hooks/use-widget-types.ts |
| 38109 |
var import_data7 = __toESM(require_data()); |
| 38110 |
var import_core_data = __toESM(require_core_data()); |
| 38111 |
var import_element131 = __toESM(require_element()); |
| 38112 |
var import_i18n54 = __toESM(require_i18n()); |
| 38113 |
(0, import_data7.dispatch)(import_core_data.store).addEntities([ |
| 38114 |
{ |
| 38115 |
name: "widgetModule", |
| 38116 |
kind: "root", |
| 38117 |
key: "name", |
| 38118 |
baseURL: "/wp/v2/widget-modules", |
| 38119 |
plural: "widgetModules", |
| 38120 |
label: (0, import_i18n54.__)("Widget modules"), |
| 38121 |
supportsPagination: false |
| 38122 |
} |
| 38123 |
]); |
| 38124 |
function useWidgetTypes() { |
| 38125 |
const records = (0, import_data7.useSelect)( |
| 38126 |
(select) => select(import_core_data.store).getEntityRecords("root", "widgetModule"), |
| 38127 |
[] |
| 38128 |
); |
| 38129 |
const [widgetTypes, setWidgetTypes] = (0, import_element131.useState)([]); |
| 38130 |
(0, import_element131.useEffect)(() => { |
| 38131 |
if (!records) { |
| 38132 |
return; |
| 38133 |
} |
| 38134 |
let cancelled = false; |
| 38135 |
Promise.all( |
| 38136 |
records.map(async (record) => { |
| 38137 |
if (!record.widget_module) { |
| 38138 |
return null; |
| 38139 |
} |
| 38140 |
try { |
| 38141 |
const module = await import( |
| 38142 |
/* webpackIgnore: true */ |
| 38143 |
record.widget_module |
| 38144 |
); |
| 38145 |
if (!module?.default) { |
| 38146 |
return null; |
| 38147 |
} |
| 38148 |
return { |
| 38149 |
...module.default, |
| 38150 |
name: record.name, |
| 38151 |
renderModule: record.render_module ?? "" |
| 38152 |
}; |
| 38153 |
} catch { |
| 38154 |
return null; |
| 38155 |
} |
| 38156 |
}) |
| 38157 |
).then((results) => { |
| 38158 |
if (cancelled) { |
| 38159 |
return; |
| 38160 |
} |
| 38161 |
setWidgetTypes( |
| 38162 |
results.filter((t2) => t2 !== null) |
| 38163 |
); |
| 38164 |
}); |
| 38165 |
return () => { |
| 38166 |
cancelled = true; |
| 38167 |
}; |
| 38168 |
}, [records]); |
| 38169 |
return widgetTypes; |
| 38170 |
} |
| 38171 |
|
| 38172 |
// routes/dashboard/stage.module.css |
| 38173 |
if (typeof process === "undefined" || true) { |
| 38174 |
registerStyle35("5a63b052df", "._2381d7918cf57baa__dashboard-widgets-container{margin:var(--wpds-dimension-padding-md,12px)}"); |
| 38175 |
} |
| 38176 |
var stage_default = { "dashboard-widgets-container": "_2381d7918cf57baa__dashboard-widgets-container" }; |
| 38177 |
|
| 38178 |
// routes/dashboard/stage.tsx |
| 38179 |
var import_jsx_runtime168 = __toESM(require_jsx_runtime()); |
| 38180 |
function Dashboard() { |
| 38181 |
const [layout, setLayout, resetLayout] = useDashboardLayout( |
| 38182 |
"gutenberg_dashboard" |
| 38183 |
); |
| 38184 |
const widgetTypes = useWidgetTypes(); |
| 38185 |
const [editMode, setEditMode] = (0, import_element132.useState)(false); |
| 38186 |
const { createSuccessNotice } = (0, import_data8.useDispatch)(import_notices.store); |
| 38187 |
const handleLayoutChange = (next) => { |
| 38188 |
setLayout(next); |
| 38189 |
void createSuccessNotice((0, import_i18n55.__)("Dashboard saved."), { |
| 38190 |
type: "snackbar" |
| 38191 |
}); |
| 38192 |
}; |
| 38193 |
return /* @__PURE__ */ (0, import_jsx_runtime168.jsx)( |
| 38194 |
WidgetDashboard, |
| 38195 |
{ |
| 38196 |
widgetTypes, |
| 38197 |
layout, |
| 38198 |
onLayoutChange: handleLayoutChange, |
| 38199 |
onLayoutReset: resetLayout, |
| 38200 |
editMode, |
| 38201 |
onEditChange: setEditMode, |
| 38202 |
children: /* @__PURE__ */ (0, import_jsx_runtime168.jsx)( |
| 38203 |
page_default, |
| 38204 |
{ |
| 38205 |
title: (0, import_i18n55.__)("Dashboard"), |
| 38206 |
actions: /* @__PURE__ */ (0, import_jsx_runtime168.jsx)(WidgetDashboard.Actions, {}), |
| 38207 |
children: /* @__PURE__ */ (0, import_jsx_runtime168.jsxs)("div", { className: stage_default["dashboard-widgets-container"], children: [ |
| 38208 |
/* @__PURE__ */ (0, import_jsx_runtime168.jsx)(WidgetDashboard.NoWidgetsState, {}), |
| 38209 |
/* @__PURE__ */ (0, import_jsx_runtime168.jsx)(WidgetDashboard.Widgets, {}) |
| 38210 |
] }) |
| 38211 |
} |
| 38212 |
) |
| 38213 |
} |
| 38214 |
); |
| 38215 |
} |
| 38216 |
var stage = Dashboard; |
| 38217 |
export { |
| 38218 |
stage |
| 38219 |
}; |
| 38220 |
/*! Bundled license information: |
| 38221 |
|
| 38222 |
use-sync-external-store/cjs/use-sync-external-store-shim.development.js: |
| 38223 |
(** |
| 38224 |
* @license React |
| 38225 |
* use-sync-external-store-shim.development.js |
| 38226 |
* |
| 38227 |
* Copyright (c) Meta Platforms, Inc. and affiliates. |
| 38228 |
* |
| 38229 |
* This source code is licensed under the MIT license found in the |
| 38230 |
* LICENSE file in the root directory of this source tree. |
| 38231 |
*) |
| 38232 |
|
| 38233 |
use-sync-external-store/cjs/use-sync-external-store-shim/with-selector.development.js: |
| 38234 |
(** |
| 38235 |
* @license React |
| 38236 |
* use-sync-external-store-shim/with-selector.development.js |
| 38237 |
* |
| 38238 |
* Copyright (c) Meta Platforms, Inc. and affiliates. |
| 38239 |
* |
| 38240 |
* This source code is licensed under the MIT license found in the |
| 38241 |
* LICENSE file in the root directory of this source tree. |
| 38242 |
*) |
| 38243 |
|
| 38244 |
tabbable/dist/index.esm.js: |
| 38245 |
(*! |
| 38246 |
* tabbable 6.4.0 |
| 38247 |
* @license MIT, https://github.com/focus-trap/tabbable/blob/master/LICENSE |
| 38248 |
*) |
| 38249 |
*/ |
| 38250 |
|